From 6f105dbd55cc67862457ee38b2a2cc64ea321fe8 Mon Sep 17 00:00:00 2001 From: Truong LD Date: Thu, 10 Nov 2016 21:52:32 +0700 Subject: [PATCH] add source code illustration selection --- .../angular-ui-select2/.bower.json | 30 + app/bower_components/angular-ui-select2/.bowerrc | 3 + app/bower_components/angular-ui-select2/.gitignore | 2 + app/bower_components/angular-ui-select2/.jshintrc | 11 + .../angular-ui-select2/.travis.yml | 13 + .../angular-ui-select2/CONTRIBUTING.md | 8 + .../angular-ui-select2/Gruntfile.js | 56 + app/bower_components/angular-ui-select2/LICENSE | 21 + app/bower_components/angular-ui-select2/README.md | 165 + app/bower_components/angular-ui-select2/bower.json | 20 + .../angular-ui-select2/docs/index.html | 47 + .../angular-ui-select2/docs/styles.css | 4 + .../angular-ui-select2/package.json | 28 + .../angular-ui-select2/src/select2.js | 212 + .../angular-ui-select2/test/karma.conf.js | 80 + .../angular-ui-select2/test/select2Spec.js | 411 + app/bower_components/fabric.js/.bithoundrc | 7 + app/bower_components/fabric.js/.bower.json | 44 + app/bower_components/fabric.js/.editorconfig | 12 + app/bower_components/fabric.js/.eslintrc.json | 149 + app/bower_components/fabric.js/.eslintrc_tests | 45 + app/bower_components/fabric.js/.gitignore | 7 + app/bower_components/fabric.js/.npmignore | 8 + app/bower_components/fabric.js/.travis.yml | 20 + app/bower_components/fabric.js/CHANGELOG.md | 289 + app/bower_components/fabric.js/CODE_OF_CONDUCT.md | 15 + app/bower_components/fabric.js/CONTRIBUTING.md | 70 + app/bower_components/fabric.js/ISSUE_TEMPLATE.md | 36 + app/bower_components/fabric.js/LICENSE | 16 + app/bower_components/fabric.js/README.md | 297 + app/bower_components/fabric.js/bower.json | 31 + app/bower_components/fabric.js/dist/fabric.js | 26080 +++++++++++++++++++ app/bower_components/fabric.js/dist/fabric.min.js | 8 + .../fabric.js/dist/fabric.min.js.gz | Bin 0 -> 68001 bytes .../fabric.js/dist/fabric.require.js | 12541 +++++++++ app/bower_components/fabric.js/package.json | 62 + app/bower_components/fabric.js/testem.json | 18 + app/bower_components/fabric.js/tests.mustache | 15 + app/bower_components/select2/.bower.json | 24 + app/bower_components/select2/.gitignore | 2 + app/bower_components/select2/LICENSE | 18 + app/bower_components/select2/README.md | 90 + app/bower_components/select2/bower.json | 8 + app/bower_components/select2/component.json | 66 + app/bower_components/select2/composer.json | 29 + app/bower_components/select2/package.json | 20 + app/bower_components/select2/release.sh | 79 + app/bower_components/select2/select2-bootstrap.css | 87 + app/bower_components/select2/select2-spinner.gif | Bin 0 -> 1849 bytes app/bower_components/select2/select2.css | 646 + app/bower_components/select2/select2.jquery.json | 36 + app/bower_components/select2/select2.js | 3448 +++ app/bower_components/select2/select2.min.js | 22 + app/bower_components/select2/select2.png | Bin 0 -> 613 bytes app/bower_components/select2/select2_locale_ar.js | 17 + app/bower_components/select2/select2_locale_bg.js | 18 + app/bower_components/select2/select2_locale_ca.js | 17 + app/bower_components/select2/select2_locale_cs.js | 49 + app/bower_components/select2/select2_locale_da.js | 17 + app/bower_components/select2/select2_locale_de.js | 15 + app/bower_components/select2/select2_locale_el.js | 17 + .../select2/select2_locale_en.js.template | 18 + app/bower_components/select2/select2_locale_es.js | 15 + app/bower_components/select2/select2_locale_et.js | 17 + app/bower_components/select2/select2_locale_eu.js | 43 + app/bower_components/select2/select2_locale_fa.js | 19 + app/bower_components/select2/select2_locale_fi.js | 28 + app/bower_components/select2/select2_locale_fr.js | 16 + app/bower_components/select2/select2_locale_gl.js | 43 + app/bower_components/select2/select2_locale_he.js | 17 + app/bower_components/select2/select2_locale_hr.js | 22 + app/bower_components/select2/select2_locale_hu.js | 15 + app/bower_components/select2/select2_locale_id.js | 17 + app/bower_components/select2/select2_locale_is.js | 15 + app/bower_components/select2/select2_locale_it.js | 15 + app/bower_components/select2/select2_locale_ja.js | 15 + app/bower_components/select2/select2_locale_ka.js | 17 + app/bower_components/select2/select2_locale_ko.js | 17 + app/bower_components/select2/select2_locale_lt.js | 24 + app/bower_components/select2/select2_locale_lv.js | 17 + app/bower_components/select2/select2_locale_mk.js | 17 + app/bower_components/select2/select2_locale_ms.js | 17 + app/bower_components/select2/select2_locale_nl.js | 15 + app/bower_components/select2/select2_locale_no.js | 18 + app/bower_components/select2/select2_locale_pl.js | 22 + .../select2/select2_locale_pt-BR.js | 15 + .../select2/select2_locale_pt-PT.js | 15 + app/bower_components/select2/select2_locale_ro.js | 15 + app/bower_components/select2/select2_locale_rs.js | 17 + app/bower_components/select2/select2_locale_ru.js | 21 + app/bower_components/select2/select2_locale_sk.js | 48 + app/bower_components/select2/select2_locale_sv.js | 17 + app/bower_components/select2/select2_locale_th.js | 17 + app/bower_components/select2/select2_locale_tr.js | 17 + app/bower_components/select2/select2_locale_uk.js | 23 + app/bower_components/select2/select2_locale_vi.js | 18 + .../select2/select2_locale_zh-CN.js | 14 + .../select2/select2_locale_zh-TW.js | 14 + app/bower_components/select2/select2x2.png | Bin 0 -> 845 bytes app/images/.DS_Store | Bin 0 -> 6148 bytes app/images/illustrations/.DS_Store | Bin 0 -> 6148 bytes app/images/illustrations/item1.png | Bin 0 -> 15242 bytes app/images/illustrations/item1.svg | 35 + app/images/illustrations/item2.png | Bin 0 -> 15230 bytes app/images/illustrations/item2.svg | 100 + app/images/illustrations/item3.png | Bin 0 -> 13578 bytes app/images/illustrations/item3.svg | 43 + app/images/illustrations/item4.png | Bin 0 -> 20952 bytes app/images/illustrations/item4.svg | 24 + app/index.html | 2 + app/scripts/app.js | 3 +- app/scripts/controllers/main.js | 17 +- app/scripts/controllers/tshirtdesign.js | 91 + app/scripts/directives/helperdirective.js | 9 + app/scripts/main.js | 12 +- app/scripts/routes.js | 4 +- app/scripts/services/illustration.js | 116 + app/styles/main.css | 74 +- app/views/tshirt-design.html | 57 +- bower.json | 4 +- test/spec/controllers/tshirtdesignSpec.js | 25 + test/spec/directives/helperdirectiveSpec.js | 23 + test/spec/services/illustrationSpec.js | 21 + 123 files changed, 46981 insertions(+), 15 deletions(-) create mode 100644 app/bower_components/angular-ui-select2/.bower.json create mode 100644 app/bower_components/angular-ui-select2/.bowerrc create mode 100644 app/bower_components/angular-ui-select2/.gitignore create mode 100644 app/bower_components/angular-ui-select2/.jshintrc create mode 100644 app/bower_components/angular-ui-select2/.travis.yml create mode 100644 app/bower_components/angular-ui-select2/CONTRIBUTING.md create mode 100644 app/bower_components/angular-ui-select2/Gruntfile.js create mode 100644 app/bower_components/angular-ui-select2/LICENSE create mode 100644 app/bower_components/angular-ui-select2/README.md create mode 100644 app/bower_components/angular-ui-select2/bower.json create mode 100644 app/bower_components/angular-ui-select2/docs/index.html create mode 100644 app/bower_components/angular-ui-select2/docs/styles.css create mode 100644 app/bower_components/angular-ui-select2/package.json create mode 100644 app/bower_components/angular-ui-select2/src/select2.js create mode 100644 app/bower_components/angular-ui-select2/test/karma.conf.js create mode 100644 app/bower_components/angular-ui-select2/test/select2Spec.js create mode 100644 app/bower_components/fabric.js/.bithoundrc create mode 100644 app/bower_components/fabric.js/.bower.json create mode 100644 app/bower_components/fabric.js/.editorconfig create mode 100644 app/bower_components/fabric.js/.eslintrc.json create mode 100644 app/bower_components/fabric.js/.eslintrc_tests create mode 100644 app/bower_components/fabric.js/.gitignore create mode 100644 app/bower_components/fabric.js/.npmignore create mode 100644 app/bower_components/fabric.js/.travis.yml create mode 100644 app/bower_components/fabric.js/CHANGELOG.md create mode 100644 app/bower_components/fabric.js/CODE_OF_CONDUCT.md create mode 100644 app/bower_components/fabric.js/CONTRIBUTING.md create mode 100644 app/bower_components/fabric.js/ISSUE_TEMPLATE.md create mode 100644 app/bower_components/fabric.js/LICENSE create mode 100644 app/bower_components/fabric.js/README.md create mode 100644 app/bower_components/fabric.js/bower.json create mode 100644 app/bower_components/fabric.js/dist/fabric.js create mode 100644 app/bower_components/fabric.js/dist/fabric.min.js create mode 100644 app/bower_components/fabric.js/dist/fabric.min.js.gz create mode 100644 app/bower_components/fabric.js/dist/fabric.require.js create mode 100644 app/bower_components/fabric.js/package.json create mode 100644 app/bower_components/fabric.js/testem.json create mode 100644 app/bower_components/fabric.js/tests.mustache create mode 100644 app/bower_components/select2/.bower.json create mode 100644 app/bower_components/select2/.gitignore create mode 100644 app/bower_components/select2/LICENSE create mode 100644 app/bower_components/select2/README.md create mode 100644 app/bower_components/select2/bower.json create mode 100644 app/bower_components/select2/component.json create mode 100644 app/bower_components/select2/composer.json create mode 100644 app/bower_components/select2/package.json create mode 100755 app/bower_components/select2/release.sh create mode 100644 app/bower_components/select2/select2-bootstrap.css create mode 100644 app/bower_components/select2/select2-spinner.gif create mode 100644 app/bower_components/select2/select2.css create mode 100644 app/bower_components/select2/select2.jquery.json create mode 100644 app/bower_components/select2/select2.js create mode 100644 app/bower_components/select2/select2.min.js create mode 100644 app/bower_components/select2/select2.png create mode 100644 app/bower_components/select2/select2_locale_ar.js create mode 100644 app/bower_components/select2/select2_locale_bg.js create mode 100644 app/bower_components/select2/select2_locale_ca.js create mode 100644 app/bower_components/select2/select2_locale_cs.js create mode 100644 app/bower_components/select2/select2_locale_da.js create mode 100644 app/bower_components/select2/select2_locale_de.js create mode 100644 app/bower_components/select2/select2_locale_el.js create mode 100644 app/bower_components/select2/select2_locale_en.js.template create mode 100644 app/bower_components/select2/select2_locale_es.js create mode 100644 app/bower_components/select2/select2_locale_et.js create mode 100644 app/bower_components/select2/select2_locale_eu.js create mode 100644 app/bower_components/select2/select2_locale_fa.js create mode 100644 app/bower_components/select2/select2_locale_fi.js create mode 100644 app/bower_components/select2/select2_locale_fr.js create mode 100644 app/bower_components/select2/select2_locale_gl.js create mode 100644 app/bower_components/select2/select2_locale_he.js create mode 100644 app/bower_components/select2/select2_locale_hr.js create mode 100644 app/bower_components/select2/select2_locale_hu.js create mode 100644 app/bower_components/select2/select2_locale_id.js create mode 100644 app/bower_components/select2/select2_locale_is.js create mode 100644 app/bower_components/select2/select2_locale_it.js create mode 100644 app/bower_components/select2/select2_locale_ja.js create mode 100644 app/bower_components/select2/select2_locale_ka.js create mode 100644 app/bower_components/select2/select2_locale_ko.js create mode 100644 app/bower_components/select2/select2_locale_lt.js create mode 100644 app/bower_components/select2/select2_locale_lv.js create mode 100644 app/bower_components/select2/select2_locale_mk.js create mode 100644 app/bower_components/select2/select2_locale_ms.js create mode 100644 app/bower_components/select2/select2_locale_nl.js create mode 100644 app/bower_components/select2/select2_locale_no.js create mode 100644 app/bower_components/select2/select2_locale_pl.js create mode 100644 app/bower_components/select2/select2_locale_pt-BR.js create mode 100644 app/bower_components/select2/select2_locale_pt-PT.js create mode 100644 app/bower_components/select2/select2_locale_ro.js create mode 100644 app/bower_components/select2/select2_locale_rs.js create mode 100644 app/bower_components/select2/select2_locale_ru.js create mode 100644 app/bower_components/select2/select2_locale_sk.js create mode 100644 app/bower_components/select2/select2_locale_sv.js create mode 100644 app/bower_components/select2/select2_locale_th.js create mode 100644 app/bower_components/select2/select2_locale_tr.js create mode 100644 app/bower_components/select2/select2_locale_uk.js create mode 100644 app/bower_components/select2/select2_locale_vi.js create mode 100644 app/bower_components/select2/select2_locale_zh-CN.js create mode 100755 app/bower_components/select2/select2_locale_zh-TW.js create mode 100644 app/bower_components/select2/select2x2.png create mode 100644 app/images/.DS_Store create mode 100644 app/images/illustrations/.DS_Store create mode 100644 app/images/illustrations/item1.png create mode 100644 app/images/illustrations/item1.svg create mode 100644 app/images/illustrations/item2.png create mode 100644 app/images/illustrations/item2.svg create mode 100644 app/images/illustrations/item3.png create mode 100644 app/images/illustrations/item3.svg create mode 100644 app/images/illustrations/item4.png create mode 100644 app/images/illustrations/item4.svg create mode 100644 app/scripts/controllers/tshirtdesign.js create mode 100644 app/scripts/directives/helperdirective.js create mode 100644 app/scripts/services/illustration.js create mode 100644 test/spec/controllers/tshirtdesignSpec.js create mode 100644 test/spec/directives/helperdirectiveSpec.js create mode 100644 test/spec/services/illustrationSpec.js diff --git a/app/bower_components/angular-ui-select2/.bower.json b/app/bower_components/angular-ui-select2/.bower.json new file mode 100644 index 0000000..2877ec1 --- /dev/null +++ b/app/bower_components/angular-ui-select2/.bower.json @@ -0,0 +1,30 @@ +{ + "author": "AngularUI", + "name": "angular-ui-select2", + "version": "0.0.5", + "homepage": "http://angular-ui.github.com", + "keywords": [ + "angular", + "angularui", + "select2" + ], + "main": "./src/select2.js", + "dependencies": { + "angular": ">=1.2.0", + "select2": "~3.4", + "jquery": ">=1.6.4" + }, + "devDependencies": { + "angular-mocks": ">=1.0.2" + }, + "_release": "0.0.5", + "_resolution": { + "type": "version", + "tag": "v0.0.5", + "commit": "680bf4abb3dba0835f0d5002fe111e3396ae617e" + }, + "_source": "https://github.com/angular-ui/ui-select2.git", + "_target": "^0.0.5", + "_originalSource": "angular-ui-select2", + "_direct": true +} \ No newline at end of file diff --git a/app/bower_components/angular-ui-select2/.bowerrc b/app/bower_components/angular-ui-select2/.bowerrc new file mode 100644 index 0000000..deceb62 --- /dev/null +++ b/app/bower_components/angular-ui-select2/.bowerrc @@ -0,0 +1,3 @@ +{ + "directory": "bower_components" +} \ No newline at end of file diff --git a/app/bower_components/angular-ui-select2/.gitignore b/app/bower_components/angular-ui-select2/.gitignore new file mode 100644 index 0000000..a088b6f --- /dev/null +++ b/app/bower_components/angular-ui-select2/.gitignore @@ -0,0 +1,2 @@ +node_modules +bower_components diff --git a/app/bower_components/angular-ui-select2/.jshintrc b/app/bower_components/angular-ui-select2/.jshintrc new file mode 100644 index 0000000..1b83bfb --- /dev/null +++ b/app/bower_components/angular-ui-select2/.jshintrc @@ -0,0 +1,11 @@ +{ + "curly": true, + "eqeqeq": true, + "immed": true, + "latedef": true, + "newcap": true, + "noarg": true, + "sub": true, + "boss": true, + "eqnull": true +} diff --git a/app/bower_components/angular-ui-select2/.travis.yml b/app/bower_components/angular-ui-select2/.travis.yml new file mode 100644 index 0000000..ffa3563 --- /dev/null +++ b/app/bower_components/angular-ui-select2/.travis.yml @@ -0,0 +1,13 @@ + language: node_js + node_js: + - "0.8" + - "0.10" + + before_install: + - export DISPLAY=:99.0 + - sh -e /etc/init.d/xvfb start + - npm install -g karma bower grunt-cli + - bower install + - npm install + + script: "grunt" diff --git a/app/bower_components/angular-ui-select2/CONTRIBUTING.md b/app/bower_components/angular-ui-select2/CONTRIBUTING.md new file mode 100644 index 0000000..cb66f02 --- /dev/null +++ b/app/bower_components/angular-ui-select2/CONTRIBUTING.md @@ -0,0 +1,8 @@ +CONTRIBUTING +============ + +* Open a [Pull Request (PR)](https://github.com/angular-ui/ui-select2/pull/new/master) +* Make sure your PR is on a **new branch** you created off of the latest version of master +* Do **not** open a PR from your master branch +* Open a PR to start a discussion even if the code isn't finished (easier to collect feedback this way) +* Make sure all previous tests pass and add new tests for added behaviors diff --git a/app/bower_components/angular-ui-select2/Gruntfile.js b/app/bower_components/angular-ui-select2/Gruntfile.js new file mode 100644 index 0000000..ea8dc33 --- /dev/null +++ b/app/bower_components/angular-ui-select2/Gruntfile.js @@ -0,0 +1,56 @@ +module.exports = function (grunt) { + 'use strict'; + + var initConfig; + + // Loading external tasks + grunt.loadNpmTasks('grunt-contrib-jshint'); + grunt.loadNpmTasks('grunt-contrib-watch'); + grunt.loadNpmTasks('grunt-karma'); + + // Project configuration. + initConfig = { + bower: 'bower_components', + pkg: grunt.file.readJSON('package.json'), + watch: { + test: { + // Lint & run unit tests in Karma + // Just running `$ grunt watch` will only lint your code; to run tests + // on watch, use `$ grunt watch:karma` to start a Karma server first + files: ['src/select2.js', 'test/select2Spec.js'], + tasks: ['jshint', 'karma:unit:run'] + } + }, + karma: { + options: { + configFile: 'test/karma.conf.js', + browsers: ['Firefox', 'PhantomJS'] + }, + unit: { + singleRun: true + }, + watch: { + autoWatch: true + }, + server: { + background: true + } + }, + jshint: { + all:[ + 'gruntFile.js', + 'src/**/*.js', + 'test/**/*Spec.js' + ], + options: { + jshintrc: '.jshintrc' + } + }, + }; + + // Register tasks + grunt.registerTask('default', ['jshint', 'karma:unit']); + grunt.registerTask('watch', ['jshint', 'karma:watch']); + + grunt.initConfig(initConfig); +}; diff --git a/app/bower_components/angular-ui-select2/LICENSE b/app/bower_components/angular-ui-select2/LICENSE new file mode 100644 index 0000000..dfc5e0c --- /dev/null +++ b/app/bower_components/angular-ui-select2/LICENSE @@ -0,0 +1,21 @@ +The MIT License + +Copyright (c) 2012 the AngularUI Team, http://angular-ui.github.com + +Permission is hereby granted, free of charge, to any person obtaining a copy +of this software and associated documentation files (the "Software"), to deal +in the Software without restriction, including without limitation the rights +to use, copy, modify, merge, publish, distribute, sublicense, and/or sell +copies of the Software, and to permit persons to whom the Software is +furnished to do so, subject to the following conditions: + +The above copyright notice and this permission notice shall be included in +all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR +IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, +FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE +AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER +LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, +OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN +THE SOFTWARE. diff --git a/app/bower_components/angular-ui-select2/README.md b/app/bower_components/angular-ui-select2/README.md new file mode 100644 index 0000000..feb3626 --- /dev/null +++ b/app/bower_components/angular-ui-select2/README.md @@ -0,0 +1,165 @@ +ui-select2 [![Build Status](https://travis-ci.org/angular-ui/ui-select2.png)](https://travis-ci.org/angular-ui/ui-select2) +========== +This directive allows you to enhance your select elements with behaviour from the [select2](http://ivaynberg.github.io/select2/) library. + +# Requirements + +- [AngularJS](http://angularjs.org/) +- [JQuery](http://jquery.com/) +- [Select2](http://ivaynberg.github.io/select2/) + +## Setup + +1. Install **Karma**, **Grunt** and **Bower** + `$ npm install -g karma grunt-cli bower` +2. Install development dependencies + `$ npm install` +3. Install components + `$ bower install` +4. ??? +5. Profit! + +## Testing + +We use [Grunt](http://gruntjs.com/) to check for JavaScript syntax errors and execute all unit tests. To run Grunt, simply execute: + +`$ grunt` + +This will lint and test the code, then exit. To have Grunt stay open and automatically lint and test your files whenever you make a code change, use: + +`$ grunt karma:server watch` + +This will start a Karma server in the background and run unit tests in Firefox and PhantomJS whenever the source code or spec file is saved. + +# Usage + +We use [bower](https://github.com/bower/bower) for dependency management. Install AngularUI Select2 into your project by running the command + +`$ bower install angular-ui-select2` + +If you use a `bower.json` file in your project, you can have Bower save ui-select2 as a dependency by passing the `--save` or `--save-dev` flag with the above command. + +This will copy the ui-select2 files into your `bower_components` folder, along with its dependencies. Load the script files in your application: +```html + + + + + +``` + +(Note that `jquery` must be loaded before `angular` so that it doesn't use `jqLite` internally) + + +Add the select2 module as a dependency to your application module: + +```javascript +var myAppModule = angular.module('MyApp', ['ui.select2']); +``` + +Apply the directive to your form elements: + +```html + +``` + +## Options + +All the select2 options can be passed through the directive. You can read more about the supported list of options and what they do on the [Select2 Documentation Page](http://ivaynberg.github.com/select2/) + +```javascript +myAppModule.controller('MyController', function($scope) { + $scope.select2Options = { + allowClear:true + }; +}); +``` + +```html + +``` + +Some time it may make sense to specify the options in the template file. + +```html + +``` + +## Working with ng-model + +The ui-select2 directive plays nicely with ng-model and validation directives such as ng-required. + +If you add the ng-model directive to same the element as ui-select2 then the picked option is automatically synchronized with the model value. + +## Working with dynamic options +`ui-select2` is incompatible with ` + + + +``` + +## Working with placeholder text +In order to properly support the Select2 placeholder, create an empty ` + + + + +``` + +## ng-required directive + +If you apply the required directive to element then the form element is invalid until an option is selected. + +Note: Remember that the ng-required directive must be explicitly set, i.e. to "true". This is especially true on divs: + +```html + +``` + +## Using simple tagging mode + +When AngularJS View-Model tags are stored as a list of strings, setting +the ui-select2 specific option `simple_tags` will allow to keep the model +as a list of strings, and not convert it into a list of Select2 tag objects. + +```html + +``` + +```javascript +myAppModule.controller('MyController', function($scope) { + $scope.list_of_string = ['tag1', 'tag2'] + $scope.select2Options = { + 'multiple': true, + 'simple_tags': true, + 'tags': ['tag1', 'tag2', 'tag3', 'tag4'] // Can be empty list. + }; +}); +``` diff --git a/app/bower_components/angular-ui-select2/bower.json b/app/bower_components/angular-ui-select2/bower.json new file mode 100644 index 0000000..2cf5041 --- /dev/null +++ b/app/bower_components/angular-ui-select2/bower.json @@ -0,0 +1,20 @@ +{ + "author": "AngularUI", + "name": "angular-ui-select2", + "version": "0.0.5", + "homepage": "http://angular-ui.github.com", + "keywords": [ + "angular", + "angularui", + "select2" + ], + "main": "./src/select2.js", + "dependencies": { + "angular": ">=1.2.0", + "select2": "~3.4", + "jquery": ">=1.6.4" + }, + "devDependencies": { + "angular-mocks": ">=1.0.2" + } +} diff --git a/app/bower_components/angular-ui-select2/docs/index.html b/app/bower_components/angular-ui-select2/docs/index.html new file mode 100644 index 0000000..ff373e7 --- /dev/null +++ b/app/bower_components/angular-ui-select2/docs/index.html @@ -0,0 +1,47 @@ +
+ +
+
+

Demo

+
+

Value is: {{select2}} (choose second)

+ +
+ +
+

Value is: {{select2multiple}} (choose second)

+ +
+
+
+

Options

+

You can pass an object to Select2 as the expression: ui-select2="{allowClear:true}" that will be passed directly to $.fn.select2(). You can read more about the supported list of options and what they do on the Select2 Documentation Page. AngularUI will leverage properties passed to Select2 for any complex behavior, there are no parameters necessary for that are specific to AngularUI.

+
+
+

ui-select2 is incompatible with <select ng-options>. For the best results use <option ng-repeat> instead

+

In order to properly support the Select2 placeholder, create an empty <option> tag at the top of the <select> and either set a data-placeholder on the select element or pass a placeholder option to Select2.

+ +

How?

+
+<p>Value is: {{select2}} <a ng-click="select2='two'">(choose second)</a></p>
+<select ui-select2 ng-model="select2">
+<option value="">Pick a number</option>
+<option value="one">First</option>
+<option value="two">Second</option>
+<option value="three">Third</option>
+</select>
+
+

Or try playing around with this sandbox demo to see how AJAX works

+
\ No newline at end of file diff --git a/app/bower_components/angular-ui-select2/docs/styles.css b/app/bower_components/angular-ui-select2/docs/styles.css new file mode 100644 index 0000000..08611a4 --- /dev/null +++ b/app/bower_components/angular-ui-select2/docs/styles.css @@ -0,0 +1,4 @@ + +#directives-select2 select { + width: 200px; +} \ No newline at end of file diff --git a/app/bower_components/angular-ui-select2/package.json b/app/bower_components/angular-ui-select2/package.json new file mode 100644 index 0000000..fc0ccd6 --- /dev/null +++ b/app/bower_components/angular-ui-select2/package.json @@ -0,0 +1,28 @@ +{ + "author": "https://github.com/angular-ui/ui-select2/graphs/contributors", + "name": "angular-ui-select2", + "keywords": [ + "angular", + "angularui", + "select2" + ], + "description": "AngularUI - The companion suite for AngularJS", + "version": "0.0.5", + "homepage": "http://angular-ui.github.com", + "repository": { + "type": "git", + "url": "git://github.com/angular-ui/ui-select2.git" + }, + "engines": { + "node": ">= 0.8.4" + }, + "dependencies": {}, + "devDependencies": { + "async": "0.1.x", + "grunt": "~0.4.1", + "grunt-contrib-jshint": "~0.6.4", + "grunt-contrib-watch": "~0.5.3", + "grunt-karma": "~0.6.2", + "karma": "~0.10.2" + } +} diff --git a/app/bower_components/angular-ui-select2/src/select2.js b/app/bower_components/angular-ui-select2/src/select2.js new file mode 100644 index 0000000..f81731c --- /dev/null +++ b/app/bower_components/angular-ui-select2/src/select2.js @@ -0,0 +1,212 @@ +/** + * Enhanced Select2 Dropmenus + * + * @AJAX Mode - When in this mode, your value will be an object (or array of objects) of the data used by Select2 + * This change is so that you do not have to do an additional query yourself on top of Select2's own query + * @params [options] {object} The configuration options passed to $.fn.select2(). Refer to the documentation + */ +angular.module('ui.select2', []).value('uiSelect2Config', {}).directive('uiSelect2', ['uiSelect2Config', '$timeout', function (uiSelect2Config, $timeout) { + var options = {}; + if (uiSelect2Config) { + angular.extend(options, uiSelect2Config); + } + return { + require: 'ngModel', + priority: 1, + compile: function (tElm, tAttrs) { + var watch, + repeatOption, + repeatAttr, + isSelect = tElm.is('select'), + isMultiple = angular.isDefined(tAttrs.multiple); + + // Enable watching of the options dataset if in use + if (tElm.is('select')) { + repeatOption = tElm.find('option[ng-repeat], option[data-ng-repeat]'); + + if (repeatOption.length) { + repeatAttr = repeatOption.attr('ng-repeat') || repeatOption.attr('data-ng-repeat'); + watch = jQuery.trim(repeatAttr.split('|')[0]).split(' ').pop(); + } + } + + return function (scope, elm, attrs, controller) { + // instance-specific options + var opts = angular.extend({}, options, scope.$eval(attrs.uiSelect2)); + + /* + Convert from Select2 view-model to Angular view-model. + */ + var convertToAngularModel = function(select2_data) { + var model; + if (opts.simple_tags) { + model = []; + angular.forEach(select2_data, function(value, index) { + model.push(value.id); + }); + } else { + model = select2_data; + } + return model; + }; + + /* + Convert from Angular view-model to Select2 view-model. + */ + var convertToSelect2Model = function(angular_data) { + var model = []; + if (!angular_data) { + return model; + } + + if (opts.simple_tags) { + model = []; + angular.forEach( + angular_data, + function(value, index) { + model.push({'id': value, 'text': value}); + }); + } else { + model = angular_data; + } + return model; + }; + + if (isSelect) { + // Use element', function () { + describe('compiling this directive', function () { + it('should throw an error if we have no model defined', function () { + expect(function(){ + compile(''); + }).toThrow(); + }); + it('should create proper DOM structure', function () { + var element = compile(''); + expect(element.siblings().is('div.select2-container')).toBe(true); + }); + it('should not modify the model if there is no initial value', function(){ + //TODO + }); + }); + describe('when model is changed programmatically', function(){ + describe('for single select', function(){ + it('should set select2 to the value', function(){ + scope.foo = 'First'; + var element = compile(''); + expect(element.select2('val')).toBe('First'); + scope.$apply('foo = "Second"'); + expect(element.select2('val')).toBe('Second'); + }); + it('should handle falsey values', function(){ + scope.foo = 'First'; + var element = compile(''); + expect(element.select2('val')).toBe('First'); + scope.$apply('foo = false'); + expect(element.select2('val')).toBe(null); + scope.$apply('foo = "Second"'); + scope.$apply('foo = null'); + expect(element.select2('val')).toBe(null); + scope.$apply('foo = "Second"'); + scope.$apply('foo = undefined'); + expect(element.select2('val')).toBe(null); + }); + }); + describe('for multiple select', function(){ + it('should set select2 to multiple value', function(){ + scope.foo = ['First']; + var element = compile(''); + expect(element.select2('val')).toEqual(['First']); + scope.$apply('foo = ["Second"]'); + expect(element.select2('val')).toEqual(['Second']); + scope.$apply('foo = ["Second","Third"]'); + expect(element.select2('val')).toEqual(['Second','Third']); + }); + it('should handle falsey values', function(){ + scope.foo = ['First']; + var element = compile(''); + expect(element.val()).toEqual(['First']); + scope.$apply('foo = ["Second"]'); + scope.$apply('foo = false'); + expect(element.select2('val')).toEqual([]); + scope.$apply('foo = ["Second"]'); + scope.$apply('foo = null'); + expect(element.select2('val')).toEqual([]); + scope.$apply('foo = ["Second"]'); + scope.$apply('foo = undefined'); + expect(element.select2('val')).toEqual([]); + }); + }); + }); + it('should observe the disabled attribute', function () { + var element = compile(''); + expect(element.siblings().hasClass('select2-container-disabled')).toBe(false); + scope.$apply('disabled = true'); + expect(element.siblings().hasClass('select2-container-disabled')).toBe(true); + scope.$apply('disabled = false'); + expect(element.siblings().hasClass('select2-container-disabled')).toBe(false); + }); + it('should observe the multiple attribute', function () { + var element = $compile('')(scope); + + expect(element.siblings().hasClass('select2-container-multi')).toBe(false); + scope.$apply('multiple = true'); + expect(element.siblings().hasClass('select2-container-multi')).toBe(true); + scope.$apply('multiple = false'); + expect(element.siblings().hasClass('select2-container-multi')).toBe(false); + }); + it('should observe an option with ng-repeat for changes', function(){ + scope.items = ['first', 'second', 'third']; + scope.foo = 'fourth'; + var element = compile(''); + expect(element.select2('val')).toBe(null); + scope.$apply('foo="fourth";items=["fourth"]'); + $timeout.flush(); + expect(element.select2('val')).toBe('fourth'); + }); + }); + describe('with an element', function () { + describe('compiling this directive', function () { + it('should throw an error if we have no model defined', function () { + expect(function() { + compile(''); + }).toThrow(); + }); + it('should create proper DOM structure', function () { + var element = compile(''); + expect(element.siblings().is('div.select2-container')).toBe(true); + }); + it('should not modify the model if there is no initial value', function(){ + //TODO + }); + }); + describe('when model is changed programmatically', function(){ + describe('for single-select', function(){ + it('should call select2(data, ...) for objects', function(){ + var element = compile(''); + spyOn($.fn, 'select2'); + scope.$apply('foo={ id: 1, text: "first" }'); + expect(element.select2).toHaveBeenCalledWith('data', { id: 1, text: "first" }); + }); + it('should call select2(val, ...) for strings', function(){ + var element = compile(''); + spyOn($.fn, 'select2'); + scope.$apply('foo="first"'); + expect(element.select2).toHaveBeenCalledWith('val', 'first'); + }); + }); + describe('for multi-select', function(){ + it('should call select2(data, ...) for arrays', function(){ + var element = compile(''); + spyOn($.fn, 'select2'); + scope.$apply('foo=[{ id: 1, text: "first" },{ id: 2, text: "second" }]'); + expect(element.select2).toHaveBeenCalledWith('data', [{ id: 1, text: "first" },{ id: 2, text: "second" }]); + }); + it('should call select2(data, []) for falsey values', function(){ + var element = compile(''); + spyOn($.fn, 'select2'); + scope.$apply('foo=[]'); + expect(element.select2).toHaveBeenCalledWith('data', []); + }); + xit('should call select2(val, ...) for strings', function(){ + var element = compile(''); + spyOn($.fn, 'select2'); + scope.$apply('foo="first,second"'); + expect(element.select2).toHaveBeenCalledWith('val', 'first,second'); + }); + }); + }); + describe('consumers of ngModel should correctly use $viewValue', function() { + it('should use any formatters if present (select - single select)', function(){ + scope.foo = 'First'; + var element = compile(''); + expect(element.select2('val')).toBe('First - I\'ve been formatted'); + scope.$apply('foo = "Second"'); + expect(element.select2('val')).toBe('Second - I\'ve been formatted'); + }); + + // isMultiple && falsey + it('should use any formatters if present (input multi select - falsey value)', function() { + // need special function to hit this case + // old code checked modelValue... can't just pass undefined to model value because view value will be the same + scope.transformers.fromModel = function(modelValue) { + if (modelValue === "magic") { + return undefined; + } + + return modelValue; + }; + + var element = compile(''); + spyOn($.fn, 'select2'); + scope.$apply('foo="magic"'); + expect(element.select2).toHaveBeenCalledWith('data', []); + }); + // isMultiple && isArray + it('should use any formatters if present (input multi select)', function() { + var element = compile(''); + spyOn($.fn, 'select2'); + scope.$apply('foo=[{ id: 1, text: "first" },{ id: 2, text: "second" }]'); + expect(element.select2).toHaveBeenCalledWith('data', [{ id: 1, text: "first - I've been formatted" },{ id: 2, text: "second - I've been formatted" }]); + }); + // isMultiple... + xit('should use any formatters if present (input multi select - non array)', function() { + var element = compile(''); + spyOn($.fn, 'select2'); + scope.$apply('foo={ id: 1, text: "first" }'); + expect(element.select2).toHaveBeenCalledWith('val', { id: 1, text: "first - I've been formatted" }); + }); + + // !isMultiple + it('should use any formatters if present (input - single select - object)', function() { + var element = compile(''); + spyOn($.fn, 'select2'); + scope.$apply('foo={ id: 1, text: "first" }'); + expect(element.select2).toHaveBeenCalledWith('data', { id: 1, text: "first - I've been formatted" }); + }); + it('should use any formatters if present (input - single select - non object)', function() { + var element = compile(''); + spyOn($.fn, 'select2'); + scope.$apply('foo="first"'); + expect(element.select2).toHaveBeenCalledWith('val', "first - I've been formatted"); + }); + + it('should not set the default value using scope.$eval', function() { + // testing directive instantiation - change order of test + spyOn($.fn, 'select2'); + spyOn($.fn, 'val'); + scope.$apply('foo=[{ id: 1, text: "first" },{ id: 2, text: "second" }]'); + + var element = compile(''); + expect(element.val).not.toHaveBeenCalledWith([{ id: 1, text: "first" },{ id: 2, text: "second" }]); + }); + it('should expect a default value to be set with a call to the render method', function() { + // this should monitor the events after init, when the timeout callback executes + var opts = angular.copy(scope.options); + opts.multiple = true; + + scope.$apply('foo=[{ id: 1, text: "first" },{ id: 2, text: "second" }]'); + + spyOn($.fn, 'select2'); + var element = compile(''); + + // select 2 init + expect(element.select2).toHaveBeenCalledWith(opts); + + // callback setting + expect(element.select2).toHaveBeenCalledWith('data', [{ id: 1, text: "first - I've been formatted" },{ id: 2, text: "second - I've been formatted" }]); + + // retieve data + expect(element.select2).toHaveBeenCalledWith('data'); + }); + + }); + it('should set the model when the user selects an item', function(){ + var element = compile(''); + // TODO: programmactically select an option + // expect(scope.foo).toBe(/* selected val */) ; + }); + + it('updated the view when model changes with complex object', function(){ + scope.foo = [{'id': '0', 'text': '0'}]; + scope.options['multiple'] = true; + var element = compile(''); + scope.$digest(); + + scope.foo.push({'id': '1', 'text': '1'}); + scope.$digest(); + + expect(element.select2('data')).toEqual( + [{'id': '0', 'text': '0'}, {'id': '1', 'text': '1'}]); + }); + + + describe('simple_tags', function() { + + beforeEach(function() { + scope.options['multiple'] = true; + scope.options['simple_tags'] = true; + scope.options['tags'] = []; + }); + + it('Initialize the select2 view based on list of strings.', function() { + scope.foo = ['tag1', 'tag2']; + + var element = compile(''); + scope.$digest(); + + expect(element.select2('data')).toEqual([ + {'id': 'tag1', 'text': 'tag1'}, + {'id': 'tag2', 'text': 'tag2'} + ]); + }); + + it( + 'When list is empty select2 view model is also initialized as empty', + function() { + scope.foo = []; + + var element = compile(''); + scope.$digest(); + + expect(element.select2('data')).toEqual([]); + }); + + it( + 'Updating the model with a string will update the select2 view model.', + function() { + scope.foo = []; + var element = compile(''); + scope.$digest(); + + scope.foo.push('tag1'); + scope.$digest(); + + expect(element.select2('data')).toEqual([ + {'id': 'tag1', 'text': 'tag1'} + ]); + }); + + it( + 'Updating the select2 model will update AngularJS model with a string.', + function() { + scope.foo = []; + var element = compile(''); + scope.$digest(); + + element.select2('data', [ + {'id':'tag1', 'text': 'tag1'}, + {'id':'tag2', 'text': 'tag2'} + ]); + element.trigger('change'); + + expect(scope.foo).toEqual(['tag1', 'tag2']); + }); + + }); + + }); +}); \ No newline at end of file diff --git a/app/bower_components/fabric.js/.bithoundrc b/app/bower_components/fabric.js/.bithoundrc new file mode 100644 index 0000000..c349458 --- /dev/null +++ b/app/bower_components/fabric.js/.bithoundrc @@ -0,0 +1,7 @@ +{ + "ignore": [ + "**/lib/**", + "**/dist/**", + "**/test/**" + ] +} diff --git a/app/bower_components/fabric.js/.bower.json b/app/bower_components/fabric.js/.bower.json new file mode 100644 index 0000000..012f8d2 --- /dev/null +++ b/app/bower_components/fabric.js/.bower.json @@ -0,0 +1,44 @@ +{ + "name": "fabric.js", + "homepage": "http://fabricjs.com", + "authors": [ + "kangax", + "Kienz", + "asturur" + ], + "description": "Object model for HTML5 canvas, and SVG-to-canvas parser. Backed by jsdom and node-canvas.", + "main": "./dist/fabric.min.js", + "ignore": [ + "lib", + "src", + "test", + "build_all", + "build.js", + "build.sh", + "create_build_script.js", + "test.js", + "HEADER.js" + ], + "keywords": [ + "canvas", + "graphic", + "graphics", + "SVG", + "node-canvas", + "parser", + "HTML5", + "object model" + ], + "license": "MIT", + "version": "1.6.6", + "_release": "1.6.6", + "_resolution": { + "type": "version", + "tag": "v1.6.6", + "commit": "28c2654a2310a675f22f8b500fd5984fd03de4ff" + }, + "_source": "https://github.com/kangax/fabric.js.git", + "_target": "^1.6.6", + "_originalSource": "fabric", + "_direct": true +} \ No newline at end of file diff --git a/app/bower_components/fabric.js/.editorconfig b/app/bower_components/fabric.js/.editorconfig new file mode 100644 index 0000000..4a7ea30 --- /dev/null +++ b/app/bower_components/fabric.js/.editorconfig @@ -0,0 +1,12 @@ +root = true + +[*] +indent_style = space +indent_size = 2 +end_of_line = lf +charset = utf-8 +trim_trailing_whitespace = true +insert_final_newline = true + +[*.md] +trim_trailing_whitespace = false diff --git a/app/bower_components/fabric.js/.eslintrc.json b/app/bower_components/fabric.js/.eslintrc.json new file mode 100644 index 0000000..5471320 --- /dev/null +++ b/app/bower_components/fabric.js/.eslintrc.json @@ -0,0 +1,149 @@ +{ + "env": { + "browser": true + }, + "globals": { + "ActiveXObject": true, + "define": true, + "eventjs": true, + "exports": true, + "fabric": true, + "G_vmlCanvasManager": true, + "require": true, + "Buffer": true, + "process": true + }, + "rules": { + "eqeqeq": 2, + "no-eq-null": 2, + "no-eval": 2, + "no-unused-expressions": [ + 2, + { + "allowShortCircuit": true + } + ], + "guard-for-in": 0, + "wrap-iife": [ + 2, + "inside" + ], + "linebreak-style": [ + 2, + "unix" + ], + "no-loop-func": 2, + "no-multi-str": 2, + "no-caller": 2, + "no-empty": [ + 2, + { + "allowEmptyCatch": true + } + ], + "no-new": 0, + "no-plusplus": 0, + "strict": 0, + "dot-notation": 2, + "no-undef": 2, + "no-unused-vars": 2, + "max-depth": [ + 2, + 4 + ], + "max-statements": [ + 2, + 45 + ], + "curly": [ + 2, + "all" + ], + "keyword-spacing": [ + 2, + {} + ], + "space-infix-ops": 2, + "array-bracket-spacing": [ + 2, + "never" + ], + "comma-style": [ + 2, + "last" + ], + "camelcase": [ + 2, + { + "properties": "never" + } + ], + "brace-style": [ + 2, + "stroustrup", + { + "allowSingleLine": true + } + ], + "eol-last": 2, + "one-var": [ + 0, + "always" + ], + "quote-props": [ + 2, + "as-needed", + { + "keywords": true + } + ], + "key-spacing": [ + 2, + { + "beforeColon": false, + "afterColon": true, + "mode": "minimum" + } + ], + "space-unary-ops": [ + 2, + { + "words": true, + "nonwords": false + } + ], + "no-with": 2, + "no-multiple-empty-lines": 2, + "no-mixed-spaces-and-tabs": 2, + "no-trailing-spaces": 2, + "quotes": [ + 2, + "single" + ], + "indent": [ + 2, + 2, + { + "SwitchCase": 1, + "VariableDeclarator": 2 + } + ], + "consistent-this": [ + 2, + "_this" + ], + "valid-jsdoc": [ + 0, + { + "requireReturn": false + } + ], + "max-len": [ + 2, + 120, + { + "ignoreComments": true + } + ] + } +} diff --git a/app/bower_components/fabric.js/.eslintrc_tests b/app/bower_components/fabric.js/.eslintrc_tests new file mode 100644 index 0000000..d8b3ae3 --- /dev/null +++ b/app/bower_components/fabric.js/.eslintrc_tests @@ -0,0 +1,45 @@ +{ + "env": { + "browser": true, + "node": true, + "qunit": true + }, + "globals": { + "fabric": true, + "G_vmlCanvasManager": true + }, + "rules": { + "eqeqeq": 0, + "no-eq-null": 2, + "no-eval": 2, + "no-unused-expressions": 2, + "guard-for-in": 0, + "wrap-iife": [ + 2, + "any" + ], + "quote-props": 0, + "linebreak-style": 2, + "no-loop-func": 2, + "no-multi-str": 0, + "new-cap": 2, + "no-caller": 2, + "no-empty": 0, + "no-new": 0, + "no-plusplus": 0, + "strict": 0, + "dot-notation": 0, + "no-undef": 2, + "no-unused-vars": 2, + "max-statements": 0, + "camelcase": 0, + "consistent-this": 0, + "max-len": [ + 0, + 120, + { + "ignoreComments": true + } + ] + } +} diff --git a/app/bower_components/fabric.js/.gitignore b/app/bower_components/fabric.js/.gitignore new file mode 100644 index 0000000..eb188e7 --- /dev/null +++ b/app/bower_components/fabric.js/.gitignore @@ -0,0 +1,7 @@ +.DS_Store +*.iml +/node_modules/ +/npm-debug.log +before_commit +/coverage/ +.idea/ diff --git a/app/bower_components/fabric.js/.npmignore b/app/bower_components/fabric.js/.npmignore new file mode 100644 index 0000000..ad5bfd9 --- /dev/null +++ b/app/bower_components/fabric.js/.npmignore @@ -0,0 +1,8 @@ +src/ +lib/ +dist/all.min.js +dist/all.min.js.gz +dist/fabric.min.js +dist/fabric.min.js.gz +.DS_Store +HEADER.js diff --git a/app/bower_components/fabric.js/.travis.yml b/app/bower_components/fabric.js/.travis.yml new file mode 100644 index 0000000..887b26a --- /dev/null +++ b/app/bower_components/fabric.js/.travis.yml @@ -0,0 +1,20 @@ +language: node_js +node_js: + - "6" + - "5" + - "4" + - "0.12" + - "0.11" + - "0.10" +env: + - CXX=g++-4.8 +addons: + apt: + sources: + - ubuntu-toolchain-r-test + packages: + - g++-4.8 +before_install: + - sudo apt-get update -qq + - sudo apt-get install -qq libgif-dev libpng-dev libjpeg8-dev libpango1.0-dev libcairo2-dev +script: 'npm run build && npm run test && npm run lint && npm run lint_tests' diff --git a/app/bower_components/fabric.js/CHANGELOG.md b/app/bower_components/fabric.js/CHANGELOG.md new file mode 100644 index 0000000..9c8423f --- /dev/null +++ b/app/bower_components/fabric.js/CHANGELOG.md @@ -0,0 +1,289 @@ +**Version 1.6.6** + +- Add: Contrast and Saturate filters [#3341](https://github.com/kangax/fabric.js/pull/3341) +- Fix: Correct registering and removal of events to handle iText objects. [#3349](https://github.com/kangax/fabric.js/pull/3349) +- Fix: Corrected 2 regression of 1.6.5 (dataurl export and itext clicks) +- Fix: Corrected path boundaries calculation for Arcs ( a and A ) [#3347](https://github.com/kangax/fabric.js/pull/3347) + +**Version 1.6.5** + +- Fix: charspacing, do not get subzero with charwidth. +- Improvement: add callback support to all object cloning. [#3212](https://github.com/kangax/fabric.js/pull/3212) +- Improvement: add backgroundColor to all classe [#3248](https://github.com/kangax/fabric.js/pull/3248) +- Fix: add custom properties to backgroundImage and overlayImage [#3250](https://github.com/kangax/fabric.js/pull/3250) +- Fix: Object intersection is calculated on boundingBox and boundingRect, intersection is fired if objects are overlapping [#3252](https://github.com/kangax/fabric.js/pull/3252) +- Change: Restored previous selection behaviour, added key to selection active object under overlaid target [#3254](https://github.com/kangax/fabric.js/pull/3254) +- Improvement: hasStateChanged let you find state changes of complex properties. [#3262](https://github.com/kangax/fabric.js/pull/3262) +- Fix: IText/Textbox shift click selection backward. [#3270](https://github.com/kangax/fabric.js/pull/3270) +- Revert: font family quoting was a bad idea. node-canvas stills use it. [#3276](https://github.com/kangax/fabric.js/pull/3276) +- Fix: fire mouse:over event for activeObject and activeGroup when using findTarget shourtcuts [#3285](https://github.com/kangax/fabric.js/pull/3285) +- Fix: clear method clear all properties of canvas [#3305](https://github.com/kangax/fabric.js/pull/3305) +- Fix: text area position method takes in account canvas offset [#3306](https://github.com/kangax/fabric.js/pull/3306) +- Improvement: Added event on right click and possibility to hide the context menu with a flag [3308](https://github.com/kangax/fabric.js/pull/3308) +- Fix: remove canvas reference from object when object gets removed from canvas [#3307](https://github.com/kangax/fabric.js/pull/3307) +- Improvement: use native stroke dash if available [#3309](https://github.com/kangax/fabric.js/pull/3309) +- Fix: Export correct src when exporting to svg [#3310](https://github.com/kangax/fabric.js/pull/3310) +- Fix: Stop text to go on zero dimensions [#3312](https://github.com/kangax/fabric.js/pull/3312) +- Fix: Error in dataURL with multiplier was outputting very big canvas with retina [#3314](https://github.com/kangax/fabric.js/pull/3314) +- Fix: Error in style map was not respecting style if textbox started with space [#3315](https://github.com/kangax/fabric.js/pull/3315) + + +**Version 1.6.4** + +- Improvement: Ignore svg: namespace during svg import. [#3081](https://github.com/kangax/fabric.js/pull/3081) +- Improvement: Better fix for lineHeight of iText/Text [#3094](https://github.com/kangax/fabric.js/pull/3094) +- Improvement: Support for gradient with 'Infinity' coordinates [#3082](https://github.com/kangax/fabric.js/pull/3082) +- Improvement: Generally "improved" logic of targeting [#3111](https://github.com/kangax/fabric.js/pull/3111) +- Fix: Selection of active group with transparency and preserveObjectStacking true or false [#3109](https://github.com/kangax/fabric.js/pull/3109) +- Fix: pattern brush now create the same pattern seen while drawing [#3112](https://github.com/kangax/fabric.js/pull/3112) +- Fix: Allow css merge during svg import [#3114](https://github.com/kangax/fabric.js/pull/3114) +- Improvement: added numeric origins handling fomr 0 to 1. [#3121](https://github.com/kangax/fabric.js/pull/3121) +- Fix: Fix a defect with shadow of objects in a scaled group. [#3134](https://github.com/kangax/fabric.js/pull/3134) +- Improvement: Do not fire unecessary selection:changed events. [#3119](https://github.com/kangax/fabric.js/pull/3119) +- Fix: Attached hiddenTextarea to body fixes IE, thanks to @plainview. [#3137](https://github.com/kangax/fabric.js/pull/3137) +- Fix: Shift unselect activegroup on transformed canvas. [#3144](https://github.com/kangax/fabric.js/pull/3144) +- Added: ColorMatrix filter [#3139](https://github.com/kangax/fabric.js/pull/3139) +- Fix: Fix condition in wich restoring from Object could cause object overwriting [#3146](https://github.com/kangax/fabric.js/pull/3146) +- Change: cloneAsImage for Object and toDataUrl for object are not retina enabled by default. Added option to enable. [#3147](https://github.com/kangax/fabric.js/pull/3147) +- Improvement: Added textSpacing support for text/itext/textbox [#3097](https://github.com/kangax/fabric.js/pull/3097) +- Fix: Quote font family when setting the context fontstyle [#3191](https://github.com/kangax/fabric.js/pull/3191) +- Fix: use getSrc during image export, make subclassing easier, return eventually the .src property if nothing else is available [#3189](https://github.com/kangax/fabric.js/pull/3189) +- Fix: Inverted the meaning of border scale factor [#3154](https://github.com/kangax/fabric.js/pull/3154) +- Improvement: Added support for RGBA in HEX notation. [#3202](https://github.com/kangax/fabric.js/pull/3202) +- Improvement: Added object deselected event. [#3195](https://github.com/kangax/fabric.js/pull/3195) +- Fix: loadFromJson callback now gets fired after filter are applied [#3210](https://github.com/kangax/fabric.js/pull/3210) + +**Version 1.6.3** + +- Improvement: Use reviver callback for background and overlay image when doing svg export. [#2975](https://github.com/kangax/fabric.js/pull/2975) +- Improvement: Added object property excludeFromExport to avoid exporting the object to JSON or to SVG. [#2976](https://github.com/kangax/fabric.js/pull/2976) +- Improvement: Correct the calculation of text boundingbox. Improves svg import [#2992](https://github.com/kangax/fabric.js/pull/2992) +- Added: Export id property to SVG [#2993](https://github.com/kangax/fabric.js/pull/2993) +- Improvement: Call the callback on loadSvgFromURL on failed xml load with null agument [#2994](https://github.com/kangax/fabric.js/pull/2994) +- Improvement: Clear only the Itext area on contextTop during cursor animation [#2996](https://github.com/kangax/fabric.js/pull/2996) +- Added: Char widths cache has been moved to fabric level and not iText level. Added fabric.util.clearFabricCharWidthsCache(fontName) [#2995](https://github.com/kangax/fabric.js/pull/2995) +- Fix: do not set background or overlay image if the url load fails. [#3003](https://github.com/kangax/fabric.js/pull/3003) +- Fix: iText mousemove event removal, clear the correct area for Itext, stopped redrawing selection if not necessary [#3016](https://github.com/kangax/fabric.js/pull/3016) +- Fix: background image and overlay image scale and move with canvas viewportTransform, parameter available [#3019](https://github.com/kangax/fabric.js/pull/3019) +- Added: support sub targeting in groups in events [#2997](https://github.com/kangax/fabric.js/pull/2997) +- Fix: Select transparent object on mouse up because of _maybeGroupObject [#2997](https://github.com/kangax/fabric.js/pull/2997) +- Fix: Remove reference to lastRenderedObject on canvas.remove [#3023](https://github.com/kangax/fabric.js/pull/3023) +- Fix: Wait for all objects to be loaded before deleting the properties and setting options. [#3029](https://github.com/kangax/fabric.js/pull/3029) +- Fix: Object Padding is unaffected by object transform. [#3057](https://github.com/kangax/fabric.js/pull/3057) +- Fix: Restore lastRenderedObject usage. Introduced Canvas.lastRenderedKey to retrieve the lastRendered object from down the stack [#3057](https://github.com/kangax/fabric.js/pull/3057) +- Fix: _calcTextareaPosition correctly calculate the position considering the viewportTransform. [#3057](https://github.com/kangax/fabric.js/pull/3057) +- Fix: Fixed selectionBacgroundColor with viewport transform. [#3057](https://github.com/kangax/fabric.js/pull/3057) +- Improvement: Correctly render the cursor with viewport scaling, improved the cursor centering. [#3057](https://github.com/kangax/fabric.js/pull/3057) +- Fix: Use canvas zoom and pan when using is target transparent. [#2980](https://github.com/kangax/fabric.js/pull/2980) + +**Version 1.6.2** + +- Fix: restore canvas properties on loadFromJSON with includeProperties. [#2921](https://github.com/kangax/fabric.js/pull/2921) +- Fix: Allow hoverCursor on non selectable objects, moveCursor does not appear if the object is not moveable. +Added object.moveCursor to specify a cursor for moving per object. [#2924](https://github.com/kangax/fabric.js/pull/2924) +- Fix: Add missing stroke.live translation, allow gradientTransform for dashed line. [#2926](https://github.com/kangax/fabric.js/pull/2926) +- Improvement: Allow customization of keys that iteract with mouse action ( multiselect key, free tranform key, alternative action key, centered transform key ) [#2925](https://github.com/kangax/fabric.js/pull/2925) +- Added: Make iText fires object:modified on text change on exit editing [#2927](https://github.com/kangax/fabric.js/pull/2927) +- Added: [control customization part 1] cornerDashArray, borderDashArray. Now borderScaleFactor influences both border and controls, changed default corner size to 13 [#2932](https://github.com/kangax/fabric.js/pull/2932) +- Fix: createSVGFontFacesMarkup was failing to retrieve fonts in style [#2935](https://github.com/kangax/fabric.js/pull/2935) +- Fix: shadow not scaled with dataUrl to multiplier [#2940](https://github.com/kangax/fabric.js/pull/2940) +- Added: [control customization part 2] cornerStrokeColor. Now is possible to specify separate stroke and fill color for the controls [#2933](https://github.com/kangax/fabric.js/pull/2933) +- Fix: Itext width calculation with caching false was returning nan. [#2943](https://github.com/kangax/fabric.js/pull/2943) +- Added: [control customization part 3] Rounded corners. It is possible to specify cornerStyle for the object. 'rect' or 'circle' [#2942](https://github.com/kangax/fabric.js/pull/2942) +- Added: [control customization part 4] Selection background. It is possible to specify selectionBackgroundColor for the object. [#2950](https://github.com/kangax/fabric.js/pull/2950) +- Fix: Behaviour of image with filters with resize effects and Object to/from json [#2954](https://github.com/kangax/fabric.js/pull/2954) +- Fix: Svg export should not output color notation in rgba format [#2955](https://github.com/kangax/fabric.js/pull/2955) +- Fix: minScaleLimit rounding bug [#2964](https://github.com/kangax/fabric.js/pull/2964) +- Fix: Itext spacing in justify mode bug [#2971](https://github.com/kangax/fabric.js/pull/2971) +- Fix: Object.toDataUrl export when some window.devicepixelRatio is present (retina or browser zoom) [#2972](https://github.com/kangax/fabric.js/pull/2972) + + +**Version 1.6.1** + +- Fix: image with broken element throwing error on toObject() [#2878](https://github.com/kangax/fabric.js/pull/2878) +- Fix: Warning on trying to set proprietary browser version of ctxImageSmoothingEnabled [#2880](https://github.com/kangax/fabric.js/pull/2880) +- Fix: Fixed Svg import regression on color and drawing polylines [#2887](https://github.com/kangax/fabric.js/pull/2887) +- Fix: Fixed animation ease that starts and stop at same value [#2888](https://github.com/kangax/fabric.js/pull/2888) +- Fix: Allow a not stateful canvas to fire object:modified at end of transform. [#2890](https://github.com/kangax/fabric.js/pull/2890) +- Fix: Made event handler removal safer. Removing firing events will not cause errors. [#2883](https://github.com/kangax/fabric.js/pull/2883) +- Fix: Proper handling of perPixelTargetFind and multi selections [#2894](https://github.com/kangax/fabric.js/pull/2894) +- Fix: Do not clear contextTop on drawingMode, to allow drawing over animations [#2895](https://github.com/kangax/fabric.js/pull/2895) +- Change the dependencies to optional. Allow npm to continue installing if nodecanvas installation fail.[#2901](https://github.com/kangax/fabric.js/pull/2901) +- Fix: Check again the target on mouseup [#2902](https://github.com/kangax/fabric.js/pull/2902) +- Fix: On perPixelTargetFind detect corners only if target is active [#2903](https://github.com/kangax/fabric.js/pull/2903) +- Improvement: Add canvas mouseout event listener [#2907](https://github.com/kangax/fabric.js/pull/2907) +- Improvement: Make small object draggable easier [#2907](https://github.com/kangax/fabric.js/pull/2907) +- Improvement: Use sendToBack, bringToFront, bringForward, sendBackwards for multiple selections [#2908](https://github.com/kangax/fabric.js/pull/2908) + +**Version 1.6.0** + +- Fix rendering of activeGroup objects while preserveObjectStacking is active. [ regression from [#2083](https://github.com/kangax/fabric.js/pull/2083) ] +- Fix `fabric.Path` initialize with user options [#2117](https://github.com/kangax/fabric.js/pull/2117) +- Fix sorting of objects in activeGroup during rendering [#2130](https://github.com/kangax/fabric.js/pull/2130). +- Make sure that 'object.canvas' property is always set if the object is directly or indirectly on canvas [#2141](https://github.com/kangax/fabric.js/pull/2141) +- Fix _getTopLeftCoords function that was returning TopCenter [#2127](https://github.com/kangax/fabric.js/pull/2127) +- Fix events not being fired after resize with pinch zoom [#510](https://github.com/kangax/fabric.js/pull/510) +- Fix mouse:over, mouse:out events not receiving event object [#2146](https://github.com/kangax/fabric.js/pull/2146) +- Don't include elements from `` during SVG parsing [#2160](https://github.com/kangax/fabric.js/pull/2160) +- Fix some iText new glitches and old bugs about style deleting and inserting, faster function for get2dCursorLocation [#2153](https://github.com/kangax/fabric.js/pull/2153) +- Change bounding box calculation, made strokewidth always considered in dimensions. Switched group stroke default to 0 strokewidth. [#2155](https://github.com/kangax/fabric.js/pull/2155) +- Fix scaling function for object with strokewidth [#2178](https://github.com/kangax/fabric.js/pull/2178) +- Fix image fromObject restoring resizeFilter [#2164](https://github.com/kangax/fabric.js/pull/2164) +- Fix double application of filter upon image init [#2164](https://github.com/kangax/fabric.js/pull/2164) +- Fix image.filter.Resize toObject and fromObject [#2164](https://github.com/kangax/fabric.js/pull/2164) +- Fix strokeWidth calculation during resize operations [#2178](https://github.com/kangax/fabric.js/pull/2178) +- Fix iText selection on upperCanvas to support transformMatrix [#2173](https://github.com/kangax/fabric.js/pull/2173) +- Removed unnecessary calls to removeShadow and restoreGlobalCompositeOperation [#2175](https://github.com/kangax/fabric.js/pull/2175) +- Fix the offset for pattern and gradients filling and stroking in text [#2183](https://github.com/kangax/fabric.js/pull/2183) +- Fix loading of stroke gradients from Object [#2182](https://github.com/kangax/fabric.js/pull/2182) +- Fix segmentation fault on node.js when image doesn't exist [#2193](https://github.com/kangax/fabric.js/pull/2193) +- Fix iText border selection when changing fontWeight [#2201](https://github.com/kangax/fabric.js/pull/2201) +- Fix calculation of object dimensions for geometry functions translation and scaling. [#2206](https://github.com/kangax/fabric.js/pull/2206) +- Fix iText cursor position on click at end of line [#2217](https://github.com/kangax/fabric.js/pull/2217) +- Fix error on parsing style string with trailing spaces [#2256](https://github.com/kangax/fabric.js/pull/2256) +- Fix delegated properties leaking on objects in a group when restoring from json [#2101](https://github.com/kangax/fabric.js/pull/2101) +- Fix cursor click position in rotated i-Text when origins different from TOPLEFT. [#2269](https://github.com/kangax/fabric.js/pull/2269) +- Fix mouse position when the canvas is in a complex style scrolling situation [#2128](https://github.com/kangax/fabric.js/pull/2128) +- Fix parser regex for not parsing svg tags attribute [#2311](https://github.com/kangax/fabric.js/pull/2311) +- Add id attribute to standard attribute parsing from SVG elements [#2317](https://github.com/kangax/fabric.js/pull/2317) +- Fix text decoration opacity [#2310](https://github.com/kangax/fabric.js/pull/2310) +- Add simple color animation utility in /src/util/animate_color.js [#2328](https://github.com/kangax/fabric.js/pull/2328) +- Fix itext paste function to check for source of copied text and strip carriage returns (\r)[#2336](https://github.com/kangax/fabric.js/pull/2336) +- Fix pattern class serialize the source using toDataURL if available [#2335](https://github.com/kangax/fabric.js/pull/2335) +- Fix imageSmoothingEnabled warning on chrome and reinit the property after setDimensions [#2337](https://github.com/kangax/fabric.js/pull/2337) +- Add ability to parse path elements with no path specified. [#2344](https://github.com/kangax/fabric.js/pull/2344) +- Fix shiftClick with activeGroup in case of normal and scaled groups [#2342](https://github.com/kangax/fabric.js/pull/2342) +- Add support for colors in shadow svg export [#2349](https://github.com/kangax/fabric.js/pull/2349) +- Add support for inner viewBoxes in svg parsing [#2345](https://github.com/kangax/fabric.js/pull/2345) +- Fix BoundingBox calculation for pathGroups that have inner transformMatrix [#2348](https://github.com/kangax/fabric.js/pull/2348) +- Fix export toObject to include transformMatrix property [#2350](https://github.com/kangax/fabric.js/pull/2350) +- Fix textbox class to supporto toSVG() and newest style fixes [#2347] +(https://github.com/kangax/fabric.js/pull/2347) +- Fix regression on text ( textDecoration and textlinebackground ) [#2354](https://github.com/kangax/fabric.js/pull/2354) +- Add support for multi keys chars using onInput event [#2352](https://github.com/kangax/fabric.js/pull/2352) +- Fix iText and textbox entering in edit mode if clicked on a corner [#2393](https://github.com/kangax/fabric.js/pull/2393) +- Fix iText styles error when in justify align [#2370](https://github.com/kangax/fabric.js/pull/2370) +- Add support for shadow export in svg for groups, pathgroups and images. [#2364] +- Add rendering shadows for groups [#2364](https://github.com/kangax/fabric.js/pull/2364) +- Add support for parsing nested SVGs x and y attributes [#2399](https://github.com/kangax/fabric.js/pull/2399) +- Add support for gradientTransform in setGradient(fill or stroke) [#2401](https://github.com/kangax/fabric.js/pull/2401) +- Fix Error in svg parsed that was stopping on gradient color-stop missing stop attribute [#2414](https://github.com/kangax/fabric.js/pull/2414) +- toObject method return copied arrays for array like properties [#2407](https://github.com/kangax/fabric.js/pull/2407) +- Fix Set stop value of colorstop to 0 if stop attribute not present [#2414](https://github.com/kangax/fabric.js/pull/2414) +- Fix correct value of e.button for mouse left click if e.which not supported[#2453](https://github.com/kangax/fabric.js/pull/2453) +- Add check for host property in getScrollTopLeft[#2462](https://github.com/kangax/fabric.js/pull/2462) +- Fix check for object.selectable in findTarget[#2466](https://github.com/kangax/fabric.js/pull/2466) +- Fix After rendering a gesture set originX/Y to its original value[#2479](https://github.com/kangax/fabric.js/pull/2479) +- Add support for skewing objects using shift and m-controls in interactive mode, and using object.skewX/Y [#2482](https://github.com/kangax/fabric.js/pull/2482) +- Fix gradientTransform not exported in gradient toObject [#2486](https://github.com/kangax/fabric.js/pull/2486) +- Fix object.toDataUrl with multiplier [#2487](https://github.com/kangax/fabric.js/pull/2487) +BACK INCOMPATIBILITY: removed 'allOnTop' parameter from fabric.StaticCanvas.renderAll. +- Fix mask filter, mask image is now streched on all image [#2543](https://github.com/kangax/fabric.js/pull/2543) +- Fix text onInput event to behave correctly if some text is selected [#2501](https://github.com/kangax/fabric.js/pull/2502) +- Fix object with selectable = false could be selected with shift click [#2503](https://github.com/kangax/fabric.js/pull/2503) +- Fix for mask filter when bigger or smaller image is used [#2534](https://github.com/kangax/fabric.js/pull/2534) +- Improvement: simplified renderAll logic [#2545](https://github.com/kangax/fabric.js/pull/2545) +- Improvement: Manage group transformation with skew rotate and scale [#2549](https://github.com/kangax/fabric.js/pull/2549) +- Fix: Add shadow affectStroke to shadow to Object method [#2568](https://github.com/kangax/fabric.js/pull/2568) +- Fix: Made multitouch pinch resize works with skewed object [#2625](https://github.com/kangax/fabric.js/pull/2625) +- Improvement: Added retina screen support [#2623](https://github.com/kangax/fabric.js/pull/2623) +- Change: Set default Image strokeWidth to 0 to improve image rendering [#2624](https://github.com/kangax/fabric.js/pull/2624) +- Fix: multitouch zoom gesture speed back to normal speed [#2625](https://github.com/kangax/fabric.js/pull/2625) +- Fix: fix controls rendering with retina scaling and controls above overlay [#2632](https://github.com/kangax/fabric.js/pull/2632) +- Improvements: resize SVG using viewport/viewbox. [#2642](https://github.com/kangax/fabric.js/pull/2642) +- Improvements: Svg import now supports rotate around point [#2645](https://github.com/kangax/fabric.js/pull/2645) +- Change: Opacity is no more a delegated property for group [#2656](https://github.com/kangax/fabric.js/pull/2656) +- Fix: Itext now check for editable property before initializing cursor [#2657](https://github.com/kangax/fabric.js/pull/2657) +- Fix: Better SVG export support for shadows of rotated objects [#2671](https://github.com/kangax/fabric.js/pull/2671) +- Fix: Avoid polygon polyline to change constructor point array [#2627](https://github.com/kangax/fabric.js/pull/2627) +- SVG import: support fill/stroke opacity when no fill/stroke attribute is present [#2703](https://github.com/kangax/fabric.js/pull/2703) +- Fix: remove white filter set opacity to 0 instead of 1 [#2714](https://github.com/kangax/fabric.js/pull/2714) +- Cleaning: removing unused fabric.Canvas.activeInstance [#2708](https://github.com/kangax/fabric.js/pull/2708) +- Change: remove flipping of text string when flipping object [#2719](https://github.com/kangax/fabric.js/pull/2719) +- Fix: Correct shift click on generic transformerd active groups [#2720](https://github.com/kangax/fabric.js/pull/2720) +- SVG import: parse svg with no spaces between transforms [#2738](https://github.com/kangax/fabric.js/pull/2738) +- Fix: Fallback to styleElement.text for IE9 [#2754](https://github.com/kangax/fabric.js/pull/2754) +- Fix: data url for node [#2777](https://github.com/kangax/fabric.js/pull/2777) +- Improvement: Extended font face to all text class during svg export [#2797](https://github.com/kangax/fabric.js/pull/2797) +- Fix: retina scaling dataurl and shadows. [#2806](https://github.com/kangax/fabric.js/pull/2806) +- Improvement: Better look to iText decoration shadows. [#2808](https://github.com/kangax/fabric.js/pull/2808) +- Improvement: New text shadow export to SVG. [#2827](https://github.com/kangax/fabric.js/pull/2827) +- fix: location of optimized 1x1 rects. [#2817](https://github.com/kangax/fabric.js/pull/2817) +- fix: TextBox handling of consecutive spaces. [#2852](https://github.com/kangax/fabric.js/pull/2852) +- fix: Respect shadow in svg export of flipped objects. [#2854](https://github.com/kangax/fabric.js/pull/2854) +- fix: Check presence of style for textBox in svg export. [#2853](https://github.com/kangax/fabric.js/pull/2853) +- Improvement: Added node compatibility for v4 and v5. [#2872](https://github.com/kangax/fabric.js/pull/2872) +- Fix: Canvas dispose remove the extra created elements. [#2875](https://github.com/kangax/fabric.js/pull/2875) +- IText improvements to cut-copy-paste, edit, mobile jumps and style. [#2868](https://github.com/kangax/fabric.js/pull/2868) + +**Version 1.5.0** + +**Edge** +- Added image preserve aspect ratio attributes and functionality (fabric.Image.alignY, fabric.Image.alignY, fabric.Image.meetOrSlic ) +- Added ImageResizeFilters , option to resize dinamically or statically the images using a set of resize filter alghoritms. +- [BACK_INCOMPAT] `fabric.Collection#remove` doesn't return removed object -> returns `this` (chainable) + +- Add "mouse:over" and "mouse:out" canvas events (and corresponding "mouseover", "mouseout" object events) +- Add support for passing options to `fabric.createCanvasForNode` + +- Various iText fixes and performance improvements +- Fix `overlayImage` / `overlayColor` during selection mode +- Fix double callback in loadFromJSON when there's no objects +- Fix paths parsing when number has negative exponent +- Fix background offset in iText +- Fix style object deletion in iText +- Fix typo in `_initCanvasHandlers` +- Fix `transformMatrix` not affecting fabric.Text +- Fix `setAngle` for different originX/originY (!= 'center') +- Change default/init noise/brightness value for `fabric.Image.filters.Noise` and `fabric.Image.filters.Brightness` from 100 to 0 +- Add `fabric.Canvas#imageSmoothingEnabled` +- Add `copy/paste` support for iText (uses clipboardData) + +**Version 1.4.0** + +- [BACK_INCOMPAT] JSON and Cufon are no longer included in default build + +- [BACK_INCOMPAT] Change default objects' originX/originY to left/top + +- [BACK_INCOMPAT] `fabric.StaticCanvas#backgroundImage` and `fabric.StaticCanvas#overlayImage` are `fabric.Image` instances. `fabric.StaticCanvas#backgroundImageOpacity`, `fabric.StaticCanvas#backgroundImageStretch`, `fabric.StaticCanvas#overlayImageLeft` and `fabric.StaticCanvas#overlayImageTop` were removed. + +- [BACK_INCOMPAT] `fabric.Text#backgroundColor` is now `fabric.Object#backgroundColor` + +- [BACK_INCOMPAT] Remove `fabric.Object#toGrayscale` and `fabric.Object#overlayFill` since they're too specific + +- [BACK_INCOMPAT] Remove `fabric.StaticCanvas.toGrayscale` since we already have that logic in `fabric.Image.filters.Grayscale`. + +- [BACK_INCOMPAT] Split `centerTransform` into the properties `centeredScaling` and `centeredRotation`. Object rotation now happens around originX/originY point UNLESS `centeredRotation=true`. Object scaling now happens non-centered UNLESS `centeredScaling=true`. + +**Version 1.3.0** + +- [BACK_INCOMPAT] Remove selectable, hasControls, hasBorders, hasRotatingPoint, transparentCorners, perPixelTargetFind from default object/json representation of objects. + +- [BACK_INCOMPAT] Object rotation now happens around originX/originY point UNLESS `centerTransform=true`. + +- [BACK_INCOMPAT] fabric.Text#textShadow has been removed - new fabric.Text.shadow property (type of fabric.Shadow). + +- [BACK_INCOMPAT] fabric.BaseBrush shadow properties are combined into one property => fabric.BaseBrush.shadow (shadowColor, shadowBlur, shadowOffsetX, shadowOffsetY no longer exist). + +- [BACK_INCOMPAT] `fabric.Path.fromObject` is now async. `fabric.Canvas#loadFromDatalessJSON` is deprecated. + +**Version 1.2.0** + +- [BACK_INCOMPAT] Make `fabric.Object#toDataURL` synchronous. + +- [BACK_INCOMPAT] `fabric.Text#strokeStyle` -> `fabric.Text#stroke`, for consistency with other objects. + +- [BACK_INCOMPAT] `fabric.Object.setActive(…)` -> `fabric.Object.set('active', …)`. + `fabric.Object.isActive` is gone (use `fabric.Object.active` instead) + +- [BACK_INCOMPAT] `fabric.Group#objects` -> `fabric.Group._objects`. + +**Version 1.1.0** + +- [BACK_INCOMPAT] `fabric.Text#setFontsize` becomes `fabric.Object#setFontSize`. + +- [BACK_INCOMPAT] `fabric.Canvas.toDataURL` now accepts options object instead linear arguments. + `fabric.Canvas.toDataURLWithMultiplier` is deprecated; + use `fabric.Canvas.toDataURL({ multiplier: … })` instead + +**Version 1.0.0** diff --git a/app/bower_components/fabric.js/CODE_OF_CONDUCT.md b/app/bower_components/fabric.js/CODE_OF_CONDUCT.md new file mode 100644 index 0000000..c2ebaab --- /dev/null +++ b/app/bower_components/fabric.js/CODE_OF_CONDUCT.md @@ -0,0 +1,15 @@ +# Contributor Code of Conduct + +As contributors and maintainers of this project, we pledge to respect all people who contribute through reporting issues, posting feature requests, updating documentation, submitting pull requests or patches, and other activities. + +We are committed to making participation in this project a harassment-free experience for everyone, regardless of level of experience, gender, gender identity and expression, sexual orientation, disability, personal appearance, body size, race, ethnicity, age, or religion. + +Examples of unacceptable behavior by participants include the use of sexual language or imagery, derogatory comments or personal attacks, trolling, public or private harassment, insults, or other unprofessional conduct. + +Project maintainers have the right and responsibility to remove, edit, or reject comments, commits, code, wiki edits, issues, and other contributions that are not aligned to this Code of Conduct. Project maintainers who do not follow the Code of Conduct may be removed from the project team. + +This code of conduct applies both within project spaces and in public spaces when an individual is representing the project or its community. + +Instances of abusive, harassing, or otherwise unacceptable behavior may be reported by opening an issue or contacting one or more of the project maintainers. + +This Code of Conduct is adapted from the [Contributor Covenant](http://contributor-covenant.org), version 1.1.0, available at [http://contributor-covenant.org/version/1/1/0/](http://contributor-covenant.org/version/1/1/0/) diff --git a/app/bower_components/fabric.js/CONTRIBUTING.md b/app/bower_components/fabric.js/CONTRIBUTING.md new file mode 100644 index 0000000..bc8e9f2 --- /dev/null +++ b/app/bower_components/fabric.js/CONTRIBUTING.md @@ -0,0 +1,70 @@ +# Contributing to Fabric + +1. [Questions?!?](#questions) +2. [Issue tracker](#issue-tracker) +3. [Issue tracker guidelines](#issue-tracker-guidelines) +4. [Pull requests](#pull-request) +5. [Pull request guidelines](#pull-request-guidelines) + +## Questions?!? + +To get your questions answered, please ask/search on [Fabric's google group], [StackOverflow] or on Fabric's IRC channel (irc://irc.freenode.net/#fabric.js). +Please do not open an issue if you're not sure it's a bug or if it's not a feature/suggestion. + +For news about Fabric you can follow [@fabric.js], [@kangax], or [@kienzle_s] on Twitter. +Demos and examples can be found on [jsfiddle], [codepen.io] and [fabricjs.com]. + +## Issue tracker + +If you are sure that it's a bug in Fabric.js or a suggestion, open a new [issue] and try to answer the following questions: + +- What did you do? +- What did you expect to happen? +- What happened instead? + +### Issue tracker guidelines + +- **Search:** Before opening a new issue please [search](https://github.com/kangax/fabric.js/search?q=&ref=cmdform&type=Issues) Fabric's existing issues. + +- **Title:** Choose an informative title. + +- **Description:** Use the questions above to describe the issue. Add logs, screenshots or videos if that makes sense. + +- **Test case:** Please post code to replicate the bug - best on [jsfiddle](http://jsfiddle.net). Ideally a failing test would be +perfect, but even a simple script demonstrating the error would suffice. You could use [this jsfiddle template](http://jsfiddle.net/fabricjs/Da7SP/) as a +starting point. + +- **Fabric.js version:** Make sure to specify which version of Fabric.js you are using. The version can be found in [fabric.js file](https://github.com/kangax/fabric.js/blob/master/dist/fabric.js#L5) or just by executing `fabric.version` in the browser console. + +## Pull requests + +We are very grateful for your pull requests! This is your chance to improve Fabric for everyone else. + +### Pull request guidelines + +Here are a few notes you should take into account: + +- **Code style, notes:** Make sure you have complied with the [guidelines](https://github.com/kangax/fabric.js/wiki/How-to-contribute-to-Fabric#code-style-notes) + +- **Distribution files:** Do your changes only in the [source files](https://github.com/kangax/fabric.js/tree/master/src). Don't include the [distribution files](https://github.com/kangax/fabric.js/tree/master/dist) in your commit. + +- **Add tests**: Tests are always a great addition - invest a little time and expand the [unit tests suite](https://github.com/kangax/fabric.js/tree/master/test/unit). More informations about [QUnit](http://qunitjs.com/) tests can be found in the [wiki](https://github.com/kangax/fabric.js/wiki/How-to-contribute-to-Fabric#testing-fabric). + +- **Add documentation:** Fabric uses [JSDoc 3] for documentation. The generated documentation can be found at [fabricjs.com](http://fabricjs.com/docs). + +- **Create topic branches.** Don't use your master branch for pull request. It's better to create a new branch for every pull request. + +- **One pull request per feature/bug**. If you want to do more than one thing, send multiple pull requests. + +- **And there you go!** If you still have questions we're always happy to help. Also feel free to consult [wiki](https://github.com/kangax/fabric.js/wiki/How-to-contribute-to-Fabric). + +[Fabric's google group]: https://groups.google.com/forum/#!forum/fabricjs +[stackoverflow]: http://stackoverflow.com/questions/tagged/fabricjs +[@fabric.js]: https://twitter.com/fabricjs +[@kangax]: https://twitter.com/kangax +[@kienzle_s]: https://twitter.com/kienzle_s +[jsfiddle]: http://jsfiddle.net/user/fabricjs/fiddles +[codepen.io]: http://codepen.io/tag/fabricjs +[fabricjs.com]: http://fabricjs.com/demos +[JSDoc 3]: http://usejsdoc.org/ +[issue]: https://github.com/kangax/fabric.js/issues diff --git a/app/bower_components/fabric.js/ISSUE_TEMPLATE.md b/app/bower_components/fabric.js/ISSUE_TEMPLATE.md new file mode 100644 index 0000000..2784f9d --- /dev/null +++ b/app/bower_components/fabric.js/ISSUE_TEMPLATE.md @@ -0,0 +1,36 @@ + + + +## Version +1.6.5 + +## Test Case +http://jsfiddle.net/fabricjs/Da7SP/ + +## Steps to reproduce + +## Expected Behavior + +## Actual Behavior diff --git a/app/bower_components/fabric.js/LICENSE b/app/bower_components/fabric.js/LICENSE new file mode 100644 index 0000000..adb89c4 --- /dev/null +++ b/app/bower_components/fabric.js/LICENSE @@ -0,0 +1,16 @@ +Copyright (c) 2008-2015 Printio (Juriy Zaytsev, Maxim Chernyak) + +Permission is hereby granted, free of charge, to any person obtaining a copy +of this software and associated documentation files (the "Software"), to deal +in the Software without restriction, including without limitation the rights +to use, copy, modify, merge, publish, distribute, sublicense, and/or sell +copies of the Software, and to permit persons to whom the Software is +furnished to do so, subject to the following conditions: + +THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR +IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, +FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE +AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER +LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, +OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE +SOFTWARE. diff --git a/app/bower_components/fabric.js/README.md b/app/bower_components/fabric.js/README.md new file mode 100644 index 0000000..0a8598c --- /dev/null +++ b/app/bower_components/fabric.js/README.md @@ -0,0 +1,297 @@ +### Fabric + + + +[![Gitter](https://badges.gitter.im/Join Chat.svg)](https://gitter.im/kangax/fabric.js?utm_source=badge&utm_medium=badge&utm_campaign=pr-badge&utm_content=badge) + + + +[![Build Status](https://secure.travis-ci.org/kangax/fabric.js.svg?branch=master)](http://travis-ci.org/#!/kangax/fabric.js) +[![Code Climate](https://d3s6mut3hikguw.cloudfront.net/github/kangax/fabric.js/badges/gpa.svg)](https://codeclimate.com/github/kangax/fabric.js) +[![Coverage Status](https://coveralls.io/repos/kangax/fabric.js/badge.png?branch=master)](https://coveralls.io/r/kangax/fabric.js?branch=master) + + + +[![Bower version](https://badge.fury.io/bo/fabric.svg)](http://badge.fury.io/bo/fabric) +[![NPM version](https://badge.fury.io/js/fabric.svg)](http://badge.fury.io/js/fabric) +[![Downloads per month](https://img.shields.io/npm/dm/fabric.svg)](https://www.npmjs.org/package/fabric) + + + +[![Dependency Status](https://david-dm.org/kangax/fabric.js.svg?theme=shields.io)](https://david-dm.org/kangax/fabric.js) +[![devDependency Status](https://david-dm.org/kangax/fabric.js/dev-status.svg?theme=shields.io)](https://david-dm.org/kangax/fabric.js#info=devDependencies) + + + +[![Bountysource](https://api.bountysource.com/badge/tracker?tracker_id=23217)](https://www.bountysource.com/trackers/23217-fabric-js?utm_source=23217&utm_medium=shield&utm_campaign=TRACKER_BADGE) +[![Tips](https://img.shields.io/gratipay/kangax.svg)](https://gratipay.com/kangax/) +[![Flattr this git repo](http://api.flattr.com/button/flattr-badge-large.png)](https://flattr.com/submit/auto?user_id=kangax&url=http://github.com/kangax/fabric.js&title=Fabric.js&language=&tags=github&category=software) + +**Fabric.js** is a framework that makes it easy to work with HTML5 canvas element. It is an **interactive object model** on top of canvas element. It is also an **SVG-to-canvas parser**. + + + +Using Fabric.js, you can create and populate objects on canvas; objects like simple geometrical shapes — rectangles, circles, ellipses, polygons, or more complex shapes consisting of hundreds or thousands of simple paths. You can then scale, move, and rotate these objects with the mouse; modify their properties — color, transparency, z-index, etc. You can also manipulate these objects altogether — grouping them with a simple mouse selection. + +### Non-Technical Introduction to Fabric + +Fabric.js allows you to easily create simple shapes like rectangles, circles, triangles and other polygons or more complex shapes made up of many paths, onto the HTML `` element on a webpage using JavaScript. Fabric.js will then allow you to manipulate the size, position and rotation of these objects with a mouse. It’s also possible to change some of the attributes of these objects such as their color, transparency, depth position on the webpage or selecting groups of these objects using the Fabric.js library. Fabric.js will also allow you to convert an SVG image into JavaScript data that can be used for putting it onto the `` element. + + +[Contributions](https://github.com/kangax/fabric.js/wiki/Love-Fabric%3F-Help-us-by...) are very much welcome! + +### Goals + +- Unit tested (2400+ tests at the moment) +- Modular (~60 small ["classes", modules, mixins](http://fabricjs.com/docs/)) +- Cross-browser +- [Fast](https://github.com/kangax/fabric.js/wiki/Focus-on-speed) +- Encapsulated in one object +- No browser sniffing for critical functionality +- Runs under ES5 strict mode +- Runs on a server under [Node.js](http://nodejs.org/) (0.8, 0.10, 0.11, 0.12) (see [Node.js limitations](https://github.com/kangax/fabric.js/wiki/Fabric-limitations-in-node.js)) +- Follows [Semantic Versioning](http://semver.org/) + +### Supported browsers + +- Firefox 2+ +- Safari 3+ +- Opera 9.64+ +- Chrome (all versions) +- IE9, IE10, IE11, Edge + +#### With help of [Explorer Canvas](http://code.google.com/p/explorercanvas/) + +- IE8 (incomplete — about 17 failing tests at the moment) +- IE7,6 (incomplete - about 27 failing tests at the moment) + +See [Fabric limitations in Old IE](https://github.com/kangax/fabric.js/wiki/Fabric-limitations-in-oldIE). + +Note: to properly make old IE work, you will need to add [html5shiv](https://github.com/aFarkas/html5shiv) as a conditional comment in your HEAD, particularly `html5shiv-printshiv.js` to allow for children elements: + +``` + +``` +Remember to add [Explorer Canvas](http://code.google.com/p/explorercanvas/) as well. + +You can [run automated unit tests](http://fabricjs.com/test/unit/) right in the browser. + +### History + +Fabric.js started as a foundation for design editor on [printio.ru](http://printio.ru) — interactive online store with ability to create your own designs. The idea was to create [Javascript-based editor](http://printio.ru/ringer_man_tees/new), which would make it easy to manipulate vector shapes and images on T-Shirts. Since performance was one of the most critical requirements, we chose canvas over SVG. While SVG is excellent with static shapes, it's not as performant as canvas when it comes to dynamic manipulation of objects (movement, scaling, rotation, etc.). Fabric.js was heavily inspired by [Ernest Delgado's canvas experiment](http://www.ernestdelgado.com/public-tests/canvasphoto/demo/canvas.html). In fact, code from Ernest's experiment was the foundation of an entire framework. Later, Fabric.js grew into a collection of distinct object types and got an SVG-to-canvas parser. + +

Install with bower

+ + $ bower install fabric + +

Install with npm

+To install Fabric.js using npm, you must first manually [install Cairo](http://cairographics.org/download/) on your system. Cairo is a system library which powers node-canvas, which Fabric.js relies on. When the installation is complete, you may need to restart your terminal or command prompt before installing fabric. + + $ npm install fabric --save + +

Building

+ +1. [Install Node.js](https://github.com/joyent/node/wiki/Installation) + +2. Build distribution file **[~77K minified, ~20K gzipped]** + + $ node build.js + + 2.1 Or build a custom distribution file, by passing (comma separated) module names to be included. + + $ node build.js modules=text,serialization,parser + // or + $ node build.js modules=text + // or + $ node build.js modules=parser,text + // etc. + + By default (when none of the modules are specified) only basic functionality is included. + See the list of modules below for more information on each one of them. + Note that default distribution has support for **static canvases** only. + + To get minimal distribution with interactivity, make sure to include corresponding module: + + $ node build.js modules=interaction + + 2.2 You can also include all modules like so: + + $ node build.js modules=ALL + + 2.3 You can exclude a few modules like so: + + $ node build.js modules=ALL exclude=gestures,image_filters + +3. Create a minified distribution file + + # Using YUICompressor (default option) + $ node build.js modules=... minifier=yui + + # or Google Closure Compiler + $ node build.js modules=... minifier=closure + +4. Enable AMD support via require.js (requires uglify) + + $ node build.js requirejs modules=... + +5. Create source map file for better productive debugging (requires uglify or google closure compiler).
More information about [source maps](http://www.html5rocks.com/en/tutorials/developertools/sourcemaps/). + + $ node build.js sourcemap modules=... + + If you use google closure compiler you have to add `sourceMappingURL` manually at the end of the minified file all.min.js (see issue https://code.google.com/p/closure-compiler/issues/detail?id=941). + + //# sourceMappingURL=fabric.min.js.map + +6. Lint source code (prerequisite: `npm -g install jshint`) + + $ jshint src + +7. Ensure code guidelines are met (prerequisite: `npm -g install jscs`) + + $ jscs src + +

Testing

+ +1. [Install Node.js](https://github.com/joyent/node/wiki/Installation) + +2. [Install NPM, if necessary](https://github.com/npm/npm#super-easy-install) + +3. Install NPM packages + + $ npm install + +4. Run test suite + +Make sure testem is installed + + $ npm install -g testem + +Run tests Chrome and Node (by default): + + $ testem + +See testem docs for more info: https://github.com/testem/testem + +### Demos + +- [Demos](http://fabricjs.com/demos/) +- [Kitchensink demo](http://fabricjs.com/kitchensink) +- [Benchmarks](http://fabricjs.com/benchmarks/) + +[Who's using Fabric?](http://trends.builtwith.com/javascript/FabricJS) + +### Documentation + +Documentation is always available at [http://fabricjs.com/docs/](http://fabricjs.com/docs/). + +Also see [official 4-part intro series](http://fabricjs.com/articles), [presentation from BK.js](http://www.slideshare.net/kangax/fabricjs-building-acanvaslibrarybk) and [presentation from Falsy Values](http://www.slideshare.net/kangax/fabric-falsy-values-8067834) for an overview of fabric.js, how it works, and its features. + +### Optional modules + +These are the optional modules that could be specified for inclusion, when building custom version of fabric: + +- **text** — Adds support for static text (`fabric.Text`) +- **itext** — Adds support for interactive text (`fabric.IText`) +- **serialization** — Adds support for `loadFromJSON`, `loadFromDatalessJSON`, and `clone` methods on `fabric.Canvas` +- **interaction** — Adds support for interactive features of fabric — selecting/transforming objects/groups via mouse/touch devices. +- **parser** — Adds support for `fabric.parseSVGDocument`, `fabric.loadSVGFromURL`, and `fabric.loadSVGFromString` +- **image_filters** — Adds support for image filters, such as grayscale of white removal. +- **easing** — Adds support for animation easing functions +- **node** — Adds support for running fabric under node.js, with help of [jsdom](https://github.com/tmpvar/jsdom) and [node-canvas](https://github.com/learnboost/node-canvas) libraries. +- **freedrawing** — Adds support for free drawing +- **gestures** — Adds support for multitouch gestures with help of [Event.js](https://github.com/mudcube/Event.js) +- **object_straightening** — Adds support for rotating an object to one of 0, 90, 180, 270, etc. depending on which is angle is closer. +- **animation** — Adds support for animation (`fabric.util.animate`, `fabric.util.requestAnimFrame`, `fabric.Object#animate`, `fabric.Canvas#fxCenterObjectH/#fxCenterObjectV/#fxRemove`) + +Additional flags for build script are: + +- **requirejs** — Makes fabric requirejs AMD-compatible in `dist/fabric.js`. *Note:* an unminified, requirejs-compatible version is always created in `dist/fabric.require.js` +- **no-strict** — Strips "use strict" directives from source +- **no-svg-export** — Removes svg exporting functionality +- **no-es5-compat** - Removes ES5 compat methods (Array.prototype.*, String.prototype.*, Function.prototype.*) +- **sourcemap** - Generates a sourceMap file and adds the `sourceMappingURL` (only if uglifyjs is used) to `dist/fabric.min.js` + +For example: + + node build.js modules=ALL exclude=json no-strict no-svg-export + +### Examples of use + +#### Adding red rectangle to canvas + +```html + + + + + + + + + + + +``` + +### Helping Fabric + +- [Fabric on Bountysource](https://www.bountysource.com/trackers/23217-fabric-js) +- [Fabric on CodeTriage](http://www.codetriage.com/kangax/fabric.js) + +### Staying in touch + +Follow [@fabric.js](http://twitter.com/fabricjs) or [@kangax](http://twitter.com/kangax) on twitter. + +Questions, suggestions — [fabric.js on Google Groups](http://groups.google.com/group/fabricjs). + +See [Fabric questions on Stackoverflow](http://stackoverflow.com/questions/tagged/fabricjs), +Fabric snippets on [jsfiddle](http://jsfiddle.net/user/fabricjs/fiddles/) +or [codepen.io](http://codepen.io/tag/fabricjs). + +Fabric on [LibKnot](http://libknot.ohmztech.com/). + +Get help in Fabric's IRC channel — irc://irc.freenode.net/#fabric.js + +### Credits + +- Ernest Delgado for the original idea of [manipulating images on canvas](http://www.ernestdelgado.com/archive/canvas/) +- [Maxim "hakunin" Chernyak](http://twitter.com/hakunin) for ideas, and help with various parts of the library throughout its life +- [Sergey Nisnevich](http://nisnya.com) for help with geometry logic +- [Stefan Kienzle](https://twitter.com/kienzle_s) for help with bugs, features, documentation, github issues +- [And all the other GitHub contributors](https://github.com/kangax/fabric.js/graphs/contributors) + +### MIT License + +Copyright (c) 2008-2015 Printio (Juriy Zaytsev, Maxim Chernyak) + +Permission is hereby granted, free of charge, to any person obtaining a copy +of this software and associated documentation files (the "Software"), to deal +in the Software without restriction, including without limitation the rights +to use, copy, modify, merge, publish, distribute, sublicense, and/or sell +copies of the Software, and to permit persons to whom the Software is +furnished to do so, subject to the following conditions: + +THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR +IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, +FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE +AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER +LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, +OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE +SOFTWARE. + + +[![Bitdeli Badge](https://d2weczhvl823v0.cloudfront.net/kangax/fabric.js/trend.png)](https://bitdeli.com/free "Bitdeli Badge") diff --git a/app/bower_components/fabric.js/bower.json b/app/bower_components/fabric.js/bower.json new file mode 100644 index 0000000..01fb598 --- /dev/null +++ b/app/bower_components/fabric.js/bower.json @@ -0,0 +1,31 @@ +{ + "name": "fabric.js", + "homepage": "http://fabricjs.com", + "authors": [ + "kangax", "Kienz", "asturur" + ], + "description": "Object model for HTML5 canvas, and SVG-to-canvas parser. Backed by jsdom and node-canvas.", + "main": "./dist/fabric.min.js", + "ignore": [ + "lib", + "src", + "test", + "build_all", + "build.js", + "build.sh", + "create_build_script.js", + "test.js", + "HEADER.js" + ], + "keywords": [ + "canvas", + "graphic", + "graphics", + "SVG", + "node-canvas", + "parser", + "HTML5", + "object model" + ], + "license": "MIT" +} diff --git a/app/bower_components/fabric.js/dist/fabric.js b/app/bower_components/fabric.js/dist/fabric.js new file mode 100644 index 0000000..9057c32 --- /dev/null +++ b/app/bower_components/fabric.js/dist/fabric.js @@ -0,0 +1,26080 @@ +/* build: `node build.js modules=ALL exclude=json,gestures minifier=uglifyjs` */ +/*! Fabric.js Copyright 2008-2015, Printio (Juriy Zaytsev, Maxim Chernyak) */ + +var fabric = fabric || { version: "1.6.6" }; +if (typeof exports !== 'undefined') { + exports.fabric = fabric; +} + +if (typeof document !== 'undefined' && typeof window !== 'undefined') { + fabric.document = document; + fabric.window = window; + // ensure globality even if entire library were function wrapped (as in Meteor.js packaging system) + window.fabric = fabric; +} +else { + // assume we're running under node.js when document/window are not present + fabric.document = require("jsdom") + .jsdom(""); + + if (fabric.document.createWindow) { + fabric.window = fabric.document.createWindow(); + } else { + fabric.window = fabric.document.parentWindow; + } +} + +/** + * True when in environment that supports touch events + * @type boolean + */ +fabric.isTouchSupported = "ontouchstart" in fabric.document.documentElement; + +/** + * True when in environment that's probably Node.js + * @type boolean + */ +fabric.isLikelyNode = typeof Buffer !== 'undefined' && + typeof window === 'undefined'; + +/* _FROM_SVG_START_ */ +/** + * Attributes parsed from all SVG elements + * @type array + */ +fabric.SHARED_ATTRIBUTES = [ + "display", + "transform", + "fill", "fill-opacity", "fill-rule", + "opacity", + "stroke", "stroke-dasharray", "stroke-linecap", + "stroke-linejoin", "stroke-miterlimit", + "stroke-opacity", "stroke-width", + "id" +]; +/* _FROM_SVG_END_ */ + +/** + * Pixel per Inch as a default value set to 96. Can be changed for more realistic conversion. + */ +fabric.DPI = 96; +fabric.reNum = '(?:[-+]?(?:\\d+|\\d*\\.\\d+)(?:e[-+]?\\d+)?)'; +fabric.fontPaths = { }; + +/** + * Cache Object for widths of chars in text rendering. + */ +fabric.charWidthsCache = { }; + +/** + * Device Pixel Ratio + * @see https://developer.apple.com/library/safari/documentation/AudioVideo/Conceptual/HTML-canvas-guide/SettingUptheCanvas/SettingUptheCanvas.html + */ +fabric.devicePixelRatio = fabric.window.devicePixelRatio || + fabric.window.webkitDevicePixelRatio || + fabric.window.mozDevicePixelRatio || + 1; + + +(function() { + + /** + * @private + * @param {String} eventName + * @param {Function} handler + */ + function _removeEventListener(eventName, handler) { + if (!this.__eventListeners[eventName]) { + return; + } + var eventListener = this.__eventListeners[eventName]; + if (handler) { + eventListener[eventListener.indexOf(handler)] = false; + } + else { + fabric.util.array.fill(eventListener, false); + } + } + + /** + * Observes specified event + * @deprecated `observe` deprecated since 0.8.34 (use `on` instead) + * @memberOf fabric.Observable + * @alias on + * @param {String|Object} eventName Event name (eg. 'after:render') or object with key/value pairs (eg. {'after:render': handler, 'selection:cleared': handler}) + * @param {Function} handler Function that receives a notification when an event of the specified type occurs + * @return {Self} thisArg + * @chainable + */ + function observe(eventName, handler) { + if (!this.__eventListeners) { + this.__eventListeners = { }; + } + // one object with key/value pairs was passed + if (arguments.length === 1) { + for (var prop in eventName) { + this.on(prop, eventName[prop]); + } + } + else { + if (!this.__eventListeners[eventName]) { + this.__eventListeners[eventName] = []; + } + this.__eventListeners[eventName].push(handler); + } + return this; + } + + /** + * Stops event observing for a particular event handler. Calling this method + * without arguments removes all handlers for all events + * @deprecated `stopObserving` deprecated since 0.8.34 (use `off` instead) + * @memberOf fabric.Observable + * @alias off + * @param {String|Object} eventName Event name (eg. 'after:render') or object with key/value pairs (eg. {'after:render': handler, 'selection:cleared': handler}) + * @param {Function} handler Function to be deleted from EventListeners + * @return {Self} thisArg + * @chainable + */ + function stopObserving(eventName, handler) { + if (!this.__eventListeners) { + return; + } + + // remove all key/value pairs (event name -> event handler) + if (arguments.length === 0) { + for (eventName in this.__eventListeners) { + _removeEventListener.call(this, eventName); + } + } + // one object with key/value pairs was passed + else if (arguments.length === 1 && typeof arguments[0] === 'object') { + for (var prop in eventName) { + _removeEventListener.call(this, prop, eventName[prop]); + } + } + else { + _removeEventListener.call(this, eventName, handler); + } + return this; + } + + /** + * Fires event with an optional options object + * @deprecated `fire` deprecated since 1.0.7 (use `trigger` instead) + * @memberOf fabric.Observable + * @alias trigger + * @param {String} eventName Event name to fire + * @param {Object} [options] Options object + * @return {Self} thisArg + * @chainable + */ + function fire(eventName, options) { + if (!this.__eventListeners) { + return; + } + + var listenersForEvent = this.__eventListeners[eventName]; + if (!listenersForEvent) { + return; + } + + for (var i = 0, len = listenersForEvent.length; i < len; i++) { + listenersForEvent[i] && listenersForEvent[i].call(this, options || { }); + } + this.__eventListeners[eventName] = listenersForEvent.filter(function(value) { + return value !== false; + }); + return this; + } + + /** + * @namespace fabric.Observable + * @tutorial {@link http://fabricjs.com/fabric-intro-part-2#events} + * @see {@link http://fabricjs.com/events|Events demo} + */ + fabric.Observable = { + observe: observe, + stopObserving: stopObserving, + fire: fire, + + on: observe, + off: stopObserving, + trigger: fire + }; +})(); + + +/** + * @namespace fabric.Collection + */ +fabric.Collection = { + + _objects: [], + + /** + * Adds objects to collection, Canvas or Group, then renders canvas + * (if `renderOnAddRemove` is not `false`). + * in case of Group no changes to bounding box are made. + * Objects should be instances of (or inherit from) fabric.Object + * @param {...fabric.Object} object Zero or more fabric instances + * @return {Self} thisArg + * @chainable + */ + add: function () { + this._objects.push.apply(this._objects, arguments); + if (this._onObjectAdded) { + for (var i = 0, length = arguments.length; i < length; i++) { + this._onObjectAdded(arguments[i]); + } + } + this.renderOnAddRemove && this.renderAll(); + return this; + }, + + /** + * Inserts an object into collection at specified index, then renders canvas (if `renderOnAddRemove` is not `false`) + * An object should be an instance of (or inherit from) fabric.Object + * @param {Object} object Object to insert + * @param {Number} index Index to insert object at + * @param {Boolean} nonSplicing When `true`, no splicing (shifting) of objects occurs + * @return {Self} thisArg + * @chainable + */ + insertAt: function (object, index, nonSplicing) { + var objects = this.getObjects(); + if (nonSplicing) { + objects[index] = object; + } + else { + objects.splice(index, 0, object); + } + this._onObjectAdded && this._onObjectAdded(object); + this.renderOnAddRemove && this.renderAll(); + return this; + }, + + /** + * Removes objects from a collection, then renders canvas (if `renderOnAddRemove` is not `false`) + * @param {...fabric.Object} object Zero or more fabric instances + * @return {Self} thisArg + * @chainable + */ + remove: function() { + var objects = this.getObjects(), + index, somethingRemoved = false; + + for (var i = 0, length = arguments.length; i < length; i++) { + index = objects.indexOf(arguments[i]); + + // only call onObjectRemoved if an object was actually removed + if (index !== -1) { + somethingRemoved = true; + objects.splice(index, 1); + this._onObjectRemoved && this._onObjectRemoved(arguments[i]); + } + } + + this.renderOnAddRemove && somethingRemoved && this.renderAll(); + return this; + }, + + /** + * Executes given function for each object in this group + * @param {Function} callback + * Callback invoked with current object as first argument, + * index - as second and an array of all objects - as third. + * Callback is invoked in a context of Global Object (e.g. `window`) + * when no `context` argument is given + * + * @param {Object} context Context (aka thisObject) + * @return {Self} thisArg + * @chainable + */ + forEachObject: function(callback, context) { + var objects = this.getObjects(); + for (var i = 0, len = objects.length; i < len; i++) { + callback.call(context, objects[i], i, objects); + } + return this; + }, + + /** + * Returns an array of children objects of this instance + * Type parameter introduced in 1.3.10 + * @param {String} [type] When specified, only objects of this type are returned + * @return {Array} + */ + getObjects: function(type) { + if (typeof type === 'undefined') { + return this._objects; + } + return this._objects.filter(function(o) { + return o.type === type; + }); + }, + + /** + * Returns object at specified index + * @param {Number} index + * @return {Self} thisArg + */ + item: function (index) { + return this.getObjects()[index]; + }, + + /** + * Returns true if collection contains no objects + * @return {Boolean} true if collection is empty + */ + isEmpty: function () { + return this.getObjects().length === 0; + }, + + /** + * Returns a size of a collection (i.e: length of an array containing its objects) + * @return {Number} Collection size + */ + size: function() { + return this.getObjects().length; + }, + + /** + * Returns true if collection contains an object + * @param {Object} object Object to check against + * @return {Boolean} `true` if collection contains an object + */ + contains: function(object) { + return this.getObjects().indexOf(object) > -1; + }, + + /** + * Returns number representation of a collection complexity + * @return {Number} complexity + */ + complexity: function () { + return this.getObjects().reduce(function (memo, current) { + memo += current.complexity ? current.complexity() : 0; + return memo; + }, 0); + } +}; + + +(function(global) { + + var sqrt = Math.sqrt, + atan2 = Math.atan2, + pow = Math.pow, + abs = Math.abs, + PiBy180 = Math.PI / 180; + + /** + * @namespace fabric.util + */ + fabric.util = { + + /** + * Removes value from an array. + * Presence of value (and its position in an array) is determined via `Array.prototype.indexOf` + * @static + * @memberOf fabric.util + * @param {Array} array + * @param {*} value + * @return {Array} original array + */ + removeFromArray: function(array, value) { + var idx = array.indexOf(value); + if (idx !== -1) { + array.splice(idx, 1); + } + return array; + }, + + /** + * Returns random number between 2 specified ones. + * @static + * @memberOf fabric.util + * @param {Number} min lower limit + * @param {Number} max upper limit + * @return {Number} random value (between min and max) + */ + getRandomInt: function(min, max) { + return Math.floor(Math.random() * (max - min + 1)) + min; + }, + + /** + * Transforms degrees to radians. + * @static + * @memberOf fabric.util + * @param {Number} degrees value in degrees + * @return {Number} value in radians + */ + degreesToRadians: function(degrees) { + return degrees * PiBy180; + }, + + /** + * Transforms radians to degrees. + * @static + * @memberOf fabric.util + * @param {Number} radians value in radians + * @return {Number} value in degrees + */ + radiansToDegrees: function(radians) { + return radians / PiBy180; + }, + + /** + * Rotates `point` around `origin` with `radians` + * @static + * @memberOf fabric.util + * @param {fabric.Point} point The point to rotate + * @param {fabric.Point} origin The origin of the rotation + * @param {Number} radians The radians of the angle for the rotation + * @return {fabric.Point} The new rotated point + */ + rotatePoint: function(point, origin, radians) { + point.subtractEquals(origin); + var v = fabric.util.rotateVector(point, radians); + return new fabric.Point(v.x, v.y).addEquals(origin); + }, + + /** + * Rotates `vector` with `radians` + * @static + * @memberOf fabric.util + * @param {Object} vector The vector to rotate (x and y) + * @param {Number} radians The radians of the angle for the rotation + * @return {Object} The new rotated point + */ + rotateVector: function(vector, radians) { + var sin = Math.sin(radians), + cos = Math.cos(radians), + rx = vector.x * cos - vector.y * sin, + ry = vector.x * sin + vector.y * cos; + return { + x: rx, + y: ry + }; + }, + + /** + * Apply transform t to point p + * @static + * @memberOf fabric.util + * @param {fabric.Point} p The point to transform + * @param {Array} t The transform + * @param {Boolean} [ignoreOffset] Indicates that the offset should not be applied + * @return {fabric.Point} The transformed point + */ + transformPoint: function(p, t, ignoreOffset) { + if (ignoreOffset) { + return new fabric.Point( + t[0] * p.x + t[2] * p.y, + t[1] * p.x + t[3] * p.y + ); + } + return new fabric.Point( + t[0] * p.x + t[2] * p.y + t[4], + t[1] * p.x + t[3] * p.y + t[5] + ); + }, + + /** + * Returns coordinates of points's bounding rectangle (left, top, width, height) + * @param {Array} points 4 points array + * @return {Object} Object with left, top, width, height properties + */ + makeBoundingBoxFromPoints: function(points) { + var xPoints = [points[0].x, points[1].x, points[2].x, points[3].x], + minX = fabric.util.array.min(xPoints), + maxX = fabric.util.array.max(xPoints), + width = Math.abs(minX - maxX), + yPoints = [points[0].y, points[1].y, points[2].y, points[3].y], + minY = fabric.util.array.min(yPoints), + maxY = fabric.util.array.max(yPoints), + height = Math.abs(minY - maxY); + + return { + left: minX, + top: minY, + width: width, + height: height + }; + }, + + /** + * Invert transformation t + * @static + * @memberOf fabric.util + * @param {Array} t The transform + * @return {Array} The inverted transform + */ + invertTransform: function(t) { + var a = 1 / (t[0] * t[3] - t[1] * t[2]), + r = [a * t[3], -a * t[1], -a * t[2], a * t[0]], + o = fabric.util.transformPoint({ x: t[4], y: t[5] }, r, true); + r[4] = -o.x; + r[5] = -o.y; + return r; + }, + + /** + * A wrapper around Number#toFixed, which contrary to native method returns number, not string. + * @static + * @memberOf fabric.util + * @param {Number|String} number number to operate on + * @param {Number} fractionDigits number of fraction digits to "leave" + * @return {Number} + */ + toFixed: function(number, fractionDigits) { + return parseFloat(Number(number).toFixed(fractionDigits)); + }, + + /** + * Converts from attribute value to pixel value if applicable. + * Returns converted pixels or original value not converted. + * @param {Number|String} value number to operate on + * @param {Number} fontSize + * @return {Number|String} + */ + parseUnit: function(value, fontSize) { + var unit = /\D{0,2}$/.exec(value), + number = parseFloat(value); + if (!fontSize) { + fontSize = fabric.Text.DEFAULT_SVG_FONT_SIZE; + } + switch (unit[0]) { + case 'mm': + return number * fabric.DPI / 25.4; + + case 'cm': + return number * fabric.DPI / 2.54; + + case 'in': + return number * fabric.DPI; + + case 'pt': + return number * fabric.DPI / 72; // or * 4 / 3 + + case 'pc': + return number * fabric.DPI / 72 * 12; // or * 16 + + case 'em': + return number * fontSize; + + default: + return number; + } + }, + + /** + * Function which always returns `false`. + * @static + * @memberOf fabric.util + * @return {Boolean} + */ + falseFunction: function() { + return false; + }, + + /** + * Returns klass "Class" object of given namespace + * @memberOf fabric.util + * @param {String} type Type of object (eg. 'circle') + * @param {String} namespace Namespace to get klass "Class" object from + * @return {Object} klass "Class" + */ + getKlass: function(type, namespace) { + // capitalize first letter only + type = fabric.util.string.camelize(type.charAt(0).toUpperCase() + type.slice(1)); + return fabric.util.resolveNamespace(namespace)[type]; + }, + + /** + * Returns object of given namespace + * @memberOf fabric.util + * @param {String} namespace Namespace string e.g. 'fabric.Image.filter' or 'fabric' + * @return {Object} Object for given namespace (default fabric) + */ + resolveNamespace: function(namespace) { + if (!namespace) { + return fabric; + } + + var parts = namespace.split('.'), + len = parts.length, i, + obj = global || fabric.window; + + for (i = 0; i < len; ++i) { + obj = obj[parts[i]]; + } + + return obj; + }, + + /** + * Loads image element from given url and passes it to a callback + * @memberOf fabric.util + * @param {String} url URL representing an image + * @param {Function} callback Callback; invoked with loaded image + * @param {*} [context] Context to invoke callback in + * @param {Object} [crossOrigin] crossOrigin value to set image element to + */ + loadImage: function(url, callback, context, crossOrigin) { + if (!url) { + callback && callback.call(context, url); + return; + } + + var img = fabric.util.createImage(); + + /** @ignore */ + img.onload = function () { + callback && callback.call(context, img); + img = img.onload = img.onerror = null; + }; + + /** @ignore */ + img.onerror = function() { + fabric.log('Error loading ' + img.src); + callback && callback.call(context, null, true); + img = img.onload = img.onerror = null; + }; + + // data-urls appear to be buggy with crossOrigin + // https://github.com/kangax/fabric.js/commit/d0abb90f1cd5c5ef9d2a94d3fb21a22330da3e0a#commitcomment-4513767 + // see https://code.google.com/p/chromium/issues/detail?id=315152 + // https://bugzilla.mozilla.org/show_bug.cgi?id=935069 + if (url.indexOf('data') !== 0 && crossOrigin) { + img.crossOrigin = crossOrigin; + } + + img.src = url; + }, + + /** + * Creates corresponding fabric instances from their object representations + * @static + * @memberOf fabric.util + * @param {Array} objects Objects to enliven + * @param {Function} callback Callback to invoke when all objects are created + * @param {String} namespace Namespace to get klass "Class" object from + * @param {Function} reviver Method for further parsing of object elements, + * called after each fabric object created. + */ + enlivenObjects: function(objects, callback, namespace, reviver) { + objects = objects || []; + + function onLoaded() { + if (++numLoadedObjects === numTotalObjects) { + callback && callback(enlivenedObjects); + } + } + + var enlivenedObjects = [], + numLoadedObjects = 0, + numTotalObjects = objects.length; + + if (!numTotalObjects) { + callback && callback(enlivenedObjects); + return; + } + + objects.forEach(function (o, index) { + // if sparse array + if (!o || !o.type) { + onLoaded(); + return; + } + var klass = fabric.util.getKlass(o.type, namespace); + if (klass.async) { + klass.fromObject(o, function (obj, error) { + if (!error) { + enlivenedObjects[index] = obj; + reviver && reviver(o, enlivenedObjects[index]); + } + onLoaded(); + }); + } + else { + enlivenedObjects[index] = klass.fromObject(o); + reviver && reviver(o, enlivenedObjects[index]); + onLoaded(); + } + }); + }, + + /** + * Groups SVG elements (usually those retrieved from SVG document) + * @static + * @memberOf fabric.util + * @param {Array} elements SVG elements to group + * @param {Object} [options] Options object + * @param {String} path Value to set sourcePath to + * @return {fabric.Object|fabric.PathGroup} + */ + groupSVGElements: function(elements, options, path) { + var object; + + object = new fabric.PathGroup(elements, options); + + if (typeof path !== 'undefined') { + object.setSourcePath(path); + } + return object; + }, + + /** + * Populates an object with properties of another object + * @static + * @memberOf fabric.util + * @param {Object} source Source object + * @param {Object} destination Destination object + * @return {Array} properties Propertie names to include + */ + populateWithProperties: function(source, destination, properties) { + if (properties && Object.prototype.toString.call(properties) === '[object Array]') { + for (var i = 0, len = properties.length; i < len; i++) { + if (properties[i] in source) { + destination[properties[i]] = source[properties[i]]; + } + } + } + }, + + /** + * Draws a dashed line between two points + * + * This method is used to draw dashed line around selection area. + * See dotted stroke in canvas + * + * @param {CanvasRenderingContext2D} ctx context + * @param {Number} x start x coordinate + * @param {Number} y start y coordinate + * @param {Number} x2 end x coordinate + * @param {Number} y2 end y coordinate + * @param {Array} da dash array pattern + */ + drawDashedLine: function(ctx, x, y, x2, y2, da) { + var dx = x2 - x, + dy = y2 - y, + len = sqrt(dx * dx + dy * dy), + rot = atan2(dy, dx), + dc = da.length, + di = 0, + draw = true; + + ctx.save(); + ctx.translate(x, y); + ctx.moveTo(0, 0); + ctx.rotate(rot); + + x = 0; + while (len > x) { + x += da[di++ % dc]; + if (x > len) { + x = len; + } + ctx[draw ? 'lineTo' : 'moveTo'](x, 0); + draw = !draw; + } + + ctx.restore(); + }, + + /** + * Creates canvas element and initializes it via excanvas if necessary + * @static + * @memberOf fabric.util + * @param {CanvasElement} [canvasEl] optional canvas element to initialize; + * when not given, element is created implicitly + * @return {CanvasElement} initialized canvas element + */ + createCanvasElement: function(canvasEl) { + canvasEl || (canvasEl = fabric.document.createElement('canvas')); + /* eslint-disable camelcase */ + if (!canvasEl.getContext && typeof G_vmlCanvasManager !== 'undefined') { + G_vmlCanvasManager.initElement(canvasEl); + } + /* eslint-enable camelcase */ + return canvasEl; + }, + + /** + * Creates image element (works on client and node) + * @static + * @memberOf fabric.util + * @return {HTMLImageElement} HTML image element + */ + createImage: function() { + return fabric.isLikelyNode + ? new (require('canvas').Image)() + : fabric.document.createElement('img'); + }, + + /** + * Creates accessors (getXXX, setXXX) for a "class", based on "stateProperties" array + * @static + * @memberOf fabric.util + * @param {Object} klass "Class" to create accessors for + */ + createAccessors: function(klass) { + var proto = klass.prototype, i, propName, + capitalizedPropName, setterName, getterName; + + for (i = proto.stateProperties.length; i--; ) { + + propName = proto.stateProperties[i]; + capitalizedPropName = propName.charAt(0).toUpperCase() + propName.slice(1); + setterName = 'set' + capitalizedPropName; + getterName = 'get' + capitalizedPropName; + + // using `new Function` for better introspection + if (!proto[getterName]) { + proto[getterName] = (function(property) { + return new Function('return this.get("' + property + '")'); + })(propName); + } + if (!proto[setterName]) { + proto[setterName] = (function(property) { + return new Function('value', 'return this.set("' + property + '", value)'); + })(propName); + } + } + }, + + /** + * @static + * @memberOf fabric.util + * @param {fabric.Object} receiver Object implementing `clipTo` method + * @param {CanvasRenderingContext2D} ctx Context to clip + */ + clipContext: function(receiver, ctx) { + ctx.save(); + ctx.beginPath(); + receiver.clipTo(ctx); + ctx.clip(); + }, + + /** + * Multiply matrix A by matrix B to nest transformations + * @static + * @memberOf fabric.util + * @param {Array} a First transformMatrix + * @param {Array} b Second transformMatrix + * @param {Boolean} is2x2 flag to multiply matrices as 2x2 matrices + * @return {Array} The product of the two transform matrices + */ + multiplyTransformMatrices: function(a, b, is2x2) { + // Matrix multiply a * b + return [ + a[0] * b[0] + a[2] * b[1], + a[1] * b[0] + a[3] * b[1], + a[0] * b[2] + a[2] * b[3], + a[1] * b[2] + a[3] * b[3], + is2x2 ? 0 : a[0] * b[4] + a[2] * b[5] + a[4], + is2x2 ? 0 : a[1] * b[4] + a[3] * b[5] + a[5] + ]; + }, + + /** + * Decomposes standard 2x2 matrix into transform componentes + * @static + * @memberOf fabric.util + * @param {Array} a transformMatrix + * @return {Object} Components of transform + */ + qrDecompose: function(a) { + var angle = atan2(a[1], a[0]), + denom = pow(a[0], 2) + pow(a[1], 2), + scaleX = sqrt(denom), + scaleY = (a[0] * a[3] - a[2] * a [1]) / scaleX, + skewX = atan2(a[0] * a[2] + a[1] * a [3], denom); + return { + angle: angle / PiBy180, + scaleX: scaleX, + scaleY: scaleY, + skewX: skewX / PiBy180, + skewY: 0, + translateX: a[4], + translateY: a[5] + }; + }, + + customTransformMatrix: function(scaleX, scaleY, skewX) { + var skewMatrixX = [1, 0, abs(Math.tan(skewX * PiBy180)), 1], + scaleMatrix = [abs(scaleX), 0, 0, abs(scaleY)]; + return fabric.util.multiplyTransformMatrices(scaleMatrix, skewMatrixX, true); + }, + + resetObjectTransform: function (target) { + target.scaleX = 1; + target.scaleY = 1; + target.skewX = 0; + target.skewY = 0; + target.flipX = false; + target.flipY = false; + target.setAngle(0); + }, + + /** + * Returns string representation of function body + * @param {Function} fn Function to get body of + * @return {String} Function body + */ + getFunctionBody: function(fn) { + return (String(fn).match(/function[^{]*\{([\s\S]*)\}/) || {})[1]; + }, + + /** + * Returns true if context has transparent pixel + * at specified location (taking tolerance into account) + * @param {CanvasRenderingContext2D} ctx context + * @param {Number} x x coordinate + * @param {Number} y y coordinate + * @param {Number} tolerance Tolerance + */ + isTransparent: function(ctx, x, y, tolerance) { + + // If tolerance is > 0 adjust start coords to take into account. + // If moves off Canvas fix to 0 + if (tolerance > 0) { + if (x > tolerance) { + x -= tolerance; + } + else { + x = 0; + } + if (y > tolerance) { + y -= tolerance; + } + else { + y = 0; + } + } + + var _isTransparent = true, i, temp, + imageData = ctx.getImageData(x, y, (tolerance * 2) || 1, (tolerance * 2) || 1), + l = imageData.data.length; + + // Split image data - for tolerance > 1, pixelDataSize = 4; + for (i = 3; i < l; i += 4) { + temp = imageData.data[i]; + _isTransparent = temp <= 0; + if (_isTransparent === false) { + break; // Stop if colour found + } + } + + imageData = null; + + return _isTransparent; + }, + + /** + * Parse preserveAspectRatio attribute from element + * @param {string} attribute to be parsed + * @return {Object} an object containing align and meetOrSlice attribute + */ + parsePreserveAspectRatioAttribute: function(attribute) { + var meetOrSlice = 'meet', alignX = 'Mid', alignY = 'Mid', + aspectRatioAttrs = attribute.split(' '), align; + + if (aspectRatioAttrs && aspectRatioAttrs.length) { + meetOrSlice = aspectRatioAttrs.pop(); + if (meetOrSlice !== 'meet' && meetOrSlice !== 'slice') { + align = meetOrSlice; + meetOrSlice = 'meet'; + } + else if (aspectRatioAttrs.length) { + align = aspectRatioAttrs.pop(); + } + } + //divide align in alignX and alignY + alignX = align !== 'none' ? align.slice(1, 4) : 'none'; + alignY = align !== 'none' ? align.slice(5, 8) : 'none'; + return { + meetOrSlice: meetOrSlice, + alignX: alignX, + alignY: alignY + }; + }, + + /** + * Clear char widths cache for a font family. + * @memberOf fabric.util + * @param {String} [fontFamily] font family to clear + */ + clearFabricFontCache: function(fontFamily) { + if (!fontFamily) { + fabric.charWidthsCache = { }; + } + else if (fabric.charWidthsCache[fontFamily]) { + delete fabric.charWidthsCache[fontFamily]; + } + } + }; + +})(typeof exports !== 'undefined' ? exports : this); + + +(function() { + + var arcToSegmentsCache = { }, + segmentToBezierCache = { }, + boundsOfCurveCache = { }, + _join = Array.prototype.join; + + /* Adapted from http://dxr.mozilla.org/mozilla-central/source/content/svg/content/src/nsSVGPathDataParser.cpp + * by Andrea Bogazzi code is under MPL. if you don't have a copy of the license you can take it here + * http://mozilla.org/MPL/2.0/ + */ + function arcToSegments(toX, toY, rx, ry, large, sweep, rotateX) { + var argsString = _join.call(arguments); + if (arcToSegmentsCache[argsString]) { + return arcToSegmentsCache[argsString]; + } + + var PI = Math.PI, th = rotateX * PI / 180, + sinTh = Math.sin(th), + cosTh = Math.cos(th), + fromX = 0, fromY = 0; + + rx = Math.abs(rx); + ry = Math.abs(ry); + + var px = -cosTh * toX * 0.5 - sinTh * toY * 0.5, + py = -cosTh * toY * 0.5 + sinTh * toX * 0.5, + rx2 = rx * rx, ry2 = ry * ry, py2 = py * py, px2 = px * px, + pl = rx2 * ry2 - rx2 * py2 - ry2 * px2, + root = 0; + + if (pl < 0) { + var s = Math.sqrt(1 - pl / (rx2 * ry2)); + rx *= s; + ry *= s; + } + else { + root = (large === sweep ? -1.0 : 1.0) * + Math.sqrt( pl / (rx2 * py2 + ry2 * px2)); + } + + var cx = root * rx * py / ry, + cy = -root * ry * px / rx, + cx1 = cosTh * cx - sinTh * cy + toX * 0.5, + cy1 = sinTh * cx + cosTh * cy + toY * 0.5, + mTheta = calcVectorAngle(1, 0, (px - cx) / rx, (py - cy) / ry), + dtheta = calcVectorAngle((px - cx) / rx, (py - cy) / ry, (-px - cx) / rx, (-py - cy) / ry); + + if (sweep === 0 && dtheta > 0) { + dtheta -= 2 * PI; + } + else if (sweep === 1 && dtheta < 0) { + dtheta += 2 * PI; + } + + // Convert into cubic bezier segments <= 90deg + var segments = Math.ceil(Math.abs(dtheta / PI * 2)), + result = [], mDelta = dtheta / segments, + mT = 8 / 3 * Math.sin(mDelta / 4) * Math.sin(mDelta / 4) / Math.sin(mDelta / 2), + th3 = mTheta + mDelta; + + for (var i = 0; i < segments; i++) { + result[i] = segmentToBezier(mTheta, th3, cosTh, sinTh, rx, ry, cx1, cy1, mT, fromX, fromY); + fromX = result[i][4]; + fromY = result[i][5]; + mTheta = th3; + th3 += mDelta; + } + arcToSegmentsCache[argsString] = result; + return result; + } + + function segmentToBezier(th2, th3, cosTh, sinTh, rx, ry, cx1, cy1, mT, fromX, fromY) { + var argsString2 = _join.call(arguments); + if (segmentToBezierCache[argsString2]) { + return segmentToBezierCache[argsString2]; + } + + var costh2 = Math.cos(th2), + sinth2 = Math.sin(th2), + costh3 = Math.cos(th3), + sinth3 = Math.sin(th3), + toX = cosTh * rx * costh3 - sinTh * ry * sinth3 + cx1, + toY = sinTh * rx * costh3 + cosTh * ry * sinth3 + cy1, + cp1X = fromX + mT * ( -cosTh * rx * sinth2 - sinTh * ry * costh2), + cp1Y = fromY + mT * ( -sinTh * rx * sinth2 + cosTh * ry * costh2), + cp2X = toX + mT * ( cosTh * rx * sinth3 + sinTh * ry * costh3), + cp2Y = toY + mT * ( sinTh * rx * sinth3 - cosTh * ry * costh3); + + segmentToBezierCache[argsString2] = [ + cp1X, cp1Y, + cp2X, cp2Y, + toX, toY + ]; + return segmentToBezierCache[argsString2]; + } + + /* + * Private + */ + function calcVectorAngle(ux, uy, vx, vy) { + var ta = Math.atan2(uy, ux), + tb = Math.atan2(vy, vx); + if (tb >= ta) { + return tb - ta; + } + else { + return 2 * Math.PI - (ta - tb); + } + } + + /** + * Draws arc + * @param {CanvasRenderingContext2D} ctx + * @param {Number} fx + * @param {Number} fy + * @param {Array} coords + */ + fabric.util.drawArc = function(ctx, fx, fy, coords) { + var rx = coords[0], + ry = coords[1], + rot = coords[2], + large = coords[3], + sweep = coords[4], + tx = coords[5], + ty = coords[6], + segs = [[], [], [], []], + segsNorm = arcToSegments(tx - fx, ty - fy, rx, ry, large, sweep, rot); + + for (var i = 0, len = segsNorm.length; i < len; i++) { + segs[i][0] = segsNorm[i][0] + fx; + segs[i][1] = segsNorm[i][1] + fy; + segs[i][2] = segsNorm[i][2] + fx; + segs[i][3] = segsNorm[i][3] + fy; + segs[i][4] = segsNorm[i][4] + fx; + segs[i][5] = segsNorm[i][5] + fy; + ctx.bezierCurveTo.apply(ctx, segs[i]); + } + }; + + /** + * Calculate bounding box of a elliptic-arc + * @param {Number} fx start point of arc + * @param {Number} fy + * @param {Number} rx horizontal radius + * @param {Number} ry vertical radius + * @param {Number} rot angle of horizontal axe + * @param {Number} large 1 or 0, whatever the arc is the big or the small on the 2 points + * @param {Number} sweep 1 or 0, 1 clockwise or counterclockwise direction + * @param {Number} tx end point of arc + * @param {Number} ty + */ + fabric.util.getBoundsOfArc = function(fx, fy, rx, ry, rot, large, sweep, tx, ty) { + + var fromX = 0, fromY = 0, bound, bounds = [], + segs = arcToSegments(tx - fx, ty - fy, rx, ry, large, sweep, rot); + + for (var i = 0, len = segs.length; i < len; i++) { + bound = getBoundsOfCurve(fromX, fromY, segs[i][0], segs[i][1], segs[i][2], segs[i][3], segs[i][4], segs[i][5]); + bounds.push({ x: bound[0].x + fx, y: bound[0].y + fy }); + bounds.push({ x: bound[1].x + fx, y: bound[1].y + fy }); + fromX = segs[i][4]; + fromY = segs[i][5]; + } + return bounds; + }; + + /** + * Calculate bounding box of a beziercurve + * @param {Number} x0 starting point + * @param {Number} y0 + * @param {Number} x1 first control point + * @param {Number} y1 + * @param {Number} x2 secondo control point + * @param {Number} y2 + * @param {Number} x3 end of beizer + * @param {Number} y3 + */ + // taken from http://jsbin.com/ivomiq/56/edit no credits available for that. + function getBoundsOfCurve(x0, y0, x1, y1, x2, y2, x3, y3) { + var argsString = _join.call(arguments); + if (boundsOfCurveCache[argsString]) { + return boundsOfCurveCache[argsString]; + } + + var sqrt = Math.sqrt, + min = Math.min, max = Math.max, + abs = Math.abs, tvalues = [], + bounds = [[], []], + a, b, c, t, t1, t2, b2ac, sqrtb2ac; + + b = 6 * x0 - 12 * x1 + 6 * x2; + a = -3 * x0 + 9 * x1 - 9 * x2 + 3 * x3; + c = 3 * x1 - 3 * x0; + + for (var i = 0; i < 2; ++i) { + if (i > 0) { + b = 6 * y0 - 12 * y1 + 6 * y2; + a = -3 * y0 + 9 * y1 - 9 * y2 + 3 * y3; + c = 3 * y1 - 3 * y0; + } + + if (abs(a) < 1e-12) { + if (abs(b) < 1e-12) { + continue; + } + t = -c / b; + if (0 < t && t < 1) { + tvalues.push(t); + } + continue; + } + b2ac = b * b - 4 * c * a; + if (b2ac < 0) { + continue; + } + sqrtb2ac = sqrt(b2ac); + t1 = (-b + sqrtb2ac) / (2 * a); + if (0 < t1 && t1 < 1) { + tvalues.push(t1); + } + t2 = (-b - sqrtb2ac) / (2 * a); + if (0 < t2 && t2 < 1) { + tvalues.push(t2); + } + } + + var x, y, j = tvalues.length, jlen = j, mt; + while (j--) { + t = tvalues[j]; + mt = 1 - t; + x = (mt * mt * mt * x0) + (3 * mt * mt * t * x1) + (3 * mt * t * t * x2) + (t * t * t * x3); + bounds[0][j] = x; + + y = (mt * mt * mt * y0) + (3 * mt * mt * t * y1) + (3 * mt * t * t * y2) + (t * t * t * y3); + bounds[1][j] = y; + } + + bounds[0][jlen] = x0; + bounds[1][jlen] = y0; + bounds[0][jlen + 1] = x3; + bounds[1][jlen + 1] = y3; + var result = [ + { + x: min.apply(null, bounds[0]), + y: min.apply(null, bounds[1]) + }, + { + x: max.apply(null, bounds[0]), + y: max.apply(null, bounds[1]) + } + ]; + boundsOfCurveCache[argsString] = result; + return result; + } + + fabric.util.getBoundsOfCurve = getBoundsOfCurve; + +})(); + + +(function() { + + var slice = Array.prototype.slice; + + /* _ES5_COMPAT_START_ */ + + if (!Array.prototype.indexOf) { + /** + * Finds index of an element in an array + * @param {*} searchElement + * @return {Number} + */ + Array.prototype.indexOf = function (searchElement /*, fromIndex */ ) { + if (this === void 0 || this === null) { + throw new TypeError(); + } + var t = Object(this), len = t.length >>> 0; + if (len === 0) { + return -1; + } + var n = 0; + if (arguments.length > 0) { + n = Number(arguments[1]); + if (n !== n) { // shortcut for verifying if it's NaN + n = 0; + } + else if (n !== 0 && n !== Number.POSITIVE_INFINITY && n !== Number.NEGATIVE_INFINITY) { + n = (n > 0 || -1) * Math.floor(Math.abs(n)); + } + } + if (n >= len) { + return -1; + } + var k = n >= 0 ? n : Math.max(len - Math.abs(n), 0); + for (; k < len; k++) { + if (k in t && t[k] === searchElement) { + return k; + } + } + return -1; + }; + } + + if (!Array.prototype.forEach) { + /** + * Iterates an array, invoking callback for each element + * @param {Function} fn Callback to invoke for each element + * @param {Object} [context] Context to invoke callback in + * @return {Array} + */ + Array.prototype.forEach = function(fn, context) { + for (var i = 0, len = this.length >>> 0; i < len; i++) { + if (i in this) { + fn.call(context, this[i], i, this); + } + } + }; + } + + if (!Array.prototype.map) { + /** + * Returns a result of iterating over an array, invoking callback for each element + * @param {Function} fn Callback to invoke for each element + * @param {Object} [context] Context to invoke callback in + * @return {Array} + */ + Array.prototype.map = function(fn, context) { + var result = []; + for (var i = 0, len = this.length >>> 0; i < len; i++) { + if (i in this) { + result[i] = fn.call(context, this[i], i, this); + } + } + return result; + }; + } + + if (!Array.prototype.every) { + /** + * Returns true if a callback returns truthy value for all elements in an array + * @param {Function} fn Callback to invoke for each element + * @param {Object} [context] Context to invoke callback in + * @return {Boolean} + */ + Array.prototype.every = function(fn, context) { + for (var i = 0, len = this.length >>> 0; i < len; i++) { + if (i in this && !fn.call(context, this[i], i, this)) { + return false; + } + } + return true; + }; + } + + if (!Array.prototype.some) { + /** + * Returns true if a callback returns truthy value for at least one element in an array + * @param {Function} fn Callback to invoke for each element + * @param {Object} [context] Context to invoke callback in + * @return {Boolean} + */ + Array.prototype.some = function(fn, context) { + for (var i = 0, len = this.length >>> 0; i < len; i++) { + if (i in this && fn.call(context, this[i], i, this)) { + return true; + } + } + return false; + }; + } + + if (!Array.prototype.filter) { + /** + * Returns the result of iterating over elements in an array + * @param {Function} fn Callback to invoke for each element + * @param {Object} [context] Context to invoke callback in + * @return {Array} + */ + Array.prototype.filter = function(fn, context) { + var result = [], val; + for (var i = 0, len = this.length >>> 0; i < len; i++) { + if (i in this) { + val = this[i]; // in case fn mutates this + if (fn.call(context, val, i, this)) { + result.push(val); + } + } + } + return result; + }; + } + + if (!Array.prototype.reduce) { + /** + * Returns "folded" (reduced) result of iterating over elements in an array + * @param {Function} fn Callback to invoke for each element + * @return {*} + */ + Array.prototype.reduce = function(fn /*, initial*/) { + var len = this.length >>> 0, + i = 0, + rv; + + if (arguments.length > 1) { + rv = arguments[1]; + } + else { + do { + if (i in this) { + rv = this[i++]; + break; + } + // if array contains no values, no initial value to return + if (++i >= len) { + throw new TypeError(); + } + } + while (true); + } + for (; i < len; i++) { + if (i in this) { + rv = fn.call(null, rv, this[i], i, this); + } + } + return rv; + }; + } + + /* _ES5_COMPAT_END_ */ + + /** + * Invokes method on all items in a given array + * @memberOf fabric.util.array + * @param {Array} array Array to iterate over + * @param {String} method Name of a method to invoke + * @return {Array} + */ + function invoke(array, method) { + var args = slice.call(arguments, 2), result = []; + for (var i = 0, len = array.length; i < len; i++) { + result[i] = args.length ? array[i][method].apply(array[i], args) : array[i][method].call(array[i]); + } + return result; + } + + /** + * Finds maximum value in array (not necessarily "first" one) + * @memberOf fabric.util.array + * @param {Array} array Array to iterate over + * @param {String} byProperty + * @return {*} + */ + function max(array, byProperty) { + return find(array, byProperty, function(value1, value2) { + return value1 >= value2; + }); + } + + /** + * Finds minimum value in array (not necessarily "first" one) + * @memberOf fabric.util.array + * @param {Array} array Array to iterate over + * @param {String} byProperty + * @return {*} + */ + function min(array, byProperty) { + return find(array, byProperty, function(value1, value2) { + return value1 < value2; + }); + } + + /** + * @private + */ + function fill(array, value) { + var k = array.length; + while (k--) { + array[k] = value; + } + return array; + } + + /** + * @private + */ + function find(array, byProperty, condition) { + if (!array || array.length === 0) { + return; + } + + var i = array.length - 1, + result = byProperty ? array[i][byProperty] : array[i]; + if (byProperty) { + while (i--) { + if (condition(array[i][byProperty], result)) { + result = array[i][byProperty]; + } + } + } + else { + while (i--) { + if (condition(array[i], result)) { + result = array[i]; + } + } + } + return result; + } + + /** + * @namespace fabric.util.array + */ + fabric.util.array = { + fill: fill, + invoke: invoke, + min: min, + max: max + }; + +})(); + + +(function() { + /** + * Copies all enumerable properties of one object to another + * @memberOf fabric.util.object + * @param {Object} destination Where to copy to + * @param {Object} source Where to copy from + * @return {Object} + */ + + function extend(destination, source, deep) { + // JScript DontEnum bug is not taken care of + // the deep clone is for internal use, is not meant to avoid + // javascript traps or cloning html element or self referenced objects. + if (deep) { + if (!fabric.isLikelyNode && source instanceof Element) { + // avoid cloning deep images, canvases, + destination = source; + } + else if (source instanceof Array) { + destination = source.map(function(v) { + return clone(v, deep) + }) + } + else if (source instanceof Object) { + for (var property in source) { + destination[property] = clone(source[property], deep) + } + } + else { + // this sounds odd for an extend but is ok for recursive use + destination = source; + } + } + else { + for (var property in source) { + destination[property] = source[property]; + } + } + return destination; + } + + /** + * Creates an empty object and copies all enumerable properties of another object to it + * @memberOf fabric.util.object + * @param {Object} object Object to clone + * @return {Object} + */ + function clone(object, deep) { + return extend({ }, object, deep); + } + + /** @namespace fabric.util.object */ + fabric.util.object = { + extend: extend, + clone: clone + }; + +})(); + + +(function() { + + /* _ES5_COMPAT_START_ */ + if (!String.prototype.trim) { + /** + * Trims a string (removing whitespace from the beginning and the end) + * @function external:String#trim + * @see String#trim on MDN + */ + String.prototype.trim = function () { + // this trim is not fully ES3 or ES5 compliant, but it should cover most cases for now + return this.replace(/^[\s\xA0]+/, '').replace(/[\s\xA0]+$/, ''); + }; + } + /* _ES5_COMPAT_END_ */ + + /** + * Camelizes a string + * @memberOf fabric.util.string + * @param {String} string String to camelize + * @return {String} Camelized version of a string + */ + function camelize(string) { + return string.replace(/-+(.)?/g, function(match, character) { + return character ? character.toUpperCase() : ''; + }); + } + + /** + * Capitalizes a string + * @memberOf fabric.util.string + * @param {String} string String to capitalize + * @param {Boolean} [firstLetterOnly] If true only first letter is capitalized + * and other letters stay untouched, if false first letter is capitalized + * and other letters are converted to lowercase. + * @return {String} Capitalized version of a string + */ + function capitalize(string, firstLetterOnly) { + return string.charAt(0).toUpperCase() + + (firstLetterOnly ? string.slice(1) : string.slice(1).toLowerCase()); + } + + /** + * Escapes XML in a string + * @memberOf fabric.util.string + * @param {String} string String to escape + * @return {String} Escaped version of a string + */ + function escapeXml(string) { + return string.replace(/&/g, '&') + .replace(/"/g, '"') + .replace(/'/g, ''') + .replace(//g, '>'); + } + + /** + * String utilities + * @namespace fabric.util.string + */ + fabric.util.string = { + camelize: camelize, + capitalize: capitalize, + escapeXml: escapeXml + }; +})(); + + +/* _ES5_COMPAT_START_ */ +(function() { + + var slice = Array.prototype.slice, + apply = Function.prototype.apply, + Dummy = function() { }; + + if (!Function.prototype.bind) { + /** + * Cross-browser approximation of ES5 Function.prototype.bind (not fully spec conforming) + * @see Function#bind on MDN + * @param {Object} thisArg Object to bind function to + * @param {Any[]} Values to pass to a bound function + * @return {Function} + */ + Function.prototype.bind = function(thisArg) { + var _this = this, args = slice.call(arguments, 1), bound; + if (args.length) { + bound = function() { + return apply.call(_this, this instanceof Dummy ? this : thisArg, args.concat(slice.call(arguments))); + }; + } + else { + /** @ignore */ + bound = function() { + return apply.call(_this, this instanceof Dummy ? this : thisArg, arguments); + }; + } + Dummy.prototype = this.prototype; + bound.prototype = new Dummy(); + + return bound; + }; + } + +})(); +/* _ES5_COMPAT_END_ */ + + +(function() { + + var slice = Array.prototype.slice, emptyFunction = function() { }, + + IS_DONTENUM_BUGGY = (function() { + for (var p in { toString: 1 }) { + if (p === 'toString') { + return false; + } + } + return true; + })(), + + /** @ignore */ + addMethods = function(klass, source, parent) { + for (var property in source) { + + if (property in klass.prototype && + typeof klass.prototype[property] === 'function' && + (source[property] + '').indexOf('callSuper') > -1) { + + klass.prototype[property] = (function(property) { + return function() { + + var superclass = this.constructor.superclass; + this.constructor.superclass = parent; + var returnValue = source[property].apply(this, arguments); + this.constructor.superclass = superclass; + + if (property !== 'initialize') { + return returnValue; + } + }; + })(property); + } + else { + klass.prototype[property] = source[property]; + } + + if (IS_DONTENUM_BUGGY) { + if (source.toString !== Object.prototype.toString) { + klass.prototype.toString = source.toString; + } + if (source.valueOf !== Object.prototype.valueOf) { + klass.prototype.valueOf = source.valueOf; + } + } + } + }; + + function Subclass() { } + + function callSuper(methodName) { + var fn = this.constructor.superclass.prototype[methodName]; + return (arguments.length > 1) + ? fn.apply(this, slice.call(arguments, 1)) + : fn.call(this); + } + + /** + * Helper for creation of "classes". + * @memberOf fabric.util + * @param {Function} [parent] optional "Class" to inherit from + * @param {Object} [properties] Properties shared by all instances of this class + * (be careful modifying objects defined here as this would affect all instances) + */ + function createClass() { + var parent = null, + properties = slice.call(arguments, 0); + + if (typeof properties[0] === 'function') { + parent = properties.shift(); + } + function klass() { + this.initialize.apply(this, arguments); + } + + klass.superclass = parent; + klass.subclasses = []; + + if (parent) { + Subclass.prototype = parent.prototype; + klass.prototype = new Subclass(); + parent.subclasses.push(klass); + } + for (var i = 0, length = properties.length; i < length; i++) { + addMethods(klass, properties[i], parent); + } + if (!klass.prototype.initialize) { + klass.prototype.initialize = emptyFunction; + } + klass.prototype.constructor = klass; + klass.prototype.callSuper = callSuper; + return klass; + } + + fabric.util.createClass = createClass; +})(); + + +(function () { + + var unknown = 'unknown'; + + /* EVENT HANDLING */ + + function areHostMethods(object) { + var methodNames = Array.prototype.slice.call(arguments, 1), + t, i, len = methodNames.length; + for (i = 0; i < len; i++) { + t = typeof object[methodNames[i]]; + if (!(/^(?:function|object|unknown)$/).test(t)) { + return false; + } + } + return true; + } + + /** @ignore */ + var getElement, + setElement, + getUniqueId = (function () { + var uid = 0; + return function (element) { + return element.__uniqueID || (element.__uniqueID = 'uniqueID__' + uid++); + }; + })(); + + (function () { + var elements = { }; + /** @ignore */ + getElement = function (uid) { + return elements[uid]; + }; + /** @ignore */ + setElement = function (uid, element) { + elements[uid] = element; + }; + })(); + + function createListener(uid, handler) { + return { + handler: handler, + wrappedHandler: createWrappedHandler(uid, handler) + }; + } + + function createWrappedHandler(uid, handler) { + return function (e) { + handler.call(getElement(uid), e || fabric.window.event); + }; + } + + function createDispatcher(uid, eventName) { + return function (e) { + if (handlers[uid] && handlers[uid][eventName]) { + var handlersForEvent = handlers[uid][eventName]; + for (var i = 0, len = handlersForEvent.length; i < len; i++) { + handlersForEvent[i].call(this, e || fabric.window.event); + } + } + }; + } + + var shouldUseAddListenerRemoveListener = ( + areHostMethods(fabric.document.documentElement, 'addEventListener', 'removeEventListener') && + areHostMethods(fabric.window, 'addEventListener', 'removeEventListener')), + + shouldUseAttachEventDetachEvent = ( + areHostMethods(fabric.document.documentElement, 'attachEvent', 'detachEvent') && + areHostMethods(fabric.window, 'attachEvent', 'detachEvent')), + + // IE branch + listeners = { }, + + // DOM L0 branch + handlers = { }, + + addListener, removeListener; + + if (shouldUseAddListenerRemoveListener) { + /** @ignore */ + addListener = function (element, eventName, handler) { + element.addEventListener(eventName, handler, false); + }; + /** @ignore */ + removeListener = function (element, eventName, handler) { + element.removeEventListener(eventName, handler, false); + }; + } + + else if (shouldUseAttachEventDetachEvent) { + /** @ignore */ + addListener = function (element, eventName, handler) { + var uid = getUniqueId(element); + setElement(uid, element); + if (!listeners[uid]) { + listeners[uid] = { }; + } + if (!listeners[uid][eventName]) { + listeners[uid][eventName] = []; + + } + var listener = createListener(uid, handler); + listeners[uid][eventName].push(listener); + element.attachEvent('on' + eventName, listener.wrappedHandler); + }; + /** @ignore */ + removeListener = function (element, eventName, handler) { + var uid = getUniqueId(element), listener; + if (listeners[uid] && listeners[uid][eventName]) { + for (var i = 0, len = listeners[uid][eventName].length; i < len; i++) { + listener = listeners[uid][eventName][i]; + if (listener && listener.handler === handler) { + element.detachEvent('on' + eventName, listener.wrappedHandler); + listeners[uid][eventName][i] = null; + } + } + } + }; + } + else { + /** @ignore */ + addListener = function (element, eventName, handler) { + var uid = getUniqueId(element); + if (!handlers[uid]) { + handlers[uid] = { }; + } + if (!handlers[uid][eventName]) { + handlers[uid][eventName] = []; + var existingHandler = element['on' + eventName]; + if (existingHandler) { + handlers[uid][eventName].push(existingHandler); + } + element['on' + eventName] = createDispatcher(uid, eventName); + } + handlers[uid][eventName].push(handler); + }; + /** @ignore */ + removeListener = function (element, eventName, handler) { + var uid = getUniqueId(element); + if (handlers[uid] && handlers[uid][eventName]) { + var handlersForEvent = handlers[uid][eventName]; + for (var i = 0, len = handlersForEvent.length; i < len; i++) { + if (handlersForEvent[i] === handler) { + handlersForEvent.splice(i, 1); + } + } + } + }; + } + + /** + * Adds an event listener to an element + * @function + * @memberOf fabric.util + * @param {HTMLElement} element + * @param {String} eventName + * @param {Function} handler + */ + fabric.util.addListener = addListener; + + /** + * Removes an event listener from an element + * @function + * @memberOf fabric.util + * @param {HTMLElement} element + * @param {String} eventName + * @param {Function} handler + */ + fabric.util.removeListener = removeListener; + + /** + * Cross-browser wrapper for getting event's coordinates + * @memberOf fabric.util + * @param {Event} event Event object + */ + function getPointer(event) { + event || (event = fabric.window.event); + + var element = event.target || + (typeof event.srcElement !== unknown ? event.srcElement : null), + + scroll = fabric.util.getScrollLeftTop(element); + + return { + x: pointerX(event) + scroll.left, + y: pointerY(event) + scroll.top + }; + } + + var pointerX = function(event) { + // looks like in IE (<9) clientX at certain point (apparently when mouseup fires on VML element) + // is represented as COM object, with all the consequences, like "unknown" type and error on [[Get]] + // need to investigate later + return (typeof event.clientX !== unknown ? event.clientX : 0); + }, + + pointerY = function(event) { + return (typeof event.clientY !== unknown ? event.clientY : 0); + }; + + function _getPointer(event, pageProp, clientProp) { + var touchProp = event.type === 'touchend' ? 'changedTouches' : 'touches'; + + return (event[touchProp] && event[touchProp][0] + ? (event[touchProp][0][pageProp] - (event[touchProp][0][pageProp] - event[touchProp][0][clientProp])) + || event[clientProp] + : event[clientProp]); + } + + if (fabric.isTouchSupported) { + pointerX = function(event) { + return _getPointer(event, 'pageX', 'clientX'); + }; + pointerY = function(event) { + return _getPointer(event, 'pageY', 'clientY'); + }; + } + + fabric.util.getPointer = getPointer; + + fabric.util.object.extend(fabric.util, fabric.Observable); + +})(); + + +(function () { + + /** + * Cross-browser wrapper for setting element's style + * @memberOf fabric.util + * @param {HTMLElement} element + * @param {Object} styles + * @return {HTMLElement} Element that was passed as a first argument + */ + function setStyle(element, styles) { + var elementStyle = element.style; + if (!elementStyle) { + return element; + } + if (typeof styles === 'string') { + element.style.cssText += ';' + styles; + return styles.indexOf('opacity') > -1 + ? setOpacity(element, styles.match(/opacity:\s*(\d?\.?\d*)/)[1]) + : element; + } + for (var property in styles) { + if (property === 'opacity') { + setOpacity(element, styles[property]); + } + else { + var normalizedProperty = (property === 'float' || property === 'cssFloat') + ? (typeof elementStyle.styleFloat === 'undefined' ? 'cssFloat' : 'styleFloat') + : property; + elementStyle[normalizedProperty] = styles[property]; + } + } + return element; + } + + var parseEl = fabric.document.createElement('div'), + supportsOpacity = typeof parseEl.style.opacity === 'string', + supportsFilters = typeof parseEl.style.filter === 'string', + reOpacity = /alpha\s*\(\s*opacity\s*=\s*([^\)]+)\)/, + + /** @ignore */ + setOpacity = function (element) { return element; }; + + if (supportsOpacity) { + /** @ignore */ + setOpacity = function(element, value) { + element.style.opacity = value; + return element; + }; + } + else if (supportsFilters) { + /** @ignore */ + setOpacity = function(element, value) { + var es = element.style; + if (element.currentStyle && !element.currentStyle.hasLayout) { + es.zoom = 1; + } + if (reOpacity.test(es.filter)) { + value = value >= 0.9999 ? '' : ('alpha(opacity=' + (value * 100) + ')'); + es.filter = es.filter.replace(reOpacity, value); + } + else { + es.filter += ' alpha(opacity=' + (value * 100) + ')'; + } + return element; + }; + } + + fabric.util.setStyle = setStyle; + +})(); + + +(function() { + + var _slice = Array.prototype.slice; + + /** + * Takes id and returns an element with that id (if one exists in a document) + * @memberOf fabric.util + * @param {String|HTMLElement} id + * @return {HTMLElement|null} + */ + function getById(id) { + return typeof id === 'string' ? fabric.document.getElementById(id) : id; + } + + var sliceCanConvertNodelists, + /** + * Converts an array-like object (e.g. arguments or NodeList) to an array + * @memberOf fabric.util + * @param {Object} arrayLike + * @return {Array} + */ + toArray = function(arrayLike) { + return _slice.call(arrayLike, 0); + }; + + try { + sliceCanConvertNodelists = toArray(fabric.document.childNodes) instanceof Array; + } + catch (err) { } + + if (!sliceCanConvertNodelists) { + toArray = function(arrayLike) { + var arr = new Array(arrayLike.length), i = arrayLike.length; + while (i--) { + arr[i] = arrayLike[i]; + } + return arr; + }; + } + + /** + * Creates specified element with specified attributes + * @memberOf fabric.util + * @param {String} tagName Type of an element to create + * @param {Object} [attributes] Attributes to set on an element + * @return {HTMLElement} Newly created element + */ + function makeElement(tagName, attributes) { + var el = fabric.document.createElement(tagName); + for (var prop in attributes) { + if (prop === 'class') { + el.className = attributes[prop]; + } + else if (prop === 'for') { + el.htmlFor = attributes[prop]; + } + else { + el.setAttribute(prop, attributes[prop]); + } + } + return el; + } + + /** + * Adds class to an element + * @memberOf fabric.util + * @param {HTMLElement} element Element to add class to + * @param {String} className Class to add to an element + */ + function addClass(element, className) { + if (element && (' ' + element.className + ' ').indexOf(' ' + className + ' ') === -1) { + element.className += (element.className ? ' ' : '') + className; + } + } + + /** + * Wraps element with another element + * @memberOf fabric.util + * @param {HTMLElement} element Element to wrap + * @param {HTMLElement|String} wrapper Element to wrap with + * @param {Object} [attributes] Attributes to set on a wrapper + * @return {HTMLElement} wrapper + */ + function wrapElement(element, wrapper, attributes) { + if (typeof wrapper === 'string') { + wrapper = makeElement(wrapper, attributes); + } + if (element.parentNode) { + element.parentNode.replaceChild(wrapper, element); + } + wrapper.appendChild(element); + return wrapper; + } + + /** + * Returns element scroll offsets + * @memberOf fabric.util + * @param {HTMLElement} element Element to operate on + * @return {Object} Object with left/top values + */ + function getScrollLeftTop(element) { + + var left = 0, + top = 0, + docElement = fabric.document.documentElement, + body = fabric.document.body || { + scrollLeft: 0, scrollTop: 0 + }; + + // While loop checks (and then sets element to) .parentNode OR .host + // to account for ShadowDOM. We still want to traverse up out of ShadowDOM, + // but the .parentNode of a root ShadowDOM node will always be null, instead + // it should be accessed through .host. See http://stackoverflow.com/a/24765528/4383938 + while (element && (element.parentNode || element.host)) { + + // Set element to element parent, or 'host' in case of ShadowDOM + element = element.parentNode || element.host; + + if (element === fabric.document) { + left = body.scrollLeft || docElement.scrollLeft || 0; + top = body.scrollTop || docElement.scrollTop || 0; + } + else { + left += element.scrollLeft || 0; + top += element.scrollTop || 0; + } + + if (element.nodeType === 1 && + fabric.util.getElementStyle(element, 'position') === 'fixed') { + break; + } + } + + return { left: left, top: top }; + } + + /** + * Returns offset for a given element + * @function + * @memberOf fabric.util + * @param {HTMLElement} element Element to get offset for + * @return {Object} Object with "left" and "top" properties + */ + function getElementOffset(element) { + var docElem, + doc = element && element.ownerDocument, + box = { left: 0, top: 0 }, + offset = { left: 0, top: 0 }, + scrollLeftTop, + offsetAttributes = { + borderLeftWidth: 'left', + borderTopWidth: 'top', + paddingLeft: 'left', + paddingTop: 'top' + }; + + if (!doc) { + return offset; + } + + for (var attr in offsetAttributes) { + offset[offsetAttributes[attr]] += parseInt(getElementStyle(element, attr), 10) || 0; + } + + docElem = doc.documentElement; + if ( typeof element.getBoundingClientRect !== 'undefined' ) { + box = element.getBoundingClientRect(); + } + + scrollLeftTop = getScrollLeftTop(element); + + return { + left: box.left + scrollLeftTop.left - (docElem.clientLeft || 0) + offset.left, + top: box.top + scrollLeftTop.top - (docElem.clientTop || 0) + offset.top + }; + } + + /** + * Returns style attribute value of a given element + * @memberOf fabric.util + * @param {HTMLElement} element Element to get style attribute for + * @param {String} attr Style attribute to get for element + * @return {String} Style attribute value of the given element. + */ + var getElementStyle; + if (fabric.document.defaultView && fabric.document.defaultView.getComputedStyle) { + getElementStyle = function(element, attr) { + var style = fabric.document.defaultView.getComputedStyle(element, null); + return style ? style[attr] : undefined; + }; + } + else { + getElementStyle = function(element, attr) { + var value = element.style[attr]; + if (!value && element.currentStyle) { + value = element.currentStyle[attr]; + } + return value; + }; + } + + (function () { + var style = fabric.document.documentElement.style, + selectProp = 'userSelect' in style + ? 'userSelect' + : 'MozUserSelect' in style + ? 'MozUserSelect' + : 'WebkitUserSelect' in style + ? 'WebkitUserSelect' + : 'KhtmlUserSelect' in style + ? 'KhtmlUserSelect' + : ''; + + /** + * Makes element unselectable + * @memberOf fabric.util + * @param {HTMLElement} element Element to make unselectable + * @return {HTMLElement} Element that was passed in + */ + function makeElementUnselectable(element) { + if (typeof element.onselectstart !== 'undefined') { + element.onselectstart = fabric.util.falseFunction; + } + if (selectProp) { + element.style[selectProp] = 'none'; + } + else if (typeof element.unselectable === 'string') { + element.unselectable = 'on'; + } + return element; + } + + /** + * Makes element selectable + * @memberOf fabric.util + * @param {HTMLElement} element Element to make selectable + * @return {HTMLElement} Element that was passed in + */ + function makeElementSelectable(element) { + if (typeof element.onselectstart !== 'undefined') { + element.onselectstart = null; + } + if (selectProp) { + element.style[selectProp] = ''; + } + else if (typeof element.unselectable === 'string') { + element.unselectable = ''; + } + return element; + } + + fabric.util.makeElementUnselectable = makeElementUnselectable; + fabric.util.makeElementSelectable = makeElementSelectable; + })(); + + (function() { + + /** + * Inserts a script element with a given url into a document; invokes callback, when that script is finished loading + * @memberOf fabric.util + * @param {String} url URL of a script to load + * @param {Function} callback Callback to execute when script is finished loading + */ + function getScript(url, callback) { + var headEl = fabric.document.getElementsByTagName('head')[0], + scriptEl = fabric.document.createElement('script'), + loading = true; + + /** @ignore */ + scriptEl.onload = /** @ignore */ scriptEl.onreadystatechange = function(e) { + if (loading) { + if (typeof this.readyState === 'string' && + this.readyState !== 'loaded' && + this.readyState !== 'complete') { + return; + } + loading = false; + callback(e || fabric.window.event); + scriptEl = scriptEl.onload = scriptEl.onreadystatechange = null; + } + }; + scriptEl.src = url; + headEl.appendChild(scriptEl); + // causes issue in Opera + // headEl.removeChild(scriptEl); + } + + fabric.util.getScript = getScript; + })(); + + fabric.util.getById = getById; + fabric.util.toArray = toArray; + fabric.util.makeElement = makeElement; + fabric.util.addClass = addClass; + fabric.util.wrapElement = wrapElement; + fabric.util.getScrollLeftTop = getScrollLeftTop; + fabric.util.getElementOffset = getElementOffset; + fabric.util.getElementStyle = getElementStyle; + +})(); + + +(function() { + + function addParamToUrl(url, param) { + return url + (/\?/.test(url) ? '&' : '?') + param; + } + + var makeXHR = (function() { + var factories = [ + function() { return new ActiveXObject('Microsoft.XMLHTTP'); }, + function() { return new ActiveXObject('Msxml2.XMLHTTP'); }, + function() { return new ActiveXObject('Msxml2.XMLHTTP.3.0'); }, + function() { return new XMLHttpRequest(); } + ]; + for (var i = factories.length; i--; ) { + try { + var req = factories[i](); + if (req) { + return factories[i]; + } + } + catch (err) { } + } + })(); + + function emptyFn() { } + + /** + * Cross-browser abstraction for sending XMLHttpRequest + * @memberOf fabric.util + * @param {String} url URL to send XMLHttpRequest to + * @param {Object} [options] Options object + * @param {String} [options.method="GET"] + * @param {String} [options.parameters] parameters to append to url in GET or in body + * @param {String} [options.body] body to send with POST or PUT request + * @param {Function} options.onComplete Callback to invoke when request is completed + * @return {XMLHttpRequest} request + */ + function request(url, options) { + + options || (options = { }); + + var method = options.method ? options.method.toUpperCase() : 'GET', + onComplete = options.onComplete || function() { }, + xhr = makeXHR(), + body = options.body || options.parameters; + + /** @ignore */ + xhr.onreadystatechange = function() { + if (xhr.readyState === 4) { + onComplete(xhr); + xhr.onreadystatechange = emptyFn; + } + }; + + if (method === 'GET') { + body = null; + if (typeof options.parameters === 'string') { + url = addParamToUrl(url, options.parameters); + } + } + + xhr.open(method, url, true); + + if (method === 'POST' || method === 'PUT') { + xhr.setRequestHeader('Content-Type', 'application/x-www-form-urlencoded'); + } + + xhr.send(body); + return xhr; + } + + fabric.util.request = request; +})(); + + +/** + * Wrapper around `console.log` (when available) + * @param {*} [values] Values to log + */ +fabric.log = function() { }; + +/** + * Wrapper around `console.warn` (when available) + * @param {*} [values] Values to log as a warning + */ +fabric.warn = function() { }; + +/* eslint-disable */ +if (typeof console !== 'undefined') { + + ['log', 'warn'].forEach(function(methodName) { + + if (typeof console[methodName] !== 'undefined' && + typeof console[methodName].apply === 'function') { + + fabric[methodName] = function() { + return console[methodName].apply(console, arguments); + }; + } + }); +} +/* eslint-enable */ + + +(function() { + + /** + * Changes value from one to another within certain period of time, invoking callbacks as value is being changed. + * @memberOf fabric.util + * @param {Object} [options] Animation options + * @param {Function} [options.onChange] Callback; invoked on every value change + * @param {Function} [options.onComplete] Callback; invoked when value change is completed + * @param {Number} [options.startValue=0] Starting value + * @param {Number} [options.endValue=100] Ending value + * @param {Number} [options.byValue=100] Value to modify the property by + * @param {Function} [options.easing] Easing function + * @param {Number} [options.duration=500] Duration of change (in ms) + */ + function animate(options) { + + requestAnimFrame(function(timestamp) { + options || (options = { }); + + var start = timestamp || +new Date(), + duration = options.duration || 500, + finish = start + duration, time, + onChange = options.onChange || function() { }, + abort = options.abort || function() { return false; }, + easing = options.easing || function(t, b, c, d) {return -c * Math.cos(t / d * (Math.PI / 2)) + c + b;}, + startValue = 'startValue' in options ? options.startValue : 0, + endValue = 'endValue' in options ? options.endValue : 100, + byValue = options.byValue || endValue - startValue; + + options.onStart && options.onStart(); + + (function tick(ticktime) { + time = ticktime || +new Date(); + var currentTime = time > finish ? duration : (time - start); + if (abort()) { + options.onComplete && options.onComplete(); + return; + } + onChange(easing(currentTime, startValue, byValue, duration)); + if (time > finish) { + options.onComplete && options.onComplete(); + return; + } + requestAnimFrame(tick); + })(start); + }); + + } + + var _requestAnimFrame = fabric.window.requestAnimationFrame || + fabric.window.webkitRequestAnimationFrame || + fabric.window.mozRequestAnimationFrame || + fabric.window.oRequestAnimationFrame || + fabric.window.msRequestAnimationFrame || + function(callback) { + fabric.window.setTimeout(callback, 1000 / 60); + }; + + /** + * requestAnimationFrame polyfill based on http://paulirish.com/2011/requestanimationframe-for-smart-animating/ + * In order to get a precise start time, `requestAnimFrame` should be called as an entry into the method + * @memberOf fabric.util + * @param {Function} callback Callback to invoke + * @param {DOMElement} element optional Element to associate with animation + */ + function requestAnimFrame() { + return _requestAnimFrame.apply(fabric.window, arguments); + } + + fabric.util.animate = animate; + fabric.util.requestAnimFrame = requestAnimFrame; + +})(); + + +(function() { + + function normalize(a, c, p, s) { + if (a < Math.abs(c)) { + a = c; + s = p / 4; + } + else { + //handle the 0/0 case: + if (c === 0 && a === 0) { + s = p / (2 * Math.PI) * Math.asin(1); + } + else { + s = p / (2 * Math.PI) * Math.asin(c / a); + } + } + return { a: a, c: c, p: p, s: s }; + } + + function elastic(opts, t, d) { + return opts.a * + Math.pow(2, 10 * (t -= 1)) * + Math.sin( (t * d - opts.s) * (2 * Math.PI) / opts.p ); + } + + /** + * Cubic easing out + * @memberOf fabric.util.ease + */ + function easeOutCubic(t, b, c, d) { + return c * ((t = t / d - 1) * t * t + 1) + b; + } + + /** + * Cubic easing in and out + * @memberOf fabric.util.ease + */ + function easeInOutCubic(t, b, c, d) { + t /= d / 2; + if (t < 1) { + return c / 2 * t * t * t + b; + } + return c / 2 * ((t -= 2) * t * t + 2) + b; + } + + /** + * Quartic easing in + * @memberOf fabric.util.ease + */ + function easeInQuart(t, b, c, d) { + return c * (t /= d) * t * t * t + b; + } + + /** + * Quartic easing out + * @memberOf fabric.util.ease + */ + function easeOutQuart(t, b, c, d) { + return -c * ((t = t / d - 1) * t * t * t - 1) + b; + } + + /** + * Quartic easing in and out + * @memberOf fabric.util.ease + */ + function easeInOutQuart(t, b, c, d) { + t /= d / 2; + if (t < 1) { + return c / 2 * t * t * t * t + b; + } + return -c / 2 * ((t -= 2) * t * t * t - 2) + b; + } + + /** + * Quintic easing in + * @memberOf fabric.util.ease + */ + function easeInQuint(t, b, c, d) { + return c * (t /= d) * t * t * t * t + b; + } + + /** + * Quintic easing out + * @memberOf fabric.util.ease + */ + function easeOutQuint(t, b, c, d) { + return c * ((t = t / d - 1) * t * t * t * t + 1) + b; + } + + /** + * Quintic easing in and out + * @memberOf fabric.util.ease + */ + function easeInOutQuint(t, b, c, d) { + t /= d / 2; + if (t < 1) { + return c / 2 * t * t * t * t * t + b; + } + return c / 2 * ((t -= 2) * t * t * t * t + 2) + b; + } + + /** + * Sinusoidal easing in + * @memberOf fabric.util.ease + */ + function easeInSine(t, b, c, d) { + return -c * Math.cos(t / d * (Math.PI / 2)) + c + b; + } + + /** + * Sinusoidal easing out + * @memberOf fabric.util.ease + */ + function easeOutSine(t, b, c, d) { + return c * Math.sin(t / d * (Math.PI / 2)) + b; + } + + /** + * Sinusoidal easing in and out + * @memberOf fabric.util.ease + */ + function easeInOutSine(t, b, c, d) { + return -c / 2 * (Math.cos(Math.PI * t / d) - 1) + b; + } + + /** + * Exponential easing in + * @memberOf fabric.util.ease + */ + function easeInExpo(t, b, c, d) { + return (t === 0) ? b : c * Math.pow(2, 10 * (t / d - 1)) + b; + } + + /** + * Exponential easing out + * @memberOf fabric.util.ease + */ + function easeOutExpo(t, b, c, d) { + return (t === d) ? b + c : c * (-Math.pow(2, -10 * t / d) + 1) + b; + } + + /** + * Exponential easing in and out + * @memberOf fabric.util.ease + */ + function easeInOutExpo(t, b, c, d) { + if (t === 0) { + return b; + } + if (t === d) { + return b + c; + } + t /= d / 2; + if (t < 1) { + return c / 2 * Math.pow(2, 10 * (t - 1)) + b; + } + return c / 2 * (-Math.pow(2, -10 * --t) + 2) + b; + } + + /** + * Circular easing in + * @memberOf fabric.util.ease + */ + function easeInCirc(t, b, c, d) { + return -c * (Math.sqrt(1 - (t /= d) * t) - 1) + b; + } + + /** + * Circular easing out + * @memberOf fabric.util.ease + */ + function easeOutCirc(t, b, c, d) { + return c * Math.sqrt(1 - (t = t / d - 1) * t) + b; + } + + /** + * Circular easing in and out + * @memberOf fabric.util.ease + */ + function easeInOutCirc(t, b, c, d) { + t /= d / 2; + if (t < 1) { + return -c / 2 * (Math.sqrt(1 - t * t) - 1) + b; + } + return c / 2 * (Math.sqrt(1 - (t -= 2) * t) + 1) + b; + } + + /** + * Elastic easing in + * @memberOf fabric.util.ease + */ + function easeInElastic(t, b, c, d) { + var s = 1.70158, p = 0, a = c; + if (t === 0) { + return b; + } + t /= d; + if (t === 1) { + return b + c; + } + if (!p) { + p = d * 0.3; + } + var opts = normalize(a, c, p, s); + return -elastic(opts, t, d) + b; + } + + /** + * Elastic easing out + * @memberOf fabric.util.ease + */ + function easeOutElastic(t, b, c, d) { + var s = 1.70158, p = 0, a = c; + if (t === 0) { + return b; + } + t /= d; + if (t === 1) { + return b + c; + } + if (!p) { + p = d * 0.3; + } + var opts = normalize(a, c, p, s); + return opts.a * Math.pow(2, -10 * t) * Math.sin((t * d - opts.s) * (2 * Math.PI) / opts.p ) + opts.c + b; + } + + /** + * Elastic easing in and out + * @memberOf fabric.util.ease + */ + function easeInOutElastic(t, b, c, d) { + var s = 1.70158, p = 0, a = c; + if (t === 0) { + return b; + } + t /= d / 2; + if (t === 2) { + return b + c; + } + if (!p) { + p = d * (0.3 * 1.5); + } + var opts = normalize(a, c, p, s); + if (t < 1) { + return -0.5 * elastic(opts, t, d) + b; + } + return opts.a * Math.pow(2, -10 * (t -= 1)) * + Math.sin((t * d - opts.s) * (2 * Math.PI) / opts.p ) * 0.5 + opts.c + b; + } + + /** + * Backwards easing in + * @memberOf fabric.util.ease + */ + function easeInBack(t, b, c, d, s) { + if (s === undefined) { + s = 1.70158; + } + return c * (t /= d) * t * ((s + 1) * t - s) + b; + } + + /** + * Backwards easing out + * @memberOf fabric.util.ease + */ + function easeOutBack(t, b, c, d, s) { + if (s === undefined) { + s = 1.70158; + } + return c * ((t = t / d - 1) * t * ((s + 1) * t + s) + 1) + b; + } + + /** + * Backwards easing in and out + * @memberOf fabric.util.ease + */ + function easeInOutBack(t, b, c, d, s) { + if (s === undefined) { + s = 1.70158; + } + t /= d / 2; + if (t < 1) { + return c / 2 * (t * t * (((s *= (1.525)) + 1) * t - s)) + b; + } + return c / 2 * ((t -= 2) * t * (((s *= (1.525)) + 1) * t + s) + 2) + b; + } + + /** + * Bouncing easing in + * @memberOf fabric.util.ease + */ + function easeInBounce(t, b, c, d) { + return c - easeOutBounce (d - t, 0, c, d) + b; + } + + /** + * Bouncing easing out + * @memberOf fabric.util.ease + */ + function easeOutBounce(t, b, c, d) { + if ((t /= d) < (1 / 2.75)) { + return c * (7.5625 * t * t) + b; + } + else if (t < (2 / 2.75)) { + return c * (7.5625 * (t -= (1.5 / 2.75)) * t + 0.75) + b; + } + else if (t < (2.5 / 2.75)) { + return c * (7.5625 * (t -= (2.25 / 2.75)) * t + 0.9375) + b; + } + else { + return c * (7.5625 * (t -= (2.625 / 2.75)) * t + 0.984375) + b; + } + } + + /** + * Bouncing easing in and out + * @memberOf fabric.util.ease + */ + function easeInOutBounce(t, b, c, d) { + if (t < d / 2) { + return easeInBounce (t * 2, 0, c, d) * 0.5 + b; + } + return easeOutBounce(t * 2 - d, 0, c, d) * 0.5 + c * 0.5 + b; + } + + /** + * Easing functions + * See Easing Equations by Robert Penner + * @namespace fabric.util.ease + */ + fabric.util.ease = { + + /** + * Quadratic easing in + * @memberOf fabric.util.ease + */ + easeInQuad: function(t, b, c, d) { + return c * (t /= d) * t + b; + }, + + /** + * Quadratic easing out + * @memberOf fabric.util.ease + */ + easeOutQuad: function(t, b, c, d) { + return -c * (t /= d) * (t - 2) + b; + }, + + /** + * Quadratic easing in and out + * @memberOf fabric.util.ease + */ + easeInOutQuad: function(t, b, c, d) { + t /= (d / 2); + if (t < 1) { + return c / 2 * t * t + b; + } + return -c / 2 * ((--t) * (t - 2) - 1) + b; + }, + + /** + * Cubic easing in + * @memberOf fabric.util.ease + */ + easeInCubic: function(t, b, c, d) { + return c * (t /= d) * t * t + b; + }, + + easeOutCubic: easeOutCubic, + easeInOutCubic: easeInOutCubic, + easeInQuart: easeInQuart, + easeOutQuart: easeOutQuart, + easeInOutQuart: easeInOutQuart, + easeInQuint: easeInQuint, + easeOutQuint: easeOutQuint, + easeInOutQuint: easeInOutQuint, + easeInSine: easeInSine, + easeOutSine: easeOutSine, + easeInOutSine: easeInOutSine, + easeInExpo: easeInExpo, + easeOutExpo: easeOutExpo, + easeInOutExpo: easeInOutExpo, + easeInCirc: easeInCirc, + easeOutCirc: easeOutCirc, + easeInOutCirc: easeInOutCirc, + easeInElastic: easeInElastic, + easeOutElastic: easeOutElastic, + easeInOutElastic: easeInOutElastic, + easeInBack: easeInBack, + easeOutBack: easeOutBack, + easeInOutBack: easeInOutBack, + easeInBounce: easeInBounce, + easeOutBounce: easeOutBounce, + easeInOutBounce: easeInOutBounce + }; + +})(); + + +(function(global) { + + 'use strict'; + + /** + * @name fabric + * @namespace + */ + + var fabric = global.fabric || (global.fabric = { }), + extend = fabric.util.object.extend, + capitalize = fabric.util.string.capitalize, + clone = fabric.util.object.clone, + toFixed = fabric.util.toFixed, + parseUnit = fabric.util.parseUnit, + multiplyTransformMatrices = fabric.util.multiplyTransformMatrices, + + reAllowedSVGTagNames = /^(path|circle|polygon|polyline|ellipse|rect|line|image|text)$/i, + reViewBoxTagNames = /^(symbol|image|marker|pattern|view|svg)$/i, + reNotAllowedAncestors = /^(?:pattern|defs|symbol|metadata)$/i, + reAllowedParents = /^(symbol|g|a|svg)$/i, + + attributesMap = { + cx: 'left', + x: 'left', + r: 'radius', + cy: 'top', + y: 'top', + display: 'visible', + visibility: 'visible', + transform: 'transformMatrix', + 'fill-opacity': 'fillOpacity', + 'fill-rule': 'fillRule', + 'font-family': 'fontFamily', + 'font-size': 'fontSize', + 'font-style': 'fontStyle', + 'font-weight': 'fontWeight', + 'stroke-dasharray': 'strokeDashArray', + 'stroke-linecap': 'strokeLineCap', + 'stroke-linejoin': 'strokeLineJoin', + 'stroke-miterlimit': 'strokeMiterLimit', + 'stroke-opacity': 'strokeOpacity', + 'stroke-width': 'strokeWidth', + 'text-decoration': 'textDecoration', + 'text-anchor': 'originX' + }, + + colorAttributes = { + stroke: 'strokeOpacity', + fill: 'fillOpacity' + }; + + fabric.cssRules = { }; + fabric.gradientDefs = { }; + + function normalizeAttr(attr) { + // transform attribute names + if (attr in attributesMap) { + return attributesMap[attr]; + } + return attr; + } + + function normalizeValue(attr, value, parentAttributes, fontSize) { + var isArray = Object.prototype.toString.call(value) === '[object Array]', + parsed; + + if ((attr === 'fill' || attr === 'stroke') && value === 'none') { + value = ''; + } + else if (attr === 'strokeDashArray') { + value = value.replace(/,/g, ' ').split(/\s+/).map(function(n) { + return parseFloat(n); + }); + } + else if (attr === 'transformMatrix') { + if (parentAttributes && parentAttributes.transformMatrix) { + value = multiplyTransformMatrices( + parentAttributes.transformMatrix, fabric.parseTransformAttribute(value)); + } + else { + value = fabric.parseTransformAttribute(value); + } + } + else if (attr === 'visible') { + value = (value === 'none' || value === 'hidden') ? false : true; + // display=none on parent element always takes precedence over child element + if (parentAttributes && parentAttributes.visible === false) { + value = false; + } + } + else if (attr === 'originX' /* text-anchor */) { + value = value === 'start' ? 'left' : value === 'end' ? 'right' : 'center'; + } + else { + parsed = isArray ? value.map(parseUnit) : parseUnit(value, fontSize); + } + + return (!isArray && isNaN(parsed) ? value : parsed); + } + + /** + * @private + * @param {Object} attributes Array of attributes to parse + */ + function _setStrokeFillOpacity(attributes) { + for (var attr in colorAttributes) { + + if (typeof attributes[colorAttributes[attr]] === 'undefined' || attributes[attr] === '') { + continue; + } + + if (typeof attributes[attr] === 'undefined') { + if (!fabric.Object.prototype[attr]) { + continue; + } + attributes[attr] = fabric.Object.prototype[attr]; + } + + if (attributes[attr].indexOf('url(') === 0) { + continue; + } + + var color = new fabric.Color(attributes[attr]); + attributes[attr] = color.setAlpha(toFixed(color.getAlpha() * attributes[colorAttributes[attr]], 2)).toRgba(); + } + return attributes; + } + + /** + * @private + */ + function _getMultipleNodes(doc, nodeNames) { + var nodeName, nodeArray = [], nodeList; + for (var i = 0; i < nodeNames.length; i++) { + nodeName = nodeNames[i]; + nodeList = doc.getElementsByTagName(nodeName); + nodeArray = nodeArray.concat(Array.prototype.slice.call(nodeList)); + } + return nodeArray; + } + + /** + * Parses "transform" attribute, returning an array of values + * @static + * @function + * @memberOf fabric + * @param {String} attributeValue String containing attribute value + * @return {Array} Array of 6 elements representing transformation matrix + */ + fabric.parseTransformAttribute = (function() { + function rotateMatrix(matrix, args) { + var angle = args[0], + x = (args.length === 3) ? args[1] : 0, + y = (args.length === 3) ? args[2] : 0; + + matrix[0] = Math.cos(angle); + matrix[1] = Math.sin(angle); + matrix[2] = -Math.sin(angle); + matrix[3] = Math.cos(angle); + matrix[4] = x - (matrix[0] * x + matrix[2] * y); + matrix[5] = y - (matrix[1] * x + matrix[3] * y); + } + + function scaleMatrix(matrix, args) { + var multiplierX = args[0], + multiplierY = (args.length === 2) ? args[1] : args[0]; + + matrix[0] = multiplierX; + matrix[3] = multiplierY; + } + + function skewXMatrix(matrix, args) { + matrix[2] = Math.tan(fabric.util.degreesToRadians(args[0])); + } + + function skewYMatrix(matrix, args) { + matrix[1] = Math.tan(fabric.util.degreesToRadians(args[0])); + } + + function translateMatrix(matrix, args) { + matrix[4] = args[0]; + if (args.length === 2) { + matrix[5] = args[1]; + } + } + + // identity matrix + var iMatrix = [ + 1, // a + 0, // b + 0, // c + 1, // d + 0, // e + 0 // f + ], + + // == begin transform regexp + number = fabric.reNum, + + commaWsp = '(?:\\s+,?\\s*|,\\s*)', + + skewX = '(?:(skewX)\\s*\\(\\s*(' + number + ')\\s*\\))', + + skewY = '(?:(skewY)\\s*\\(\\s*(' + number + ')\\s*\\))', + + rotate = '(?:(rotate)\\s*\\(\\s*(' + number + ')(?:' + + commaWsp + '(' + number + ')' + + commaWsp + '(' + number + '))?\\s*\\))', + + scale = '(?:(scale)\\s*\\(\\s*(' + number + ')(?:' + + commaWsp + '(' + number + '))?\\s*\\))', + + translate = '(?:(translate)\\s*\\(\\s*(' + number + ')(?:' + + commaWsp + '(' + number + '))?\\s*\\))', + + matrix = '(?:(matrix)\\s*\\(\\s*' + + '(' + number + ')' + commaWsp + + '(' + number + ')' + commaWsp + + '(' + number + ')' + commaWsp + + '(' + number + ')' + commaWsp + + '(' + number + ')' + commaWsp + + '(' + number + ')' + + '\\s*\\))', + + transform = '(?:' + + matrix + '|' + + translate + '|' + + scale + '|' + + rotate + '|' + + skewX + '|' + + skewY + + ')', + + transforms = '(?:' + transform + '(?:' + commaWsp + '*' + transform + ')*' + ')', + + transformList = '^\\s*(?:' + transforms + '?)\\s*$', + + // http://www.w3.org/TR/SVG/coords.html#TransformAttribute + reTransformList = new RegExp(transformList), + // == end transform regexp + + reTransform = new RegExp(transform, 'g'); + + return function(attributeValue) { + + // start with identity matrix + var matrix = iMatrix.concat(), + matrices = []; + + // return if no argument was given or + // an argument does not match transform attribute regexp + if (!attributeValue || (attributeValue && !reTransformList.test(attributeValue))) { + return matrix; + } + + attributeValue.replace(reTransform, function(match) { + + var m = new RegExp(transform).exec(match).filter(function (match) { + // match !== '' && match != null + return (!!match); + }), + operation = m[1], + args = m.slice(2).map(parseFloat); + + switch (operation) { + case 'translate': + translateMatrix(matrix, args); + break; + case 'rotate': + args[0] = fabric.util.degreesToRadians(args[0]); + rotateMatrix(matrix, args); + break; + case 'scale': + scaleMatrix(matrix, args); + break; + case 'skewX': + skewXMatrix(matrix, args); + break; + case 'skewY': + skewYMatrix(matrix, args); + break; + case 'matrix': + matrix = args; + break; + } + + // snapshot current matrix into matrices array + matrices.push(matrix.concat()); + // reset + matrix = iMatrix.concat(); + }); + + var combinedMatrix = matrices[0]; + while (matrices.length > 1) { + matrices.shift(); + combinedMatrix = fabric.util.multiplyTransformMatrices(combinedMatrix, matrices[0]); + } + return combinedMatrix; + }; + })(); + + /** + * @private + */ + function parseStyleString(style, oStyle) { + var attr, value; + style.replace(/;\s*$/, '').split(';').forEach(function (chunk) { + var pair = chunk.split(':'); + + attr = normalizeAttr(pair[0].trim().toLowerCase()); + value = normalizeValue(attr, pair[1].trim()); + + oStyle[attr] = value; + }); + } + + /** + * @private + */ + function parseStyleObject(style, oStyle) { + var attr, value; + for (var prop in style) { + if (typeof style[prop] === 'undefined') { + continue; + } + + attr = normalizeAttr(prop.toLowerCase()); + value = normalizeValue(attr, style[prop]); + + oStyle[attr] = value; + } + } + + /** + * @private + */ + function getGlobalStylesForElement(element, svgUid) { + var styles = { }; + for (var rule in fabric.cssRules[svgUid]) { + if (elementMatchesRule(element, rule.split(' '))) { + for (var property in fabric.cssRules[svgUid][rule]) { + styles[property] = fabric.cssRules[svgUid][rule][property]; + } + } + } + return styles; + } + + /** + * @private + */ + function elementMatchesRule(element, selectors) { + var firstMatching, parentMatching = true; + //start from rightmost selector. + firstMatching = selectorMatches(element, selectors.pop()); + if (firstMatching && selectors.length) { + parentMatching = doesSomeParentMatch(element, selectors); + } + return firstMatching && parentMatching && (selectors.length === 0); + } + + function doesSomeParentMatch(element, selectors) { + var selector, parentMatching = true; + while (element.parentNode && element.parentNode.nodeType === 1 && selectors.length) { + if (parentMatching) { + selector = selectors.pop(); + } + element = element.parentNode; + parentMatching = selectorMatches(element, selector); + } + return selectors.length === 0; + } + + /** + * @private + */ + function selectorMatches(element, selector) { + var nodeName = element.nodeName, + classNames = element.getAttribute('class'), + id = element.getAttribute('id'), matcher; + // i check if a selector matches slicing away part from it. + // if i get empty string i should match + matcher = new RegExp('^' + nodeName, 'i'); + selector = selector.replace(matcher, ''); + if (id && selector.length) { + matcher = new RegExp('#' + id + '(?![a-zA-Z\\-]+)', 'i'); + selector = selector.replace(matcher, ''); + } + if (classNames && selector.length) { + classNames = classNames.split(' '); + for (var i = classNames.length; i--;) { + matcher = new RegExp('\\.' + classNames[i] + '(?![a-zA-Z\\-]+)', 'i'); + selector = selector.replace(matcher, ''); + } + } + return selector.length === 0; + } + + /** + * @private + * to support IE8 missing getElementById on SVGdocument + */ + function elementById(doc, id) { + var el; + doc.getElementById && (el = doc.getElementById(id)); + if (el) { + return el; + } + var node, i, nodelist = doc.getElementsByTagName('*'); + for (i = 0; i < nodelist.length; i++) { + node = nodelist[i]; + if (id === node.getAttribute('id')) { + return node; + } + } + } + + /** + * @private + */ + function parseUseDirectives(doc) { + var nodelist = _getMultipleNodes(doc, ['use', 'svg:use']), i = 0; + + while (nodelist.length && i < nodelist.length) { + var el = nodelist[i], + xlink = el.getAttribute('xlink:href').substr(1), + x = el.getAttribute('x') || 0, + y = el.getAttribute('y') || 0, + el2 = elementById(doc, xlink).cloneNode(true), + currentTrans = (el2.getAttribute('transform') || '') + ' translate(' + x + ', ' + y + ')', + parentNode, oldLength = nodelist.length, attr, j, attrs, l; + + applyViewboxTransform(el2); + if (/^svg$/i.test(el2.nodeName)) { + var el3 = el2.ownerDocument.createElement('g'); + for (j = 0, attrs = el2.attributes, l = attrs.length; j < l; j++) { + attr = attrs.item(j); + el3.setAttribute(attr.nodeName, attr.nodeValue); + } + // el2.firstChild != null + while (el2.firstChild) { + el3.appendChild(el2.firstChild); + } + el2 = el3; + } + + for (j = 0, attrs = el.attributes, l = attrs.length; j < l; j++) { + attr = attrs.item(j); + if (attr.nodeName === 'x' || attr.nodeName === 'y' || attr.nodeName === 'xlink:href') { + continue; + } + + if (attr.nodeName === 'transform') { + currentTrans = attr.nodeValue + ' ' + currentTrans; + } + else { + el2.setAttribute(attr.nodeName, attr.nodeValue); + } + } + + el2.setAttribute('transform', currentTrans); + el2.setAttribute('instantiated_by_use', '1'); + el2.removeAttribute('id'); + parentNode = el.parentNode; + parentNode.replaceChild(el2, el); + // some browsers do not shorten nodelist after replaceChild (IE8) + if (nodelist.length === oldLength) { + i++; + } + } + } + + // http://www.w3.org/TR/SVG/coords.html#ViewBoxAttribute + // matches, e.g.: +14.56e-12, etc. + var reViewBoxAttrValue = new RegExp( + '^' + + '\\s*(' + fabric.reNum + '+)\\s*,?' + + '\\s*(' + fabric.reNum + '+)\\s*,?' + + '\\s*(' + fabric.reNum + '+)\\s*,?' + + '\\s*(' + fabric.reNum + '+)\\s*' + + '$' + ); + + /** + * Add a element that envelop all child elements and makes the viewbox transformMatrix descend on all elements + */ + function applyViewboxTransform(element) { + + var viewBoxAttr = element.getAttribute('viewBox'), + scaleX = 1, + scaleY = 1, + minX = 0, + minY = 0, + viewBoxWidth, viewBoxHeight, matrix, el, + widthAttr = element.getAttribute('width'), + heightAttr = element.getAttribute('height'), + x = element.getAttribute('x') || 0, + y = element.getAttribute('y') || 0, + preserveAspectRatio = element.getAttribute('preserveAspectRatio') || '', + missingViewBox = (!viewBoxAttr || !reViewBoxTagNames.test(element.nodeName) + || !(viewBoxAttr = viewBoxAttr.match(reViewBoxAttrValue))), + missingDimAttr = (!widthAttr || !heightAttr || widthAttr === '100%' || heightAttr === '100%'), + toBeParsed = missingViewBox && missingDimAttr, + parsedDim = { }, translateMatrix = ''; + + parsedDim.width = 0; + parsedDim.height = 0; + parsedDim.toBeParsed = toBeParsed; + + if (toBeParsed) { + return parsedDim; + } + + if (missingViewBox) { + parsedDim.width = parseUnit(widthAttr); + parsedDim.height = parseUnit(heightAttr); + return parsedDim; + } + + minX = -parseFloat(viewBoxAttr[1]); + minY = -parseFloat(viewBoxAttr[2]); + viewBoxWidth = parseFloat(viewBoxAttr[3]); + viewBoxHeight = parseFloat(viewBoxAttr[4]); + + if (!missingDimAttr) { + parsedDim.width = parseUnit(widthAttr); + parsedDim.height = parseUnit(heightAttr); + scaleX = parsedDim.width / viewBoxWidth; + scaleY = parsedDim.height / viewBoxHeight; + } + else { + parsedDim.width = viewBoxWidth; + parsedDim.height = viewBoxHeight; + } + + // default is to preserve aspect ratio + preserveAspectRatio = fabric.util.parsePreserveAspectRatioAttribute(preserveAspectRatio); + if (preserveAspectRatio.alignX !== 'none') { + //translate all container for the effect of Mid, Min, Max + scaleY = scaleX = (scaleX > scaleY ? scaleY : scaleX); + } + + if (scaleX === 1 && scaleY === 1 && minX === 0 && minY === 0 && x === 0 && y === 0) { + return parsedDim; + } + + if (x || y) { + translateMatrix = ' translate(' + parseUnit(x) + ' ' + parseUnit(y) + ') '; + } + + matrix = translateMatrix + ' matrix(' + scaleX + + ' 0' + + ' 0 ' + + scaleY + ' ' + + (minX * scaleX) + ' ' + + (minY * scaleY) + ') '; + + if (element.nodeName === 'svg') { + el = element.ownerDocument.createElement('g'); + // element.firstChild != null + while (element.firstChild) { + el.appendChild(element.firstChild); + } + element.appendChild(el); + } + else { + el = element; + matrix = el.getAttribute('transform') + matrix; + } + + el.setAttribute('transform', matrix); + return parsedDim; + } + + /** + * Parses an SVG document, converts it to an array of corresponding fabric.* instances and passes them to a callback + * @static + * @function + * @memberOf fabric + * @param {SVGDocument} doc SVG document to parse + * @param {Function} callback Callback to call when parsing is finished; + * It's being passed an array of elements (parsed from a document). + * @param {Function} [reviver] Method for further parsing of SVG elements, called after each fabric object created. + */ + fabric.parseSVGDocument = (function() { + + function hasAncestorWithNodeName(element, nodeName) { + while (element && (element = element.parentNode)) { + if (element.nodeName && nodeName.test(element.nodeName.replace('svg:', '')) + && !element.getAttribute('instantiated_by_use')) { + return true; + } + } + return false; + } + + return function(doc, callback, reviver) { + if (!doc) { + return; + } + + parseUseDirectives(doc); + + var startTime = new Date(), + svgUid = fabric.Object.__uid++, + options = applyViewboxTransform(doc), + descendants = fabric.util.toArray(doc.getElementsByTagName('*')); + + options.svgUid = svgUid; + + if (descendants.length === 0 && fabric.isLikelyNode) { + // we're likely in node, where "o3-xml" library fails to gEBTN("*") + // https://github.com/ajaxorg/node-o3-xml/issues/21 + descendants = doc.selectNodes('//*[name(.)!="svg"]'); + var arr = []; + for (var i = 0, len = descendants.length; i < len; i++) { + arr[i] = descendants[i]; + } + descendants = arr; + } + + var elements = descendants.filter(function(el) { + applyViewboxTransform(el); + return reAllowedSVGTagNames.test(el.nodeName.replace('svg:', '')) && + !hasAncestorWithNodeName(el, reNotAllowedAncestors); // http://www.w3.org/TR/SVG/struct.html#DefsElement + }); + + if (!elements || (elements && !elements.length)) { + callback && callback([], {}); + return; + } + + fabric.gradientDefs[svgUid] = fabric.getGradientDefs(doc); + fabric.cssRules[svgUid] = fabric.getCSSRules(doc); + // Precedence of rules: style > class > attribute + fabric.parseElements(elements, function(instances) { + fabric.documentParsingTime = new Date() - startTime; + if (callback) { + callback(instances, options); + } + }, clone(options), reviver); + }; + })(); + + /** + * Used for caching SVG documents (loaded via `fabric.Canvas#loadSVGFromURL`) + * @namespace + */ + var svgCache = { + + /** + * @param {String} name + * @param {Function} callback + */ + has: function (name, callback) { + callback(false); + }, + + get: function () { + /* NOOP */ + }, + + set: function () { + /* NOOP */ + } + }; + + /** + * @private + */ + function _enlivenCachedObject(cachedObject) { + + var objects = cachedObject.objects, + options = cachedObject.options; + + objects = objects.map(function (o) { + return fabric[capitalize(o.type)].fromObject(o); + }); + + return ({ objects: objects, options: options }); + } + + /** + * @private + */ + function _createSVGPattern(markup, canvas, property) { + if (canvas[property] && canvas[property].toSVG) { + markup.push( + '\t\n', + '\t\t\n\t\n' + ); + } + } + + var reFontDeclaration = new RegExp( + '(normal|italic)?\\s*(normal|small-caps)?\\s*' + + '(normal|bold|bolder|lighter|100|200|300|400|500|600|700|800|900)?\\s*(' + + fabric.reNum + + '(?:px|cm|mm|em|pt|pc|in)*)(?:\\/(normal|' + fabric.reNum + '))?\\s+(.*)'); + + extend(fabric, { + /** + * Parses a short font declaration, building adding its properties to a style object + * @static + * @function + * @memberOf fabric + * @param {String} value font declaration + * @param {Object} oStyle definition + */ + parseFontDeclaration: function(value, oStyle) { + var match = value.match(reFontDeclaration); + + if (!match) { + return; + } + var fontStyle = match[1], + // font variant is not used + // fontVariant = match[2], + fontWeight = match[3], + fontSize = match[4], + lineHeight = match[5], + fontFamily = match[6]; + + if (fontStyle) { + oStyle.fontStyle = fontStyle; + } + if (fontWeight) { + oStyle.fontWeight = isNaN(parseFloat(fontWeight)) ? fontWeight : parseFloat(fontWeight); + } + if (fontSize) { + oStyle.fontSize = parseUnit(fontSize); + } + if (fontFamily) { + oStyle.fontFamily = fontFamily; + } + if (lineHeight) { + oStyle.lineHeight = lineHeight === 'normal' ? 1 : lineHeight; + } + }, + + /** + * Parses an SVG document, returning all of the gradient declarations found in it + * @static + * @function + * @memberOf fabric + * @param {SVGDocument} doc SVG document to parse + * @return {Object} Gradient definitions; key corresponds to element id, value -- to gradient definition element + */ + getGradientDefs: function(doc) { + var tagArray = [ + 'linearGradient', + 'radialGradient', + 'svg:linearGradient', + 'svg:radialGradient'], + elList = _getMultipleNodes(doc, tagArray), + el, j = 0, id, xlink, + gradientDefs = { }, idsToXlinkMap = { }; + + j = elList.length; + + while (j--) { + el = elList[j]; + xlink = el.getAttribute('xlink:href'); + id = el.getAttribute('id'); + if (xlink) { + idsToXlinkMap[id] = xlink.substr(1); + } + gradientDefs[id] = el; + } + + for (id in idsToXlinkMap) { + var el2 = gradientDefs[idsToXlinkMap[id]].cloneNode(true); + el = gradientDefs[id]; + while (el2.firstChild) { + el.appendChild(el2.firstChild); + } + } + return gradientDefs; + }, + + /** + * Returns an object of attributes' name/value, given element and an array of attribute names; + * Parses parent "g" nodes recursively upwards. + * @static + * @memberOf fabric + * @param {DOMElement} element Element to parse + * @param {Array} attributes Array of attributes to parse + * @return {Object} object containing parsed attributes' names/values + */ + parseAttributes: function(element, attributes, svgUid) { + + if (!element) { + return; + } + + var value, + parentAttributes = { }, + fontSize; + + if (typeof svgUid === 'undefined') { + svgUid = element.getAttribute('svgUid'); + } + // if there's a parent container (`g` or `a` or `symbol` node), parse its attributes recursively upwards + if (element.parentNode && reAllowedParents.test(element.parentNode.nodeName)) { + parentAttributes = fabric.parseAttributes(element.parentNode, attributes, svgUid); + } + fontSize = (parentAttributes && parentAttributes.fontSize ) || + element.getAttribute('font-size') || fabric.Text.DEFAULT_SVG_FONT_SIZE; + + var ownAttributes = attributes.reduce(function(memo, attr) { + value = element.getAttribute(attr); + if (value) { + attr = normalizeAttr(attr); + value = normalizeValue(attr, value, parentAttributes, fontSize); + + memo[attr] = value; + } + return memo; + }, { }); + + // add values parsed from style, which take precedence over attributes + // (see: http://www.w3.org/TR/SVG/styling.html#UsingPresentationAttributes) + ownAttributes = extend(ownAttributes, + extend(getGlobalStylesForElement(element, svgUid), fabric.parseStyleAttribute(element))); + if (ownAttributes.font) { + fabric.parseFontDeclaration(ownAttributes.font, ownAttributes); + } + return _setStrokeFillOpacity(extend(parentAttributes, ownAttributes)); + }, + + /** + * Transforms an array of svg elements to corresponding fabric.* instances + * @static + * @memberOf fabric + * @param {Array} elements Array of elements to parse + * @param {Function} callback Being passed an array of fabric instances (transformed from SVG elements) + * @param {Object} [options] Options object + * @param {Function} [reviver] Method for further parsing of SVG elements, called after each fabric object created. + */ + parseElements: function(elements, callback, options, reviver) { + new fabric.ElementsParser(elements, callback, options, reviver).parse(); + }, + + /** + * Parses "style" attribute, retuning an object with values + * @static + * @memberOf fabric + * @param {SVGElement} element Element to parse + * @return {Object} Objects with values parsed from style attribute of an element + */ + parseStyleAttribute: function(element) { + var oStyle = { }, + style = element.getAttribute('style'); + + if (!style) { + return oStyle; + } + + if (typeof style === 'string') { + parseStyleString(style, oStyle); + } + else { + parseStyleObject(style, oStyle); + } + + return oStyle; + }, + + /** + * Parses "points" attribute, returning an array of values + * @static + * @memberOf fabric + * @param {String} points points attribute string + * @return {Array} array of points + */ + parsePointsAttribute: function(points) { + + // points attribute is required and must not be empty + if (!points) { + return null; + } + + // replace commas with whitespace and remove bookending whitespace + points = points.replace(/,/g, ' ').trim(); + + points = points.split(/\s+/); + var parsedPoints = [], i, len; + + i = 0; + len = points.length; + for (; i < len; i += 2) { + parsedPoints.push({ + x: parseFloat(points[i]), + y: parseFloat(points[i + 1]) + }); + } + + // odd number of points is an error + // if (parsedPoints.length % 2 !== 0) { + // return null; + // } + + return parsedPoints; + }, + + /** + * Returns CSS rules for a given SVG document + * @static + * @function + * @memberOf fabric + * @param {SVGDocument} doc SVG document to parse + * @return {Object} CSS rules of this document + */ + getCSSRules: function(doc) { + var styles = doc.getElementsByTagName('style'), + allRules = { }, rules; + + // very crude parsing of style contents + for (var i = 0, len = styles.length; i < len; i++) { + // IE9 doesn't support textContent, but provides text instead. + var styleContents = styles[i].textContent || styles[i].text; + + // remove comments + styleContents = styleContents.replace(/\/\*[\s\S]*?\*\//g, ''); + if (styleContents.trim() === '') { + continue; + } + rules = styleContents.match(/[^{]*\{[\s\S]*?\}/g); + rules = rules.map(function(rule) { return rule.trim(); }); + rules.forEach(function(rule) { + + var match = rule.match(/([\s\S]*?)\s*\{([^}]*)\}/), + ruleObj = { }, declaration = match[2].trim(), + propertyValuePairs = declaration.replace(/;$/, '').split(/\s*;\s*/); + + for (var i = 0, len = propertyValuePairs.length; i < len; i++) { + var pair = propertyValuePairs[i].split(/\s*:\s*/), + property = normalizeAttr(pair[0]), + value = normalizeValue(property, pair[1], pair[0]); + ruleObj[property] = value; + } + rule = match[1]; + rule.split(',').forEach(function(_rule) { + _rule = _rule.replace(/^svg/i, '').trim(); + if (_rule === '') { + return; + } + if (allRules[_rule]) { + fabric.util.object.extend(allRules[_rule], ruleObj); + } + else { + allRules[_rule] = fabric.util.object.clone(ruleObj); + } + }); + }); + } + return allRules; + }, + + /** + * Takes url corresponding to an SVG document, and parses it into a set of fabric objects. + * Note that SVG is fetched via XMLHttpRequest, so it needs to conform to SOP (Same Origin Policy) + * @memberOf fabric + * @param {String} url + * @param {Function} callback + * @param {Function} [reviver] Method for further parsing of SVG elements, called after each fabric object created. + */ + loadSVGFromURL: function(url, callback, reviver) { + + url = url.replace(/^\n\s*/, '').trim(); + svgCache.has(url, function (hasUrl) { + if (hasUrl) { + svgCache.get(url, function (value) { + var enlivedRecord = _enlivenCachedObject(value); + callback(enlivedRecord.objects, enlivedRecord.options); + }); + } + else { + new fabric.util.request(url, { + method: 'get', + onComplete: onComplete + }); + } + }); + + function onComplete(r) { + + var xml = r.responseXML; + if (xml && !xml.documentElement && fabric.window.ActiveXObject && r.responseText) { + xml = new ActiveXObject('Microsoft.XMLDOM'); + xml.async = 'false'; + //IE chokes on DOCTYPE + xml.loadXML(r.responseText.replace(//i, '')); + } + if (!xml || !xml.documentElement) { + callback && callback(null); + } + + fabric.parseSVGDocument(xml.documentElement, function (results, options) { + svgCache.set(url, { + objects: fabric.util.array.invoke(results, 'toObject'), + options: options + }); + callback && callback(results, options); + }, reviver); + } + }, + + /** + * Takes string corresponding to an SVG document, and parses it into a set of fabric objects + * @memberOf fabric + * @param {String} string + * @param {Function} callback + * @param {Function} [reviver] Method for further parsing of SVG elements, called after each fabric object created. + */ + loadSVGFromString: function(string, callback, reviver) { + string = string.trim(); + var doc; + if (typeof DOMParser !== 'undefined') { + var parser = new DOMParser(); + if (parser && parser.parseFromString) { + doc = parser.parseFromString(string, 'text/xml'); + } + } + else if (fabric.window.ActiveXObject) { + doc = new ActiveXObject('Microsoft.XMLDOM'); + doc.async = 'false'; + // IE chokes on DOCTYPE + doc.loadXML(string.replace(//i, '')); + } + + fabric.parseSVGDocument(doc.documentElement, function (results, options) { + callback(results, options); + }, reviver); + }, + + /** + * Creates markup containing SVG font faces, + * font URLs for font faces must be collected by developers + * and are not extracted from the DOM by fabricjs + * @param {Array} objects Array of fabric objects + * @return {String} + */ + createSVGFontFacesMarkup: function(objects) { + var markup = '', fontList = { }, obj, fontFamily, + style, row, rowIndex, _char, charIndex, + fontPaths = fabric.fontPaths; + + for (var i = 0, len = objects.length; i < len; i++) { + obj = objects[i]; + fontFamily = obj.fontFamily; + if (obj.type.indexOf('text') === -1 || fontList[fontFamily] || !fontPaths[fontFamily]) { + continue; + } + fontList[fontFamily] = true; + if (!obj.styles) { + continue; + } + style = obj.styles; + for (rowIndex in style) { + row = style[rowIndex]; + for (charIndex in row) { + _char = row[charIndex]; + fontFamily = _char.fontFamily; + if (!fontList[fontFamily] && fontPaths[fontFamily]) { + fontList[fontFamily] = true; + } + } + } + } + + for (var j in fontList) { + markup += [ + '\t\t@font-face {\n', + '\t\t\tfont-family: \'', j, '\';\n', + '\t\t\tsrc: url(\'', fontPaths[j], '\');\n', + '\t\t}\n' + ].join(''); + } + + if (markup) { + markup = [ + '\t\n' + ].join(''); + } + + return markup; + }, + + /** + * Creates markup containing SVG referenced elements like patterns, gradients etc. + * @param {fabric.Canvas} canvas instance of fabric.Canvas + * @return {String} + */ + createSVGRefElementsMarkup: function(canvas) { + var markup = []; + + _createSVGPattern(markup, canvas, 'backgroundColor'); + _createSVGPattern(markup, canvas, 'overlayColor'); + + return markup.join(''); + } + }); + +})(typeof exports !== 'undefined' ? exports : this); + + +fabric.ElementsParser = function(elements, callback, options, reviver) { + this.elements = elements; + this.callback = callback; + this.options = options; + this.reviver = reviver; + this.svgUid = (options && options.svgUid) || 0; +}; + +fabric.ElementsParser.prototype.parse = function() { + this.instances = new Array(this.elements.length); + this.numElements = this.elements.length; + + this.createObjects(); +}; + +fabric.ElementsParser.prototype.createObjects = function() { + for (var i = 0, len = this.elements.length; i < len; i++) { + this.elements[i].setAttribute('svgUid', this.svgUid); + (function(_obj, i) { + setTimeout(function() { + _obj.createObject(_obj.elements[i], i); + }, 0); + })(this, i); + } +}; + +fabric.ElementsParser.prototype.createObject = function(el, index) { + var klass = fabric[fabric.util.string.capitalize(el.tagName.replace('svg:', ''))]; + if (klass && klass.fromElement) { + try { + this._createObject(klass, el, index); + } + catch (err) { + fabric.log(err); + } + } + else { + this.checkIfDone(); + } +}; + +fabric.ElementsParser.prototype._createObject = function(klass, el, index) { + if (klass.async) { + klass.fromElement(el, this.createCallback(index, el), this.options); + } + else { + var obj = klass.fromElement(el, this.options); + this.resolveGradient(obj, 'fill'); + this.resolveGradient(obj, 'stroke'); + this.reviver && this.reviver(el, obj); + this.instances[index] = obj; + this.checkIfDone(); + } +}; + +fabric.ElementsParser.prototype.createCallback = function(index, el) { + var _this = this; + return function(obj) { + _this.resolveGradient(obj, 'fill'); + _this.resolveGradient(obj, 'stroke'); + _this.reviver && _this.reviver(el, obj); + _this.instances[index] = obj; + _this.checkIfDone(); + }; +}; + +fabric.ElementsParser.prototype.resolveGradient = function(obj, property) { + + var instanceFillValue = obj.get(property); + if (!(/^url\(/).test(instanceFillValue)) { + return; + } + var gradientId = instanceFillValue.slice(5, instanceFillValue.length - 1); + if (fabric.gradientDefs[this.svgUid][gradientId]) { + obj.set(property, + fabric.Gradient.fromElement(fabric.gradientDefs[this.svgUid][gradientId], obj)); + } +}; + +fabric.ElementsParser.prototype.checkIfDone = function() { + if (--this.numElements === 0) { + this.instances = this.instances.filter(function(el) { + // eslint-disable-next-line no-eq-null, eqeqeq + return el != null; + }); + this.callback(this.instances); + } +}; + + +(function(global) { + + 'use strict'; + + /* Adaptation of work of Kevin Lindsey (kevin@kevlindev.com) */ + + var fabric = global.fabric || (global.fabric = { }); + + if (fabric.Point) { + fabric.warn('fabric.Point is already defined'); + return; + } + + fabric.Point = Point; + + /** + * Point class + * @class fabric.Point + * @memberOf fabric + * @constructor + * @param {Number} x + * @param {Number} y + * @return {fabric.Point} thisArg + */ + function Point(x, y) { + this.x = x; + this.y = y; + } + + Point.prototype = /** @lends fabric.Point.prototype */ { + + type: 'point', + + constructor: Point, + + /** + * Adds another point to this one and returns another one + * @param {fabric.Point} that + * @return {fabric.Point} new Point instance with added values + */ + add: function (that) { + return new Point(this.x + that.x, this.y + that.y); + }, + + /** + * Adds another point to this one + * @param {fabric.Point} that + * @return {fabric.Point} thisArg + * @chainable + */ + addEquals: function (that) { + this.x += that.x; + this.y += that.y; + return this; + }, + + /** + * Adds value to this point and returns a new one + * @param {Number} scalar + * @return {fabric.Point} new Point with added value + */ + scalarAdd: function (scalar) { + return new Point(this.x + scalar, this.y + scalar); + }, + + /** + * Adds value to this point + * @param {Number} scalar + * @return {fabric.Point} thisArg + * @chainable + */ + scalarAddEquals: function (scalar) { + this.x += scalar; + this.y += scalar; + return this; + }, + + /** + * Subtracts another point from this point and returns a new one + * @param {fabric.Point} that + * @return {fabric.Point} new Point object with subtracted values + */ + subtract: function (that) { + return new Point(this.x - that.x, this.y - that.y); + }, + + /** + * Subtracts another point from this point + * @param {fabric.Point} that + * @return {fabric.Point} thisArg + * @chainable + */ + subtractEquals: function (that) { + this.x -= that.x; + this.y -= that.y; + return this; + }, + + /** + * Subtracts value from this point and returns a new one + * @param {Number} scalar + * @return {fabric.Point} + */ + scalarSubtract: function (scalar) { + return new Point(this.x - scalar, this.y - scalar); + }, + + /** + * Subtracts value from this point + * @param {Number} scalar + * @return {fabric.Point} thisArg + * @chainable + */ + scalarSubtractEquals: function (scalar) { + this.x -= scalar; + this.y -= scalar; + return this; + }, + + /** + * Miltiplies this point by a value and returns a new one + * TODO: rename in scalarMultiply in 2.0 + * @param {Number} scalar + * @return {fabric.Point} + */ + multiply: function (scalar) { + return new Point(this.x * scalar, this.y * scalar); + }, + + /** + * Miltiplies this point by a value + * TODO: rename in scalarMultiplyEquals in 2.0 + * @param {Number} scalar + * @return {fabric.Point} thisArg + * @chainable + */ + multiplyEquals: function (scalar) { + this.x *= scalar; + this.y *= scalar; + return this; + }, + + /** + * Divides this point by a value and returns a new one + * TODO: rename in scalarDivide in 2.0 + * @param {Number} scalar + * @return {fabric.Point} + */ + divide: function (scalar) { + return new Point(this.x / scalar, this.y / scalar); + }, + + /** + * Divides this point by a value + * TODO: rename in scalarDivideEquals in 2.0 + * @param {Number} scalar + * @return {fabric.Point} thisArg + * @chainable + */ + divideEquals: function (scalar) { + this.x /= scalar; + this.y /= scalar; + return this; + }, + + /** + * Returns true if this point is equal to another one + * @param {fabric.Point} that + * @return {Boolean} + */ + eq: function (that) { + return (this.x === that.x && this.y === that.y); + }, + + /** + * Returns true if this point is less than another one + * @param {fabric.Point} that + * @return {Boolean} + */ + lt: function (that) { + return (this.x < that.x && this.y < that.y); + }, + + /** + * Returns true if this point is less than or equal to another one + * @param {fabric.Point} that + * @return {Boolean} + */ + lte: function (that) { + return (this.x <= that.x && this.y <= that.y); + }, + + /** + + * Returns true if this point is greater another one + * @param {fabric.Point} that + * @return {Boolean} + */ + gt: function (that) { + return (this.x > that.x && this.y > that.y); + }, + + /** + * Returns true if this point is greater than or equal to another one + * @param {fabric.Point} that + * @return {Boolean} + */ + gte: function (that) { + return (this.x >= that.x && this.y >= that.y); + }, + + /** + * Returns new point which is the result of linear interpolation with this one and another one + * @param {fabric.Point} that + * @param {Number} t , position of interpolation, between 0 and 1 default 0.5 + * @return {fabric.Point} + */ + lerp: function (that, t) { + if (typeof t === 'undefined') { + t = 0.5; + } + t = Math.max(Math.min(1, t), 0); + return new Point(this.x + (that.x - this.x) * t, this.y + (that.y - this.y) * t); + }, + + /** + * Returns distance from this point and another one + * @param {fabric.Point} that + * @return {Number} + */ + distanceFrom: function (that) { + var dx = this.x - that.x, + dy = this.y - that.y; + return Math.sqrt(dx * dx + dy * dy); + }, + + /** + * Returns the point between this point and another one + * @param {fabric.Point} that + * @return {fabric.Point} + */ + midPointFrom: function (that) { + return this.lerp(that); + }, + + /** + * Returns a new point which is the min of this and another one + * @param {fabric.Point} that + * @return {fabric.Point} + */ + min: function (that) { + return new Point(Math.min(this.x, that.x), Math.min(this.y, that.y)); + }, + + /** + * Returns a new point which is the max of this and another one + * @param {fabric.Point} that + * @return {fabric.Point} + */ + max: function (that) { + return new Point(Math.max(this.x, that.x), Math.max(this.y, that.y)); + }, + + /** + * Returns string representation of this point + * @return {String} + */ + toString: function () { + return this.x + ',' + this.y; + }, + + /** + * Sets x/y of this point + * @param {Number} x + * @param {Number} y + * @chainable + */ + setXY: function (x, y) { + this.x = x; + this.y = y; + return this; + }, + + /** + * Sets x of this point + * @param {Number} x + * @chainable + */ + setX: function (x) { + this.x = x; + return this; + }, + + /** + * Sets y of this point + * @param {Number} y + * @chainable + */ + setY: function (y) { + this.y = y; + return this; + }, + + /** + * Sets x/y of this point from another point + * @param {fabric.Point} that + * @chainable + */ + setFromPoint: function (that) { + this.x = that.x; + this.y = that.y; + return this; + }, + + /** + * Swaps x/y of this point and another point + * @param {fabric.Point} that + */ + swap: function (that) { + var x = this.x, + y = this.y; + this.x = that.x; + this.y = that.y; + that.x = x; + that.y = y; + }, + + /** + * return a cloned instance of the point + * @return {fabric.Point} + */ + clone: function () { + return new Point(this.x, this.y); + } + }; + +})(typeof exports !== 'undefined' ? exports : this); + + +(function(global) { + + 'use strict'; + + /* Adaptation of work of Kevin Lindsey (kevin@kevlindev.com) */ + var fabric = global.fabric || (global.fabric = { }); + + if (fabric.Intersection) { + fabric.warn('fabric.Intersection is already defined'); + return; + } + + /** + * Intersection class + * @class fabric.Intersection + * @memberOf fabric + * @constructor + */ + function Intersection(status) { + this.status = status; + this.points = []; + } + + fabric.Intersection = Intersection; + + fabric.Intersection.prototype = /** @lends fabric.Intersection.prototype */ { + + constructor: Intersection, + + /** + * Appends a point to intersection + * @param {fabric.Point} point + * @return {fabric.Intersection} thisArg + * @chainable + */ + appendPoint: function (point) { + this.points.push(point); + return this; + }, + + /** + * Appends points to intersection + * @param {Array} points + * @return {fabric.Intersection} thisArg + * @chainable + */ + appendPoints: function (points) { + this.points = this.points.concat(points); + return this; + } + }; + + /** + * Checks if one line intersects another + * TODO: rename in intersectSegmentSegment + * @static + * @param {fabric.Point} a1 + * @param {fabric.Point} a2 + * @param {fabric.Point} b1 + * @param {fabric.Point} b2 + * @return {fabric.Intersection} + */ + fabric.Intersection.intersectLineLine = function (a1, a2, b1, b2) { + var result, + uaT = (b2.x - b1.x) * (a1.y - b1.y) - (b2.y - b1.y) * (a1.x - b1.x), + ubT = (a2.x - a1.x) * (a1.y - b1.y) - (a2.y - a1.y) * (a1.x - b1.x), + uB = (b2.y - b1.y) * (a2.x - a1.x) - (b2.x - b1.x) * (a2.y - a1.y); + if (uB !== 0) { + var ua = uaT / uB, + ub = ubT / uB; + if (0 <= ua && ua <= 1 && 0 <= ub && ub <= 1) { + result = new Intersection('Intersection'); + result.appendPoint(new fabric.Point(a1.x + ua * (a2.x - a1.x), a1.y + ua * (a2.y - a1.y))); + } + else { + result = new Intersection(); + } + } + else { + if (uaT === 0 || ubT === 0) { + result = new Intersection('Coincident'); + } + else { + result = new Intersection('Parallel'); + } + } + return result; + }; + + /** + * Checks if line intersects polygon + * TODO: rename in intersectSegmentPolygon + * fix detection of coincident + * @static + * @param {fabric.Point} a1 + * @param {fabric.Point} a2 + * @param {Array} points + * @return {fabric.Intersection} + */ + fabric.Intersection.intersectLinePolygon = function(a1, a2, points) { + var result = new Intersection(), + length = points.length, + b1, b2, inter; + + for (var i = 0; i < length; i++) { + b1 = points[i]; + b2 = points[(i + 1) % length]; + inter = Intersection.intersectLineLine(a1, a2, b1, b2); + + result.appendPoints(inter.points); + } + if (result.points.length > 0) { + result.status = 'Intersection'; + } + return result; + }; + + /** + * Checks if polygon intersects another polygon + * @static + * @param {Array} points1 + * @param {Array} points2 + * @return {fabric.Intersection} + */ + fabric.Intersection.intersectPolygonPolygon = function (points1, points2) { + var result = new Intersection(), + length = points1.length; + + for (var i = 0; i < length; i++) { + var a1 = points1[i], + a2 = points1[(i + 1) % length], + inter = Intersection.intersectLinePolygon(a1, a2, points2); + + result.appendPoints(inter.points); + } + if (result.points.length > 0) { + result.status = 'Intersection'; + } + return result; + }; + + /** + * Checks if polygon intersects rectangle + * @static + * @param {Array} points + * @param {fabric.Point} r1 + * @param {fabric.Point} r2 + * @return {fabric.Intersection} + */ + fabric.Intersection.intersectPolygonRectangle = function (points, r1, r2) { + var min = r1.min(r2), + max = r1.max(r2), + topRight = new fabric.Point(max.x, min.y), + bottomLeft = new fabric.Point(min.x, max.y), + inter1 = Intersection.intersectLinePolygon(min, topRight, points), + inter2 = Intersection.intersectLinePolygon(topRight, max, points), + inter3 = Intersection.intersectLinePolygon(max, bottomLeft, points), + inter4 = Intersection.intersectLinePolygon(bottomLeft, min, points), + result = new Intersection(); + + result.appendPoints(inter1.points); + result.appendPoints(inter2.points); + result.appendPoints(inter3.points); + result.appendPoints(inter4.points); + + if (result.points.length > 0) { + result.status = 'Intersection'; + } + return result; + }; + +})(typeof exports !== 'undefined' ? exports : this); + + +(function(global) { + + 'use strict'; + + var fabric = global.fabric || (global.fabric = { }); + + if (fabric.Color) { + fabric.warn('fabric.Color is already defined.'); + return; + } + + /** + * Color class + * The purpose of {@link fabric.Color} is to abstract and encapsulate common color operations; + * {@link fabric.Color} is a constructor and creates instances of {@link fabric.Color} objects. + * + * @class fabric.Color + * @param {String} color optional in hex or rgb(a) or hsl format or from known color list + * @return {fabric.Color} thisArg + * @tutorial {@link http://fabricjs.com/fabric-intro-part-2/#colors} + */ + function Color(color) { + if (!color) { + this.setSource([0, 0, 0, 1]); + } + else { + this._tryParsingColor(color); + } + } + + fabric.Color = Color; + + fabric.Color.prototype = /** @lends fabric.Color.prototype */ { + + /** + * @private + * @param {String|Array} color Color value to parse + */ + _tryParsingColor: function(color) { + var source; + + if (color in Color.colorNameMap) { + color = Color.colorNameMap[color]; + } + + if (color === 'transparent') { + source = [255, 255, 255, 0]; + } + + if (!source) { + source = Color.sourceFromHex(color); + } + if (!source) { + source = Color.sourceFromRgb(color); + } + if (!source) { + source = Color.sourceFromHsl(color); + } + if (!source) { + //if color is not recognize let's make black as canvas does + source = [0, 0, 0, 1]; + } + if (source) { + this.setSource(source); + } + }, + + /** + * Adapted from https://github.com/mjijackson + * @private + * @param {Number} r Red color value + * @param {Number} g Green color value + * @param {Number} b Blue color value + * @return {Array} Hsl color + */ + _rgbToHsl: function(r, g, b) { + r /= 255; g /= 255; b /= 255; + + var h, s, l, + max = fabric.util.array.max([r, g, b]), + min = fabric.util.array.min([r, g, b]); + + l = (max + min) / 2; + + if (max === min) { + h = s = 0; // achromatic + } + else { + var d = max - min; + s = l > 0.5 ? d / (2 - max - min) : d / (max + min); + switch (max) { + case r: + h = (g - b) / d + (g < b ? 6 : 0); + break; + case g: + h = (b - r) / d + 2; + break; + case b: + h = (r - g) / d + 4; + break; + } + h /= 6; + } + + return [ + Math.round(h * 360), + Math.round(s * 100), + Math.round(l * 100) + ]; + }, + + /** + * Returns source of this color (where source is an array representation; ex: [200, 200, 100, 1]) + * @return {Array} + */ + getSource: function() { + return this._source; + }, + + /** + * Sets source of this color (where source is an array representation; ex: [200, 200, 100, 1]) + * @param {Array} source + */ + setSource: function(source) { + this._source = source; + }, + + /** + * Returns color represenation in RGB format + * @return {String} ex: rgb(0-255,0-255,0-255) + */ + toRgb: function() { + var source = this.getSource(); + return 'rgb(' + source[0] + ',' + source[1] + ',' + source[2] + ')'; + }, + + /** + * Returns color represenation in RGBA format + * @return {String} ex: rgba(0-255,0-255,0-255,0-1) + */ + toRgba: function() { + var source = this.getSource(); + return 'rgba(' + source[0] + ',' + source[1] + ',' + source[2] + ',' + source[3] + ')'; + }, + + /** + * Returns color represenation in HSL format + * @return {String} ex: hsl(0-360,0%-100%,0%-100%) + */ + toHsl: function() { + var source = this.getSource(), + hsl = this._rgbToHsl(source[0], source[1], source[2]); + + return 'hsl(' + hsl[0] + ',' + hsl[1] + '%,' + hsl[2] + '%)'; + }, + + /** + * Returns color represenation in HSLA format + * @return {String} ex: hsla(0-360,0%-100%,0%-100%,0-1) + */ + toHsla: function() { + var source = this.getSource(), + hsl = this._rgbToHsl(source[0], source[1], source[2]); + + return 'hsla(' + hsl[0] + ',' + hsl[1] + '%,' + hsl[2] + '%,' + source[3] + ')'; + }, + + /** + * Returns color represenation in HEX format + * @return {String} ex: FF5555 + */ + toHex: function() { + var source = this.getSource(), r, g, b; + + r = source[0].toString(16); + r = (r.length === 1) ? ('0' + r) : r; + + g = source[1].toString(16); + g = (g.length === 1) ? ('0' + g) : g; + + b = source[2].toString(16); + b = (b.length === 1) ? ('0' + b) : b; + + return r.toUpperCase() + g.toUpperCase() + b.toUpperCase(); + }, + + /** + * Gets value of alpha channel for this color + * @return {Number} 0-1 + */ + getAlpha: function() { + return this.getSource()[3]; + }, + + /** + * Sets value of alpha channel for this color + * @param {Number} alpha Alpha value 0-1 + * @return {fabric.Color} thisArg + */ + setAlpha: function(alpha) { + var source = this.getSource(); + source[3] = alpha; + this.setSource(source); + return this; + }, + + /** + * Transforms color to its grayscale representation + * @return {fabric.Color} thisArg + */ + toGrayscale: function() { + var source = this.getSource(), + average = parseInt((source[0] * 0.3 + source[1] * 0.59 + source[2] * 0.11).toFixed(0), 10), + currentAlpha = source[3]; + this.setSource([average, average, average, currentAlpha]); + return this; + }, + + /** + * Transforms color to its black and white representation + * @param {Number} threshold + * @return {fabric.Color} thisArg + */ + toBlackWhite: function(threshold) { + var source = this.getSource(), + average = (source[0] * 0.3 + source[1] * 0.59 + source[2] * 0.11).toFixed(0), + currentAlpha = source[3]; + + threshold = threshold || 127; + + average = (Number(average) < Number(threshold)) ? 0 : 255; + this.setSource([average, average, average, currentAlpha]); + return this; + }, + + /** + * Overlays color with another color + * @param {String|fabric.Color} otherColor + * @return {fabric.Color} thisArg + */ + overlayWith: function(otherColor) { + if (!(otherColor instanceof Color)) { + otherColor = new Color(otherColor); + } + + var result = [], + alpha = this.getAlpha(), + otherAlpha = 0.5, + source = this.getSource(), + otherSource = otherColor.getSource(); + + for (var i = 0; i < 3; i++) { + result.push(Math.round((source[i] * (1 - otherAlpha)) + (otherSource[i] * otherAlpha))); + } + + result[3] = alpha; + this.setSource(result); + return this; + } + }; + + /** + * Regex matching color in RGB or RGBA formats (ex: rgb(0, 0, 0), rgba(255, 100, 10, 0.5), rgba( 255 , 100 , 10 , 0.5 ), rgb(1,1,1), rgba(100%, 60%, 10%, 0.5)) + * @static + * @field + * @memberOf fabric.Color + */ + // eslint-disable-next-line max-len + fabric.Color.reRGBa = /^rgba?\(\s*(\d{1,3}(?:\.\d+)?\%?)\s*,\s*(\d{1,3}(?:\.\d+)?\%?)\s*,\s*(\d{1,3}(?:\.\d+)?\%?)\s*(?:\s*,\s*(\d+(?:\.\d+)?)\s*)?\)$/; + + /** + * Regex matching color in HSL or HSLA formats (ex: hsl(200, 80%, 10%), hsla(300, 50%, 80%, 0.5), hsla( 300 , 50% , 80% , 0.5 )) + * @static + * @field + * @memberOf fabric.Color + */ + fabric.Color.reHSLa = /^hsla?\(\s*(\d{1,3})\s*,\s*(\d{1,3}\%)\s*,\s*(\d{1,3}\%)\s*(?:\s*,\s*(\d+(?:\.\d+)?)\s*)?\)$/; + + /** + * Regex matching color in HEX format (ex: #FF5544CC, #FF5555, 010155, aff) + * @static + * @field + * @memberOf fabric.Color + */ + fabric.Color.reHex = /^#?([0-9a-f]{8}|[0-9a-f]{6}|[0-9a-f]{4}|[0-9a-f]{3})$/i; + + /** + * Map of the 17 basic color names with HEX code + * @static + * @field + * @memberOf fabric.Color + * @see: http://www.w3.org/TR/CSS2/syndata.html#color-units + */ + fabric.Color.colorNameMap = { + aqua: '#00FFFF', + black: '#000000', + blue: '#0000FF', + fuchsia: '#FF00FF', + gray: '#808080', + grey: '#808080', + green: '#008000', + lime: '#00FF00', + maroon: '#800000', + navy: '#000080', + olive: '#808000', + orange: '#FFA500', + purple: '#800080', + red: '#FF0000', + silver: '#C0C0C0', + teal: '#008080', + white: '#FFFFFF', + yellow: '#FFFF00' + }; + + /** + * @private + * @param {Number} p + * @param {Number} q + * @param {Number} t + * @return {Number} + */ + function hue2rgb(p, q, t) { + if (t < 0) { + t += 1; + } + if (t > 1) { + t -= 1; + } + if (t < 1 / 6) { + return p + (q - p) * 6 * t; + } + if (t < 1 / 2) { + return q; + } + if (t < 2 / 3) { + return p + (q - p) * (2 / 3 - t) * 6; + } + return p; + } + + /** + * Returns new color object, when given a color in RGB format + * @memberOf fabric.Color + * @param {String} color Color value ex: rgb(0-255,0-255,0-255) + * @return {fabric.Color} + */ + fabric.Color.fromRgb = function(color) { + return Color.fromSource(Color.sourceFromRgb(color)); + }; + + /** + * Returns array representation (ex: [100, 100, 200, 1]) of a color that's in RGB or RGBA format + * @memberOf fabric.Color + * @param {String} color Color value ex: rgb(0-255,0-255,0-255), rgb(0%-100%,0%-100%,0%-100%) + * @return {Array} source + */ + fabric.Color.sourceFromRgb = function(color) { + var match = color.match(Color.reRGBa); + if (match) { + var r = parseInt(match[1], 10) / (/%$/.test(match[1]) ? 100 : 1) * (/%$/.test(match[1]) ? 255 : 1), + g = parseInt(match[2], 10) / (/%$/.test(match[2]) ? 100 : 1) * (/%$/.test(match[2]) ? 255 : 1), + b = parseInt(match[3], 10) / (/%$/.test(match[3]) ? 100 : 1) * (/%$/.test(match[3]) ? 255 : 1); + + return [ + parseInt(r, 10), + parseInt(g, 10), + parseInt(b, 10), + match[4] ? parseFloat(match[4]) : 1 + ]; + } + }; + + /** + * Returns new color object, when given a color in RGBA format + * @static + * @function + * @memberOf fabric.Color + * @param {String} color + * @return {fabric.Color} + */ + fabric.Color.fromRgba = Color.fromRgb; + + /** + * Returns new color object, when given a color in HSL format + * @param {String} color Color value ex: hsl(0-260,0%-100%,0%-100%) + * @memberOf fabric.Color + * @return {fabric.Color} + */ + fabric.Color.fromHsl = function(color) { + return Color.fromSource(Color.sourceFromHsl(color)); + }; + + /** + * Returns array representation (ex: [100, 100, 200, 1]) of a color that's in HSL or HSLA format. + * Adapted from https://github.com/mjijackson + * @memberOf fabric.Color + * @param {String} color Color value ex: hsl(0-360,0%-100%,0%-100%) or hsla(0-360,0%-100%,0%-100%, 0-1) + * @return {Array} source + * @see http://http://www.w3.org/TR/css3-color/#hsl-color + */ + fabric.Color.sourceFromHsl = function(color) { + var match = color.match(Color.reHSLa); + if (!match) { + return; + } + + var h = (((parseFloat(match[1]) % 360) + 360) % 360) / 360, + s = parseFloat(match[2]) / (/%$/.test(match[2]) ? 100 : 1), + l = parseFloat(match[3]) / (/%$/.test(match[3]) ? 100 : 1), + r, g, b; + + if (s === 0) { + r = g = b = l; + } + else { + var q = l <= 0.5 ? l * (s + 1) : l + s - l * s, + p = l * 2 - q; + + r = hue2rgb(p, q, h + 1 / 3); + g = hue2rgb(p, q, h); + b = hue2rgb(p, q, h - 1 / 3); + } + + return [ + Math.round(r * 255), + Math.round(g * 255), + Math.round(b * 255), + match[4] ? parseFloat(match[4]) : 1 + ]; + }; + + /** + * Returns new color object, when given a color in HSLA format + * @static + * @function + * @memberOf fabric.Color + * @param {String} color + * @return {fabric.Color} + */ + fabric.Color.fromHsla = Color.fromHsl; + + /** + * Returns new color object, when given a color in HEX format + * @static + * @memberOf fabric.Color + * @param {String} color Color value ex: FF5555 + * @return {fabric.Color} + */ + fabric.Color.fromHex = function(color) { + return Color.fromSource(Color.sourceFromHex(color)); + }; + + /** + * Returns array representation (ex: [100, 100, 200, 1]) of a color that's in HEX format + * @static + * @memberOf fabric.Color + * @param {String} color ex: FF5555 or FF5544CC (RGBa) + * @return {Array} source + */ + fabric.Color.sourceFromHex = function(color) { + if (color.match(Color.reHex)) { + var value = color.slice(color.indexOf('#') + 1), + isShortNotation = (value.length === 3 || value.length === 4), + isRGBa = (value.length === 8 || value.length === 4), + r = isShortNotation ? (value.charAt(0) + value.charAt(0)) : value.substring(0, 2), + g = isShortNotation ? (value.charAt(1) + value.charAt(1)) : value.substring(2, 4), + b = isShortNotation ? (value.charAt(2) + value.charAt(2)) : value.substring(4, 6), + a = isRGBa ? (isShortNotation ? (value.charAt(3) + value.charAt(3)) : value.substring(6, 8)) : 'FF'; + + return [ + parseInt(r, 16), + parseInt(g, 16), + parseInt(b, 16), + parseFloat((parseInt(a, 16) / 255).toFixed(2)) + ]; + } + }; + + /** + * Returns new color object, when given color in array representation (ex: [200, 100, 100, 0.5]) + * @static + * @memberOf fabric.Color + * @param {Array} source + * @return {fabric.Color} + */ + fabric.Color.fromSource = function(source) { + var oColor = new Color(); + oColor.setSource(source); + return oColor; + }; + +})(typeof exports !== 'undefined' ? exports : this); + + +(function() { + + /* _FROM_SVG_START_ */ + function getColorStop(el) { + var style = el.getAttribute('style'), + offset = el.getAttribute('offset') || 0, + color, colorAlpha, opacity; + + // convert percents to absolute values + offset = parseFloat(offset) / (/%$/.test(offset) ? 100 : 1); + offset = offset < 0 ? 0 : offset > 1 ? 1 : offset; + if (style) { + var keyValuePairs = style.split(/\s*;\s*/); + + if (keyValuePairs[keyValuePairs.length - 1] === '') { + keyValuePairs.pop(); + } + + for (var i = keyValuePairs.length; i--; ) { + + var split = keyValuePairs[i].split(/\s*:\s*/), + key = split[0].trim(), + value = split[1].trim(); + + if (key === 'stop-color') { + color = value; + } + else if (key === 'stop-opacity') { + opacity = value; + } + } + } + + if (!color) { + color = el.getAttribute('stop-color') || 'rgb(0,0,0)'; + } + if (!opacity) { + opacity = el.getAttribute('stop-opacity'); + } + + color = new fabric.Color(color); + colorAlpha = color.getAlpha(); + opacity = isNaN(parseFloat(opacity)) ? 1 : parseFloat(opacity); + opacity *= colorAlpha; + + return { + offset: offset, + color: color.toRgb(), + opacity: opacity + }; + } + + function getLinearCoords(el) { + return { + x1: el.getAttribute('x1') || 0, + y1: el.getAttribute('y1') || 0, + x2: el.getAttribute('x2') || '100%', + y2: el.getAttribute('y2') || 0 + }; + } + + function getRadialCoords(el) { + return { + x1: el.getAttribute('fx') || el.getAttribute('cx') || '50%', + y1: el.getAttribute('fy') || el.getAttribute('cy') || '50%', + r1: 0, + x2: el.getAttribute('cx') || '50%', + y2: el.getAttribute('cy') || '50%', + r2: el.getAttribute('r') || '50%' + }; + } + /* _FROM_SVG_END_ */ + + /** + * Gradient class + * @class fabric.Gradient + * @tutorial {@link http://fabricjs.com/fabric-intro-part-2#gradients} + * @see {@link fabric.Gradient#initialize} for constructor definition + */ + fabric.Gradient = fabric.util.createClass(/** @lends fabric.Gradient.prototype */ { + + /** + * Horizontal offset for aligning gradients coming from SVG when outside pathgroups + * @type Number + * @default 0 + */ + offsetX: 0, + + /** + * Vertical offset for aligning gradients coming from SVG when outside pathgroups + * @type Number + * @default 0 + */ + offsetY: 0, + + /** + * Constructor + * @param {Object} [options] Options object with type, coords, gradientUnits and colorStops + * @return {fabric.Gradient} thisArg + */ + initialize: function(options) { + options || (options = { }); + + var coords = { }; + + this.id = fabric.Object.__uid++; + this.type = options.type || 'linear'; + + coords = { + x1: options.coords.x1 || 0, + y1: options.coords.y1 || 0, + x2: options.coords.x2 || 0, + y2: options.coords.y2 || 0 + }; + + if (this.type === 'radial') { + coords.r1 = options.coords.r1 || 0; + coords.r2 = options.coords.r2 || 0; + } + this.coords = coords; + this.colorStops = options.colorStops.slice(); + if (options.gradientTransform) { + this.gradientTransform = options.gradientTransform; + } + this.offsetX = options.offsetX || this.offsetX; + this.offsetY = options.offsetY || this.offsetY; + }, + + /** + * Adds another colorStop + * @param {Object} colorStop Object with offset and color + * @return {fabric.Gradient} thisArg + */ + addColorStop: function(colorStop) { + for (var position in colorStop) { + var color = new fabric.Color(colorStop[position]); + this.colorStops.push({ + offset: position, + color: color.toRgb(), + opacity: color.getAlpha() + }); + } + return this; + }, + + /** + * Returns object representation of a gradient + * @return {Object} + */ + toObject: function() { + return { + type: this.type, + coords: this.coords, + colorStops: this.colorStops, + offsetX: this.offsetX, + offsetY: this.offsetY, + gradientTransform: this.gradientTransform ? this.gradientTransform.concat() : this.gradientTransform + }; + }, + + /* _TO_SVG_START_ */ + /** + * Returns SVG representation of an gradient + * @param {Object} object Object to create a gradient for + * @return {String} SVG representation of an gradient (linear/radial) + */ + toSVG: function(object) { + var coords = fabric.util.object.clone(this.coords), + markup, commonAttributes; + + // colorStops must be sorted ascending + this.colorStops.sort(function(a, b) { + return a.offset - b.offset; + }); + + if (!(object.group && object.group.type === 'path-group')) { + for (var prop in coords) { + if (prop === 'x1' || prop === 'x2' || prop === 'r2') { + coords[prop] += this.offsetX - object.width / 2; + } + else if (prop === 'y1' || prop === 'y2') { + coords[prop] += this.offsetY - object.height / 2; + } + } + } + + commonAttributes = 'id="SVGID_' + this.id + + '" gradientUnits="userSpaceOnUse"'; + if (this.gradientTransform) { + commonAttributes += ' gradientTransform="matrix(' + this.gradientTransform.join(' ') + ')" '; + } + if (this.type === 'linear') { + markup = [ + '\n' + ]; + } + else if (this.type === 'radial') { + markup = [ + '\n' + ]; + } + + for (var i = 0; i < this.colorStops.length; i++) { + markup.push( + '\n' + ); + } + + markup.push((this.type === 'linear' ? '\n' : '\n')); + + return markup.join(''); + }, + /* _TO_SVG_END_ */ + + /** + * Returns an instance of CanvasGradient + * @param {CanvasRenderingContext2D} ctx Context to render on + * @param {Object} object + * @return {CanvasGradient} + */ + toLive: function(ctx, object) { + var gradient, prop, coords = fabric.util.object.clone(this.coords); + + if (!this.type) { + return; + } + + if (object.group && object.group.type === 'path-group') { + for (prop in coords) { + if (prop === 'x1' || prop === 'x2') { + coords[prop] += -this.offsetX + object.width / 2; + } + else if (prop === 'y1' || prop === 'y2') { + coords[prop] += -this.offsetY + object.height / 2; + } + } + } + + if (this.type === 'linear') { + gradient = ctx.createLinearGradient( + coords.x1, coords.y1, coords.x2, coords.y2); + } + else if (this.type === 'radial') { + gradient = ctx.createRadialGradient( + coords.x1, coords.y1, coords.r1, coords.x2, coords.y2, coords.r2); + } + + for (var i = 0, len = this.colorStops.length; i < len; i++) { + var color = this.colorStops[i].color, + opacity = this.colorStops[i].opacity, + offset = this.colorStops[i].offset; + + if (typeof opacity !== 'undefined') { + color = new fabric.Color(color).setAlpha(opacity).toRgba(); + } + gradient.addColorStop(parseFloat(offset), color); + } + + return gradient; + } + }); + + fabric.util.object.extend(fabric.Gradient, { + + /* _FROM_SVG_START_ */ + /** + * Returns {@link fabric.Gradient} instance from an SVG element + * @static + * @memberOf fabric.Gradient + * @param {SVGGradientElement} el SVG gradient element + * @param {fabric.Object} instance + * @return {fabric.Gradient} Gradient instance + * @see http://www.w3.org/TR/SVG/pservers.html#LinearGradientElement + * @see http://www.w3.org/TR/SVG/pservers.html#RadialGradientElement + */ + fromElement: function(el, instance) { + + /** + * @example: + * + * + * + * + * + * + * OR + * + * + * + * + * + * + * OR + * + * + * + * + * + * + * + * OR + * + * + * + * + * + * + * + */ + + var colorStopEls = el.getElementsByTagName('stop'), + type, + gradientUnits = el.getAttribute('gradientUnits') || 'objectBoundingBox', + gradientTransform = el.getAttribute('gradientTransform'), + colorStops = [], + coords, ellipseMatrix; + + if (el.nodeName === 'linearGradient' || el.nodeName === 'LINEARGRADIENT') { + type = 'linear'; + } + else { + type = 'radial'; + } + + if (type === 'linear') { + coords = getLinearCoords(el); + } + else if (type === 'radial') { + coords = getRadialCoords(el); + } + + for (var i = colorStopEls.length; i--; ) { + colorStops.push(getColorStop(colorStopEls[i])); + } + + ellipseMatrix = _convertPercentUnitsToValues(instance, coords, gradientUnits); + + var gradient = new fabric.Gradient({ + type: type, + coords: coords, + colorStops: colorStops, + offsetX: -instance.left, + offsetY: -instance.top + }); + + if (gradientTransform || ellipseMatrix !== '') { + gradient.gradientTransform = fabric.parseTransformAttribute((gradientTransform || '') + ellipseMatrix); + } + return gradient; + }, + /* _FROM_SVG_END_ */ + + /** + * Returns {@link fabric.Gradient} instance from its object representation + * @static + * @memberOf fabric.Gradient + * @param {Object} obj + * @param {Object} [options] Options object + */ + forObject: function(obj, options) { + options || (options = { }); + _convertPercentUnitsToValues(obj, options.coords, 'userSpaceOnUse'); + return new fabric.Gradient(options); + } + }); + + /** + * @private + */ + function _convertPercentUnitsToValues(object, options, gradientUnits) { + var propValue, addFactor = 0, multFactor = 1, ellipseMatrix = ''; + for (var prop in options) { + if (options[prop] === 'Infinity') { + options[prop] = 1; + } + else if (options[prop] === '-Infinity') { + options[prop] = 0; + } + propValue = parseFloat(options[prop], 10); + if (typeof options[prop] === 'string' && /^\d+%$/.test(options[prop])) { + multFactor = 0.01; + } + else { + multFactor = 1; + } + if (prop === 'x1' || prop === 'x2' || prop === 'r2') { + multFactor *= gradientUnits === 'objectBoundingBox' ? object.width : 1; + addFactor = gradientUnits === 'objectBoundingBox' ? object.left || 0 : 0; + } + else if (prop === 'y1' || prop === 'y2') { + multFactor *= gradientUnits === 'objectBoundingBox' ? object.height : 1; + addFactor = gradientUnits === 'objectBoundingBox' ? object.top || 0 : 0; + } + options[prop] = propValue * multFactor + addFactor; + } + if (object.type === 'ellipse' && + options.r2 !== null && + gradientUnits === 'objectBoundingBox' && + object.rx !== object.ry) { + + var scaleFactor = object.ry / object.rx; + ellipseMatrix = ' scale(1, ' + scaleFactor + ')'; + if (options.y1) { + options.y1 /= scaleFactor; + } + if (options.y2) { + options.y2 /= scaleFactor; + } + } + return ellipseMatrix; + } +})(); + + +/** + * Pattern class + * @class fabric.Pattern + * @see {@link http://fabricjs.com/patterns|Pattern demo} + * @see {@link http://fabricjs.com/dynamic-patterns|DynamicPattern demo} + * @see {@link fabric.Pattern#initialize} for constructor definition + */ +fabric.Pattern = fabric.util.createClass(/** @lends fabric.Pattern.prototype */ { + + /** + * Repeat property of a pattern (one of repeat, repeat-x, repeat-y or no-repeat) + * @type String + * @default + */ + repeat: 'repeat', + + /** + * Pattern horizontal offset from object's left/top corner + * @type Number + * @default + */ + offsetX: 0, + + /** + * Pattern vertical offset from object's left/top corner + * @type Number + * @default + */ + offsetY: 0, + + /** + * Constructor + * @param {Object} [options] Options object + * @return {fabric.Pattern} thisArg + */ + initialize: function(options) { + options || (options = { }); + + this.id = fabric.Object.__uid++; + + if (options.source) { + if (typeof options.source === 'string') { + // function string + if (typeof fabric.util.getFunctionBody(options.source) !== 'undefined') { + this.source = new Function(fabric.util.getFunctionBody(options.source)); + } + else { + // img src string + var _this = this; + this.source = fabric.util.createImage(); + fabric.util.loadImage(options.source, function(img) { + _this.source = img; + }); + } + } + else { + // img element + this.source = options.source; + } + } + if (options.repeat) { + this.repeat = options.repeat; + } + if (options.offsetX) { + this.offsetX = options.offsetX; + } + if (options.offsetY) { + this.offsetY = options.offsetY; + } + }, + + /** + * Returns object representation of a pattern + * @return {Object} Object representation of a pattern instance + */ + toObject: function() { + + var source; + + // callback + if (typeof this.source === 'function') { + source = String(this.source); + } + // element + else if (typeof this.source.src === 'string') { + source = this.source.src; + } + // element + else if (typeof this.source === 'object' && this.source.toDataURL) { + source = this.source.toDataURL(); + } + + return { + source: source, + repeat: this.repeat, + offsetX: this.offsetX, + offsetY: this.offsetY + }; + }, + + /* _TO_SVG_START_ */ + /** + * Returns SVG representation of a pattern + * @param {fabric.Object} object + * @return {String} SVG representation of a pattern + */ + toSVG: function(object) { + var patternSource = typeof this.source === 'function' ? this.source() : this.source, + patternWidth = patternSource.width / object.getWidth(), + patternHeight = patternSource.height / object.getHeight(), + patternOffsetX = this.offsetX / object.getWidth(), + patternOffsetY = this.offsetY / object.getHeight(), + patternImgSrc = ''; + if (this.repeat === 'repeat-x' || this.repeat === 'no-repeat') { + patternHeight = 1; + } + if (this.repeat === 'repeat-y' || this.repeat === 'no-repeat') { + patternWidth = 1; + } + if (patternSource.src) { + patternImgSrc = patternSource.src; + } + else if (patternSource.toDataURL) { + patternImgSrc = patternSource.toDataURL(); + } + + return '\n' + + '\n' + + '\n'; + }, + /* _TO_SVG_END_ */ + + /** + * Returns an instance of CanvasPattern + * @param {CanvasRenderingContext2D} ctx Context to create pattern + * @return {CanvasPattern} + */ + toLive: function(ctx) { + var source = typeof this.source === 'function' + ? this.source() + : this.source; + + // if the image failed to load, return, and allow rest to continue loading + if (!source) { + return ''; + } + + // if an image + if (typeof source.src !== 'undefined') { + if (!source.complete) { + return ''; + } + if (source.naturalWidth === 0 || source.naturalHeight === 0) { + return ''; + } + } + return ctx.createPattern(source, this.repeat); + } +}); + + +(function(global) { + + 'use strict'; + + var fabric = global.fabric || (global.fabric = { }), + toFixed = fabric.util.toFixed; + + if (fabric.Shadow) { + fabric.warn('fabric.Shadow is already defined.'); + return; + } + + /** + * Shadow class + * @class fabric.Shadow + * @see {@link http://fabricjs.com/shadows|Shadow demo} + * @see {@link fabric.Shadow#initialize} for constructor definition + */ + fabric.Shadow = fabric.util.createClass(/** @lends fabric.Shadow.prototype */ { + + /** + * Shadow color + * @type String + * @default + */ + color: 'rgb(0,0,0)', + + /** + * Shadow blur + * @type Number + */ + blur: 0, + + /** + * Shadow horizontal offset + * @type Number + * @default + */ + offsetX: 0, + + /** + * Shadow vertical offset + * @type Number + * @default + */ + offsetY: 0, + + /** + * Whether the shadow should affect stroke operations + * @type Boolean + * @default + */ + affectStroke: false, + + /** + * Indicates whether toObject should include default values + * @type Boolean + * @default + */ + includeDefaultValues: true, + + /** + * Constructor + * @param {Object|String} [options] Options object with any of color, blur, offsetX, offsetX properties or string (e.g. "rgba(0,0,0,0.2) 2px 2px 10px, "2px 2px 10px rgba(0,0,0,0.2)") + * @return {fabric.Shadow} thisArg + */ + initialize: function(options) { + + if (typeof options === 'string') { + options = this._parseShadow(options); + } + + for (var prop in options) { + this[prop] = options[prop]; + } + + this.id = fabric.Object.__uid++; + }, + + /** + * @private + * @param {String} shadow Shadow value to parse + * @return {Object} Shadow object with color, offsetX, offsetY and blur + */ + _parseShadow: function(shadow) { + var shadowStr = shadow.trim(), + offsetsAndBlur = fabric.Shadow.reOffsetsAndBlur.exec(shadowStr) || [], + color = shadowStr.replace(fabric.Shadow.reOffsetsAndBlur, '') || 'rgb(0,0,0)'; + + return { + color: color.trim(), + offsetX: parseInt(offsetsAndBlur[1], 10) || 0, + offsetY: parseInt(offsetsAndBlur[2], 10) || 0, + blur: parseInt(offsetsAndBlur[3], 10) || 0 + }; + }, + + /** + * Returns a string representation of an instance + * @see http://www.w3.org/TR/css-text-decor-3/#text-shadow + * @return {String} Returns CSS3 text-shadow declaration + */ + toString: function() { + return [this.offsetX, this.offsetY, this.blur, this.color].join('px '); + }, + + /* _TO_SVG_START_ */ + /** + * Returns SVG representation of a shadow + * @param {fabric.Object} object + * @return {String} SVG representation of a shadow + */ + toSVG: function(object) { + var fBoxX = 40, fBoxY = 40, NUM_FRACTION_DIGITS = fabric.Object.NUM_FRACTION_DIGITS, + offset = fabric.util.rotateVector( + { x: this.offsetX, y: this.offsetY }, + fabric.util.degreesToRadians(-object.angle)), + BLUR_BOX = 20; + + if (object.width && object.height) { + //http://www.w3.org/TR/SVG/filters.html#FilterEffectsRegion + // we add some extra space to filter box to contain the blur ( 20 ) + fBoxX = toFixed((Math.abs(offset.x) + this.blur) / object.width, NUM_FRACTION_DIGITS) * 100 + BLUR_BOX; + fBoxY = toFixed((Math.abs(offset.y) + this.blur) / object.height, NUM_FRACTION_DIGITS) * 100 + BLUR_BOX; + } + if (object.flipX) { + offset.x *= -1; + } + if (object.flipY) { + offset.y *= -1; + } + return ( + '\n' + + '\t\n' + + '\t\n' + + '\t\n' + + '\t\n' + + '\t\n' + + '\t\t\n' + + '\t\t\n' + + '\t\n' + + '\n'); + }, + /* _TO_SVG_END_ */ + + /** + * Returns object representation of a shadow + * @return {Object} Object representation of a shadow instance + */ + toObject: function() { + if (this.includeDefaultValues) { + return { + color: this.color, + blur: this.blur, + offsetX: this.offsetX, + offsetY: this.offsetY, + affectStroke: this.affectStroke + }; + } + var obj = { }, proto = fabric.Shadow.prototype; + + ['color', 'blur', 'offsetX', 'offsetY', 'affectStroke'].forEach(function(prop) { + if (this[prop] !== proto[prop]) { + obj[prop] = this[prop]; + } + }, this); + + return obj; + } + }); + + /** + * Regex matching shadow offsetX, offsetY and blur (ex: "2px 2px 10px rgba(0,0,0,0.2)", "rgb(0,255,0) 2px 2px") + * @static + * @field + * @memberOf fabric.Shadow + */ + // eslint-disable-next-line max-len + fabric.Shadow.reOffsetsAndBlur = /(?:\s|^)(-?\d+(?:px)?(?:\s?|$))?(-?\d+(?:px)?(?:\s?|$))?(\d+(?:px)?)?(?:\s?|$)(?:$|\s)/; + +})(typeof exports !== 'undefined' ? exports : this); + + +(function () { + + 'use strict'; + + if (fabric.StaticCanvas) { + fabric.warn('fabric.StaticCanvas is already defined.'); + return; + } + + // aliases for faster resolution + var extend = fabric.util.object.extend, + getElementOffset = fabric.util.getElementOffset, + removeFromArray = fabric.util.removeFromArray, + toFixed = fabric.util.toFixed, + + CANVAS_INIT_ERROR = new Error('Could not initialize `canvas` element'); + + /** + * Static canvas class + * @class fabric.StaticCanvas + * @mixes fabric.Collection + * @mixes fabric.Observable + * @see {@link http://fabricjs.com/static_canvas|StaticCanvas demo} + * @see {@link fabric.StaticCanvas#initialize} for constructor definition + * @fires before:render + * @fires after:render + * @fires canvas:cleared + * @fires object:added + * @fires object:removed + */ + fabric.StaticCanvas = fabric.util.createClass(/** @lends fabric.StaticCanvas.prototype */ { + + /** + * Constructor + * @param {HTMLElement | String} el <canvas> element to initialize instance on + * @param {Object} [options] Options object + * @return {Object} thisArg + */ + initialize: function(el, options) { + options || (options = { }); + + this._initStatic(el, options); + }, + + /** + * Background color of canvas instance. + * Should be set via {@link fabric.StaticCanvas#setBackgroundColor}. + * @type {(String|fabric.Pattern)} + * @default + */ + backgroundColor: '', + + /** + * Background image of canvas instance. + * Should be set via {@link fabric.StaticCanvas#setBackgroundImage}. + * Backwards incompatibility note: The "backgroundImageOpacity" + * and "backgroundImageStretch" properties are deprecated since 1.3.9. + * Use {@link fabric.Image#opacity}, {@link fabric.Image#width} and {@link fabric.Image#height}. + * @type fabric.Image + * @default + */ + backgroundImage: null, + + /** + * Overlay color of canvas instance. + * Should be set via {@link fabric.StaticCanvas#setOverlayColor} + * @since 1.3.9 + * @type {(String|fabric.Pattern)} + * @default + */ + overlayColor: '', + + /** + * Overlay image of canvas instance. + * Should be set via {@link fabric.StaticCanvas#setOverlayImage}. + * Backwards incompatibility note: The "overlayImageLeft" + * and "overlayImageTop" properties are deprecated since 1.3.9. + * Use {@link fabric.Image#left} and {@link fabric.Image#top}. + * @type fabric.Image + * @default + */ + overlayImage: null, + + /** + * Indicates whether toObject/toDatalessObject should include default values + * @type Boolean + * @default + */ + includeDefaultValues: true, + + /** + * Indicates whether objects' state should be saved + * @type Boolean + * @default + */ + stateful: true, + + /** + * Indicates whether {@link fabric.Collection.add}, {@link fabric.Collection.insertAt} and {@link fabric.Collection.remove} should also re-render canvas. + * Disabling this option could give a great performance boost when adding/removing a lot of objects to/from canvas at once + * (followed by a manual rendering after addition/deletion) + * @type Boolean + * @default + */ + renderOnAddRemove: true, + + /** + * Function that determines clipping of entire canvas area + * Being passed context as first argument. See clipping canvas area in {@link https://github.com/kangax/fabric.js/wiki/FAQ} + * @type Function + * @default + */ + clipTo: null, + + /** + * Indicates whether object controls (borders/controls) are rendered above overlay image + * @type Boolean + * @default + */ + controlsAboveOverlay: false, + + /** + * Indicates whether the browser can be scrolled when using a touchscreen and dragging on the canvas + * @type Boolean + * @default + */ + allowTouchScrolling: false, + + /** + * Indicates whether this canvas will use image smoothing, this is on by default in browsers + * @type Boolean + * @default + */ + imageSmoothingEnabled: true, + + /** + * The transformation (in the format of Canvas transform) which focuses the viewport + * @type Array + * @default + */ + viewportTransform: [1, 0, 0, 1, 0, 0], + + /** + * if set to false background image is not affected by viewport transform + * @since 1.6.3 + * @type Boolean + * @default + */ + backgroundVpt: true, + + /** + * if set to false overlya image is not affected by viewport transform + * @since 1.6.3 + * @type Boolean + * @default + */ + overlayVpt: true, + + /** + * Callback; invoked right before object is about to be scaled/rotated + */ + onBeforeScaleRotate: function () { + /* NOOP */ + }, + + /** + * When true, canvas is scaled by devicePixelRatio for better rendering on retina screens + */ + enableRetinaScaling: true, + + /** + * @private + * @param {HTMLElement | String} el <canvas> element to initialize instance on + * @param {Object} [options] Options object + */ + _initStatic: function(el, options) { + var cb = fabric.StaticCanvas.prototype.renderAll.bind(this); + this._objects = []; + this._createLowerCanvas(el); + this._initOptions(options); + this._setImageSmoothing(); + // only initialize retina scaling once + if (!this.interactive) { + this._initRetinaScaling(); + } + + if (options.overlayImage) { + this.setOverlayImage(options.overlayImage, cb); + } + if (options.backgroundImage) { + this.setBackgroundImage(options.backgroundImage, cb); + } + if (options.backgroundColor) { + this.setBackgroundColor(options.backgroundColor, cb); + } + if (options.overlayColor) { + this.setOverlayColor(options.overlayColor, cb); + } + this.calcOffset(); + }, + + /** + * @private + */ + _isRetinaScaling: function() { + return (fabric.devicePixelRatio !== 1 && this.enableRetinaScaling); + }, + + /** + * @private + * @return {Number} retinaScaling if applied, otherwise 1; + */ + getRetinaScaling: function() { + return this._isRetinaScaling() ? fabric.devicePixelRatio : 1; + }, + + /** + * @private + */ + _initRetinaScaling: function() { + if (!this._isRetinaScaling()) { + return; + } + this.lowerCanvasEl.setAttribute('width', this.width * fabric.devicePixelRatio); + this.lowerCanvasEl.setAttribute('height', this.height * fabric.devicePixelRatio); + + this.contextContainer.scale(fabric.devicePixelRatio, fabric.devicePixelRatio); + }, + + /** + * Calculates canvas element offset relative to the document + * This method is also attached as "resize" event handler of window + * @return {fabric.Canvas} instance + * @chainable + */ + calcOffset: function () { + this._offset = getElementOffset(this.lowerCanvasEl); + return this; + }, + + /** + * Sets {@link fabric.StaticCanvas#overlayImage|overlay image} for this canvas + * @param {(fabric.Image|String)} image fabric.Image instance or URL of an image to set overlay to + * @param {Function} callback callback to invoke when image is loaded and set as an overlay + * @param {Object} [options] Optional options to set for the {@link fabric.Image|overlay image}. + * @return {fabric.Canvas} thisArg + * @chainable + * @see {@link http://jsfiddle.net/fabricjs/MnzHT/|jsFiddle demo} + * @example Normal overlayImage with left/top = 0 + * canvas.setOverlayImage('http://fabricjs.com/assets/jail_cell_bars.png', canvas.renderAll.bind(canvas), { + * // Needed to position overlayImage at 0/0 + * originX: 'left', + * originY: 'top' + * }); + * @example overlayImage with different properties + * canvas.setOverlayImage('http://fabricjs.com/assets/jail_cell_bars.png', canvas.renderAll.bind(canvas), { + * opacity: 0.5, + * angle: 45, + * left: 400, + * top: 400, + * originX: 'left', + * originY: 'top' + * }); + * @example Stretched overlayImage #1 - width/height correspond to canvas width/height + * fabric.Image.fromURL('http://fabricjs.com/assets/jail_cell_bars.png', function(img) { + * img.set({width: canvas.width, height: canvas.height, originX: 'left', originY: 'top'}); + * canvas.setOverlayImage(img, canvas.renderAll.bind(canvas)); + * }); + * @example Stretched overlayImage #2 - width/height correspond to canvas width/height + * canvas.setOverlayImage('http://fabricjs.com/assets/jail_cell_bars.png', canvas.renderAll.bind(canvas), { + * width: canvas.width, + * height: canvas.height, + * // Needed to position overlayImage at 0/0 + * originX: 'left', + * originY: 'top' + * }); + * @example overlayImage loaded from cross-origin + * canvas.setOverlayImage('http://fabricjs.com/assets/jail_cell_bars.png', canvas.renderAll.bind(canvas), { + * opacity: 0.5, + * angle: 45, + * left: 400, + * top: 400, + * originX: 'left', + * originY: 'top', + * crossOrigin: 'anonymous' + * }); + */ + setOverlayImage: function (image, callback, options) { + return this.__setBgOverlayImage('overlayImage', image, callback, options); + }, + + /** + * Sets {@link fabric.StaticCanvas#backgroundImage|background image} for this canvas + * @param {(fabric.Image|String)} image fabric.Image instance or URL of an image to set background to + * @param {Function} callback Callback to invoke when image is loaded and set as background + * @param {Object} [options] Optional options to set for the {@link fabric.Image|background image}. + * @return {fabric.Canvas} thisArg + * @chainable + * @see {@link http://jsfiddle.net/fabricjs/YH9yD/|jsFiddle demo} + * @example Normal backgroundImage with left/top = 0 + * canvas.setBackgroundImage('http://fabricjs.com/assets/honey_im_subtle.png', canvas.renderAll.bind(canvas), { + * // Needed to position backgroundImage at 0/0 + * originX: 'left', + * originY: 'top' + * }); + * @example backgroundImage with different properties + * canvas.setBackgroundImage('http://fabricjs.com/assets/honey_im_subtle.png', canvas.renderAll.bind(canvas), { + * opacity: 0.5, + * angle: 45, + * left: 400, + * top: 400, + * originX: 'left', + * originY: 'top' + * }); + * @example Stretched backgroundImage #1 - width/height correspond to canvas width/height + * fabric.Image.fromURL('http://fabricjs.com/assets/honey_im_subtle.png', function(img) { + * img.set({width: canvas.width, height: canvas.height, originX: 'left', originY: 'top'}); + * canvas.setBackgroundImage(img, canvas.renderAll.bind(canvas)); + * }); + * @example Stretched backgroundImage #2 - width/height correspond to canvas width/height + * canvas.setBackgroundImage('http://fabricjs.com/assets/honey_im_subtle.png', canvas.renderAll.bind(canvas), { + * width: canvas.width, + * height: canvas.height, + * // Needed to position backgroundImage at 0/0 + * originX: 'left', + * originY: 'top' + * }); + * @example backgroundImage loaded from cross-origin + * canvas.setBackgroundImage('http://fabricjs.com/assets/honey_im_subtle.png', canvas.renderAll.bind(canvas), { + * opacity: 0.5, + * angle: 45, + * left: 400, + * top: 400, + * originX: 'left', + * originY: 'top', + * crossOrigin: 'anonymous' + * }); + */ + setBackgroundImage: function (image, callback, options) { + return this.__setBgOverlayImage('backgroundImage', image, callback, options); + }, + + /** + * Sets {@link fabric.StaticCanvas#overlayColor|background color} for this canvas + * @param {(String|fabric.Pattern)} overlayColor Color or pattern to set background color to + * @param {Function} callback Callback to invoke when background color is set + * @return {fabric.Canvas} thisArg + * @chainable + * @see {@link http://jsfiddle.net/fabricjs/pB55h/|jsFiddle demo} + * @example Normal overlayColor - color value + * canvas.setOverlayColor('rgba(255, 73, 64, 0.6)', canvas.renderAll.bind(canvas)); + * @example fabric.Pattern used as overlayColor + * canvas.setOverlayColor({ + * source: 'http://fabricjs.com/assets/escheresque_ste.png' + * }, canvas.renderAll.bind(canvas)); + * @example fabric.Pattern used as overlayColor with repeat and offset + * canvas.setOverlayColor({ + * source: 'http://fabricjs.com/assets/escheresque_ste.png', + * repeat: 'repeat', + * offsetX: 200, + * offsetY: 100 + * }, canvas.renderAll.bind(canvas)); + */ + setOverlayColor: function(overlayColor, callback) { + return this.__setBgOverlayColor('overlayColor', overlayColor, callback); + }, + + /** + * Sets {@link fabric.StaticCanvas#backgroundColor|background color} for this canvas + * @param {(String|fabric.Pattern)} backgroundColor Color or pattern to set background color to + * @param {Function} callback Callback to invoke when background color is set + * @return {fabric.Canvas} thisArg + * @chainable + * @see {@link http://jsfiddle.net/fabricjs/hXzvk/|jsFiddle demo} + * @example Normal backgroundColor - color value + * canvas.setBackgroundColor('rgba(255, 73, 64, 0.6)', canvas.renderAll.bind(canvas)); + * @example fabric.Pattern used as backgroundColor + * canvas.setBackgroundColor({ + * source: 'http://fabricjs.com/assets/escheresque_ste.png' + * }, canvas.renderAll.bind(canvas)); + * @example fabric.Pattern used as backgroundColor with repeat and offset + * canvas.setBackgroundColor({ + * source: 'http://fabricjs.com/assets/escheresque_ste.png', + * repeat: 'repeat', + * offsetX: 200, + * offsetY: 100 + * }, canvas.renderAll.bind(canvas)); + */ + setBackgroundColor: function(backgroundColor, callback) { + return this.__setBgOverlayColor('backgroundColor', backgroundColor, callback); + }, + + /** + * @private + * @see {@link http://www.whatwg.org/specs/web-apps/current-work/multipage/the-canvas-element.html#dom-context-2d-imagesmoothingenabled|WhatWG Canvas Standard} + */ + _setImageSmoothing: function() { + var ctx = this.getContext(); + + ctx.imageSmoothingEnabled = ctx.imageSmoothingEnabled || ctx.webkitImageSmoothingEnabled + || ctx.mozImageSmoothingEnabled || ctx.msImageSmoothingEnabled || ctx.oImageSmoothingEnabled; + ctx.imageSmoothingEnabled = this.imageSmoothingEnabled; + }, + + /** + * @private + * @param {String} property Property to set ({@link fabric.StaticCanvas#backgroundImage|backgroundImage} + * or {@link fabric.StaticCanvas#overlayImage|overlayImage}) + * @param {(fabric.Image|String|null)} image fabric.Image instance, URL of an image or null to set background or overlay to + * @param {Function} callback Callback to invoke when image is loaded and set as background or overlay + * @param {Object} [options] Optional options to set for the {@link fabric.Image|image}. + */ + __setBgOverlayImage: function(property, image, callback, options) { + if (typeof image === 'string') { + fabric.util.loadImage(image, function(img) { + img && (this[property] = new fabric.Image(img, options)); + callback && callback(img); + }, this, options && options.crossOrigin); + } + else { + options && image.setOptions(options); + this[property] = image; + callback && callback(image); + } + + return this; + }, + + /** + * @private + * @param {String} property Property to set ({@link fabric.StaticCanvas#backgroundColor|backgroundColor} + * or {@link fabric.StaticCanvas#overlayColor|overlayColor}) + * @param {(Object|String|null)} color Object with pattern information, color value or null + * @param {Function} [callback] Callback is invoked when color is set + */ + __setBgOverlayColor: function(property, color, callback) { + if (color && color.source) { + var _this = this; + fabric.util.loadImage(color.source, function(img) { + _this[property] = new fabric.Pattern({ + source: img, + repeat: color.repeat, + offsetX: color.offsetX, + offsetY: color.offsetY + }); + callback && callback(); + }); + } + else { + this[property] = color; + callback && callback(); + } + + return this; + }, + + /** + * @private + */ + _createCanvasElement: function(canvasEl) { + var element = fabric.util.createCanvasElement(canvasEl) + if (!element.style) { + element.style = { }; + } + if (!element) { + throw CANVAS_INIT_ERROR; + } + if (typeof element.getContext === 'undefined') { + throw CANVAS_INIT_ERROR; + } + return element; + }, + + /** + * @private + * @param {Object} [options] Options object + */ + _initOptions: function (options) { + for (var prop in options) { + this[prop] = options[prop]; + } + + this.width = this.width || parseInt(this.lowerCanvasEl.width, 10) || 0; + this.height = this.height || parseInt(this.lowerCanvasEl.height, 10) || 0; + + if (!this.lowerCanvasEl.style) { + return; + } + + this.lowerCanvasEl.width = this.width; + this.lowerCanvasEl.height = this.height; + + this.lowerCanvasEl.style.width = this.width + 'px'; + this.lowerCanvasEl.style.height = this.height + 'px'; + + this.viewportTransform = this.viewportTransform.slice(); + }, + + /** + * Creates a bottom canvas + * @private + * @param {HTMLElement} [canvasEl] + */ + _createLowerCanvas: function (canvasEl) { + this.lowerCanvasEl = fabric.util.getById(canvasEl) || this._createCanvasElement(canvasEl); + + fabric.util.addClass(this.lowerCanvasEl, 'lower-canvas'); + + if (this.interactive) { + this._applyCanvasStyle(this.lowerCanvasEl); + } + + this.contextContainer = this.lowerCanvasEl.getContext('2d'); + }, + + /** + * Returns canvas width (in px) + * @return {Number} + */ + getWidth: function () { + return this.width; + }, + + /** + * Returns canvas height (in px) + * @return {Number} + */ + getHeight: function () { + return this.height; + }, + + /** + * Sets width of this canvas instance + * @param {Number|String} value Value to set width to + * @param {Object} [options] Options object + * @param {Boolean} [options.backstoreOnly=false] Set the given dimensions only as canvas backstore dimensions + * @param {Boolean} [options.cssOnly=false] Set the given dimensions only as css dimensions + * @return {fabric.Canvas} instance + * @chainable true + */ + setWidth: function (value, options) { + return this.setDimensions({ width: value }, options); + }, + + /** + * Sets height of this canvas instance + * @param {Number|String} value Value to set height to + * @param {Object} [options] Options object + * @param {Boolean} [options.backstoreOnly=false] Set the given dimensions only as canvas backstore dimensions + * @param {Boolean} [options.cssOnly=false] Set the given dimensions only as css dimensions + * @return {fabric.Canvas} instance + * @chainable true + */ + setHeight: function (value, options) { + return this.setDimensions({ height: value }, options); + }, + + /** + * Sets dimensions (width, height) of this canvas instance. when options.cssOnly flag active you should also supply the unit of measure (px/%/em) + * @param {Object} dimensions Object with width/height properties + * @param {Number|String} [dimensions.width] Width of canvas element + * @param {Number|String} [dimensions.height] Height of canvas element + * @param {Object} [options] Options object + * @param {Boolean} [options.backstoreOnly=false] Set the given dimensions only as canvas backstore dimensions + * @param {Boolean} [options.cssOnly=false] Set the given dimensions only as css dimensions + * @return {fabric.Canvas} thisArg + * @chainable + */ + setDimensions: function (dimensions, options) { + var cssValue; + + options = options || {}; + + for (var prop in dimensions) { + cssValue = dimensions[prop]; + + if (!options.cssOnly) { + this._setBackstoreDimension(prop, dimensions[prop]); + cssValue += 'px'; + } + + if (!options.backstoreOnly) { + this._setCssDimension(prop, cssValue); + } + } + this._initRetinaScaling(); + this._setImageSmoothing(); + this.calcOffset(); + + if (!options.cssOnly) { + this.renderAll(); + } + + return this; + }, + + /** + * Helper for setting width/height + * @private + * @param {String} prop property (width|height) + * @param {Number} value value to set property to + * @return {fabric.Canvas} instance + * @chainable true + */ + _setBackstoreDimension: function (prop, value) { + this.lowerCanvasEl[prop] = value; + + if (this.upperCanvasEl) { + this.upperCanvasEl[prop] = value; + } + + if (this.cacheCanvasEl) { + this.cacheCanvasEl[prop] = value; + } + + this[prop] = value; + + return this; + }, + + /** + * Helper for setting css width/height + * @private + * @param {String} prop property (width|height) + * @param {String} value value to set property to + * @return {fabric.Canvas} instance + * @chainable true + */ + _setCssDimension: function (prop, value) { + this.lowerCanvasEl.style[prop] = value; + + if (this.upperCanvasEl) { + this.upperCanvasEl.style[prop] = value; + } + + if (this.wrapperEl) { + this.wrapperEl.style[prop] = value; + } + + return this; + }, + + /** + * Returns canvas zoom level + * @return {Number} + */ + getZoom: function () { + return Math.sqrt(this.viewportTransform[0] * this.viewportTransform[3]); + }, + + /** + * Sets viewport transform of this canvas instance + * @param {Array} vpt the transform in the form of context.transform + * @return {fabric.Canvas} instance + * @chainable true + */ + setViewportTransform: function (vpt) { + var activeGroup = this._activeGroup, object; + this.viewportTransform = vpt; + for (var i = 0, len = this._objects.length; i < len; i++) { + object = this._objects[i]; + object.group || object.setCoords(); + } + if (activeGroup) { + activeGroup.setCoords(); + } + this.renderAll(); + return this; + }, + + /** + * Sets zoom level of this canvas instance, zoom centered around point + * @param {fabric.Point} point to zoom with respect to + * @param {Number} value to set zoom to, less than 1 zooms out + * @return {fabric.Canvas} instance + * @chainable true + */ + zoomToPoint: function (point, value) { + // TODO: just change the scale, preserve other transformations + var before = point, vpt = this.viewportTransform.slice(0); + point = fabric.util.transformPoint(point, fabric.util.invertTransform(this.viewportTransform)); + vpt[0] = value; + vpt[3] = value; + var after = fabric.util.transformPoint(point, vpt); + vpt[4] += before.x - after.x; + vpt[5] += before.y - after.y; + return this.setViewportTransform(vpt); + }, + + /** + * Sets zoom level of this canvas instance + * @param {Number} value to set zoom to, less than 1 zooms out + * @return {fabric.Canvas} instance + * @chainable true + */ + setZoom: function (value) { + this.zoomToPoint(new fabric.Point(0, 0), value); + return this; + }, + + /** + * Pan viewport so as to place point at top left corner of canvas + * @param {fabric.Point} point to move to + * @return {fabric.Canvas} instance + * @chainable true + */ + absolutePan: function (point) { + var vpt = this.viewportTransform.slice(0); + vpt[4] = -point.x; + vpt[5] = -point.y; + return this.setViewportTransform(vpt); + }, + + /** + * Pans viewpoint relatively + * @param {fabric.Point} point (position vector) to move by + * @return {fabric.Canvas} instance + * @chainable true + */ + relativePan: function (point) { + return this.absolutePan(new fabric.Point( + -point.x - this.viewportTransform[4], + -point.y - this.viewportTransform[5] + )); + }, + + /** + * Returns <canvas> element corresponding to this instance + * @return {HTMLCanvasElement} + */ + getElement: function () { + return this.lowerCanvasEl; + }, + + /** + * @private + * @param {fabric.Object} obj Object that was added + */ + _onObjectAdded: function(obj) { + this.stateful && obj.setupState(); + obj._set('canvas', this); + obj.setCoords(); + this.fire('object:added', { target: obj }); + obj.fire('added'); + }, + + /** + * @private + * @param {fabric.Object} obj Object that was removed + */ + _onObjectRemoved: function(obj) { + this.fire('object:removed', { target: obj }); + obj.fire('removed'); + delete obj.canvas; + }, + + /** + * Clears specified context of canvas element + * @param {CanvasRenderingContext2D} ctx Context to clear + * @return {fabric.Canvas} thisArg + * @chainable + */ + clearContext: function(ctx) { + ctx.clearRect(0, 0, this.width, this.height); + return this; + }, + + /** + * Returns context of canvas where objects are drawn + * @return {CanvasRenderingContext2D} + */ + getContext: function () { + return this.contextContainer; + }, + + /** + * Clears all contexts (background, main, top) of an instance + * @return {fabric.Canvas} thisArg + * @chainable + */ + clear: function () { + this._objects.length = 0; + this.backgroundImage = null; + this.overlayImage = null; + this.backgroundColor = ''; + this.overlayColor = '' + if (this._hasITextHandlers) { + this.off('selection:cleared', this._canvasITextSelectionClearedHanlder); + this.off('object:selected', this._canvasITextSelectionClearedHanlder); + this.off('mouse:up', this._mouseUpITextHandler); + this._iTextInstances = null; + this._hasITextHandlers = false; + } + this.clearContext(this.contextContainer); + this.fire('canvas:cleared'); + this.renderAll(); + return this; + }, + + /** + * Renders both the canvas. + * @return {fabric.Canvas} instance + * @chainable + */ + renderAll: function () { + var canvasToDrawOn = this.contextContainer; + this.renderCanvas(canvasToDrawOn, this._objects); + return this; + }, + + /** + * Renders background, objects, overlay and controls. + * @param {CanvasRenderingContext2D} ctx + * @param {Array} objects to render + * @return {fabric.Canvas} instance + * @chainable + */ + renderCanvas: function(ctx, objects) { + this.clearContext(ctx); + this.fire('before:render'); + if (this.clipTo) { + fabric.util.clipContext(this, ctx); + } + this._renderBackground(ctx); + + ctx.save(); + //apply viewport transform once for all rendering process + ctx.transform.apply(ctx, this.viewportTransform); + this._renderObjects(ctx, objects); + ctx.restore(); + if (!this.controlsAboveOverlay && this.interactive) { + this.drawControls(ctx); + } + if (this.clipTo) { + ctx.restore(); + } + this._renderOverlay(ctx); + if (this.controlsAboveOverlay && this.interactive) { + this.drawControls(ctx); + } + this.fire('after:render'); + }, + + /** + * @private + * @param {CanvasRenderingContext2D} ctx Context to render on + * @param {Array} objects to render + */ + _renderObjects: function(ctx, objects) { + for (var i = 0, length = objects.length; i < length; ++i) { + objects[i] && objects[i].render(ctx); + } + }, + + /** + * @private + * @param {CanvasRenderingContext2D} ctx Context to render on + * @param {string} property 'background' or 'overlay' + */ + _renderBackgroundOrOverlay: function(ctx, property) { + var object = this[property + 'Color']; + if (object) { + ctx.fillStyle = object.toLive + ? object.toLive(ctx) + : object; + + ctx.fillRect( + object.offsetX || 0, + object.offsetY || 0, + this.width, + this.height); + } + object = this[property + 'Image']; + if (object) { + if (this[property + 'Vpt']) { + ctx.save(); + ctx.transform.apply(ctx, this.viewportTransform); + } + object.render(ctx); + this[property + 'Vpt'] && ctx.restore(); + } + }, + + /** + * @private + * @param {CanvasRenderingContext2D} ctx Context to render on + */ + _renderBackground: function(ctx) { + this._renderBackgroundOrOverlay(ctx, 'background'); + }, + + /** + * @private + * @param {CanvasRenderingContext2D} ctx Context to render on + */ + _renderOverlay: function(ctx) { + this._renderBackgroundOrOverlay(ctx, 'overlay'); + }, + + /** + * Returns coordinates of a center of canvas. + * Returned value is an object with top and left properties + * @return {Object} object with "top" and "left" number values + */ + getCenter: function () { + return { + top: this.getHeight() / 2, + left: this.getWidth() / 2 + }; + }, + + /** + * Centers object horizontally in the canvas + * You might need to call `setCoords` on an object after centering, to update controls area. + * @param {fabric.Object} object Object to center horizontally + * @return {fabric.Canvas} thisArg + */ + centerObjectH: function (object) { + return this._centerObject(object, new fabric.Point(this.getCenter().left, object.getCenterPoint().y)); + }, + + /** + * Centers object vertically in the canvas + * You might need to call `setCoords` on an object after centering, to update controls area. + * @param {fabric.Object} object Object to center vertically + * @return {fabric.Canvas} thisArg + * @chainable + */ + centerObjectV: function (object) { + return this._centerObject(object, new fabric.Point(object.getCenterPoint().x, this.getCenter().top)); + }, + + /** + * Centers object vertically and horizontally in the canvas + * You might need to call `setCoords` on an object after centering, to update controls area. + * @param {fabric.Object} object Object to center vertically and horizontally + * @return {fabric.Canvas} thisArg + * @chainable + */ + centerObject: function(object) { + var center = this.getCenter(); + + return this._centerObject(object, new fabric.Point(center.left, center.top)); + }, + + /** + * Centers object vertically and horizontally in the viewport + * You might need to call `setCoords` on an object after centering, to update controls area. + * @param {fabric.Object} object Object to center vertically and horizontally + * @return {fabric.Canvas} thisArg + * @chainable + */ + viewportCenterObject: function(object) { + var vpCenter = this.getVpCenter(); + + return this._centerObject(object, vpCenter); + }, + + /** + * Centers object horizontally in the viewport, object.top is unchanged + * You might need to call `setCoords` on an object after centering, to update controls area. + * @param {fabric.Object} object Object to center vertically and horizontally + * @return {fabric.Canvas} thisArg + * @chainable + */ + viewportCenterObjectH: function(object) { + var vpCenter = this.getVpCenter(); + this._centerObject(object, new fabric.Point(vpCenter.x, object.getCenterPoint().y)); + return this; + }, + + /** + * Centers object Vertically in the viewport, object.top is unchanged + * You might need to call `setCoords` on an object after centering, to update controls area. + * @param {fabric.Object} object Object to center vertically and horizontally + * @return {fabric.Canvas} thisArg + * @chainable + */ + viewportCenterObjectV: function(object) { + var vpCenter = this.getVpCenter(); + + return this._centerObject(object, new fabric.Point(object.getCenterPoint().x, vpCenter.y)); + }, + + /** + * Calculate the point in canvas that correspond to the center of actual viewport. + * @return {fabric.Point} vpCenter, viewport center + * @chainable + */ + getVpCenter: function() { + var center = this.getCenter(), + iVpt = fabric.util.invertTransform(this.viewportTransform); + return fabric.util.transformPoint({ x: center.left, y: center.top }, iVpt); + }, + + /** + * @private + * @param {fabric.Object} object Object to center + * @param {fabric.Point} center Center point + * @return {fabric.Canvas} thisArg + * @chainable + */ + _centerObject: function(object, center) { + object.setPositionByOrigin(center, 'center', 'center'); + this.renderAll(); + return this; + }, + + /** + * Returs dataless JSON representation of canvas + * @param {Array} [propertiesToInclude] Any properties that you might want to additionally include in the output + * @return {String} json string + */ + toDatalessJSON: function (propertiesToInclude) { + return this.toDatalessObject(propertiesToInclude); + }, + + /** + * Returns object representation of canvas + * @param {Array} [propertiesToInclude] Any properties that you might want to additionally include in the output + * @return {Object} object representation of an instance + */ + toObject: function (propertiesToInclude) { + return this._toObjectMethod('toObject', propertiesToInclude); + }, + + /** + * Returns dataless object representation of canvas + * @param {Array} [propertiesToInclude] Any properties that you might want to additionally include in the output + * @return {Object} object representation of an instance + */ + toDatalessObject: function (propertiesToInclude) { + return this._toObjectMethod('toDatalessObject', propertiesToInclude); + }, + + /** + * @private + */ + _toObjectMethod: function (methodName, propertiesToInclude) { + + var data = { + objects: this._toObjects(methodName, propertiesToInclude) + }; + + extend(data, this.__serializeBgOverlay(propertiesToInclude)); + + fabric.util.populateWithProperties(this, data, propertiesToInclude); + + return data; + }, + + /** + * @private + */ + _toObjects: function(methodName, propertiesToInclude) { + return this.getObjects().filter(function(object) { + return !object.excludeFromExport; + }).map(function(instance) { + return this._toObject(instance, methodName, propertiesToInclude); + }, this); + }, + + /** + * @private + */ + _toObject: function(instance, methodName, propertiesToInclude) { + var originalValue; + + if (!this.includeDefaultValues) { + originalValue = instance.includeDefaultValues; + instance.includeDefaultValues = false; + } + + var object = instance[methodName](propertiesToInclude); + if (!this.includeDefaultValues) { + instance.includeDefaultValues = originalValue; + } + return object; + }, + + /** + * @private + */ + __serializeBgOverlay: function(propertiesToInclude) { + var data = { + background: (this.backgroundColor && this.backgroundColor.toObject) + ? this.backgroundColor.toObject(propertiesToInclude) + : this.backgroundColor + }; + + if (this.overlayColor) { + data.overlay = this.overlayColor.toObject + ? this.overlayColor.toObject(propertiesToInclude) + : this.overlayColor; + } + if (this.backgroundImage) { + data.backgroundImage = this.backgroundImage.toObject(propertiesToInclude); + } + if (this.overlayImage) { + data.overlayImage = this.overlayImage.toObject(propertiesToInclude); + } + + return data; + }, + + /* _TO_SVG_START_ */ + /** + * When true, getSvgTransform() will apply the StaticCanvas.viewportTransform to the SVG transformation. When true, + * a zoomed canvas will then produce zoomed SVG output. + * @type Boolean + * @default + */ + svgViewportTransformation: true, + + /** + * Returns SVG representation of canvas + * @function + * @param {Object} [options] Options object for SVG output + * @param {Boolean} [options.suppressPreamble=false] If true xml tag is not included + * @param {Object} [options.viewBox] SVG viewbox object + * @param {Number} [options.viewBox.x] x-cooridnate of viewbox + * @param {Number} [options.viewBox.y] y-coordinate of viewbox + * @param {Number} [options.viewBox.width] Width of viewbox + * @param {Number} [options.viewBox.height] Height of viewbox + * @param {String} [options.encoding=UTF-8] Encoding of SVG output + * @param {String} [options.width] desired width of svg with or without units + * @param {String} [options.height] desired height of svg with or without units + * @param {Function} [reviver] Method for further parsing of svg elements, called after each fabric object converted into svg representation. + * @return {String} SVG string + * @tutorial {@link http://fabricjs.com/fabric-intro-part-3#serialization} + * @see {@link http://jsfiddle.net/fabricjs/jQ3ZZ/|jsFiddle demo} + * @example Normal SVG output + * var svg = canvas.toSVG(); + * @example SVG output without preamble (without <?xml ../>) + * var svg = canvas.toSVG({suppressPreamble: true}); + * @example SVG output with viewBox attribute + * var svg = canvas.toSVG({ + * viewBox: { + * x: 100, + * y: 100, + * width: 200, + * height: 300 + * } + * }); + * @example SVG output with different encoding (default: UTF-8) + * var svg = canvas.toSVG({encoding: 'ISO-8859-1'}); + * @example Modify SVG output with reviver function + * var svg = canvas.toSVG(null, function(svg) { + * return svg.replace('stroke-dasharray: ; stroke-linecap: butt; stroke-linejoin: miter; stroke-miterlimit: 10; ', ''); + * }); + */ + toSVG: function(options, reviver) { + options || (options = { }); + + var markup = []; + + this._setSVGPreamble(markup, options); + this._setSVGHeader(markup, options); + + this._setSVGBgOverlayColor(markup, 'backgroundColor'); + this._setSVGBgOverlayImage(markup, 'backgroundImage', reviver); + + this._setSVGObjects(markup, reviver); + + this._setSVGBgOverlayColor(markup, 'overlayColor'); + this._setSVGBgOverlayImage(markup, 'overlayImage', reviver); + + markup.push(''); + + return markup.join(''); + }, + + /** + * @private + */ + _setSVGPreamble: function(markup, options) { + if (options.suppressPreamble) { + return; + } + markup.push( + '\n', + '\n' + ); + }, + + /** + * @private + */ + _setSVGHeader: function(markup, options) { + var width = options.width || this.width, + height = options.height || this.height, + vpt, viewBox = 'viewBox="0 0 ' + this.width + ' ' + this.height + '" ', + NUM_FRACTION_DIGITS = fabric.Object.NUM_FRACTION_DIGITS; + + if (options.viewBox) { + viewBox = 'viewBox="' + + options.viewBox.x + ' ' + + options.viewBox.y + ' ' + + options.viewBox.width + ' ' + + options.viewBox.height + '" '; + } + else { + if (this.svgViewportTransformation) { + vpt = this.viewportTransform; + viewBox = 'viewBox="' + + toFixed(-vpt[4] / vpt[0], NUM_FRACTION_DIGITS) + ' ' + + toFixed(-vpt[5] / vpt[3], NUM_FRACTION_DIGITS) + ' ' + + toFixed(this.width / vpt[0], NUM_FRACTION_DIGITS) + ' ' + + toFixed(this.height / vpt[3], NUM_FRACTION_DIGITS) + '" '; + } + } + + markup.push( + '\n', + 'Created with Fabric.js ', fabric.version, '\n', + '', + fabric.createSVGFontFacesMarkup(this.getObjects()), + fabric.createSVGRefElementsMarkup(this), + '\n' + ); + }, + + /** + * @private + */ + _setSVGObjects: function(markup, reviver) { + var instance; + for (var i = 0, objects = this.getObjects(), len = objects.length; i < len; i++) { + instance = objects[i]; + if (instance.excludeFromExport) { + continue; + } + this._setSVGObject(markup, instance, reviver); + } + }, + + /** + * push single object svg representation in the markup + * @private + */ + _setSVGObject: function(markup, instance, reviver) { + markup.push(instance.toSVG(reviver)); + }, + + /** + * @private + */ + _setSVGBgOverlayImage: function(markup, property, reviver) { + if (this[property] && this[property].toSVG) { + markup.push(this[property].toSVG(reviver)); + } + }, + + /** + * @private + */ + _setSVGBgOverlayColor: function(markup, property) { + if (this[property] && this[property].source) { + markup.push( + '\n' + ); + } + else if (this[property] && property === 'overlayColor') { + markup.push( + '\n' + ); + } + }, + /* _TO_SVG_END_ */ + + /** + * Moves an object or the objects of a multiple selection + * to the bottom of the stack of drawn objects + * @param {fabric.Object} object Object to send to back + * @return {fabric.Canvas} thisArg + * @chainable + */ + sendToBack: function (object) { + if (!object) { + return this; + } + var activeGroup = this._activeGroup, + i, obj, objs; + if (object === activeGroup) { + objs = activeGroup._objects; + for (i = objs.length; i--;) { + obj = objs[i]; + removeFromArray(this._objects, obj); + this._objects.unshift(obj); + } + } + else { + removeFromArray(this._objects, object); + this._objects.unshift(object); + } + return this.renderAll && this.renderAll(); + }, + + /** + * Moves an object or the objects of a multiple selection + * to the top of the stack of drawn objects + * @param {fabric.Object} object Object to send + * @return {fabric.Canvas} thisArg + * @chainable + */ + bringToFront: function (object) { + if (!object) { + return this; + } + var activeGroup = this._activeGroup, + i, obj, objs; + if (object === activeGroup) { + objs = activeGroup._objects; + for (i = 0; i < objs.length; i++) { + obj = objs[i]; + removeFromArray(this._objects, obj); + this._objects.push(obj); + } + } + else { + removeFromArray(this._objects, object); + this._objects.push(object); + } + return this.renderAll && this.renderAll(); + }, + + /** + * Moves an object or a selection down in stack of drawn objects + * @param {fabric.Object} object Object to send + * @param {Boolean} [intersecting] If `true`, send object behind next lower intersecting object + * @return {fabric.Canvas} thisArg + * @chainable + */ + sendBackwards: function (object, intersecting) { + if (!object) { + return this; + } + var activeGroup = this._activeGroup, + i, obj, idx, newIdx, objs; + + if (object === activeGroup) { + objs = activeGroup._objects; + for (i = 0; i < objs.length; i++) { + obj = objs[i]; + idx = this._objects.indexOf(obj); + if (idx !== 0) { + newIdx = idx - 1; + removeFromArray(this._objects, obj); + this._objects.splice(newIdx, 0, obj); + } + } + } + else { + idx = this._objects.indexOf(object); + if (idx !== 0) { + // if object is not on the bottom of stack + newIdx = this._findNewLowerIndex(object, idx, intersecting); + removeFromArray(this._objects, object); + this._objects.splice(newIdx, 0, object); + } + } + this.renderAll && this.renderAll(); + return this; + }, + + /** + * @private + */ + _findNewLowerIndex: function(object, idx, intersecting) { + var newIdx; + + if (intersecting) { + newIdx = idx; + + // traverse down the stack looking for the nearest intersecting object + for (var i = idx - 1; i >= 0; --i) { + + var isIntersecting = object.intersectsWithObject(this._objects[i]) || + object.isContainedWithinObject(this._objects[i]) || + this._objects[i].isContainedWithinObject(object); + + if (isIntersecting) { + newIdx = i; + break; + } + } + } + else { + newIdx = idx - 1; + } + + return newIdx; + }, + + /** + * Moves an object or a selection up in stack of drawn objects + * @param {fabric.Object} object Object to send + * @param {Boolean} [intersecting] If `true`, send object in front of next upper intersecting object + * @return {fabric.Canvas} thisArg + * @chainable + */ + bringForward: function (object, intersecting) { + if (!object) { + return this; + } + var activeGroup = this._activeGroup, + i, obj, idx, newIdx, objs; + + if (object === activeGroup) { + objs = activeGroup._objects; + for (i = objs.length; i--;) { + obj = objs[i]; + idx = this._objects.indexOf(obj); + if (idx !== this._objects.length - 1) { + newIdx = idx + 1; + removeFromArray(this._objects, obj); + this._objects.splice(newIdx, 0, obj); + } + } + } + else { + idx = this._objects.indexOf(object); + if (idx !== this._objects.length - 1) { + // if object is not on top of stack (last item in an array) + newIdx = this._findNewUpperIndex(object, idx, intersecting); + removeFromArray(this._objects, object); + this._objects.splice(newIdx, 0, object); + } + } + this.renderAll && this.renderAll(); + return this; + }, + + /** + * @private + */ + _findNewUpperIndex: function(object, idx, intersecting) { + var newIdx; + + if (intersecting) { + newIdx = idx; + + // traverse up the stack looking for the nearest intersecting object + for (var i = idx + 1; i < this._objects.length; ++i) { + + var isIntersecting = object.intersectsWithObject(this._objects[i]) || + object.isContainedWithinObject(this._objects[i]) || + this._objects[i].isContainedWithinObject(object); + + if (isIntersecting) { + newIdx = i; + break; + } + } + } + else { + newIdx = idx + 1; + } + + return newIdx; + }, + + /** + * Moves an object to specified level in stack of drawn objects + * @param {fabric.Object} object Object to send + * @param {Number} index Position to move to + * @return {fabric.Canvas} thisArg + * @chainable + */ + moveTo: function (object, index) { + removeFromArray(this._objects, object); + this._objects.splice(index, 0, object); + return this.renderAll && this.renderAll(); + }, + + /** + * Clears a canvas element and removes all event listeners + * @return {fabric.Canvas} thisArg + * @chainable + */ + dispose: function () { + this.clear(); + return this; + }, + + /** + * Returns a string representation of an instance + * @return {String} string representation of an instance + */ + toString: function () { + return '#'; + } + }); + + extend(fabric.StaticCanvas.prototype, fabric.Observable); + extend(fabric.StaticCanvas.prototype, fabric.Collection); + extend(fabric.StaticCanvas.prototype, fabric.DataURLExporter); + + extend(fabric.StaticCanvas, /** @lends fabric.StaticCanvas */ { + + /** + * @static + * @type String + * @default + */ + EMPTY_JSON: '{"objects": [], "background": "white"}', + + /** + * Provides a way to check support of some of the canvas methods + * (either those of HTMLCanvasElement itself, or rendering context) + * + * @param {String} methodName Method to check support for; + * Could be one of "getImageData", "toDataURL", "toDataURLWithQuality" or "setLineDash" + * @return {Boolean | null} `true` if method is supported (or at least exists), + * `null` if canvas element or context can not be initialized + */ + supports: function (methodName) { + var el = fabric.util.createCanvasElement(); + + if (!el || !el.getContext) { + return null; + } + + var ctx = el.getContext('2d'); + if (!ctx) { + return null; + } + + switch (methodName) { + + case 'getImageData': + return typeof ctx.getImageData !== 'undefined'; + + case 'setLineDash': + return typeof ctx.setLineDash !== 'undefined'; + + case 'toDataURL': + return typeof el.toDataURL !== 'undefined'; + + case 'toDataURLWithQuality': + try { + el.toDataURL('image/jpeg', 0); + return true; + } + catch (e) { } + return false; + + default: + return null; + } + } + }); + + /** + * Returns JSON representation of canvas + * @function + * @param {Array} [propertiesToInclude] Any properties that you might want to additionally include in the output + * @return {String} JSON string + * @tutorial {@link http://fabricjs.com/fabric-intro-part-3#serialization} + * @see {@link http://jsfiddle.net/fabricjs/pec86/|jsFiddle demo} + * @example JSON without additional properties + * var json = canvas.toJSON(); + * @example JSON with additional properties included + * var json = canvas.toJSON(['lockMovementX', 'lockMovementY', 'lockRotation', 'lockScalingX', 'lockScalingY', 'lockUniScaling']); + * @example JSON without default values + * canvas.includeDefaultValues = false; + * var json = canvas.toJSON(); + */ + fabric.StaticCanvas.prototype.toJSON = fabric.StaticCanvas.prototype.toObject; + +})(); + + +/** + * BaseBrush class + * @class fabric.BaseBrush + * @see {@link http://fabricjs.com/freedrawing|Freedrawing demo} + */ +fabric.BaseBrush = fabric.util.createClass(/** @lends fabric.BaseBrush.prototype */ { + + /** + * Color of a brush + * @type String + * @default + */ + color: 'rgb(0, 0, 0)', + + /** + * Width of a brush + * @type Number + * @default + */ + width: 1, + + /** + * Shadow object representing shadow of this shape. + * Backwards incompatibility note: This property replaces "shadowColor" (String), "shadowOffsetX" (Number), + * "shadowOffsetY" (Number) and "shadowBlur" (Number) since v1.2.12 + * @type fabric.Shadow + * @default + */ + shadow: null, + + /** + * Line endings style of a brush (one of "butt", "round", "square") + * @type String + * @default + */ + strokeLineCap: 'round', + + /** + * Corner style of a brush (one of "bevil", "round", "miter") + * @type String + * @default + */ + strokeLineJoin: 'round', + + /** + * Stroke Dash Array. + * @type Array + * @default + */ + strokeDashArray: null, + + /** + * Sets shadow of an object + * @param {Object|String} [options] Options object or string (e.g. "2px 2px 10px rgba(0,0,0,0.2)") + * @return {fabric.Object} thisArg + * @chainable + */ + setShadow: function(options) { + this.shadow = new fabric.Shadow(options); + return this; + }, + + /** + * Sets brush styles + * @private + */ + _setBrushStyles: function() { + var ctx = this.canvas.contextTop; + + ctx.strokeStyle = this.color; + ctx.lineWidth = this.width; + ctx.lineCap = this.strokeLineCap; + ctx.lineJoin = this.strokeLineJoin; + if (this.strokeDashArray && fabric.StaticCanvas.supports('setLineDash')) { + ctx.setLineDash(this.strokeDashArray); + } + }, + + /** + * Sets brush shadow styles + * @private + */ + _setShadow: function() { + if (!this.shadow) { + return; + } + + var ctx = this.canvas.contextTop; + + ctx.shadowColor = this.shadow.color; + ctx.shadowBlur = this.shadow.blur; + ctx.shadowOffsetX = this.shadow.offsetX; + ctx.shadowOffsetY = this.shadow.offsetY; + }, + + /** + * Removes brush shadow styles + * @private + */ + _resetShadow: function() { + var ctx = this.canvas.contextTop; + + ctx.shadowColor = ''; + ctx.shadowBlur = ctx.shadowOffsetX = ctx.shadowOffsetY = 0; + } +}); + + +(function() { + + /** + * PencilBrush class + * @class fabric.PencilBrush + * @extends fabric.BaseBrush + */ + fabric.PencilBrush = fabric.util.createClass(fabric.BaseBrush, /** @lends fabric.PencilBrush.prototype */ { + + /** + * Constructor + * @param {fabric.Canvas} canvas + * @return {fabric.PencilBrush} Instance of a pencil brush + */ + initialize: function(canvas) { + this.canvas = canvas; + this._points = []; + }, + + /** + * Inovoked on mouse down + * @param {Object} pointer + */ + onMouseDown: function(pointer) { + this._prepareForDrawing(pointer); + // capture coordinates immediately + // this allows to draw dots (when movement never occurs) + this._captureDrawingPath(pointer); + this._render(); + }, + + /** + * Inovoked on mouse move + * @param {Object} pointer + */ + onMouseMove: function(pointer) { + this._captureDrawingPath(pointer); + // redraw curve + // clear top canvas + this.canvas.clearContext(this.canvas.contextTop); + this._render(); + }, + + /** + * Invoked on mouse up + */ + onMouseUp: function() { + this._finalizeAndAddPath(); + }, + + /** + * @private + * @param {Object} pointer Actual mouse position related to the canvas. + */ + _prepareForDrawing: function(pointer) { + + var p = new fabric.Point(pointer.x, pointer.y); + + this._reset(); + this._addPoint(p); + + this.canvas.contextTop.moveTo(p.x, p.y); + }, + + /** + * @private + * @param {fabric.Point} point Point to be added to points array + */ + _addPoint: function(point) { + this._points.push(point); + }, + + /** + * Clear points array and set contextTop canvas style. + * @private + */ + _reset: function() { + this._points.length = 0; + + this._setBrushStyles(); + this._setShadow(); + }, + + /** + * @private + * @param {Object} pointer Actual mouse position related to the canvas. + */ + _captureDrawingPath: function(pointer) { + var pointerPoint = new fabric.Point(pointer.x, pointer.y); + this._addPoint(pointerPoint); + }, + + /** + * Draw a smooth path on the topCanvas using quadraticCurveTo + * @private + */ + _render: function() { + var ctx = this.canvas.contextTop, + v = this.canvas.viewportTransform, + p1 = this._points[0], + p2 = this._points[1]; + + ctx.save(); + ctx.transform(v[0], v[1], v[2], v[3], v[4], v[5]); + ctx.beginPath(); + + //if we only have 2 points in the path and they are the same + //it means that the user only clicked the canvas without moving the mouse + //then we should be drawing a dot. A path isn't drawn between two identical dots + //that's why we set them apart a bit + if (this._points.length === 2 && p1.x === p2.x && p1.y === p2.y) { + p1.x -= 0.5; + p2.x += 0.5; + } + ctx.moveTo(p1.x, p1.y); + + for (var i = 1, len = this._points.length; i < len; i++) { + // we pick the point between pi + 1 & pi + 2 as the + // end point and p1 as our control point. + var midPoint = p1.midPointFrom(p2); + ctx.quadraticCurveTo(p1.x, p1.y, midPoint.x, midPoint.y); + + p1 = this._points[i]; + p2 = this._points[i + 1]; + } + // Draw last line as a straight line while + // we wait for the next point to be able to calculate + // the bezier control point + ctx.lineTo(p1.x, p1.y); + ctx.stroke(); + ctx.restore(); + }, + + /** + * Converts points to SVG path + * @param {Array} points Array of points + * @return {String} SVG path + */ + convertPointsToSVGPath: function(points) { + var path = [], + p1 = new fabric.Point(points[0].x, points[0].y), + p2 = new fabric.Point(points[1].x, points[1].y); + + path.push('M ', points[0].x, ' ', points[0].y, ' '); + for (var i = 1, len = points.length; i < len; i++) { + var midPoint = p1.midPointFrom(p2); + // p1 is our bezier control point + // midpoint is our endpoint + // start point is p(i-1) value. + path.push('Q ', p1.x, ' ', p1.y, ' ', midPoint.x, ' ', midPoint.y, ' '); + p1 = new fabric.Point(points[i].x, points[i].y); + if ((i + 1) < points.length) { + p2 = new fabric.Point(points[i + 1].x, points[i + 1].y); + } + } + path.push('L ', p1.x, ' ', p1.y, ' '); + return path; + }, + + /** + * Creates fabric.Path object to add on canvas + * @param {String} pathData Path data + * @return {fabric.Path} Path to add on canvas + */ + createPath: function(pathData) { + var path = new fabric.Path(pathData, { + fill: null, + stroke: this.color, + strokeWidth: this.width, + strokeLineCap: this.strokeLineCap, + strokeLineJoin: this.strokeLineJoin, + strokeDashArray: this.strokeDashArray, + originX: 'center', + originY: 'center' + }); + + if (this.shadow) { + this.shadow.affectStroke = true; + path.setShadow(this.shadow); + } + + return path; + }, + + /** + * On mouseup after drawing the path on contextTop canvas + * we use the points captured to create an new fabric path object + * and add it to the fabric canvas. + */ + _finalizeAndAddPath: function() { + var ctx = this.canvas.contextTop; + ctx.closePath(); + + var pathData = this.convertPointsToSVGPath(this._points).join(''); + if (pathData === 'M 0 0 Q 0 0 0 0 L 0 0') { + // do not create 0 width/height paths, as they are + // rendered inconsistently across browsers + // Firefox 4, for example, renders a dot, + // whereas Chrome 10 renders nothing + this.canvas.renderAll(); + return; + } + + var path = this.createPath(pathData); + + this.canvas.add(path); + path.setCoords(); + + this.canvas.clearContext(this.canvas.contextTop); + this._resetShadow(); + this.canvas.renderAll(); + + // fire event 'path' created + this.canvas.fire('path:created', { path: path }); + } + }); +})(); + + +/** + * CircleBrush class + * @class fabric.CircleBrush + */ +fabric.CircleBrush = fabric.util.createClass(fabric.BaseBrush, /** @lends fabric.CircleBrush.prototype */ { + + /** + * Width of a brush + * @type Number + * @default + */ + width: 10, + + /** + * Constructor + * @param {fabric.Canvas} canvas + * @return {fabric.CircleBrush} Instance of a circle brush + */ + initialize: function(canvas) { + this.canvas = canvas; + this.points = []; + }, + + /** + * Invoked inside on mouse down and mouse move + * @param {Object} pointer + */ + drawDot: function(pointer) { + var point = this.addPoint(pointer), + ctx = this.canvas.contextTop, + v = this.canvas.viewportTransform; + ctx.save(); + ctx.transform(v[0], v[1], v[2], v[3], v[4], v[5]); + + ctx.fillStyle = point.fill; + ctx.beginPath(); + ctx.arc(point.x, point.y, point.radius, 0, Math.PI * 2, false); + ctx.closePath(); + ctx.fill(); + + ctx.restore(); + }, + + /** + * Invoked on mouse down + */ + onMouseDown: function(pointer) { + this.points.length = 0; + this.canvas.clearContext(this.canvas.contextTop); + this._setShadow(); + this.drawDot(pointer); + }, + + /** + * Invoked on mouse move + * @param {Object} pointer + */ + onMouseMove: function(pointer) { + this.drawDot(pointer); + }, + + /** + * Invoked on mouse up + */ + onMouseUp: function() { + var originalRenderOnAddRemove = this.canvas.renderOnAddRemove; + this.canvas.renderOnAddRemove = false; + + var circles = []; + + for (var i = 0, len = this.points.length; i < len; i++) { + var point = this.points[i], + circle = new fabric.Circle({ + radius: point.radius, + left: point.x, + top: point.y, + originX: 'center', + originY: 'center', + fill: point.fill + }); + + this.shadow && circle.setShadow(this.shadow); + + circles.push(circle); + } + var group = new fabric.Group(circles, { originX: 'center', originY: 'center' }); + group.canvas = this.canvas; + + this.canvas.add(group); + this.canvas.fire('path:created', { path: group }); + + this.canvas.clearContext(this.canvas.contextTop); + this._resetShadow(); + this.canvas.renderOnAddRemove = originalRenderOnAddRemove; + this.canvas.renderAll(); + }, + + /** + * @param {Object} pointer + * @return {fabric.Point} Just added pointer point + */ + addPoint: function(pointer) { + var pointerPoint = new fabric.Point(pointer.x, pointer.y), + + circleRadius = fabric.util.getRandomInt( + Math.max(0, this.width - 20), this.width + 20) / 2, + + circleColor = new fabric.Color(this.color) + .setAlpha(fabric.util.getRandomInt(0, 100) / 100) + .toRgba(); + + pointerPoint.radius = circleRadius; + pointerPoint.fill = circleColor; + + this.points.push(pointerPoint); + + return pointerPoint; + } +}); + + +/** + * SprayBrush class + * @class fabric.SprayBrush + */ +fabric.SprayBrush = fabric.util.createClass( fabric.BaseBrush, /** @lends fabric.SprayBrush.prototype */ { + + /** + * Width of a spray + * @type Number + * @default + */ + width: 10, + + /** + * Density of a spray (number of dots per chunk) + * @type Number + * @default + */ + density: 20, + + /** + * Width of spray dots + * @type Number + * @default + */ + dotWidth: 1, + + /** + * Width variance of spray dots + * @type Number + * @default + */ + dotWidthVariance: 1, + + /** + * Whether opacity of a dot should be random + * @type Boolean + * @default + */ + randomOpacity: false, + + /** + * Whether overlapping dots (rectangles) should be removed (for performance reasons) + * @type Boolean + * @default + */ + optimizeOverlapping: true, + + /** + * Constructor + * @param {fabric.Canvas} canvas + * @return {fabric.SprayBrush} Instance of a spray brush + */ + initialize: function(canvas) { + this.canvas = canvas; + this.sprayChunks = []; + }, + + /** + * Invoked on mouse down + * @param {Object} pointer + */ + onMouseDown: function(pointer) { + this.sprayChunks.length = 0; + this.canvas.clearContext(this.canvas.contextTop); + this._setShadow(); + + this.addSprayChunk(pointer); + this.render(); + }, + + /** + * Invoked on mouse move + * @param {Object} pointer + */ + onMouseMove: function(pointer) { + this.addSprayChunk(pointer); + this.render(); + }, + + /** + * Invoked on mouse up + */ + onMouseUp: function() { + var originalRenderOnAddRemove = this.canvas.renderOnAddRemove; + this.canvas.renderOnAddRemove = false; + + var rects = []; + + for (var i = 0, ilen = this.sprayChunks.length; i < ilen; i++) { + var sprayChunk = this.sprayChunks[i]; + + for (var j = 0, jlen = sprayChunk.length; j < jlen; j++) { + + var rect = new fabric.Rect({ + width: sprayChunk[j].width, + height: sprayChunk[j].width, + left: sprayChunk[j].x + 1, + top: sprayChunk[j].y + 1, + originX: 'center', + originY: 'center', + fill: this.color + }); + + this.shadow && rect.setShadow(this.shadow); + rects.push(rect); + } + } + + if (this.optimizeOverlapping) { + rects = this._getOptimizedRects(rects); + } + + var group = new fabric.Group(rects, { originX: 'center', originY: 'center' }); + group.canvas = this.canvas; + + this.canvas.add(group); + this.canvas.fire('path:created', { path: group }); + + this.canvas.clearContext(this.canvas.contextTop); + this._resetShadow(); + this.canvas.renderOnAddRemove = originalRenderOnAddRemove; + this.canvas.renderAll(); + }, + + /** + * @private + * @param {Array} rects + */ + _getOptimizedRects: function(rects) { + + // avoid creating duplicate rects at the same coordinates + var uniqueRects = { }, key; + + for (var i = 0, len = rects.length; i < len; i++) { + key = rects[i].left + '' + rects[i].top; + if (!uniqueRects[key]) { + uniqueRects[key] = rects[i]; + } + } + var uniqueRectsArray = []; + for (key in uniqueRects) { + uniqueRectsArray.push(uniqueRects[key]); + } + + return uniqueRectsArray; + }, + + /** + * Renders brush + */ + render: function() { + var ctx = this.canvas.contextTop; + ctx.fillStyle = this.color; + + var v = this.canvas.viewportTransform; + ctx.save(); + ctx.transform(v[0], v[1], v[2], v[3], v[4], v[5]); + + for (var i = 0, len = this.sprayChunkPoints.length; i < len; i++) { + var point = this.sprayChunkPoints[i]; + if (typeof point.opacity !== 'undefined') { + ctx.globalAlpha = point.opacity; + } + ctx.fillRect(point.x, point.y, point.width, point.width); + } + ctx.restore(); + }, + + /** + * @param {Object} pointer + */ + addSprayChunk: function(pointer) { + this.sprayChunkPoints = []; + + var x, y, width, radius = this.width / 2; + + for (var i = 0; i < this.density; i++) { + + x = fabric.util.getRandomInt(pointer.x - radius, pointer.x + radius); + y = fabric.util.getRandomInt(pointer.y - radius, pointer.y + radius); + + if (this.dotWidthVariance) { + width = fabric.util.getRandomInt( + // bottom clamp width to 1 + Math.max(1, this.dotWidth - this.dotWidthVariance), + this.dotWidth + this.dotWidthVariance); + } + else { + width = this.dotWidth; + } + + var point = new fabric.Point(x, y); + point.width = width; + + if (this.randomOpacity) { + point.opacity = fabric.util.getRandomInt(0, 100) / 100; + } + + this.sprayChunkPoints.push(point); + } + + this.sprayChunks.push(this.sprayChunkPoints); + } +}); + + +/** + * PatternBrush class + * @class fabric.PatternBrush + * @extends fabric.BaseBrush + */ +fabric.PatternBrush = fabric.util.createClass(fabric.PencilBrush, /** @lends fabric.PatternBrush.prototype */ { + + getPatternSrc: function() { + + var dotWidth = 20, + dotDistance = 5, + patternCanvas = fabric.document.createElement('canvas'), + patternCtx = patternCanvas.getContext('2d'); + + patternCanvas.width = patternCanvas.height = dotWidth + dotDistance; + + patternCtx.fillStyle = this.color; + patternCtx.beginPath(); + patternCtx.arc(dotWidth / 2, dotWidth / 2, dotWidth / 2, 0, Math.PI * 2, false); + patternCtx.closePath(); + patternCtx.fill(); + + return patternCanvas; + }, + + getPatternSrcFunction: function() { + return String(this.getPatternSrc).replace('this.color', '"' + this.color + '"'); + }, + + /** + * Creates "pattern" instance property + */ + getPattern: function() { + return this.canvas.contextTop.createPattern(this.source || this.getPatternSrc(), 'repeat'); + }, + + /** + * Sets brush styles + */ + _setBrushStyles: function() { + this.callSuper('_setBrushStyles'); + this.canvas.contextTop.strokeStyle = this.getPattern(); + }, + + /** + * Creates path + */ + createPath: function(pathData) { + var path = this.callSuper('createPath', pathData), + topLeft = path._getLeftTopCoords().scalarAdd(path.strokeWidth / 2); + + path.stroke = new fabric.Pattern({ + source: this.source || this.getPatternSrcFunction(), + offsetX: -topLeft.x, + offsetY: -topLeft.y + }); + return path; + } +}); + + +(function() { + + var getPointer = fabric.util.getPointer, + degreesToRadians = fabric.util.degreesToRadians, + radiansToDegrees = fabric.util.radiansToDegrees, + atan2 = Math.atan2, + abs = Math.abs, + supportLineDash = fabric.StaticCanvas.supports('setLineDash'), + + STROKE_OFFSET = 0.5; + + /** + * Canvas class + * @class fabric.Canvas + * @extends fabric.StaticCanvas + * @tutorial {@link http://fabricjs.com/fabric-intro-part-1#canvas} + * @see {@link fabric.Canvas#initialize} for constructor definition + * + * @fires object:added + * @fires object:modified + * @fires object:rotating + * @fires object:scaling + * @fires object:moving + * @fires object:selected + * + * @fires before:selection:cleared + * @fires selection:cleared + * @fires selection:created + * + * @fires path:created + * @fires mouse:down + * @fires mouse:move + * @fires mouse:up + * @fires mouse:over + * @fires mouse:out + * + */ + fabric.Canvas = fabric.util.createClass(fabric.StaticCanvas, /** @lends fabric.Canvas.prototype */ { + + /** + * Constructor + * @param {HTMLElement | String} el <canvas> element to initialize instance on + * @param {Object} [options] Options object + * @return {Object} thisArg + */ + initialize: function(el, options) { + options || (options = { }); + + this._initStatic(el, options); + this._initInteractive(); + this._createCacheCanvas(); + }, + + /** + * When true, objects can be transformed by one side (unproportionally) + * @type Boolean + * @default + */ + uniScaleTransform: false, + + /** + * Indicates which key enable unproportional scaling + * values: altKey, shiftKey, ctrlKey + * @since 1.6.2 + * @type String + * @default + */ + uniScaleKey: 'shiftKey', + + /** + * When true, objects use center point as the origin of scale transformation. + * Backwards incompatibility note: This property replaces "centerTransform" (Boolean). + * @since 1.3.4 + * @type Boolean + * @default + */ + centeredScaling: false, + + /** + * When true, objects use center point as the origin of rotate transformation. + * Backwards incompatibility note: This property replaces "centerTransform" (Boolean). + * @since 1.3.4 + * @type Boolean + * @default + */ + centeredRotation: false, + + /** + * Indicates which key enable centered Transfrom + * values: altKey, shiftKey, ctrlKey + * @since 1.6.2 + * @type String + * @default + */ + centeredKey: 'altKey', + + /** + * Indicates which key enable alternate action on corner + * values: altKey, shiftKey, ctrlKey + * @since 1.6.2 + * @type String + * @default + */ + altActionKey: 'shiftKey', + + /** + * Indicates that canvas is interactive. This property should not be changed. + * @type Boolean + * @default + */ + interactive: true, + + /** + * Indicates whether group selection should be enabled + * @type Boolean + * @default + */ + selection: true, + + /** + * Indicates which key enable multiple click selection + * values: altKey, shiftKey, ctrlKey, cmdKey + * @since 1.6.2 + * @type String + * @default + */ + selectionKey: 'shiftKey', + + /** + * Indicates which key enable alternative selection + * in case of target overlapping with active object + * values: altKey, shiftKey, ctrlKey, cmdKey + * @since 1.6.5 + * @type null|String + * @default + */ + altSelectionKey: null, + + /** + * Color of selection + * @type String + * @default + */ + selectionColor: 'rgba(100, 100, 255, 0.3)', // blue + + /** + * Default dash array pattern + * If not empty the selection border is dashed + * @type Array + */ + selectionDashArray: [], + + /** + * Color of the border of selection (usually slightly darker than color of selection itself) + * @type String + * @default + */ + selectionBorderColor: 'rgba(255, 255, 255, 0.3)', + + /** + * Width of a line used in object/group selection + * @type Number + * @default + */ + selectionLineWidth: 1, + + /** + * Default cursor value used when hovering over an object on canvas + * @type String + * @default + */ + hoverCursor: 'move', + + /** + * Default cursor value used when moving an object on canvas + * @type String + * @default + */ + moveCursor: 'move', + + /** + * Default cursor value used for the entire canvas + * @type String + * @default + */ + defaultCursor: 'default', + + /** + * Cursor value used during free drawing + * @type String + * @default + */ + freeDrawingCursor: 'crosshair', + + /** + * Cursor value used for rotation point + * @type String + * @default + */ + rotationCursor: 'crosshair', + + /** + * Default element class that's given to wrapper (div) element of canvas + * @type String + * @default + */ + containerClass: 'canvas-container', + + /** + * When true, object detection happens on per-pixel basis rather than on per-bounding-box + * @type Boolean + * @default + */ + perPixelTargetFind: false, + + /** + * Number of pixels around target pixel to tolerate (consider active) during object detection + * @type Number + * @default + */ + targetFindTolerance: 0, + + /** + * When true, target detection is skipped when hovering over canvas. This can be used to improve performance. + * @type Boolean + * @default + */ + skipTargetFind: false, + + /** + * When true, mouse events on canvas (mousedown/mousemove/mouseup) result in free drawing. + * After mousedown, mousemove creates a shape, + * and then mouseup finalizes it and adds an instance of `fabric.Path` onto canvas. + * @tutorial {@link http://fabricjs.com/fabric-intro-part-4#free_drawing} + * @type Boolean + * @default + */ + isDrawingMode: false, + + /** + * Indicates whether objects should remain in current stack position when selected. + * When false objects are brought to top and rendered as part of the selection group + * @type Boolean + * @default + */ + preserveObjectStacking: false, + + /** + * Indicates if the right click on canvas can output the context menu or not + * @type Boolean + * @since 1.6.5 + * @default + */ + stopContextMenu: false, + + /** + * Indicates if the canvas can fire right click events + * @type Boolean + * @since 1.6.5 + * @default + */ + fireRightClick: false, + + /** + * @private + */ + _initInteractive: function() { + this._currentTransform = null; + this._groupSelector = null; + this._initWrapperElement(); + this._createUpperCanvas(); + this._initEventListeners(); + + this._initRetinaScaling(); + + this.freeDrawingBrush = fabric.PencilBrush && new fabric.PencilBrush(this); + + this.calcOffset(); + }, + + /** + * Divides objects in two groups, one to render immediately + * and one to render as activeGroup. + * @return {Array} objects to render immediately and pushes the other in the activeGroup. + */ + _chooseObjectsToRender: function() { + var activeGroup = this.getActiveGroup(), + activeObject = this.getActiveObject(), + object, objsToRender = [], activeGroupObjects = []; + + if ((activeGroup || activeObject) && !this.preserveObjectStacking) { + for (var i = 0, length = this._objects.length; i < length; i++) { + object = this._objects[i]; + if ((!activeGroup || !activeGroup.contains(object)) && object !== activeObject) { + objsToRender.push(object); + } + else { + activeGroupObjects.push(object); + } + } + if (activeGroup) { + activeGroup._set('_objects', activeGroupObjects); + objsToRender.push(activeGroup); + } + activeObject && objsToRender.push(activeObject); + } + else { + objsToRender = this._objects; + } + return objsToRender; + }, + + /** + * Renders both the top canvas and the secondary container canvas. + * @return {fabric.Canvas} instance + * @chainable + */ + renderAll: function () { + if (this.selection && !this._groupSelector && !this.isDrawingMode) { + this.clearContext(this.contextTop); + } + var canvasToDrawOn = this.contextContainer; + this.renderCanvas(canvasToDrawOn, this._chooseObjectsToRender()); + return this; + }, + + /** + * Method to render only the top canvas. + * Also used to render the group selection box. + * @return {fabric.Canvas} thisArg + * @chainable + */ + renderTop: function () { + var ctx = this.contextTop; + this.clearContext(ctx); + + // we render the top context - last object + if (this.selection && this._groupSelector) { + this._drawSelection(ctx); + } + + this.fire('after:render'); + + return this; + }, + + /** + * Resets the current transform to its original values and chooses the type of resizing based on the event + * @private + */ + _resetCurrentTransform: function() { + var t = this._currentTransform; + + t.target.set({ + scaleX: t.original.scaleX, + scaleY: t.original.scaleY, + skewX: t.original.skewX, + skewY: t.original.skewY, + left: t.original.left, + top: t.original.top + }); + + if (this._shouldCenterTransform(t.target)) { + if (t.action === 'rotate') { + this._setOriginToCenter(t.target); + } + else { + if (t.originX !== 'center') { + if (t.originX === 'right') { + t.mouseXSign = -1; + } + else { + t.mouseXSign = 1; + } + } + if (t.originY !== 'center') { + if (t.originY === 'bottom') { + t.mouseYSign = -1; + } + else { + t.mouseYSign = 1; + } + } + + t.originX = 'center'; + t.originY = 'center'; + } + } + else { + t.originX = t.original.originX; + t.originY = t.original.originY; + } + }, + + /** + * Checks if point is contained within an area of given object + * @param {Event} e Event object + * @param {fabric.Object} target Object to test against + * @param {Object} [point] x,y object of point coordinates we want to check. + * @return {Boolean} true if point is contained within an area of given object + */ + containsPoint: function (e, target, point) { + var ignoreZoom = true, + pointer = point || this.getPointer(e, ignoreZoom), + xy; + + if (target.group && target.group === this.getActiveGroup()) { + xy = this._normalizePointer(target.group, pointer); + } + else { + xy = { x: pointer.x, y: pointer.y }; + } + // http://www.geog.ubc.ca/courses/klink/gis.notes/ncgia/u32.html + // http://idav.ucdavis.edu/~okreylos/TAship/Spring2000/PointInPolygon.html + return (target.containsPoint(xy) || target._findTargetCorner(pointer)); + }, + + /** + * @private + */ + _normalizePointer: function (object, pointer) { + var m = object.calcTransformMatrix(), + invertedM = fabric.util.invertTransform(m), + vpt = this.viewportTransform, + vptPointer = this.restorePointerVpt(pointer), + p = fabric.util.transformPoint(vptPointer, invertedM); + return fabric.util.transformPoint(p, vpt); + }, + + /** + * Returns true if object is transparent at a certain location + * @param {fabric.Object} target Object to check + * @param {Number} x Left coordinate + * @param {Number} y Top coordinate + * @return {Boolean} + */ + isTargetTransparent: function (target, x, y) { + var hasBorders = target.hasBorders, + transparentCorners = target.transparentCorners, + ctx = this.contextCache, + originalColor = target.selectionBackgroundColor; + + target.hasBorders = target.transparentCorners = false; + target.selectionBackgroundColor = ''; + + ctx.save(); + ctx.transform.apply(ctx, this.viewportTransform); + target.render(ctx); + ctx.restore(); + + target.active && target._renderControls(ctx); + + target.hasBorders = hasBorders; + target.transparentCorners = transparentCorners; + target.selectionBackgroundColor = originalColor; + + var isTransparent = fabric.util.isTransparent( + ctx, x, y, this.targetFindTolerance); + + this.clearContext(ctx); + + return isTransparent; + }, + + /** + * @private + * @param {Event} e Event object + * @param {fabric.Object} target + */ + _shouldClearSelection: function (e, target) { + var activeGroup = this.getActiveGroup(), + activeObject = this.getActiveObject(); + + return ( + !target + || + (target && + activeGroup && + !activeGroup.contains(target) && + activeGroup !== target && + !e[this.selectionKey]) + || + (target && !target.evented) + || + (target && + !target.selectable && + activeObject && + activeObject !== target) + ); + }, + + /** + * @private + * @param {fabric.Object} target + */ + _shouldCenterTransform: function (target) { + if (!target) { + return; + } + + var t = this._currentTransform, + centerTransform; + + if (t.action === 'scale' || t.action === 'scaleX' || t.action === 'scaleY') { + centerTransform = this.centeredScaling || target.centeredScaling; + } + else if (t.action === 'rotate') { + centerTransform = this.centeredRotation || target.centeredRotation; + } + + return centerTransform ? !t.altKey : t.altKey; + }, + + /** + * @private + */ + _getOriginFromCorner: function(target, corner) { + var origin = { + x: target.originX, + y: target.originY + }; + + if (corner === 'ml' || corner === 'tl' || corner === 'bl') { + origin.x = 'right'; + } + else if (corner === 'mr' || corner === 'tr' || corner === 'br') { + origin.x = 'left'; + } + + if (corner === 'tl' || corner === 'mt' || corner === 'tr') { + origin.y = 'bottom'; + } + else if (corner === 'bl' || corner === 'mb' || corner === 'br') { + origin.y = 'top'; + } + + return origin; + }, + + /** + * @private + */ + _getActionFromCorner: function(target, corner, e) { + if (!corner) { + return 'drag'; + } + + switch (corner) { + case 'mtr': + return 'rotate'; + case 'ml': + case 'mr': + return e[this.altActionKey] ? 'skewY' : 'scaleX'; + case 'mt': + case 'mb': + return e[this.altActionKey] ? 'skewX' : 'scaleY'; + default: + return 'scale'; + } + }, + + /** + * @private + * @param {Event} e Event object + * @param {fabric.Object} target + */ + _setupCurrentTransform: function (e, target) { + if (!target) { + return; + } + + var pointer = this.getPointer(e), + corner = target._findTargetCorner(this.getPointer(e, true)), + action = this._getActionFromCorner(target, corner, e), + origin = this._getOriginFromCorner(target, corner); + + this._currentTransform = { + target: target, + action: action, + corner: corner, + scaleX: target.scaleX, + scaleY: target.scaleY, + skewX: target.skewX, + skewY: target.skewY, + offsetX: pointer.x - target.left, + offsetY: pointer.y - target.top, + originX: origin.x, + originY: origin.y, + ex: pointer.x, + ey: pointer.y, + lastX: pointer.x, + lastY: pointer.y, + left: target.left, + top: target.top, + theta: degreesToRadians(target.angle), + width: target.width * target.scaleX, + mouseXSign: 1, + mouseYSign: 1, + shiftKey: e.shiftKey, + altKey: e[this.centeredKey] + }; + + this._currentTransform.original = { + left: target.left, + top: target.top, + scaleX: target.scaleX, + scaleY: target.scaleY, + skewX: target.skewX, + skewY: target.skewY, + originX: origin.x, + originY: origin.y + }; + + this._resetCurrentTransform(); + }, + + /** + * Translates object by "setting" its left/top + * @private + * @param {Number} x pointer's x coordinate + * @param {Number} y pointer's y coordinate + * @return {Boolean} true if the translation occurred + */ + _translateObject: function (x, y) { + var transform = this._currentTransform, + target = transform.target, + newLeft = x - transform.offsetX, + newTop = y - transform.offsetY, + moveX = !target.get('lockMovementX') && target.left !== newLeft, + moveY = !target.get('lockMovementY') && target.top !== newTop; + + moveX && target.set('left', newLeft); + moveY && target.set('top', newTop); + return moveX || moveY; + }, + + /** + * Check if we are increasing a positive skew or lower it, + * checking mouse direction and pressed corner. + * @private + */ + _changeSkewTransformOrigin: function(mouseMove, t, by) { + var property = 'originX', origins = { 0: 'center' }, + skew = t.target.skewX, originA = 'left', originB = 'right', + corner = t.corner === 'mt' || t.corner === 'ml' ? 1 : -1, + flipSign = 1; + + mouseMove = mouseMove > 0 ? 1 : -1; + if (by === 'y') { + skew = t.target.skewY; + originA = 'top'; + originB = 'bottom'; + property = 'originY'; + } + origins[-1] = originA; + origins[1] = originB; + + t.target.flipX && (flipSign *= -1); + t.target.flipY && (flipSign *= -1); + + if (skew === 0) { + t.skewSign = -corner * mouseMove * flipSign; + t[property] = origins[-mouseMove]; + } + else { + skew = skew > 0 ? 1 : -1; + t.skewSign = skew; + t[property] = origins[skew * corner * flipSign]; + } + }, + + /** + * Skew object by mouse events + * @private + * @param {Number} x pointer's x coordinate + * @param {Number} y pointer's y coordinate + * @param {String} by Either 'x' or 'y' + * @return {Boolean} true if the skewing occurred + */ + _skewObject: function (x, y, by) { + var t = this._currentTransform, + target = t.target, skewed = false, + lockSkewingX = target.get('lockSkewingX'), + lockSkewingY = target.get('lockSkewingY'); + + if ((lockSkewingX && by === 'x') || (lockSkewingY && by === 'y')) { + return false; + } + + // Get the constraint point + var center = target.getCenterPoint(), + actualMouseByCenter = target.toLocalPoint(new fabric.Point(x, y), 'center', 'center')[by], + lastMouseByCenter = target.toLocalPoint(new fabric.Point(t.lastX, t.lastY), 'center', 'center')[by], + actualMouseByOrigin, constraintPosition, dim = target._getTransformedDimensions(); + + this._changeSkewTransformOrigin(actualMouseByCenter - lastMouseByCenter, t, by); + actualMouseByOrigin = target.toLocalPoint(new fabric.Point(x, y), t.originX, t.originY)[by]; + constraintPosition = target.translateToOriginPoint(center, t.originX, t.originY); + // Actually skew the object + skewed = this._setObjectSkew(actualMouseByOrigin, t, by, dim); + t.lastX = x; + t.lastY = y; + // Make sure the constraints apply + target.setPositionByOrigin(constraintPosition, t.originX, t.originY); + return skewed; + }, + + /** + * Set object skew + * @private + * @return {Boolean} true if the skewing occurred + */ + _setObjectSkew: function(localMouse, transform, by, _dim) { + var target = transform.target, newValue, skewed = false, + skewSign = transform.skewSign, newDim, dimNoSkew, + otherBy, _otherBy, _by, newDimMouse, skewX, skewY; + + if (by === 'x') { + otherBy = 'y'; + _otherBy = 'Y'; + _by = 'X'; + skewX = 0; + skewY = target.skewY; + } + else { + otherBy = 'x'; + _otherBy = 'X'; + _by = 'Y'; + skewX = target.skewX; + skewY = 0; + } + + dimNoSkew = target._getTransformedDimensions(skewX, skewY); + newDimMouse = 2 * Math.abs(localMouse) - dimNoSkew[by]; + if (newDimMouse <= 2) { + newValue = 0; + } + else { + newValue = skewSign * Math.atan((newDimMouse / target['scale' + _by]) / + (dimNoSkew[otherBy] / target['scale' + _otherBy])); + newValue = fabric.util.radiansToDegrees(newValue); + } + skewed = target['skew' + _by] !== newValue; + target.set('skew' + _by, newValue); + if (target['skew' + _otherBy] !== 0) { + newDim = target._getTransformedDimensions(); + newValue = (_dim[otherBy] / newDim[otherBy]) * target['scale' + _otherBy]; + target.set('scale' + _otherBy, newValue); + } + return skewed; + }, + + /** + * Scales object by invoking its scaleX/scaleY methods + * @private + * @param {Number} x pointer's x coordinate + * @param {Number} y pointer's y coordinate + * @param {String} by Either 'x' or 'y' - specifies dimension constraint by which to scale an object. + * When not provided, an object is scaled by both dimensions equally + * @return {Boolean} true if the scaling occurred + */ + _scaleObject: function (x, y, by) { + var t = this._currentTransform, + target = t.target, + lockScalingX = target.get('lockScalingX'), + lockScalingY = target.get('lockScalingY'), + lockScalingFlip = target.get('lockScalingFlip'); + + if (lockScalingX && lockScalingY) { + return false; + } + + // Get the constraint point + var constraintPosition = target.translateToOriginPoint(target.getCenterPoint(), t.originX, t.originY), + localMouse = target.toLocalPoint(new fabric.Point(x, y), t.originX, t.originY), + dim = target._getTransformedDimensions(), scaled = false; + + this._setLocalMouse(localMouse, t); + + // Actually scale the object + scaled = this._setObjectScale(localMouse, t, lockScalingX, lockScalingY, by, lockScalingFlip, dim); + + // Make sure the constraints apply + target.setPositionByOrigin(constraintPosition, t.originX, t.originY); + return scaled; + }, + + /** + * @private + * @return {Boolean} true if the scaling occurred + */ + _setObjectScale: function(localMouse, transform, lockScalingX, lockScalingY, by, lockScalingFlip, _dim) { + var target = transform.target, forbidScalingX = false, forbidScalingY = false, scaled = false, + changeX, changeY, scaleX, scaleY; + + scaleX = localMouse.x * target.scaleX / _dim.x; + scaleY = localMouse.y * target.scaleY / _dim.y; + changeX = target.scaleX !== scaleX; + changeY = target.scaleY !== scaleY; + + if (lockScalingFlip && scaleX <= 0 && scaleX < target.scaleX) { + forbidScalingX = true; + } + + if (lockScalingFlip && scaleY <= 0 && scaleY < target.scaleY) { + forbidScalingY = true; + } + + if (by === 'equally' && !lockScalingX && !lockScalingY) { + forbidScalingX || forbidScalingY || (scaled = this._scaleObjectEqually(localMouse, target, transform, _dim)); + } + else if (!by) { + forbidScalingX || lockScalingX || (target.set('scaleX', scaleX) && (scaled = scaled || changeX)); + forbidScalingY || lockScalingY || (target.set('scaleY', scaleY) && (scaled = scaled || changeY)); + } + else if (by === 'x' && !target.get('lockUniScaling')) { + forbidScalingX || lockScalingX || (target.set('scaleX', scaleX) && (scaled = scaled || changeX)); + } + else if (by === 'y' && !target.get('lockUniScaling')) { + forbidScalingY || lockScalingY || (target.set('scaleY', scaleY) && (scaled = scaled || changeY)); + } + transform.newScaleX = scaleX; + transform.newScaleY = scaleY; + forbidScalingX || forbidScalingY || this._flipObject(transform, by); + return scaled; + }, + + /** + * @private + * @return {Boolean} true if the scaling occurred + */ + _scaleObjectEqually: function(localMouse, target, transform, _dim) { + + var dist = localMouse.y + localMouse.x, + lastDist = _dim.y * transform.original.scaleY / target.scaleY + + _dim.x * transform.original.scaleX / target.scaleX, + scaled; + + // We use transform.scaleX/Y instead of target.scaleX/Y + // because the object may have a min scale and we'll loose the proportions + transform.newScaleX = transform.original.scaleX * dist / lastDist; + transform.newScaleY = transform.original.scaleY * dist / lastDist; + scaled = transform.newScaleX !== target.scaleX || transform.newScaleY !== target.scaleY; + target.set('scaleX', transform.newScaleX); + target.set('scaleY', transform.newScaleY); + return scaled; + }, + + /** + * @private + */ + _flipObject: function(transform, by) { + if (transform.newScaleX < 0 && by !== 'y') { + if (transform.originX === 'left') { + transform.originX = 'right'; + } + else if (transform.originX === 'right') { + transform.originX = 'left'; + } + } + + if (transform.newScaleY < 0 && by !== 'x') { + if (transform.originY === 'top') { + transform.originY = 'bottom'; + } + else if (transform.originY === 'bottom') { + transform.originY = 'top'; + } + } + }, + + /** + * @private + */ + _setLocalMouse: function(localMouse, t) { + var target = t.target; + + if (t.originX === 'right') { + localMouse.x *= -1; + } + else if (t.originX === 'center') { + localMouse.x *= t.mouseXSign * 2; + if (localMouse.x < 0) { + t.mouseXSign = -t.mouseXSign; + } + } + + if (t.originY === 'bottom') { + localMouse.y *= -1; + } + else if (t.originY === 'center') { + localMouse.y *= t.mouseYSign * 2; + if (localMouse.y < 0) { + t.mouseYSign = -t.mouseYSign; + } + } + + // adjust the mouse coordinates when dealing with padding + if (abs(localMouse.x) > target.padding) { + if (localMouse.x < 0) { + localMouse.x += target.padding; + } + else { + localMouse.x -= target.padding; + } + } + else { // mouse is within the padding, set to 0 + localMouse.x = 0; + } + + if (abs(localMouse.y) > target.padding) { + if (localMouse.y < 0) { + localMouse.y += target.padding; + } + else { + localMouse.y -= target.padding; + } + } + else { + localMouse.y = 0; + } + }, + + /** + * Rotates object by invoking its rotate method + * @private + * @param {Number} x pointer's x coordinate + * @param {Number} y pointer's y coordinate + * @return {Boolean} true if the rotation occurred + */ + _rotateObject: function (x, y) { + + var t = this._currentTransform; + + if (t.target.get('lockRotation')) { + return false; + } + + var lastAngle = atan2(t.ey - t.top, t.ex - t.left), + curAngle = atan2(y - t.top, x - t.left), + angle = radiansToDegrees(curAngle - lastAngle + t.theta); + + // normalize angle to positive value + if (angle < 0) { + angle = 360 + angle; + } + + t.target.angle = angle % 360; + return true; + }, + + /** + * Set the cursor type of the canvas element + * @param {String} value Cursor type of the canvas element. + * @see http://www.w3.org/TR/css3-ui/#cursor + */ + setCursor: function (value) { + this.upperCanvasEl.style.cursor = value; + }, + + /** + * @param {fabric.Object} target to reset transform + * @private + */ + _resetObjectTransform: function (target) { + target.scaleX = 1; + target.scaleY = 1; + target.skewX = 0; + target.skewY = 0; + target.setAngle(0); + }, + + /** + * @private + * @param {CanvasRenderingContext2D} ctx to draw the selection on + */ + _drawSelection: function (ctx) { + var groupSelector = this._groupSelector, + left = groupSelector.left, + top = groupSelector.top, + aleft = abs(left), + atop = abs(top); + + if (this.selectionColor) { + ctx.fillStyle = this.selectionColor; + + ctx.fillRect( + groupSelector.ex - ((left > 0) ? 0 : -left), + groupSelector.ey - ((top > 0) ? 0 : -top), + aleft, + atop + ); + } + + if (!this.selectionLineWidth || !this.selectionBorderColor) { + return; + } + ctx.lineWidth = this.selectionLineWidth; + ctx.strokeStyle = this.selectionBorderColor; + + // selection border + if (this.selectionDashArray.length > 1 && !supportLineDash) { + + var px = groupSelector.ex + STROKE_OFFSET - ((left > 0) ? 0 : aleft), + py = groupSelector.ey + STROKE_OFFSET - ((top > 0) ? 0 : atop); + + ctx.beginPath(); + + fabric.util.drawDashedLine(ctx, px, py, px + aleft, py, this.selectionDashArray); + fabric.util.drawDashedLine(ctx, px, py + atop - 1, px + aleft, py + atop - 1, this.selectionDashArray); + fabric.util.drawDashedLine(ctx, px, py, px, py + atop, this.selectionDashArray); + fabric.util.drawDashedLine(ctx, px + aleft - 1, py, px + aleft - 1, py + atop, this.selectionDashArray); + + ctx.closePath(); + ctx.stroke(); + } + else { + fabric.Object.prototype._setLineDash.call(this, ctx, this.selectionDashArray); + ctx.strokeRect( + groupSelector.ex + STROKE_OFFSET - ((left > 0) ? 0 : aleft), + groupSelector.ey + STROKE_OFFSET - ((top > 0) ? 0 : atop), + aleft, + atop + ); + } + }, + + /** + * Method that determines what object we are clicking on + * @param {Event} e mouse event + * @param {Boolean} skipGroup when true, activeGroup is skipped and only objects are traversed through + */ + findTarget: function (e, skipGroup) { + if (this.skipTargetFind) { + return; + } + + var ignoreZoom = true, + pointer = this.getPointer(e, ignoreZoom), + activeGroup = this.getActiveGroup(), + activeObject = this.getActiveObject(), + activeTarget; + + // first check current group (if one exists) + // active group does not check sub targets like normal groups. + // if active group just exits. + if (activeGroup && !skipGroup && this._checkTarget(pointer, activeGroup)) { + this._fireOverOutEvents(activeGroup, e); + return activeGroup; + } + // if we hit the corner of an activeObject, let's return that. + if (activeObject && activeObject._findTargetCorner(pointer)) { + this._fireOverOutEvents(activeObject, e); + return activeObject; + } + if (activeObject && this._checkTarget(pointer, activeObject)) { + if (!this.preserveObjectStacking) { + this._fireOverOutEvents(activeObject, e); + return activeObject; + } + else { + activeTarget = activeObject; + } + } + + this.targets = []; + + var target = this._searchPossibleTargets(this._objects, pointer); + if (e[this.altSelectionKey] && target && activeTarget && target !== activeTarget) { + target = activeTarget; + } + this._fireOverOutEvents(target, e); + return target; + }, + + /** + * @private + */ + _fireOverOutEvents: function(target, e) { + if (target) { + if (this._hoveredTarget !== target) { + if (this._hoveredTarget) { + this.fire('mouse:out', { target: this._hoveredTarget, e: e }); + this._hoveredTarget.fire('mouseout'); + } + this.fire('mouse:over', { target: target, e: e }); + target.fire('mouseover'); + this._hoveredTarget = target; + } + } + else if (this._hoveredTarget) { + this.fire('mouse:out', { target: this._hoveredTarget, e: e }); + this._hoveredTarget.fire('mouseout'); + this._hoveredTarget = null; + } + }, + + /** + * @private + */ + _checkTarget: function(pointer, obj) { + if (obj && + obj.visible && + obj.evented && + this.containsPoint(null, obj, pointer)){ + if ((this.perPixelTargetFind || obj.perPixelTargetFind) && !obj.isEditing) { + var isTransparent = this.isTargetTransparent(obj, pointer.x, pointer.y); + if (!isTransparent) { + return true; + } + } + else { + return true; + } + } + }, + + /** + * @private + */ + _searchPossibleTargets: function(objects, pointer) { + + // Cache all targets where their bounding box contains point. + var target, i = objects.length, normalizedPointer, subTarget; + // Do not check for currently grouped objects, since we check the parent group itself. + // untill we call this function specifically to search inside the activeGroup + while (i--) { + if (this._checkTarget(pointer, objects[i])) { + target = objects[i]; + if (target.type === 'group' && target.subTargetCheck) { + normalizedPointer = this._normalizePointer(target, pointer); + subTarget = this._searchPossibleTargets(target._objects, normalizedPointer); + subTarget && this.targets.push(subTarget); + } + break; + } + } + return target; + }, + + /** + * Returns pointer coordinates without the effect of the viewport + * @param {Object} pointer with "x" and "y" number values + * @return {Object} object with "x" and "y" number values + */ + restorePointerVpt: function(pointer) { + return fabric.util.transformPoint( + pointer, + fabric.util.invertTransform(this.viewportTransform) + ); + }, + + /** + * Returns pointer coordinates relative to canvas. + * @param {Event} e + * @param {Boolean} ignoreZoom + * @return {Object} object with "x" and "y" number values + */ + getPointer: function (e, ignoreZoom, upperCanvasEl) { + if (!upperCanvasEl) { + upperCanvasEl = this.upperCanvasEl; + } + var pointer = getPointer(e), + bounds = upperCanvasEl.getBoundingClientRect(), + boundsWidth = bounds.width || 0, + boundsHeight = bounds.height || 0, + cssScale; + + if (!boundsWidth || !boundsHeight ) { + if ('top' in bounds && 'bottom' in bounds) { + boundsHeight = Math.abs( bounds.top - bounds.bottom ); + } + if ('right' in bounds && 'left' in bounds) { + boundsWidth = Math.abs( bounds.right - bounds.left ); + } + } + + this.calcOffset(); + + pointer.x = pointer.x - this._offset.left; + pointer.y = pointer.y - this._offset.top; + if (!ignoreZoom) { + pointer = this.restorePointerVpt(pointer); + } + + if (boundsWidth === 0 || boundsHeight === 0) { + // If bounds are not available (i.e. not visible), do not apply scale. + cssScale = { width: 1, height: 1 }; + } + else { + cssScale = { + width: upperCanvasEl.width / boundsWidth, + height: upperCanvasEl.height / boundsHeight + }; + } + + return { + x: pointer.x * cssScale.width, + y: pointer.y * cssScale.height + }; + }, + + /** + * @private + * @throws {CANVAS_INIT_ERROR} If canvas can not be initialized + */ + _createUpperCanvas: function () { + var lowerCanvasClass = this.lowerCanvasEl.className.replace(/\s*lower-canvas\s*/, ''); + + this.upperCanvasEl = this._createCanvasElement(); + fabric.util.addClass(this.upperCanvasEl, 'upper-canvas ' + lowerCanvasClass); + + this.wrapperEl.appendChild(this.upperCanvasEl); + + this._copyCanvasStyle(this.lowerCanvasEl, this.upperCanvasEl); + this._applyCanvasStyle(this.upperCanvasEl); + this.contextTop = this.upperCanvasEl.getContext('2d'); + }, + + /** + * @private + */ + _createCacheCanvas: function () { + this.cacheCanvasEl = this._createCanvasElement(); + this.cacheCanvasEl.setAttribute('width', this.width); + this.cacheCanvasEl.setAttribute('height', this.height); + this.contextCache = this.cacheCanvasEl.getContext('2d'); + }, + + /** + * @private + */ + _initWrapperElement: function () { + this.wrapperEl = fabric.util.wrapElement(this.lowerCanvasEl, 'div', { + 'class': this.containerClass + }); + fabric.util.setStyle(this.wrapperEl, { + width: this.getWidth() + 'px', + height: this.getHeight() + 'px', + position: 'relative' + }); + fabric.util.makeElementUnselectable(this.wrapperEl); + }, + + /** + * @private + * @param {HTMLElement} element canvas element to apply styles on + */ + _applyCanvasStyle: function (element) { + var width = this.getWidth() || element.width, + height = this.getHeight() || element.height; + + fabric.util.setStyle(element, { + position: 'absolute', + width: width + 'px', + height: height + 'px', + left: 0, + top: 0 + }); + element.width = width; + element.height = height; + fabric.util.makeElementUnselectable(element); + }, + + /** + * Copys the the entire inline style from one element (fromEl) to another (toEl) + * @private + * @param {Element} fromEl Element style is copied from + * @param {Element} toEl Element copied style is applied to + */ + _copyCanvasStyle: function (fromEl, toEl) { + toEl.style.cssText = fromEl.style.cssText; + }, + + /** + * Returns context of canvas where object selection is drawn + * @return {CanvasRenderingContext2D} + */ + getSelectionContext: function() { + return this.contextTop; + }, + + /** + * Returns <canvas> element on which object selection is drawn + * @return {HTMLCanvasElement} + */ + getSelectionElement: function () { + return this.upperCanvasEl; + }, + + /** + * @private + * @param {Object} object + */ + _setActiveObject: function(object) { + if (this._activeObject) { + this._activeObject.set('active', false); + } + this._activeObject = object; + object.set('active', true); + }, + + /** + * Sets given object as the only active object on canvas + * @param {fabric.Object} object Object to set as an active one + * @param {Event} [e] Event (passed along when firing "object:selected") + * @return {fabric.Canvas} thisArg + * @chainable + */ + setActiveObject: function (object, e) { + this._setActiveObject(object); + this.renderAll(); + this.fire('object:selected', { target: object, e: e }); + object.fire('selected', { e: e }); + return this; + }, + + /** + * Returns currently active object + * @return {fabric.Object} active object + */ + getActiveObject: function () { + return this._activeObject; + }, + + /** + * @private + * @param {fabric.Object} obj Object that was removed + */ + _onObjectRemoved: function(obj) { + // removing active object should fire "selection:cleared" events + if (this.getActiveObject() === obj) { + this.fire('before:selection:cleared', { target: obj }); + this._discardActiveObject(); + this.fire('selection:cleared', { target: obj }); + obj.fire('deselected'); + } + this.callSuper('_onObjectRemoved', obj); + }, + + /** + * @private + */ + _discardActiveObject: function() { + if (this._activeObject) { + this._activeObject.set('active', false); + } + this._activeObject = null; + }, + + /** + * Discards currently active object and fire events + * @param {event} e + * @return {fabric.Canvas} thisArg + * @chainable + */ + discardActiveObject: function (e) { + var activeObject = this._activeObject; + this.fire('before:selection:cleared', { target: activeObject, e: e }); + this._discardActiveObject(); + this.fire('selection:cleared', { e: e }); + activeObject && activeObject.fire('deselected', { e: e }); + return this; + }, + + /** + * @private + * @param {fabric.Group} group + */ + _setActiveGroup: function(group) { + this._activeGroup = group; + if (group) { + group.set('active', true); + } + }, + + /** + * Sets active group to a specified one + * @param {fabric.Group} group Group to set as a current one + * @param {Event} e Event object + * @return {fabric.Canvas} thisArg + * @chainable + */ + setActiveGroup: function (group, e) { + this._setActiveGroup(group); + if (group) { + this.fire('object:selected', { target: group, e: e }); + group.fire('selected', { e: e }); + } + return this; + }, + + /** + * Returns currently active group + * @return {fabric.Group} Current group + */ + getActiveGroup: function () { + return this._activeGroup; + }, + + /** + * @private + */ + _discardActiveGroup: function() { + var g = this.getActiveGroup(); + if (g) { + g.destroy(); + } + this.setActiveGroup(null); + }, + + /** + * Discards currently active group and fire events + * @return {fabric.Canvas} thisArg + * @chainable + */ + discardActiveGroup: function (e) { + var g = this.getActiveGroup(); + this.fire('before:selection:cleared', { e: e, target: g }); + this._discardActiveGroup(); + this.fire('selection:cleared', { e: e }); + return this; + }, + + /** + * Deactivates all objects on canvas, removing any active group or object + * @return {fabric.Canvas} thisArg + * @chainable + */ + deactivateAll: function () { + var allObjects = this.getObjects(), + i = 0, + len = allObjects.length; + for ( ; i < len; i++) { + allObjects[i].set('active', false); + } + this._discardActiveGroup(); + this._discardActiveObject(); + return this; + }, + + /** + * Deactivates all objects and dispatches appropriate events + * @return {fabric.Canvas} thisArg + * @chainable + */ + deactivateAllWithDispatch: function (e) { + var activeGroup = this.getActiveGroup(), + activeObject = this.getActiveObject(); + if (activeObject || activeGroup) { + this.fire('before:selection:cleared', { target: activeObject || activeGroup, e: e }); + } + this.deactivateAll(); + if (activeObject || activeGroup) { + this.fire('selection:cleared', { e: e, target: activeObject }); + activeObject && activeObject.fire('deselected'); + } + return this; + }, + + /** + * Clears a canvas element and removes all event listeners + * @return {fabric.Canvas} thisArg + * @chainable + */ + dispose: function () { + this.callSuper('dispose'); + var wrapper = this.wrapperEl; + this.removeListeners(); + wrapper.removeChild(this.upperCanvasEl); + wrapper.removeChild(this.lowerCanvasEl); + delete this.upperCanvasEl; + if (wrapper.parentNode) { + wrapper.parentNode.replaceChild(this.lowerCanvasEl, this.wrapperEl); + } + delete this.wrapperEl; + return this; + }, + + /** + * Clears all contexts (background, main, top) of an instance + * @return {fabric.Canvas} thisArg + * @chainable + */ + clear: function () { + this.discardActiveGroup(); + this.discardActiveObject(); + this.clearContext(this.contextTop); + return this.callSuper('clear'); + }, + + /** + * Draws objects' controls (borders/controls) + * @param {CanvasRenderingContext2D} ctx Context to render controls on + */ + drawControls: function(ctx) { + var activeGroup = this.getActiveGroup(); + + if (activeGroup) { + activeGroup._renderControls(ctx); + } + else { + this._drawObjectsControls(ctx); + } + }, + + /** + * @private + */ + _drawObjectsControls: function(ctx) { + for (var i = 0, len = this._objects.length; i < len; ++i) { + if (!this._objects[i] || !this._objects[i].active) { + continue; + } + this._objects[i]._renderControls(ctx); + } + }, + + /** + * @private + */ + _toObject: function(instance, methodName, propertiesToInclude) { + //If the object is part of the current selection group, it should + //be transformed appropriately + //i.e. it should be serialised as it would appear if the selection group + //were to be destroyed. + var originalProperties = this._realizeGroupTransformOnObject(instance), + object = this.callSuper('_toObject', instance, methodName, propertiesToInclude); + //Undo the damage we did by changing all of its properties + this._unwindGroupTransformOnObject(instance, originalProperties); + return object; + }, + + /** + * Realises an object's group transformation on it + * @private + * @param {fabric.Object} [instance] the object to transform (gets mutated) + * @returns the original values of instance which were changed + */ + _realizeGroupTransformOnObject: function(instance) { + var layoutProps = ['angle', 'flipX', 'flipY', 'height', 'left', 'scaleX', 'scaleY', 'top', 'width']; + if (instance.group && instance.group === this.getActiveGroup()) { + //Copy all the positionally relevant properties across now + var originalValues = {}; + layoutProps.forEach(function(prop) { + originalValues[prop] = instance[prop]; + }); + this.getActiveGroup().realizeTransform(instance); + return originalValues; + } + else { + return null; + } + }, + + /** + * Restores the changed properties of instance + * @private + * @param {fabric.Object} [instance] the object to un-transform (gets mutated) + * @param {Object} [originalValues] the original values of instance, as returned by _realizeGroupTransformOnObject + */ + _unwindGroupTransformOnObject: function(instance, originalValues) { + if (originalValues) { + instance.set(originalValues); + } + }, + + /** + * @private + */ + _setSVGObject: function(markup, instance, reviver) { + var originalProperties; + //If the object is in a selection group, simulate what would happen to that + //object when the group is deselected + originalProperties = this._realizeGroupTransformOnObject(instance); + this.callSuper('_setSVGObject', markup, instance, reviver); + this._unwindGroupTransformOnObject(instance, originalProperties); + }, + }); + + // copying static properties manually to work around Opera's bug, + // where "prototype" property is enumerable and overrides existing prototype + for (var prop in fabric.StaticCanvas) { + if (prop !== 'prototype') { + fabric.Canvas[prop] = fabric.StaticCanvas[prop]; + } + } + + if (fabric.isTouchSupported) { + /** @ignore */ + fabric.Canvas.prototype._setCursorFromEvent = function() { }; + } + + /** + * @ignore + * @class fabric.Element + * @alias fabric.Canvas + * @deprecated Use {@link fabric.Canvas} instead. + * @constructor + */ + fabric.Element = fabric.Canvas; +})(); + + +(function() { + + var cursorOffset = { + mt: 0, // n + tr: 1, // ne + mr: 2, // e + br: 3, // se + mb: 4, // s + bl: 5, // sw + ml: 6, // w + tl: 7 // nw + }, + addListener = fabric.util.addListener, + removeListener = fabric.util.removeListener; + + fabric.util.object.extend(fabric.Canvas.prototype, /** @lends fabric.Canvas.prototype */ { + + /** + * Map of cursor style values for each of the object controls + * @private + */ + cursorMap: [ + 'n-resize', + 'ne-resize', + 'e-resize', + 'se-resize', + 's-resize', + 'sw-resize', + 'w-resize', + 'nw-resize' + ], + + /** + * Adds mouse listeners to canvas + * @private + */ + _initEventListeners: function () { + + this._bindEvents(); + + addListener(fabric.window, 'resize', this._onResize); + + // mouse events + addListener(this.upperCanvasEl, 'mousedown', this._onMouseDown); + addListener(this.upperCanvasEl, 'mousemove', this._onMouseMove); + addListener(this.upperCanvasEl, 'mouseout', this._onMouseOut); + addListener(this.upperCanvasEl, 'wheel', this._onMouseWheel); + addListener(this.upperCanvasEl, 'contextmenu', this._onContextMenu); + + // touch events + addListener(this.upperCanvasEl, 'touchstart', this._onMouseDown); + addListener(this.upperCanvasEl, 'touchmove', this._onMouseMove); + + if (typeof eventjs !== 'undefined' && 'add' in eventjs) { + eventjs.add(this.upperCanvasEl, 'gesture', this._onGesture); + eventjs.add(this.upperCanvasEl, 'drag', this._onDrag); + eventjs.add(this.upperCanvasEl, 'orientation', this._onOrientationChange); + eventjs.add(this.upperCanvasEl, 'shake', this._onShake); + eventjs.add(this.upperCanvasEl, 'longpress', this._onLongPress); + } + }, + + /** + * @private + */ + _bindEvents: function() { + this._onMouseDown = this._onMouseDown.bind(this); + this._onMouseMove = this._onMouseMove.bind(this); + this._onMouseUp = this._onMouseUp.bind(this); + this._onResize = this._onResize.bind(this); + this._onGesture = this._onGesture.bind(this); + this._onDrag = this._onDrag.bind(this); + this._onShake = this._onShake.bind(this); + this._onLongPress = this._onLongPress.bind(this); + this._onOrientationChange = this._onOrientationChange.bind(this); + this._onMouseWheel = this._onMouseWheel.bind(this); + this._onMouseOut = this._onMouseOut.bind(this); + this._onContextMenu = this._onContextMenu.bind(this); + }, + + /** + * Removes all event listeners + */ + removeListeners: function() { + removeListener(fabric.window, 'resize', this._onResize); + + removeListener(this.upperCanvasEl, 'mousedown', this._onMouseDown); + removeListener(this.upperCanvasEl, 'mousemove', this._onMouseMove); + removeListener(this.upperCanvasEl, 'mouseout', this._onMouseOut); + removeListener(this.upperCanvasEl, 'wheel', this._onMouseWheel); + removeListener(this.upperCanvasEl, 'contextmenu', this._onContextMenu); + + removeListener(this.upperCanvasEl, 'touchstart', this._onMouseDown); + removeListener(this.upperCanvasEl, 'touchmove', this._onMouseMove); + + if (typeof eventjs !== 'undefined' && 'remove' in eventjs) { + eventjs.remove(this.upperCanvasEl, 'gesture', this._onGesture); + eventjs.remove(this.upperCanvasEl, 'drag', this._onDrag); + eventjs.remove(this.upperCanvasEl, 'orientation', this._onOrientationChange); + eventjs.remove(this.upperCanvasEl, 'shake', this._onShake); + eventjs.remove(this.upperCanvasEl, 'longpress', this._onLongPress); + } + }, + + /** + * @private + * @param {Event} [e] Event object fired on Event.js gesture + * @param {Event} [self] Inner Event object + */ + _onGesture: function(e, self) { + this.__onTransformGesture && this.__onTransformGesture(e, self); + }, + + /** + * @private + * @param {Event} [e] Event object fired on Event.js drag + * @param {Event} [self] Inner Event object + */ + _onDrag: function(e, self) { + this.__onDrag && this.__onDrag(e, self); + }, + + /** + * @private + * @param {Event} [e] Event object fired on wheel event + */ + _onMouseWheel: function(e) { + this.__onMouseWheel(e); + }, + + /** + * @private + * @param {Event} e Event object fired on mousedown + */ + _onMouseOut: function(e) { + var target = this._hoveredTarget; + this.fire('mouse:out', { target: target, e: e }); + this._hoveredTarget = null; + target && target.fire('mouseout', { e: e }); + }, + + /** + * @private + * @param {Event} [e] Event object fired on Event.js orientation change + * @param {Event} [self] Inner Event object + */ + _onOrientationChange: function(e, self) { + this.__onOrientationChange && this.__onOrientationChange(e, self); + }, + + /** + * @private + * @param {Event} [e] Event object fired on Event.js shake + * @param {Event} [self] Inner Event object + */ + _onShake: function(e, self) { + this.__onShake && this.__onShake(e, self); + }, + + /** + * @private + * @param {Event} [e] Event object fired on Event.js shake + * @param {Event} [self] Inner Event object + */ + _onLongPress: function(e, self) { + this.__onLongPress && this.__onLongPress(e, self); + }, + + /** + * @private + * @param {Event} e Event object fired on mousedown + */ + _onContextMenu: function (e) { + if (this.stopContextMenu) { + e.stopPropagation() + e.preventDefault(); + } + return false; + }, + + /** + * @private + * @param {Event} e Event object fired on mousedown + */ + _onMouseDown: function (e) { + this.__onMouseDown(e); + + addListener(fabric.document, 'touchend', this._onMouseUp); + addListener(fabric.document, 'touchmove', this._onMouseMove); + + removeListener(this.upperCanvasEl, 'mousemove', this._onMouseMove); + removeListener(this.upperCanvasEl, 'touchmove', this._onMouseMove); + + if (e.type === 'touchstart') { + // Unbind mousedown to prevent double triggers from touch devices + removeListener(this.upperCanvasEl, 'mousedown', this._onMouseDown); + } + else { + addListener(fabric.document, 'mouseup', this._onMouseUp); + addListener(fabric.document, 'mousemove', this._onMouseMove); + } + }, + + /** + * @private + * @param {Event} e Event object fired on mouseup + */ + _onMouseUp: function (e) { + this.__onMouseUp(e); + + removeListener(fabric.document, 'mouseup', this._onMouseUp); + removeListener(fabric.document, 'touchend', this._onMouseUp); + + removeListener(fabric.document, 'mousemove', this._onMouseMove); + removeListener(fabric.document, 'touchmove', this._onMouseMove); + + addListener(this.upperCanvasEl, 'mousemove', this._onMouseMove); + addListener(this.upperCanvasEl, 'touchmove', this._onMouseMove); + + if (e.type === 'touchend') { + // Wait 400ms before rebinding mousedown to prevent double triggers + // from touch devices + var _this = this; + setTimeout(function() { + addListener(_this.upperCanvasEl, 'mousedown', _this._onMouseDown); + }, 400); + } + }, + + /** + * @private + * @param {Event} e Event object fired on mousemove + */ + _onMouseMove: function (e) { + !this.allowTouchScrolling && e.preventDefault && e.preventDefault(); + this.__onMouseMove(e); + }, + + /** + * @private + */ + _onResize: function () { + this.calcOffset(); + }, + + /** + * Decides whether the canvas should be redrawn in mouseup and mousedown events. + * @private + * @param {Object} target + * @param {Object} pointer + */ + _shouldRender: function(target, pointer) { + var activeObject = this.getActiveGroup() || this.getActiveObject(); + + return !!( + (target && ( + target.isMoving || + target !== activeObject)) + || + (!target && !!activeObject) + || + (!target && !activeObject && !this._groupSelector) + || + (pointer && + this._previousPointer && + this.selection && ( + pointer.x !== this._previousPointer.x || + pointer.y !== this._previousPointer.y)) + ); + }, + + /** + * Method that defines the actions when mouse is released on canvas. + * The method resets the currentTransform parameters, store the image corner + * position in the image object and render the canvas on top. + * @private + * @param {Event} e Event object fired on mouseup + */ + __onMouseUp: function (e) { + var target, searchTarget = true, transform = this._currentTransform, + groupSelector = this._groupSelector, + isClick = (!groupSelector || (groupSelector.left === 0 && groupSelector.top === 0)); + + if (this.isDrawingMode && this._isCurrentlyDrawing) { + this._onMouseUpInDrawingMode(e); + return; + } + + if (transform) { + this._finalizeCurrentTransform(); + searchTarget = !transform.actionPerformed; + } + + target = searchTarget ? this.findTarget(e, true) : transform.target; + + var shouldRender = this._shouldRender(target, this.getPointer(e)); + + if (target || !isClick) { + this._maybeGroupObjects(e); + } + else { + // those are done by default on mouse up + // by _maybeGroupObjects, we are skipping it in case of no target find + this._groupSelector = null; + this._currentTransform = null; + } + + if (target) { + target.isMoving = false; + } + + this._handleCursorAndEvent(e, target, 'up'); + target && (target.__corner = 0); + shouldRender && this.renderAll(); + }, + + /** + * set cursor for mouse up and handle mouseUp event + * @param {Event} e event from mouse + * @param {fabric.Object} target receiving event + * @param {String} eventType event to fire (up, down or move) + */ + _handleCursorAndEvent: function(e, target, eventType) { + this._setCursorFromEvent(e, target); + this._handleEvent(e, eventType, target ? target : null); + }, + + /** + * Handle event firing for target and subtargets + * @param {Event} e event from mouse + * @param {String} eventType event to fire (up, down or move) + * @param {fabric.Object} targetObj receiving event + */ + _handleEvent: function(e, eventType, targetObj) { + var target = typeof targetObj === undefined ? this.findTarget(e) : targetObj, + targets = this.targets || [], + options = { e: e, target: target, subTargets: targets }; + + this.fire('mouse:' + eventType, options); + target && target.fire('mouse' + eventType, options); + for (var i = 0; i < targets.length; i++) { + targets[i].fire('mouse' + eventType, options); + } + }, + + /** + * @private + */ + _finalizeCurrentTransform: function() { + + var transform = this._currentTransform, + target = transform.target; + + if (target._scaling) { + target._scaling = false; + } + + target.setCoords(); + this._restoreOriginXY(target); + + if (transform.actionPerformed || (this.stateful && target.hasStateChanged())) { + this.fire('object:modified', { target: target }); + target.fire('modified'); + } + }, + + /** + * @private + * @param {Object} target Object to restore + */ + _restoreOriginXY: function(target) { + if (this._previousOriginX && this._previousOriginY) { + + var originPoint = target.translateToOriginPoint( + target.getCenterPoint(), + this._previousOriginX, + this._previousOriginY); + + target.originX = this._previousOriginX; + target.originY = this._previousOriginY; + + target.left = originPoint.x; + target.top = originPoint.y; + + this._previousOriginX = null; + this._previousOriginY = null; + } + }, + + /** + * @private + * @param {Event} e Event object fired on mousedown + */ + _onMouseDownInDrawingMode: function(e) { + this._isCurrentlyDrawing = true; + this.discardActiveObject(e).renderAll(); + if (this.clipTo) { + fabric.util.clipContext(this, this.contextTop); + } + var pointer = this.getPointer(e); + this.freeDrawingBrush.onMouseDown(pointer); + this._handleEvent(e, 'down'); + }, + + /** + * @private + * @param {Event} e Event object fired on mousemove + */ + _onMouseMoveInDrawingMode: function(e) { + if (this._isCurrentlyDrawing) { + var pointer = this.getPointer(e); + this.freeDrawingBrush.onMouseMove(pointer); + } + this.setCursor(this.freeDrawingCursor); + this._handleEvent(e, 'move'); + }, + + /** + * @private + * @param {Event} e Event object fired on mouseup + */ + _onMouseUpInDrawingMode: function(e) { + this._isCurrentlyDrawing = false; + if (this.clipTo) { + this.contextTop.restore(); + } + this.freeDrawingBrush.onMouseUp(); + this._handleEvent(e, 'up'); + }, + + /** + * Method that defines the actions when mouse is clic ked on canvas. + * The method inits the currentTransform parameters and renders all the + * canvas so the current image can be placed on the top canvas and the rest + * in on the container one. + * @private + * @param {Event} e Event object fired on mousedown + */ + __onMouseDown: function (e) { + + // if right click just fire events + var isRightClick = 'which' in e ? e.which === 3 : e.button === 2; + if (isRightClick) { + if (this.fireRightClick) { + this._handleEvent(e, 'down', target ? target : null); + } + return; + } + + if (this.isDrawingMode) { + this._onMouseDownInDrawingMode(e); + return; + } + + // ignore if some object is being transformed at this moment + if (this._currentTransform) { + return; + } + + var target = this.findTarget(e), + pointer = this.getPointer(e, true); + + // save pointer for check in __onMouseUp event + this._previousPointer = pointer; + + var shouldRender = this._shouldRender(target, pointer), + shouldGroup = this._shouldGroup(e, target); + + if (this._shouldClearSelection(e, target)) { + this._clearSelection(e, target, pointer); + } + else if (shouldGroup) { + this._handleGrouping(e, target); + target = this.getActiveGroup(); + } + + if (target) { + if (target.selectable && (target.__corner || !shouldGroup)) { + this._beforeTransform(e, target); + this._setupCurrentTransform(e, target); + } + + if (target !== this.getActiveGroup() && target !== this.getActiveObject()) { + this.deactivateAll(); + target.selectable && this.setActiveObject(target, e); + } + } + this._handleEvent(e, 'down', target ? target : null); + // we must renderAll so that we update the visuals + shouldRender && this.renderAll(); + }, + + /** + * @private + */ + _beforeTransform: function(e, target) { + this.stateful && target.saveState(); + + // determine if it's a drag or rotate case + if (target._findTargetCorner(this.getPointer(e))) { + this.onBeforeScaleRotate(target); + } + + }, + + /** + * @private + */ + _clearSelection: function(e, target, pointer) { + this.deactivateAllWithDispatch(e); + + if (target && target.selectable) { + this.setActiveObject(target, e); + } + else if (this.selection) { + this._groupSelector = { + ex: pointer.x, + ey: pointer.y, + top: 0, + left: 0 + }; + } + }, + + /** + * @private + * @param {Object} target Object for that origin is set to center + */ + _setOriginToCenter: function(target) { + this._previousOriginX = this._currentTransform.target.originX; + this._previousOriginY = this._currentTransform.target.originY; + + var center = target.getCenterPoint(); + + target.originX = 'center'; + target.originY = 'center'; + + target.left = center.x; + target.top = center.y; + + this._currentTransform.left = target.left; + this._currentTransform.top = target.top; + }, + + /** + * @private + * @param {Object} target Object for that center is set to origin + */ + _setCenterToOrigin: function(target) { + var originPoint = target.translateToOriginPoint( + target.getCenterPoint(), + this._previousOriginX, + this._previousOriginY); + + target.originX = this._previousOriginX; + target.originY = this._previousOriginY; + + target.left = originPoint.x; + target.top = originPoint.y; + + this._previousOriginX = null; + this._previousOriginY = null; + }, + + /** + * Method that defines the actions when mouse is hovering the canvas. + * The currentTransform parameter will definde whether the user is rotating/scaling/translating + * an image or neither of them (only hovering). A group selection is also possible and would cancel + * all any other type of action. + * In case of an image transformation only the top canvas will be rendered. + * @private + * @param {Event} e Event object fired on mousemove + */ + __onMouseMove: function (e) { + + var target, pointer; + + if (this.isDrawingMode) { + this._onMouseMoveInDrawingMode(e); + return; + } + if (typeof e.touches !== 'undefined' && e.touches.length > 1) { + return; + } + + var groupSelector = this._groupSelector; + + // We initially clicked in an empty area, so we draw a box for multiple selection + if (groupSelector) { + pointer = this.getPointer(e, true); + + groupSelector.left = pointer.x - groupSelector.ex; + groupSelector.top = pointer.y - groupSelector.ey; + + this.renderTop(); + } + else if (!this._currentTransform) { + target = this.findTarget(e); + this._setCursorFromEvent(e, target); + } + else { + this._transformObject(e); + } + this._handleEvent(e, 'move', target ? target : null); + }, + + /** + * Method that defines actions when an Event Mouse Wheel + * @param {Event} e Event object fired on mouseup + */ + __onMouseWheel: function(e) { + this.fire('mouse:wheel', { + e: e + }); + }, + + /** + * @private + * @param {Event} e Event fired on mousemove + */ + _transformObject: function(e) { + var pointer = this.getPointer(e), + transform = this._currentTransform; + + transform.reset = false; + transform.target.isMoving = true; + + this._beforeScaleTransform(e, transform); + this._performTransformAction(e, transform, pointer); + + transform.actionPerformed && this.renderAll(); + }, + + /** + * @private + */ + _performTransformAction: function(e, transform, pointer) { + var x = pointer.x, + y = pointer.y, + target = transform.target, + action = transform.action, + actionPerformed = false; + + if (action === 'rotate') { + (actionPerformed = this._rotateObject(x, y)) && this._fire('rotating', target, e); + } + else if (action === 'scale') { + (actionPerformed = this._onScale(e, transform, x, y)) && this._fire('scaling', target, e); + } + else if (action === 'scaleX') { + (actionPerformed = this._scaleObject(x, y, 'x')) && this._fire('scaling', target, e); + } + else if (action === 'scaleY') { + (actionPerformed = this._scaleObject(x, y, 'y')) && this._fire('scaling', target, e); + } + else if (action === 'skewX') { + (actionPerformed = this._skewObject(x, y, 'x')) && this._fire('skewing', target, e); + } + else if (action === 'skewY') { + (actionPerformed = this._skewObject(x, y, 'y')) && this._fire('skewing', target, e); + } + else { + actionPerformed = this._translateObject(x, y); + if (actionPerformed) { + this._fire('moving', target, e); + this.setCursor(target.moveCursor || this.moveCursor); + } + } + transform.actionPerformed = actionPerformed; + }, + + /** + * @private + */ + _fire: function(eventName, target, e) { + this.fire('object:' + eventName, { target: target, e: e }); + target.fire(eventName, { e: e }); + }, + + /** + * @private + */ + _beforeScaleTransform: function(e, transform) { + if (transform.action === 'scale' || transform.action === 'scaleX' || transform.action === 'scaleY') { + var centerTransform = this._shouldCenterTransform(transform.target); + + // Switch from a normal resize to center-based + if ((centerTransform && (transform.originX !== 'center' || transform.originY !== 'center')) || + // Switch from center-based resize to normal one + (!centerTransform && transform.originX === 'center' && transform.originY === 'center') + ) { + this._resetCurrentTransform(); + transform.reset = true; + } + } + }, + + /** + * @private + * @param {Event} e Event object + * @param {Object} transform current tranform + * @param {Number} x mouse position x from origin + * @param {Number} y mouse poistion y from origin + * @return {Boolean} true if the scaling occurred + */ + _onScale: function(e, transform, x, y) { + if ((e[this.uniScaleKey] || this.uniScaleTransform) && !transform.target.get('lockUniScaling')) { + transform.currentAction = 'scale'; + return this._scaleObject(x, y); + } + else { + // Switch from a normal resize to proportional + if (!transform.reset && transform.currentAction === 'scale') { + this._resetCurrentTransform(); + } + + transform.currentAction = 'scaleEqually'; + return this._scaleObject(x, y, 'equally'); + } + }, + + /** + * Sets the cursor depending on where the canvas is being hovered. + * Note: very buggy in Opera + * @param {Event} e Event object + * @param {Object} target Object that the mouse is hovering, if so. + */ + _setCursorFromEvent: function (e, target) { + if (!target) { + this.setCursor(this.defaultCursor); + return false; + } + + var hoverCursor = target.hoverCursor || this.hoverCursor; + if (!target.selectable) { + //let's skip _findTargetCorner if object is not selectable + this.setCursor(hoverCursor); + } + else { + var activeGroup = this.getActiveGroup(), + // only show proper corner when group selection is not active + corner = target._findTargetCorner + && (!activeGroup || !activeGroup.contains(target)) + && target._findTargetCorner(this.getPointer(e, true)); + + if (!corner) { + this.setCursor(hoverCursor); + } + else { + this._setCornerCursor(corner, target, e); + } + } + //actually unclear why it should return something + //is never evaluated + return true; + }, + + /** + * @private + */ + _setCornerCursor: function(corner, target, e) { + if (corner in cursorOffset) { + this.setCursor(this._getRotatedCornerCursor(corner, target, e)); + } + else if (corner === 'mtr' && target.hasRotatingPoint) { + this.setCursor(this.rotationCursor); + } + else { + this.setCursor(this.defaultCursor); + return false; + } + }, + + /** + * @private + */ + _getRotatedCornerCursor: function(corner, target, e) { + var n = Math.round((target.getAngle() % 360) / 45); + + if (n < 0) { + n += 8; // full circle ahead + } + n += cursorOffset[corner]; + if (e[this.altActionKey] && cursorOffset[corner] % 2 === 0) { + //if we are holding shift and we are on a mx corner... + n += 2; + } + // normalize n to be from 0 to 7 + n %= 8; + + return this.cursorMap[n]; + } + }); +})(); + + +(function() { + + var min = Math.min, + max = Math.max; + + fabric.util.object.extend(fabric.Canvas.prototype, /** @lends fabric.Canvas.prototype */ { + + /** + * @private + * @param {Event} e Event object + * @param {fabric.Object} target + * @return {Boolean} + */ + _shouldGroup: function(e, target) { + var activeObject = this.getActiveObject(); + return e[this.selectionKey] && target && target.selectable && + (this.getActiveGroup() || (activeObject && activeObject !== target)) + && this.selection; + }, + + /** + * @private + * @param {Event} e Event object + * @param {fabric.Object} target + */ + _handleGrouping: function (e, target) { + var activeGroup = this.getActiveGroup(); + + if (target === activeGroup) { + // if it's a group, find target again, using activeGroup objects + target = this.findTarget(e, true); + // if even object is not found, bail out + if (!target) { + return; + } + } + if (activeGroup) { + this._updateActiveGroup(target, e); + } + else { + this._createActiveGroup(target, e); + } + + if (this._activeGroup) { + this._activeGroup.saveCoords(); + } + }, + + /** + * @private + */ + _updateActiveGroup: function(target, e) { + var activeGroup = this.getActiveGroup(); + + if (activeGroup.contains(target)) { + + activeGroup.removeWithUpdate(target); + target.set('active', false); + + if (activeGroup.size() === 1) { + // remove group alltogether if after removal it only contains 1 object + this.discardActiveGroup(e); + // activate last remaining object + this.setActiveObject(activeGroup.item(0)); + return; + } + } + else { + activeGroup.addWithUpdate(target); + } + this.fire('selection:created', { target: activeGroup, e: e }); + activeGroup.set('active', true); + }, + + /** + * @private + */ + _createActiveGroup: function(target, e) { + + if (this._activeObject && target !== this._activeObject) { + + var group = this._createGroup(target); + group.addWithUpdate(); + + this.setActiveGroup(group); + this._activeObject = null; + + this.fire('selection:created', { target: group, e: e }); + } + + target.set('active', true); + }, + + /** + * @private + * @param {Object} target + */ + _createGroup: function(target) { + + var objects = this.getObjects(), + isActiveLower = objects.indexOf(this._activeObject) < objects.indexOf(target), + groupObjects = isActiveLower + ? [this._activeObject, target] + : [target, this._activeObject]; + this._activeObject.isEditing && this._activeObject.exitEditing(); + return new fabric.Group(groupObjects, { + canvas: this + }); + }, + + /** + * @private + * @param {Event} e mouse event + */ + _groupSelectedObjects: function (e) { + + var group = this._collectObjects(); + + // do not create group for 1 element only + if (group.length === 1) { + this.setActiveObject(group[0], e); + } + else if (group.length > 1) { + group = new fabric.Group(group.reverse(), { + canvas: this + }); + group.addWithUpdate(); + this.setActiveGroup(group, e); + group.saveCoords(); + this.fire('selection:created', { target: group }); + this.renderAll(); + } + }, + + /** + * @private + */ + _collectObjects: function() { + var group = [], + currentObject, + x1 = this._groupSelector.ex, + y1 = this._groupSelector.ey, + x2 = x1 + this._groupSelector.left, + y2 = y1 + this._groupSelector.top, + selectionX1Y1 = new fabric.Point(min(x1, x2), min(y1, y2)), + selectionX2Y2 = new fabric.Point(max(x1, x2), max(y1, y2)), + isClick = x1 === x2 && y1 === y2; + + for (var i = this._objects.length; i--; ) { + currentObject = this._objects[i]; + + if (!currentObject || !currentObject.selectable || !currentObject.visible) { + continue; + } + + if (currentObject.intersectsWithRect(selectionX1Y1, selectionX2Y2) || + currentObject.isContainedWithinRect(selectionX1Y1, selectionX2Y2) || + currentObject.containsPoint(selectionX1Y1) || + currentObject.containsPoint(selectionX2Y2) + ) { + currentObject.set('active', true); + group.push(currentObject); + + // only add one object if it's a click + if (isClick) { + break; + } + } + } + + return group; + }, + + /** + * @private + */ + _maybeGroupObjects: function(e) { + if (this.selection && this._groupSelector) { + this._groupSelectedObjects(e); + } + + var activeGroup = this.getActiveGroup(); + if (activeGroup) { + activeGroup.setObjectsCoords().setCoords(); + activeGroup.isMoving = false; + this.setCursor(this.defaultCursor); + } + + // clear selection and current transformation + this._groupSelector = null; + this._currentTransform = null; + } + }); + +})(); + + +(function () { + + var supportQuality = fabric.StaticCanvas.supports('toDataURLWithQuality'); + + fabric.util.object.extend(fabric.StaticCanvas.prototype, /** @lends fabric.StaticCanvas.prototype */ { + + /** + * Exports canvas element to a dataurl image. Note that when multiplier is used, cropping is scaled appropriately + * @param {Object} [options] Options object + * @param {String} [options.format=png] The format of the output image. Either "jpeg" or "png" + * @param {Number} [options.quality=1] Quality level (0..1). Only used for jpeg. + * @param {Number} [options.multiplier=1] Multiplier to scale by + * @param {Number} [options.left] Cropping left offset. Introduced in v1.2.14 + * @param {Number} [options.top] Cropping top offset. Introduced in v1.2.14 + * @param {Number} [options.width] Cropping width. Introduced in v1.2.14 + * @param {Number} [options.height] Cropping height. Introduced in v1.2.14 + * @return {String} Returns a data: URL containing a representation of the object in the format specified by options.format + * @see {@link http://jsfiddle.net/fabricjs/NfZVb/|jsFiddle demo} + * @example Generate jpeg dataURL with lower quality + * var dataURL = canvas.toDataURL({ + * format: 'jpeg', + * quality: 0.8 + * }); + * @example Generate cropped png dataURL (clipping of canvas) + * var dataURL = canvas.toDataURL({ + * format: 'png', + * left: 100, + * top: 100, + * width: 200, + * height: 200 + * }); + * @example Generate double scaled png dataURL + * var dataURL = canvas.toDataURL({ + * format: 'png', + * multiplier: 2 + * }); + */ + toDataURL: function (options) { + options || (options = { }); + + var format = options.format || 'png', + quality = options.quality || 1, + multiplier = options.multiplier || 1, + cropping = { + left: options.left || 0, + top: options.top || 0, + width: options.width || 0, + height: options.height || 0, + }; + return this.__toDataURLWithMultiplier(format, quality, cropping, multiplier); + }, + + /** + * @private + */ + __toDataURLWithMultiplier: function(format, quality, cropping, multiplier) { + + var origWidth = this.getWidth(), + origHeight = this.getHeight(), + scaledWidth = (cropping.width || this.getWidth()) * multiplier, + scaledHeight = (cropping.height || this.getHeight()) * multiplier, + zoom = this.getZoom(), + newZoom = zoom * multiplier, + vp = this.viewportTransform, + translateX = (vp[4] - cropping.left) * multiplier, + translateY = (vp[5] - cropping.top) * multiplier, + newVp = [newZoom, 0, 0, newZoom, translateX, translateY], + originalInteractive = this.interactive; + + this.viewportTransform = newVp; + // setting interactive to false avoid exporting controls + this.interactive && (this.interactive = false); + if (origWidth !== scaledWidth || origHeight !== scaledHeight) { + // this.setDimensions is going to renderAll also; + this.setDimensions({ width: scaledWidth, height: scaledHeight }); + } + else { + this.renderAll(); + } + var data = this.__toDataURL(format, quality, cropping); + originalInteractive && (this.interactive = originalInteractive); + this.viewportTransform = vp; + //setDimensions with no option object is taking care of: + //this.width, this.height, this.renderAll() + this.setDimensions({ width: origWidth, height: origHeight }); + return data; + }, + + /** + * @private + */ + __toDataURL: function(format, quality) { + + var canvasEl = this.contextContainer.canvas; + // to avoid common confusion https://github.com/kangax/fabric.js/issues/806 + if (format === 'jpg') { + format = 'jpeg'; + } + + var data = supportQuality + ? canvasEl.toDataURL('image/' + format, quality) + : canvasEl.toDataURL('image/' + format); + + return data; + }, + + /** + * Exports canvas element to a dataurl image (allowing to change image size via multiplier). + * @deprecated since 1.0.13 + * @param {String} format (png|jpeg) + * @param {Number} multiplier + * @param {Number} quality (0..1) + * @return {String} + */ + toDataURLWithMultiplier: function (format, multiplier, quality) { + return this.toDataURL({ + format: format, + multiplier: multiplier, + quality: quality + }); + }, + }); + +})(); + + +fabric.util.object.extend(fabric.StaticCanvas.prototype, /** @lends fabric.StaticCanvas.prototype */ { + + /** + * Populates canvas with data from the specified dataless JSON. + * JSON format must conform to the one of {@link fabric.Canvas#toDatalessJSON} + * @deprecated since 1.2.2 + * @param {String|Object} json JSON string or object + * @param {Function} callback Callback, invoked when json is parsed + * and corresponding objects (e.g: {@link fabric.Image}) + * are initialized + * @param {Function} [reviver] Method for further parsing of JSON elements, called after each fabric object created. + * @return {fabric.Canvas} instance + * @chainable + * @tutorial {@link http://fabricjs.com/fabric-intro-part-3#deserialization} + */ + loadFromDatalessJSON: function (json, callback, reviver) { + return this.loadFromJSON(json, callback, reviver); + }, + + /** + * Populates canvas with data from the specified JSON. + * JSON format must conform to the one of {@link fabric.Canvas#toJSON} + * @param {String|Object} json JSON string or object + * @param {Function} callback Callback, invoked when json is parsed + * and corresponding objects (e.g: {@link fabric.Image}) + * are initialized + * @param {Function} [reviver] Method for further parsing of JSON elements, called after each fabric object created. + * @return {fabric.Canvas} instance + * @chainable + * @tutorial {@link http://fabricjs.com/fabric-intro-part-3#deserialization} + * @see {@link http://jsfiddle.net/fabricjs/fmgXt/|jsFiddle demo} + * @example loadFromJSON + * canvas.loadFromJSON(json, canvas.renderAll.bind(canvas)); + * @example loadFromJSON with reviver + * canvas.loadFromJSON(json, canvas.renderAll.bind(canvas), function(o, object) { + * // `o` = json object + * // `object` = fabric.Object instance + * // ... do some stuff ... + * }); + */ + loadFromJSON: function (json, callback, reviver) { + if (!json) { + return; + } + + // serialize if it wasn't already + var serialized = (typeof json === 'string') + ? JSON.parse(json) + : fabric.util.object.clone(json); + + this.clear(); + + var _this = this; + this._enlivenObjects(serialized.objects, function () { + _this._setBgOverlay(serialized, function () { + // remove parts i cannot set as options + delete serialized.objects; + delete serialized.backgroundImage; + delete serialized.overlayImage; + delete serialized.background; + delete serialized.overlay; + // this._initOptions does too many things to just + // call it. Normally loading an Object from JSON + // create the Object instance. Here the Canvas is + // already an instance and we are just loading things over it + for (var prop in serialized) { + _this[prop] = serialized[prop]; + } + callback && callback(); + }); + }, reviver); + return this; + }, + + /** + * @private + * @param {Object} serialized Object with background and overlay information + * @param {Function} callback Invoked after all background and overlay images/patterns loaded + */ + _setBgOverlay: function(serialized, callback) { + var _this = this, + loaded = { + backgroundColor: false, + overlayColor: false, + backgroundImage: false, + overlayImage: false + }; + + if (!serialized.backgroundImage && !serialized.overlayImage && !serialized.background && !serialized.overlay) { + callback && callback(); + return; + } + + var cbIfLoaded = function () { + if (loaded.backgroundImage && loaded.overlayImage && loaded.backgroundColor && loaded.overlayColor) { + _this.renderAll(); + callback && callback(); + } + }; + + this.__setBgOverlay('backgroundImage', serialized.backgroundImage, loaded, cbIfLoaded); + this.__setBgOverlay('overlayImage', serialized.overlayImage, loaded, cbIfLoaded); + this.__setBgOverlay('backgroundColor', serialized.background, loaded, cbIfLoaded); + this.__setBgOverlay('overlayColor', serialized.overlay, loaded, cbIfLoaded); + + cbIfLoaded(); + }, + + /** + * @private + * @param {String} property Property to set (backgroundImage, overlayImage, backgroundColor, overlayColor) + * @param {(Object|String)} value Value to set + * @param {Object} loaded Set loaded property to true if property is set + * @param {Object} callback Callback function to invoke after property is set + */ + __setBgOverlay: function(property, value, loaded, callback) { + var _this = this; + + if (!value) { + loaded[property] = true; + return; + } + + if (property === 'backgroundImage' || property === 'overlayImage') { + fabric.Image.fromObject(value, function(img) { + _this[property] = img; + loaded[property] = true; + callback && callback(); + }); + } + else { + this['set' + fabric.util.string.capitalize(property, true)](value, function() { + loaded[property] = true; + callback && callback(); + }); + } + }, + + /** + * @private + * @param {Array} objects + * @param {Function} callback + * @param {Function} [reviver] + */ + _enlivenObjects: function (objects, callback, reviver) { + var _this = this; + + if (!objects || objects.length === 0) { + callback && callback(); + return; + } + + var renderOnAddRemove = this.renderOnAddRemove; + this.renderOnAddRemove = false; + + fabric.util.enlivenObjects(objects, function(enlivenedObjects) { + enlivenedObjects.forEach(function(obj, index) { + // we splice the array just in case some custom classes restored from JSON + // will add more object to canvas at canvas init. + _this.insertAt(obj, index); + }); + + _this.renderOnAddRemove = renderOnAddRemove; + callback && callback(); + }, null, reviver); + }, + + /** + * @private + * @param {String} format + * @param {Function} callback + */ + _toDataURL: function (format, callback) { + this.clone(function (clone) { + callback(clone.toDataURL(format)); + }); + }, + + /** + * @private + * @param {String} format + * @param {Number} multiplier + * @param {Function} callback + */ + _toDataURLWithMultiplier: function (format, multiplier, callback) { + this.clone(function (clone) { + callback(clone.toDataURLWithMultiplier(format, multiplier)); + }); + }, + + /** + * Clones canvas instance + * @param {Object} [callback] Receives cloned instance as a first argument + * @param {Array} [properties] Array of properties to include in the cloned canvas and children + */ + clone: function (callback, properties) { + var data = JSON.stringify(this.toJSON(properties)); + this.cloneWithoutData(function(clone) { + clone.loadFromJSON(data, function() { + callback && callback(clone); + }); + }); + }, + + /** + * Clones canvas instance without cloning existing data. + * This essentially copies canvas dimensions, clipping properties, etc. + * but leaves data empty (so that you can populate it with your own) + * @param {Object} [callback] Receives cloned instance as a first argument + */ + cloneWithoutData: function(callback) { + var el = fabric.document.createElement('canvas'); + + el.width = this.getWidth(); + el.height = this.getHeight(); + + var clone = new fabric.Canvas(el); + clone.clipTo = this.clipTo; + if (this.backgroundImage) { + clone.setBackgroundImage(this.backgroundImage.src, function() { + clone.renderAll(); + callback && callback(clone); + }); + clone.backgroundImageOpacity = this.backgroundImageOpacity; + clone.backgroundImageStretch = this.backgroundImageStretch; + } + else { + callback && callback(clone); + } + } +}); + + +(function(global) { + + 'use strict'; + + var fabric = global.fabric || (global.fabric = { }), + extend = fabric.util.object.extend, + toFixed = fabric.util.toFixed, + capitalize = fabric.util.string.capitalize, + degreesToRadians = fabric.util.degreesToRadians, + supportsLineDash = fabric.StaticCanvas.supports('setLineDash'); + + if (fabric.Object) { + return; + } + + /** + * Root object class from which all 2d shape classes inherit from + * @class fabric.Object + * @tutorial {@link http://fabricjs.com/fabric-intro-part-1#objects} + * @see {@link fabric.Object#initialize} for constructor definition + * + * @fires added + * @fires removed + * + * @fires selected + * @fires deselected + * @fires modified + * @fires rotating + * @fires scaling + * @fires moving + * @fires skewing + * + * @fires mousedown + * @fires mouseup + * @fires mouseover + * @fires mouseout + */ + fabric.Object = fabric.util.createClass(/** @lends fabric.Object.prototype */ { + + /** + * Retrieves object's {@link fabric.Object#clipTo|clipping function} + * @method getClipTo + * @memberOf fabric.Object.prototype + * @return {Function} + */ + + /** + * Sets object's {@link fabric.Object#clipTo|clipping function} + * @method setClipTo + * @memberOf fabric.Object.prototype + * @param {Function} clipTo Clipping function + * @return {fabric.Object} thisArg + * @chainable + */ + + /** + * Retrieves object's {@link fabric.Object#transformMatrix|transformMatrix} + * @method getTransformMatrix + * @memberOf fabric.Object.prototype + * @return {Array} transformMatrix + */ + + /** + * Sets object's {@link fabric.Object#transformMatrix|transformMatrix} + * @method setTransformMatrix + * @memberOf fabric.Object.prototype + * @param {Array} transformMatrix + * @return {fabric.Object} thisArg + * @chainable + */ + + /** + * Retrieves object's {@link fabric.Object#visible|visible} state + * @method getVisible + * @memberOf fabric.Object.prototype + * @return {Boolean} True if visible + */ + + /** + * Sets object's {@link fabric.Object#visible|visible} state + * @method setVisible + * @memberOf fabric.Object.prototype + * @param {Boolean} value visible value + * @return {fabric.Object} thisArg + * @chainable + */ + + /** + * Retrieves object's {@link fabric.Object#shadow|shadow} + * @method getShadow + * @memberOf fabric.Object.prototype + * @return {Object} Shadow instance + */ + + /** + * Retrieves object's {@link fabric.Object#stroke|stroke} + * @method getStroke + * @memberOf fabric.Object.prototype + * @return {String} stroke value + */ + + /** + * Sets object's {@link fabric.Object#stroke|stroke} + * @method setStroke + * @memberOf fabric.Object.prototype + * @param {String} value stroke value + * @return {fabric.Object} thisArg + * @chainable + */ + + /** + * Retrieves object's {@link fabric.Object#strokeWidth|strokeWidth} + * @method getStrokeWidth + * @memberOf fabric.Object.prototype + * @return {Number} strokeWidth value + */ + + /** + * Sets object's {@link fabric.Object#strokeWidth|strokeWidth} + * @method setStrokeWidth + * @memberOf fabric.Object.prototype + * @param {Number} value strokeWidth value + * @return {fabric.Object} thisArg + * @chainable + */ + + /** + * Retrieves object's {@link fabric.Object#originX|originX} + * @method getOriginX + * @memberOf fabric.Object.prototype + * @return {String} originX value + */ + + /** + * Sets object's {@link fabric.Object#originX|originX} + * @method setOriginX + * @memberOf fabric.Object.prototype + * @param {String} value originX value + * @return {fabric.Object} thisArg + * @chainable + */ + + /** + * Retrieves object's {@link fabric.Object#originY|originY} + * @method getOriginY + * @memberOf fabric.Object.prototype + * @return {String} originY value + */ + + /** + * Sets object's {@link fabric.Object#originY|originY} + * @method setOriginY + * @memberOf fabric.Object.prototype + * @param {String} value originY value + * @return {fabric.Object} thisArg + * @chainable + */ + + /** + * Retrieves object's {@link fabric.Object#fill|fill} + * @method getFill + * @memberOf fabric.Object.prototype + * @return {String} Fill value + */ + + /** + * Sets object's {@link fabric.Object#fill|fill} + * @method setFill + * @memberOf fabric.Object.prototype + * @param {String} value Fill value + * @return {fabric.Object} thisArg + * @chainable + */ + + /** + * Retrieves object's {@link fabric.Object#opacity|opacity} + * @method getOpacity + * @memberOf fabric.Object.prototype + * @return {Number} Opacity value (0-1) + */ + + /** + * Sets object's {@link fabric.Object#opacity|opacity} + * @method setOpacity + * @memberOf fabric.Object.prototype + * @param {Number} value Opacity value (0-1) + * @return {fabric.Object} thisArg + * @chainable + */ + + /** + * Retrieves object's {@link fabric.Object#angle|angle} (in degrees) + * @method getAngle + * @memberOf fabric.Object.prototype + * @return {Number} + */ + + /** + * Retrieves object's {@link fabric.Object#top|top position} + * @method getTop + * @memberOf fabric.Object.prototype + * @return {Number} Top value (in pixels) + */ + + /** + * Sets object's {@link fabric.Object#top|top position} + * @method setTop + * @memberOf fabric.Object.prototype + * @param {Number} value Top value (in pixels) + * @return {fabric.Object} thisArg + * @chainable + */ + + /** + * Retrieves object's {@link fabric.Object#left|left position} + * @method getLeft + * @memberOf fabric.Object.prototype + * @return {Number} Left value (in pixels) + */ + + /** + * Sets object's {@link fabric.Object#left|left position} + * @method setLeft + * @memberOf fabric.Object.prototype + * @param {Number} value Left value (in pixels) + * @return {fabric.Object} thisArg + * @chainable + */ + + /** + * Retrieves object's {@link fabric.Object#scaleX|scaleX} value + * @method getScaleX + * @memberOf fabric.Object.prototype + * @return {Number} scaleX value + */ + + /** + * Sets object's {@link fabric.Object#scaleX|scaleX} value + * @method setScaleX + * @memberOf fabric.Object.prototype + * @param {Number} value scaleX value + * @return {fabric.Object} thisArg + * @chainable + */ + + /** + * Retrieves object's {@link fabric.Object#scaleY|scaleY} value + * @method getScaleY + * @memberOf fabric.Object.prototype + * @return {Number} scaleY value + */ + + /** + * Sets object's {@link fabric.Object#scaleY|scaleY} value + * @method setScaleY + * @memberOf fabric.Object.prototype + * @param {Number} value scaleY value + * @return {fabric.Object} thisArg + * @chainable + */ + + /** + * Retrieves object's {@link fabric.Object#flipX|flipX} value + * @method getFlipX + * @memberOf fabric.Object.prototype + * @return {Boolean} flipX value + */ + + /** + * Sets object's {@link fabric.Object#flipX|flipX} value + * @method setFlipX + * @memberOf fabric.Object.prototype + * @param {Boolean} value flipX value + * @return {fabric.Object} thisArg + * @chainable + */ + + /** + * Retrieves object's {@link fabric.Object#flipY|flipY} value + * @method getFlipY + * @memberOf fabric.Object.prototype + * @return {Boolean} flipY value + */ + + /** + * Sets object's {@link fabric.Object#flipY|flipY} value + * @method setFlipY + * @memberOf fabric.Object.prototype + * @param {Boolean} value flipY value + * @return {fabric.Object} thisArg + * @chainable + */ + + /** + * Type of an object (rect, circle, path, etc.). + * Note that this property is meant to be read-only and not meant to be modified. + * If you modify, certain parts of Fabric (such as JSON loading) won't work correctly. + * @type String + * @default + */ + type: 'object', + + /** + * Horizontal origin of transformation of an object (one of "left", "right", "center") + * See http://jsfiddle.net/1ow02gea/40/ on how originX/originY affect objects in groups + * @type String + * @default + */ + originX: 'left', + + /** + * Vertical origin of transformation of an object (one of "top", "bottom", "center") + * See http://jsfiddle.net/1ow02gea/40/ on how originX/originY affect objects in groups + * @type String + * @default + */ + originY: 'top', + + /** + * Top position of an object. Note that by default it's relative to object top. You can change this by setting originY={top/center/bottom} + * @type Number + * @default + */ + top: 0, + + /** + * Left position of an object. Note that by default it's relative to object left. You can change this by setting originX={left/center/right} + * @type Number + * @default + */ + left: 0, + + /** + * Object width + * @type Number + * @default + */ + width: 0, + + /** + * Object height + * @type Number + * @default + */ + height: 0, + + /** + * Object scale factor (horizontal) + * @type Number + * @default + */ + scaleX: 1, + + /** + * Object scale factor (vertical) + * @type Number + * @default + */ + scaleY: 1, + + /** + * When true, an object is rendered as flipped horizontally + * @type Boolean + * @default + */ + flipX: false, + + /** + * When true, an object is rendered as flipped vertically + * @type Boolean + * @default + */ + flipY: false, + + /** + * Opacity of an object + * @type Number + * @default + */ + opacity: 1, + + /** + * Angle of rotation of an object (in degrees) + * @type Number + * @default + */ + angle: 0, + + /** + * Angle of skew on x axes of an object (in degrees) + * @type Number + * @default + */ + skewX: 0, + + /** + * Angle of skew on y axes of an object (in degrees) + * @type Number + * @default + */ + skewY: 0, + + /** + * Size of object's controlling corners (in pixels) + * @type Number + * @default + */ + cornerSize: 13, + + /** + * When true, object's controlling corners are rendered as transparent inside (i.e. stroke instead of fill) + * @type Boolean + * @default + */ + transparentCorners: true, + + /** + * Default cursor value used when hovering over this object on canvas + * @type String + * @default + */ + hoverCursor: null, + + /** + * Default cursor value used when moving this object on canvas + * @type String + * @default + */ + moveCursor: null, + + /** + * Padding between object and its controlling borders (in pixels) + * @type Number + * @default + */ + padding: 0, + + /** + * Color of controlling borders of an object (when it's active) + * @type String + * @default + */ + borderColor: 'rgba(102,153,255,0.75)', + + /** + * Array specifying dash pattern of an object's borders (hasBorder must be true) + * @since 1.6.2 + * @type Array + */ + borderDashArray: null, + + /** + * Color of controlling corners of an object (when it's active) + * @type String + * @default + */ + cornerColor: 'rgba(102,153,255,0.5)', + + /** + * Color of controlling corners of an object (when it's active and transparentCorners false) + * @since 1.6.2 + * @type String + * @default + */ + cornerStrokeColor: null, + + /** + * Specify style of control, 'rect' or 'circle' + * @since 1.6.2 + * @type String + */ + cornerStyle: 'rect', + + /** + * Array specifying dash pattern of an object's control (hasBorder must be true) + * @since 1.6.2 + * @type Array + */ + cornerDashArray: null, + + /** + * When true, this object will use center point as the origin of transformation + * when being scaled via the controls. + * Backwards incompatibility note: This property replaces "centerTransform" (Boolean). + * @since 1.3.4 + * @type Boolean + * @default + */ + centeredScaling: false, + + /** + * When true, this object will use center point as the origin of transformation + * when being rotated via the controls. + * Backwards incompatibility note: This property replaces "centerTransform" (Boolean). + * @since 1.3.4 + * @type Boolean + * @default + */ + centeredRotation: true, + + /** + * Color of object's fill + * @type String + * @default + */ + fill: 'rgb(0,0,0)', + + /** + * Fill rule used to fill an object + * accepted values are nonzero, evenodd + * Backwards incompatibility note: This property was used for setting globalCompositeOperation until v1.4.12 (use `fabric.Object#globalCompositeOperation` instead) + * @type String + * @default + */ + fillRule: 'nonzero', + + /** + * Composite rule used for canvas globalCompositeOperation + * @type String + * @default + */ + globalCompositeOperation: 'source-over', + + /** + * Background color of an object. Only works with text objects at the moment. + * @type String + * @default + */ + backgroundColor: '', + + /** + * Selection Background color of an object. colored layer behind the object when it is active. + * does not mix good with globalCompositeOperation methods. + * @type String + * @default + */ + selectionBackgroundColor: '', + + /** + * When defined, an object is rendered via stroke and this property specifies its color + * @type String + * @default + */ + stroke: null, + + /** + * Width of a stroke used to render this object + * @type Number + * @default + */ + strokeWidth: 1, + + /** + * Array specifying dash pattern of an object's stroke (stroke must be defined) + * @type Array + */ + strokeDashArray: null, + + /** + * Line endings style of an object's stroke (one of "butt", "round", "square") + * @type String + * @default + */ + strokeLineCap: 'butt', + + /** + * Corner style of an object's stroke (one of "bevil", "round", "miter") + * @type String + * @default + */ + strokeLineJoin: 'miter', + + /** + * Maximum miter length (used for strokeLineJoin = "miter") of an object's stroke + * @type Number + * @default + */ + strokeMiterLimit: 10, + + /** + * Shadow object representing shadow of this shape + * @type fabric.Shadow + * @default + */ + shadow: null, + + /** + * Opacity of object's controlling borders when object is active and moving + * @type Number + * @default + */ + borderOpacityWhenMoving: 0.4, + + /** + * Scale factor of object's controlling borders + * @type Number + * @default + */ + borderScaleFactor: 1, + + /** + * Transform matrix (similar to SVG's transform matrix) + * @type Array + */ + transformMatrix: null, + + /** + * Minimum allowed scale value of an object + * @type Number + * @default + */ + minScaleLimit: 0.01, + + /** + * When set to `false`, an object can not be selected for modification (using either point-click-based or group-based selection). + * But events still fire on it. + * @type Boolean + * @default + */ + selectable: true, + + /** + * When set to `false`, an object can not be a target of events. All events propagate through it. Introduced in v1.3.4 + * @type Boolean + * @default + */ + evented: true, + + /** + * When set to `false`, an object is not rendered on canvas + * @type Boolean + * @default + */ + visible: true, + + /** + * When set to `false`, object's controls are not displayed and can not be used to manipulate object + * @type Boolean + * @default + */ + hasControls: true, + + /** + * When set to `false`, object's controlling borders are not rendered + * @type Boolean + * @default + */ + hasBorders: true, + + /** + * When set to `false`, object's controlling rotating point will not be visible or selectable + * @type Boolean + * @default + */ + hasRotatingPoint: true, + + /** + * Offset for object's controlling rotating point (when enabled via `hasRotatingPoint`) + * @type Number + * @default + */ + rotatingPointOffset: 40, + + /** + * When set to `true`, objects are "found" on canvas on per-pixel basis rather than according to bounding box + * @type Boolean + * @default + */ + perPixelTargetFind: false, + + /** + * When `false`, default object's values are not included in its serialization + * @type Boolean + * @default + */ + includeDefaultValues: true, + + /** + * Function that determines clipping of an object (context is passed as a first argument) + * Note that context origin is at the object's center point (not left/top corner) + * @type Function + */ + clipTo: null, + + /** + * When `true`, object horizontal movement is locked + * @type Boolean + * @default + */ + lockMovementX: false, + + /** + * When `true`, object vertical movement is locked + * @type Boolean + * @default + */ + lockMovementY: false, + + /** + * When `true`, object rotation is locked + * @type Boolean + * @default + */ + lockRotation: false, + + /** + * When `true`, object horizontal scaling is locked + * @type Boolean + * @default + */ + lockScalingX: false, + + /** + * When `true`, object vertical scaling is locked + * @type Boolean + * @default + */ + lockScalingY: false, + + /** + * When `true`, object non-uniform scaling is locked + * @type Boolean + * @default + */ + lockUniScaling: false, + + /** + * When `true`, object horizontal skewing is locked + * @type Boolean + * @default + */ + lockSkewingX: false, + + /** + * When `true`, object vertical skewing is locked + * @type Boolean + * @default + */ + lockSkewingY: false, + + /** + * When `true`, object cannot be flipped by scaling into negative values + * @type Boolean + * @default + */ + + lockScalingFlip: false, + + /** + * When `true`, object is not exported in SVG or OBJECT/JSON + * since 1.6.3 + * @type Boolean + * @default + */ + + excludeFromExport: false, + + /** + * List of properties to consider when checking if state + * of an object is changed (fabric.Object#hasStateChanged) + * as well as for history (undo/redo) purposes + * @type Array + */ + stateProperties: ( + 'top left width height scaleX scaleY flipX flipY originX originY transformMatrix ' + + 'stroke strokeWidth strokeDashArray strokeLineCap strokeLineJoin strokeMiterLimit ' + + 'angle opacity fill fillRule globalCompositeOperation shadow clipTo visible backgroundColor ' + + 'skewX skewY' + ).split(' '), + + /** + * Constructor + * @param {Object} [options] Options object + */ + initialize: function(options) { + if (options) { + this.setOptions(options); + } + }, + + /** + * @private + * @param {Object} [options] Options object + */ + _initGradient: function(options) { + if (options.fill && options.fill.colorStops && !(options.fill instanceof fabric.Gradient)) { + this.set('fill', new fabric.Gradient(options.fill)); + } + if (options.stroke && options.stroke.colorStops && !(options.stroke instanceof fabric.Gradient)) { + this.set('stroke', new fabric.Gradient(options.stroke)); + } + }, + + /** + * @private + * @param {Object} [options] Options object + */ + _initPattern: function(options) { + if (options.fill && options.fill.source && !(options.fill instanceof fabric.Pattern)) { + this.set('fill', new fabric.Pattern(options.fill)); + } + if (options.stroke && options.stroke.source && !(options.stroke instanceof fabric.Pattern)) { + this.set('stroke', new fabric.Pattern(options.stroke)); + } + }, + + /** + * @private + * @param {Object} [options] Options object + */ + _initClipping: function(options) { + if (!options.clipTo || typeof options.clipTo !== 'string') { + return; + } + + var functionBody = fabric.util.getFunctionBody(options.clipTo); + if (typeof functionBody !== 'undefined') { + this.clipTo = new Function('ctx', functionBody); + } + }, + + /** + * Sets object's properties from options + * @param {Object} [options] Options object + */ + setOptions: function(options) { + for (var prop in options) { + this.set(prop, options[prop]); + } + this._initGradient(options); + this._initPattern(options); + this._initClipping(options); + }, + + /** + * Transforms context when rendering an object + * @param {CanvasRenderingContext2D} ctx Context + * @param {Boolean} fromLeft When true, context is transformed to object's top/left corner. This is used when rendering text on Node + */ + transform: function(ctx, fromLeft) { + if (this.group && !this.group._transformDone && this.group === this.canvas._activeGroup) { + this.group.transform(ctx); + } + var center = fromLeft ? this._getLeftTopCoords() : this.getCenterPoint(); + ctx.translate(center.x, center.y); + ctx.rotate(degreesToRadians(this.angle)); + ctx.scale( + this.scaleX * (this.flipX ? -1 : 1), + this.scaleY * (this.flipY ? -1 : 1) + ); + ctx.transform(1, 0, Math.tan(degreesToRadians(this.skewX)), 1, 0, 0); + ctx.transform(1, Math.tan(degreesToRadians(this.skewY)), 0, 1, 0, 0); + }, + + /** + * Returns an object representation of an instance + * @param {Array} [propertiesToInclude] Any properties that you might want to additionally include in the output + * @return {Object} Object representation of an instance + */ + toObject: function(propertiesToInclude) { + var NUM_FRACTION_DIGITS = fabric.Object.NUM_FRACTION_DIGITS, + + object = { + type: this.type, + originX: this.originX, + originY: this.originY, + left: toFixed(this.left, NUM_FRACTION_DIGITS), + top: toFixed(this.top, NUM_FRACTION_DIGITS), + width: toFixed(this.width, NUM_FRACTION_DIGITS), + height: toFixed(this.height, NUM_FRACTION_DIGITS), + fill: (this.fill && this.fill.toObject) ? this.fill.toObject() : this.fill, + stroke: (this.stroke && this.stroke.toObject) ? this.stroke.toObject() : this.stroke, + strokeWidth: toFixed(this.strokeWidth, NUM_FRACTION_DIGITS), + strokeDashArray: this.strokeDashArray ? this.strokeDashArray.concat() : this.strokeDashArray, + strokeLineCap: this.strokeLineCap, + strokeLineJoin: this.strokeLineJoin, + strokeMiterLimit: toFixed(this.strokeMiterLimit, NUM_FRACTION_DIGITS), + scaleX: toFixed(this.scaleX, NUM_FRACTION_DIGITS), + scaleY: toFixed(this.scaleY, NUM_FRACTION_DIGITS), + angle: toFixed(this.getAngle(), NUM_FRACTION_DIGITS), + flipX: this.flipX, + flipY: this.flipY, + opacity: toFixed(this.opacity, NUM_FRACTION_DIGITS), + shadow: (this.shadow && this.shadow.toObject) ? this.shadow.toObject() : this.shadow, + visible: this.visible, + clipTo: this.clipTo && String(this.clipTo), + backgroundColor: this.backgroundColor, + fillRule: this.fillRule, + globalCompositeOperation: this.globalCompositeOperation, + transformMatrix: this.transformMatrix ? this.transformMatrix.concat() : this.transformMatrix, + skewX: toFixed(this.skewX, NUM_FRACTION_DIGITS), + skewY: toFixed(this.skewY, NUM_FRACTION_DIGITS) + }; + + if (!this.includeDefaultValues) { + object = this._removeDefaultValues(object); + } + + fabric.util.populateWithProperties(this, object, propertiesToInclude); + + return object; + }, + + /** + * Returns (dataless) object representation of an instance + * @param {Array} [propertiesToInclude] Any properties that you might want to additionally include in the output + * @return {Object} Object representation of an instance + */ + toDatalessObject: function(propertiesToInclude) { + // will be overwritten by subclasses + return this.toObject(propertiesToInclude); + }, + + /** + * @private + * @param {Object} object + */ + _removeDefaultValues: function(object) { + var prototype = fabric.util.getKlass(object.type).prototype, + stateProperties = prototype.stateProperties; + + stateProperties.forEach(function(prop) { + if (object[prop] === prototype[prop]) { + delete object[prop]; + } + var isArray = Object.prototype.toString.call(object[prop]) === '[object Array]' && + Object.prototype.toString.call(prototype[prop]) === '[object Array]'; + + // basically a check for [] === [] + if (isArray && object[prop].length === 0 && prototype[prop].length === 0) { + delete object[prop]; + } + }); + + return object; + }, + + /** + * Returns a string representation of an instance + * @return {String} + */ + toString: function() { + return '#'; + }, + + /** + * Basic getter + * @param {String} property Property name + * @return {*} value of a property + */ + get: function(property) { + return this[property]; + }, + + /** + * Return the object scale factor counting also the group scaling + * @return {Object} object with scaleX and scaleY properties + */ + getObjectScaling: function() { + var scaleX = this.scaleX, scaleY = this.scaleY; + if (this.group) { + var scaling = this.group.getObjectScaling(); + scaleX *= scaling.scaleX; + scaleY *= scaling.scaleY; + } + return { scaleX: scaleX, scaleY: scaleY }; + }, + + /** + * @private + */ + _setObject: function(obj) { + for (var prop in obj) { + this._set(prop, obj[prop]); + } + }, + + /** + * Sets property to a given value. When changing position/dimension -related properties (left, top, scale, angle, etc.) `set` does not update position of object's borders/controls. If you need to update those, call `setCoords()`. + * @param {String|Object} key Property name or object (if object, iterate over the object properties) + * @param {Object|Function} value Property value (if function, the value is passed into it and its return value is used as a new one) + * @return {fabric.Object} thisArg + * @chainable + */ + set: function(key, value) { + if (typeof key === 'object') { + this._setObject(key); + } + else { + if (typeof value === 'function' && key !== 'clipTo') { + this._set(key, value(this.get(key))); + } + else { + this._set(key, value); + } + } + return this; + }, + + /** + * @private + * @param {String} key + * @param {*} value + * @return {fabric.Object} thisArg + */ + _set: function(key, value) { + var shouldConstrainValue = (key === 'scaleX' || key === 'scaleY'); + + if (shouldConstrainValue) { + value = this._constrainScale(value); + } + if (key === 'scaleX' && value < 0) { + this.flipX = !this.flipX; + value *= -1; + } + else if (key === 'scaleY' && value < 0) { + this.flipY = !this.flipY; + value *= -1; + } + else if (key === 'shadow' && value && !(value instanceof fabric.Shadow)) { + value = new fabric.Shadow(value); + } + + this[key] = value; + + if (key === 'width' || key === 'height') { + this.minScaleLimit = Math.min(0.1, 1 / Math.max(this.width, this.height)); + } + + return this; + }, + + /** + * This callback function is called by the parent group of an object every + * time a non-delegated property changes on the group. It is passed the key + * and value as parameters. Not adding in this function's signature to avoid + * Travis build error about unused variables. + */ + setOnGroup: function() { + // implemented by sub-classes, as needed. + }, + + /** + * Toggles specified property from `true` to `false` or from `false` to `true` + * @param {String} property Property to toggle + * @return {fabric.Object} thisArg + * @chainable + */ + toggle: function(property) { + var value = this.get(property); + if (typeof value === 'boolean') { + this.set(property, !value); + } + return this; + }, + + /** + * Sets sourcePath of an object + * @param {String} value Value to set sourcePath to + * @return {fabric.Object} thisArg + * @chainable + */ + setSourcePath: function(value) { + this.sourcePath = value; + return this; + }, + + /** + * Retrieves viewportTransform from Object's canvas if possible + * @method getViewportTransform + * @memberOf fabric.Object.prototype + * @return {Boolean} flipY value // TODO + */ + getViewportTransform: function() { + if (this.canvas && this.canvas.viewportTransform) { + return this.canvas.viewportTransform; + } + return [1, 0, 0, 1, 0, 0]; + }, + + /** + * Renders an object on a specified context + * @param {CanvasRenderingContext2D} ctx Context to render on + * @param {Boolean} [noTransform] When true, context is not transformed + */ + render: function(ctx, noTransform) { + // do not render if width/height are zeros or object is not visible + if ((this.width === 0 && this.height === 0) || !this.visible) { + return; + } + + ctx.save(); + + //setup fill rule for current object + this._setupCompositeOperation(ctx); + this.drawSelectionBackground(ctx); + if (!noTransform) { + this.transform(ctx); + } + this._setOpacity(ctx); + this._setShadow(ctx); + this._renderBackground(ctx); + this._setStrokeStyles(ctx); + this._setFillStyles(ctx); + if (this.transformMatrix) { + ctx.transform.apply(ctx, this.transformMatrix); + } + this.clipTo && fabric.util.clipContext(this, ctx); + this._render(ctx, noTransform); + this.clipTo && ctx.restore(); + + ctx.restore(); + }, + + /** + * Draws a background for the object big as its width and height; + * @private + * @param {CanvasRenderingContext2D} ctx Context to render on + */ + _renderBackground: function(ctx) { + if (!this.backgroundColor) { + return; + } + + ctx.fillStyle = this.backgroundColor; + + ctx.fillRect( + -this.width / 2, + -this.height / 2, + this.width, + this.height + ); + // if there is background color no other shadows + // should be casted + this._removeShadow(ctx); + }, + + /** + * @private + * @param {CanvasRenderingContext2D} ctx Context to render on + */ + _setOpacity: function(ctx) { + if (this.group) { + this.group._setOpacity(ctx); + } + ctx.globalAlpha *= this.opacity; + }, + + _setStrokeStyles: function(ctx) { + if (this.stroke) { + ctx.lineWidth = this.strokeWidth; + ctx.lineCap = this.strokeLineCap; + ctx.lineJoin = this.strokeLineJoin; + ctx.miterLimit = this.strokeMiterLimit; + ctx.strokeStyle = this.stroke.toLive + ? this.stroke.toLive(ctx, this) + : this.stroke; + } + }, + + _setFillStyles: function(ctx) { + if (this.fill) { + ctx.fillStyle = this.fill.toLive + ? this.fill.toLive(ctx, this) + : this.fill; + } + }, + + /** + * @private + * Sets line dash + * @param {CanvasRenderingContext2D} ctx Context to set the dash line on + * @param {Array} dashArray array representing dashes + * @param {Function} alternative function to call if browaser does not support lineDash + */ + _setLineDash: function(ctx, dashArray, alternative) { + if (!dashArray) { + return; + } + // Spec requires the concatenation of two copies the dash list when the number of elements is odd + if (1 & dashArray.length) { + dashArray.push.apply(dashArray, dashArray); + } + if (supportsLineDash) { + ctx.setLineDash(dashArray); + } + else { + alternative && alternative(ctx); + } + }, + + /** + * Renders controls and borders for the object + * @param {CanvasRenderingContext2D} ctx Context to render on + * @param {Boolean} [noTransform] When true, context is not transformed + */ + _renderControls: function(ctx, noTransform) { + if (!this.active || noTransform + || (this.group && this.group !== this.canvas.getActiveGroup())) { + return; + } + + var vpt = this.getViewportTransform(), + matrix = this.calcTransformMatrix(), + options; + matrix = fabric.util.multiplyTransformMatrices(vpt, matrix); + options = fabric.util.qrDecompose(matrix); + + ctx.save(); + ctx.translate(options.translateX, options.translateY); + ctx.lineWidth = 1 * this.borderScaleFactor; + ctx.globalAlpha = this.isMoving ? this.borderOpacityWhenMoving : 1; + + if (this.group && this.group === this.canvas.getActiveGroup()) { + ctx.rotate(degreesToRadians(options.angle)); + this.drawBordersInGroup(ctx, options); + } + else { + ctx.rotate(degreesToRadians(this.angle)); + this.drawBorders(ctx); + } + this.drawControls(ctx); + ctx.restore(); + }, + + /** + * @private + * @param {CanvasRenderingContext2D} ctx Context to render on + */ + _setShadow: function(ctx) { + if (!this.shadow) { + return; + } + + var multX = (this.canvas && this.canvas.viewportTransform[0]) || 1, + multY = (this.canvas && this.canvas.viewportTransform[3]) || 1, + scaling = this.getObjectScaling(); + if (this.canvas && this.canvas._isRetinaScaling()) { + multX *= fabric.devicePixelRatio; + multY *= fabric.devicePixelRatio; + } + ctx.shadowColor = this.shadow.color; + ctx.shadowBlur = this.shadow.blur * (multX + multY) * (scaling.scaleX + scaling.scaleY) / 4; + ctx.shadowOffsetX = this.shadow.offsetX * multX * scaling.scaleX; + ctx.shadowOffsetY = this.shadow.offsetY * multY * scaling.scaleY; + }, + + /** + * @private + * @param {CanvasRenderingContext2D} ctx Context to render on + */ + _removeShadow: function(ctx) { + if (!this.shadow) { + return; + } + + ctx.shadowColor = ''; + ctx.shadowBlur = ctx.shadowOffsetX = ctx.shadowOffsetY = 0; + }, + + /** + * @private + * @param {CanvasRenderingContext2D} ctx Context to render on + */ + _renderFill: function(ctx) { + if (!this.fill) { + return; + } + + ctx.save(); + if (this.fill.gradientTransform) { + var g = this.fill.gradientTransform; + ctx.transform.apply(ctx, g); + } + if (this.fill.toLive) { + ctx.translate( + -this.width / 2 + this.fill.offsetX || 0, + -this.height / 2 + this.fill.offsetY || 0); + } + if (this.fillRule === 'evenodd') { + ctx.fill('evenodd'); + } + else { + ctx.fill(); + } + ctx.restore(); + }, + + /** + * @private + * @param {CanvasRenderingContext2D} ctx Context to render on + */ + _renderStroke: function(ctx) { + if (!this.stroke || this.strokeWidth === 0) { + return; + } + + if (this.shadow && !this.shadow.affectStroke) { + this._removeShadow(ctx); + } + + ctx.save(); + + this._setLineDash(ctx, this.strokeDashArray, this._renderDashedStroke); + if (this.stroke.gradientTransform) { + var g = this.stroke.gradientTransform; + ctx.transform.apply(ctx, g); + } + if (this.stroke.toLive) { + ctx.translate( + -this.width / 2 + this.stroke.offsetX || 0, + -this.height / 2 + this.stroke.offsetY || 0); + } + ctx.stroke(); + ctx.restore(); + }, + + /** + * Clones an instance, some objects are async, so using callback method will work for every object. + * Using the direct return does not work for images and groups. + * @param {Function} callback Callback is invoked with a clone as a first argument + * @param {Array} [propertiesToInclude] Any properties that you might want to additionally include in the output + * @return {fabric.Object} clone of an instance + */ + clone: function(callback, propertiesToInclude) { + if (this.constructor.fromObject) { + return this.constructor.fromObject(this.toObject(propertiesToInclude), callback); + } + return new fabric.Object(this.toObject(propertiesToInclude)); + }, + + /** + * Creates an instance of fabric.Image out of an object + * @param {Function} callback callback, invoked with an instance as a first argument + * @param {Object} [options] for clone as image, passed to toDataURL + * @param {Boolean} [options.enableRetinaScaling] enable retina scaling for the cloned image + * @return {fabric.Object} thisArg + */ + cloneAsImage: function(callback, options) { + var dataUrl = this.toDataURL(options); + fabric.util.loadImage(dataUrl, function(img) { + if (callback) { + callback(new fabric.Image(img)); + } + }); + return this; + }, + + /** + * Converts an object into a data-url-like string + * @param {Object} options Options object + * @param {String} [options.format=png] The format of the output image. Either "jpeg" or "png" + * @param {Number} [options.quality=1] Quality level (0..1). Only used for jpeg. + * @param {Number} [options.multiplier=1] Multiplier to scale by + * @param {Number} [options.left] Cropping left offset. Introduced in v1.2.14 + * @param {Number} [options.top] Cropping top offset. Introduced in v1.2.14 + * @param {Number} [options.width] Cropping width. Introduced in v1.2.14 + * @param {Number} [options.height] Cropping height. Introduced in v1.2.14 + * @param {Boolean} [options.enableRetina] Enable retina scaling for clone image. Introduce in 1.6.4 + * @return {String} Returns a data: URL containing a representation of the object in the format specified by options.format + */ + toDataURL: function(options) { + options || (options = { }); + + var el = fabric.util.createCanvasElement(), + boundingRect = this.getBoundingRect(); + + el.width = boundingRect.width; + el.height = boundingRect.height; + fabric.util.wrapElement(el, 'div'); + var canvas = new fabric.StaticCanvas(el, { enableRetinaScaling: options.enableRetinaScaling }); + // to avoid common confusion https://github.com/kangax/fabric.js/issues/806 + if (options.format === 'jpg') { + options.format = 'jpeg'; + } + + if (options.format === 'jpeg') { + canvas.backgroundColor = '#fff'; + } + + var origParams = { + active: this.get('active'), + left: this.getLeft(), + top: this.getTop() + }; + + this.set('active', false); + this.setPositionByOrigin(new fabric.Point(canvas.getWidth() / 2, canvas.getHeight() / 2), 'center', 'center'); + + var originalCanvas = this.canvas; + canvas.add(this); + var data = canvas.toDataURL(options); + + this.set(origParams).setCoords(); + this.canvas = originalCanvas; + + canvas.dispose(); + canvas = null; + + return data; + }, + + /** + * Returns true if specified type is identical to the type of an instance + * @param {String} type Type to check against + * @return {Boolean} + */ + isType: function(type) { + return this.type === type; + }, + + /** + * Returns complexity of an instance + * @return {Number} complexity of this instance + */ + complexity: function() { + return 0; + }, + + /** + * Returns a JSON representation of an instance + * @param {Array} [propertiesToInclude] Any properties that you might want to additionally include in the output + * @return {Object} JSON + */ + toJSON: function(propertiesToInclude) { + // delegate, not alias + return this.toObject(propertiesToInclude); + }, + + /** + * Sets gradient (fill or stroke) of an object + * Backwards incompatibility note: This method was named "setGradientFill" until v1.1.0 + * @param {String} property Property name 'stroke' or 'fill' + * @param {Object} [options] Options object + * @param {String} [options.type] Type of gradient 'radial' or 'linear' + * @param {Number} [options.x1=0] x-coordinate of start point + * @param {Number} [options.y1=0] y-coordinate of start point + * @param {Number} [options.x2=0] x-coordinate of end point + * @param {Number} [options.y2=0] y-coordinate of end point + * @param {Number} [options.r1=0] Radius of start point (only for radial gradients) + * @param {Number} [options.r2=0] Radius of end point (only for radial gradients) + * @param {Object} [options.colorStops] Color stops object eg. {0: 'ff0000', 1: '000000'} + * @param {Object} [options.gradientTransform] transforMatrix for gradient + * @return {fabric.Object} thisArg + * @chainable + * @see {@link http://jsfiddle.net/fabricjs/58y8b/|jsFiddle demo} + * @example Set linear gradient + * object.setGradient('fill', { + * type: 'linear', + * x1: -object.width / 2, + * y1: 0, + * x2: object.width / 2, + * y2: 0, + * colorStops: { + * 0: 'red', + * 0.5: '#005555', + * 1: 'rgba(0,0,255,0.5)' + * } + * }); + * canvas.renderAll(); + * @example Set radial gradient + * object.setGradient('fill', { + * type: 'radial', + * x1: 0, + * y1: 0, + * x2: 0, + * y2: 0, + * r1: object.width / 2, + * r2: 10, + * colorStops: { + * 0: 'red', + * 0.5: '#005555', + * 1: 'rgba(0,0,255,0.5)' + * } + * }); + * canvas.renderAll(); + */ + setGradient: function(property, options) { + options || (options = { }); + + var gradient = { colorStops: [] }; + + gradient.type = options.type || (options.r1 || options.r2 ? 'radial' : 'linear'); + gradient.coords = { + x1: options.x1, + y1: options.y1, + x2: options.x2, + y2: options.y2 + }; + + if (options.r1 || options.r2) { + gradient.coords.r1 = options.r1; + gradient.coords.r2 = options.r2; + } + + options.gradientTransform && (gradient.gradientTransform = options.gradientTransform); + + for (var position in options.colorStops) { + var color = new fabric.Color(options.colorStops[position]); + gradient.colorStops.push({ + offset: position, + color: color.toRgb(), + opacity: color.getAlpha() + }); + } + + return this.set(property, fabric.Gradient.forObject(this, gradient)); + }, + + /** + * Sets pattern fill of an object + * @param {Object} options Options object + * @param {(String|HTMLImageElement)} options.source Pattern source + * @param {String} [options.repeat=repeat] Repeat property of a pattern (one of repeat, repeat-x, repeat-y or no-repeat) + * @param {Number} [options.offsetX=0] Pattern horizontal offset from object's left/top corner + * @param {Number} [options.offsetY=0] Pattern vertical offset from object's left/top corner + * @return {fabric.Object} thisArg + * @chainable + * @see {@link http://jsfiddle.net/fabricjs/QT3pa/|jsFiddle demo} + * @example Set pattern + * fabric.util.loadImage('http://fabricjs.com/assets/escheresque_ste.png', function(img) { + * object.setPatternFill({ + * source: img, + * repeat: 'repeat' + * }); + * canvas.renderAll(); + * }); + */ + setPatternFill: function(options) { + return this.set('fill', new fabric.Pattern(options)); + }, + + /** + * Sets {@link fabric.Object#shadow|shadow} of an object + * @param {Object|String} [options] Options object or string (e.g. "2px 2px 10px rgba(0,0,0,0.2)") + * @param {String} [options.color=rgb(0,0,0)] Shadow color + * @param {Number} [options.blur=0] Shadow blur + * @param {Number} [options.offsetX=0] Shadow horizontal offset + * @param {Number} [options.offsetY=0] Shadow vertical offset + * @return {fabric.Object} thisArg + * @chainable + * @see {@link http://jsfiddle.net/fabricjs/7gvJG/|jsFiddle demo} + * @example Set shadow with string notation + * object.setShadow('2px 2px 10px rgba(0,0,0,0.2)'); + * canvas.renderAll(); + * @example Set shadow with object notation + * object.setShadow({ + * color: 'red', + * blur: 10, + * offsetX: 20, + * offsetY: 20 + * }); + * canvas.renderAll(); + */ + setShadow: function(options) { + return this.set('shadow', options ? new fabric.Shadow(options) : null); + }, + + /** + * Sets "color" of an instance (alias of `set('fill', …)`) + * @param {String} color Color value + * @return {fabric.Object} thisArg + * @chainable + */ + setColor: function(color) { + this.set('fill', color); + return this; + }, + + /** + * Sets "angle" of an instance + * @param {Number} angle Angle value (in degrees) + * @return {fabric.Object} thisArg + * @chainable + */ + setAngle: function(angle) { + var shouldCenterOrigin = (this.originX !== 'center' || this.originY !== 'center') && this.centeredRotation; + + if (shouldCenterOrigin) { + this._setOriginToCenter(); + } + + this.set('angle', angle); + + if (shouldCenterOrigin) { + this._resetOrigin(); + } + + return this; + }, + + /** + * Centers object horizontally on canvas to which it was added last. + * You might need to call `setCoords` on an object after centering, to update controls area. + * @return {fabric.Object} thisArg + * @chainable + */ + centerH: function () { + this.canvas && this.canvas.centerObjectH(this); + return this; + }, + + /** + * Centers object horizontally on current viewport of canvas to which it was added last. + * You might need to call `setCoords` on an object after centering, to update controls area. + * @return {fabric.Object} thisArg + * @chainable + */ + viewportCenterH: function () { + this.canvas && this.canvas.viewportCenterObjectH(this); + return this; + }, + + /** + * Centers object vertically on canvas to which it was added last. + * You might need to call `setCoords` on an object after centering, to update controls area. + * @return {fabric.Object} thisArg + * @chainable + */ + centerV: function () { + this.canvas && this.canvas.centerObjectV(this); + return this; + }, + + /** + * Centers object vertically on current viewport of canvas to which it was added last. + * You might need to call `setCoords` on an object after centering, to update controls area. + * @return {fabric.Object} thisArg + * @chainable + */ + viewportCenterV: function () { + this.canvas && this.canvas.viewportCenterObjectV(this); + return this; + }, + + /** + * Centers object vertically and horizontally on canvas to which is was added last + * You might need to call `setCoords` on an object after centering, to update controls area. + * @return {fabric.Object} thisArg + * @chainable + */ + center: function () { + this.canvas && this.canvas.centerObject(this); + return this; + }, + + /** + * Centers object on current viewport of canvas to which it was added last. + * You might need to call `setCoords` on an object after centering, to update controls area. + * @return {fabric.Object} thisArg + * @chainable + */ + viewportCenter: function () { + this.canvas && this.canvas.viewportCenterObject(this); + return this; + }, + + /** + * Removes object from canvas to which it was added last + * @return {fabric.Object} thisArg + * @chainable + */ + remove: function() { + this.canvas && this.canvas.remove(this); + return this; + }, + + /** + * Returns coordinates of a pointer relative to an object + * @param {Event} e Event to operate upon + * @param {Object} [pointer] Pointer to operate upon (instead of event) + * @return {Object} Coordinates of a pointer (x, y) + */ + getLocalPointer: function(e, pointer) { + pointer = pointer || this.canvas.getPointer(e); + var pClicked = new fabric.Point(pointer.x, pointer.y), + objectLeftTop = this._getLeftTopCoords(); + if (this.angle) { + pClicked = fabric.util.rotatePoint( + pClicked, objectLeftTop, fabric.util.degreesToRadians(-this.angle)); + } + return { + x: pClicked.x - objectLeftTop.x, + y: pClicked.y - objectLeftTop.y + }; + }, + + /** + * Sets canvas globalCompositeOperation for specific object + * custom composition operation for the particular object can be specifed using globalCompositeOperation property + * @param {CanvasRenderingContext2D} ctx Rendering canvas context + */ + _setupCompositeOperation: function (ctx) { + if (this.globalCompositeOperation) { + ctx.globalCompositeOperation = this.globalCompositeOperation; + } + } + }); + + fabric.util.createAccessors(fabric.Object); + + /** + * Alias for {@link fabric.Object.prototype.setAngle} + * @alias rotate -> setAngle + * @memberOf fabric.Object + */ + fabric.Object.prototype.rotate = fabric.Object.prototype.setAngle; + + extend(fabric.Object.prototype, fabric.Observable); + + /** + * Defines the number of fraction digits to use when serializing object values. + * You can use it to increase/decrease precision of such values like left, top, scaleX, scaleY, etc. + * @static + * @memberOf fabric.Object + * @constant + * @type Number + */ + fabric.Object.NUM_FRACTION_DIGITS = 2; + + /** + * Unique id used internally when creating SVG elements + * @static + * @memberOf fabric.Object + * @type Number + */ + fabric.Object.__uid = 0; + +})(typeof exports !== 'undefined' ? exports : this); + + +(function() { + + var degreesToRadians = fabric.util.degreesToRadians, + originXOffset = { + left: -0.5, + center: 0, + right: 0.5 + }, + originYOffset = { + top: -0.5, + center: 0, + bottom: 0.5 + }; + + fabric.util.object.extend(fabric.Object.prototype, /** @lends fabric.Object.prototype */ { + + /** + * Translates the coordinates from origin to center coordinates (based on the object's dimensions) + * @param {fabric.Point} point The point which corresponds to the originX and originY params + * @param {String} fromOriginX Horizontal origin: 'left', 'center' or 'right' + * @param {String} fromOriginY Vertical origin: 'top', 'center' or 'bottom' + * @param {String} toOriginX Horizontal origin: 'left', 'center' or 'right' + * @param {String} toOriginY Vertical origin: 'top', 'center' or 'bottom' + * @return {fabric.Point} + */ + translateToGivenOrigin: function(point, fromOriginX, fromOriginY, toOriginX, toOriginY) { + var x = point.x, + y = point.y, + offsetX, offsetY, dim; + + if (typeof fromOriginX === 'string') { + fromOriginX = originXOffset[fromOriginX]; + } + else { + fromOriginX -= 0.5; + } + + if (typeof toOriginX === 'string') { + toOriginX = originXOffset[toOriginX]; + } + else { + toOriginX -= 0.5; + } + + offsetX = toOriginX - fromOriginX; + + if (typeof fromOriginY === 'string') { + fromOriginY = originYOffset[fromOriginY]; + } + else { + fromOriginY -= 0.5; + } + + if (typeof toOriginY === 'string') { + toOriginY = originYOffset[toOriginY]; + } + else { + toOriginY -= 0.5; + } + + offsetY = toOriginY - fromOriginY; + + if (offsetX || offsetY) { + dim = this._getTransformedDimensions(); + x = point.x + offsetX * dim.x; + y = point.y + offsetY * dim.y; + } + + return new fabric.Point(x, y); + }, + + /** + * Translates the coordinates from origin to center coordinates (based on the object's dimensions) + * @param {fabric.Point} point The point which corresponds to the originX and originY params + * @param {String} originX Horizontal origin: 'left', 'center' or 'right' + * @param {String} originY Vertical origin: 'top', 'center' or 'bottom' + * @return {fabric.Point} + */ + translateToCenterPoint: function(point, originX, originY) { + var p = this.translateToGivenOrigin(point, originX, originY, 'center', 'center'); + if (this.angle) { + return fabric.util.rotatePoint(p, point, degreesToRadians(this.angle)); + } + return p; + }, + + /** + * Translates the coordinates from center to origin coordinates (based on the object's dimensions) + * @param {fabric.Point} center The point which corresponds to center of the object + * @param {String} originX Horizontal origin: 'left', 'center' or 'right' + * @param {String} originY Vertical origin: 'top', 'center' or 'bottom' + * @return {fabric.Point} + */ + translateToOriginPoint: function(center, originX, originY) { + var p = this.translateToGivenOrigin(center, 'center', 'center', originX, originY); + if (this.angle) { + return fabric.util.rotatePoint(p, center, degreesToRadians(this.angle)); + } + return p; + }, + + /** + * Returns the real center coordinates of the object + * @return {fabric.Point} + */ + getCenterPoint: function() { + var leftTop = new fabric.Point(this.left, this.top); + return this.translateToCenterPoint(leftTop, this.originX, this.originY); + }, + + /** + * Returns the coordinates of the object based on center coordinates + * @param {fabric.Point} point The point which corresponds to the originX and originY params + * @return {fabric.Point} + */ + // getOriginPoint: function(center) { + // return this.translateToOriginPoint(center, this.originX, this.originY); + // }, + + /** + * Returns the coordinates of the object as if it has a different origin + * @param {String} originX Horizontal origin: 'left', 'center' or 'right' + * @param {String} originY Vertical origin: 'top', 'center' or 'bottom' + * @return {fabric.Point} + */ + getPointByOrigin: function(originX, originY) { + var center = this.getCenterPoint(); + return this.translateToOriginPoint(center, originX, originY); + }, + + /** + * Returns the point in local coordinates + * @param {fabric.Point} point The point relative to the global coordinate system + * @param {String} originX Horizontal origin: 'left', 'center' or 'right' + * @param {String} originY Vertical origin: 'top', 'center' or 'bottom' + * @return {fabric.Point} + */ + toLocalPoint: function(point, originX, originY) { + var center = this.getCenterPoint(), + p, p2; + + if (typeof originX !== 'undefined' && typeof originY !== 'undefined' ) { + p = this.translateToGivenOrigin(center, 'center', 'center', originX, originY); + } + else { + p = new fabric.Point(this.left, this.top); + } + + p2 = new fabric.Point(point.x, point.y); + if (this.angle) { + p2 = fabric.util.rotatePoint(p2, center, -degreesToRadians(this.angle)); + } + return p2.subtractEquals(p); + }, + + /** + * Returns the point in global coordinates + * @param {fabric.Point} The point relative to the local coordinate system + * @return {fabric.Point} + */ + // toGlobalPoint: function(point) { + // return fabric.util.rotatePoint(point, this.getCenterPoint(), degreesToRadians(this.angle)).addEquals(new fabric.Point(this.left, this.top)); + // }, + + /** + * Sets the position of the object taking into consideration the object's origin + * @param {fabric.Point} pos The new position of the object + * @param {String} originX Horizontal origin: 'left', 'center' or 'right' + * @param {String} originY Vertical origin: 'top', 'center' or 'bottom' + * @return {void} + */ + setPositionByOrigin: function(pos, originX, originY) { + var center = this.translateToCenterPoint(pos, originX, originY), + position = this.translateToOriginPoint(center, this.originX, this.originY); + + this.set('left', position.x); + this.set('top', position.y); + }, + + /** + * @param {String} to One of 'left', 'center', 'right' + */ + adjustPosition: function(to) { + var angle = degreesToRadians(this.angle), + hypotFull = this.getWidth(), + xFull = Math.cos(angle) * hypotFull, + yFull = Math.sin(angle) * hypotFull, + offsetFrom, offsetTo; + + //TODO: this function does not consider mixed situation like top, center. + if (typeof this.originX === 'string') { + offsetFrom = originXOffset[this.originX]; + } + else { + offsetFrom = this.originX - 0.5; + } + if (typeof to === 'string') { + offsetTo = originXOffset[to]; + } + else { + offsetTo = to - 0.5; + } + this.left += xFull * (offsetTo - offsetFrom); + this.top += yFull * (offsetTo - offsetFrom); + this.setCoords(); + this.originX = to; + }, + + /** + * Sets the origin/position of the object to it's center point + * @private + * @return {void} + */ + _setOriginToCenter: function() { + this._originalOriginX = this.originX; + this._originalOriginY = this.originY; + + var center = this.getCenterPoint(); + + this.originX = 'center'; + this.originY = 'center'; + + this.left = center.x; + this.top = center.y; + }, + + /** + * Resets the origin/position of the object to it's original origin + * @private + * @return {void} + */ + _resetOrigin: function() { + var originPoint = this.translateToOriginPoint( + this.getCenterPoint(), + this._originalOriginX, + this._originalOriginY); + + this.originX = this._originalOriginX; + this.originY = this._originalOriginY; + + this.left = originPoint.x; + this.top = originPoint.y; + + this._originalOriginX = null; + this._originalOriginY = null; + }, + + /** + * @private + */ + _getLeftTopCoords: function() { + return this.translateToOriginPoint(this.getCenterPoint(), 'left', 'top'); + } + }); + +})(); + + +(function() { + + function getCoords(oCoords) { + return [ + new fabric.Point(oCoords.tl.x, oCoords.tl.y), + new fabric.Point(oCoords.tr.x, oCoords.tr.y), + new fabric.Point(oCoords.br.x, oCoords.br.y), + new fabric.Point(oCoords.bl.x, oCoords.bl.y) + ]; + } + + var degreesToRadians = fabric.util.degreesToRadians, + multiplyMatrices = fabric.util.multiplyTransformMatrices; + + fabric.util.object.extend(fabric.Object.prototype, /** @lends fabric.Object.prototype */ { + + /** + * Object containing coordinates of object's controls + * @type Object + * @default + */ + oCoords: null, + + /** + * Checks if object intersects with an area formed by 2 points + * @param {Object} pointTL top-left point of area + * @param {Object} pointBR bottom-right point of area + * @return {Boolean} true if object intersects with an area formed by 2 points + */ + intersectsWithRect: function(pointTL, pointBR) { + var oCoords = getCoords(this.oCoords), + intersection = fabric.Intersection.intersectPolygonRectangle( + oCoords, + pointTL, + pointBR + ); + return intersection.status === 'Intersection'; + }, + + /** + * Checks if object intersects with another object + * @param {Object} other Object to test + * @return {Boolean} true if object intersects with another object + */ + intersectsWithObject: function(other) { + var intersection = fabric.Intersection.intersectPolygonPolygon( + getCoords(this.oCoords), + getCoords(other.oCoords) + ); + + return intersection.status === 'Intersection' + || other.isContainedWithinObject(this) + || this.isContainedWithinObject(other); + }, + + /** + * Checks if object is fully contained within area of another object + * @param {Object} other Object to test + * @return {Boolean} true if object is fully contained within area of another object + */ + isContainedWithinObject: function(other) { + var points = getCoords(this.oCoords), + i = 0; + for (; i < 4; i++) { + if (!other.containsPoint(points[i])) { + return false; + } + } + return true; + }, + + /** + * Checks if object is fully contained within area formed by 2 points + * @param {Object} pointTL top-left point of area + * @param {Object} pointBR bottom-right point of area + * @return {Boolean} true if object is fully contained within area formed by 2 points + */ + isContainedWithinRect: function(pointTL, pointBR) { + var boundingRect = this.getBoundingRect(); + + return ( + boundingRect.left >= pointTL.x && + boundingRect.left + boundingRect.width <= pointBR.x && + boundingRect.top >= pointTL.y && + boundingRect.top + boundingRect.height <= pointBR.y + ); + }, + + /** + * Checks if point is inside the object + * @param {fabric.Point} point Point to check against + * @return {Boolean} true if point is inside the object + */ + containsPoint: function(point) { + if (!this.oCoords) { + this.setCoords(); + } + var lines = this._getImageLines(this.oCoords), + xPoints = this._findCrossPoints(point, lines); + + // if xPoints is odd then point is inside the object + return (xPoints !== 0 && xPoints % 2 === 1); + }, + + /** + * Method that returns an object with the object edges in it, given the coordinates of the corners + * @private + * @param {Object} oCoords Coordinates of the object corners + */ + _getImageLines: function(oCoords) { + return { + topline: { + o: oCoords.tl, + d: oCoords.tr + }, + rightline: { + o: oCoords.tr, + d: oCoords.br + }, + bottomline: { + o: oCoords.br, + d: oCoords.bl + }, + leftline: { + o: oCoords.bl, + d: oCoords.tl + } + }; + }, + + /** + * Helper method to determine how many cross points are between the 4 object edges + * and the horizontal line determined by a point on canvas + * @private + * @param {fabric.Point} point Point to check + * @param {Object} oCoords Coordinates of the object being evaluated + */ + // remove yi, not used but left code here just in case. + _findCrossPoints: function(point, oCoords) { + var b1, b2, a1, a2, xi, // yi, + xcount = 0, + iLine; + + for (var lineKey in oCoords) { + iLine = oCoords[lineKey]; + // optimisation 1: line below point. no cross + if ((iLine.o.y < point.y) && (iLine.d.y < point.y)) { + continue; + } + // optimisation 2: line above point. no cross + if ((iLine.o.y >= point.y) && (iLine.d.y >= point.y)) { + continue; + } + // optimisation 3: vertical line case + if ((iLine.o.x === iLine.d.x) && (iLine.o.x >= point.x)) { + xi = iLine.o.x; + // yi = point.y; + } + // calculate the intersection point + else { + b1 = 0; + b2 = (iLine.d.y - iLine.o.y) / (iLine.d.x - iLine.o.x); + a1 = point.y - b1 * point.x; + a2 = iLine.o.y - b2 * iLine.o.x; + + xi = -(a1 - a2) / (b1 - b2); + // yi = a1 + b1 * xi; + } + // dont count xi < point.x cases + if (xi >= point.x) { + xcount += 1; + } + // optimisation 4: specific for square images + if (xcount === 2) { + break; + } + } + return xcount; + }, + + /** + * Returns width of an object's bounding rectangle + * @deprecated since 1.0.4 + * @return {Number} width value + */ + getBoundingRectWidth: function() { + return this.getBoundingRect().width; + }, + + /** + * Returns height of an object's bounding rectangle + * @deprecated since 1.0.4 + * @return {Number} height value + */ + getBoundingRectHeight: function() { + return this.getBoundingRect().height; + }, + + /** + * Returns coordinates of object's bounding rectangle (left, top, width, height) + * @return {Object} Object with left, top, width, height properties + */ + getBoundingRect: function() { + this.oCoords || this.setCoords(); + return fabric.util.makeBoundingBoxFromPoints([ + this.oCoords.tl, + this.oCoords.tr, + this.oCoords.br, + this.oCoords.bl + ]); + }, + + /** + * Returns width of an object bounding box counting transformations + * @return {Number} width value + */ + getWidth: function() { + return this._getTransformedDimensions().x; + }, + + /** + * Returns height of an object bounding box counting transformations + * to be renamed in 2.0 + * @return {Number} height value + */ + getHeight: function() { + return this._getTransformedDimensions().y; + }, + + /** + * Makes sure the scale is valid and modifies it if necessary + * @private + * @param {Number} value + * @return {Number} + */ + _constrainScale: function(value) { + if (Math.abs(value) < this.minScaleLimit) { + if (value < 0) { + return -this.minScaleLimit; + } + else { + return this.minScaleLimit; + } + } + return value; + }, + + /** + * Scales an object (equally by x and y) + * @param {Number} value Scale factor + * @return {fabric.Object} thisArg + * @chainable + */ + scale: function(value) { + value = this._constrainScale(value); + + if (value < 0) { + this.flipX = !this.flipX; + this.flipY = !this.flipY; + value *= -1; + } + + this.scaleX = value; + this.scaleY = value; + this.setCoords(); + return this; + }, + + /** + * Scales an object to a given width, with respect to bounding box (scaling by x/y equally) + * @param {Number} value New width value + * @return {fabric.Object} thisArg + * @chainable + */ + scaleToWidth: function(value) { + // adjust to bounding rect factor so that rotated shapes would fit as well + var boundingRectFactor = this.getBoundingRect().width / this.getWidth(); + return this.scale(value / this.width / boundingRectFactor); + }, + + /** + * Scales an object to a given height, with respect to bounding box (scaling by x/y equally) + * @param {Number} value New height value + * @return {fabric.Object} thisArg + * @chainable + */ + scaleToHeight: function(value) { + // adjust to bounding rect factor so that rotated shapes would fit as well + var boundingRectFactor = this.getBoundingRect().height / this.getHeight(); + return this.scale(value / this.height / boundingRectFactor); + }, + + /** + * Sets corner position coordinates based on current angle, width and height + * See https://github.com/kangax/fabric.js/wiki/When-to-call-setCoords + * @return {fabric.Object} thisArg + * @chainable + */ + setCoords: function() { + var theta = degreesToRadians(this.angle), + vpt = this.getViewportTransform(), + dim = this._calculateCurrentDimensions(), + currentWidth = dim.x, currentHeight = dim.y; + + // If width is negative, make postive. Fixes path selection issue + if (currentWidth < 0) { + currentWidth = Math.abs(currentWidth); + } + + var sinTh = Math.sin(theta), + cosTh = Math.cos(theta), + _angle = currentWidth > 0 ? Math.atan(currentHeight / currentWidth) : 0, + _hypotenuse = (currentWidth / Math.cos(_angle)) / 2, + offsetX = Math.cos(_angle + theta) * _hypotenuse, + offsetY = Math.sin(_angle + theta) * _hypotenuse, + + // offset added for rotate and scale actions + coords = fabric.util.transformPoint(this.getCenterPoint(), vpt), + tl = new fabric.Point(coords.x - offsetX, coords.y - offsetY), + tr = new fabric.Point(tl.x + (currentWidth * cosTh), tl.y + (currentWidth * sinTh)), + bl = new fabric.Point(tl.x - (currentHeight * sinTh), tl.y + (currentHeight * cosTh)), + br = new fabric.Point(coords.x + offsetX, coords.y + offsetY), + ml = new fabric.Point((tl.x + bl.x) / 2, (tl.y + bl.y) / 2), + mt = new fabric.Point((tr.x + tl.x) / 2, (tr.y + tl.y) / 2), + mr = new fabric.Point((br.x + tr.x) / 2, (br.y + tr.y) / 2), + mb = new fabric.Point((br.x + bl.x) / 2, (br.y + bl.y) / 2), + mtr = new fabric.Point(mt.x + sinTh * this.rotatingPointOffset, mt.y - cosTh * this.rotatingPointOffset); + // debugging + + /* setTimeout(function() { + canvas.contextTop.fillStyle = 'green'; + canvas.contextTop.fillRect(mb.x, mb.y, 3, 3); + canvas.contextTop.fillRect(bl.x, bl.y, 3, 3); + canvas.contextTop.fillRect(br.x, br.y, 3, 3); + canvas.contextTop.fillRect(tl.x, tl.y, 3, 3); + canvas.contextTop.fillRect(tr.x, tr.y, 3, 3); + canvas.contextTop.fillRect(ml.x, ml.y, 3, 3); + canvas.contextTop.fillRect(mr.x, mr.y, 3, 3); + canvas.contextTop.fillRect(mt.x, mt.y, 3, 3); + canvas.contextTop.fillRect(mtr.x, mtr.y, 3, 3); + }, 50); */ + + this.oCoords = { + // corners + tl: tl, tr: tr, br: br, bl: bl, + // middle + ml: ml, mt: mt, mr: mr, mb: mb, + // rotating point + mtr: mtr + }; + + // set coordinates of the draggable boxes in the corners used to scale/rotate the image + this._setCornerCoords && this._setCornerCoords(); + + return this; + }, + + /* + * calculate rotation matrix of an object + * @return {Array} rotation matrix for the object + */ + _calcRotateMatrix: function() { + if (this.angle) { + var theta = degreesToRadians(this.angle), cos = Math.cos(theta), sin = Math.sin(theta); + return [cos, sin, -sin, cos, 0, 0]; + } + return [1, 0, 0, 1, 0, 0]; + }, + + /* + * calculate trasform Matrix that represent current transformation from + * object properties. + * @return {Array} matrix Transform Matrix for the object + */ + calcTransformMatrix: function() { + var center = this.getCenterPoint(), + translateMatrix = [1, 0, 0, 1, center.x, center.y], + rotateMatrix = this._calcRotateMatrix(), + dimensionMatrix = this._calcDimensionsTransformMatrix(this.skewX, this.skewY, true), + matrix = this.group ? this.group.calcTransformMatrix() : [1, 0, 0, 1, 0, 0]; + matrix = multiplyMatrices(matrix, translateMatrix); + matrix = multiplyMatrices(matrix, rotateMatrix); + matrix = multiplyMatrices(matrix, dimensionMatrix); + return matrix; + }, + + _calcDimensionsTransformMatrix: function(skewX, skewY, flipping) { + var skewMatrixX = [1, 0, Math.tan(degreesToRadians(skewX)), 1], + skewMatrixY = [1, Math.tan(degreesToRadians(skewY)), 0, 1], + scaleX = this.scaleX * (flipping && this.flipX ? -1 : 1), + scaleY = this.scaleY * (flipping && this.flipY ? -1 : 1), + scaleMatrix = [scaleX, 0, 0, scaleY], + m = multiplyMatrices(scaleMatrix, skewMatrixX, true); + return multiplyMatrices(m, skewMatrixY, true); + } + }); +})(); + + +fabric.util.object.extend(fabric.Object.prototype, /** @lends fabric.Object.prototype */ { + + /** + * Moves an object to the bottom of the stack of drawn objects + * @return {fabric.Object} thisArg + * @chainable + */ + sendToBack: function() { + if (this.group) { + fabric.StaticCanvas.prototype.sendToBack.call(this.group, this); + } + else { + this.canvas.sendToBack(this); + } + return this; + }, + + /** + * Moves an object to the top of the stack of drawn objects + * @return {fabric.Object} thisArg + * @chainable + */ + bringToFront: function() { + if (this.group) { + fabric.StaticCanvas.prototype.bringToFront.call(this.group, this); + } + else { + this.canvas.bringToFront(this); + } + return this; + }, + + /** + * Moves an object down in stack of drawn objects + * @param {Boolean} [intersecting] If `true`, send object behind next lower intersecting object + * @return {fabric.Object} thisArg + * @chainable + */ + sendBackwards: function(intersecting) { + if (this.group) { + fabric.StaticCanvas.prototype.sendBackwards.call(this.group, this, intersecting); + } + else { + this.canvas.sendBackwards(this, intersecting); + } + return this; + }, + + /** + * Moves an object up in stack of drawn objects + * @param {Boolean} [intersecting] If `true`, send object in front of next upper intersecting object + * @return {fabric.Object} thisArg + * @chainable + */ + bringForward: function(intersecting) { + if (this.group) { + fabric.StaticCanvas.prototype.bringForward.call(this.group, this, intersecting); + } + else { + this.canvas.bringForward(this, intersecting); + } + return this; + }, + + /** + * Moves an object to specified level in stack of drawn objects + * @param {Number} index New position of object + * @return {fabric.Object} thisArg + * @chainable + */ + moveTo: function(index) { + if (this.group) { + fabric.StaticCanvas.prototype.moveTo.call(this.group, this, index); + } + else { + this.canvas.moveTo(this, index); + } + return this; + } +}); + + +/* _TO_SVG_START_ */ +(function() { + + function getSvgColorString(prop, value) { + if (!value) { + return prop + ': none; '; + } + else if (value.toLive) { + return prop + ': url(#SVGID_' + value.id + '); '; + } + else { + var color = new fabric.Color(value), + str = prop + ': ' + color.toRgb() + '; ', + opacity = color.getAlpha(); + if (opacity !== 1) { + //change the color in rgb + opacity + str += prop + '-opacity: ' + opacity.toString() + '; '; + } + return str; + } + } + + fabric.util.object.extend(fabric.Object.prototype, /** @lends fabric.Object.prototype */ { + /** + * Returns styles-string for svg-export + * @param {Boolean} skipShadow a boolean to skip shadow filter output + * @return {String} + */ + getSvgStyles: function(skipShadow) { + + var fillRule = this.fillRule, + strokeWidth = this.strokeWidth ? this.strokeWidth : '0', + strokeDashArray = this.strokeDashArray ? this.strokeDashArray.join(' ') : 'none', + strokeLineCap = this.strokeLineCap ? this.strokeLineCap : 'butt', + strokeLineJoin = this.strokeLineJoin ? this.strokeLineJoin : 'miter', + strokeMiterLimit = this.strokeMiterLimit ? this.strokeMiterLimit : '4', + opacity = typeof this.opacity !== 'undefined' ? this.opacity : '1', + visibility = this.visible ? '' : ' visibility: hidden;', + filter = skipShadow ? '' : this.getSvgFilter(), + fill = getSvgColorString('fill', this.fill), + stroke = getSvgColorString('stroke', this.stroke); + + return [ + stroke, + 'stroke-width: ', strokeWidth, '; ', + 'stroke-dasharray: ', strokeDashArray, '; ', + 'stroke-linecap: ', strokeLineCap, '; ', + 'stroke-linejoin: ', strokeLineJoin, '; ', + 'stroke-miterlimit: ', strokeMiterLimit, '; ', + fill, + 'fill-rule: ', fillRule, '; ', + 'opacity: ', opacity, ';', + filter, + visibility + ].join(''); + }, + + /** + * Returns filter for svg shadow + * @return {String} + */ + getSvgFilter: function() { + return this.shadow ? 'filter: url(#SVGID_' + this.shadow.id + ');' : ''; + }, + + /** + * Returns id attribute for svg output + * @return {String} + */ + getSvgId: function() { + return this.id ? 'id="' + this.id + '" ' : ''; + }, + + /** + * Returns transform-string for svg-export + * @return {String} + */ + getSvgTransform: function() { + if (this.group && this.group.type === 'path-group') { + return ''; + } + var toFixed = fabric.util.toFixed, + angle = this.getAngle(), + skewX = (this.getSkewX() % 360), + skewY = (this.getSkewY() % 360), + center = this.getCenterPoint(), + + NUM_FRACTION_DIGITS = fabric.Object.NUM_FRACTION_DIGITS, + + translatePart = this.type === 'path-group' ? '' : 'translate(' + + toFixed(center.x, NUM_FRACTION_DIGITS) + + ' ' + + toFixed(center.y, NUM_FRACTION_DIGITS) + + ')', + + anglePart = angle !== 0 + ? (' rotate(' + toFixed(angle, NUM_FRACTION_DIGITS) + ')') + : '', + + scalePart = (this.scaleX === 1 && this.scaleY === 1) + ? '' : + (' scale(' + + toFixed(this.scaleX, NUM_FRACTION_DIGITS) + + ' ' + + toFixed(this.scaleY, NUM_FRACTION_DIGITS) + + ')'), + + skewXPart = skewX !== 0 ? ' skewX(' + toFixed(skewX, NUM_FRACTION_DIGITS) + ')' : '', + + skewYPart = skewY !== 0 ? ' skewY(' + toFixed(skewY, NUM_FRACTION_DIGITS) + ')' : '', + + addTranslateX = this.type === 'path-group' ? this.width : 0, + + flipXPart = this.flipX ? ' matrix(-1 0 0 1 ' + addTranslateX + ' 0) ' : '', + + addTranslateY = this.type === 'path-group' ? this.height : 0, + + flipYPart = this.flipY ? ' matrix(1 0 0 -1 0 ' + addTranslateY + ')' : ''; + + return [ + translatePart, anglePart, scalePart, flipXPart, flipYPart, skewXPart, skewYPart + ].join(''); + }, + + /** + * Returns transform-string for svg-export from the transform matrix of single elements + * @return {String} + */ + getSvgTransformMatrix: function() { + return this.transformMatrix ? ' matrix(' + this.transformMatrix.join(' ') + ') ' : ''; + }, + + /** + * @private + */ + _createBaseSVGMarkup: function() { + var markup = []; + + if (this.fill && this.fill.toLive) { + markup.push(this.fill.toSVG(this, false)); + } + if (this.stroke && this.stroke.toLive) { + markup.push(this.stroke.toSVG(this, false)); + } + if (this.shadow) { + markup.push(this.shadow.toSVG(this)); + } + return markup; + } + }); +})(); +/* _TO_SVG_END_ */ + + +(function() { + + var extend = fabric.util.object.extend; + + /* + Depends on `stateProperties` + */ + function saveProps(origin, destination, props) { + var tmpObj = { }, deep = true; + props.forEach(function(prop) { + tmpObj[prop] = origin[prop]; + }); + extend(origin[destination], tmpObj, deep); + } + + function _isEqual(origValue, currentValue) { + if (!fabric.isLikelyNode && origValue instanceof Element) { + // avoid checking deep html elements + return origValue === currentValue; + } + else if (origValue instanceof Array) { + if (origValue.length !== currentValue.length) { + return false + } + var _currentValue = currentValue.concat().sort(), + _origValue = origValue.concat().sort(); + return !_origValue.some(function(v, i) { + return !_isEqual(_currentValue[i], v); + }); + } + else if (origValue instanceof Object) { + for (var key in origValue) { + if (!_isEqual(origValue[key], currentValue[key])) { + return false; + } + } + return true; + } + else { + return origValue === currentValue; + } + } + + + fabric.util.object.extend(fabric.Object.prototype, /** @lends fabric.Object.prototype */ { + + /** + * Returns true if object state (one of its state properties) was changed + * @return {Boolean} true if instance' state has changed since `{@link fabric.Object#saveState}` was called + */ + hasStateChanged: function() { + return !_isEqual(this.originalState, this); + }, + + /** + * Saves state of an object + * @param {Object} [options] Object with additional `stateProperties` array to include when saving state + * @return {fabric.Object} thisArg + */ + saveState: function(options) { + saveProps(this, 'originalState', this.stateProperties); + if (options && options.stateProperties) { + saveProps(this, 'originalState', options.stateProperties); + } + return this; + }, + + /** + * Setups state of an object + * @param {Object} [options] Object with additional `stateProperties` array to include when saving state + * @return {fabric.Object} thisArg + */ + setupState: function(options) { + this.originalState = { }; + this.saveState(options); + return this; + } + }); +})(); + + +(function() { + + var degreesToRadians = fabric.util.degreesToRadians, + /* eslint-disable camelcase */ + isVML = function() { return typeof G_vmlCanvasManager !== 'undefined'; }; + /* eslint-enable camelcase */ + fabric.util.object.extend(fabric.Object.prototype, /** @lends fabric.Object.prototype */ { + + /** + * The object interactivity controls. + * @private + */ + _controlsVisibility: null, + + /** + * Determines which corner has been clicked + * @private + * @param {Object} pointer The pointer indicating the mouse position + * @return {String|Boolean} corner code (tl, tr, bl, br, etc.), or false if nothing is found + */ + _findTargetCorner: function(pointer) { + if (!this.hasControls || !this.active) { + return false; + } + + var ex = pointer.x, + ey = pointer.y, + xPoints, + lines; + this.__corner = 0; + for (var i in this.oCoords) { + + if (!this.isControlVisible(i)) { + continue; + } + + if (i === 'mtr' && !this.hasRotatingPoint) { + continue; + } + + if (this.get('lockUniScaling') && + (i === 'mt' || i === 'mr' || i === 'mb' || i === 'ml')) { + continue; + } + + lines = this._getImageLines(this.oCoords[i].corner); + + // debugging + + // canvas.contextTop.fillRect(lines.bottomline.d.x, lines.bottomline.d.y, 2, 2); + // canvas.contextTop.fillRect(lines.bottomline.o.x, lines.bottomline.o.y, 2, 2); + + // canvas.contextTop.fillRect(lines.leftline.d.x, lines.leftline.d.y, 2, 2); + // canvas.contextTop.fillRect(lines.leftline.o.x, lines.leftline.o.y, 2, 2); + + // canvas.contextTop.fillRect(lines.topline.d.x, lines.topline.d.y, 2, 2); + // canvas.contextTop.fillRect(lines.topline.o.x, lines.topline.o.y, 2, 2); + + // canvas.contextTop.fillRect(lines.rightline.d.x, lines.rightline.d.y, 2, 2); + // canvas.contextTop.fillRect(lines.rightline.o.x, lines.rightline.o.y, 2, 2); + + xPoints = this._findCrossPoints({ x: ex, y: ey }, lines); + if (xPoints !== 0 && xPoints % 2 === 1) { + this.__corner = i; + return i; + } + } + return false; + }, + + /** + * Sets the coordinates of the draggable boxes in the corners of + * the image used to scale/rotate it. + * @private + */ + _setCornerCoords: function() { + var coords = this.oCoords, + newTheta = degreesToRadians(45 - this.angle), + /* Math.sqrt(2 * Math.pow(this.cornerSize, 2)) / 2, */ + /* 0.707106 stands for sqrt(2)/2 */ + cornerHypotenuse = this.cornerSize * 0.707106, + cosHalfOffset = cornerHypotenuse * Math.cos(newTheta), + sinHalfOffset = cornerHypotenuse * Math.sin(newTheta), + x, y; + + for (var point in coords) { + x = coords[point].x; + y = coords[point].y; + coords[point].corner = { + tl: { + x: x - sinHalfOffset, + y: y - cosHalfOffset + }, + tr: { + x: x + cosHalfOffset, + y: y - sinHalfOffset + }, + bl: { + x: x - cosHalfOffset, + y: y + sinHalfOffset + }, + br: { + x: x + sinHalfOffset, + y: y + cosHalfOffset + } + }; + } + }, + + /* + * Calculate object dimensions from its properties + * @private + */ + _getNonTransformedDimensions: function() { + var strokeWidth = this.strokeWidth, + w = this.width, + h = this.height, + addStrokeToW = true, + addStrokeToH = true; + + if (this.type === 'line' && this.strokeLineCap === 'butt') { + addStrokeToH = w; + addStrokeToW = h; + } + + if (addStrokeToH) { + h += h < 0 ? -strokeWidth : strokeWidth; + } + + if (addStrokeToW) { + w += w < 0 ? -strokeWidth : strokeWidth; + } + + return { x: w, y: h }; + }, + + /* + * @private + */ + _getTransformedDimensions: function(skewX, skewY) { + if (typeof skewX === 'undefined') { + skewX = this.skewX; + } + if (typeof skewY === 'undefined') { + skewY = this.skewY; + } + var dimensions = this._getNonTransformedDimensions(), + dimX = dimensions.x / 2, dimY = dimensions.y / 2, + points = [ + { + x: -dimX, + y: -dimY + }, + { + x: dimX, + y: -dimY + }, + { + x: -dimX, + y: dimY + }, + { + x: dimX, + y: dimY + }], + i, transformMatrix = this._calcDimensionsTransformMatrix(skewX, skewY, false), + bbox; + for (i = 0; i < points.length; i++) { + points[i] = fabric.util.transformPoint(points[i], transformMatrix); + } + bbox = fabric.util.makeBoundingBoxFromPoints(points); + return { x: bbox.width, y: bbox.height }; + }, + + /* + * private + */ + _calculateCurrentDimensions: function() { + var vpt = this.getViewportTransform(), + dim = this._getTransformedDimensions(), + w = dim.x, h = dim.y, + p = fabric.util.transformPoint(new fabric.Point(w, h), vpt, true); + + return p.scalarAdd(2 * this.padding); + }, + + /** + * Draws a colored layer behind the object, inside its selection borders. + * Requires public options: padding, selectionBackgroundColor + * this function is called when the context is transformed + * @param {CanvasRenderingContext2D} ctx Context to draw on + * @return {fabric.Object} thisArg + * @chainable + */ + drawSelectionBackground: function(ctx) { + if (!this.selectionBackgroundColor || this.group || !this.active) { + return this; + } + ctx.save(); + var center = this.getCenterPoint(), wh = this._calculateCurrentDimensions(), + vpt = this.canvas.viewportTransform; + ctx.translate(center.x, center.y); + ctx.scale(1 / vpt[0], 1 / vpt[3]); + ctx.rotate(degreesToRadians(this.angle)); + ctx.fillStyle = this.selectionBackgroundColor; + ctx.fillRect(-wh.x / 2, -wh.y / 2, wh.x, wh.y); + ctx.restore(); + return this; + }, + + /** + * Draws borders of an object's bounding box. + * Requires public properties: width, height + * Requires public options: padding, borderColor + * @param {CanvasRenderingContext2D} ctx Context to draw on + * @return {fabric.Object} thisArg + * @chainable + */ + drawBorders: function(ctx) { + if (!this.hasBorders) { + return this; + } + + var wh = this._calculateCurrentDimensions(), + strokeWidth = 1 / this.borderScaleFactor, + width = wh.x + strokeWidth, + height = wh.y + strokeWidth; + + ctx.save(); + ctx.strokeStyle = this.borderColor; + this._setLineDash(ctx, this.borderDashArray, null); + + ctx.strokeRect( + -width / 2, + -height / 2, + width, + height + ); + + if (this.hasRotatingPoint && this.isControlVisible('mtr') && !this.get('lockRotation') && this.hasControls) { + + var rotateHeight = -height / 2; + + ctx.beginPath(); + ctx.moveTo(0, rotateHeight); + ctx.lineTo(0, rotateHeight - this.rotatingPointOffset); + ctx.closePath(); + ctx.stroke(); + } + + ctx.restore(); + return this; + }, + + /** + * Draws borders of an object's bounding box when it is inside a group. + * Requires public properties: width, height + * Requires public options: padding, borderColor + * @param {CanvasRenderingContext2D} ctx Context to draw on + * @param {object} options object representing current object parameters + * @return {fabric.Object} thisArg + * @chainable + */ + drawBordersInGroup: function(ctx, options) { + if (!this.hasBorders) { + return this; + } + + var p = this._getNonTransformedDimensions(), + matrix = fabric.util.customTransformMatrix(options.scaleX, options.scaleY, options.skewX), + wh = fabric.util.transformPoint(p, matrix), + strokeWidth = 1 / this.borderScaleFactor, + width = wh.x + strokeWidth + 2 * this.padding, + height = wh.y + strokeWidth + 2 * this.padding; + + ctx.save(); + this._setLineDash(ctx, this.borderDashArray, null); + ctx.strokeStyle = this.borderColor; + + ctx.strokeRect( + -width / 2, + -height / 2, + width, + height + ); + + ctx.restore(); + return this; + }, + + /** + * Draws corners of an object's bounding box. + * Requires public properties: width, height + * Requires public options: cornerSize, padding + * @param {CanvasRenderingContext2D} ctx Context to draw on + * @return {fabric.Object} thisArg + * @chainable + */ + drawControls: function(ctx) { + if (!this.hasControls) { + return this; + } + + var wh = this._calculateCurrentDimensions(), + width = wh.x, + height = wh.y, + scaleOffset = this.cornerSize, + left = -(width + scaleOffset) / 2, + top = -(height + scaleOffset) / 2, + methodName = this.transparentCorners ? 'stroke' : 'fill'; + + ctx.save(); + ctx.strokeStyle = ctx.fillStyle = this.cornerColor; + if (!this.transparentCorners) { + ctx.strokeStyle = this.cornerStrokeColor; + } + this._setLineDash(ctx, this.cornerDashArray, null); + + // top-left + this._drawControl('tl', ctx, methodName, + left, + top); + + // top-right + this._drawControl('tr', ctx, methodName, + left + width, + top); + + // bottom-left + this._drawControl('bl', ctx, methodName, + left, + top + height); + + // bottom-right + this._drawControl('br', ctx, methodName, + left + width, + top + height); + + if (!this.get('lockUniScaling')) { + + // middle-top + this._drawControl('mt', ctx, methodName, + left + width / 2, + top); + + // middle-bottom + this._drawControl('mb', ctx, methodName, + left + width / 2, + top + height); + + // middle-right + this._drawControl('mr', ctx, methodName, + left + width, + top + height / 2); + + // middle-left + this._drawControl('ml', ctx, methodName, + left, + top + height / 2); + } + + // middle-top-rotate + if (this.hasRotatingPoint) { + this._drawControl('mtr', ctx, methodName, + left + width / 2, + top - this.rotatingPointOffset); + } + + ctx.restore(); + + return this; + }, + + /** + * @private + */ + _drawControl: function(control, ctx, methodName, left, top) { + if (!this.isControlVisible(control)) { + return; + } + var size = this.cornerSize, stroke = !this.transparentCorners && this.cornerStrokeColor; + switch (this.cornerStyle) { + case 'circle': + ctx.beginPath(); + ctx.arc(left + size / 2, top + size / 2, size / 2, 0, 2 * Math.PI, false); + ctx[methodName](); + if (stroke) { + ctx.stroke(); + } + break; + default: + isVML() || this.transparentCorners || ctx.clearRect(left, top, size, size); + ctx[methodName + 'Rect'](left, top, size, size); + if (stroke) { + ctx.strokeRect(left, top, size, size); + } + } + }, + + /** + * Returns true if the specified control is visible, false otherwise. + * @param {String} controlName The name of the control. Possible values are 'tl', 'tr', 'br', 'bl', 'ml', 'mt', 'mr', 'mb', 'mtr'. + * @returns {Boolean} true if the specified control is visible, false otherwise + */ + isControlVisible: function(controlName) { + return this._getControlsVisibility()[controlName]; + }, + + /** + * Sets the visibility of the specified control. + * @param {String} controlName The name of the control. Possible values are 'tl', 'tr', 'br', 'bl', 'ml', 'mt', 'mr', 'mb', 'mtr'. + * @param {Boolean} visible true to set the specified control visible, false otherwise + * @return {fabric.Object} thisArg + * @chainable + */ + setControlVisible: function(controlName, visible) { + this._getControlsVisibility()[controlName] = visible; + return this; + }, + + /** + * Sets the visibility state of object controls. + * @param {Object} [options] Options object + * @param {Boolean} [options.bl] true to enable the bottom-left control, false to disable it + * @param {Boolean} [options.br] true to enable the bottom-right control, false to disable it + * @param {Boolean} [options.mb] true to enable the middle-bottom control, false to disable it + * @param {Boolean} [options.ml] true to enable the middle-left control, false to disable it + * @param {Boolean} [options.mr] true to enable the middle-right control, false to disable it + * @param {Boolean} [options.mt] true to enable the middle-top control, false to disable it + * @param {Boolean} [options.tl] true to enable the top-left control, false to disable it + * @param {Boolean} [options.tr] true to enable the top-right control, false to disable it + * @param {Boolean} [options.mtr] true to enable the middle-top-rotate control, false to disable it + * @return {fabric.Object} thisArg + * @chainable + */ + setControlsVisibility: function(options) { + options || (options = { }); + + for (var p in options) { + this.setControlVisible(p, options[p]); + } + return this; + }, + + /** + * Returns the instance of the control visibility set for this object. + * @private + * @returns {Object} + */ + _getControlsVisibility: function() { + if (!this._controlsVisibility) { + this._controlsVisibility = { + tl: true, + tr: true, + br: true, + bl: true, + ml: true, + mt: true, + mr: true, + mb: true, + mtr: true + }; + } + return this._controlsVisibility; + } + }); +})(); + + +fabric.util.object.extend(fabric.StaticCanvas.prototype, /** @lends fabric.StaticCanvas.prototype */ { + + /** + * Animation duration (in ms) for fx* methods + * @type Number + * @default + */ + FX_DURATION: 500, + + /** + * Centers object horizontally with animation. + * @param {fabric.Object} object Object to center + * @param {Object} [callbacks] Callbacks object with optional "onComplete" and/or "onChange" properties + * @param {Function} [callbacks.onComplete] Invoked on completion + * @param {Function} [callbacks.onChange] Invoked on every step of animation + * @return {fabric.Canvas} thisArg + * @chainable + */ + fxCenterObjectH: function (object, callbacks) { + callbacks = callbacks || { }; + + var empty = function() { }, + onComplete = callbacks.onComplete || empty, + onChange = callbacks.onChange || empty, + _this = this; + + fabric.util.animate({ + startValue: object.get('left'), + endValue: this.getCenter().left, + duration: this.FX_DURATION, + onChange: function(value) { + object.set('left', value); + _this.renderAll(); + onChange(); + }, + onComplete: function() { + object.setCoords(); + onComplete(); + } + }); + + return this; + }, + + /** + * Centers object vertically with animation. + * @param {fabric.Object} object Object to center + * @param {Object} [callbacks] Callbacks object with optional "onComplete" and/or "onChange" properties + * @param {Function} [callbacks.onComplete] Invoked on completion + * @param {Function} [callbacks.onChange] Invoked on every step of animation + * @return {fabric.Canvas} thisArg + * @chainable + */ + fxCenterObjectV: function (object, callbacks) { + callbacks = callbacks || { }; + + var empty = function() { }, + onComplete = callbacks.onComplete || empty, + onChange = callbacks.onChange || empty, + _this = this; + + fabric.util.animate({ + startValue: object.get('top'), + endValue: this.getCenter().top, + duration: this.FX_DURATION, + onChange: function(value) { + object.set('top', value); + _this.renderAll(); + onChange(); + }, + onComplete: function() { + object.setCoords(); + onComplete(); + } + }); + + return this; + }, + + /** + * Same as `fabric.Canvas#remove` but animated + * @param {fabric.Object} object Object to remove + * @param {Object} [callbacks] Callbacks object with optional "onComplete" and/or "onChange" properties + * @param {Function} [callbacks.onComplete] Invoked on completion + * @param {Function} [callbacks.onChange] Invoked on every step of animation + * @return {fabric.Canvas} thisArg + * @chainable + */ + fxRemove: function (object, callbacks) { + callbacks = callbacks || { }; + + var empty = function() { }, + onComplete = callbacks.onComplete || empty, + onChange = callbacks.onChange || empty, + _this = this; + + fabric.util.animate({ + startValue: object.get('opacity'), + endValue: 0, + duration: this.FX_DURATION, + onStart: function() { + object.set('active', false); + }, + onChange: function(value) { + object.set('opacity', value); + _this.renderAll(); + onChange(); + }, + onComplete: function () { + _this.remove(object); + onComplete(); + } + }); + + return this; + } +}); + +fabric.util.object.extend(fabric.Object.prototype, /** @lends fabric.Object.prototype */ { + /** + * Animates object's properties + * @param {String|Object} property Property to animate (if string) or properties to animate (if object) + * @param {Number|Object} value Value to animate property to (if string was given first) or options object + * @return {fabric.Object} thisArg + * @tutorial {@link http://fabricjs.com/fabric-intro-part-2#animation} + * @chainable + * + * As object — multiple properties + * + * object.animate({ left: ..., top: ... }); + * object.animate({ left: ..., top: ... }, { duration: ... }); + * + * As string — one property + * + * object.animate('left', ...); + * object.animate('left', { duration: ... }); + * + */ + animate: function() { + if (arguments[0] && typeof arguments[0] === 'object') { + var propsToAnimate = [], prop, skipCallbacks; + for (prop in arguments[0]) { + propsToAnimate.push(prop); + } + for (var i = 0, len = propsToAnimate.length; i < len; i++) { + prop = propsToAnimate[i]; + skipCallbacks = i !== len - 1; + this._animate(prop, arguments[0][prop], arguments[1], skipCallbacks); + } + } + else { + this._animate.apply(this, arguments); + } + return this; + }, + + /** + * @private + * @param {String} property Property to animate + * @param {String} to Value to animate to + * @param {Object} [options] Options object + * @param {Boolean} [skipCallbacks] When true, callbacks like onchange and oncomplete are not invoked + */ + _animate: function(property, to, options, skipCallbacks) { + var _this = this, propPair; + + to = to.toString(); + + if (!options) { + options = { }; + } + else { + options = fabric.util.object.clone(options); + } + + if (~property.indexOf('.')) { + propPair = property.split('.'); + } + + var currentValue = propPair + ? this.get(propPair[0])[propPair[1]] + : this.get(property); + + if (!('from' in options)) { + options.from = currentValue; + } + + if (~to.indexOf('=')) { + to = currentValue + parseFloat(to.replace('=', '')); + } + else { + to = parseFloat(to); + } + + fabric.util.animate({ + startValue: options.from, + endValue: to, + byValue: options.by, + easing: options.easing, + duration: options.duration, + abort: options.abort && function() { + return options.abort.call(_this); + }, + onChange: function(value) { + if (propPair) { + _this[propPair[0]][propPair[1]] = value; + } + else { + _this.set(property, value); + } + if (skipCallbacks) { + return; + } + options.onChange && options.onChange(); + }, + onComplete: function() { + if (skipCallbacks) { + return; + } + + _this.setCoords(); + options.onComplete && options.onComplete(); + } + }); + } +}); + + +(function(global) { + + 'use strict'; + + var fabric = global.fabric || (global.fabric = { }), + extend = fabric.util.object.extend, + coordProps = { x1: 1, x2: 1, y1: 1, y2: 1 }, + supportsLineDash = fabric.StaticCanvas.supports('setLineDash'); + + if (fabric.Line) { + fabric.warn('fabric.Line is already defined'); + return; + } + + /** + * Line class + * @class fabric.Line + * @extends fabric.Object + * @see {@link fabric.Line#initialize} for constructor definition + */ + fabric.Line = fabric.util.createClass(fabric.Object, /** @lends fabric.Line.prototype */ { + + /** + * Type of an object + * @type String + * @default + */ + type: 'line', + + /** + * x value or first line edge + * @type Number + * @default + */ + x1: 0, + + /** + * y value or first line edge + * @type Number + * @default + */ + y1: 0, + + /** + * x value or second line edge + * @type Number + * @default + */ + x2: 0, + + /** + * y value or second line edge + * @type Number + * @default + */ + y2: 0, + + /** + * Constructor + * @param {Array} [points] Array of points + * @param {Object} [options] Options object + * @return {fabric.Line} thisArg + */ + initialize: function(points, options) { + options = options || { }; + + if (!points) { + points = [0, 0, 0, 0]; + } + + this.callSuper('initialize', options); + + this.set('x1', points[0]); + this.set('y1', points[1]); + this.set('x2', points[2]); + this.set('y2', points[3]); + + this._setWidthHeight(options); + }, + + /** + * @private + * @param {Object} [options] Options + */ + _setWidthHeight: function(options) { + options || (options = { }); + + this.width = Math.abs(this.x2 - this.x1); + this.height = Math.abs(this.y2 - this.y1); + + this.left = 'left' in options + ? options.left + : this._getLeftToOriginX(); + + this.top = 'top' in options + ? options.top + : this._getTopToOriginY(); + }, + + /** + * @private + * @param {String} key + * @param {*} value + */ + _set: function(key, value) { + this.callSuper('_set', key, value); + if (typeof coordProps[key] !== 'undefined') { + this._setWidthHeight(); + } + return this; + }, + + /** + * @private + * @return {Number} leftToOriginX Distance from left edge of canvas to originX of Line. + */ + _getLeftToOriginX: makeEdgeToOriginGetter( + { // property names + origin: 'originX', + axis1: 'x1', + axis2: 'x2', + dimension: 'width' + }, + { // possible values of origin + nearest: 'left', + center: 'center', + farthest: 'right' + } + ), + + /** + * @private + * @return {Number} topToOriginY Distance from top edge of canvas to originY of Line. + */ + _getTopToOriginY: makeEdgeToOriginGetter( + { // property names + origin: 'originY', + axis1: 'y1', + axis2: 'y2', + dimension: 'height' + }, + { // possible values of origin + nearest: 'top', + center: 'center', + farthest: 'bottom' + } + ), + + /** + * @private + * @param {CanvasRenderingContext2D} ctx Context to render on + * @param {Boolean} noTransform + */ + _render: function(ctx, noTransform) { + ctx.beginPath(); + + if (noTransform) { + // Line coords are distances from left-top of canvas to origin of line. + // To render line in a path-group, we need to translate them to + // distances from center of path-group to center of line. + var cp = this.getCenterPoint(); + ctx.translate( + cp.x - this.strokeWidth / 2, + cp.y - this.strokeWidth / 2 + ); + } + + if (!this.strokeDashArray || this.strokeDashArray && supportsLineDash) { + // move from center (of virtual box) to its left/top corner + // we can't assume x1, y1 is top left and x2, y2 is bottom right + var p = this.calcLinePoints(); + ctx.moveTo(p.x1, p.y1); + ctx.lineTo(p.x2, p.y2); + } + + ctx.lineWidth = this.strokeWidth; + + // TODO: test this + // make sure setting "fill" changes color of a line + // (by copying fillStyle to strokeStyle, since line is stroked, not filled) + var origStrokeStyle = ctx.strokeStyle; + ctx.strokeStyle = this.stroke || ctx.fillStyle; + this.stroke && this._renderStroke(ctx); + ctx.strokeStyle = origStrokeStyle; + }, + + /** + * @private + * @param {CanvasRenderingContext2D} ctx Context to render on + */ + _renderDashedStroke: function(ctx) { + var p = this.calcLinePoints(); + + ctx.beginPath(); + fabric.util.drawDashedLine(ctx, p.x1, p.y1, p.x2, p.y2, this.strokeDashArray); + ctx.closePath(); + }, + + /** + * Returns object representation of an instance + * @methd toObject + * @param {Array} [propertiesToInclude] Any properties that you might want to additionally include in the output + * @return {Object} object representation of an instance + */ + toObject: function(propertiesToInclude) { + return extend(this.callSuper('toObject', propertiesToInclude), this.calcLinePoints()); + }, + + /** + * Recalculates line points given width and height + * @private + */ + calcLinePoints: function() { + var xMult = this.x1 <= this.x2 ? -1 : 1, + yMult = this.y1 <= this.y2 ? -1 : 1, + x1 = (xMult * this.width * 0.5), + y1 = (yMult * this.height * 0.5), + x2 = (xMult * this.width * -0.5), + y2 = (yMult * this.height * -0.5); + + return { + x1: x1, + x2: x2, + y1: y1, + y2: y2 + }; + }, + + /* _TO_SVG_START_ */ + /** + * Returns SVG representation of an instance + * @param {Function} [reviver] Method for further parsing of svg representation. + * @return {String} svg representation of an instance + */ + toSVG: function(reviver) { + var markup = this._createBaseSVGMarkup(), + p = { x1: this.x1, x2: this.x2, y1: this.y1, y2: this.y2 }; + + if (!(this.group && this.group.type === 'path-group')) { + p = this.calcLinePoints(); + } + markup.push( + '\n' + ); + + return reviver ? reviver(markup.join('')) : markup.join(''); + }, + /* _TO_SVG_END_ */ + + /** + * Returns complexity of an instance + * @return {Number} complexity + */ + complexity: function() { + return 1; + } + }); + + /* _FROM_SVG_START_ */ + /** + * List of attribute names to account for when parsing SVG element (used by {@link fabric.Line.fromElement}) + * @static + * @memberOf fabric.Line + * @see http://www.w3.org/TR/SVG/shapes.html#LineElement + */ + fabric.Line.ATTRIBUTE_NAMES = fabric.SHARED_ATTRIBUTES.concat('x1 y1 x2 y2'.split(' ')); + + /** + * Returns fabric.Line instance from an SVG element + * @static + * @memberOf fabric.Line + * @param {SVGElement} element Element to parse + * @param {Object} [options] Options object + * @return {fabric.Line} instance of fabric.Line + */ + fabric.Line.fromElement = function(element, options) { + var parsedAttributes = fabric.parseAttributes(element, fabric.Line.ATTRIBUTE_NAMES), + points = [ + parsedAttributes.x1 || 0, + parsedAttributes.y1 || 0, + parsedAttributes.x2 || 0, + parsedAttributes.y2 || 0 + ]; + return new fabric.Line(points, extend(parsedAttributes, options)); + }; + /* _FROM_SVG_END_ */ + + /** + * Returns fabric.Line instance from an object representation + * @static + * @memberOf fabric.Line + * @param {Object} object Object to create an instance from + * @param {function} [callback] invoked with new instance as first argument + * @return {fabric.Line} instance of fabric.Line + */ + fabric.Line.fromObject = function(object, callback) { + var points = [object.x1, object.y1, object.x2, object.y2], + line = new fabric.Line(points, object); + callback && callback(line); + return line; + }; + + /** + * Produces a function that calculates distance from canvas edge to Line origin. + */ + function makeEdgeToOriginGetter(propertyNames, originValues) { + var origin = propertyNames.origin, + axis1 = propertyNames.axis1, + axis2 = propertyNames.axis2, + dimension = propertyNames.dimension, + nearest = originValues.nearest, + center = originValues.center, + farthest = originValues.farthest; + + return function() { + switch (this.get(origin)) { + case nearest: + return Math.min(this.get(axis1), this.get(axis2)); + case center: + return Math.min(this.get(axis1), this.get(axis2)) + (0.5 * this.get(dimension)); + case farthest: + return Math.max(this.get(axis1), this.get(axis2)); + } + }; + + } + +})(typeof exports !== 'undefined' ? exports : this); + + +(function(global) { + + 'use strict'; + + var fabric = global.fabric || (global.fabric = { }), + pi = Math.PI, + extend = fabric.util.object.extend; + + if (fabric.Circle) { + fabric.warn('fabric.Circle is already defined.'); + return; + } + + /** + * Circle class + * @class fabric.Circle + * @extends fabric.Object + * @see {@link fabric.Circle#initialize} for constructor definition + */ + fabric.Circle = fabric.util.createClass(fabric.Object, /** @lends fabric.Circle.prototype */ { + + /** + * Type of an object + * @type String + * @default + */ + type: 'circle', + + /** + * Radius of this circle + * @type Number + * @default + */ + radius: 0, + + /** + * Start angle of the circle, moving clockwise + * @type Number + * @default 0 + */ + startAngle: 0, + + /** + * End angle of the circle + * @type Number + * @default 2Pi + */ + endAngle: pi * 2, + + /** + * Constructor + * @param {Object} [options] Options object + * @return {fabric.Circle} thisArg + */ + initialize: function(options) { + options = options || { }; + + this.callSuper('initialize', options); + this.set('radius', options.radius || 0); + + this.startAngle = options.startAngle || this.startAngle; + this.endAngle = options.endAngle || this.endAngle; + }, + + /** + * @private + * @param {String} key + * @param {*} value + * @return {fabric.Circle} thisArg + */ + _set: function(key, value) { + this.callSuper('_set', key, value); + + if (key === 'radius') { + this.setRadius(value); + } + + return this; + }, + + /** + * Returns object representation of an instance + * @param {Array} [propertiesToInclude] Any properties that you might want to additionally include in the output + * @return {Object} object representation of an instance + */ + toObject: function(propertiesToInclude) { + return extend(this.callSuper('toObject', propertiesToInclude), { + radius: this.get('radius'), + startAngle: this.startAngle, + endAngle: this.endAngle + }); + }, + + /* _TO_SVG_START_ */ + /** + * Returns svg representation of an instance + * @param {Function} [reviver] Method for further parsing of svg representation. + * @return {String} svg representation of an instance + */ + toSVG: function(reviver) { + var markup = this._createBaseSVGMarkup(), x = 0, y = 0, + angle = (this.endAngle - this.startAngle) % ( 2 * pi); + + if (angle === 0) { + if (this.group && this.group.type === 'path-group') { + x = this.left + this.radius; + y = this.top + this.radius; + } + markup.push( + '\n' + ); + } + else { + var startX = Math.cos(this.startAngle) * this.radius, + startY = Math.sin(this.startAngle) * this.radius, + endX = Math.cos(this.endAngle) * this.radius, + endY = Math.sin(this.endAngle) * this.radius, + largeFlag = angle > pi ? '1' : '0'; + + markup.push( + '\n' + ); + } + + return reviver ? reviver(markup.join('')) : markup.join(''); + }, + /* _TO_SVG_END_ */ + + /** + * @private + * @param {CanvasRenderingContext2D} ctx context to render on + * @param {Boolean} [noTransform] When true, context is not transformed + */ + _render: function(ctx, noTransform) { + ctx.beginPath(); + ctx.arc(noTransform ? this.left + this.radius : 0, + noTransform ? this.top + this.radius : 0, + this.radius, + this.startAngle, + this.endAngle, false); + this._renderFill(ctx); + this._renderStroke(ctx); + }, + + /** + * Returns horizontal radius of an object (according to how an object is scaled) + * @return {Number} + */ + getRadiusX: function() { + return this.get('radius') * this.get('scaleX'); + }, + + /** + * Returns vertical radius of an object (according to how an object is scaled) + * @return {Number} + */ + getRadiusY: function() { + return this.get('radius') * this.get('scaleY'); + }, + + /** + * Sets radius of an object (and updates width accordingly) + * @return {fabric.Circle} thisArg + */ + setRadius: function(value) { + this.radius = value; + return this.set('width', value * 2).set('height', value * 2); + }, + + /** + * Returns complexity of an instance + * @return {Number} complexity of this instance + */ + complexity: function() { + return 1; + } + }); + + /* _FROM_SVG_START_ */ + /** + * List of attribute names to account for when parsing SVG element (used by {@link fabric.Circle.fromElement}) + * @static + * @memberOf fabric.Circle + * @see: http://www.w3.org/TR/SVG/shapes.html#CircleElement + */ + fabric.Circle.ATTRIBUTE_NAMES = fabric.SHARED_ATTRIBUTES.concat('cx cy r'.split(' ')); + + /** + * Returns {@link fabric.Circle} instance from an SVG element + * @static + * @memberOf fabric.Circle + * @param {SVGElement} element Element to parse + * @param {Object} [options] Options object + * @throws {Error} If value of `r` attribute is missing or invalid + * @return {fabric.Circle} Instance of fabric.Circle + */ + fabric.Circle.fromElement = function(element, options) { + options || (options = { }); + + var parsedAttributes = fabric.parseAttributes(element, fabric.Circle.ATTRIBUTE_NAMES); + + if (!isValidRadius(parsedAttributes)) { + throw new Error('value of `r` attribute is required and can not be negative'); + } + + parsedAttributes.left = parsedAttributes.left || 0; + parsedAttributes.top = parsedAttributes.top || 0; + + var obj = new fabric.Circle(extend(parsedAttributes, options)); + + obj.left -= obj.radius; + obj.top -= obj.radius; + return obj; + }; + + /** + * @private + */ + function isValidRadius(attributes) { + return (('radius' in attributes) && (attributes.radius >= 0)); + } + /* _FROM_SVG_END_ */ + + /** + * Returns {@link fabric.Circle} instance from an object representation + * @static + * @memberOf fabric.Circle + * @param {Object} object Object to create an instance from + * @param {function} [callback] invoked with new instance as first argument + * @return {Object} Instance of fabric.Circle + */ + fabric.Circle.fromObject = function(object, callback) { + var circle = new fabric.Circle(object); + callback && callback(circle); + return circle; + }; + +})(typeof exports !== 'undefined' ? exports : this); + + +(function(global) { + + 'use strict'; + + var fabric = global.fabric || (global.fabric = { }); + + if (fabric.Triangle) { + fabric.warn('fabric.Triangle is already defined'); + return; + } + + /** + * Triangle class + * @class fabric.Triangle + * @extends fabric.Object + * @return {fabric.Triangle} thisArg + * @see {@link fabric.Triangle#initialize} for constructor definition + */ + fabric.Triangle = fabric.util.createClass(fabric.Object, /** @lends fabric.Triangle.prototype */ { + + /** + * Type of an object + * @type String + * @default + */ + type: 'triangle', + + /** + * Constructor + * @param {Object} [options] Options object + * @return {Object} thisArg + */ + initialize: function(options) { + options = options || { }; + + this.callSuper('initialize', options); + + this.set('width', options.width || 100) + .set('height', options.height || 100); + }, + + /** + * @private + * @param {CanvasRenderingContext2D} ctx Context to render on + */ + _render: function(ctx) { + var widthBy2 = this.width / 2, + heightBy2 = this.height / 2; + + ctx.beginPath(); + ctx.moveTo(-widthBy2, heightBy2); + ctx.lineTo(0, -heightBy2); + ctx.lineTo(widthBy2, heightBy2); + ctx.closePath(); + + this._renderFill(ctx); + this._renderStroke(ctx); + }, + + /** + * @private + * @param {CanvasRenderingContext2D} ctx Context to render on + */ + _renderDashedStroke: function(ctx) { + var widthBy2 = this.width / 2, + heightBy2 = this.height / 2; + + ctx.beginPath(); + fabric.util.drawDashedLine(ctx, -widthBy2, heightBy2, 0, -heightBy2, this.strokeDashArray); + fabric.util.drawDashedLine(ctx, 0, -heightBy2, widthBy2, heightBy2, this.strokeDashArray); + fabric.util.drawDashedLine(ctx, widthBy2, heightBy2, -widthBy2, heightBy2, this.strokeDashArray); + ctx.closePath(); + }, + + /* _TO_SVG_START_ */ + /** + * Returns SVG representation of an instance + * @param {Function} [reviver] Method for further parsing of svg representation. + * @return {String} svg representation of an instance + */ + toSVG: function(reviver) { + var markup = this._createBaseSVGMarkup(), + widthBy2 = this.width / 2, + heightBy2 = this.height / 2, + points = [ + -widthBy2 + ' ' + heightBy2, + '0 ' + -heightBy2, + widthBy2 + ' ' + heightBy2 + ] + .join(','); + + markup.push( + '' + ); + + return reviver ? reviver(markup.join('')) : markup.join(''); + }, + /* _TO_SVG_END_ */ + + /** + * Returns complexity of an instance + * @return {Number} complexity of this instance + */ + complexity: function() { + return 1; + } + }); + + /** + * Returns fabric.Triangle instance from an object representation + * @static + * @memberOf fabric.Triangle + * @param {Object} object Object to create an instance from + * @param {Function} [callback] Callback to invoke when an fabric.Triangle instance is created + * @return {Object} instance of Canvas.Triangle + */ + fabric.Triangle.fromObject = function(object, callback) { + var triangle = new fabric.Triangle(object); + callback && callback(triangle); + return triangle; + }; + +})(typeof exports !== 'undefined' ? exports : this); + + +(function(global) { + + 'use strict'; + + var fabric = global.fabric || (global.fabric = { }), + piBy2 = Math.PI * 2, + extend = fabric.util.object.extend; + + if (fabric.Ellipse) { + fabric.warn('fabric.Ellipse is already defined.'); + return; + } + + /** + * Ellipse class + * @class fabric.Ellipse + * @extends fabric.Object + * @return {fabric.Ellipse} thisArg + * @see {@link fabric.Ellipse#initialize} for constructor definition + */ + fabric.Ellipse = fabric.util.createClass(fabric.Object, /** @lends fabric.Ellipse.prototype */ { + + /** + * Type of an object + * @type String + * @default + */ + type: 'ellipse', + + /** + * Horizontal radius + * @type Number + * @default + */ + rx: 0, + + /** + * Vertical radius + * @type Number + * @default + */ + ry: 0, + + /** + * Constructor + * @param {Object} [options] Options object + * @return {fabric.Ellipse} thisArg + */ + initialize: function(options) { + options = options || { }; + + this.callSuper('initialize', options); + + this.set('rx', options.rx || 0); + this.set('ry', options.ry || 0); + }, + + /** + * @private + * @param {String} key + * @param {*} value + * @return {fabric.Ellipse} thisArg + */ + _set: function(key, value) { + this.callSuper('_set', key, value); + switch (key) { + + case 'rx': + this.rx = value; + this.set('width', value * 2); + break; + + case 'ry': + this.ry = value; + this.set('height', value * 2); + break; + + } + return this; + }, + + /** + * Returns horizontal radius of an object (according to how an object is scaled) + * @return {Number} + */ + getRx: function() { + return this.get('rx') * this.get('scaleX'); + }, + + /** + * Returns Vertical radius of an object (according to how an object is scaled) + * @return {Number} + */ + getRy: function() { + return this.get('ry') * this.get('scaleY'); + }, + + /** + * Returns object representation of an instance + * @param {Array} [propertiesToInclude] Any properties that you might want to additionally include in the output + * @return {Object} object representation of an instance + */ + toObject: function(propertiesToInclude) { + return extend(this.callSuper('toObject', propertiesToInclude), { + rx: this.get('rx'), + ry: this.get('ry') + }); + }, + + /* _TO_SVG_START_ */ + /** + * Returns svg representation of an instance + * @param {Function} [reviver] Method for further parsing of svg representation. + * @return {String} svg representation of an instance + */ + toSVG: function(reviver) { + var markup = this._createBaseSVGMarkup(), x = 0, y = 0; + if (this.group && this.group.type === 'path-group') { + x = this.left + this.rx; + y = this.top + this.ry; + } + markup.push( + '\n' + ); + + return reviver ? reviver(markup.join('')) : markup.join(''); + }, + /* _TO_SVG_END_ */ + + /** + * @private + * @param {CanvasRenderingContext2D} ctx context to render on + * @param {Boolean} [noTransform] When true, context is not transformed + */ + _render: function(ctx, noTransform) { + ctx.beginPath(); + ctx.save(); + ctx.transform(1, 0, 0, this.ry / this.rx, 0, 0); + ctx.arc( + noTransform ? this.left + this.rx : 0, + noTransform ? (this.top + this.ry) * this.rx / this.ry : 0, + this.rx, + 0, + piBy2, + false); + ctx.restore(); + this._renderFill(ctx); + this._renderStroke(ctx); + }, + + /** + * Returns complexity of an instance + * @return {Number} complexity + */ + complexity: function() { + return 1; + } + }); + + /* _FROM_SVG_START_ */ + /** + * List of attribute names to account for when parsing SVG element (used by {@link fabric.Ellipse.fromElement}) + * @static + * @memberOf fabric.Ellipse + * @see http://www.w3.org/TR/SVG/shapes.html#EllipseElement + */ + fabric.Ellipse.ATTRIBUTE_NAMES = fabric.SHARED_ATTRIBUTES.concat('cx cy rx ry'.split(' ')); + + /** + * Returns {@link fabric.Ellipse} instance from an SVG element + * @static + * @memberOf fabric.Ellipse + * @param {SVGElement} element Element to parse + * @param {Object} [options] Options object + * @return {fabric.Ellipse} + */ + fabric.Ellipse.fromElement = function(element, options) { + options || (options = { }); + + var parsedAttributes = fabric.parseAttributes(element, fabric.Ellipse.ATTRIBUTE_NAMES); + + parsedAttributes.left = parsedAttributes.left || 0; + parsedAttributes.top = parsedAttributes.top || 0; + + var ellipse = new fabric.Ellipse(extend(parsedAttributes, options)); + + ellipse.top -= ellipse.ry; + ellipse.left -= ellipse.rx; + return ellipse; + }; + /* _FROM_SVG_END_ */ + + /** + * Returns {@link fabric.Ellipse} instance from an object representation + * @static + * @memberOf fabric.Ellipse + * @param {Object} object Object to create an instance from + * @param {function} [callback] invoked with new instance as first argument + * @return {fabric.Ellipse} + */ + fabric.Ellipse.fromObject = function(object, callback) { + var ellipse = new fabric.Ellipse(object); + callback && callback(ellipse); + return ellipse; + }; + +})(typeof exports !== 'undefined' ? exports : this); + + +(function(global) { + + 'use strict'; + + var fabric = global.fabric || (global.fabric = { }), + extend = fabric.util.object.extend; + + if (fabric.Rect) { + fabric.warn('fabric.Rect is already defined'); + return; + } + + var stateProperties = fabric.Object.prototype.stateProperties.concat(); + stateProperties.push('rx', 'ry', 'x', 'y'); + + /** + * Rectangle class + * @class fabric.Rect + * @extends fabric.Object + * @return {fabric.Rect} thisArg + * @see {@link fabric.Rect#initialize} for constructor definition + */ + fabric.Rect = fabric.util.createClass(fabric.Object, /** @lends fabric.Rect.prototype */ { + + /** + * List of properties to consider when checking if state of an object is changed ({@link fabric.Object#hasStateChanged}) + * as well as for history (undo/redo) purposes + * @type Array + */ + stateProperties: stateProperties, + + /** + * Type of an object + * @type String + * @default + */ + type: 'rect', + + /** + * Horizontal border radius + * @type Number + * @default + */ + rx: 0, + + /** + * Vertical border radius + * @type Number + * @default + */ + ry: 0, + + /** + * Used to specify dash pattern for stroke on this object + * @type Array + */ + strokeDashArray: null, + + /** + * Constructor + * @param {Object} [options] Options object + * @return {Object} thisArg + */ + initialize: function(options) { + options = options || { }; + + this.callSuper('initialize', options); + this._initRxRy(); + + }, + + /** + * Initializes rx/ry attributes + * @private + */ + _initRxRy: function() { + if (this.rx && !this.ry) { + this.ry = this.rx; + } + else if (this.ry && !this.rx) { + this.rx = this.ry; + } + }, + + /** + * @private + * @param {CanvasRenderingContext2D} ctx Context to render on + * @param {Boolean} noTransform + */ + _render: function(ctx, noTransform) { + + // optimize 1x1 case (used in spray brush) + if (this.width === 1 && this.height === 1) { + ctx.fillRect(-0.5, -0.5, 1, 1); + return; + } + + var rx = this.rx ? Math.min(this.rx, this.width / 2) : 0, + ry = this.ry ? Math.min(this.ry, this.height / 2) : 0, + w = this.width, + h = this.height, + x = noTransform ? this.left : -this.width / 2, + y = noTransform ? this.top : -this.height / 2, + isRounded = rx !== 0 || ry !== 0, + /* "magic number" for bezier approximations of arcs (http://itc.ktu.lt/itc354/Riskus354.pdf) */ + k = 1 - 0.5522847498; + ctx.beginPath(); + + ctx.moveTo(x + rx, y); + + ctx.lineTo(x + w - rx, y); + isRounded && ctx.bezierCurveTo(x + w - k * rx, y, x + w, y + k * ry, x + w, y + ry); + + ctx.lineTo(x + w, y + h - ry); + isRounded && ctx.bezierCurveTo(x + w, y + h - k * ry, x + w - k * rx, y + h, x + w - rx, y + h); + + ctx.lineTo(x + rx, y + h); + isRounded && ctx.bezierCurveTo(x + k * rx, y + h, x, y + h - k * ry, x, y + h - ry); + + ctx.lineTo(x, y + ry); + isRounded && ctx.bezierCurveTo(x, y + k * ry, x + k * rx, y, x + rx, y); + + ctx.closePath(); + + this._renderFill(ctx); + this._renderStroke(ctx); + }, + + /** + * @private + * @param {CanvasRenderingContext2D} ctx Context to render on + */ + _renderDashedStroke: function(ctx) { + var x = -this.width / 2, + y = -this.height / 2, + w = this.width, + h = this.height; + + ctx.beginPath(); + fabric.util.drawDashedLine(ctx, x, y, x + w, y, this.strokeDashArray); + fabric.util.drawDashedLine(ctx, x + w, y, x + w, y + h, this.strokeDashArray); + fabric.util.drawDashedLine(ctx, x + w, y + h, x, y + h, this.strokeDashArray); + fabric.util.drawDashedLine(ctx, x, y + h, x, y, this.strokeDashArray); + ctx.closePath(); + }, + + /** + * Returns object representation of an instance + * @param {Array} [propertiesToInclude] Any properties that you might want to additionally include in the output + * @return {Object} object representation of an instance + */ + toObject: function(propertiesToInclude) { + var object = extend(this.callSuper('toObject', propertiesToInclude), { + rx: this.get('rx') || 0, + ry: this.get('ry') || 0 + }); + if (!this.includeDefaultValues) { + this._removeDefaultValues(object); + } + return object; + }, + + /* _TO_SVG_START_ */ + /** + * Returns svg representation of an instance + * @param {Function} [reviver] Method for further parsing of svg representation. + * @return {String} svg representation of an instance + */ + toSVG: function(reviver) { + var markup = this._createBaseSVGMarkup(), x = this.left, y = this.top; + if (!(this.group && this.group.type === 'path-group')) { + x = -this.width / 2; + y = -this.height / 2; + } + markup.push( + '\n'); + + return reviver ? reviver(markup.join('')) : markup.join(''); + }, + /* _TO_SVG_END_ */ + + /** + * Returns complexity of an instance + * @return {Number} complexity + */ + complexity: function() { + return 1; + } + }); + + /* _FROM_SVG_START_ */ + /** + * List of attribute names to account for when parsing SVG element (used by `fabric.Rect.fromElement`) + * @static + * @memberOf fabric.Rect + * @see: http://www.w3.org/TR/SVG/shapes.html#RectElement + */ + fabric.Rect.ATTRIBUTE_NAMES = fabric.SHARED_ATTRIBUTES.concat('x y rx ry width height'.split(' ')); + + /** + * Returns {@link fabric.Rect} instance from an SVG element + * @static + * @memberOf fabric.Rect + * @param {SVGElement} element Element to parse + * @param {Object} [options] Options object + * @return {fabric.Rect} Instance of fabric.Rect + */ + fabric.Rect.fromElement = function(element, options) { + if (!element) { + return null; + } + options = options || { }; + + var parsedAttributes = fabric.parseAttributes(element, fabric.Rect.ATTRIBUTE_NAMES); + + parsedAttributes.left = parsedAttributes.left || 0; + parsedAttributes.top = parsedAttributes.top || 0; + var rect = new fabric.Rect(extend((options ? fabric.util.object.clone(options) : { }), parsedAttributes)); + rect.visible = rect.visible && rect.width > 0 && rect.height > 0; + return rect; + }; + /* _FROM_SVG_END_ */ + + /** + * Returns {@link fabric.Rect} instance from an object representation + * @static + * @memberOf fabric.Rect + * @param {Object} object Object to create an instance from + * @param {Function} [callback] Callback to invoke when an fabric.Rect instance is created + * @return {Object} instance of fabric.Rect + */ + fabric.Rect.fromObject = function(object, callback) { + var rect = new fabric.Rect(object); + callback && callback(rect); + return rect; + }; + +})(typeof exports !== 'undefined' ? exports : this); + + +(function(global) { + + 'use strict'; + + var fabric = global.fabric || (global.fabric = { }); + + if (fabric.Polyline) { + fabric.warn('fabric.Polyline is already defined'); + return; + } + + /** + * Polyline class + * @class fabric.Polyline + * @extends fabric.Object + * @see {@link fabric.Polyline#initialize} for constructor definition + */ + fabric.Polyline = fabric.util.createClass(fabric.Object, /** @lends fabric.Polyline.prototype */ { + + /** + * Type of an object + * @type String + * @default + */ + type: 'polyline', + + /** + * Points array + * @type Array + * @default + */ + points: null, + + /** + * Minimum X from points values, necessary to offset points + * @type Number + * @default + */ + minX: 0, + + /** + * Minimum Y from points values, necessary to offset points + * @type Number + * @default + */ + minY: 0, + + /** + * Constructor + * @param {Array} points Array of points (where each point is an object with x and y) + * @param {Object} [options] Options object + * @return {fabric.Polyline} thisArg + * @example + * var poly = new fabric.Polyline([ + * { x: 10, y: 10 }, + * { x: 50, y: 30 }, + * { x: 40, y: 70 }, + * { x: 60, y: 50 }, + * { x: 100, y: 150 }, + * { x: 40, y: 100 } + * ], { + * stroke: 'red', + * left: 100, + * top: 100 + * }); + */ + initialize: function(points, options) { + return fabric.Polygon.prototype.initialize.call(this, points, options); + }, + + /** + * @private + */ + _calcDimensions: function() { + return fabric.Polygon.prototype._calcDimensions.call(this); + }, + + /** + * Returns object representation of an instance + * @param {Array} [propertiesToInclude] Any properties that you might want to additionally include in the output + * @return {Object} Object representation of an instance + */ + toObject: function(propertiesToInclude) { + return fabric.Polygon.prototype.toObject.call(this, propertiesToInclude); + }, + + /* _TO_SVG_START_ */ + /** + * Returns SVG representation of an instance + * @param {Function} [reviver] Method for further parsing of svg representation. + * @return {String} svg representation of an instance + */ + toSVG: function(reviver) { + return fabric.Polygon.prototype.toSVG.call(this, reviver); + }, + /* _TO_SVG_END_ */ + + /** + * @private + * @param {CanvasRenderingContext2D} ctx Context to render on + * @param {Boolean} noTransform + */ + _render: function(ctx, noTransform) { + if (!fabric.Polygon.prototype.commonRender.call(this, ctx, noTransform)) { + return; + } + this._renderFill(ctx); + this._renderStroke(ctx); + }, + + /** + * @private + * @param {CanvasRenderingContext2D} ctx Context to render on + */ + _renderDashedStroke: function(ctx) { + var p1, p2; + + ctx.beginPath(); + for (var i = 0, len = this.points.length; i < len; i++) { + p1 = this.points[i]; + p2 = this.points[i + 1] || p1; + fabric.util.drawDashedLine(ctx, p1.x, p1.y, p2.x, p2.y, this.strokeDashArray); + } + }, + + /** + * Returns complexity of an instance + * @return {Number} complexity of this instance + */ + complexity: function() { + return this.get('points').length; + } + }); + + /* _FROM_SVG_START_ */ + /** + * List of attribute names to account for when parsing SVG element (used by {@link fabric.Polyline.fromElement}) + * @static + * @memberOf fabric.Polyline + * @see: http://www.w3.org/TR/SVG/shapes.html#PolylineElement + */ + fabric.Polyline.ATTRIBUTE_NAMES = fabric.SHARED_ATTRIBUTES.concat(); + + /** + * Returns fabric.Polyline instance from an SVG element + * @static + * @memberOf fabric.Polyline + * @param {SVGElement} element Element to parse + * @param {Object} [options] Options object + * @return {fabric.Polyline} Instance of fabric.Polyline + */ + fabric.Polyline.fromElement = function(element, options) { + if (!element) { + return null; + } + options || (options = { }); + + var points = fabric.parsePointsAttribute(element.getAttribute('points')), + parsedAttributes = fabric.parseAttributes(element, fabric.Polyline.ATTRIBUTE_NAMES); + + return new fabric.Polyline(points, fabric.util.object.extend(parsedAttributes, options)); + }; + /* _FROM_SVG_END_ */ + + /** + * Returns fabric.Polyline instance from an object representation + * @static + * @memberOf fabric.Polyline + * @param {Object} object Object to create an instance from + * @param {Function} [callback] Callback to invoke when an fabric.Path instance is created + * @return {fabric.Polyline} Instance of fabric.Polyline + */ + fabric.Polyline.fromObject = function(object, callback) { + var polyline = new fabric.Polyline(object.points, object); + callback && callback(polyline); + return polyline; + }; + +})(typeof exports !== 'undefined' ? exports : this); + + +(function(global) { + + 'use strict'; + + var fabric = global.fabric || (global.fabric = { }), + extend = fabric.util.object.extend, + min = fabric.util.array.min, + max = fabric.util.array.max, + toFixed = fabric.util.toFixed; + + if (fabric.Polygon) { + fabric.warn('fabric.Polygon is already defined'); + return; + } + + /** + * Polygon class + * @class fabric.Polygon + * @extends fabric.Object + * @see {@link fabric.Polygon#initialize} for constructor definition + */ + fabric.Polygon = fabric.util.createClass(fabric.Object, /** @lends fabric.Polygon.prototype */ { + + /** + * Type of an object + * @type String + * @default + */ + type: 'polygon', + + /** + * Points array + * @type Array + * @default + */ + points: null, + + /** + * Minimum X from points values, necessary to offset points + * @type Number + * @default + */ + minX: 0, + + /** + * Minimum Y from points values, necessary to offset points + * @type Number + * @default + */ + minY: 0, + + /** + * Constructor + * @param {Array} points Array of points + * @param {Object} [options] Options object + * @return {fabric.Polygon} thisArg + */ + initialize: function(points, options) { + options = options || { }; + this.points = points || []; + this.callSuper('initialize', options); + this._calcDimensions(); + if (!('top' in options)) { + this.top = this.minY; + } + if (!('left' in options)) { + this.left = this.minX; + } + this.pathOffset = { + x: this.minX + this.width / 2, + y: this.minY + this.height / 2 + }; + }, + + /** + * @private + */ + _calcDimensions: function() { + + var points = this.points, + minX = min(points, 'x'), + minY = min(points, 'y'), + maxX = max(points, 'x'), + maxY = max(points, 'y'); + + this.width = (maxX - minX) || 0; + this.height = (maxY - minY) || 0; + this.minX = minX || 0; + this.minY = minY || 0; + }, + + /** + * Returns object representation of an instance + * @param {Array} [propertiesToInclude] Any properties that you might want to additionally include in the output + * @return {Object} Object representation of an instance + */ + toObject: function(propertiesToInclude) { + return extend(this.callSuper('toObject', propertiesToInclude), { + points: this.points.concat() + }); + }, + + /* _TO_SVG_START_ */ + /** + * Returns svg representation of an instance + * @param {Function} [reviver] Method for further parsing of svg representation. + * @return {String} svg representation of an instance + */ + toSVG: function(reviver) { + var points = [], addTransform, + markup = this._createBaseSVGMarkup(); + + for (var i = 0, len = this.points.length; i < len; i++) { + points.push(toFixed(this.points[i].x, 2), ',', toFixed(this.points[i].y, 2), ' '); + } + if (!(this.group && this.group.type === 'path-group')) { + addTransform = ' translate(' + (-this.pathOffset.x) + ', ' + (-this.pathOffset.y) + ') '; + } + markup.push( + '<', this.type, ' ', this.getSvgId(), + 'points="', points.join(''), + '" style="', this.getSvgStyles(), + '" transform="', this.getSvgTransform(), addTransform, + ' ', this.getSvgTransformMatrix(), + '"/>\n' + ); + + return reviver ? reviver(markup.join('')) : markup.join(''); + }, + /* _TO_SVG_END_ */ + + /** + * @private + * @param {CanvasRenderingContext2D} ctx Context to render on + * @param {Boolean} noTransform + */ + _render: function(ctx, noTransform) { + if (!this.commonRender(ctx, noTransform)) { + return; + } + this._renderFill(ctx); + if (this.stroke || this.strokeDashArray) { + ctx.closePath(); + this._renderStroke(ctx); + } + }, + + /** + * @private + * @param {CanvasRenderingContext2D} ctx Context to render on + * @param {Boolean} noTransform + */ + commonRender: function(ctx, noTransform) { + var point, len = this.points.length; + + if (!len || isNaN(this.points[len - 1].y)) { + // do not draw if no points or odd points + // NaN comes from parseFloat of a empty string in parser + return false; + } + + noTransform || ctx.translate(-this.pathOffset.x, -this.pathOffset.y); + ctx.beginPath(); + ctx.moveTo(this.points[0].x, this.points[0].y); + for (var i = 0; i < len; i++) { + point = this.points[i]; + ctx.lineTo(point.x, point.y); + } + return true; + }, + + /** + * @private + * @param {CanvasRenderingContext2D} ctx Context to render on + */ + _renderDashedStroke: function(ctx) { + fabric.Polyline.prototype._renderDashedStroke.call(this, ctx); + ctx.closePath(); + }, + + /** + * Returns complexity of an instance + * @return {Number} complexity of this instance + */ + complexity: function() { + return this.points.length; + } + }); + + /* _FROM_SVG_START_ */ + /** + * List of attribute names to account for when parsing SVG element (used by `fabric.Polygon.fromElement`) + * @static + * @memberOf fabric.Polygon + * @see: http://www.w3.org/TR/SVG/shapes.html#PolygonElement + */ + fabric.Polygon.ATTRIBUTE_NAMES = fabric.SHARED_ATTRIBUTES.concat(); + + /** + * Returns {@link fabric.Polygon} instance from an SVG element + * @static + * @memberOf fabric.Polygon + * @param {SVGElement} element Element to parse + * @param {Object} [options] Options object + * @return {fabric.Polygon} Instance of fabric.Polygon + */ + fabric.Polygon.fromElement = function(element, options) { + if (!element) { + return null; + } + + options || (options = { }); + + var points = fabric.parsePointsAttribute(element.getAttribute('points')), + parsedAttributes = fabric.parseAttributes(element, fabric.Polygon.ATTRIBUTE_NAMES); + + return new fabric.Polygon(points, extend(parsedAttributes, options)); + }; + /* _FROM_SVG_END_ */ + + /** + * Returns fabric.Polygon instance from an object representation + * @static + * @memberOf fabric.Polygon + * @param {Object} object Object to create an instance from + * @param {Function} [callback] Callback to invoke when an fabric.Path instance is created + * @return {fabric.Polygon} Instance of fabric.Polygon + */ + fabric.Polygon.fromObject = function(object, callback) { + var polygon = new fabric.Polygon(object.points, object); + callback && callback(polygon); + return polygon; + }; + +})(typeof exports !== 'undefined' ? exports : this); + + +(function(global) { + + 'use strict'; + + var fabric = global.fabric || (global.fabric = { }), + min = fabric.util.array.min, + max = fabric.util.array.max, + extend = fabric.util.object.extend, + _toString = Object.prototype.toString, + drawArc = fabric.util.drawArc, + commandLengths = { + m: 2, + l: 2, + h: 1, + v: 1, + c: 6, + s: 4, + q: 4, + t: 2, + a: 7 + }, + repeatedCommands = { + m: 'l', + M: 'L' + }; + + if (fabric.Path) { + fabric.warn('fabric.Path is already defined'); + return; + } + + /** + * Path class + * @class fabric.Path + * @extends fabric.Object + * @tutorial {@link http://fabricjs.com/fabric-intro-part-1#path_and_pathgroup} + * @see {@link fabric.Path#initialize} for constructor definition + */ + fabric.Path = fabric.util.createClass(fabric.Object, /** @lends fabric.Path.prototype */ { + + /** + * Type of an object + * @type String + * @default + */ + type: 'path', + + /** + * Array of path points + * @type Array + * @default + */ + path: null, + + /** + * Minimum X from points values, necessary to offset points + * @type Number + * @default + */ + minX: 0, + + /** + * Minimum Y from points values, necessary to offset points + * @type Number + * @default + */ + minY: 0, + + /** + * Constructor + * @param {Array|String} path Path data (sequence of coordinates and corresponding "command" tokens) + * @param {Object} [options] Options object + * @return {fabric.Path} thisArg + */ + initialize: function(path, options) { + options = options || { }; + + this.setOptions(options); + + if (!path) { + path = []; + } + + var fromArray = _toString.call(path) === '[object Array]'; + + this.path = fromArray + ? path + // one of commands (m,M,l,L,q,Q,c,C,etc.) followed by non-command characters (i.e. command values) + : path.match && path.match(/[mzlhvcsqta][^mzlhvcsqta]*/gi); + + if (!this.path) { + return; + } + + if (!fromArray) { + this.path = this._parsePath(); + } + + this._setPositionDimensions(options); + + if (options.sourcePath) { + this.setSourcePath(options.sourcePath); + } + }, + + /** + * @private + * @param {Object} options Options object + */ + _setPositionDimensions: function(options) { + var calcDim = this._parseDimensions(); + + this.minX = calcDim.left; + this.minY = calcDim.top; + this.width = calcDim.width; + this.height = calcDim.height; + + if (typeof options.left === 'undefined') { + this.left = calcDim.left + (this.originX === 'center' + ? this.width / 2 + : this.originX === 'right' + ? this.width + : 0); + } + + if (typeof options.top === 'undefined') { + this.top = calcDim.top + (this.originY === 'center' + ? this.height / 2 + : this.originY === 'bottom' + ? this.height + : 0); + } + + this.pathOffset = this.pathOffset || { + x: this.minX + this.width / 2, + y: this.minY + this.height / 2 + }; + }, + + /** + * @private + * @param {CanvasRenderingContext2D} ctx context to render path on + */ + _renderPathCommands: function(ctx) { + var current, // current instruction + previous = null, + subpathStartX = 0, + subpathStartY = 0, + x = 0, // current x + y = 0, // current y + controlX = 0, // current control point x + controlY = 0, // current control point y + tempX, + tempY, + l = -this.pathOffset.x, + t = -this.pathOffset.y; + + if (this.group && this.group.type === 'path-group') { + l = 0; + t = 0; + } + + ctx.beginPath(); + + for (var i = 0, len = this.path.length; i < len; ++i) { + + current = this.path[i]; + + switch (current[0]) { // first letter + + case 'l': // lineto, relative + x += current[1]; + y += current[2]; + ctx.lineTo(x + l, y + t); + break; + + case 'L': // lineto, absolute + x = current[1]; + y = current[2]; + ctx.lineTo(x + l, y + t); + break; + + case 'h': // horizontal lineto, relative + x += current[1]; + ctx.lineTo(x + l, y + t); + break; + + case 'H': // horizontal lineto, absolute + x = current[1]; + ctx.lineTo(x + l, y + t); + break; + + case 'v': // vertical lineto, relative + y += current[1]; + ctx.lineTo(x + l, y + t); + break; + + case 'V': // verical lineto, absolute + y = current[1]; + ctx.lineTo(x + l, y + t); + break; + + case 'm': // moveTo, relative + x += current[1]; + y += current[2]; + subpathStartX = x; + subpathStartY = y; + ctx.moveTo(x + l, y + t); + break; + + case 'M': // moveTo, absolute + x = current[1]; + y = current[2]; + subpathStartX = x; + subpathStartY = y; + ctx.moveTo(x + l, y + t); + break; + + case 'c': // bezierCurveTo, relative + tempX = x + current[5]; + tempY = y + current[6]; + controlX = x + current[3]; + controlY = y + current[4]; + ctx.bezierCurveTo( + x + current[1] + l, // x1 + y + current[2] + t, // y1 + controlX + l, // x2 + controlY + t, // y2 + tempX + l, + tempY + t + ); + x = tempX; + y = tempY; + break; + + case 'C': // bezierCurveTo, absolute + x = current[5]; + y = current[6]; + controlX = current[3]; + controlY = current[4]; + ctx.bezierCurveTo( + current[1] + l, + current[2] + t, + controlX + l, + controlY + t, + x + l, + y + t + ); + break; + + case 's': // shorthand cubic bezierCurveTo, relative + + // transform to absolute x,y + tempX = x + current[3]; + tempY = y + current[4]; + + if (previous[0].match(/[CcSs]/) === null) { + // If there is no previous command or if the previous command was not a C, c, S, or s, + // the control point is coincident with the current point + controlX = x; + controlY = y; + } + else { + // calculate reflection of previous control points + controlX = 2 * x - controlX; + controlY = 2 * y - controlY; + } + + ctx.bezierCurveTo( + controlX + l, + controlY + t, + x + current[1] + l, + y + current[2] + t, + tempX + l, + tempY + t + ); + // set control point to 2nd one of this command + // "... the first control point is assumed to be + // the reflection of the second control point on + // the previous command relative to the current point." + controlX = x + current[1]; + controlY = y + current[2]; + + x = tempX; + y = tempY; + break; + + case 'S': // shorthand cubic bezierCurveTo, absolute + tempX = current[3]; + tempY = current[4]; + if (previous[0].match(/[CcSs]/) === null) { + // If there is no previous command or if the previous command was not a C, c, S, or s, + // the control point is coincident with the current point + controlX = x; + controlY = y; + } + else { + // calculate reflection of previous control points + controlX = 2 * x - controlX; + controlY = 2 * y - controlY; + } + ctx.bezierCurveTo( + controlX + l, + controlY + t, + current[1] + l, + current[2] + t, + tempX + l, + tempY + t + ); + x = tempX; + y = tempY; + + // set control point to 2nd one of this command + // "... the first control point is assumed to be + // the reflection of the second control point on + // the previous command relative to the current point." + controlX = current[1]; + controlY = current[2]; + + break; + + case 'q': // quadraticCurveTo, relative + // transform to absolute x,y + tempX = x + current[3]; + tempY = y + current[4]; + + controlX = x + current[1]; + controlY = y + current[2]; + + ctx.quadraticCurveTo( + controlX + l, + controlY + t, + tempX + l, + tempY + t + ); + x = tempX; + y = tempY; + break; + + case 'Q': // quadraticCurveTo, absolute + tempX = current[3]; + tempY = current[4]; + + ctx.quadraticCurveTo( + current[1] + l, + current[2] + t, + tempX + l, + tempY + t + ); + x = tempX; + y = tempY; + controlX = current[1]; + controlY = current[2]; + break; + + case 't': // shorthand quadraticCurveTo, relative + + // transform to absolute x,y + tempX = x + current[1]; + tempY = y + current[2]; + + if (previous[0].match(/[QqTt]/) === null) { + // If there is no previous command or if the previous command was not a Q, q, T or t, + // assume the control point is coincident with the current point + controlX = x; + controlY = y; + } + else { + // calculate reflection of previous control point + controlX = 2 * x - controlX; + controlY = 2 * y - controlY; + } + + ctx.quadraticCurveTo( + controlX + l, + controlY + t, + tempX + l, + tempY + t + ); + x = tempX; + y = tempY; + + break; + + case 'T': + tempX = current[1]; + tempY = current[2]; + + if (previous[0].match(/[QqTt]/) === null) { + // If there is no previous command or if the previous command was not a Q, q, T or t, + // assume the control point is coincident with the current point + controlX = x; + controlY = y; + } + else { + // calculate reflection of previous control point + controlX = 2 * x - controlX; + controlY = 2 * y - controlY; + } + ctx.quadraticCurveTo( + controlX + l, + controlY + t, + tempX + l, + tempY + t + ); + x = tempX; + y = tempY; + break; + + case 'a': + // TODO: optimize this + drawArc(ctx, x + l, y + t, [ + current[1], + current[2], + current[3], + current[4], + current[5], + current[6] + x + l, + current[7] + y + t + ]); + x += current[6]; + y += current[7]; + break; + + case 'A': + // TODO: optimize this + drawArc(ctx, x + l, y + t, [ + current[1], + current[2], + current[3], + current[4], + current[5], + current[6] + l, + current[7] + t + ]); + x = current[6]; + y = current[7]; + break; + + case 'z': + case 'Z': + x = subpathStartX; + y = subpathStartY; + ctx.closePath(); + break; + } + previous = current; + } + }, + + /** + * @private + * @param {CanvasRenderingContext2D} ctx context to render path on + */ + _render: function(ctx) { + this._renderPathCommands(ctx); + this._renderFill(ctx); + this._renderStroke(ctx); + }, + + /** + * Returns string representation of an instance + * @return {String} string representation of an instance + */ + toString: function() { + return '#'; + }, + + /** + * Returns object representation of an instance + * @param {Array} [propertiesToInclude] Any properties that you might want to additionally include in the output + * @return {Object} object representation of an instance + */ + toObject: function(propertiesToInclude) { + var o = extend(this.callSuper('toObject', propertiesToInclude), { + path: this.path.map(function(item) { return item.slice() }), + pathOffset: this.pathOffset + }); + if (this.sourcePath) { + o.sourcePath = this.sourcePath; + } + if (this.transformMatrix) { + o.transformMatrix = this.transformMatrix; + } + return o; + }, + + /** + * Returns dataless object representation of an instance + * @param {Array} [propertiesToInclude] Any properties that you might want to additionally include in the output + * @return {Object} object representation of an instance + */ + toDatalessObject: function(propertiesToInclude) { + var o = this.toObject(propertiesToInclude); + if (this.sourcePath) { + o.path = this.sourcePath; + } + delete o.sourcePath; + return o; + }, + + /* _TO_SVG_START_ */ + /** + * Returns svg representation of an instance + * @param {Function} [reviver] Method for further parsing of svg representation. + * @return {String} svg representation of an instance + */ + toSVG: function(reviver) { + var chunks = [], + markup = this._createBaseSVGMarkup(), addTransform = ''; + + for (var i = 0, len = this.path.length; i < len; i++) { + chunks.push(this.path[i].join(' ')); + } + var path = chunks.join(' '); + if (!(this.group && this.group.type === 'path-group')) { + addTransform = ' translate(' + (-this.pathOffset.x) + ', ' + (-this.pathOffset.y) + ') '; + } + markup.push( + '\n' + ); + + return reviver ? reviver(markup.join('')) : markup.join(''); + }, + /* _TO_SVG_END_ */ + + /** + * Returns number representation of an instance complexity + * @return {Number} complexity of this instance + */ + complexity: function() { + return this.path.length; + }, + + /** + * @private + */ + _parsePath: function() { + var result = [], + coords = [], + currentPath, + parsed, + re = /([-+]?((\d+\.\d+)|((\d+)|(\.\d+)))(?:e[-+]?\d+)?)/ig, + match, + coordsStr; + + for (var i = 0, coordsParsed, len = this.path.length; i < len; i++) { + currentPath = this.path[i]; + + coordsStr = currentPath.slice(1).trim(); + coords.length = 0; + + while ((match = re.exec(coordsStr))) { + coords.push(match[0]); + } + + coordsParsed = [currentPath.charAt(0)]; + + for (var j = 0, jlen = coords.length; j < jlen; j++) { + parsed = parseFloat(coords[j]); + if (!isNaN(parsed)) { + coordsParsed.push(parsed); + } + } + + var command = coordsParsed[0], + commandLength = commandLengths[command.toLowerCase()], + repeatedCommand = repeatedCommands[command] || command; + + if (coordsParsed.length - 1 > commandLength) { + for (var k = 1, klen = coordsParsed.length; k < klen; k += commandLength) { + result.push([command].concat(coordsParsed.slice(k, k + commandLength))); + command = repeatedCommand; + } + } + else { + result.push(coordsParsed); + } + } + + return result; + }, + + /** + * @private + */ + _parseDimensions: function() { + + var aX = [], + aY = [], + current, // current instruction + previous = null, + subpathStartX = 0, + subpathStartY = 0, + x = 0, // current x + y = 0, // current y + controlX = 0, // current control point x + controlY = 0, // current control point y + tempX, + tempY, + bounds; + + for (var i = 0, len = this.path.length; i < len; ++i) { + + current = this.path[i]; + + switch (current[0]) { // first letter + + case 'l': // lineto, relative + x += current[1]; + y += current[2]; + bounds = []; + break; + + case 'L': // lineto, absolute + x = current[1]; + y = current[2]; + bounds = []; + break; + + case 'h': // horizontal lineto, relative + x += current[1]; + bounds = []; + break; + + case 'H': // horizontal lineto, absolute + x = current[1]; + bounds = []; + break; + + case 'v': // vertical lineto, relative + y += current[1]; + bounds = []; + break; + + case 'V': // verical lineto, absolute + y = current[1]; + bounds = []; + break; + + case 'm': // moveTo, relative + x += current[1]; + y += current[2]; + subpathStartX = x; + subpathStartY = y; + bounds = []; + break; + + case 'M': // moveTo, absolute + x = current[1]; + y = current[2]; + subpathStartX = x; + subpathStartY = y; + bounds = []; + break; + + case 'c': // bezierCurveTo, relative + tempX = x + current[5]; + tempY = y + current[6]; + controlX = x + current[3]; + controlY = y + current[4]; + bounds = fabric.util.getBoundsOfCurve(x, y, + x + current[1], // x1 + y + current[2], // y1 + controlX, // x2 + controlY, // y2 + tempX, + tempY + ); + x = tempX; + y = tempY; + break; + + case 'C': // bezierCurveTo, absolute + x = current[5]; + y = current[6]; + controlX = current[3]; + controlY = current[4]; + bounds = fabric.util.getBoundsOfCurve(x, y, + current[1], + current[2], + controlX, + controlY, + x, + y + ); + break; + + case 's': // shorthand cubic bezierCurveTo, relative + + // transform to absolute x,y + tempX = x + current[3]; + tempY = y + current[4]; + + if (previous[0].match(/[CcSs]/) === null) { + // If there is no previous command or if the previous command was not a C, c, S, or s, + // the control point is coincident with the current point + controlX = x; + controlY = y; + } + else { + // calculate reflection of previous control points + controlX = 2 * x - controlX; + controlY = 2 * y - controlY; + } + + bounds = fabric.util.getBoundsOfCurve(x, y, + controlX, + controlY, + x + current[1], + y + current[2], + tempX, + tempY + ); + // set control point to 2nd one of this command + // "... the first control point is assumed to be + // the reflection of the second control point on + // the previous command relative to the current point." + controlX = x + current[1]; + controlY = y + current[2]; + x = tempX; + y = tempY; + break; + + case 'S': // shorthand cubic bezierCurveTo, absolute + tempX = current[3]; + tempY = current[4]; + if (previous[0].match(/[CcSs]/) === null) { + // If there is no previous command or if the previous command was not a C, c, S, or s, + // the control point is coincident with the current point + controlX = x; + controlY = y; + } + else { + // calculate reflection of previous control points + controlX = 2 * x - controlX; + controlY = 2 * y - controlY; + } + bounds = fabric.util.getBoundsOfCurve(x, y, + controlX, + controlY, + current[1], + current[2], + tempX, + tempY + ); + x = tempX; + y = tempY; + // set control point to 2nd one of this command + // "... the first control point is assumed to be + // the reflection of the second control point on + // the previous command relative to the current point." + controlX = current[1]; + controlY = current[2]; + break; + + case 'q': // quadraticCurveTo, relative + // transform to absolute x,y + tempX = x + current[3]; + tempY = y + current[4]; + controlX = x + current[1]; + controlY = y + current[2]; + bounds = fabric.util.getBoundsOfCurve(x, y, + controlX, + controlY, + controlX, + controlY, + tempX, + tempY + ); + x = tempX; + y = tempY; + break; + + case 'Q': // quadraticCurveTo, absolute + controlX = current[1]; + controlY = current[2]; + bounds = fabric.util.getBoundsOfCurve(x, y, + controlX, + controlY, + controlX, + controlY, + current[3], + current[4] + ); + x = current[3]; + y = current[4]; + break; + + case 't': // shorthand quadraticCurveTo, relative + // transform to absolute x,y + tempX = x + current[1]; + tempY = y + current[2]; + if (previous[0].match(/[QqTt]/) === null) { + // If there is no previous command or if the previous command was not a Q, q, T or t, + // assume the control point is coincident with the current point + controlX = x; + controlY = y; + } + else { + // calculate reflection of previous control point + controlX = 2 * x - controlX; + controlY = 2 * y - controlY; + } + + bounds = fabric.util.getBoundsOfCurve(x, y, + controlX, + controlY, + controlX, + controlY, + tempX, + tempY + ); + x = tempX; + y = tempY; + + break; + + case 'T': + tempX = current[1]; + tempY = current[2]; + + if (previous[0].match(/[QqTt]/) === null) { + // If there is no previous command or if the previous command was not a Q, q, T or t, + // assume the control point is coincident with the current point + controlX = x; + controlY = y; + } + else { + // calculate reflection of previous control point + controlX = 2 * x - controlX; + controlY = 2 * y - controlY; + } + bounds = fabric.util.getBoundsOfCurve(x, y, + controlX, + controlY, + controlX, + controlY, + tempX, + tempY + ); + x = tempX; + y = tempY; + break; + + case 'a': + // TODO: optimize this + bounds = fabric.util.getBoundsOfArc(x, y, + current[1], + current[2], + current[3], + current[4], + current[5], + current[6] + x, + current[7] + y + ); + x += current[6]; + y += current[7]; + break; + + case 'A': + // TODO: optimize this + bounds = fabric.util.getBoundsOfArc(x, y, + current[1], + current[2], + current[3], + current[4], + current[5], + current[6], + current[7] + ); + x = current[6]; + y = current[7]; + break; + + case 'z': + case 'Z': + x = subpathStartX; + y = subpathStartY; + break; + } + previous = current; + bounds.forEach(function (point) { + aX.push(point.x); + aY.push(point.y); + }); + aX.push(x); + aY.push(y); + } + + var minX = min(aX) || 0, + minY = min(aY) || 0, + maxX = max(aX) || 0, + maxY = max(aY) || 0, + deltaX = maxX - minX, + deltaY = maxY - minY, + + o = { + left: minX, + top: minY, + width: deltaX, + height: deltaY + }; + + return o; + } + }); + + /** + * Creates an instance of fabric.Path from an object + * @static + * @memberOf fabric.Path + * @param {Object} object + * @param {Function} [callback] Callback to invoke when an fabric.Path instance is created + */ + fabric.Path.fromObject = function(object, callback) { + // remove this pattern rom 2.0, accept just object. + var path; + if (typeof object.path === 'string') { + fabric.loadSVGFromURL(object.path, function (elements) { + var pathUrl = object.path; + path = elements[0]; + delete object.path; + + fabric.util.object.extend(path, object); + path.setSourcePath(pathUrl); + + callback && callback(path); + }); + } + else { + path = new fabric.Path(object.path, object); + callback && callback(path); + return path; + } + }; + + /* _FROM_SVG_START_ */ + /** + * List of attribute names to account for when parsing SVG element (used by `fabric.Path.fromElement`) + * @static + * @memberOf fabric.Path + * @see http://www.w3.org/TR/SVG/paths.html#PathElement + */ + fabric.Path.ATTRIBUTE_NAMES = fabric.SHARED_ATTRIBUTES.concat(['d']); + + /** + * Creates an instance of fabric.Path from an SVG element + * @static + * @memberOf fabric.Path + * @param {SVGElement} element to parse + * @param {Function} callback Callback to invoke when an fabric.Path instance is created + * @param {Object} [options] Options object + */ + fabric.Path.fromElement = function(element, callback, options) { + var parsedAttributes = fabric.parseAttributes(element, fabric.Path.ATTRIBUTE_NAMES); + callback && callback(new fabric.Path(parsedAttributes.d, extend(parsedAttributes, options))); + }; + /* _FROM_SVG_END_ */ + + /** + * Indicates that instances of this type are async + * @static + * @memberOf fabric.Path + * @type Boolean + * @default + */ + fabric.Path.async = true; + +})(typeof exports !== 'undefined' ? exports : this); + + +(function(global) { + + 'use strict'; + + var fabric = global.fabric || (global.fabric = { }), + extend = fabric.util.object.extend, + invoke = fabric.util.array.invoke, + parentToObject = fabric.Object.prototype.toObject; + + if (fabric.PathGroup) { + fabric.warn('fabric.PathGroup is already defined'); + return; + } + + /** + * Path group class + * @class fabric.PathGroup + * @extends fabric.Path + * @tutorial {@link http://fabricjs.com/fabric-intro-part-1#path_and_pathgroup} + * @see {@link fabric.PathGroup#initialize} for constructor definition + */ + fabric.PathGroup = fabric.util.createClass(fabric.Path, /** @lends fabric.PathGroup.prototype */ { + + /** + * Type of an object + * @type String + * @default + */ + type: 'path-group', + + /** + * Fill value + * @type String + * @default + */ + fill: '', + + /** + * Constructor + * @param {Array} paths + * @param {Object} [options] Options object + * @return {fabric.PathGroup} thisArg + */ + initialize: function(paths, options) { + + options = options || { }; + this.paths = paths || []; + + for (var i = this.paths.length; i--;) { + this.paths[i].group = this; + } + + if (options.toBeParsed) { + this.parseDimensionsFromPaths(options); + delete options.toBeParsed; + } + this.setOptions(options); + this.setCoords(); + + if (options.sourcePath) { + this.setSourcePath(options.sourcePath); + } + }, + + /** + * Calculate width and height based on paths contained + */ + parseDimensionsFromPaths: function(options) { + var points, p, xC = [], yC = [], path, height, width, + m; + for (var j = this.paths.length; j--;) { + path = this.paths[j]; + height = path.height + path.strokeWidth; + width = path.width + path.strokeWidth; + points = [ + { x: path.left, y: path.top }, + { x: path.left + width, y: path.top }, + { x: path.left, y: path.top + height }, + { x: path.left + width, y: path.top + height } + ]; + m = this.paths[j].transformMatrix; + for (var i = 0; i < points.length; i++) { + p = points[i]; + if (m) { + p = fabric.util.transformPoint(p, m, false); + } + xC.push(p.x); + yC.push(p.y); + } + } + options.width = Math.max.apply(null, xC); + options.height = Math.max.apply(null, yC); + }, + + /** + * Renders this group on a specified context + * @param {CanvasRenderingContext2D} ctx Context to render this instance on + */ + render: function(ctx) { + // do not render if object is not visible + if (!this.visible) { + return; + } + + ctx.save(); + + if (this.transformMatrix) { + ctx.transform.apply(ctx, this.transformMatrix); + } + this.transform(ctx); + + this._setShadow(ctx); + this.clipTo && fabric.util.clipContext(this, ctx); + ctx.translate(-this.width / 2, -this.height / 2); + for (var i = 0, l = this.paths.length; i < l; ++i) { + this.paths[i].render(ctx, true); + } + this.clipTo && ctx.restore(); + ctx.restore(); + }, + + /** + * Sets certain property to a certain value + * @param {String} prop + * @param {*} value + * @return {fabric.PathGroup} thisArg + */ + _set: function(prop, value) { + + if (prop === 'fill' && value && this.isSameColor()) { + var i = this.paths.length; + while (i--) { + this.paths[i]._set(prop, value); + } + } + + return this.callSuper('_set', prop, value); + }, + + /** + * Returns object representation of this path group + * @param {Array} [propertiesToInclude] Any properties that you might want to additionally include in the output + * @return {Object} object representation of an instance + */ + toObject: function(propertiesToInclude) { + var o = extend(parentToObject.call(this, propertiesToInclude), { + paths: invoke(this.getObjects(), 'toObject', propertiesToInclude) + }); + if (this.sourcePath) { + o.sourcePath = this.sourcePath; + } + return o; + }, + + /** + * Returns dataless object representation of this path group + * @param {Array} [propertiesToInclude] Any properties that you might want to additionally include in the output + * @return {Object} dataless object representation of an instance + */ + toDatalessObject: function(propertiesToInclude) { + var o = this.toObject(propertiesToInclude); + if (this.sourcePath) { + o.paths = this.sourcePath; + } + return o; + }, + + /* _TO_SVG_START_ */ + /** + * Returns svg representation of an instance + * @param {Function} [reviver] Method for further parsing of svg representation. + * @return {String} svg representation of an instance + */ + toSVG: function(reviver) { + var objects = this.getObjects(), + p = this.getPointByOrigin('left', 'top'), + translatePart = 'translate(' + p.x + ' ' + p.y + ')', + markup = this._createBaseSVGMarkup(); + markup.push( + '\n' + ); + + for (var i = 0, len = objects.length; i < len; i++) { + markup.push('\t', objects[i].toSVG(reviver)); + } + markup.push('\n'); + + return reviver ? reviver(markup.join('')) : markup.join(''); + }, + /* _TO_SVG_END_ */ + + /** + * Returns a string representation of this path group + * @return {String} string representation of an object + */ + toString: function() { + return '#'; + }, + + /** + * Returns true if all paths in this group are of same color + * @return {Boolean} true if all paths are of the same color (`fill`) + */ + isSameColor: function() { + var firstPathFill = this.getObjects()[0].get('fill') || ''; + if (typeof firstPathFill !== 'string') { + return false; + } + firstPathFill = firstPathFill.toLowerCase(); + return this.getObjects().every(function(path) { + var pathFill = path.get('fill') || ''; + return typeof pathFill === 'string' && (pathFill).toLowerCase() === firstPathFill; + }); + }, + + /** + * Returns number representation of object's complexity + * @return {Number} complexity + */ + complexity: function() { + return this.paths.reduce(function(total, path) { + return total + ((path && path.complexity) ? path.complexity() : 0); + }, 0); + }, + + /** + * Returns all paths in this path group + * @return {Array} array of path objects included in this path group + */ + getObjects: function() { + return this.paths; + } + }); + + /** + * Creates fabric.PathGroup instance from an object representation + * @static + * @memberOf fabric.PathGroup + * @param {Object} object Object to create an instance from + * @param {Function} [callback] Callback to invoke when an fabric.PathGroup instance is created + */ + fabric.PathGroup.fromObject = function(object, callback) { + // remove this pattern from 2.0 accepts only object + if (typeof object.paths === 'string') { + fabric.loadSVGFromURL(object.paths, function (elements) { + + var pathUrl = object.paths; + delete object.paths; + + var pathGroup = fabric.util.groupSVGElements(elements, object, pathUrl); + + callback(pathGroup); + }); + } + else { + fabric.util.enlivenObjects(object.paths, function(enlivenedObjects) { + delete object.paths; + callback(new fabric.PathGroup(enlivenedObjects, object)); + }); + } + }; + + /** + * Indicates that instances of this type are async + * @static + * @memberOf fabric.PathGroup + * @type Boolean + * @default + */ + fabric.PathGroup.async = true; + +})(typeof exports !== 'undefined' ? exports : this); + + +(function(global) { + + 'use strict'; + + var fabric = global.fabric || (global.fabric = { }), + extend = fabric.util.object.extend, + min = fabric.util.array.min, + max = fabric.util.array.max, + invoke = fabric.util.array.invoke; + + if (fabric.Group) { + return; + } + + // lock-related properties, for use in fabric.Group#get + // to enable locking behavior on group + // when one of its objects has lock-related properties set + var _lockProperties = { + lockMovementX: true, + lockMovementY: true, + lockRotation: true, + lockScalingX: true, + lockScalingY: true, + lockUniScaling: true + }; + + /** + * Group class + * @class fabric.Group + * @extends fabric.Object + * @mixes fabric.Collection + * @tutorial {@link http://fabricjs.com/fabric-intro-part-3#groups} + * @see {@link fabric.Group#initialize} for constructor definition + */ + fabric.Group = fabric.util.createClass(fabric.Object, fabric.Collection, /** @lends fabric.Group.prototype */ { + + /** + * Type of an object + * @type String + * @default + */ + type: 'group', + + /** + * Width of stroke + * @type Number + * @default + */ + strokeWidth: 0, + + /** + * Indicates if click events should also check for subtargets + * @type Boolean + * @default + */ + subTargetCheck: false, + + /** + * Constructor + * @param {Object} objects Group objects + * @param {Object} [options] Options object + * @param {Boolean} [isAlreadyGrouped] if true, objects have been grouped already. + * @return {Object} thisArg + */ + initialize: function(objects, options, isAlreadyGrouped) { + options = options || { }; + + this._objects = []; + // if objects enclosed in a group have been grouped already, + // we cannot change properties of objects. + // Thus we need to set options to group without objects, + // because delegatedProperties propagate to objects. + isAlreadyGrouped && this.callSuper('initialize', options); + + this._objects = objects || []; + for (var i = this._objects.length; i--; ) { + this._objects[i].group = this; + } + + this.originalState = { }; + + if (options.originX) { + this.originX = options.originX; + } + if (options.originY) { + this.originY = options.originY; + } + + if (isAlreadyGrouped) { + // do not change coordinate of objects enclosed in a group, + // because objects coordinate system have been group coodinate system already. + this._updateObjectsCoords(true); + } + else { + this._calcBounds(); + this._updateObjectsCoords(); + this.callSuper('initialize', options); + } + + this.setCoords(); + this.saveCoords(); + }, + + /** + * @private + * @param {Boolean} [skipCoordsChange] if true, coordinates of objects enclosed in a group do not change + */ + _updateObjectsCoords: function(skipCoordsChange) { + for (var i = this._objects.length; i--; ){ + this._updateObjectCoords(this._objects[i], skipCoordsChange); + } + }, + + /** + * @private + * @param {Object} object + * @param {Boolean} [skipCoordsChange] if true, coordinates of object dose not change + */ + _updateObjectCoords: function(object, skipCoordsChange) { + // do not display corners of objects enclosed in a group + object.__origHasControls = object.hasControls; + object.hasControls = false; + + if (skipCoordsChange) { + return; + } + + var objectLeft = object.getLeft(), + objectTop = object.getTop(), + center = this.getCenterPoint(); + + object.set({ + originalLeft: objectLeft, + originalTop: objectTop, + left: objectLeft - center.x, + top: objectTop - center.y + }); + object.setCoords(); + }, + + /** + * Returns string represenation of a group + * @return {String} + */ + toString: function() { + return '#'; + }, + + /** + * Adds an object to a group; Then recalculates group's dimension, position. + * @param {Object} object + * @return {fabric.Group} thisArg + * @chainable + */ + addWithUpdate: function(object) { + this._restoreObjectsState(); + fabric.util.resetObjectTransform(this); + if (object) { + this._objects.push(object); + object.group = this; + object._set('canvas', this.canvas); + } + // since _restoreObjectsState set objects inactive + this.forEachObject(this._setObjectActive, this); + this._calcBounds(); + this._updateObjectsCoords(); + return this; + }, + + /** + * @private + */ + _setObjectActive: function(object) { + object.set('active', true); + object.group = this; + }, + + /** + * Removes an object from a group; Then recalculates group's dimension, position. + * @param {Object} object + * @return {fabric.Group} thisArg + * @chainable + */ + removeWithUpdate: function(object) { + this._restoreObjectsState(); + fabric.util.resetObjectTransform(this); + // since _restoreObjectsState set objects inactive + this.forEachObject(this._setObjectActive, this); + + this.remove(object); + this._calcBounds(); + this._updateObjectsCoords(); + + return this; + }, + + /** + * @private + */ + _onObjectAdded: function(object) { + object.group = this; + object._set('canvas', this.canvas); + }, + + /** + * @private + */ + _onObjectRemoved: function(object) { + delete object.group; + object.set('active', false); + }, + + /** + * Properties that are delegated to group objects when reading/writing + * @param {Object} delegatedProperties + */ + delegatedProperties: { + fill: true, + stroke: true, + strokeWidth: true, + fontFamily: true, + fontWeight: true, + fontSize: true, + fontStyle: true, + lineHeight: true, + textDecoration: true, + textAlign: true, + backgroundColor: true + }, + + /** + * @private + */ + _set: function(key, value) { + var i = this._objects.length; + + if (this.delegatedProperties[key] || key === 'canvas') { + while (i--) { + this._objects[i].set(key, value); + } + } + else { + while (i--) { + this._objects[i].setOnGroup(key, value); + } + } + + this.callSuper('_set', key, value); + }, + + /** + * Returns object representation of an instance + * @param {Array} [propertiesToInclude] Any properties that you might want to additionally include in the output + * @return {Object} object representation of an instance + */ + toObject: function(propertiesToInclude) { + return extend(this.callSuper('toObject', propertiesToInclude), { + objects: invoke(this._objects, 'toObject', propertiesToInclude) + }); + }, + + /** + * Renders instance on a given context + * @param {CanvasRenderingContext2D} ctx context to render instance on + */ + render: function(ctx) { + // do not render if object is not visible + if (!this.visible) { + return; + } + + ctx.save(); + if (this.transformMatrix) { + ctx.transform.apply(ctx, this.transformMatrix); + } + this.transform(ctx); + this._setShadow(ctx); + this.clipTo && fabric.util.clipContext(this, ctx); + this._transformDone = true; + // the array is now sorted in order of highest first, so start from end + for (var i = 0, len = this._objects.length; i < len; i++) { + this._renderObject(this._objects[i], ctx); + } + + this.clipTo && ctx.restore(); + ctx.restore(); + this._transformDone = false; + }, + + /** + * Renders controls and borders for the object + * @param {CanvasRenderingContext2D} ctx Context to render on + * @param {Boolean} [noTransform] When true, context is not transformed + */ + _renderControls: function(ctx, noTransform) { + this.callSuper('_renderControls', ctx, noTransform); + for (var i = 0, len = this._objects.length; i < len; i++) { + this._objects[i]._renderControls(ctx); + } + }, + + /** + * @private + */ + _renderObject: function(object, ctx) { + // do not render if object is not visible + if (!object.visible) { + return; + } + + var originalHasRotatingPoint = object.hasRotatingPoint; + object.hasRotatingPoint = false; + object.render(ctx); + object.hasRotatingPoint = originalHasRotatingPoint; + }, + + /** + * Retores original state of each of group objects (original state is that which was before group was created). + * @private + * @return {fabric.Group} thisArg + * @chainable + */ + _restoreObjectsState: function() { + this._objects.forEach(this._restoreObjectState, this); + return this; + }, + + /** + * Realises the transform from this group onto the supplied object + * i.e. it tells you what would happen if the supplied object was in + * the group, and then the group was destroyed. It mutates the supplied + * object. + * @param {fabric.Object} object + * @return {fabric.Object} transformedObject + */ + realizeTransform: function(object) { + var matrix = object.calcTransformMatrix(), + options = fabric.util.qrDecompose(matrix), + center = new fabric.Point(options.translateX, options.translateY); + object.scaleX = options.scaleX; + object.scaleY = options.scaleY; + object.skewX = options.skewX; + object.skewY = options.skewY; + object.angle = options.angle; + object.flipX = false; + object.flipY = false; + object.setPositionByOrigin(center, 'center', 'center'); + return object; + }, + + /** + * Restores original state of a specified object in group + * @private + * @param {fabric.Object} object + * @return {fabric.Group} thisArg + */ + _restoreObjectState: function(object) { + this.realizeTransform(object); + object.setCoords(); + object.hasControls = object.__origHasControls; + delete object.__origHasControls; + object.set('active', false); + delete object.group; + + return this; + }, + + /** + * Destroys a group (restoring state of its objects) + * @return {fabric.Group} thisArg + * @chainable + */ + destroy: function() { + return this._restoreObjectsState(); + }, + + /** + * Saves coordinates of this instance (to be used together with `hasMoved`) + * @saveCoords + * @return {fabric.Group} thisArg + * @chainable + */ + saveCoords: function() { + this._originalLeft = this.get('left'); + this._originalTop = this.get('top'); + return this; + }, + + /** + * Checks whether this group was moved (since `saveCoords` was called last) + * @return {Boolean} true if an object was moved (since fabric.Group#saveCoords was called) + */ + hasMoved: function() { + return this._originalLeft !== this.get('left') || + this._originalTop !== this.get('top'); + }, + + /** + * Sets coordinates of all group objects + * @return {fabric.Group} thisArg + * @chainable + */ + setObjectsCoords: function() { + this.forEachObject(function(object) { + object.setCoords(); + }); + return this; + }, + + /** + * @private + */ + _calcBounds: function(onlyWidthHeight) { + var aX = [], + aY = [], + o, prop, + props = ['tr', 'br', 'bl', 'tl'], + i = 0, iLen = this._objects.length, + j, jLen = props.length; + + for ( ; i < iLen; ++i) { + o = this._objects[i]; + o.setCoords(); + for (j = 0; j < jLen; j++) { + prop = props[j]; + aX.push(o.oCoords[prop].x); + aY.push(o.oCoords[prop].y); + } + } + + this.set(this._getBounds(aX, aY, onlyWidthHeight)); + }, + + /** + * @private + */ + _getBounds: function(aX, aY, onlyWidthHeight) { + var ivt = fabric.util.invertTransform(this.getViewportTransform()), + minXY = fabric.util.transformPoint(new fabric.Point(min(aX), min(aY)), ivt), + maxXY = fabric.util.transformPoint(new fabric.Point(max(aX), max(aY)), ivt), + obj = { + width: (maxXY.x - minXY.x) || 0, + height: (maxXY.y - minXY.y) || 0 + }; + + if (!onlyWidthHeight) { + obj.left = minXY.x || 0; + obj.top = minXY.y || 0; + if (this.originX === 'center') { + obj.left += obj.width / 2; + } + if (this.originX === 'right') { + obj.left += obj.width; + } + if (this.originY === 'center') { + obj.top += obj.height / 2; + } + if (this.originY === 'bottom') { + obj.top += obj.height; + } + } + return obj; + }, + + /* _TO_SVG_START_ */ + /** + * Returns svg representation of an instance + * @param {Function} [reviver] Method for further parsing of svg representation. + * @return {String} svg representation of an instance + */ + toSVG: function(reviver) { + var markup = this._createBaseSVGMarkup(); + markup.push( + '\n' + ); + + for (var i = 0, len = this._objects.length; i < len; i++) { + markup.push('\t', this._objects[i].toSVG(reviver)); + } + + markup.push('\n'); + + return reviver ? reviver(markup.join('')) : markup.join(''); + }, + /* _TO_SVG_END_ */ + + /** + * Returns requested property + * @param {String} prop Property to get + * @return {*} + */ + get: function(prop) { + if (prop in _lockProperties) { + if (this[prop]) { + return this[prop]; + } + else { + for (var i = 0, len = this._objects.length; i < len; i++) { + if (this._objects[i][prop]) { + return true; + } + } + return false; + } + } + else { + if (prop in this.delegatedProperties) { + return this._objects[0] && this._objects[0].get(prop); + } + return this[prop]; + } + } + }); + + /** + * Returns {@link fabric.Group} instance from an object representation + * @static + * @memberOf fabric.Group + * @param {Object} object Object to create a group from + * @param {Function} [callback] Callback to invoke when an group instance is created + */ + fabric.Group.fromObject = function(object, callback) { + fabric.util.enlivenObjects(object.objects, function(enlivenedObjects) { + delete object.objects; + callback && callback(new fabric.Group(enlivenedObjects, object, true)); + }); + }; + + /** + * Indicates that instances of this type are async + * @static + * @memberOf fabric.Group + * @type Boolean + * @default + */ + fabric.Group.async = true; + +})(typeof exports !== 'undefined' ? exports : this); + + +(function(global) { + + 'use strict'; + + var extend = fabric.util.object.extend; + + if (!global.fabric) { + global.fabric = { }; + } + + if (global.fabric.Image) { + fabric.warn('fabric.Image is already defined.'); + return; + } + + var stateProperties = fabric.Object.prototype.stateProperties.concat(); + stateProperties.push( + 'alignX', + 'alignY', + 'meetOrSlice' + ); + + /** + * Image class + * @class fabric.Image + * @extends fabric.Object + * @tutorial {@link http://fabricjs.com/fabric-intro-part-1#images} + * @see {@link fabric.Image#initialize} for constructor definition + */ + fabric.Image = fabric.util.createClass(fabric.Object, /** @lends fabric.Image.prototype */ { + + /** + * Type of an object + * @type String + * @default + */ + type: 'image', + + /** + * crossOrigin value (one of "", "anonymous", "use-credentials") + * @see https://developer.mozilla.org/en-US/docs/HTML/CORS_settings_attributes + * @type String + * @default + */ + crossOrigin: '', + + /** + * AlignX value, part of preserveAspectRatio (one of "none", "mid", "min", "max") + * @see http://www.w3.org/TR/SVG/coords.html#PreserveAspectRatioAttribute + * This parameter defines how the picture is aligned to its viewport when image element width differs from image width. + * @type String + * @default + */ + alignX: 'none', + + /** + * AlignY value, part of preserveAspectRatio (one of "none", "mid", "min", "max") + * @see http://www.w3.org/TR/SVG/coords.html#PreserveAspectRatioAttribute + * This parameter defines how the picture is aligned to its viewport when image element height differs from image height. + * @type String + * @default + */ + alignY: 'none', + + /** + * meetOrSlice value, part of preserveAspectRatio (one of "meet", "slice"). + * if meet the image is always fully visibile, if slice the viewport is always filled with image. + * @see http://www.w3.org/TR/SVG/coords.html#PreserveAspectRatioAttribute + * @type String + * @default + */ + meetOrSlice: 'meet', + + /** + * Width of a stroke. + * For image quality a stroke multiple of 2 gives better results. + * @type Number + * @default + */ + strokeWidth: 0, + + /** + * private + * contains last value of scaleX to detect + * if the Image got resized after the last Render + * @type Number + */ + _lastScaleX: 1, + + /** + * private + * contains last value of scaleY to detect + * if the Image got resized after the last Render + * @type Number + */ + _lastScaleY: 1, + + /** + * minimum scale factor under which any resizeFilter is triggered to resize the image + * 0 will disable the automatic resize. 1 will trigger automatically always. + * number bigger than 1 can be used in case we want to scale with some filter above + * the natural image dimensions + * @type Number + */ + minimumScaleTrigger: 0.5, + + /** + * List of properties to consider when checking if + * state of an object is changed ({@link fabric.Object#hasStateChanged}) + * as well as for history (undo/redo) purposes + * @type Array + */ + stateProperties: stateProperties, + + /** + * Constructor + * @param {HTMLImageElement | String} element Image element + * @param {Object} [options] Options object + * @param {function} [callback] callback function to call after eventual filters applied. + * @return {fabric.Image} thisArg + */ + initialize: function(element, options, callback) { + options || (options = { }); + this.filters = []; + this.resizeFilters = []; + this.callSuper('initialize', options); + this._initElement(element, options, callback); + }, + + /** + * Returns image element which this instance if based on + * @return {HTMLImageElement} Image element + */ + getElement: function() { + return this._element; + }, + + /** + * Sets image element for this instance to a specified one. + * If filters defined they are applied to new image. + * You might need to call `canvas.renderAll` and `object.setCoords` after replacing, to render new image and update controls area. + * @param {HTMLImageElement} element + * @param {Function} [callback] Callback is invoked when all filters have been applied and new image is generated + * @param {Object} [options] Options object + * @return {fabric.Image} thisArg + * @chainable + */ + setElement: function(element, callback, options) { + + var _callback, _this; + + this._element = element; + this._originalElement = element; + this._initConfig(options); + + if (this.resizeFilters.length === 0) { + _callback = callback; + } + else { + _this = this; + _callback = function() { + _this.applyFilters(callback, _this.resizeFilters, _this._filteredEl || _this._originalElement, true); + }; + } + + if (this.filters.length !== 0) { + this.applyFilters(_callback); + } + else if (_callback) { + _callback(this); + } + + return this; + }, + + /** + * Sets crossOrigin value (on an instance and corresponding image element) + * @return {fabric.Image} thisArg + * @chainable + */ + setCrossOrigin: function(value) { + this.crossOrigin = value; + this._element.crossOrigin = value; + + return this; + }, + + /** + * Returns original size of an image + * @return {Object} Object with "width" and "height" properties + */ + getOriginalSize: function() { + var element = this.getElement(); + return { + width: element.width, + height: element.height + }; + }, + + /** + * @private + * @param {CanvasRenderingContext2D} ctx Context to render on + */ + _stroke: function(ctx) { + if (!this.stroke || this.strokeWidth === 0) { + return; + } + var w = this.width / 2, h = this.height / 2; + ctx.beginPath(); + ctx.moveTo(-w, -h); + ctx.lineTo(w, -h); + ctx.lineTo(w, h); + ctx.lineTo(-w, h); + ctx.lineTo(-w, -h); + ctx.closePath(); + }, + + /** + * @private + * @param {CanvasRenderingContext2D} ctx Context to render on + */ + _renderDashedStroke: function(ctx) { + var x = -this.width / 2, + y = -this.height / 2, + w = this.width, + h = this.height; + + ctx.save(); + this._setStrokeStyles(ctx); + + ctx.beginPath(); + fabric.util.drawDashedLine(ctx, x, y, x + w, y, this.strokeDashArray); + fabric.util.drawDashedLine(ctx, x + w, y, x + w, y + h, this.strokeDashArray); + fabric.util.drawDashedLine(ctx, x + w, y + h, x, y + h, this.strokeDashArray); + fabric.util.drawDashedLine(ctx, x, y + h, x, y, this.strokeDashArray); + ctx.closePath(); + ctx.restore(); + }, + + /** + * Returns object representation of an instance + * @param {Array} [propertiesToInclude] Any properties that you might want to additionally include in the output + * @return {Object} Object representation of an instance + */ + toObject: function(propertiesToInclude) { + var filters = [], resizeFilters = [], + scaleX = 1, scaleY = 1; + + this.filters.forEach(function(filterObj) { + if (filterObj) { + if (filterObj.type === 'Resize') { + scaleX *= filterObj.scaleX; + scaleY *= filterObj.scaleY; + } + filters.push(filterObj.toObject()); + } + }); + + this.resizeFilters.forEach(function(filterObj) { + filterObj && resizeFilters.push(filterObj.toObject()); + }); + + var object = extend(this.callSuper('toObject', propertiesToInclude), { + src: this.getSrc(), + filters: filters, + resizeFilters: resizeFilters, + crossOrigin: this.crossOrigin, + alignX: this.alignX, + alignY: this.alignY, + meetOrSlice: this.meetOrSlice + }); + + object.width /= scaleX; + object.height /= scaleY; + + if (!this.includeDefaultValues) { + this._removeDefaultValues(object); + } + + return object; + }, + + /* _TO_SVG_START_ */ + /** + * Returns SVG representation of an instance + * @param {Function} [reviver] Method for further parsing of svg representation. + * @return {String} svg representation of an instance + */ + toSVG: function(reviver) { + var markup = this._createBaseSVGMarkup(), x = -this.width / 2, y = -this.height / 2, + preserveAspectRatio = 'none', filtered = true; + if (this.group && this.group.type === 'path-group') { + x = this.left; + y = this.top; + } + if (this.alignX !== 'none' && this.alignY !== 'none') { + preserveAspectRatio = 'x' + this.alignX + 'Y' + this.alignY + ' ' + this.meetOrSlice; + } + markup.push( + '\n', + '\n' + ); + + if (this.stroke || this.strokeDashArray) { + var origFill = this.fill; + this.fill = null; + markup.push( + '\n' + ); + this.fill = origFill; + } + + markup.push('\n'); + + return reviver ? reviver(markup.join('')) : markup.join(''); + }, + /* _TO_SVG_END_ */ + + /** + * Returns source of an image + * @param {Boolean} filtered indicates if the src is needed for svg + * @return {String} Source of an image + */ + getSrc: function(filtered) { + var element = filtered ? this._element : this._originalElement; + if (element) { + return fabric.isLikelyNode ? element._src : element.src; + } + else { + return this.src || ''; + } + }, + + /** + * Sets source of an image + * @param {String} src Source string (URL) + * @param {Function} [callback] Callback is invoked when image has been loaded (and all filters have been applied) + * @param {Object} [options] Options object + * @return {fabric.Image} thisArg + * @chainable + */ + setSrc: function(src, callback, options) { + fabric.util.loadImage(src, function(img) { + return this.setElement(img, callback, options); + }, this, options && options.crossOrigin); + }, + + /** + * Returns string representation of an instance + * @return {String} String representation of an instance + */ + toString: function() { + return '#'; + }, + + /** + * Applies filters assigned to this image (from "filters" array) + * @method applyFilters + * @param {Function} callback Callback is invoked when all filters have been applied and new image is generated + * @param {Array} filters to be applied + * @param {fabric.Image} imgElement image to filter ( default to this._element ) + * @param {Boolean} forResizing + * @return {CanvasElement} canvasEl to be drawn immediately + * @chainable + */ + applyFilters: function(callback, filters, imgElement, forResizing) { + + filters = filters || this.filters; + imgElement = imgElement || this._originalElement; + + if (!imgElement) { + return; + } + + var replacement = fabric.util.createImage(), + retinaScaling = this.canvas ? this.canvas.getRetinaScaling() : fabric.devicePixelRatio, + minimumScale = this.minimumScaleTrigger / retinaScaling, + _this = this, scaleX, scaleY; + + if (filters.length === 0) { + this._element = imgElement; + callback && callback(this); + return imgElement; + } + + var canvasEl = fabric.util.createCanvasElement(); + canvasEl.width = imgElement.width; + canvasEl.height = imgElement.height; + canvasEl.getContext('2d').drawImage(imgElement, 0, 0, imgElement.width, imgElement.height); + + filters.forEach(function(filter) { + if (!filter) { + return; + } + if (forResizing) { + scaleX = _this.scaleX < minimumScale ? _this.scaleX : 1; + scaleY = _this.scaleY < minimumScale ? _this.scaleY : 1; + if (scaleX * retinaScaling < 1) { + scaleX *= retinaScaling; + } + if (scaleY * retinaScaling < 1) { + scaleY *= retinaScaling; + } + } + else { + scaleX = filter.scaleX; + scaleY = filter.scaleY; + } + filter.applyTo(canvasEl, scaleX, scaleY); + if (!forResizing && filter.type === 'Resize') { + _this.width *= filter.scaleX; + _this.height *= filter.scaleY; + } + }); + + /** @ignore */ + replacement.width = canvasEl.width; + replacement.height = canvasEl.height; + if (fabric.isLikelyNode) { + replacement.src = canvasEl.toBuffer(undefined, fabric.Image.pngCompression); + // onload doesn't fire in some node versions, so we invoke callback manually + _this._element = replacement; + !forResizing && (_this._filteredEl = replacement); + callback && callback(_this); + } + else { + replacement.onload = function() { + _this._element = replacement; + !forResizing && (_this._filteredEl = replacement); + callback && callback(_this); + replacement.onload = canvasEl = null; + }; + replacement.src = canvasEl.toDataURL('image/png'); + } + return canvasEl; + }, + + /** + * @private + * @param {CanvasRenderingContext2D} ctx Context to render on + * @param {Boolean} noTransform + */ + _render: function(ctx, noTransform) { + var x, y, imageMargins = this._findMargins(), elementToDraw; + + x = (noTransform ? this.left : -this.width / 2); + y = (noTransform ? this.top : -this.height / 2); + + if (this.meetOrSlice === 'slice') { + ctx.beginPath(); + ctx.rect(x, y, this.width, this.height); + ctx.clip(); + } + + if (this.isMoving === false && this.resizeFilters.length && this._needsResize()) { + this._lastScaleX = this.scaleX; + this._lastScaleY = this.scaleY; + elementToDraw = this.applyFilters(null, this.resizeFilters, this._filteredEl || this._originalElement, true); + } + else { + elementToDraw = this._element; + } + elementToDraw && ctx.drawImage(elementToDraw, + x + imageMargins.marginX, + y + imageMargins.marginY, + imageMargins.width, + imageMargins.height + ); + + this._stroke(ctx); + this._renderStroke(ctx); + }, + + /** + * @private, needed to check if image needs resize + */ + _needsResize: function() { + return (this.scaleX !== this._lastScaleX || this.scaleY !== this._lastScaleY); + }, + + /** + * @private + */ + _findMargins: function() { + var width = this.width, height = this.height, scales, + scale, marginX = 0, marginY = 0; + + if (this.alignX !== 'none' || this.alignY !== 'none') { + scales = [this.width / this._element.width, this.height / this._element.height]; + scale = this.meetOrSlice === 'meet' + ? Math.min.apply(null, scales) : Math.max.apply(null, scales); + width = this._element.width * scale; + height = this._element.height * scale; + if (this.alignX === 'Mid') { + marginX = (this.width - width) / 2; + } + if (this.alignX === 'Max') { + marginX = this.width - width; + } + if (this.alignY === 'Mid') { + marginY = (this.height - height) / 2; + } + if (this.alignY === 'Max') { + marginY = this.height - height; + } + } + return { + width: width, + height: height, + marginX: marginX, + marginY: marginY + }; + }, + + /** + * @private + */ + _resetWidthHeight: function() { + var element = this.getElement(); + + this.set('width', element.width); + this.set('height', element.height); + }, + + /** + * The Image class's initialization method. This method is automatically + * called by the constructor. + * @private + * @param {HTMLImageElement|String} element The element representing the image + * @param {Object} [options] Options object + */ + _initElement: function(element, options, callback) { + this.setElement(fabric.util.getById(element), callback, options); + fabric.util.addClass(this.getElement(), fabric.Image.CSS_CANVAS); + }, + + /** + * @private + * @param {Object} [options] Options object + */ + _initConfig: function(options) { + options || (options = { }); + this.setOptions(options); + this._setWidthHeight(options); + if (this._element && this.crossOrigin) { + this._element.crossOrigin = this.crossOrigin; + } + }, + + /** + * @private + * @param {Array} filters to be initialized + * @param {Function} callback Callback to invoke when all fabric.Image.filters instances are created + */ + _initFilters: function(filters, callback) { + if (filters && filters.length) { + fabric.util.enlivenObjects(filters, function(enlivenedObjects) { + callback && callback(enlivenedObjects); + }, 'fabric.Image.filters'); + } + else { + callback && callback(); + } + }, + + /** + * @private + * @param {Object} [options] Object with width/height properties + */ + _setWidthHeight: function(options) { + this.width = 'width' in options + ? options.width + : (this.getElement() + ? this.getElement().width || 0 + : 0); + + this.height = 'height' in options + ? options.height + : (this.getElement() + ? this.getElement().height || 0 + : 0); + }, + + /** + * Returns complexity of an instance + * @return {Number} complexity of this instance + */ + complexity: function() { + return 1; + } + }); + + /** + * Default CSS class name for canvas + * @static + * @type String + * @default + */ + fabric.Image.CSS_CANVAS = 'canvas-img'; + + /** + * Alias for getSrc + * @static + */ + fabric.Image.prototype.getSvgSrc = fabric.Image.prototype.getSrc; + + /** + * Creates an instance of fabric.Image from its object representation + * @static + * @param {Object} object Object to create an instance from + * @param {Function} callback Callback to invoke when an image instance is created + */ + fabric.Image.fromObject = function(object, callback) { + fabric.util.loadImage(object.src, function(img) { + fabric.Image.prototype._initFilters.call(object, object.filters, function(filters) { + object.filters = filters || []; + fabric.Image.prototype._initFilters.call(object, object.resizeFilters, function(resizeFilters) { + object.resizeFilters = resizeFilters || []; + return new fabric.Image(img, object, callback); + }); + }); + }, null, object.crossOrigin); + }; + + /** + * Creates an instance of fabric.Image from an URL string + * @static + * @param {String} url URL to create an image from + * @param {Function} [callback] Callback to invoke when image is created (newly created image is passed as a first argument) + * @param {Object} [imgOptions] Options object + */ + fabric.Image.fromURL = function(url, callback, imgOptions) { + fabric.util.loadImage(url, function(img) { + callback && callback(new fabric.Image(img, imgOptions)); + }, null, imgOptions && imgOptions.crossOrigin); + }; + + /* _FROM_SVG_START_ */ + /** + * List of attribute names to account for when parsing SVG element (used by {@link fabric.Image.fromElement}) + * @static + * @see {@link http://www.w3.org/TR/SVG/struct.html#ImageElement} + */ + fabric.Image.ATTRIBUTE_NAMES = + fabric.SHARED_ATTRIBUTES.concat('x y width height preserveAspectRatio xlink:href'.split(' ')); + + /** + * Returns {@link fabric.Image} instance from an SVG element + * @static + * @param {SVGElement} element Element to parse + * @param {Function} callback Callback to execute when fabric.Image object is created + * @param {Object} [options] Options object + * @return {fabric.Image} Instance of fabric.Image + */ + fabric.Image.fromElement = function(element, callback, options) { + var parsedAttributes = fabric.parseAttributes(element, fabric.Image.ATTRIBUTE_NAMES), + preserveAR; + + if (parsedAttributes.preserveAspectRatio) { + preserveAR = fabric.util.parsePreserveAspectRatioAttribute(parsedAttributes.preserveAspectRatio); + extend(parsedAttributes, preserveAR); + } + + fabric.Image.fromURL(parsedAttributes['xlink:href'], callback, + extend((options ? fabric.util.object.clone(options) : { }), parsedAttributes)); + }; + /* _FROM_SVG_END_ */ + + /** + * Indicates that instances of this type are async + * @static + * @type Boolean + * @default + */ + fabric.Image.async = true; + + /** + * Indicates compression level used when generating PNG under Node (in applyFilters). Any of 0-9 + * @static + * @type Number + * @default + */ + fabric.Image.pngCompression = 1; + +})(typeof exports !== 'undefined' ? exports : this); + + +fabric.util.object.extend(fabric.Object.prototype, /** @lends fabric.Object.prototype */ { + + /** + * @private + * @return {Number} angle value + */ + _getAngleValueForStraighten: function() { + var angle = this.getAngle() % 360; + if (angle > 0) { + return Math.round((angle - 1) / 90) * 90; + } + return Math.round(angle / 90) * 90; + }, + + /** + * Straightens an object (rotating it from current angle to one of 0, 90, 180, 270, etc. depending on which is closer) + * @return {fabric.Object} thisArg + * @chainable + */ + straighten: function() { + this.setAngle(this._getAngleValueForStraighten()); + return this; + }, + + /** + * Same as {@link fabric.Object.prototype.straighten} but with animation + * @param {Object} callbacks Object with callback functions + * @param {Function} [callbacks.onComplete] Invoked on completion + * @param {Function} [callbacks.onChange] Invoked on every step of animation + * @return {fabric.Object} thisArg + * @chainable + */ + fxStraighten: function(callbacks) { + callbacks = callbacks || { }; + + var empty = function() { }, + onComplete = callbacks.onComplete || empty, + onChange = callbacks.onChange || empty, + _this = this; + + fabric.util.animate({ + startValue: this.get('angle'), + endValue: this._getAngleValueForStraighten(), + duration: this.FX_DURATION, + onChange: function(value) { + _this.setAngle(value); + onChange(); + }, + onComplete: function() { + _this.setCoords(); + onComplete(); + }, + onStart: function() { + _this.set('active', false); + } + }); + + return this; + } +}); + +fabric.util.object.extend(fabric.StaticCanvas.prototype, /** @lends fabric.StaticCanvas.prototype */ { + + /** + * Straightens object, then rerenders canvas + * @param {fabric.Object} object Object to straighten + * @return {fabric.Canvas} thisArg + * @chainable + */ + straightenObject: function (object) { + object.straighten(); + this.renderAll(); + return this; + }, + + /** + * Same as {@link fabric.Canvas.prototype.straightenObject}, but animated + * @param {fabric.Object} object Object to straighten + * @return {fabric.Canvas} thisArg + * @chainable + */ + fxStraightenObject: function (object) { + object.fxStraighten({ + onChange: this.renderAll.bind(this) + }); + return this; + } +}); + + +/** + * @namespace fabric.Image.filters + * @memberOf fabric.Image + * @tutorial {@link http://fabricjs.com/fabric-intro-part-2#image_filters} + * @see {@link http://fabricjs.com/image-filters|ImageFilters demo} + */ +fabric.Image.filters = fabric.Image.filters || { }; + +/** + * Root filter class from which all filter classes inherit from + * @class fabric.Image.filters.BaseFilter + * @memberOf fabric.Image.filters + */ +fabric.Image.filters.BaseFilter = fabric.util.createClass(/** @lends fabric.Image.filters.BaseFilter.prototype */ { + + /** + * Filter type + * @param {String} type + * @default + */ + type: 'BaseFilter', + + /** + * Constructor + * @param {Object} [options] Options object + */ + initialize: function(options) { + if (options) { + this.setOptions(options); + } + }, + + /** + * Sets filter's properties from options + * @param {Object} [options] Options object + */ + setOptions: function(options) { + for (var prop in options) { + this[prop] = options[prop]; + } + }, + + /** + * Returns object representation of an instance + * @return {Object} Object representation of an instance + */ + toObject: function() { + return { type: this.type }; + }, + + /** + * Returns a JSON representation of an instance + * @return {Object} JSON + */ + toJSON: function() { + // delegate, not alias + return this.toObject(); + } +}); + + +(function(global) { + + 'use strict'; + + var fabric = global.fabric || (global.fabric = { }), + extend = fabric.util.object.extend, + filters = fabric.Image.filters, + createClass = fabric.util.createClass; + + /** + * Brightness filter class + * @class fabric.Image.filters.Brightness + * @memberOf fabric.Image.filters + * @extends fabric.Image.filters.BaseFilter + * @see {@link fabric.Image.filters.Brightness#initialize} for constructor definition + * @see {@link http://fabricjs.com/image-filters|ImageFilters demo} + * @example + * var filter = new fabric.Image.filters.Brightness({ + * brightness: 200 + * }); + * object.filters.push(filter); + * object.applyFilters(canvas.renderAll.bind(canvas)); + */ + filters.Brightness = createClass(filters.BaseFilter, /** @lends fabric.Image.filters.Brightness.prototype */ { + + /** + * Filter type + * @param {String} type + * @default + */ + type: 'Brightness', + + /** + * Constructor + * @memberOf fabric.Image.filters.Brightness.prototype + * @param {Object} [options] Options object + * @param {Number} [options.brightness=0] Value to brighten the image up (-255..255) + */ + initialize: function(options) { + options = options || { }; + this.brightness = options.brightness || 0; + }, + + /** + * Applies filter to canvas element + * @param {Object} canvasEl Canvas element to apply filter to + */ + applyTo: function(canvasEl) { + var context = canvasEl.getContext('2d'), + imageData = context.getImageData(0, 0, canvasEl.width, canvasEl.height), + data = imageData.data, + brightness = this.brightness; + + for (var i = 0, len = data.length; i < len; i += 4) { + data[i] += brightness; + data[i + 1] += brightness; + data[i + 2] += brightness; + } + + context.putImageData(imageData, 0, 0); + }, + + /** + * Returns object representation of an instance + * @return {Object} Object representation of an instance + */ + toObject: function() { + return extend(this.callSuper('toObject'), { + brightness: this.brightness + }); + } + }); + + /** + * Returns filter instance from an object representation + * @static + * @param {Object} object Object to create an instance from + * @return {fabric.Image.filters.Brightness} Instance of fabric.Image.filters.Brightness + */ + fabric.Image.filters.Brightness.fromObject = function(object) { + return new fabric.Image.filters.Brightness(object); + }; + +})(typeof exports !== 'undefined' ? exports : this); + + +(function(global) { + + 'use strict'; + + var fabric = global.fabric || (global.fabric = { }), + extend = fabric.util.object.extend, + filters = fabric.Image.filters, + createClass = fabric.util.createClass; + + /** + * Adapted from html5rocks article + * @class fabric.Image.filters.Convolute + * @memberOf fabric.Image.filters + * @extends fabric.Image.filters.BaseFilter + * @see {@link fabric.Image.filters.Convolute#initialize} for constructor definition + * @see {@link http://fabricjs.com/image-filters|ImageFilters demo} + * @example Sharpen filter + * var filter = new fabric.Image.filters.Convolute({ + * matrix: [ 0, -1, 0, + * -1, 5, -1, + * 0, -1, 0 ] + * }); + * object.filters.push(filter); + * object.applyFilters(canvas.renderAll.bind(canvas)); + * @example Blur filter + * var filter = new fabric.Image.filters.Convolute({ + * matrix: [ 1/9, 1/9, 1/9, + * 1/9, 1/9, 1/9, + * 1/9, 1/9, 1/9 ] + * }); + * object.filters.push(filter); + * object.applyFilters(canvas.renderAll.bind(canvas)); + * @example Emboss filter + * var filter = new fabric.Image.filters.Convolute({ + * matrix: [ 1, 1, 1, + * 1, 0.7, -1, + * -1, -1, -1 ] + * }); + * object.filters.push(filter); + * object.applyFilters(canvas.renderAll.bind(canvas)); + * @example Emboss filter with opaqueness + * var filter = new fabric.Image.filters.Convolute({ + * opaque: true, + * matrix: [ 1, 1, 1, + * 1, 0.7, -1, + * -1, -1, -1 ] + * }); + * object.filters.push(filter); + * object.applyFilters(canvas.renderAll.bind(canvas)); + */ + filters.Convolute = createClass(filters.BaseFilter, /** @lends fabric.Image.filters.Convolute.prototype */ { + + /** + * Filter type + * @param {String} type + * @default + */ + type: 'Convolute', + + /** + * Constructor + * @memberOf fabric.Image.filters.Convolute.prototype + * @param {Object} [options] Options object + * @param {Boolean} [options.opaque=false] Opaque value (true/false) + * @param {Array} [options.matrix] Filter matrix + */ + initialize: function(options) { + options = options || { }; + + this.opaque = options.opaque; + this.matrix = options.matrix || [ + 0, 0, 0, + 0, 1, 0, + 0, 0, 0 + ]; + }, + + /** + * Applies filter to canvas element + * @param {Object} canvasEl Canvas element to apply filter to + */ + applyTo: function(canvasEl) { + + var weights = this.matrix, + context = canvasEl.getContext('2d'), + pixels = context.getImageData(0, 0, canvasEl.width, canvasEl.height), + + side = Math.round(Math.sqrt(weights.length)), + halfSide = Math.floor(side / 2), + src = pixels.data, + sw = pixels.width, + sh = pixels.height, + output = context.createImageData(sw, sh), + dst = output.data, + // go through the destination image pixels + alphaFac = this.opaque ? 1 : 0, + r, g, b, a, dstOff, + scx, scy, srcOff, wt; + + for (var y = 0; y < sh; y++) { + for (var x = 0; x < sw; x++) { + dstOff = (y * sw + x) * 4; + // calculate the weighed sum of the source image pixels that + // fall under the convolution matrix + r = 0; g = 0; b = 0; a = 0; + + for (var cy = 0; cy < side; cy++) { + for (var cx = 0; cx < side; cx++) { + scy = y + cy - halfSide; + scx = x + cx - halfSide; + + // eslint-disable-next-line max-depth + if (scy < 0 || scy > sh || scx < 0 || scx > sw) { + continue; + } + + srcOff = (scy * sw + scx) * 4; + wt = weights[cy * side + cx]; + + r += src[srcOff] * wt; + g += src[srcOff + 1] * wt; + b += src[srcOff + 2] * wt; + a += src[srcOff + 3] * wt; + } + } + dst[dstOff] = r; + dst[dstOff + 1] = g; + dst[dstOff + 2] = b; + dst[dstOff + 3] = a + alphaFac * (255 - a); + } + } + + context.putImageData(output, 0, 0); + }, + + /** + * Returns object representation of an instance + * @return {Object} Object representation of an instance + */ + toObject: function() { + return extend(this.callSuper('toObject'), { + opaque: this.opaque, + matrix: this.matrix + }); + } + }); + + /** + * Returns filter instance from an object representation + * @static + * @param {Object} object Object to create an instance from + * @return {fabric.Image.filters.Convolute} Instance of fabric.Image.filters.Convolute + */ + fabric.Image.filters.Convolute.fromObject = function(object) { + return new fabric.Image.filters.Convolute(object); + }; + +})(typeof exports !== 'undefined' ? exports : this); + + +(function(global) { + + 'use strict'; + + var fabric = global.fabric || (global.fabric = { }), + extend = fabric.util.object.extend, + filters = fabric.Image.filters, + createClass = fabric.util.createClass; + + /** + * GradientTransparency filter class + * @class fabric.Image.filters.GradientTransparency + * @memberOf fabric.Image.filters + * @extends fabric.Image.filters.BaseFilter + * @see {@link fabric.Image.filters.GradientTransparency#initialize} for constructor definition + * @see {@link http://fabricjs.com/image-filters|ImageFilters demo} + * @example + * var filter = new fabric.Image.filters.GradientTransparency({ + * threshold: 200 + * }); + * object.filters.push(filter); + * object.applyFilters(canvas.renderAll.bind(canvas)); + */ + // eslint-disable-next-line max-len + filters.GradientTransparency = createClass(filters.BaseFilter, /** @lends fabric.Image.filters.GradientTransparency.prototype */ { + + /** + * Filter type + * @param {String} type + * @default + */ + type: 'GradientTransparency', + + /** + * Constructor + * @memberOf fabric.Image.filters.GradientTransparency.prototype + * @param {Object} [options] Options object + * @param {Number} [options.threshold=100] Threshold value + */ + initialize: function(options) { + options = options || { }; + this.threshold = options.threshold || 100; + }, + + /** + * Applies filter to canvas element + * @param {Object} canvasEl Canvas element to apply filter to + */ + applyTo: function(canvasEl) { + var context = canvasEl.getContext('2d'), + imageData = context.getImageData(0, 0, canvasEl.width, canvasEl.height), + data = imageData.data, + threshold = this.threshold, + total = data.length; + + for (var i = 0, len = data.length; i < len; i += 4) { + data[i + 3] = threshold + 255 * (total - i) / total; + } + + context.putImageData(imageData, 0, 0); + }, + + /** + * Returns object representation of an instance + * @return {Object} Object representation of an instance + */ + toObject: function() { + return extend(this.callSuper('toObject'), { + threshold: this.threshold + }); + } + }); + + /** + * Returns filter instance from an object representation + * @static + * @param {Object} object Object to create an instance from + * @return {fabric.Image.filters.GradientTransparency} Instance of fabric.Image.filters.GradientTransparency + */ + fabric.Image.filters.GradientTransparency.fromObject = function(object) { + return new fabric.Image.filters.GradientTransparency(object); + }; + +})(typeof exports !== 'undefined' ? exports : this); + + +(function(global) { + + 'use strict'; + + var fabric = global.fabric || (global.fabric = { }), + filters = fabric.Image.filters, + createClass = fabric.util.createClass; + + /** + * Grayscale image filter class + * @class fabric.Image.filters.Grayscale + * @memberOf fabric.Image.filters + * @extends fabric.Image.filters.BaseFilter + * @see {@link http://fabricjs.com/image-filters|ImageFilters demo} + * @example + * var filter = new fabric.Image.filters.Grayscale(); + * object.filters.push(filter); + * object.applyFilters(canvas.renderAll.bind(canvas)); + */ + filters.Grayscale = createClass(filters.BaseFilter, /** @lends fabric.Image.filters.Grayscale.prototype */ { + + /** + * Filter type + * @param {String} type + * @default + */ + type: 'Grayscale', + + /** + * Applies filter to canvas element + * @memberOf fabric.Image.filters.Grayscale.prototype + * @param {Object} canvasEl Canvas element to apply filter to + */ + applyTo: function(canvasEl) { + var context = canvasEl.getContext('2d'), + imageData = context.getImageData(0, 0, canvasEl.width, canvasEl.height), + data = imageData.data, + len = imageData.width * imageData.height * 4, + index = 0, + average; + + while (index < len) { + average = (data[index] + data[index + 1] + data[index + 2]) / 3; + data[index] = average; + data[index + 1] = average; + data[index + 2] = average; + index += 4; + } + + context.putImageData(imageData, 0, 0); + } + }); + + /** + * Returns filter instance from an object representation + * @static + * @return {fabric.Image.filters.Grayscale} Instance of fabric.Image.filters.Grayscale + */ + fabric.Image.filters.Grayscale.fromObject = function() { + return new fabric.Image.filters.Grayscale(); + }; + +})(typeof exports !== 'undefined' ? exports : this); + + +(function(global) { + + 'use strict'; + + var fabric = global.fabric || (global.fabric = { }), + filters = fabric.Image.filters, + createClass = fabric.util.createClass; + + /** + * Invert filter class + * @class fabric.Image.filters.Invert + * @memberOf fabric.Image.filters + * @extends fabric.Image.filters.BaseFilter + * @see {@link http://fabricjs.com/image-filters|ImageFilters demo} + * @example + * var filter = new fabric.Image.filters.Invert(); + * object.filters.push(filter); + * object.applyFilters(canvas.renderAll.bind(canvas)); + */ + filters.Invert = createClass(filters.BaseFilter, /** @lends fabric.Image.filters.Invert.prototype */ { + + /** + * Filter type + * @param {String} type + * @default + */ + type: 'Invert', + + /** + * Applies filter to canvas element + * @memberOf fabric.Image.filters.Invert.prototype + * @param {Object} canvasEl Canvas element to apply filter to + */ + applyTo: function(canvasEl) { + var context = canvasEl.getContext('2d'), + imageData = context.getImageData(0, 0, canvasEl.width, canvasEl.height), + data = imageData.data, + iLen = data.length, i; + + for (i = 0; i < iLen; i += 4) { + data[i] = 255 - data[i]; + data[i + 1] = 255 - data[i + 1]; + data[i + 2] = 255 - data[i + 2]; + } + + context.putImageData(imageData, 0, 0); + } + }); + + /** + * Returns filter instance from an object representation + * @static + * @return {fabric.Image.filters.Invert} Instance of fabric.Image.filters.Invert + */ + fabric.Image.filters.Invert.fromObject = function() { + return new fabric.Image.filters.Invert(); + }; + +})(typeof exports !== 'undefined' ? exports : this); + + +(function(global) { + + 'use strict'; + + var fabric = global.fabric || (global.fabric = { }), + extend = fabric.util.object.extend, + filters = fabric.Image.filters, + createClass = fabric.util.createClass; + + /** + * Mask filter class + * See http://resources.aleph-1.com/mask/ + * @class fabric.Image.filters.Mask + * @memberOf fabric.Image.filters + * @extends fabric.Image.filters.BaseFilter + * @see {@link fabric.Image.filters.Mask#initialize} for constructor definition + */ + filters.Mask = createClass(filters.BaseFilter, /** @lends fabric.Image.filters.Mask.prototype */ { + + /** + * Filter type + * @param {String} type + * @default + */ + type: 'Mask', + + /** + * Constructor + * @memberOf fabric.Image.filters.Mask.prototype + * @param {Object} [options] Options object + * @param {fabric.Image} [options.mask] Mask image object + * @param {Number} [options.channel=0] Rgb channel (0, 1, 2 or 3) + */ + initialize: function(options) { + options = options || { }; + + this.mask = options.mask; + this.channel = [0, 1, 2, 3].indexOf(options.channel) > -1 ? options.channel : 0; + }, + + /** + * Applies filter to canvas element + * @param {Object} canvasEl Canvas element to apply filter to + */ + applyTo: function(canvasEl) { + if (!this.mask) { + return; + } + + var context = canvasEl.getContext('2d'), + imageData = context.getImageData(0, 0, canvasEl.width, canvasEl.height), + data = imageData.data, + maskEl = this.mask.getElement(), + maskCanvasEl = fabric.util.createCanvasElement(), + channel = this.channel, + i, + iLen = imageData.width * imageData.height * 4; + + maskCanvasEl.width = canvasEl.width; + maskCanvasEl.height = canvasEl.height; + + maskCanvasEl.getContext('2d').drawImage(maskEl, 0, 0, canvasEl.width, canvasEl.height); + + var maskImageData = maskCanvasEl.getContext('2d').getImageData(0, 0, canvasEl.width, canvasEl.height), + maskData = maskImageData.data; + + for (i = 0; i < iLen; i += 4) { + data[i + 3] = maskData[i + channel]; + } + + context.putImageData(imageData, 0, 0); + }, + + /** + * Returns object representation of an instance + * @return {Object} Object representation of an instance + */ + toObject: function() { + return extend(this.callSuper('toObject'), { + mask: this.mask.toObject(), + channel: this.channel + }); + } + }); + + /** + * Returns filter instance from an object representation + * @static + * @param {Object} object Object to create an instance from + * @param {Function} [callback] Callback to invoke when a mask filter instance is created + */ + fabric.Image.filters.Mask.fromObject = function(object, callback) { + fabric.util.loadImage(object.mask.src, function(img) { + object.mask = new fabric.Image(img, object.mask); + callback && callback(new fabric.Image.filters.Mask(object)); + }); + }; + + /** + * Indicates that instances of this type are async + * @static + * @type Boolean + * @default + */ + fabric.Image.filters.Mask.async = true; + +})(typeof exports !== 'undefined' ? exports : this); + + +(function(global) { + + 'use strict'; + + var fabric = global.fabric || (global.fabric = { }), + extend = fabric.util.object.extend, + filters = fabric.Image.filters, + createClass = fabric.util.createClass; + + /** + * Noise filter class + * @class fabric.Image.filters.Noise + * @memberOf fabric.Image.filters + * @extends fabric.Image.filters.BaseFilter + * @see {@link fabric.Image.filters.Noise#initialize} for constructor definition + * @see {@link http://fabricjs.com/image-filters|ImageFilters demo} + * @example + * var filter = new fabric.Image.filters.Noise({ + * noise: 700 + * }); + * object.filters.push(filter); + * object.applyFilters(canvas.renderAll.bind(canvas)); + */ + filters.Noise = createClass(filters.BaseFilter, /** @lends fabric.Image.filters.Noise.prototype */ { + + /** + * Filter type + * @param {String} type + * @default + */ + type: 'Noise', + + /** + * Constructor + * @memberOf fabric.Image.filters.Noise.prototype + * @param {Object} [options] Options object + * @param {Number} [options.noise=0] Noise value + */ + initialize: function(options) { + options = options || { }; + this.noise = options.noise || 0; + }, + + /** + * Applies filter to canvas element + * @param {Object} canvasEl Canvas element to apply filter to + */ + applyTo: function(canvasEl) { + var context = canvasEl.getContext('2d'), + imageData = context.getImageData(0, 0, canvasEl.width, canvasEl.height), + data = imageData.data, + noise = this.noise, rand; + + for (var i = 0, len = data.length; i < len; i += 4) { + + rand = (0.5 - Math.random()) * noise; + + data[i] += rand; + data[i + 1] += rand; + data[i + 2] += rand; + } + + context.putImageData(imageData, 0, 0); + }, + + /** + * Returns object representation of an instance + * @return {Object} Object representation of an instance + */ + toObject: function() { + return extend(this.callSuper('toObject'), { + noise: this.noise + }); + } + }); + + /** + * Returns filter instance from an object representation + * @static + * @param {Object} object Object to create an instance from + * @return {fabric.Image.filters.Noise} Instance of fabric.Image.filters.Noise + */ + fabric.Image.filters.Noise.fromObject = function(object) { + return new fabric.Image.filters.Noise(object); + }; + +})(typeof exports !== 'undefined' ? exports : this); + + +(function(global) { + + 'use strict'; + + var fabric = global.fabric || (global.fabric = { }), + extend = fabric.util.object.extend, + filters = fabric.Image.filters, + createClass = fabric.util.createClass; + + /** + * Pixelate filter class + * @class fabric.Image.filters.Pixelate + * @memberOf fabric.Image.filters + * @extends fabric.Image.filters.BaseFilter + * @see {@link fabric.Image.filters.Pixelate#initialize} for constructor definition + * @see {@link http://fabricjs.com/image-filters|ImageFilters demo} + * @example + * var filter = new fabric.Image.filters.Pixelate({ + * blocksize: 8 + * }); + * object.filters.push(filter); + * object.applyFilters(canvas.renderAll.bind(canvas)); + */ + filters.Pixelate = createClass(filters.BaseFilter, /** @lends fabric.Image.filters.Pixelate.prototype */ { + + /** + * Filter type + * @param {String} type + * @default + */ + type: 'Pixelate', + + /** + * Constructor + * @memberOf fabric.Image.filters.Pixelate.prototype + * @param {Object} [options] Options object + * @param {Number} [options.blocksize=4] Blocksize for pixelate + */ + initialize: function(options) { + options = options || { }; + this.blocksize = options.blocksize || 4; + }, + + /** + * Applies filter to canvas element + * @param {Object} canvasEl Canvas element to apply filter to + */ + applyTo: function(canvasEl) { + var context = canvasEl.getContext('2d'), + imageData = context.getImageData(0, 0, canvasEl.width, canvasEl.height), + data = imageData.data, + iLen = imageData.height, + jLen = imageData.width, + index, i, j, r, g, b, a; + + for (i = 0; i < iLen; i += this.blocksize) { + for (j = 0; j < jLen; j += this.blocksize) { + + index = (i * 4) * jLen + (j * 4); + + r = data[index]; + g = data[index + 1]; + b = data[index + 2]; + a = data[index + 3]; + + /* + blocksize: 4 + + [1,x,x,x,1] + [x,x,x,x,1] + [x,x,x,x,1] + [x,x,x,x,1] + [1,1,1,1,1] + */ + + for (var _i = i, _ilen = i + this.blocksize; _i < _ilen; _i++) { + for (var _j = j, _jlen = j + this.blocksize; _j < _jlen; _j++) { + index = (_i * 4) * jLen + (_j * 4); + data[index] = r; + data[index + 1] = g; + data[index + 2] = b; + data[index + 3] = a; + } + } + } + } + + context.putImageData(imageData, 0, 0); + }, + + /** + * Returns object representation of an instance + * @return {Object} Object representation of an instance + */ + toObject: function() { + return extend(this.callSuper('toObject'), { + blocksize: this.blocksize + }); + } + }); + + /** + * Returns filter instance from an object representation + * @static + * @param {Object} object Object to create an instance from + * @return {fabric.Image.filters.Pixelate} Instance of fabric.Image.filters.Pixelate + */ + fabric.Image.filters.Pixelate.fromObject = function(object) { + return new fabric.Image.filters.Pixelate(object); + }; + +})(typeof exports !== 'undefined' ? exports : this); + + +(function(global) { + + 'use strict'; + + var fabric = global.fabric || (global.fabric = { }), + extend = fabric.util.object.extend, + filters = fabric.Image.filters, + createClass = fabric.util.createClass; + + /** + * Remove white filter class + * @class fabric.Image.filters.RemoveWhite + * @memberOf fabric.Image.filters + * @extends fabric.Image.filters.BaseFilter + * @see {@link fabric.Image.filters.RemoveWhite#initialize} for constructor definition + * @see {@link http://fabricjs.com/image-filters|ImageFilters demo} + * @example + * var filter = new fabric.Image.filters.RemoveWhite({ + * threshold: 40, + * distance: 140 + * }); + * object.filters.push(filter); + * object.applyFilters(canvas.renderAll.bind(canvas)); + */ + filters.RemoveWhite = createClass(filters.BaseFilter, /** @lends fabric.Image.filters.RemoveWhite.prototype */ { + + /** + * Filter type + * @param {String} type + * @default + */ + type: 'RemoveWhite', + + /** + * Constructor + * @memberOf fabric.Image.filters.RemoveWhite.prototype + * @param {Object} [options] Options object + * @param {Number} [options.threshold=30] Threshold value + * @param {Number} [options.distance=20] Distance value + */ + initialize: function(options) { + options = options || { }; + this.threshold = options.threshold || 30; + this.distance = options.distance || 20; + }, + + /** + * Applies filter to canvas element + * @param {Object} canvasEl Canvas element to apply filter to + */ + applyTo: function(canvasEl) { + var context = canvasEl.getContext('2d'), + imageData = context.getImageData(0, 0, canvasEl.width, canvasEl.height), + data = imageData.data, + threshold = this.threshold, + distance = this.distance, + limit = 255 - threshold, + abs = Math.abs, + r, g, b; + + for (var i = 0, len = data.length; i < len; i += 4) { + r = data[i]; + g = data[i + 1]; + b = data[i + 2]; + + if (r > limit && + g > limit && + b > limit && + abs(r - g) < distance && + abs(r - b) < distance && + abs(g - b) < distance + ) { + data[i + 3] = 0; + } + } + + context.putImageData(imageData, 0, 0); + }, + + /** + * Returns object representation of an instance + * @return {Object} Object representation of an instance + */ + toObject: function() { + return extend(this.callSuper('toObject'), { + threshold: this.threshold, + distance: this.distance + }); + } + }); + + /** + * Returns filter instance from an object representation + * @static + * @param {Object} object Object to create an instance from + * @return {fabric.Image.filters.RemoveWhite} Instance of fabric.Image.filters.RemoveWhite + */ + fabric.Image.filters.RemoveWhite.fromObject = function(object) { + return new fabric.Image.filters.RemoveWhite(object); + }; + +})(typeof exports !== 'undefined' ? exports : this); + + +(function(global) { + + 'use strict'; + + var fabric = global.fabric || (global.fabric = { }), + filters = fabric.Image.filters, + createClass = fabric.util.createClass; + + /** + * Sepia filter class + * @class fabric.Image.filters.Sepia + * @memberOf fabric.Image.filters + * @extends fabric.Image.filters.BaseFilter + * @see {@link http://fabricjs.com/image-filters|ImageFilters demo} + * @example + * var filter = new fabric.Image.filters.Sepia(); + * object.filters.push(filter); + * object.applyFilters(canvas.renderAll.bind(canvas)); + */ + filters.Sepia = createClass(filters.BaseFilter, /** @lends fabric.Image.filters.Sepia.prototype */ { + + /** + * Filter type + * @param {String} type + * @default + */ + type: 'Sepia', + + /** + * Applies filter to canvas element + * @memberOf fabric.Image.filters.Sepia.prototype + * @param {Object} canvasEl Canvas element to apply filter to + */ + applyTo: function(canvasEl) { + var context = canvasEl.getContext('2d'), + imageData = context.getImageData(0, 0, canvasEl.width, canvasEl.height), + data = imageData.data, + iLen = data.length, i, avg; + + for (i = 0; i < iLen; i += 4) { + avg = 0.3 * data[i] + 0.59 * data[i + 1] + 0.11 * data[i + 2]; + data[i] = avg + 100; + data[i + 1] = avg + 50; + data[i + 2] = avg + 255; + } + + context.putImageData(imageData, 0, 0); + } + }); + + /** + * Returns filter instance from an object representation + * @static + * @return {fabric.Image.filters.Sepia} Instance of fabric.Image.filters.Sepia + */ + fabric.Image.filters.Sepia.fromObject = function() { + return new fabric.Image.filters.Sepia(); + }; + +})(typeof exports !== 'undefined' ? exports : this); + + +(function(global) { + + 'use strict'; + + var fabric = global.fabric || (global.fabric = { }), + filters = fabric.Image.filters, + createClass = fabric.util.createClass; + + /** + * Sepia2 filter class + * @class fabric.Image.filters.Sepia2 + * @memberOf fabric.Image.filters + * @extends fabric.Image.filters.BaseFilter + * @see {@link http://fabricjs.com/image-filters|ImageFilters demo} + * @example + * var filter = new fabric.Image.filters.Sepia2(); + * object.filters.push(filter); + * object.applyFilters(canvas.renderAll.bind(canvas)); + */ + filters.Sepia2 = createClass(filters.BaseFilter, /** @lends fabric.Image.filters.Sepia2.prototype */ { + + /** + * Filter type + * @param {String} type + * @default + */ + type: 'Sepia2', + + /** + * Applies filter to canvas element + * @memberOf fabric.Image.filters.Sepia.prototype + * @param {Object} canvasEl Canvas element to apply filter to + */ + applyTo: function(canvasEl) { + var context = canvasEl.getContext('2d'), + imageData = context.getImageData(0, 0, canvasEl.width, canvasEl.height), + data = imageData.data, + iLen = data.length, i, r, g, b; + + for (i = 0; i < iLen; i += 4) { + r = data[i]; + g = data[i + 1]; + b = data[i + 2]; + + data[i] = (r * 0.393 + g * 0.769 + b * 0.189 ) / 1.351; + data[i + 1] = (r * 0.349 + g * 0.686 + b * 0.168 ) / 1.203; + data[i + 2] = (r * 0.272 + g * 0.534 + b * 0.131 ) / 2.140; + } + + context.putImageData(imageData, 0, 0); + } + }); + + /** + * Returns filter instance from an object representation + * @static + * @return {fabric.Image.filters.Sepia2} Instance of fabric.Image.filters.Sepia2 + */ + fabric.Image.filters.Sepia2.fromObject = function() { + return new fabric.Image.filters.Sepia2(); + }; + +})(typeof exports !== 'undefined' ? exports : this); + + +(function(global) { + + 'use strict'; + + var fabric = global.fabric || (global.fabric = { }), + extend = fabric.util.object.extend, + filters = fabric.Image.filters, + createClass = fabric.util.createClass; + + /** + * Tint filter class + * Adapted from https://github.com/mezzoblue/PaintbrushJS + * @class fabric.Image.filters.Tint + * @memberOf fabric.Image.filters + * @extends fabric.Image.filters.BaseFilter + * @see {@link fabric.Image.filters.Tint#initialize} for constructor definition + * @see {@link http://fabricjs.com/image-filters|ImageFilters demo} + * @example Tint filter with hex color and opacity + * var filter = new fabric.Image.filters.Tint({ + * color: '#3513B0', + * opacity: 0.5 + * }); + * object.filters.push(filter); + * object.applyFilters(canvas.renderAll.bind(canvas)); + * @example Tint filter with rgba color + * var filter = new fabric.Image.filters.Tint({ + * color: 'rgba(53, 21, 176, 0.5)' + * }); + * object.filters.push(filter); + * object.applyFilters(canvas.renderAll.bind(canvas)); + */ + filters.Tint = createClass(filters.BaseFilter, /** @lends fabric.Image.filters.Tint.prototype */ { + + /** + * Filter type + * @param {String} type + * @default + */ + type: 'Tint', + + /** + * Constructor + * @memberOf fabric.Image.filters.Tint.prototype + * @param {Object} [options] Options object + * @param {String} [options.color=#000000] Color to tint the image with + * @param {Number} [options.opacity] Opacity value that controls the tint effect's transparency (0..1) + */ + initialize: function(options) { + options = options || { }; + + this.color = options.color || '#000000'; + this.opacity = typeof options.opacity !== 'undefined' + ? options.opacity + : new fabric.Color(this.color).getAlpha(); + }, + + /** + * Applies filter to canvas element + * @param {Object} canvasEl Canvas element to apply filter to + */ + applyTo: function(canvasEl) { + var context = canvasEl.getContext('2d'), + imageData = context.getImageData(0, 0, canvasEl.width, canvasEl.height), + data = imageData.data, + iLen = data.length, i, + tintR, tintG, tintB, + r, g, b, alpha1, + source; + + source = new fabric.Color(this.color).getSource(); + + tintR = source[0] * this.opacity; + tintG = source[1] * this.opacity; + tintB = source[2] * this.opacity; + + alpha1 = 1 - this.opacity; + + for (i = 0; i < iLen; i += 4) { + r = data[i]; + g = data[i + 1]; + b = data[i + 2]; + + // alpha compositing + data[i] = tintR + r * alpha1; + data[i + 1] = tintG + g * alpha1; + data[i + 2] = tintB + b * alpha1; + } + + context.putImageData(imageData, 0, 0); + }, + + /** + * Returns object representation of an instance + * @return {Object} Object representation of an instance + */ + toObject: function() { + return extend(this.callSuper('toObject'), { + color: this.color, + opacity: this.opacity + }); + } + }); + + /** + * Returns filter instance from an object representation + * @static + * @param {Object} object Object to create an instance from + * @return {fabric.Image.filters.Tint} Instance of fabric.Image.filters.Tint + */ + fabric.Image.filters.Tint.fromObject = function(object) { + return new fabric.Image.filters.Tint(object); + }; + +})(typeof exports !== 'undefined' ? exports : this); + + +(function(global) { + + 'use strict'; + + var fabric = global.fabric || (global.fabric = { }), + extend = fabric.util.object.extend, + filters = fabric.Image.filters, + createClass = fabric.util.createClass; + + /** + * Multiply filter class + * Adapted from http://www.laurenscorijn.com/articles/colormath-basics + * @class fabric.Image.filters.Multiply + * @memberOf fabric.Image.filters + * @extends fabric.Image.filters.BaseFilter + * @example Multiply filter with hex color + * var filter = new fabric.Image.filters.Multiply({ + * color: '#F0F' + * }); + * object.filters.push(filter); + * object.applyFilters(canvas.renderAll.bind(canvas)); + * @example Multiply filter with rgb color + * var filter = new fabric.Image.filters.Multiply({ + * color: 'rgb(53, 21, 176)' + * }); + * object.filters.push(filter); + * object.applyFilters(canvas.renderAll.bind(canvas)); + */ + filters.Multiply = createClass(filters.BaseFilter, /** @lends fabric.Image.filters.Multiply.prototype */ { + + /** + * Filter type + * @param {String} type + * @default + */ + type: 'Multiply', + + /** + * Constructor + * @memberOf fabric.Image.filters.Multiply.prototype + * @param {Object} [options] Options object + * @param {String} [options.color=#000000] Color to multiply the image pixels with + */ + initialize: function(options) { + options = options || { }; + + this.color = options.color || '#000000'; + }, + + /** + * Applies filter to canvas element + * @param {Object} canvasEl Canvas element to apply filter to + */ + applyTo: function(canvasEl) { + var context = canvasEl.getContext('2d'), + imageData = context.getImageData(0, 0, canvasEl.width, canvasEl.height), + data = imageData.data, + iLen = data.length, i, + source; + + source = new fabric.Color(this.color).getSource(); + + for (i = 0; i < iLen; i += 4) { + data[i] *= source[0] / 255; + data[i + 1] *= source[1] / 255; + data[i + 2] *= source[2] / 255; + } + + context.putImageData(imageData, 0, 0); + }, + + /** + * Returns object representation of an instance + * @return {Object} Object representation of an instance + */ + toObject: function() { + return extend(this.callSuper('toObject'), { + color: this.color + }); + } + }); + + /** + * Returns filter instance from an object representation + * @static + * @param {Object} object Object to create an instance from + * @return {fabric.Image.filters.Multiply} Instance of fabric.Image.filters.Multiply + */ + fabric.Image.filters.Multiply.fromObject = function(object) { + return new fabric.Image.filters.Multiply(object); + }; + +})(typeof exports !== 'undefined' ? exports : this); + + +(function(global) { + 'use strict'; + + var fabric = global.fabric, + filters = fabric.Image.filters, + createClass = fabric.util.createClass; + + /** + * Color Blend filter class + * @class fabric.Image.filter.Blend + * @memberOf fabric.Image.filters + * @extends fabric.Image.filters.BaseFilter + * @example + * var filter = new fabric.Image.filters.Blend({ + * color: '#000', + * mode: 'multiply' + * }); + * + * var filter = new fabric.Image.filters.Blend({ + * image: fabricImageObject, + * mode: 'multiply', + * alpha: 0.5 + * }); + + * object.filters.push(filter); + * object.applyFilters(canvas.renderAll.bind(canvas)); + */ + + filters.Blend = createClass(filters.BaseFilter, /** @lends fabric.Image.filters.Blend.prototype */ { + type: 'Blend', + + initialize: function(options) { + options = options || {}; + this.color = options.color || '#000'; + this.image = options.image || false; + this.mode = options.mode || 'multiply'; + this.alpha = options.alpha || 1; + }, + + applyTo: function(canvasEl) { + var context = canvasEl.getContext('2d'), + imageData = context.getImageData(0, 0, canvasEl.width, canvasEl.height), + data = imageData.data, + tr, tg, tb, + r, g, b, + _r, _g, _b, + source, + isImage = false; + + if (this.image) { + // Blend images + isImage = true; + + var _el = fabric.util.createCanvasElement(); + _el.width = this.image.width; + _el.height = this.image.height; + + var tmpCanvas = new fabric.StaticCanvas(_el); + tmpCanvas.add(this.image); + var context2 = tmpCanvas.getContext('2d'); + source = context2.getImageData(0, 0, tmpCanvas.width, tmpCanvas.height).data; + } + else { + // Blend color + source = new fabric.Color(this.color).getSource(); + + tr = source[0] * this.alpha; + tg = source[1] * this.alpha; + tb = source[2] * this.alpha; + } + + for (var i = 0, len = data.length; i < len; i += 4) { + + r = data[i]; + g = data[i + 1]; + b = data[i + 2]; + + if (isImage) { + tr = source[i] * this.alpha; + tg = source[i + 1] * this.alpha; + tb = source[i + 2] * this.alpha; + } + + switch (this.mode) { + case 'multiply': + data[i] = r * tr / 255; + data[i + 1] = g * tg / 255; + data[i + 2] = b * tb / 255; + break; + case 'screen': + data[i] = 1 - (1 - r) * (1 - tr); + data[i + 1] = 1 - (1 - g) * (1 - tg); + data[i + 2] = 1 - (1 - b) * (1 - tb); + break; + case 'add': + data[i] = Math.min(255, r + tr); + data[i + 1] = Math.min(255, g + tg); + data[i + 2] = Math.min(255, b + tb); + break; + case 'diff': + case 'difference': + data[i] = Math.abs(r - tr); + data[i + 1] = Math.abs(g - tg); + data[i + 2] = Math.abs(b - tb); + break; + case 'subtract': + _r = r - tr; + _g = g - tg; + _b = b - tb; + + data[i] = (_r < 0) ? 0 : _r; + data[i + 1] = (_g < 0) ? 0 : _g; + data[i + 2] = (_b < 0) ? 0 : _b; + break; + case 'darken': + data[i] = Math.min(r, tr); + data[i + 1] = Math.min(g, tg); + data[i + 2] = Math.min(b, tb); + break; + case 'lighten': + data[i] = Math.max(r, tr); + data[i + 1] = Math.max(g, tg); + data[i + 2] = Math.max(b, tb); + break; + } + } + + context.putImageData(imageData, 0, 0); + }, + + /** + * Returns object representation of an instance + * @return {Object} Object representation of an instance + */ + toObject: function() { + return { + color: this.color, + image: this.image, + mode: this.mode, + alpha: this.alpha + }; + } + }); + + fabric.Image.filters.Blend.fromObject = function(object) { + return new fabric.Image.filters.Blend(object); + }; +})(typeof exports !== 'undefined' ? exports : this); + + +(function(global) { + + 'use strict'; + + var fabric = global.fabric || (global.fabric = { }), pow = Math.pow, floor = Math.floor, + sqrt = Math.sqrt, abs = Math.abs, max = Math.max, round = Math.round, sin = Math.sin, + ceil = Math.ceil, + filters = fabric.Image.filters, + createClass = fabric.util.createClass; + + /** + * Resize image filter class + * @class fabric.Image.filters.Resize + * @memberOf fabric.Image.filters + * @extends fabric.Image.filters.BaseFilter + * @see {@link http://fabricjs.com/image-filters|ImageFilters demo} + * @example + * var filter = new fabric.Image.filters.Resize(); + * object.filters.push(filter); + * object.applyFilters(canvas.renderAll.bind(canvas)); + */ + filters.Resize = createClass(filters.BaseFilter, /** @lends fabric.Image.filters.Resize.prototype */ { + + /** + * Filter type + * @param {String} type + * @default + */ + type: 'Resize', + + /** + * Resize type + * @param {String} resizeType + * @default + */ + resizeType: 'hermite', + + /** + * Scale factor for resizing, x axis + * @param {Number} scaleX + * @default + */ + scaleX: 0, + + /** + * Scale factor for resizing, y axis + * @param {Number} scaleY + * @default + */ + scaleY: 0, + + /** + * LanczosLobes parameter for lanczos filter + * @param {Number} lanczosLobes + * @default + */ + lanczosLobes: 3, + + /** + * Applies filter to canvas element + * @memberOf fabric.Image.filters.Resize.prototype + * @param {Object} canvasEl Canvas element to apply filter to + * @param {Number} scaleX + * @param {Number} scaleY + */ + applyTo: function(canvasEl, scaleX, scaleY) { + if (scaleX === 1 && scaleY === 1) { + return; + } + + this.rcpScaleX = 1 / scaleX; + this.rcpScaleY = 1 / scaleY; + + var oW = canvasEl.width, oH = canvasEl.height, + dW = round(oW * scaleX), dH = round(oH * scaleY), + imageData; + + if (this.resizeType === 'sliceHack') { + imageData = this.sliceByTwo(canvasEl, oW, oH, dW, dH); + } + if (this.resizeType === 'hermite') { + imageData = this.hermiteFastResize(canvasEl, oW, oH, dW, dH); + } + if (this.resizeType === 'bilinear') { + imageData = this.bilinearFiltering(canvasEl, oW, oH, dW, dH); + } + if (this.resizeType === 'lanczos') { + imageData = this.lanczosResize(canvasEl, oW, oH, dW, dH); + } + canvasEl.width = dW; + canvasEl.height = dH; + canvasEl.getContext('2d').putImageData(imageData, 0, 0); + }, + + /** + * Filter sliceByTwo + * @param {Object} canvasEl Canvas element to apply filter to + * @param {Number} oW Original Width + * @param {Number} oH Original Height + * @param {Number} dW Destination Width + * @param {Number} dH Destination Height + * @returns {ImageData} + */ + sliceByTwo: function(canvasEl, oW, oH, dW, dH) { + var context = canvasEl.getContext('2d'), imageData, + multW = 0.5, multH = 0.5, signW = 1, signH = 1, + doneW = false, doneH = false, stepW = oW, stepH = oH, + tmpCanvas = fabric.util.createCanvasElement(), + tmpCtx = tmpCanvas.getContext('2d'); + dW = floor(dW); + dH = floor(dH); + tmpCanvas.width = max(dW, oW); + tmpCanvas.height = max(dH, oH); + + if (dW > oW) { + multW = 2; + signW = -1; + } + if (dH > oH) { + multH = 2; + signH = -1; + } + imageData = context.getImageData(0, 0, oW, oH); + canvasEl.width = max(dW, oW); + canvasEl.height = max(dH, oH); + context.putImageData(imageData, 0, 0); + + while (!doneW || !doneH) { + oW = stepW; + oH = stepH; + if (dW * signW < floor(stepW * multW * signW)) { + stepW = floor(stepW * multW); + } + else { + stepW = dW; + doneW = true; + } + if (dH * signH < floor(stepH * multH * signH)) { + stepH = floor(stepH * multH); + } + else { + stepH = dH; + doneH = true; + } + imageData = context.getImageData(0, 0, oW, oH); + tmpCtx.putImageData(imageData, 0, 0); + context.clearRect(0, 0, stepW, stepH); + context.drawImage(tmpCanvas, 0, 0, oW, oH, 0, 0, stepW, stepH); + } + return context.getImageData(0, 0, dW, dH); + }, + + /** + * Filter lanczosResize + * @param {Object} canvasEl Canvas element to apply filter to + * @param {Number} oW Original Width + * @param {Number} oH Original Height + * @param {Number} dW Destination Width + * @param {Number} dH Destination Height + * @returns {ImageData} + */ + lanczosResize: function(canvasEl, oW, oH, dW, dH) { + + function lanczosCreate(lobes) { + return function(x) { + if (x > lobes) { + return 0; + } + x *= Math.PI; + if (abs(x) < 1e-16) { + return 1; + } + var xx = x / lobes; + return sin(x) * sin(xx) / x / xx; + }; + } + + function process(u) { + var v, i, weight, idx, a, red, green, + blue, alpha, fX, fY; + center.x = (u + 0.5) * ratioX; + icenter.x = floor(center.x); + for (v = 0; v < dH; v++) { + center.y = (v + 0.5) * ratioY; + icenter.y = floor(center.y); + a = 0; red = 0; green = 0; blue = 0; alpha = 0; + for (i = icenter.x - range2X; i <= icenter.x + range2X; i++) { + if (i < 0 || i >= oW) { + continue; + } + fX = floor(1000 * abs(i - center.x)); + if (!cacheLanc[fX]) { + cacheLanc[fX] = { }; + } + for (var j = icenter.y - range2Y; j <= icenter.y + range2Y; j++) { + if (j < 0 || j >= oH) { + continue; + } + fY = floor(1000 * abs(j - center.y)); + if (!cacheLanc[fX][fY]) { + cacheLanc[fX][fY] = lanczos(sqrt(pow(fX * rcpRatioX, 2) + pow(fY * rcpRatioY, 2)) / 1000); + } + weight = cacheLanc[fX][fY]; + if (weight > 0) { + idx = (j * oW + i) * 4; + a += weight; + red += weight * srcData[idx]; + green += weight * srcData[idx + 1]; + blue += weight * srcData[idx + 2]; + alpha += weight * srcData[idx + 3]; + } + } + } + idx = (v * dW + u) * 4; + destData[idx] = red / a; + destData[idx + 1] = green / a; + destData[idx + 2] = blue / a; + destData[idx + 3] = alpha / a; + } + + if (++u < dW) { + return process(u); + } + else { + return destImg; + } + } + + var context = canvasEl.getContext('2d'), + srcImg = context.getImageData(0, 0, oW, oH), + destImg = context.getImageData(0, 0, dW, dH), + srcData = srcImg.data, destData = destImg.data, + lanczos = lanczosCreate(this.lanczosLobes), + ratioX = this.rcpScaleX, ratioY = this.rcpScaleY, + rcpRatioX = 2 / this.rcpScaleX, rcpRatioY = 2 / this.rcpScaleY, + range2X = ceil(ratioX * this.lanczosLobes / 2), + range2Y = ceil(ratioY * this.lanczosLobes / 2), + cacheLanc = { }, center = { }, icenter = { }; + + return process(0); + }, + + /** + * bilinearFiltering + * @param {Object} canvasEl Canvas element to apply filter to + * @param {Number} oW Original Width + * @param {Number} oH Original Height + * @param {Number} dW Destination Width + * @param {Number} dH Destination Height + * @returns {ImageData} + */ + bilinearFiltering: function(canvasEl, oW, oH, dW, dH) { + var a, b, c, d, x, y, i, j, xDiff, yDiff, chnl, + color, offset = 0, origPix, ratioX = this.rcpScaleX, + ratioY = this.rcpScaleY, context = canvasEl.getContext('2d'), + w4 = 4 * (oW - 1), img = context.getImageData(0, 0, oW, oH), + pixels = img.data, destImage = context.getImageData(0, 0, dW, dH), + destPixels = destImage.data; + for (i = 0; i < dH; i++) { + for (j = 0; j < dW; j++) { + x = floor(ratioX * j); + y = floor(ratioY * i); + xDiff = ratioX * j - x; + yDiff = ratioY * i - y; + origPix = 4 * (y * oW + x); + + for (chnl = 0; chnl < 4; chnl++) { + a = pixels[origPix + chnl]; + b = pixels[origPix + 4 + chnl]; + c = pixels[origPix + w4 + chnl]; + d = pixels[origPix + w4 + 4 + chnl]; + color = a * (1 - xDiff) * (1 - yDiff) + b * xDiff * (1 - yDiff) + + c * yDiff * (1 - xDiff) + d * xDiff * yDiff; + destPixels[offset++] = color; + } + } + } + return destImage; + }, + + /** + * hermiteFastResize + * @param {Object} canvasEl Canvas element to apply filter to + * @param {Number} oW Original Width + * @param {Number} oH Original Height + * @param {Number} dW Destination Width + * @param {Number} dH Destination Height + * @returns {ImageData} + */ + hermiteFastResize: function(canvasEl, oW, oH, dW, dH) { + var ratioW = this.rcpScaleX, ratioH = this.rcpScaleY, + ratioWHalf = ceil(ratioW / 2), + ratioHHalf = ceil(ratioH / 2), + context = canvasEl.getContext('2d'), + img = context.getImageData(0, 0, oW, oH), data = img.data, + img2 = context.getImageData(0, 0, dW, dH), data2 = img2.data; + for (var j = 0; j < dH; j++) { + for (var i = 0; i < dW; i++) { + var x2 = (i + j * dW) * 4, weight = 0, weights = 0, weightsAlpha = 0, + gxR = 0, gxG = 0, gxB = 0, gxA = 0, centerY = (j + 0.5) * ratioH; + for (var yy = floor(j * ratioH); yy < (j + 1) * ratioH; yy++) { + var dy = abs(centerY - (yy + 0.5)) / ratioHHalf, + centerX = (i + 0.5) * ratioW, w0 = dy * dy; + for (var xx = floor(i * ratioW); xx < (i + 1) * ratioW; xx++) { + var dx = abs(centerX - (xx + 0.5)) / ratioWHalf, + w = sqrt(w0 + dx * dx); + /* eslint-disable max-depth */ + if (w > 1 && w < -1) { + continue; + } + //hermite filter + weight = 2 * w * w * w - 3 * w * w + 1; + if (weight > 0) { + dx = 4 * (xx + yy * oW); + //alpha + gxA += weight * data[dx + 3]; + weightsAlpha += weight; + //colors + if (data[dx + 3] < 255) { + weight = weight * data[dx + 3] / 250; + } + gxR += weight * data[dx]; + gxG += weight * data[dx + 1]; + gxB += weight * data[dx + 2]; + weights += weight; + } + /* eslint-enable max-depth */ + } + } + data2[x2] = gxR / weights; + data2[x2 + 1] = gxG / weights; + data2[x2 + 2] = gxB / weights; + data2[x2 + 3] = gxA / weightsAlpha; + } + } + return img2; + }, + + /** + * Returns object representation of an instance + * @return {Object} Object representation of an instance + */ + toObject: function() { + return { + type: this.type, + scaleX: this.scaleX, + scaleY: this.scaleY, + resizeType: this.resizeType, + lanczosLobes: this.lanczosLobes + }; + } + }); + + /** + * Returns filter instance from an object representation + * @static + * @return {fabric.Image.filters.Resize} Instance of fabric.Image.filters.Resize + */ + fabric.Image.filters.Resize.fromObject = function(object) { + return new fabric.Image.filters.Resize(object); + }; + +})(typeof exports !== 'undefined' ? exports : this); + + +(function(global) { + + 'use strict'; + + var fabric = global.fabric || (global.fabric = { }), + extend = fabric.util.object.extend, + filters = fabric.Image.filters, + createClass = fabric.util.createClass; + + /** + * Color Matrix filter class + * @class fabric.Image.filters.ColorMatrix + * @memberOf fabric.Image.filters + * @extends fabric.Image.filters.BaseFilter + * @see {@link fabric.Image.filters.ColorMatrix#initialize} for constructor definition + * @see {@link http://fabricjs.com/image-filters|ImageFilters demo} + * @see {@Link http://www.webwasp.co.uk/tutorials/219/Color_Matrix_Filter.php} + * @see {@Link http://phoboslab.org/log/2013/11/fast-image-filters-with-webgl} + * @example Kodachrome filter + * var filter = new fabric.Image.filters.ColorMatrix({ + * matrix: [ + 1.1285582396593525, -0.3967382283601348, -0.03992559172921793, 0, 63.72958762196502, + -0.16404339962244616, 1.0835251566291304, -0.05498805115633132, 0, 24.732407896706203, + -0.16786010706155763, -0.5603416277695248, 1.6014850761964943, 0, 35.62982807460946, + 0, 0, 0, 1, 0 + ] + * }); + * object.filters.push(filter); + * object.applyFilters(canvas.renderAll.bind(canvas)); + */ + filters.ColorMatrix = createClass(filters.BaseFilter, /** @lends fabric.Image.filters.ColorMatrix.prototype */ { + + /** + * Filter type + * @param {String} type + * @default + */ + type: 'ColorMatrix', + + /** + * Constructor + * @memberOf fabric.Image.filters.ColorMatrix.prototype + * @param {Object} [options] Options object + * @param {Array} [options.matrix] Color Matrix to modify the image data with + */ + initialize: function( options ) { + options || ( options = {} ); + this.matrix = options.matrix || [ + 1, 0, 0, 0, 0, + 0, 1, 0, 0, 0, + 0, 0, 1, 0, 0, + 0, 0, 0, 1, 0 + ]; + }, + + /** + * Applies filter to canvas element + * @param {Object} canvasEl Canvas element to apply filter to + */ + applyTo: function( canvasEl ) { + var context = canvasEl.getContext( '2d' ), + imageData = context.getImageData( 0, 0, canvasEl.width, canvasEl.height ), + data = imageData.data, + iLen = data.length, + i, + r, + g, + b, + a, + m = this.matrix; + + for ( i = 0; i < iLen; i += 4 ) { + r = data[ i ]; + g = data[ i + 1 ]; + b = data[ i + 2 ]; + a = data[ i + 3 ]; + + data[ i ] = r * m[ 0 ] + g * m[ 1 ] + b * m[ 2 ] + a * m[ 3 ] + m[ 4 ]; + data[ i + 1 ] = r * m[ 5 ] + g * m[ 6 ] + b * m[ 7 ] + a * m[ 8 ] + m[ 9 ]; + data[ i + 2 ] = r * m[ 10 ] + g * m[ 11 ] + b * m[ 12 ] + a * m[ 13 ] + m[ 14 ]; + data[ i + 3 ] = r * m[ 15 ] + g * m[ 16 ] + b * m[ 17 ] + a * m[ 18 ] + m[ 19 ]; + } + + context.putImageData( imageData, 0, 0 ); + }, + + /** + * Returns object representation of an instance + * @return {Object} Object representation of an instance + */ + toObject: function() { + return extend(this.callSuper('toObject'), { + type: this.type, + matrix: this.matrix + }); + } + }); + + /** + * Returns filter instance from an object representation + * @static + * @param {Object} object Object to create an instance from + * @return {fabric.Image.filters.ColorMatrix} Instance of fabric.Image.filters.ColorMatrix + */ + fabric.Image.filters.ColorMatrix.fromObject = function( object ) { + return new fabric.Image.filters.ColorMatrix( object ); + }; + +})(typeof exports !== 'undefined' ? exports : this); + + +(function(global) { + + 'use strict'; + + var fabric = global.fabric || (global.fabric = { }), + extend = fabric.util.object.extend, + filters = fabric.Image.filters, + createClass = fabric.util.createClass; + + /** + * Contrast filter class + * @class fabric.Image.filters.Contrast + * @memberOf fabric.Image.filters + * @extends fabric.Image.filters.BaseFilter + * @see {@link fabric.Image.filters.Contrast#initialize} for constructor definition + * @see {@link http://fabricjs.com/image-filters|ImageFilters demo} + * @example + * var filter = new fabric.Image.filters.Contrast({ + * contrast: 40 + * }); + * object.filters.push(filter); + * object.applyFilters(canvas.renderAll.bind(canvas)); + */ + filters.Contrast = createClass(filters.BaseFilter, /** @lends fabric.Image.filters.Contrast.prototype */ { + + /** + * Filter type + * @param {String} type + * @default + */ + type: 'Contrast', + + /** + * Constructor + * @memberOf fabric.Image.filters.Contrast.prototype + * @param {Object} [options] Options object + * @param {Number} [options.contrast=0] Value to contrast the image up (-255...255) + */ + initialize: function(options) { + options = options || { }; + this.contrast = options.contrast || 0; + }, + + /** + * Applies filter to canvas element + * @param {Object} canvasEl Canvas element to apply filter to + */ + applyTo: function(canvasEl) { + var context = canvasEl.getContext('2d'), + imageData = context.getImageData(0, 0, canvasEl.width, canvasEl.height), + data = imageData.data, + contrastF = 259 * (this.contrast + 255) / (255 * (259 - this.contrast)); + + for (var i = 0, len = data.length; i < len; i += 4) { + data[i] = contrastF * (data[i] - 128) + 128; + data[i + 1] = contrastF * (data[i + 1] - 128) + 128; + data[i + 2] = contrastF * (data[i + 2] - 128) + 128; + } + + context.putImageData(imageData, 0, 0); + }, + + /** + * Returns object representation of an instance + * @return {Object} Object representation of an instance + */ + toObject: function() { + return extend(this.callSuper('toObject'), { + contrast: this.contrast + }); + } + }); + + /** + * Returns filter instance from an object representation + * @static + * @param {Object} object Object to create an instance from + * @return {fabric.Image.filters.Contrast} Instance of fabric.Image.filters.Contrast + */ + fabric.Image.filters.Contrast.fromObject = function(object) { + return new fabric.Image.filters.Contrast(object); + }; + +})(typeof exports !== 'undefined' ? exports : this); + + +(function(global) { + + 'use strict'; + + var fabric = global.fabric || (global.fabric = { }), + extend = fabric.util.object.extend, + filters = fabric.Image.filters, + createClass = fabric.util.createClass; + + /** + * Saturate filter class + * @class fabric.Image.filters.Saturate + * @memberOf fabric.Image.filters + * @extends fabric.Image.filters.BaseFilter + * @see {@link fabric.Image.filters.Saturate#initialize} for constructor definition + * @see {@link http://fabricjs.com/image-filters|ImageFilters demo} + * @example + * var filter = new fabric.Image.filters.Saturate({ + * saturate: 100 + * }); + * object.filters.push(filter); + * object.applyFilters(canvas.renderAll.bind(canvas)); + */ + filters.Saturate = createClass(filters.BaseFilter, /** @lends fabric.Image.filters.Saturate.prototype */ { + + /** + * Filter type + * @param {String} type + * @default + */ + type: 'Saturate', + + /** + * Constructor + * @memberOf fabric.Image.filters.Saturate.prototype + * @param {Object} [options] Options object + * @param {Number} [options.contrast=0] Value to saturate the image (-255...255) + */ + initialize: function(options) { + options = options || { }; + this.saturate = options.saturate || 0; + this.loadProgram(); + }, + + /** + * Applies filter to canvas element + * @param {Object} canvasEl Canvas element to apply filter to + */ + applyTo: function(canvasEl) { + var context = canvasEl.getContext('2d'), + imageData = context.getImageData(0, 0, canvasEl.width, canvasEl.height), + data = imageData.data, + max, adjust = -this.saturate * 0.01; + + for (var i = 0, len = data.length; i < len; i += 4) { + max = Math.max(data[i], data[i + 1], data[i + 2]); + data[i] += max !== data[i] ? (max - data[i]) * adjust : 0; + data[i + 1] += max !== data[i + 1] ? (max - data[i + 1]) * adjust : 0; + data[i + 2] += max !== data[i + 2] ? (max - data[i + 2]) * adjust : 0; + } + + context.putImageData(imageData, 0, 0); + }, + + /** + * Returns object representation of an instance + * @return {Object} Object representation of an instance + */ + toObject: function() { + return extend(this.callSuper('toObject'), { + saturate: this.saturate + }); + } + }); + + /** + * Returns filter instance from an object representation + * @static + * @param {Object} object Object to create an instance from + * @return {fabric.Image.filters.Saturate} Instance of fabric.Image.filters.Saturate + */ + fabric.Image.filters.Saturate.fromObject = function(object) { + return new fabric.Image.filters.Saturate(object); + }; + +})(typeof exports !== 'undefined' ? exports : this); + + +(function(global) { + + 'use strict'; + + var fabric = global.fabric || (global.fabric = { }), + extend = fabric.util.object.extend, + clone = fabric.util.object.clone, + toFixed = fabric.util.toFixed, + NUM_FRACTION_DIGITS = fabric.Object.NUM_FRACTION_DIGITS, + MIN_TEXT_WIDTH = 2; + + if (fabric.Text) { + fabric.warn('fabric.Text is already defined'); + return; + } + + var stateProperties = fabric.Object.prototype.stateProperties.concat(); + stateProperties.push( + 'fontFamily', + 'fontWeight', + 'fontSize', + 'text', + 'textDecoration', + 'textAlign', + 'fontStyle', + 'lineHeight', + 'textBackgroundColor' + ); + + /** + * Text class + * @class fabric.Text + * @extends fabric.Object + * @return {fabric.Text} thisArg + * @tutorial {@link http://fabricjs.com/fabric-intro-part-2#text} + * @see {@link fabric.Text#initialize} for constructor definition + */ + fabric.Text = fabric.util.createClass(fabric.Object, /** @lends fabric.Text.prototype */ { + + /** + * Properties which when set cause object to change dimensions + * @type Object + * @private + */ + _dimensionAffectingProps: { + fontSize: true, + fontWeight: true, + fontFamily: true, + fontStyle: true, + lineHeight: true, + text: true, + charSpacing: true, + textAlign: true, + strokeWidth: false, + }, + + /** + * @private + */ + _reNewline: /\r?\n/, + + /** + * Use this regular expression to filter for whitespace that is not a new line. + * Mostly used when text is 'justify' aligned. + * @private + */ + _reSpacesAndTabs: /[ \t\r]+/g, + + /** + * Retrieves object's fontSize + * @method getFontSize + * @memberOf fabric.Text.prototype + * @return {String} Font size (in pixels) + */ + + /** + * Sets object's fontSize + * Does not update the object .width and .height, + * call ._initDimensions() to update the values. + * @method setFontSize + * @memberOf fabric.Text.prototype + * @param {Number} fontSize Font size (in pixels) + * @return {fabric.Text} + * @chainable + */ + + /** + * Retrieves object's fontWeight + * @method getFontWeight + * @memberOf fabric.Text.prototype + * @return {(String|Number)} Font weight + */ + + /** + * Sets object's fontWeight + * Does not update the object .width and .height, + * call ._initDimensions() to update the values. + * @method setFontWeight + * @memberOf fabric.Text.prototype + * @param {(Number|String)} fontWeight Font weight + * @return {fabric.Text} + * @chainable + */ + + /** + * Retrieves object's fontFamily + * @method getFontFamily + * @memberOf fabric.Text.prototype + * @return {String} Font family + */ + + /** + * Sets object's fontFamily + * Does not update the object .width and .height, + * call ._initDimensions() to update the values. + * @method setFontFamily + * @memberOf fabric.Text.prototype + * @param {String} fontFamily Font family + * @return {fabric.Text} + * @chainable + */ + + /** + * Retrieves object's text + * @method getText + * @memberOf fabric.Text.prototype + * @return {String} text + */ + + /** + * Sets object's text + * Does not update the object .width and .height, + * call ._initDimensions() to update the values. + * @method setText + * @memberOf fabric.Text.prototype + * @param {String} text Text + * @return {fabric.Text} + * @chainable + */ + + /** + * Retrieves object's textDecoration + * @method getTextDecoration + * @memberOf fabric.Text.prototype + * @return {String} Text decoration + */ + + /** + * Sets object's textDecoration + * @method setTextDecoration + * @memberOf fabric.Text.prototype + * @param {String} textDecoration Text decoration + * @return {fabric.Text} + * @chainable + */ + + /** + * Retrieves object's fontStyle + * @method getFontStyle + * @memberOf fabric.Text.prototype + * @return {String} Font style + */ + + /** + * Sets object's fontStyle + * Does not update the object .width and .height, + * call ._initDimensions() to update the values. + * @method setFontStyle + * @memberOf fabric.Text.prototype + * @param {String} fontStyle Font style + * @return {fabric.Text} + * @chainable + */ + + /** + * Retrieves object's lineHeight + * @method getLineHeight + * @memberOf fabric.Text.prototype + * @return {Number} Line height + */ + + /** + * Sets object's lineHeight + * @method setLineHeight + * @memberOf fabric.Text.prototype + * @param {Number} lineHeight Line height + * @return {fabric.Text} + * @chainable + */ + + /** + * Retrieves object's textAlign + * @method getTextAlign + * @memberOf fabric.Text.prototype + * @return {String} Text alignment + */ + + /** + * Sets object's textAlign + * @method setTextAlign + * @memberOf fabric.Text.prototype + * @param {String} textAlign Text alignment + * @return {fabric.Text} + * @chainable + */ + + /** + * Retrieves object's textBackgroundColor + * @method getTextBackgroundColor + * @memberOf fabric.Text.prototype + * @return {String} Text background color + */ + + /** + * Sets object's textBackgroundColor + * @method setTextBackgroundColor + * @memberOf fabric.Text.prototype + * @param {String} textBackgroundColor Text background color + * @return {fabric.Text} + * @chainable + */ + + /** + * Type of an object + * @type String + * @default + */ + type: 'text', + + /** + * Font size (in pixels) + * @type Number + * @default + */ + fontSize: 40, + + /** + * Font weight (e.g. bold, normal, 400, 600, 800) + * @type {(Number|String)} + * @default + */ + fontWeight: 'normal', + + /** + * Font family + * @type String + * @default + */ + fontFamily: 'Times New Roman', + + /** + * Text decoration Possible values: "", "underline", "overline" or "line-through". + * @type String + * @default + */ + textDecoration: '', + + /** + * Text alignment. Possible values: "left", "center", "right" or "justify". + * @type String + * @default + */ + textAlign: 'left', + + /** + * Font style . Possible values: "", "normal", "italic" or "oblique". + * @type String + * @default + */ + fontStyle: '', + + /** + * Line height + * @type Number + * @default + */ + lineHeight: 1.16, + + /** + * Background color of text lines + * @type String + * @default + */ + textBackgroundColor: '', + + /** + * List of properties to consider when checking if + * state of an object is changed ({@link fabric.Object#hasStateChanged}) + * as well as for history (undo/redo) purposes + * @type Array + */ + stateProperties: stateProperties, + + /** + * When defined, an object is rendered via stroke and this property specifies its color. + * Backwards incompatibility note: This property was named "strokeStyle" until v1.1.6 + * @type String + * @default + */ + stroke: null, + + /** + * Shadow object representing shadow of this shape. + * Backwards incompatibility note: This property was named "textShadow" (String) until v1.2.11 + * @type fabric.Shadow + * @default + */ + shadow: null, + + /** + * @private + */ + _fontSizeFraction: 0.25, + + /** + * Text Line proportion to font Size (in pixels) + * @type Number + * @default + */ + _fontSizeMult: 1.13, + + /** + * additional space between characters + * expressed in thousands of em unit + * @type Number + * @default + */ + charSpacing: 0, + + /** + * Constructor + * @param {String} text Text string + * @param {Object} [options] Options object + * @return {fabric.Text} thisArg + */ + initialize: function(text, options) { + options = options || { }; + this.text = text; + this.__skipDimension = true; + this.setOptions(options); + this.__skipDimension = false; + this._initDimensions(); + }, + + /** + * Initialize text dimensions. Render all text on given context + * or on a offscreen canvas to get the text width with measureText. + * Updates this.width and this.height with the proper values. + * Does not return dimensions. + * @param {CanvasRenderingContext2D} [ctx] Context to render on + * @private + */ + _initDimensions: function(ctx) { + if (this.__skipDimension) { + return; + } + if (!ctx) { + ctx = fabric.util.createCanvasElement().getContext('2d'); + this._setTextStyles(ctx); + } + this._textLines = this._splitTextIntoLines(); + this._clearCache(); + this.width = this._getTextWidth(ctx) || this.cursorWidth || MIN_TEXT_WIDTH; + this.height = this._getTextHeight(ctx); + }, + + /** + * Returns string representation of an instance + * @return {String} String representation of text object + */ + toString: function() { + return '#'; + }, + + /** + * @private + * @param {CanvasRenderingContext2D} ctx Context to render on + */ + _render: function(ctx) { + this.clipTo && fabric.util.clipContext(this, ctx); + this._setOpacity(ctx); + this._setShadow(ctx); + this._setupCompositeOperation(ctx); + this._renderTextBackground(ctx); + this._setStrokeStyles(ctx); + this._setFillStyles(ctx); + this._renderText(ctx); + this._renderTextDecoration(ctx); + this.clipTo && ctx.restore(); + }, + + /** + * @private + * @param {CanvasRenderingContext2D} ctx Context to render on + */ + _renderText: function(ctx) { + this._renderTextFill(ctx); + this._renderTextStroke(ctx); + }, + + /** + * @private + * @param {CanvasRenderingContext2D} ctx Context to render on + */ + _setTextStyles: function(ctx) { + ctx.textBaseline = 'alphabetic'; + ctx.font = this._getFontDeclaration(); + }, + + /** + * @private + * @return {Number} Height of fabric.Text object + */ + _getTextHeight: function() { + return this._getHeightOfSingleLine() + (this._textLines.length - 1) * this._getHeightOfLine(); + }, + + /** + * @private + * @param {CanvasRenderingContext2D} ctx Context to render on + * @return {Number} Maximum width of fabric.Text object + */ + _getTextWidth: function(ctx) { + var maxWidth = this._getLineWidth(ctx, 0); + + for (var i = 1, len = this._textLines.length; i < len; i++) { + var currentLineWidth = this._getLineWidth(ctx, i); + if (currentLineWidth > maxWidth) { + maxWidth = currentLineWidth; + } + } + return maxWidth; + }, + + /* + * Calculate object dimensions from its properties + * @override + * @private + */ + _getNonTransformedDimensions: function() { + return { x: this.width, y: this.height }; + }, + + /** + * @private + * @param {String} method Method name ("fillText" or "strokeText") + * @param {CanvasRenderingContext2D} ctx Context to render on + * @param {String} chars Chars to render + * @param {Number} left Left position of text + * @param {Number} top Top position of text + */ + _renderChars: function(method, ctx, chars, left, top) { + // remove Text word from method var + var shortM = method.slice(0, -4), char, width; + if (this[shortM].toLive) { + var offsetX = -this.width / 2 + this[shortM].offsetX || 0, + offsetY = -this.height / 2 + this[shortM].offsetY || 0; + ctx.save(); + ctx.translate(offsetX, offsetY); + left -= offsetX; + top -= offsetY; + } + if (this.charSpacing !== 0) { + var additionalSpace = this._getWidthOfCharSpacing(); + chars = chars.split(''); + for (var i = 0, len = chars.length; i < len; i++) { + char = chars[i]; + width = ctx.measureText(char).width + additionalSpace; + ctx[method](char, left, top); + left += width > 0 ? width : 0; + } + } + else { + ctx[method](chars, left, top); + } + this[shortM].toLive && ctx.restore(); + }, + + /** + * @private + * @param {String} method Method name ("fillText" or "strokeText") + * @param {CanvasRenderingContext2D} ctx Context to render on + * @param {String} line Text to render + * @param {Number} left Left position of text + * @param {Number} top Top position of text + * @param {Number} lineIndex Index of a line in a text + */ + _renderTextLine: function(method, ctx, line, left, top, lineIndex) { + // lift the line by quarter of fontSize + top -= this.fontSize * this._fontSizeFraction; + + // short-circuit + var lineWidth = this._getLineWidth(ctx, lineIndex); + if (this.textAlign !== 'justify' || this.width < lineWidth) { + this._renderChars(method, ctx, line, left, top, lineIndex); + return; + } + + // stretch the line + var words = line.split(/\s+/), + charOffset = 0, + wordsWidth = this._getWidthOfWords(ctx, words.join(''), lineIndex, 0), + widthDiff = this.width - wordsWidth, + numSpaces = words.length - 1, + spaceWidth = numSpaces > 0 ? widthDiff / numSpaces : 0, + leftOffset = 0, word; + + for (var i = 0, len = words.length; i < len; i++) { + while (line[charOffset] === ' ' && charOffset < line.length) { + charOffset++; + } + word = words[i]; + this._renderChars(method, ctx, word, left + leftOffset, top, lineIndex, charOffset); + leftOffset += this._getWidthOfWords(ctx, word, lineIndex, charOffset) + spaceWidth; + charOffset += word.length; + } + }, + + /** + * @private + * @param {CanvasRenderingContext2D} ctx Context to render on + * @param {String} word + */ + _getWidthOfWords: function (ctx, word) { + var width = ctx.measureText(word).width, charCount, additionalSpace; + if (this.charSpacing !== 0) { + charCount = word.split('').length; + additionalSpace = charCount * this._getWidthOfCharSpacing(); + width += additionalSpace; + } + return width > 0 ? width : 0; + }, + + /** + * @private + * @return {Number} Left offset + */ + _getLeftOffset: function() { + return -this.width / 2; + }, + + /** + * @private + * @return {Number} Top offset + */ + _getTopOffset: function() { + return -this.height / 2; + }, + + /** + * Returns true because text has no style + */ + isEmptyStyles: function() { + return true; + }, + + /** + * @private + * @param {CanvasRenderingContext2D} ctx Context to render on + * @param {String} method Method name ("fillText" or "strokeText") + */ + _renderTextCommon: function(ctx, method) { + + var lineHeights = 0, left = this._getLeftOffset(), top = this._getTopOffset(); + + for (var i = 0, len = this._textLines.length; i < len; i++) { + var heightOfLine = this._getHeightOfLine(ctx, i), + maxHeight = heightOfLine / this.lineHeight, + lineWidth = this._getLineWidth(ctx, i), + leftOffset = this._getLineLeftOffset(lineWidth); + this._renderTextLine( + method, + ctx, + this._textLines[i], + left + leftOffset, + top + lineHeights + maxHeight, + i + ); + lineHeights += heightOfLine; + } + }, + + /** + * @private + * @param {CanvasRenderingContext2D} ctx Context to render on + */ + _renderTextFill: function(ctx) { + if (!this.fill && this.isEmptyStyles()) { + return; + } + + this._renderTextCommon(ctx, 'fillText'); + }, + + /** + * @private + * @param {CanvasRenderingContext2D} ctx Context to render on + */ + _renderTextStroke: function(ctx) { + if ((!this.stroke || this.strokeWidth === 0) && this.isEmptyStyles()) { + return; + } + + if (this.shadow && !this.shadow.affectStroke) { + this._removeShadow(ctx); + } + + ctx.save(); + this._setLineDash(ctx, this.strokedashArray); + ctx.beginPath(); + this._renderTextCommon(ctx, 'strokeText'); + ctx.closePath(); + ctx.restore(); + }, + + /** + * @private + * @return {Number} height of line + */ + _getHeightOfLine: function() { + return this._getHeightOfSingleLine() * this.lineHeight; + }, + + /** + * @private + * @return {Number} height of line without lineHeight + */ + _getHeightOfSingleLine: function() { + return this.fontSize * this._fontSizeMult; + }, + + /** + * @private + * @param {CanvasRenderingContext2D} ctx Context to render on + */ + _renderTextBackground: function(ctx) { + this._renderBackground(ctx); + this._renderTextLinesBackground(ctx); + }, + + /** + * @private + * @param {CanvasRenderingContext2D} ctx Context to render on + */ + _renderTextLinesBackground: function(ctx) { + if (!this.textBackgroundColor) { + return; + } + var lineTopOffset = 0, heightOfLine, + lineWidth, lineLeftOffset; + + ctx.fillStyle = this.textBackgroundColor; + for (var i = 0, len = this._textLines.length; i < len; i++) { + heightOfLine = this._getHeightOfLine(ctx, i); + lineWidth = this._getLineWidth(ctx, i); + if (lineWidth > 0) { + lineLeftOffset = this._getLineLeftOffset(lineWidth); + ctx.fillRect( + this._getLeftOffset() + lineLeftOffset, + this._getTopOffset() + lineTopOffset, + lineWidth, + heightOfLine / this.lineHeight + ); + } + lineTopOffset += heightOfLine; + } + // if there is text background color no + // other shadows should be casted + this._removeShadow(ctx); + }, + + /** + * @private + * @param {Number} lineWidth Width of text line + * @return {Number} Line left offset + */ + _getLineLeftOffset: function(lineWidth) { + if (this.textAlign === 'center') { + return (this.width - lineWidth) / 2; + } + if (this.textAlign === 'right') { + return this.width - lineWidth; + } + return 0; + }, + + /** + * @private + */ + _clearCache: function() { + this.__lineWidths = []; + this.__lineHeights = []; + }, + + /** + * @private + */ + _shouldClearCache: function() { + var shouldClear = false; + if (this._forceClearCache) { + this._forceClearCache = false; + return true; + } + for (var prop in this._dimensionAffectingProps) { + if (this['__' + prop] !== this[prop]) { + this['__' + prop] = this[prop]; + shouldClear = true; + } + } + return shouldClear; + }, + + /** + * @private + * @param {CanvasRenderingContext2D} ctx Context to render on + * @param {Number} lineIndex line number + * @return {Number} Line width + */ + _getLineWidth: function(ctx, lineIndex) { + if (this.__lineWidths[lineIndex]) { + return this.__lineWidths[lineIndex] === -1 ? this.width : this.__lineWidths[lineIndex]; + } + + var width, wordCount, line = this._textLines[lineIndex]; + + if (line === '') { + width = 0; + } + else { + width = this._measureLine(ctx, lineIndex); + } + this.__lineWidths[lineIndex] = width; + + if (width && this.textAlign === 'justify') { + wordCount = line.split(/\s+/); + if (wordCount.length > 1) { + this.__lineWidths[lineIndex] = -1; + } + } + return width; + }, + + _getWidthOfCharSpacing: function() { + if (this.charSpacing !== 0) { + return this.fontSize * this.charSpacing / 1000; + } + return 0; + }, + + /** + * @private + * @param {CanvasRenderingContext2D} ctx Context to render on + * @param {Number} lineIndex line number + * @return {Number} Line width + */ + _measureLine: function(ctx, lineIndex) { + var line = this._textLines[lineIndex], + width = ctx.measureText(line).width, + additionalSpace = 0, charCount, finalWidth; + if (this.charSpacing !== 0) { + charCount = line.split('').length; + additionalSpace = (charCount - 1) * this._getWidthOfCharSpacing(); + } + finalWidth = width + additionalSpace; + return finalWidth > 0 ? finalWidth : 0; + }, + + /** + * @private + * @param {CanvasRenderingContext2D} ctx Context to render on + */ + _renderTextDecoration: function(ctx) { + if (!this.textDecoration) { + return; + } + var halfOfVerticalBox = this.height / 2, + _this = this, offsets = []; + + /** @ignore */ + function renderLinesAtOffset(offsets) { + var i, lineHeight = 0, len, j, oLen, lineWidth, + lineLeftOffset, heightOfLine; + + for (i = 0, len = _this._textLines.length; i < len; i++) { + + lineWidth = _this._getLineWidth(ctx, i); + lineLeftOffset = _this._getLineLeftOffset(lineWidth); + heightOfLine = _this._getHeightOfLine(ctx, i); + + for (j = 0, oLen = offsets.length; j < oLen; j++) { + ctx.fillRect( + _this._getLeftOffset() + lineLeftOffset, + lineHeight + (_this._fontSizeMult - 1 + offsets[j] ) * _this.fontSize - halfOfVerticalBox, + lineWidth, + _this.fontSize / 15); + } + lineHeight += heightOfLine; + } + } + + if (this.textDecoration.indexOf('underline') > -1) { + offsets.push(0.85); // 1 - 3/16 + } + if (this.textDecoration.indexOf('line-through') > -1) { + offsets.push(0.43); + } + if (this.textDecoration.indexOf('overline') > -1) { + offsets.push(-0.12); + } + if (offsets.length > 0) { + renderLinesAtOffset(offsets); + } + }, + + /** + * return font declaration string for canvas context + * @returns {String} font declaration formatted for canvas context. + */ + _getFontDeclaration: function() { + return [ + // node-canvas needs "weight style", while browsers need "style weight" + (fabric.isLikelyNode ? this.fontWeight : this.fontStyle), + (fabric.isLikelyNode ? this.fontStyle : this.fontWeight), + this.fontSize + 'px', + (fabric.isLikelyNode ? ('"' + this.fontFamily + '"') : this.fontFamily) + ].join(' '); + }, + + /** + * Renders text instance on a specified context + * @param {CanvasRenderingContext2D} ctx Context to render on + * @param {Boolean} noTransform + */ + render: function(ctx, noTransform) { + // do not render if object is not visible + if (!this.visible) { + return; + } + + ctx.save(); + this._setTextStyles(ctx); + + if (this._shouldClearCache()) { + this._initDimensions(ctx); + } + this.drawSelectionBackground(ctx); + if (!noTransform) { + this.transform(ctx); + } + if (this.transformMatrix) { + ctx.transform.apply(ctx, this.transformMatrix); + } + if (this.group && this.group.type === 'path-group') { + ctx.translate(this.left, this.top); + } + this._render(ctx); + ctx.restore(); + }, + + /** + * Returns the text as an array of lines. + * @returns {Array} Lines in the text + */ + _splitTextIntoLines: function() { + return this.text.split(this._reNewline); + }, + + /** + * Returns object representation of an instance + * @param {Array} [propertiesToInclude] Any properties that you might want to additionally include in the output + * @return {Object} Object representation of an instance + */ + toObject: function(propertiesToInclude) { + var object = extend(this.callSuper('toObject', propertiesToInclude), { + text: this.text, + fontSize: this.fontSize, + fontWeight: this.fontWeight, + fontFamily: this.fontFamily, + fontStyle: this.fontStyle, + lineHeight: this.lineHeight, + textDecoration: this.textDecoration, + textAlign: this.textAlign, + textBackgroundColor: this.textBackgroundColor, + charSpacing: this.charSpacing + }); + if (!this.includeDefaultValues) { + this._removeDefaultValues(object); + } + return object; + }, + + /* _TO_SVG_START_ */ + /** + * Returns SVG representation of an instance + * @param {Function} [reviver] Method for further parsing of svg representation. + * @return {String} svg representation of an instance + */ + toSVG: function(reviver) { + if (!this.ctx) { + this.ctx = fabric.util.createCanvasElement().getContext('2d'); + } + var markup = this._createBaseSVGMarkup(), + offsets = this._getSVGLeftTopOffsets(this.ctx), + textAndBg = this._getSVGTextAndBg(offsets.textTop, offsets.textLeft); + this._wrapSVGTextAndBg(markup, textAndBg); + + return reviver ? reviver(markup.join('')) : markup.join(''); + }, + + /** + * @private + */ + _getSVGLeftTopOffsets: function(ctx) { + var lineTop = this._getHeightOfLine(ctx, 0), + textLeft = -this.width / 2, + textTop = 0; + + return { + textLeft: textLeft + (this.group && this.group.type === 'path-group' ? this.left : 0), + textTop: textTop + (this.group && this.group.type === 'path-group' ? -this.top : 0), + lineTop: lineTop + }; + }, + + /** + * @private + */ + _wrapSVGTextAndBg: function(markup, textAndBg) { + var noShadow = true, filter = this.getSvgFilter(), + style = filter === '' ? '' : ' style="' + filter + '"'; + + markup.push( + '\t\n', + textAndBg.textBgRects.join(''), + '\t\t\n', + textAndBg.textSpans.join(''), + '\t\t\n', + '\t\n' + ); + }, + + /** + * @private + * @param {Number} textTopOffset Text top offset + * @param {Number} textLeftOffset Text left offset + * @return {Object} + */ + _getSVGTextAndBg: function(textTopOffset, textLeftOffset) { + var textSpans = [], + textBgRects = [], + height = 0; + // bounding-box background + this._setSVGBg(textBgRects); + + // text and text-background + for (var i = 0, len = this._textLines.length; i < len; i++) { + if (this.textBackgroundColor) { + this._setSVGTextLineBg(textBgRects, i, textLeftOffset, textTopOffset, height); + } + this._setSVGTextLineText(i, textSpans, height, textLeftOffset, textTopOffset, textBgRects); + height += this._getHeightOfLine(this.ctx, i); + } + + return { + textSpans: textSpans, + textBgRects: textBgRects + }; + }, + + _setSVGTextLineText: function(i, textSpans, height, textLeftOffset, textTopOffset) { + var yPos = this.fontSize * (this._fontSizeMult - this._fontSizeFraction) + - textTopOffset + height - this.height / 2; + if (this.textAlign === 'justify') { + // i call from here to do not intefere with IText + this._setSVGTextLineJustifed(i, textSpans, yPos, textLeftOffset); + return; + } + textSpans.push( + '\t\t\t elements since setting opacity + // on containing one doesn't work in Illustrator + this._getFillAttributes(this.fill), '>', + fabric.util.string.escapeXml(this._textLines[i]), + '\n' + ); + }, + + _setSVGTextLineJustifed: function(i, textSpans, yPos, textLeftOffset) { + var ctx = fabric.util.createCanvasElement().getContext('2d'); + + this._setTextStyles(ctx); + + var line = this._textLines[i], + words = line.split(/\s+/), + wordsWidth = this._getWidthOfWords(ctx, words.join('')), + widthDiff = this.width - wordsWidth, + numSpaces = words.length - 1, + spaceWidth = numSpaces > 0 ? widthDiff / numSpaces : 0, + word, attributes = this._getFillAttributes(this.fill), + len; + + textLeftOffset += this._getLineLeftOffset(this._getLineWidth(ctx, i)); + + for (i = 0, len = words.length; i < len; i++) { + word = words[i]; + textSpans.push( + '\t\t\t elements since setting opacity + // on containing one doesn't work in Illustrator + attributes, '>', + fabric.util.string.escapeXml(word), + '\n' + ); + textLeftOffset += this._getWidthOfWords(ctx, word) + spaceWidth; + } + }, + + _setSVGTextLineBg: function(textBgRects, i, textLeftOffset, textTopOffset, height) { + textBgRects.push( + '\t\t\n'); + }, + + _setSVGBg: function(textBgRects) { + if (this.backgroundColor) { + textBgRects.push( + '\t\t\n'); + } + }, + + /** + * Adobe Illustrator (at least CS5) is unable to render rgba()-based fill values + * we work around it by "moving" alpha channel into opacity attribute and setting fill's alpha to 1 + * + * @private + * @param {*} value + * @return {String} + */ + _getFillAttributes: function(value) { + var fillColor = (value && typeof value === 'string') ? new fabric.Color(value) : ''; + if (!fillColor || !fillColor.getSource() || fillColor.getAlpha() === 1) { + return 'fill="' + value + '"'; + } + return 'opacity="' + fillColor.getAlpha() + '" fill="' + fillColor.setAlpha(1).toRgb() + '"'; + }, + /* _TO_SVG_END_ */ + + /** + * Sets specified property to a specified value + * @param {String} key + * @param {*} value + * @return {fabric.Text} thisArg + * @chainable + */ + _set: function(key, value) { + this.callSuper('_set', key, value); + + if (key in this._dimensionAffectingProps) { + this._initDimensions(); + this.setCoords(); + } + }, + + /** + * Returns complexity of an instance + * @return {Number} complexity + */ + complexity: function() { + return 1; + } + }); + + /* _FROM_SVG_START_ */ + /** + * List of attribute names to account for when parsing SVG element (used by {@link fabric.Text.fromElement}) + * @static + * @memberOf fabric.Text + * @see: http://www.w3.org/TR/SVG/text.html#TextElement + */ + fabric.Text.ATTRIBUTE_NAMES = fabric.SHARED_ATTRIBUTES.concat( + 'x y dx dy font-family font-style font-weight font-size text-decoration text-anchor'.split(' ')); + + /** + * Default SVG font size + * @static + * @memberOf fabric.Text + */ + fabric.Text.DEFAULT_SVG_FONT_SIZE = 16; + + /** + * Returns fabric.Text instance from an SVG element (not yet implemented) + * @static + * @memberOf fabric.Text + * @param {SVGElement} element Element to parse + * @param {Object} [options] Options object + * @return {fabric.Text} Instance of fabric.Text + */ + fabric.Text.fromElement = function(element, options) { + if (!element) { + return null; + } + + var parsedAttributes = fabric.parseAttributes(element, fabric.Text.ATTRIBUTE_NAMES); + options = fabric.util.object.extend((options ? fabric.util.object.clone(options) : { }), parsedAttributes); + + options.top = options.top || 0; + options.left = options.left || 0; + if ('dx' in parsedAttributes) { + options.left += parsedAttributes.dx; + } + if ('dy' in parsedAttributes) { + options.top += parsedAttributes.dy; + } + if (!('fontSize' in options)) { + options.fontSize = fabric.Text.DEFAULT_SVG_FONT_SIZE; + } + + if (!options.originX) { + options.originX = 'left'; + } + + var textContent = ''; + + // The XML is not properly parsed in IE9 so a workaround to get + // textContent is through firstChild.data. Another workaround would be + // to convert XML loaded from a file to be converted using DOMParser (same way loadSVGFromString() does) + if (!('textContent' in element)) { + if ('firstChild' in element && element.firstChild !== null) { + if ('data' in element.firstChild && element.firstChild.data !== null) { + textContent = element.firstChild.data; + } + } + } + else { + textContent = element.textContent; + } + + textContent = textContent.replace(/^\s+|\s+$|\n+/g, '').replace(/\s+/g, ' '); + + var text = new fabric.Text(textContent, options), + textHeightScaleFactor = text.getHeight() / text.height, + lineHeightDiff = (text.height + text.strokeWidth) * text.lineHeight - text.height, + scaledDiff = lineHeightDiff * textHeightScaleFactor, + textHeight = text.getHeight() + scaledDiff, + offX = 0; + /* + Adjust positioning: + x/y attributes in SVG correspond to the bottom-left corner of text bounding box + top/left properties in Fabric correspond to center point of text bounding box + */ + if (text.originX === 'left') { + offX = text.getWidth() / 2; + } + if (text.originX === 'right') { + offX = -text.getWidth() / 2; + } + text.set({ + left: text.getLeft() + offX, + top: text.getTop() - textHeight / 2 + text.fontSize * (0.18 + text._fontSizeFraction) / text.lineHeight /* 0.3 is the old lineHeight */ + }); + + return text; + }; + /* _FROM_SVG_END_ */ + + /** + * Returns fabric.Text instance from an object representation + * @static + * @memberOf fabric.Text + * @param {Object} object Object to create an instance from + * @param {Function} [callback] Callback to invoke when an fabric.Text instance is created + * @return {fabric.Text} Instance of fabric.Text + */ + fabric.Text.fromObject = function(object, callback) { + var text = new fabric.Text(object.text, clone(object)); + callback && callback(text); + return text; + }; + + fabric.util.createAccessors(fabric.Text); + +})(typeof exports !== 'undefined' ? exports : this); + + +(function() { + + var clone = fabric.util.object.clone; + + /** + * IText class (introduced in v1.4) Events are also fired with "text:" + * prefix when observing canvas. + * @class fabric.IText + * @extends fabric.Text + * @mixes fabric.Observable + * + * @fires changed + * @fires selection:changed + * @fires editing:entered + * @fires editing:exited + * + * @return {fabric.IText} thisArg + * @see {@link fabric.IText#initialize} for constructor definition + * + *

Supported key combinations:

+ *
+   *   Move cursor:                    left, right, up, down
+   *   Select character:               shift + left, shift + right
+   *   Select text vertically:         shift + up, shift + down
+   *   Move cursor by word:            alt + left, alt + right
+   *   Select words:                   shift + alt + left, shift + alt + right
+   *   Move cursor to line start/end:  cmd + left, cmd + right or home, end
+   *   Select till start/end of line:  cmd + shift + left, cmd + shift + right or shift + home, shift + end
+   *   Jump to start/end of text:      cmd + up, cmd + down
+   *   Select till start/end of text:  cmd + shift + up, cmd + shift + down or shift + pgUp, shift + pgDown
+   *   Delete character:               backspace
+   *   Delete word:                    alt + backspace
+   *   Delete line:                    cmd + backspace
+   *   Forward delete:                 delete
+   *   Copy text:                      ctrl/cmd + c
+   *   Paste text:                     ctrl/cmd + v
+   *   Cut text:                       ctrl/cmd + x
+   *   Select entire text:             ctrl/cmd + a
+   *   Quit editing                    tab or esc
+   * 
+ * + *

Supported mouse/touch combination

+ *
+   *   Position cursor:                click/touch
+   *   Create selection:               click/touch & drag
+   *   Create selection:               click & shift + click
+   *   Select word:                    double click
+   *   Select line:                    triple click
+   * 
+ */ + fabric.IText = fabric.util.createClass(fabric.Text, fabric.Observable, /** @lends fabric.IText.prototype */ { + + /** + * Type of an object + * @type String + * @default + */ + type: 'i-text', + + /** + * Index where text selection starts (or where cursor is when there is no selection) + * @type Number + * @default + */ + selectionStart: 0, + + /** + * Index where text selection ends + * @type Number + * @default + */ + selectionEnd: 0, + + /** + * Color of text selection + * @type String + * @default + */ + selectionColor: 'rgba(17,119,255,0.3)', + + /** + * Indicates whether text is in editing mode + * @type Boolean + * @default + */ + isEditing: false, + + /** + * Indicates whether a text can be edited + * @type Boolean + * @default + */ + editable: true, + + /** + * Border color of text object while it's in editing mode + * @type String + * @default + */ + editingBorderColor: 'rgba(102,153,255,0.25)', + + /** + * Width of cursor (in px) + * @type Number + * @default + */ + cursorWidth: 2, + + /** + * Color of default cursor (when not overwritten by character style) + * @type String + * @default + */ + cursorColor: '#333', + + /** + * Delay between cursor blink (in ms) + * @type Number + * @default + */ + cursorDelay: 1000, + + /** + * Duration of cursor fadein (in ms) + * @type Number + * @default + */ + cursorDuration: 600, + + /** + * Object containing character styles + * (where top-level properties corresponds to line number and 2nd-level properties -- to char number in a line) + * @type Object + * @default + */ + styles: null, + + /** + * Indicates whether internal text char widths can be cached + * @type Boolean + * @default + */ + caching: true, + + /** + * @private + */ + _reSpace: /\s|\n/, + + /** + * @private + */ + _currentCursorOpacity: 0, + + /** + * @private + */ + _selectionDirection: null, + + /** + * @private + */ + _abortCursorAnimation: false, + + /** + * @private + */ + __widthOfSpace: [], + + /** + * Constructor + * @param {String} text Text string + * @param {Object} [options] Options object + * @return {fabric.IText} thisArg + */ + initialize: function(text, options) { + this.styles = options ? (options.styles || { }) : { }; + this.callSuper('initialize', text, options); + this.initBehavior(); + }, + + /** + * @private + */ + _clearCache: function() { + this.callSuper('_clearCache'); + this.__widthOfSpace = []; + }, + + /** + * Returns true if object has no styling + */ + isEmptyStyles: function() { + if (!this.styles) { + return true; + } + var obj = this.styles; + + for (var p1 in obj) { + for (var p2 in obj[p1]) { + // eslint-disable-next-line no-unused-vars + for (var p3 in obj[p1][p2]) { + return false; + } + } + } + return true; + }, + + /** + * Sets selection start (left boundary of a selection) + * @param {Number} index Index to set selection start to + */ + setSelectionStart: function(index) { + index = Math.max(index, 0); + this._updateAndFire('selectionStart', index); + }, + + /** + * Sets selection end (right boundary of a selection) + * @param {Number} index Index to set selection end to + */ + setSelectionEnd: function(index) { + index = Math.min(index, this.text.length); + this._updateAndFire('selectionEnd', index); + }, + + /** + * @private + * @param {String} property 'selectionStart' or 'selectionEnd' + * @param {Number} index new position of property + */ + _updateAndFire: function(property, index) { + if (this[property] !== index) { + this._fireSelectionChanged(); + this[property] = index; + } + this._updateTextarea(); + }, + + /** + * Fires the even of selection changed + * @private + */ + _fireSelectionChanged: function() { + this.fire('selection:changed'); + this.canvas && this.canvas.fire('text:selection:changed', { target: this }); + }, + + /** + * Gets style of a current selection/cursor (at the start position) + * @param {Number} [startIndex] Start index to get styles at + * @param {Number} [endIndex] End index to get styles at + * @return {Object} styles Style object at a specified (or current) index + */ + getSelectionStyles: function(startIndex, endIndex) { + + if (arguments.length === 2) { + var styles = []; + for (var i = startIndex; i < endIndex; i++) { + styles.push(this.getSelectionStyles(i)); + } + return styles; + } + + var loc = this.get2DCursorLocation(startIndex), + style = this._getStyleDeclaration(loc.lineIndex, loc.charIndex); + + return style || {}; + }, + + /** + * Sets style of a current selection + * @param {Object} [styles] Styles object + * @return {fabric.IText} thisArg + * @chainable + */ + setSelectionStyles: function(styles) { + if (this.selectionStart === this.selectionEnd) { + this._extendStyles(this.selectionStart, styles); + } + else { + for (var i = this.selectionStart; i < this.selectionEnd; i++) { + this._extendStyles(i, styles); + } + } + /* not included in _extendStyles to avoid clearing cache more than once */ + this._forceClearCache = true; + return this; + }, + + /** + * @private + */ + _extendStyles: function(index, styles) { + var loc = this.get2DCursorLocation(index); + + if (!this._getLineStyle(loc.lineIndex)) { + this._setLineStyle(loc.lineIndex, {}); + } + + if (!this._getStyleDeclaration(loc.lineIndex, loc.charIndex)) { + this._setStyleDeclaration(loc.lineIndex, loc.charIndex, {}); + } + + fabric.util.object.extend(this._getStyleDeclaration(loc.lineIndex, loc.charIndex), styles); + }, + + /** + * @private + * @param {CanvasRenderingContext2D} ctx Context to render on + */ + _render: function(ctx) { + this.oldWidth = this.width; + this.oldHeight = this.height; + this.callSuper('_render', ctx); + this.ctx = ctx; + // clear the cursorOffsetCache, so we ensure to calculate once per renderCursor + // the correct position but not at every cursor animation. + this.cursorOffsetCache = { }; + this.renderCursorOrSelection(); + }, + + /** + * Renders cursor or selection (depending on what exists) + */ + renderCursorOrSelection: function() { + if (!this.active || !this.isEditing) { + return; + } + var chars = this.text.split(''), + boundaries, ctx; + if (this.canvas.contextTop) { + ctx = this.canvas.contextTop; + ctx.save(); + ctx.transform.apply(ctx, this.canvas.viewportTransform); + this.transform(ctx); + this.transformMatrix && ctx.transform.apply(ctx, this.transformMatrix); + this._clearTextArea(ctx); + } + else { + ctx = this.ctx; + ctx.save(); + } + if (this.selectionStart === this.selectionEnd) { + boundaries = this._getCursorBoundaries(chars, 'cursor'); + this.renderCursor(boundaries, ctx); + } + else { + boundaries = this._getCursorBoundaries(chars, 'selection'); + this.renderSelection(chars, boundaries, ctx); + } + + ctx.restore(); + }, + + _clearTextArea: function(ctx) { + // we add 4 pixel, to be sure to do not leave any pixel out + var width = this.oldWidth + 4, height = this.oldHeight + 4; + ctx.clearRect(-width / 2, -height / 2, width, height); + }, + /** + * Returns 2d representation (lineIndex and charIndex) of cursor (or selection start) + * @param {Number} [selectionStart] Optional index. When not given, current selectionStart is used. + */ + get2DCursorLocation: function(selectionStart) { + if (typeof selectionStart === 'undefined') { + selectionStart = this.selectionStart; + } + var len = this._textLines.length; + for (var i = 0; i < len; i++) { + if (selectionStart <= this._textLines[i].length) { + return { + lineIndex: i, + charIndex: selectionStart + }; + } + selectionStart -= this._textLines[i].length + 1; + } + return { + lineIndex: i - 1, + charIndex: this._textLines[i - 1].length < selectionStart ? this._textLines[i - 1].length : selectionStart + }; + }, + + /** + * Returns complete style of char at the current cursor + * @param {Number} lineIndex Line index + * @param {Number} charIndex Char index + * @return {Object} Character style + */ + getCurrentCharStyle: function(lineIndex, charIndex) { + var style = this._getStyleDeclaration(lineIndex, charIndex === 0 ? 0 : charIndex - 1); + + return { + fontSize: style && style.fontSize || this.fontSize, + fill: style && style.fill || this.fill, + textBackgroundColor: style && style.textBackgroundColor || this.textBackgroundColor, + textDecoration: style && style.textDecoration || this.textDecoration, + fontFamily: style && style.fontFamily || this.fontFamily, + fontWeight: style && style.fontWeight || this.fontWeight, + fontStyle: style && style.fontStyle || this.fontStyle, + stroke: style && style.stroke || this.stroke, + strokeWidth: style && style.strokeWidth || this.strokeWidth + }; + }, + + /** + * Returns fontSize of char at the current cursor + * @param {Number} lineIndex Line index + * @param {Number} charIndex Char index + * @return {Number} Character font size + */ + getCurrentCharFontSize: function(lineIndex, charIndex) { + var style = this._getStyleDeclaration(lineIndex, charIndex === 0 ? 0 : charIndex - 1); + return style && style.fontSize ? style.fontSize : this.fontSize; + }, + + /** + * Returns color (fill) of char at the current cursor + * @param {Number} lineIndex Line index + * @param {Number} charIndex Char index + * @return {String} Character color (fill) + */ + getCurrentCharColor: function(lineIndex, charIndex) { + var style = this._getStyleDeclaration(lineIndex, charIndex === 0 ? 0 : charIndex - 1); + return style && style.fill ? style.fill : this.cursorColor; + }, + + /** + * Returns cursor boundaries (left, top, leftOffset, topOffset) + * @private + * @param {Array} chars Array of characters + * @param {String} typeOfBoundaries + */ + _getCursorBoundaries: function(chars, typeOfBoundaries) { + + // left/top are left/top of entire text box + // leftOffset/topOffset are offset from that left/top point of a text box + + var left = Math.round(this._getLeftOffset()), + top = this._getTopOffset(), + + offsets = this._getCursorBoundariesOffsets( + chars, typeOfBoundaries); + + return { + left: left, + top: top, + leftOffset: offsets.left + offsets.lineLeft, + topOffset: offsets.top + }; + }, + + /** + * @private + */ + _getCursorBoundariesOffsets: function(chars, typeOfBoundaries) { + if (this.cursorOffsetCache && 'top' in this.cursorOffsetCache) { + return this.cursorOffsetCache; + } + var lineLeftOffset = 0, + lineIndex = 0, + charIndex = 0, + topOffset = 0, + leftOffset = 0, + boundaries; + + for (var i = 0; i < this.selectionStart; i++) { + if (chars[i] === '\n') { + leftOffset = 0; + topOffset += this._getHeightOfLine(this.ctx, lineIndex); + + lineIndex++; + charIndex = 0; + } + else { + leftOffset += this._getWidthOfChar(this.ctx, chars[i], lineIndex, charIndex); + charIndex++; + } + + lineLeftOffset = this._getLineLeftOffset(this._getLineWidth(this.ctx, lineIndex)); + } + if (typeOfBoundaries === 'cursor') { + topOffset += (1 - this._fontSizeFraction) * this._getHeightOfLine(this.ctx, lineIndex) / this.lineHeight + - this.getCurrentCharFontSize(lineIndex, charIndex) * (1 - this._fontSizeFraction); + } + if (this.charSpacing !== 0 && charIndex === this._textLines[lineIndex].length) { + leftOffset -= this._getWidthOfCharSpacing(); + } + boundaries = { + top: topOffset, + left: leftOffset > 0 ? leftOffset : 0, + lineLeft: lineLeftOffset + }; + this.cursorOffsetCache = boundaries; + return this.cursorOffsetCache; + }, + + /** + * Renders cursor + * @param {Object} boundaries + * @param {CanvasRenderingContext2D} ctx transformed context to draw on + */ + renderCursor: function(boundaries, ctx) { + + var cursorLocation = this.get2DCursorLocation(), + lineIndex = cursorLocation.lineIndex, + charIndex = cursorLocation.charIndex, + charHeight = this.getCurrentCharFontSize(lineIndex, charIndex), + leftOffset = (lineIndex === 0 && charIndex === 0) + ? this._getLineLeftOffset(this._getLineWidth(ctx, lineIndex)) + : boundaries.leftOffset, + multiplier = this.scaleX * this.canvas.getZoom(), + cursorWidth = this.cursorWidth / multiplier; + + ctx.fillStyle = this.getCurrentCharColor(lineIndex, charIndex); + ctx.globalAlpha = this.__isMousedown ? 1 : this._currentCursorOpacity; + + ctx.fillRect( + boundaries.left + leftOffset - cursorWidth / 2, + boundaries.top + boundaries.topOffset, + cursorWidth, + charHeight); + }, + + /** + * Renders text selection + * @param {Array} chars Array of characters + * @param {Object} boundaries Object with left/top/leftOffset/topOffset + * @param {CanvasRenderingContext2D} ctx transformed context to draw on + */ + renderSelection: function(chars, boundaries, ctx) { + + ctx.fillStyle = this.selectionColor; + + var start = this.get2DCursorLocation(this.selectionStart), + end = this.get2DCursorLocation(this.selectionEnd), + startLine = start.lineIndex, + endLine = end.lineIndex; + for (var i = startLine; i <= endLine; i++) { + var lineOffset = this._getLineLeftOffset(this._getLineWidth(ctx, i)) || 0, + lineHeight = this._getHeightOfLine(this.ctx, i), + realLineHeight = 0, boxWidth = 0, line = this._textLines[i]; + + if (i === startLine) { + for (var j = 0, len = line.length; j < len; j++) { + if (j >= start.charIndex && (i !== endLine || j < end.charIndex)) { + boxWidth += this._getWidthOfChar(ctx, line[j], i, j); + } + if (j < start.charIndex) { + lineOffset += this._getWidthOfChar(ctx, line[j], i, j); + } + } + if (j === line.length) { + boxWidth -= this._getWidthOfCharSpacing(); + } + } + else if (i > startLine && i < endLine) { + boxWidth += this._getLineWidth(ctx, i) || 5; + } + else if (i === endLine) { + for (var j2 = 0, j2len = end.charIndex; j2 < j2len; j2++) { + boxWidth += this._getWidthOfChar(ctx, line[j2], i, j2); + } + if (end.charIndex === line.length) { + boxWidth -= this._getWidthOfCharSpacing(); + } + } + realLineHeight = lineHeight; + if (this.lineHeight < 1 || (i === endLine && this.lineHeight > 1)) { + lineHeight /= this.lineHeight; + } + ctx.fillRect( + boundaries.left + lineOffset, + boundaries.top + boundaries.topOffset, + boxWidth > 0 ? boxWidth : 0, + lineHeight); + + boundaries.topOffset += realLineHeight; + } + }, + + /** + * @private + * @param {String} method + * @param {CanvasRenderingContext2D} ctx Context to render on + * @param {String} line Content of the line + * @param {Number} left + * @param {Number} top + * @param {Number} lineIndex + * @param {Number} charOffset + */ + _renderChars: function(method, ctx, line, left, top, lineIndex, charOffset) { + + if (this.isEmptyStyles()) { + return this._renderCharsFast(method, ctx, line, left, top); + } + + charOffset = charOffset || 0; + + // set proper line offset + var lineHeight = this._getHeightOfLine(ctx, lineIndex), + prevStyle, + thisStyle, + charsToRender = ''; + + ctx.save(); + top -= lineHeight / this.lineHeight * this._fontSizeFraction; + for (var i = charOffset, len = line.length + charOffset; i <= len; i++) { + prevStyle = prevStyle || this.getCurrentCharStyle(lineIndex, i); + thisStyle = this.getCurrentCharStyle(lineIndex, i + 1); + + if (this._hasStyleChanged(prevStyle, thisStyle) || i === len) { + this._renderChar(method, ctx, lineIndex, i - 1, charsToRender, left, top, lineHeight); + charsToRender = ''; + prevStyle = thisStyle; + } + charsToRender += line[i - charOffset]; + } + ctx.restore(); + }, + + /** + * @private + * @param {String} method + * @param {CanvasRenderingContext2D} ctx Context to render on + * @param {String} line Content of the line + * @param {Number} left Left coordinate + * @param {Number} top Top coordinate + */ + _renderCharsFast: function(method, ctx, line, left, top) { + + if (method === 'fillText' && this.fill) { + this.callSuper('_renderChars', method, ctx, line, left, top); + } + if (method === 'strokeText' && ((this.stroke && this.strokeWidth > 0) || this.skipFillStrokeCheck)) { + this.callSuper('_renderChars', method, ctx, line, left, top); + } + }, + + /** + * @private + * @param {String} method + * @param {CanvasRenderingContext2D} ctx Context to render on + * @param {Number} lineIndex + * @param {Number} i + * @param {String} _char + * @param {Number} left Left coordinate + * @param {Number} top Top coordinate + * @param {Number} lineHeight Height of the line + */ + _renderChar: function(method, ctx, lineIndex, i, _char, left, top, lineHeight) { + var charWidth, charHeight, shouldFill, shouldStroke, + decl = this._getStyleDeclaration(lineIndex, i), + offset, textDecoration, chars, additionalSpace, _charWidth; + + if (decl) { + charHeight = this._getHeightOfChar(ctx, _char, lineIndex, i); + shouldStroke = decl.stroke; + shouldFill = decl.fill; + textDecoration = decl.textDecoration; + } + else { + charHeight = this.fontSize; + } + + shouldStroke = (shouldStroke || this.stroke) && method === 'strokeText'; + shouldFill = (shouldFill || this.fill) && method === 'fillText'; + + decl && ctx.save(); + + charWidth = this._applyCharStylesGetWidth(ctx, _char, lineIndex, i, decl || null); + textDecoration = textDecoration || this.textDecoration; + + if (decl && decl.textBackgroundColor) { + this._removeShadow(ctx); + } + if (this.charSpacing !== 0) { + additionalSpace = this._getWidthOfCharSpacing(); + chars = _char.split(''); + charWidth = 0; + for (var j = 0, len = chars.length, char; j < len; j++) { + char = chars[j]; + shouldFill && ctx.fillText(char, left + charWidth, top); + shouldStroke && ctx.strokeText(char, left + charWidth, top); + _charWidth = ctx.measureText(char).width + additionalSpace; + charWidth += _charWidth > 0 ? _charWidth : 0; + } + } + else { + shouldFill && ctx.fillText(_char, left, top); + shouldStroke && ctx.strokeText(_char, left, top); + } + + if (textDecoration || textDecoration !== '') { + offset = this._fontSizeFraction * lineHeight / this.lineHeight; + this._renderCharDecoration(ctx, textDecoration, left, top, offset, charWidth, charHeight); + } + + decl && ctx.restore(); + ctx.translate(charWidth, 0); + }, + + /** + * @private + * @param {Object} prevStyle + * @param {Object} thisStyle + */ + _hasStyleChanged: function(prevStyle, thisStyle) { + return (prevStyle.fill !== thisStyle.fill || + prevStyle.fontSize !== thisStyle.fontSize || + prevStyle.textBackgroundColor !== thisStyle.textBackgroundColor || + prevStyle.textDecoration !== thisStyle.textDecoration || + prevStyle.fontFamily !== thisStyle.fontFamily || + prevStyle.fontWeight !== thisStyle.fontWeight || + prevStyle.fontStyle !== thisStyle.fontStyle || + prevStyle.stroke !== thisStyle.stroke || + prevStyle.strokeWidth !== thisStyle.strokeWidth + ); + }, + + /** + * @private + * @param {CanvasRenderingContext2D} ctx Context to render on + */ + _renderCharDecoration: function(ctx, textDecoration, left, top, offset, charWidth, charHeight) { + + if (!textDecoration) { + return; + } + + var decorationWeight = charHeight / 15, + positions = { + underline: top + charHeight / 10, + 'line-through': top - charHeight * (this._fontSizeFraction + this._fontSizeMult - 1) + decorationWeight, + overline: top - (this._fontSizeMult - this._fontSizeFraction) * charHeight + }, + decorations = ['underline', 'line-through', 'overline'], i, decoration; + + for (i = 0; i < decorations.length; i++) { + decoration = decorations[i]; + if (textDecoration.indexOf(decoration) > -1) { + ctx.fillRect(left, positions[decoration], charWidth , decorationWeight); + } + } + }, + + /** + * @private + * @param {String} method + * @param {CanvasRenderingContext2D} ctx Context to render on + * @param {String} line + * @param {Number} left + * @param {Number} top + * @param {Number} lineIndex + */ + _renderTextLine: function(method, ctx, line, left, top, lineIndex) { + // to "cancel" this.fontSize subtraction in fabric.Text#_renderTextLine + // the adding 0.03 is just to align text with itext by overlap test + if (!this.isEmptyStyles()) { + top += this.fontSize * (this._fontSizeFraction + 0.03); + } + this.callSuper('_renderTextLine', method, ctx, line, left, top, lineIndex); + }, + + /** + * @private + * @param {CanvasRenderingContext2D} ctx Context to render on + */ + _renderTextDecoration: function(ctx) { + if (this.isEmptyStyles()) { + return this.callSuper('_renderTextDecoration', ctx); + } + }, + + /** + * @private + * @param {CanvasRenderingContext2D} ctx Context to render on + */ + _renderTextLinesBackground: function(ctx) { + this.callSuper('_renderTextLinesBackground', ctx); + + var lineTopOffset = 0, heightOfLine, + lineWidth, lineLeftOffset, + leftOffset = this._getLeftOffset(), + topOffset = this._getTopOffset(), + line, _char, style; + + for (var i = 0, len = this._textLines.length; i < len; i++) { + heightOfLine = this._getHeightOfLine(ctx, i); + line = this._textLines[i]; + + if (line === '' || !this.styles || !this._getLineStyle(i)) { + lineTopOffset += heightOfLine; + continue; + } + + lineWidth = this._getLineWidth(ctx, i); + lineLeftOffset = this._getLineLeftOffset(lineWidth); + + for (var j = 0, jlen = line.length; j < jlen; j++) { + style = this._getStyleDeclaration(i, j); + if (!style || !style.textBackgroundColor) { + continue; + } + _char = line[j]; + + ctx.fillStyle = style.textBackgroundColor; + + ctx.fillRect( + leftOffset + lineLeftOffset + this._getWidthOfCharsAt(ctx, i, j), + topOffset + lineTopOffset, + this._getWidthOfChar(ctx, _char, i, j) + 1, + heightOfLine / this.lineHeight + ); + } + lineTopOffset += heightOfLine; + } + }, + + /** + * @private + */ + _getCacheProp: function(_char, styleDeclaration) { + return _char + + styleDeclaration.fontSize + + styleDeclaration.fontWeight + + styleDeclaration.fontStyle; + }, + + /** + * @private + * @param {String} fontFamily name + * @return {Object} reference to cache + */ + _getFontCache: function(fontFamily) { + if (!fabric.charWidthsCache[fontFamily]) { + fabric.charWidthsCache[fontFamily] = { }; + } + return fabric.charWidthsCache[fontFamily]; + }, + + /** + * @private + * @param {CanvasRenderingContext2D} ctx Context to render on + * @param {String} _char + * @param {Number} lineIndex + * @param {Number} charIndex + * @param {Object} [decl] + */ + _applyCharStylesGetWidth: function(ctx, _char, lineIndex, charIndex, decl) { + var charDecl = decl || this._getStyleDeclaration(lineIndex, charIndex), + styleDeclaration = clone(charDecl), + width, cacheProp, charWidthsCache; + + this._applyFontStyles(styleDeclaration); + charWidthsCache = this._getFontCache(styleDeclaration.fontFamily); + cacheProp = this._getCacheProp(_char, styleDeclaration); + + // short-circuit if no styles for this char + // global style from object is always applyed and handled by save and restore + if (!charDecl && charWidthsCache[cacheProp] && this.caching) { + return charWidthsCache[cacheProp]; + } + + if (typeof styleDeclaration.shadow === 'string') { + styleDeclaration.shadow = new fabric.Shadow(styleDeclaration.shadow); + } + + var fill = styleDeclaration.fill || this.fill; + ctx.fillStyle = fill.toLive + ? fill.toLive(ctx, this) + : fill; + + if (styleDeclaration.stroke) { + ctx.strokeStyle = (styleDeclaration.stroke && styleDeclaration.stroke.toLive) + ? styleDeclaration.stroke.toLive(ctx, this) + : styleDeclaration.stroke; + } + + ctx.lineWidth = styleDeclaration.strokeWidth || this.strokeWidth; + ctx.font = this._getFontDeclaration.call(styleDeclaration); + + //if we want this._setShadow.call to work with styleDeclarion + //we have to add those references + if (styleDeclaration.shadow) { + styleDeclaration.scaleX = this.scaleX; + styleDeclaration.scaleY = this.scaleY; + styleDeclaration.canvas = this.canvas; + styleDeclaration.getObjectScaling = this.getObjectScaling; + this._setShadow.call(styleDeclaration, ctx); + } + + if (!this.caching || !charWidthsCache[cacheProp]) { + width = ctx.measureText(_char).width; + this.caching && (charWidthsCache[cacheProp] = width); + return width; + } + + return charWidthsCache[cacheProp]; + }, + + /** + * @private + * @param {Object} styleDeclaration + */ + _applyFontStyles: function(styleDeclaration) { + if (!styleDeclaration.fontFamily) { + styleDeclaration.fontFamily = this.fontFamily; + } + if (!styleDeclaration.fontSize) { + styleDeclaration.fontSize = this.fontSize; + } + if (!styleDeclaration.fontWeight) { + styleDeclaration.fontWeight = this.fontWeight; + } + if (!styleDeclaration.fontStyle) { + styleDeclaration.fontStyle = this.fontStyle; + } + }, + + /** + * @param {Number} lineIndex + * @param {Number} charIndex + * @param {Boolean} [returnCloneOrEmpty=false] + * @private + */ + _getStyleDeclaration: function(lineIndex, charIndex, returnCloneOrEmpty) { + if (returnCloneOrEmpty) { + return (this.styles[lineIndex] && this.styles[lineIndex][charIndex]) + ? clone(this.styles[lineIndex][charIndex]) + : { }; + } + + return this.styles[lineIndex] && this.styles[lineIndex][charIndex] ? this.styles[lineIndex][charIndex] : null; + }, + + /** + * @param {Number} lineIndex + * @param {Number} charIndex + * @param {Object} style + * @private + */ + _setStyleDeclaration: function(lineIndex, charIndex, style) { + this.styles[lineIndex][charIndex] = style; + }, + + /** + * + * @param {Number} lineIndex + * @param {Number} charIndex + * @private + */ + _deleteStyleDeclaration: function(lineIndex, charIndex) { + delete this.styles[lineIndex][charIndex]; + }, + + /** + * @param {Number} lineIndex + * @private + */ + _getLineStyle: function(lineIndex) { + return this.styles[lineIndex]; + }, + + /** + * @param {Number} lineIndex + * @param {Object} style + * @private + */ + _setLineStyle: function(lineIndex, style) { + this.styles[lineIndex] = style; + }, + + /** + * @param {Number} lineIndex + * @private + */ + _deleteLineStyle: function(lineIndex) { + delete this.styles[lineIndex]; + }, + + /** + * @private + * @param {CanvasRenderingContext2D} ctx Context to render on + */ + _getWidthOfChar: function(ctx, _char, lineIndex, charIndex) { + if (!this._isMeasuring && this.textAlign === 'justify' && this._reSpacesAndTabs.test(_char)) { + return this._getWidthOfSpace(ctx, lineIndex); + } + ctx.save(); + var width = this._applyCharStylesGetWidth(ctx, _char, lineIndex, charIndex); + if (this.charSpacing !== 0) { + width += this._getWidthOfCharSpacing(); + } + ctx.restore(); + return width > 0 ? width : 0 + }, + + /** + * @private + * @param {CanvasRenderingContext2D} ctx Context to render on + * @param {Number} lineIndex + * @param {Number} charIndex + */ + _getHeightOfChar: function(ctx, lineIndex, charIndex) { + var style = this._getStyleDeclaration(lineIndex, charIndex); + return style && style.fontSize ? style.fontSize : this.fontSize; + }, + + /** + * @private + * @param {CanvasRenderingContext2D} ctx Context to render on + * @param {Number} lineIndex + * @param {Number} charIndex + */ + _getWidthOfCharsAt: function(ctx, lineIndex, charIndex) { + var width = 0, i, _char; + for (i = 0; i < charIndex; i++) { + _char = this._textLines[lineIndex][i]; + width += this._getWidthOfChar(ctx, _char, lineIndex, i); + } + return width; + }, + + /** + * @private + * @param {CanvasRenderingContext2D} ctx Context to render on + * @param {Number} lineIndex line number + * @return {Number} Line width + */ + _measureLine: function(ctx, lineIndex) { + this._isMeasuring = true; + var width = this._getWidthOfCharsAt(ctx, lineIndex, this._textLines[lineIndex].length); + if (this.charSpacing !== 0) { + width -= this._getWidthOfCharSpacing(); + } + this._isMeasuring = false; + return width > 0 ? width : 0; + }, + + /** + * @private + * @param {CanvasRenderingContext2D} ctx Context to render on + * @param {Number} lineIndex + */ + _getWidthOfSpace: function (ctx, lineIndex) { + if (this.__widthOfSpace[lineIndex]) { + return this.__widthOfSpace[lineIndex]; + } + var line = this._textLines[lineIndex], + wordsWidth = this._getWidthOfWords(ctx, line, lineIndex, 0), + widthDiff = this.width - wordsWidth, + numSpaces = line.length - line.replace(this._reSpacesAndTabs, '').length, + width = Math.max(widthDiff / numSpaces, ctx.measureText(' ').width); + this.__widthOfSpace[lineIndex] = width; + return width; + }, + + /** + * @private + * @param {CanvasRenderingContext2D} ctx Context to render on + * @param {String} line + * @param {Number} lineIndex + * @param {Number} charOffset + */ + _getWidthOfWords: function (ctx, line, lineIndex, charOffset) { + var width = 0; + + for (var charIndex = 0; charIndex < line.length; charIndex++) { + var _char = line[charIndex]; + + if (!_char.match(/\s/)) { + width += this._getWidthOfChar(ctx, _char, lineIndex, charIndex + charOffset); + } + } + + return width; + }, + + /** + * @private + * @param {CanvasRenderingContext2D} ctx Context to render on + */ + _getHeightOfLine: function(ctx, lineIndex) { + if (this.__lineHeights[lineIndex]) { + return this.__lineHeights[lineIndex]; + } + + var line = this._textLines[lineIndex], + maxHeight = this._getHeightOfChar(ctx, lineIndex, 0); + + for (var i = 1, len = line.length; i < len; i++) { + var currentCharHeight = this._getHeightOfChar(ctx, lineIndex, i); + if (currentCharHeight > maxHeight) { + maxHeight = currentCharHeight; + } + } + this.__lineHeights[lineIndex] = maxHeight * this.lineHeight * this._fontSizeMult; + return this.__lineHeights[lineIndex]; + }, + + /** + * @private + * @param {CanvasRenderingContext2D} ctx Context to render on + */ + _getTextHeight: function(ctx) { + var lineHeight, height = 0; + for (var i = 0, len = this._textLines.length; i < len; i++) { + lineHeight = this._getHeightOfLine(ctx, i); + height += (i === len - 1 ? lineHeight / this.lineHeight : lineHeight); + } + return height; + }, + + /** + * Returns object representation of an instance + * @method toObject + * @param {Array} [propertiesToInclude] Any properties that you might want to additionally include in the output + * @return {Object} object representation of an instance + */ + toObject: function(propertiesToInclude) { + var clonedStyles = { }, i, j, row; + for (i in this.styles) { + row = this.styles[i]; + clonedStyles[i] = { }; + for (j in row) { + clonedStyles[i][j] = clone(row[j]); + } + } + return fabric.util.object.extend(this.callSuper('toObject', propertiesToInclude), { + styles: clonedStyles + }); + } + }); + + /** + * Returns fabric.IText instance from an object representation + * @static + * @memberOf fabric.IText + * @param {Object} object Object to create an instance from + * @param {function} [callback] invoked with new instance as argument + * @return {fabric.IText} instance of fabric.IText + */ + fabric.IText.fromObject = function(object, callback) { + var iText = new fabric.IText(object.text, clone(object)); + callback && callback(iText); + return iText; + }; +})(); + + +(function() { + + var clone = fabric.util.object.clone; + + fabric.util.object.extend(fabric.IText.prototype, /** @lends fabric.IText.prototype */ { + + /** + * Initializes all the interactive behavior of IText + */ + initBehavior: function() { + this.initAddedHandler(); + this.initRemovedHandler(); + this.initCursorSelectionHandlers(); + this.initDoubleClickSimulation(); + this.mouseMoveHandler = this.mouseMoveHandler.bind(this); + }, + + /** + * Initializes "selected" event handler + */ + initSelectedHandler: function() { + this.on('selected', function() { + + var _this = this; + setTimeout(function() { + _this.selected = true; + }, 100); + }); + }, + + /** + * Initializes "added" event handler + */ + initAddedHandler: function() { + var _this = this; + this.on('added', function() { + var canvas = _this.canvas; + if (canvas) { + if (!canvas._hasITextHandlers) { + canvas._hasITextHandlers = true; + _this._initCanvasHandlers(canvas); + } + canvas._iTextInstances = canvas._iTextInstances || []; + canvas._iTextInstances.push(_this); + } + }); + }, + + initRemovedHandler: function() { + var _this = this; + this.on('removed', function() { + var canvas = _this.canvas; + if (canvas) { + canvas._iTextInstances = canvas._iTextInstances || []; + fabric.util.removeFromArray(canvas._iTextInstances, _this); + if (canvas._iTextInstances.length === 0) { + canvas._hasITextHandlers = false; + _this._removeCanvasHandlers(canvas); + } + } + }); + }, + + /** + * register canvas event to manage exiting on other instances + * @private + */ + _initCanvasHandlers: function(canvas) { + canvas._canvasITextSelectionClearedHanlder = (function() { + fabric.IText.prototype.exitEditingOnOthers(canvas); + }).bind(this); + canvas._mouseUpITextHandler = (function() { + if (canvas._iTextInstances) { + canvas._iTextInstances.forEach(function(obj) { + obj.__isMousedown = false; + }); + } + }).bind(this); + canvas.on('selection:cleared', canvas._canvasITextSelectionClearedHanlder); + canvas.on('object:selected', canvas._canvasITextSelectionClearedHanlder); + canvas.on('mouse:up', canvas._mouseUpITextHandler); + }, + + /** + * remove canvas event to manage exiting on other instances + * @private + */ + _removeCanvasHandlers: function(canvas) { + canvas.off('selection:cleared', canvas._canvasITextSelectionClearedHanlder); + canvas.off('object:selected', canvas._canvasITextSelectionClearedHanlder); + canvas.off('mouse:up', canvas._mouseUpITextHandler); + }, + + /** + * @private + */ + _tick: function() { + this._currentTickState = this._animateCursor(this, 1, this.cursorDuration, '_onTickComplete'); + }, + + /** + * @private + */ + _animateCursor: function(obj, targetOpacity, duration, completeMethod) { + + var tickState; + + tickState = { + isAborted: false, + abort: function() { + this.isAborted = true; + }, + }; + + obj.animate('_currentCursorOpacity', targetOpacity, { + duration: duration, + onComplete: function() { + if (!tickState.isAborted) { + obj[completeMethod](); + } + }, + onChange: function() { + // we do not want to animate a selection, only cursor + if (obj.canvas && obj.selectionStart === obj.selectionEnd) { + obj.renderCursorOrSelection(); + } + }, + abort: function() { + return tickState.isAborted; + } + }); + return tickState; + }, + + /** + * @private + */ + _onTickComplete: function() { + + var _this = this; + + if (this._cursorTimeout1) { + clearTimeout(this._cursorTimeout1); + } + this._cursorTimeout1 = setTimeout(function() { + _this._currentTickCompleteState = _this._animateCursor(_this, 0, this.cursorDuration / 2, '_tick'); + }, 100); + }, + + /** + * Initializes delayed cursor + */ + initDelayedCursor: function(restart) { + var _this = this, + delay = restart ? 0 : this.cursorDelay; + + this.abortCursorAnimation(); + this._currentCursorOpacity = 1; + this._cursorTimeout2 = setTimeout(function() { + _this._tick(); + }, delay); + }, + + /** + * Aborts cursor animation and clears all timeouts + */ + abortCursorAnimation: function() { + var shouldClear = this._currentTickState || this._currentTickCompleteState; + this._currentTickState && this._currentTickState.abort(); + this._currentTickCompleteState && this._currentTickCompleteState.abort(); + + clearTimeout(this._cursorTimeout1); + clearTimeout(this._cursorTimeout2); + + this._currentCursorOpacity = 0; + // to clear just itext area we need to transform the context + // it may not be worth it + if (shouldClear) { + this.canvas && this.canvas.clearContext(this.canvas.contextTop || this.ctx); + } + + }, + + /** + * Selects entire text + */ + selectAll: function() { + this.selectionStart = 0; + this.selectionEnd = this.text.length; + this._fireSelectionChanged(); + this._updateTextarea(); + }, + + /** + * Returns selected text + * @return {String} + */ + getSelectedText: function() { + return this.text.slice(this.selectionStart, this.selectionEnd); + }, + + /** + * Find new selection index representing start of current word according to current selection index + * @param {Number} startFrom Surrent selection index + * @return {Number} New selection index + */ + findWordBoundaryLeft: function(startFrom) { + var offset = 0, index = startFrom - 1; + + // remove space before cursor first + if (this._reSpace.test(this.text.charAt(index))) { + while (this._reSpace.test(this.text.charAt(index))) { + offset++; + index--; + } + } + while (/\S/.test(this.text.charAt(index)) && index > -1) { + offset++; + index--; + } + + return startFrom - offset; + }, + + /** + * Find new selection index representing end of current word according to current selection index + * @param {Number} startFrom Current selection index + * @return {Number} New selection index + */ + findWordBoundaryRight: function(startFrom) { + var offset = 0, index = startFrom; + + // remove space after cursor first + if (this._reSpace.test(this.text.charAt(index))) { + while (this._reSpace.test(this.text.charAt(index))) { + offset++; + index++; + } + } + while (/\S/.test(this.text.charAt(index)) && index < this.text.length) { + offset++; + index++; + } + + return startFrom + offset; + }, + + /** + * Find new selection index representing start of current line according to current selection index + * @param {Number} startFrom Current selection index + * @return {Number} New selection index + */ + findLineBoundaryLeft: function(startFrom) { + var offset = 0, index = startFrom - 1; + + while (!/\n/.test(this.text.charAt(index)) && index > -1) { + offset++; + index--; + } + + return startFrom - offset; + }, + + /** + * Find new selection index representing end of current line according to current selection index + * @param {Number} startFrom Current selection index + * @return {Number} New selection index + */ + findLineBoundaryRight: function(startFrom) { + var offset = 0, index = startFrom; + + while (!/\n/.test(this.text.charAt(index)) && index < this.text.length) { + offset++; + index++; + } + + return startFrom + offset; + }, + + /** + * Returns number of newlines in selected text + * @return {Number} Number of newlines in selected text + */ + getNumNewLinesInSelectedText: function() { + var selectedText = this.getSelectedText(), + numNewLines = 0; + + for (var i = 0, len = selectedText.length; i < len; i++) { + if (selectedText[i] === '\n') { + numNewLines++; + } + } + return numNewLines; + }, + + /** + * Finds index corresponding to beginning or end of a word + * @param {Number} selectionStart Index of a character + * @param {Number} direction 1 or -1 + * @return {Number} Index of the beginning or end of a word + */ + searchWordBoundary: function(selectionStart, direction) { + var index = this._reSpace.test(this.text.charAt(selectionStart)) ? selectionStart - 1 : selectionStart, + _char = this.text.charAt(index), + reNonWord = /[ \n\.,;!\?\-]/; + + while (!reNonWord.test(_char) && index > 0 && index < this.text.length) { + index += direction; + _char = this.text.charAt(index); + } + if (reNonWord.test(_char) && _char !== '\n') { + index += direction === 1 ? 0 : 1; + } + return index; + }, + + /** + * Selects a word based on the index + * @param {Number} selectionStart Index of a character + */ + selectWord: function(selectionStart) { + selectionStart = selectionStart || this.selectionStart; + var newSelectionStart = this.searchWordBoundary(selectionStart, -1), /* search backwards */ + newSelectionEnd = this.searchWordBoundary(selectionStart, 1); /* search forward */ + + this.selectionStart = newSelectionStart; + this.selectionEnd = newSelectionEnd; + this._fireSelectionChanged(); + this._updateTextarea(); + this.renderCursorOrSelection(); + }, + + /** + * Selects a line based on the index + * @param {Number} selectionStart Index of a character + */ + selectLine: function(selectionStart) { + selectionStart = selectionStart || this.selectionStart; + var newSelectionStart = this.findLineBoundaryLeft(selectionStart), + newSelectionEnd = this.findLineBoundaryRight(selectionStart); + + this.selectionStart = newSelectionStart; + this.selectionEnd = newSelectionEnd; + this._fireSelectionChanged(); + this._updateTextarea(); + }, + + /** + * Enters editing state + * @return {fabric.IText} thisArg + * @chainable + */ + enterEditing: function(e) { + if (this.isEditing || !this.editable) { + return; + } + + if (this.canvas) { + this.exitEditingOnOthers(this.canvas); + } + + this.isEditing = true; + + this.initHiddenTextarea(e); + this.hiddenTextarea.focus(); + this._updateTextarea(); + this._saveEditingProps(); + this._setEditingProps(); + this._textBeforeEdit = this.text; + + this._tick(); + this.fire('editing:entered'); + + if (!this.canvas) { + return this; + } + this.canvas.fire('text:editing:entered', { target: this }); + this.initMouseMoveHandler(); + this.canvas.renderAll(); + return this; + }, + + exitEditingOnOthers: function(canvas) { + if (canvas._iTextInstances) { + canvas._iTextInstances.forEach(function(obj) { + obj.selected = false; + if (obj.isEditing) { + obj.exitEditing(); + } + }); + } + }, + + /** + * Initializes "mousemove" event handler + */ + initMouseMoveHandler: function() { + this.canvas.on('mouse:move', this.mouseMoveHandler); + }, + + /** + * @private + */ + mouseMoveHandler: function(options) { + if (!this.__isMousedown || !this.isEditing) { + return; + } + + var newSelectionStart = this.getSelectionStartFromPointer(options.e), + currentStart = this.selectionStart, + currentEnd = this.selectionEnd; + if (newSelectionStart === this.__selectionStartOnMouseDown) { + return; + } + if (newSelectionStart > this.__selectionStartOnMouseDown) { + this.selectionStart = this.__selectionStartOnMouseDown; + this.selectionEnd = newSelectionStart; + } + else { + this.selectionStart = newSelectionStart; + this.selectionEnd = this.__selectionStartOnMouseDown; + } + if (this.selectionStart !== currentStart || this.selectionEnd !== currentEnd) { + this._fireSelectionChanged(); + this._updateTextarea(); + this.renderCursorOrSelection(); + } + }, + + /** + * @private + */ + _setEditingProps: function() { + this.hoverCursor = 'text'; + + if (this.canvas) { + this.canvas.defaultCursor = this.canvas.moveCursor = 'text'; + } + + this.borderColor = this.editingBorderColor; + + this.hasControls = this.selectable = false; + this.lockMovementX = this.lockMovementY = true; + }, + + /** + * @private + */ + _updateTextarea: function() { + if (!this.hiddenTextarea || this.inCompositionMode) { + return; + } + this.cursorOffsetCache = { }; + this.hiddenTextarea.value = this.text; + this.hiddenTextarea.selectionStart = this.selectionStart; + this.hiddenTextarea.selectionEnd = this.selectionEnd; + if (this.selectionStart === this.selectionEnd) { + var style = this._calcTextareaPosition(); + this.hiddenTextarea.style.left = style.left; + this.hiddenTextarea.style.top = style.top; + this.hiddenTextarea.style.fontSize = style.fontSize; + } + }, + + /** + * @private + * @return {Object} style contains style for hiddenTextarea + */ + _calcTextareaPosition: function() { + if (!this.canvas) { + return { x: 1, y: 1 }; + } + var chars = this.text.split(''), + boundaries = this._getCursorBoundaries(chars, 'cursor'), + cursorLocation = this.get2DCursorLocation(), + lineIndex = cursorLocation.lineIndex, + charIndex = cursorLocation.charIndex, + charHeight = this.getCurrentCharFontSize(lineIndex, charIndex), + leftOffset = (lineIndex === 0 && charIndex === 0) + ? this._getLineLeftOffset(this._getLineWidth(this.ctx, lineIndex)) + : boundaries.leftOffset, + m = this.calcTransformMatrix(), + p = { + x: boundaries.left + leftOffset, + y: boundaries.top + boundaries.topOffset + charHeight + }, + upperCanvas = this.canvas.upperCanvasEl, + maxWidth = upperCanvas.width - charHeight, + maxHeight = upperCanvas.height - charHeight; + + p = fabric.util.transformPoint(p, m); + p = fabric.util.transformPoint(p, this.canvas.viewportTransform); + + if (p.x < 0) { + p.x = 0; + } + if (p.x > maxWidth) { + p.x = maxWidth; + } + if (p.y < 0) { + p.y = 0; + } + if (p.y > maxHeight) { + p.y = maxHeight; + } + + // add canvas offset on document + p.x += this.canvas._offset.left; + p.y += this.canvas._offset.top; + + return { left: p.x + 'px', top: p.y + 'px', fontSize: charHeight }; + }, + + /** + * @private + */ + _saveEditingProps: function() { + this._savedProps = { + hasControls: this.hasControls, + borderColor: this.borderColor, + lockMovementX: this.lockMovementX, + lockMovementY: this.lockMovementY, + hoverCursor: this.hoverCursor, + defaultCursor: this.canvas && this.canvas.defaultCursor, + moveCursor: this.canvas && this.canvas.moveCursor + }; + }, + + /** + * @private + */ + _restoreEditingProps: function() { + if (!this._savedProps) { + return; + } + + this.hoverCursor = this._savedProps.overCursor; + this.hasControls = this._savedProps.hasControls; + this.borderColor = this._savedProps.borderColor; + this.lockMovementX = this._savedProps.lockMovementX; + this.lockMovementY = this._savedProps.lockMovementY; + + if (this.canvas) { + this.canvas.defaultCursor = this._savedProps.defaultCursor; + this.canvas.moveCursor = this._savedProps.moveCursor; + } + }, + + /** + * Exits from editing state + * @return {fabric.IText} thisArg + * @chainable + */ + exitEditing: function() { + var isTextChanged = (this._textBeforeEdit !== this.text); + this.selected = false; + this.isEditing = false; + this.selectable = true; + + this.selectionEnd = this.selectionStart; + this.hiddenTextarea && this.canvas && this.hiddenTextarea.parentNode.removeChild(this.hiddenTextarea); + this.hiddenTextarea = null; + + this.abortCursorAnimation(); + this._restoreEditingProps(); + this._currentCursorOpacity = 0; + + this.fire('editing:exited'); + isTextChanged && this.fire('modified'); + if (this.canvas) { + this.canvas.off('mouse:move', this.mouseMoveHandler); + this.canvas.fire('text:editing:exited', { target: this }); + isTextChanged && this.canvas.fire('object:modified', { target: this }); + } + + return this; + }, + + /** + * @private + */ + _removeExtraneousStyles: function() { + for (var prop in this.styles) { + if (!this._textLines[prop]) { + delete this.styles[prop]; + } + } + }, + + /** + * @private + */ + _removeCharsFromTo: function(start, end) { + while (end !== start) { + this._removeSingleCharAndStyle(start + 1); + end--; + } + this.selectionStart = start; + this.selectionEnd = start; + }, + + _removeSingleCharAndStyle: function(index) { + var isBeginningOfLine = this.text[index - 1] === '\n', + indexStyle = isBeginningOfLine ? index : index - 1; + this.removeStyleObject(isBeginningOfLine, indexStyle); + this.text = this.text.slice(0, index - 1) + + this.text.slice(index); + + this._textLines = this._splitTextIntoLines(); + }, + + /** + * Inserts characters where cursor is (replacing selection if one exists) + * @param {String} _chars Characters to insert + * @param {Boolean} useCopiedStyle use fabric.copiedTextStyle + */ + insertChars: function(_chars, useCopiedStyle) { + var style; + + if (this.selectionEnd - this.selectionStart > 1) { + this._removeCharsFromTo(this.selectionStart, this.selectionEnd); + } + //short circuit for block paste + if (!useCopiedStyle && this.isEmptyStyles()) { + this.insertChar(_chars, false); + return; + } + for (var i = 0, len = _chars.length; i < len; i++) { + if (useCopiedStyle) { + style = fabric.copiedTextStyle[i]; + } + this.insertChar(_chars[i], i < len - 1, style); + } + }, + + /** + * Inserts a character where cursor is + * @param {String} _char Characters to insert + * @param {Boolean} skipUpdate trigger rendering and updates at the end of text insert + * @param {Object} styleObject Style to be inserted for the new char + */ + insertChar: function(_char, skipUpdate, styleObject) { + var isEndOfLine = this.text[this.selectionStart] === '\n'; + this.text = this.text.slice(0, this.selectionStart) + + _char + this.text.slice(this.selectionEnd); + this._textLines = this._splitTextIntoLines(); + this.insertStyleObjects(_char, isEndOfLine, styleObject); + this.selectionStart += _char.length; + this.selectionEnd = this.selectionStart; + if (skipUpdate) { + return; + } + this._updateTextarea(); + this.setCoords(); + this._fireSelectionChanged(); + this.fire('changed'); + this.canvas && this.canvas.fire('text:changed', { target: this }); + this.canvas && this.canvas.renderAll(); + }, + + /** + * Inserts new style object + * @param {Number} lineIndex Index of a line + * @param {Number} charIndex Index of a char + * @param {Boolean} isEndOfLine True if it's end of line + */ + insertNewlineStyleObject: function(lineIndex, charIndex, isEndOfLine) { + + this.shiftLineStyles(lineIndex, +1); + + if (!this.styles[lineIndex + 1]) { + this.styles[lineIndex + 1] = {}; + } + + var currentCharStyle = {}, + newLineStyles = {}; + + if (this.styles[lineIndex] && this.styles[lineIndex][charIndex - 1]) { + currentCharStyle = this.styles[lineIndex][charIndex - 1]; + } + + // if there's nothing after cursor, + // we clone current char style onto the next (otherwise empty) line + if (isEndOfLine) { + newLineStyles[0] = clone(currentCharStyle); + this.styles[lineIndex + 1] = newLineStyles; + } + // otherwise we clone styles of all chars + // after cursor onto the next line, from the beginning + else { + for (var index in this.styles[lineIndex]) { + if (parseInt(index, 10) >= charIndex) { + newLineStyles[parseInt(index, 10) - charIndex] = this.styles[lineIndex][index]; + // remove lines from the previous line since they're on a new line now + delete this.styles[lineIndex][index]; + } + } + this.styles[lineIndex + 1] = newLineStyles; + } + this._forceClearCache = true; + }, + + /** + * Inserts style object for a given line/char index + * @param {Number} lineIndex Index of a line + * @param {Number} charIndex Index of a char + * @param {Object} [style] Style object to insert, if given + */ + insertCharStyleObject: function(lineIndex, charIndex, style) { + + var currentLineStyles = this.styles[lineIndex], + currentLineStylesCloned = clone(currentLineStyles); + + if (charIndex === 0 && !style) { + charIndex = 1; + } + + // shift all char styles by 1 forward + // 0,1,2,3 -> (charIndex=2) -> 0,1,3,4 -> (insert 2) -> 0,1,2,3,4 + for (var index in currentLineStylesCloned) { + var numericIndex = parseInt(index, 10); + + if (numericIndex >= charIndex) { + currentLineStyles[numericIndex + 1] = currentLineStylesCloned[numericIndex]; + + // only delete the style if there was nothing moved there + if (!currentLineStylesCloned[numericIndex - 1]) { + delete currentLineStyles[numericIndex]; + } + } + } + + this.styles[lineIndex][charIndex] = + style || clone(currentLineStyles[charIndex - 1]); + this._forceClearCache = true; + }, + + /** + * Inserts style object(s) + * @param {String} _chars Characters at the location where style is inserted + * @param {Boolean} isEndOfLine True if it's end of line + * @param {Object} [styleObject] Style to insert + */ + insertStyleObjects: function(_chars, isEndOfLine, styleObject) { + // removed shortcircuit over isEmptyStyles + + var cursorLocation = this.get2DCursorLocation(), + lineIndex = cursorLocation.lineIndex, + charIndex = cursorLocation.charIndex; + + if (!this._getLineStyle(lineIndex)) { + this._setLineStyle(lineIndex, {}); + } + + if (_chars === '\n') { + this.insertNewlineStyleObject(lineIndex, charIndex, isEndOfLine); + } + else { + this.insertCharStyleObject(lineIndex, charIndex, styleObject); + } + }, + + /** + * Shifts line styles up or down + * @param {Number} lineIndex Index of a line + * @param {Number} offset Can be -1 or +1 + */ + shiftLineStyles: function(lineIndex, offset) { + // shift all line styles by 1 upward + var clonedStyles = clone(this.styles); + for (var line in this.styles) { + var numericLine = parseInt(line, 10); + if (numericLine > lineIndex) { + this.styles[numericLine + offset] = clonedStyles[numericLine]; + if (!clonedStyles[numericLine - offset]) { + delete this.styles[numericLine]; + } + } + } + //TODO: evaluate if delete old style lines with offset -1 + }, + + /** + * Removes style object + * @param {Boolean} isBeginningOfLine True if cursor is at the beginning of line + * @param {Number} [index] Optional index. When not given, current selectionStart is used. + */ + removeStyleObject: function(isBeginningOfLine, index) { + + var cursorLocation = this.get2DCursorLocation(index), + lineIndex = cursorLocation.lineIndex, + charIndex = cursorLocation.charIndex; + + this._removeStyleObject(isBeginningOfLine, cursorLocation, lineIndex, charIndex); + }, + + _getTextOnPreviousLine: function(lIndex) { + return this._textLines[lIndex - 1]; + }, + + _removeStyleObject: function(isBeginningOfLine, cursorLocation, lineIndex, charIndex) { + + if (isBeginningOfLine) { + var textOnPreviousLine = this._getTextOnPreviousLine(cursorLocation.lineIndex), + newCharIndexOnPrevLine = textOnPreviousLine ? textOnPreviousLine.length : 0; + + if (!this.styles[lineIndex - 1]) { + this.styles[lineIndex - 1] = {}; + } + for (charIndex in this.styles[lineIndex]) { + this.styles[lineIndex - 1][parseInt(charIndex, 10) + newCharIndexOnPrevLine] + = this.styles[lineIndex][charIndex]; + } + this.shiftLineStyles(cursorLocation.lineIndex, -1); + } + else { + var currentLineStyles = this.styles[lineIndex]; + + if (currentLineStyles) { + delete currentLineStyles[charIndex]; + } + var currentLineStylesCloned = clone(currentLineStyles); + // shift all styles by 1 backwards + for (var i in currentLineStylesCloned) { + var numericIndex = parseInt(i, 10); + if (numericIndex >= charIndex && numericIndex !== 0) { + currentLineStyles[numericIndex - 1] = currentLineStylesCloned[numericIndex]; + delete currentLineStyles[numericIndex]; + } + } + } + }, + + /** + * Inserts new line + */ + insertNewline: function() { + this.insertChars('\n'); + }, + + /** + * Set the selectionStart and selectionEnd according to the ne postion of cursor + * mimic the key - mouse navigation when shift is pressed. + */ + setSelectionStartEndWithShift: function(start, end, newSelection) { + if (newSelection <= start) { + if (end === start) { + this._selectionDirection = 'left'; + } + else if (this._selectionDirection === 'right') { + this._selectionDirection = 'left'; + this.selectionEnd = start; + } + this.selectionStart = newSelection; + } + else if (newSelection > start && newSelection < end) { + if (this._selectionDirection === 'right') { + this.selectionEnd = newSelection; + } + else { + this.selectionStart = newSelection; + } + } + else { + // newSelection is > selection start and end + if (end === start) { + this._selectionDirection = 'right'; + } + else if (this._selectionDirection === 'left') { + this._selectionDirection = 'right'; + this.selectionStart = end; + } + this.selectionEnd = newSelection; + } + }, + + setSelectionInBoundaries: function() { + var length = this.text.length; + if (this.selectionStart > length) { + this.selectionStart = length; + } + else if (this.selectionStart < 0) { + this.selectionStart = 0; + } + if (this.selectionEnd > length) { + this.selectionEnd = length; + } + else if (this.selectionEnd < 0) { + this.selectionEnd = 0; + } + } + }); +})(); + + +fabric.util.object.extend(fabric.IText.prototype, /** @lends fabric.IText.prototype */ { + /** + * Initializes "dbclick" event handler + */ + initDoubleClickSimulation: function() { + + // for double click + this.__lastClickTime = +new Date(); + + // for triple click + this.__lastLastClickTime = +new Date(); + + this.__lastPointer = { }; + + this.on('mousedown', this.onMouseDown.bind(this)); + }, + + onMouseDown: function(options) { + + this.__newClickTime = +new Date(); + var newPointer = this.canvas.getPointer(options.e); + + if (this.isTripleClick(newPointer)) { + this.fire('tripleclick', options); + this._stopEvent(options.e); + } + else if (this.isDoubleClick(newPointer)) { + this.fire('dblclick', options); + this._stopEvent(options.e); + } + + this.__lastLastClickTime = this.__lastClickTime; + this.__lastClickTime = this.__newClickTime; + this.__lastPointer = newPointer; + this.__lastIsEditing = this.isEditing; + this.__lastSelected = this.selected; + }, + + isDoubleClick: function(newPointer) { + return this.__newClickTime - this.__lastClickTime < 500 && + this.__lastPointer.x === newPointer.x && + this.__lastPointer.y === newPointer.y && this.__lastIsEditing; + }, + + isTripleClick: function(newPointer) { + return this.__newClickTime - this.__lastClickTime < 500 && + this.__lastClickTime - this.__lastLastClickTime < 500 && + this.__lastPointer.x === newPointer.x && + this.__lastPointer.y === newPointer.y; + }, + + /** + * @private + */ + _stopEvent: function(e) { + e.preventDefault && e.preventDefault(); + e.stopPropagation && e.stopPropagation(); + }, + + /** + * Initializes event handlers related to cursor or selection + */ + initCursorSelectionHandlers: function() { + this.initSelectedHandler(); + this.initMousedownHandler(); + this.initMouseupHandler(); + this.initClicks(); + }, + + /** + * Initializes double and triple click event handlers + */ + initClicks: function() { + this.on('dblclick', function(options) { + this.selectWord(this.getSelectionStartFromPointer(options.e)); + }); + this.on('tripleclick', function(options) { + this.selectLine(this.getSelectionStartFromPointer(options.e)); + }); + }, + + /** + * Initializes "mousedown" event handler + */ + initMousedownHandler: function() { + this.on('mousedown', function(options) { + if (!this.editable) { + return; + } + var pointer = this.canvas.getPointer(options.e); + + this.__mousedownX = pointer.x; + this.__mousedownY = pointer.y; + this.__isMousedown = true; + + if (this.selected) { + this.setCursorByClick(options.e); + } + + if (this.isEditing) { + this.__selectionStartOnMouseDown = this.selectionStart; + if (this.selectionStart === this.selectionEnd) { + this.abortCursorAnimation(); + } + this.renderCursorOrSelection(); + } + }); + }, + + /** + * @private + */ + _isObjectMoved: function(e) { + var pointer = this.canvas.getPointer(e); + + return this.__mousedownX !== pointer.x || + this.__mousedownY !== pointer.y; + }, + + /** + * Initializes "mouseup" event handler + */ + initMouseupHandler: function() { + this.on('mouseup', function(options) { + this.__isMousedown = false; + if (!this.editable || this._isObjectMoved(options.e)) { + return; + } + + if (this.__lastSelected && !this.__corner) { + this.enterEditing(options.e); + if (this.selectionStart === this.selectionEnd) { + this.initDelayedCursor(true); + } + else { + this.renderCursorOrSelection(); + } + } + this.selected = true; + }); + }, + + /** + * Changes cursor location in a text depending on passed pointer (x/y) object + * @param {Event} e Event object + */ + setCursorByClick: function(e) { + var newSelection = this.getSelectionStartFromPointer(e), + start = this.selectionStart, end = this.selectionEnd; + if (e.shiftKey) { + this.setSelectionStartEndWithShift(start, end, newSelection); + } + else { + this.selectionStart = newSelection; + this.selectionEnd = newSelection; + } + this._fireSelectionChanged(); + this._updateTextarea(); + }, + + /** + * Returns index of a character corresponding to where an object was clicked + * @param {Event} e Event object + * @return {Number} Index of a character + */ + getSelectionStartFromPointer: function(e) { + var mouseOffset = this.getLocalPointer(e), + prevWidth = 0, + width = 0, + height = 0, + charIndex = 0, + newSelectionStart, + line; + + for (var i = 0, len = this._textLines.length; i < len; i++) { + line = this._textLines[i]; + height += this._getHeightOfLine(this.ctx, i) * this.scaleY; + + var widthOfLine = this._getLineWidth(this.ctx, i), + lineLeftOffset = this._getLineLeftOffset(widthOfLine); + + width = lineLeftOffset * this.scaleX; + + for (var j = 0, jlen = line.length; j < jlen; j++) { + + prevWidth = width; + + width += this._getWidthOfChar(this.ctx, line[j], i, this.flipX ? jlen - j : j) * + this.scaleX; + + if (height <= mouseOffset.y || width <= mouseOffset.x) { + charIndex++; + continue; + } + + return this._getNewSelectionStartFromOffset( + mouseOffset, prevWidth, width, charIndex + i, jlen); + } + + if (mouseOffset.y < height) { + //this happens just on end of lines. + return this._getNewSelectionStartFromOffset( + mouseOffset, prevWidth, width, charIndex + i - 1, jlen); + } + } + + // clicked somewhere after all chars, so set at the end + if (typeof newSelectionStart === 'undefined') { + return this.text.length; + } + }, + + /** + * @private + */ + _getNewSelectionStartFromOffset: function(mouseOffset, prevWidth, width, index, jlen) { + + var distanceBtwLastCharAndCursor = mouseOffset.x - prevWidth, + distanceBtwNextCharAndCursor = width - mouseOffset.x, + offset = distanceBtwNextCharAndCursor > distanceBtwLastCharAndCursor ? 0 : 1, + newSelectionStart = index + offset; + + // if object is horizontally flipped, mirror cursor location from the end + if (this.flipX) { + newSelectionStart = jlen - newSelectionStart; + } + + if (newSelectionStart > this.text.length) { + newSelectionStart = this.text.length; + } + + return newSelectionStart; + } +}); + + +fabric.util.object.extend(fabric.IText.prototype, /** @lends fabric.IText.prototype */ { + + /** + * Initializes hidden textarea (needed to bring up keyboard in iOS) + */ + initHiddenTextarea: function() { + this.hiddenTextarea = fabric.document.createElement('textarea'); + this.hiddenTextarea.setAttribute('autocapitalize', 'off'); + var style = this._calcTextareaPosition(); + this.hiddenTextarea.style.cssText = 'position: absolute; top: ' + style.top + '; left: ' + style.left + ';' + + ' opacity: 0; width: 0px; height: 0px; z-index: -999;'; + fabric.document.body.appendChild(this.hiddenTextarea); + + fabric.util.addListener(this.hiddenTextarea, 'keydown', this.onKeyDown.bind(this)); + fabric.util.addListener(this.hiddenTextarea, 'keyup', this.onKeyUp.bind(this)); + fabric.util.addListener(this.hiddenTextarea, 'input', this.onInput.bind(this)); + fabric.util.addListener(this.hiddenTextarea, 'copy', this.copy.bind(this)); + fabric.util.addListener(this.hiddenTextarea, 'cut', this.cut.bind(this)); + fabric.util.addListener(this.hiddenTextarea, 'paste', this.paste.bind(this)); + fabric.util.addListener(this.hiddenTextarea, 'compositionstart', this.onCompositionStart.bind(this)); + fabric.util.addListener(this.hiddenTextarea, 'compositionupdate', this.onCompositionUpdate.bind(this)); + fabric.util.addListener(this.hiddenTextarea, 'compositionend', this.onCompositionEnd.bind(this)); + + if (!this._clickHandlerInitialized && this.canvas) { + fabric.util.addListener(this.canvas.upperCanvasEl, 'click', this.onClick.bind(this)); + this._clickHandlerInitialized = true; + } + }, + + /** + * @private + */ + _keysMap: { + 8: 'removeChars', + 9: 'exitEditing', + 27: 'exitEditing', + 13: 'insertNewline', + 33: 'moveCursorUp', + 34: 'moveCursorDown', + 35: 'moveCursorRight', + 36: 'moveCursorLeft', + 37: 'moveCursorLeft', + 38: 'moveCursorUp', + 39: 'moveCursorRight', + 40: 'moveCursorDown', + 46: 'forwardDelete' + }, + + /** + * @private + */ + _ctrlKeysMapUp: { + 67: 'copy', + 88: 'cut' + }, + + /** + * @private + */ + _ctrlKeysMapDown: { + 65: 'selectAll' + }, + + onClick: function() { + // No need to trigger click event here, focus is enough to have the keyboard appear on Android + this.hiddenTextarea && this.hiddenTextarea.focus(); + }, + + /** + * Handles keyup event + * @param {Event} e Event object + */ + onKeyDown: function(e) { + if (!this.isEditing) { + return; + } + if (e.keyCode in this._keysMap) { + this[this._keysMap[e.keyCode]](e); + } + else if ((e.keyCode in this._ctrlKeysMapDown) && (e.ctrlKey || e.metaKey)) { + this[this._ctrlKeysMapDown[e.keyCode]](e); + } + else { + return; + } + e.stopImmediatePropagation(); + e.preventDefault(); + this.canvas && this.canvas.renderAll(); + }, + + /** + * Handles keyup event + * We handle KeyUp because ie11 and edge have difficulties copy/pasting + * if a copy/cut event fired, keyup is dismissed + * @param {Event} e Event object + */ + onKeyUp: function(e) { + if (!this.isEditing || this._copyDone) { + this._copyDone = false; + return; + } + if ((e.keyCode in this._ctrlKeysMapUp) && (e.ctrlKey || e.metaKey)) { + this[this._ctrlKeysMapUp[e.keyCode]](e); + } + else { + return; + } + e.stopImmediatePropagation(); + e.preventDefault(); + this.canvas && this.canvas.renderAll(); + }, + + /** + * Handles onInput event + * @param {Event} e Event object + */ + onInput: function(e) { + if (!this.isEditing || this.inCompositionMode) { + return; + } + var offset = this.selectionStart || 0, + offsetEnd = this.selectionEnd || 0, + textLength = this.text.length, + newTextLength = this.hiddenTextarea.value.length, + diff, charsToInsert, start; + if (newTextLength > textLength) { + //we added some character + start = this._selectionDirection === 'left' ? offsetEnd : offset; + diff = newTextLength - textLength; + charsToInsert = this.hiddenTextarea.value.slice(start, start + diff); + } + else { + //we selected a portion of text and then input something else. + //Internet explorer does not trigger this else + diff = newTextLength - textLength + offsetEnd - offset; + charsToInsert = this.hiddenTextarea.value.slice(offset, offset + diff); + } + this.insertChars(charsToInsert); + e.stopPropagation(); + }, + + /** + * Composition start + */ + onCompositionStart: function() { + this.inCompositionMode = true; + this.prevCompositionLength = 0; + this.compositionStart = this.selectionStart; + }, + + /** + * Composition end + */ + onCompositionEnd: function() { + this.inCompositionMode = false; + }, + + /** + * Composition update + */ + onCompositionUpdate: function(e) { + var data = e.data; + this.selectionStart = this.compositionStart; + this.selectionEnd = this.selectionEnd === this.selectionStart ? + this.compositionStart + this.prevCompositionLength : this.selectionEnd; + this.insertChars(data, false); + this.prevCompositionLength = data.length; + }, + + /** + * Forward delete + */ + forwardDelete: function(e) { + if (this.selectionStart === this.selectionEnd) { + if (this.selectionStart === this.text.length) { + return; + } + this.moveCursorRight(e); + } + this.removeChars(e); + }, + + /** + * Copies selected text + * @param {Event} e Event object + */ + copy: function(e) { + if (this.selectionStart === this.selectionEnd) { + //do not cut-copy if no selection + return; + } + var selectedText = this.getSelectedText(), + clipboardData = this._getClipboardData(e); + + // Check for backward compatibility with old browsers + if (clipboardData) { + clipboardData.setData('text', selectedText); + } + + fabric.copiedText = selectedText; + fabric.copiedTextStyle = this.getSelectionStyles( + this.selectionStart, + this.selectionEnd); + e.stopImmediatePropagation(); + e.preventDefault(); + this._copyDone = true; + }, + + /** + * Pastes text + * @param {Event} e Event object + */ + paste: function(e) { + var copiedText = null, + clipboardData = this._getClipboardData(e), + useCopiedStyle = true; + + // Check for backward compatibility with old browsers + if (clipboardData) { + copiedText = clipboardData.getData('text').replace(/\r/g, ''); + if (!fabric.copiedTextStyle || fabric.copiedText !== copiedText) { + useCopiedStyle = false; + } + } + else { + copiedText = fabric.copiedText; + } + + if (copiedText) { + this.insertChars(copiedText, useCopiedStyle); + } + e.stopImmediatePropagation(); + e.preventDefault(); + }, + + /** + * Cuts text + * @param {Event} e Event object + */ + cut: function(e) { + if (this.selectionStart === this.selectionEnd) { + return; + } + + this.copy(e); + this.removeChars(e); + }, + + /** + * @private + * @param {Event} e Event object + * @return {Object} Clipboard data object + */ + _getClipboardData: function(e) { + return (e && e.clipboardData) || fabric.window.clipboardData; + }, + + /** + * Finds the width in pixels before the cursor on the same line + * @private + * @param {Number} lineIndex + * @param {Number} charIndex + * @return {Number} widthBeforeCursor width before cursor + */ + _getWidthBeforeCursor: function(lineIndex, charIndex) { + var textBeforeCursor = this._textLines[lineIndex].slice(0, charIndex), + widthOfLine = this._getLineWidth(this.ctx, lineIndex), + widthBeforeCursor = this._getLineLeftOffset(widthOfLine), _char; + + for (var i = 0, len = textBeforeCursor.length; i < len; i++) { + _char = textBeforeCursor[i]; + widthBeforeCursor += this._getWidthOfChar(this.ctx, _char, lineIndex, i); + } + return widthBeforeCursor; + }, + + /** + * Gets start offset of a selection + * @param {Event} e Event object + * @param {Boolean} isRight + * @return {Number} + */ + getDownCursorOffset: function(e, isRight) { + var selectionProp = this._getSelectionForOffset(e, isRight), + cursorLocation = this.get2DCursorLocation(selectionProp), + lineIndex = cursorLocation.lineIndex; + // if on last line, down cursor goes to end of line + if (lineIndex === this._textLines.length - 1 || e.metaKey || e.keyCode === 34) { + // move to the end of a text + return this.text.length - selectionProp; + } + var charIndex = cursorLocation.charIndex, + widthBeforeCursor = this._getWidthBeforeCursor(lineIndex, charIndex), + indexOnOtherLine = this._getIndexOnLine(lineIndex + 1, widthBeforeCursor), + textAfterCursor = this._textLines[lineIndex].slice(charIndex); + + return textAfterCursor.length + indexOnOtherLine + 2; + }, + + /** + * private + * Helps finding if the offset should be counted from Start or End + * @param {Event} e Event object + * @param {Boolean} isRight + * @return {Number} + */ + _getSelectionForOffset: function(e, isRight) { + if (e.shiftKey && this.selectionStart !== this.selectionEnd && isRight) { + return this.selectionEnd; + } + else { + return this.selectionStart; + } + }, + + /** + * @param {Event} e Event object + * @param {Boolean} isRight + * @return {Number} + */ + getUpCursorOffset: function(e, isRight) { + var selectionProp = this._getSelectionForOffset(e, isRight), + cursorLocation = this.get2DCursorLocation(selectionProp), + lineIndex = cursorLocation.lineIndex; + if (lineIndex === 0 || e.metaKey || e.keyCode === 33) { + // if on first line, up cursor goes to start of line + return -selectionProp; + } + var charIndex = cursorLocation.charIndex, + widthBeforeCursor = this._getWidthBeforeCursor(lineIndex, charIndex), + indexOnOtherLine = this._getIndexOnLine(lineIndex - 1, widthBeforeCursor), + textBeforeCursor = this._textLines[lineIndex].slice(0, charIndex); + // return a negative offset + return -this._textLines[lineIndex - 1].length + indexOnOtherLine - textBeforeCursor.length; + }, + + /** + * find for a given width it founds the matching character. + * @private + */ + _getIndexOnLine: function(lineIndex, width) { + + var widthOfLine = this._getLineWidth(this.ctx, lineIndex), + textOnLine = this._textLines[lineIndex], + lineLeftOffset = this._getLineLeftOffset(widthOfLine), + widthOfCharsOnLine = lineLeftOffset, + indexOnLine = 0, + foundMatch; + + for (var j = 0, jlen = textOnLine.length; j < jlen; j++) { + + var _char = textOnLine[j], + widthOfChar = this._getWidthOfChar(this.ctx, _char, lineIndex, j); + + widthOfCharsOnLine += widthOfChar; + + if (widthOfCharsOnLine > width) { + + foundMatch = true; + + var leftEdge = widthOfCharsOnLine - widthOfChar, + rightEdge = widthOfCharsOnLine, + offsetFromLeftEdge = Math.abs(leftEdge - width), + offsetFromRightEdge = Math.abs(rightEdge - width); + + indexOnLine = offsetFromRightEdge < offsetFromLeftEdge ? j : (j - 1); + + break; + } + } + + // reached end + if (!foundMatch) { + indexOnLine = textOnLine.length - 1; + } + + return indexOnLine; + }, + + + /** + * Moves cursor down + * @param {Event} e Event object + */ + moveCursorDown: function(e) { + if (this.selectionStart >= this.text.length && this.selectionEnd >= this.text.length) { + return; + } + this._moveCursorUpOrDown('Down', e); + }, + + /** + * Moves cursor up + * @param {Event} e Event object + */ + moveCursorUp: function(e) { + if (this.selectionStart === 0 && this.selectionEnd === 0) { + return; + } + this._moveCursorUpOrDown('Up', e); + }, + + /** + * Moves cursor up or down, fires the events + * @param {String} direction 'Up' or 'Down' + * @param {Event} e Event object + */ + _moveCursorUpOrDown: function(direction, e) { + // getUpCursorOffset + // getDownCursorOffset + var action = 'get' + direction + 'CursorOffset', + offset = this[action](e, this._selectionDirection === 'right'); + if (e.shiftKey) { + this.moveCursorWithShift(offset); + } + else { + this.moveCursorWithoutShift(offset); + } + if (offset !== 0) { + this.setSelectionInBoundaries(); + this.abortCursorAnimation(); + this._currentCursorOpacity = 1; + this.initDelayedCursor(); + this._fireSelectionChanged(); + this._updateTextarea(); + } + }, + + /** + * Moves cursor with shift + * @param {Number} offset + */ + moveCursorWithShift: function(offset) { + var newSelection = this._selectionDirection === 'left' + ? this.selectionStart + offset + : this.selectionEnd + offset; + this.setSelectionStartEndWithShift(this.selectionStart, this.selectionEnd, newSelection); + return offset !== 0; + }, + + /** + * Moves cursor up without shift + * @param {Number} offset + */ + moveCursorWithoutShift: function(offset) { + if (offset < 0) { + this.selectionStart += offset; + this.selectionEnd = this.selectionStart; + } + else { + this.selectionEnd += offset; + this.selectionStart = this.selectionEnd; + } + return offset !== 0; + }, + + /** + * Moves cursor left + * @param {Event} e Event object + */ + moveCursorLeft: function(e) { + if (this.selectionStart === 0 && this.selectionEnd === 0) { + return; + } + this._moveCursorLeftOrRight('Left', e); + }, + + /** + * @private + * @return {Boolean} true if a change happened + */ + _move: function(e, prop, direction) { + var newValue; + if (e.altKey) { + newValue = this['findWordBoundary' + direction](this[prop]); + } + else if (e.metaKey || e.keyCode === 35 || e.keyCode === 36 ) { + newValue = this['findLineBoundary' + direction](this[prop]); + } + else { + this[prop] += direction === 'Left' ? -1 : 1; + return true; + } + if (typeof newValue !== undefined && this[prop] !== newValue) { + this[prop] = newValue; + return true; + } + }, + + /** + * @private + */ + _moveLeft: function(e, prop) { + return this._move(e, prop, 'Left'); + }, + + /** + * @private + */ + _moveRight: function(e, prop) { + return this._move(e, prop, 'Right'); + }, + + /** + * Moves cursor left without keeping selection + * @param {Event} e + */ + moveCursorLeftWithoutShift: function(e) { + var change = true; + this._selectionDirection = 'left'; + + // only move cursor when there is no selection, + // otherwise we discard it, and leave cursor on same place + if (this.selectionEnd === this.selectionStart && this.selectionStart !== 0) { + change = this._moveLeft(e, 'selectionStart'); + + } + this.selectionEnd = this.selectionStart; + return change; + }, + + /** + * Moves cursor left while keeping selection + * @param {Event} e + */ + moveCursorLeftWithShift: function(e) { + if (this._selectionDirection === 'right' && this.selectionStart !== this.selectionEnd) { + return this._moveLeft(e, 'selectionEnd'); + } + else if (this.selectionStart !== 0){ + this._selectionDirection = 'left'; + return this._moveLeft(e, 'selectionStart'); + } + }, + + /** + * Moves cursor right + * @param {Event} e Event object + */ + moveCursorRight: function(e) { + if (this.selectionStart >= this.text.length && this.selectionEnd >= this.text.length) { + return; + } + this._moveCursorLeftOrRight('Right', e); + }, + + /** + * Moves cursor right or Left, fires event + * @param {String} direction 'Left', 'Right' + * @param {Event} e Event object + */ + _moveCursorLeftOrRight: function(direction, e) { + var actionName = 'moveCursor' + direction + 'With'; + this._currentCursorOpacity = 1; + + if (e.shiftKey) { + actionName += 'Shift'; + } + else { + actionName += 'outShift'; + } + if (this[actionName](e)) { + this.abortCursorAnimation(); + this.initDelayedCursor(); + this._fireSelectionChanged(); + this._updateTextarea(); + } + }, + + /** + * Moves cursor right while keeping selection + * @param {Event} e + */ + moveCursorRightWithShift: function(e) { + if (this._selectionDirection === 'left' && this.selectionStart !== this.selectionEnd) { + return this._moveRight(e, 'selectionStart'); + } + else if (this.selectionEnd !== this.text.length) { + this._selectionDirection = 'right'; + return this._moveRight(e, 'selectionEnd'); + } + }, + + /** + * Moves cursor right without keeping selection + * @param {Event} e Event object + */ + moveCursorRightWithoutShift: function(e) { + var changed = true; + this._selectionDirection = 'right'; + + if (this.selectionStart === this.selectionEnd) { + changed = this._moveRight(e, 'selectionStart'); + this.selectionEnd = this.selectionStart; + } + else { + this.selectionStart = this.selectionEnd; + } + return changed; + }, + + /** + * Removes characters selected by selection + * @param {Event} e Event object + */ + removeChars: function(e) { + if (this.selectionStart === this.selectionEnd) { + this._removeCharsNearCursor(e); + } + else { + this._removeCharsFromTo(this.selectionStart, this.selectionEnd); + } + + this.setSelectionEnd(this.selectionStart); + + this._removeExtraneousStyles(); + + this.canvas && this.canvas.renderAll(); + + this.setCoords(); + this.fire('changed'); + this.canvas && this.canvas.fire('text:changed', { target: this }); + }, + + /** + * @private + * @param {Event} e Event object + */ + _removeCharsNearCursor: function(e) { + if (this.selectionStart === 0) { + return; + } + if (e.metaKey) { + // remove all till the start of current line + var leftLineBoundary = this.findLineBoundaryLeft(this.selectionStart); + + this._removeCharsFromTo(leftLineBoundary, this.selectionStart); + this.setSelectionStart(leftLineBoundary); + } + else if (e.altKey) { + // remove all till the start of current word + var leftWordBoundary = this.findWordBoundaryLeft(this.selectionStart); + + this._removeCharsFromTo(leftWordBoundary, this.selectionStart); + this.setSelectionStart(leftWordBoundary); + } + else { + this._removeSingleCharAndStyle(this.selectionStart); + this.setSelectionStart(this.selectionStart - 1); + } + } +}); + + +/* _TO_SVG_START_ */ +(function() { + var toFixed = fabric.util.toFixed, + NUM_FRACTION_DIGITS = fabric.Object.NUM_FRACTION_DIGITS; + + fabric.util.object.extend(fabric.IText.prototype, /** @lends fabric.IText.prototype */ { + + /** + * @private + */ + _setSVGTextLineText: function(lineIndex, textSpans, height, textLeftOffset, textTopOffset, textBgRects) { + if (!this._getLineStyle(lineIndex)) { + fabric.Text.prototype._setSVGTextLineText.call(this, + lineIndex, textSpans, height, textLeftOffset, textTopOffset); + } + else { + this._setSVGTextLineChars( + lineIndex, textSpans, height, textLeftOffset, textBgRects); + } + }, + + /** + * @private + */ + _setSVGTextLineChars: function(lineIndex, textSpans, height, textLeftOffset, textBgRects) { + + var chars = this._textLines[lineIndex], + charOffset = 0, + lineLeftOffset = this._getLineLeftOffset(this._getLineWidth(this.ctx, lineIndex)) - this.width / 2, + lineOffset = this._getSVGLineTopOffset(lineIndex), + heightOfLine = this._getHeightOfLine(this.ctx, lineIndex); + + for (var i = 0, len = chars.length; i < len; i++) { + var styleDecl = this._getStyleDeclaration(lineIndex, i) || { }; + + textSpans.push( + this._createTextCharSpan( + chars[i], styleDecl, lineLeftOffset, lineOffset.lineTop + lineOffset.offset, charOffset)); + + var charWidth = this._getWidthOfChar(this.ctx, chars[i], lineIndex, i); + + if (styleDecl.textBackgroundColor) { + textBgRects.push( + this._createTextCharBg( + styleDecl, lineLeftOffset, lineOffset.lineTop, heightOfLine, charWidth, charOffset)); + } + + charOffset += charWidth; + } + }, + + /** + * @private + */ + _getSVGLineTopOffset: function(lineIndex) { + var lineTopOffset = 0, lastHeight = 0; + for (var j = 0; j < lineIndex; j++) { + lineTopOffset += this._getHeightOfLine(this.ctx, j); + } + lastHeight = this._getHeightOfLine(this.ctx, j); + return { + lineTop: lineTopOffset, + offset: (this._fontSizeMult - this._fontSizeFraction) * lastHeight / (this.lineHeight * this._fontSizeMult) + }; + }, + + /** + * @private + */ + _createTextCharBg: function(styleDecl, lineLeftOffset, lineTopOffset, heightOfLine, charWidth, charOffset) { + return [ + '\t\t\n' + ].join(''); + }, + + /** + * @private + */ + _createTextCharSpan: function(_char, styleDecl, lineLeftOffset, lineTopOffset, charOffset) { + + var fillStyles = this.getSvgStyles.call(fabric.util.object.extend({ + visible: true, + fill: this.fill, + stroke: this.stroke, + type: 'text', + getSvgFilter: fabric.Object.prototype.getSvgFilter + }, styleDecl)); + + return [ + '\t\t\t', + fabric.util.string.escapeXml(_char), + '\n' + ].join(''); + } + }); +})(); +/* _TO_SVG_END_ */ + + +(function(global) { + + 'use strict'; + + var fabric = global.fabric || (global.fabric = {}), + clone = fabric.util.object.clone; + + /** + * Textbox class, based on IText, allows the user to resize the text rectangle + * and wraps lines automatically. Textboxes have their Y scaling locked, the + * user can only change width. Height is adjusted automatically based on the + * wrapping of lines. + * @class fabric.Textbox + * @extends fabric.IText + * @mixes fabric.Observable + * @return {fabric.Textbox} thisArg + * @see {@link fabric.Textbox#initialize} for constructor definition + */ + fabric.Textbox = fabric.util.createClass(fabric.IText, fabric.Observable, { + + /** + * Type of an object + * @type String + * @default + */ + type: 'textbox', + + /** + * Minimum width of textbox, in pixels. + * @type Number + * @default + */ + minWidth: 20, + + /** + * Minimum calculated width of a textbox, in pixels. + * fixed to 2 so that an empty textbox cannot go to 0 + * and is still selectable without text. + * @type Number + * @default + */ + dynamicMinWidth: 2, + + /** + * Cached array of text wrapping. + * @type Array + */ + __cachedLines: null, + + /** + * Override standard Object class values + */ + lockScalingY: true, + + /** + * Override standard Object class values + */ + lockScalingFlip: true, + + /** + * Constructor. Some scaling related property values are forced. Visibility + * of controls is also fixed; only the rotation and width controls are + * made available. + * @param {String} text Text string + * @param {Object} [options] Options object + * @return {fabric.Textbox} thisArg + */ + initialize: function(text, options) { + this.ctx = fabric.util.createCanvasElement().getContext('2d'); + this.callSuper('initialize', text, options); + this.setControlsVisibility(fabric.Textbox.getTextboxControlVisibility()); + + // add width to this list of props that effect line wrapping. + this._dimensionAffectingProps.width = true; + }, + + /** + * Unlike superclass's version of this function, Textbox does not update + * its width. + * @param {CanvasRenderingContext2D} ctx Context to use for measurements + * @private + * @override + */ + _initDimensions: function(ctx) { + if (this.__skipDimension) { + return; + } + + if (!ctx) { + ctx = fabric.util.createCanvasElement().getContext('2d'); + this._setTextStyles(ctx); + } + + // clear dynamicMinWidth as it will be different after we re-wrap line + this.dynamicMinWidth = 0; + + // wrap lines + this._textLines = this._splitTextIntoLines(); + // if after wrapping, the width is smaller than dynamicMinWidth, change the width and re-wrap + if (this.dynamicMinWidth > this.width) { + this._set('width', this.dynamicMinWidth); + } + + // clear cache and re-calculate height + this._clearCache(); + this.height = this._getTextHeight(ctx); + }, + + /** + * Generate an object that translates the style object so that it is + * broken up by visual lines (new lines and automatic wrapping). + * The original text styles object is broken up by actual lines (new lines only), + * which is only sufficient for Text / IText + * @private + */ + _generateStyleMap: function() { + var realLineCount = 0, + realLineCharCount = 0, + charCount = 0, + map = {}; + + for (var i = 0; i < this._textLines.length; i++) { + if (this.text[charCount] === '\n' && i > 0) { + realLineCharCount = 0; + charCount++; + realLineCount++; + } + else if (this.text[charCount] === ' ' && i > 0) { + // this case deals with space's that are removed from end of lines when wrapping + realLineCharCount++; + charCount++; + } + + map[i] = { line: realLineCount, offset: realLineCharCount }; + + charCount += this._textLines[i].length; + realLineCharCount += this._textLines[i].length; + } + + return map; + }, + + /** + * @param {Number} lineIndex + * @param {Number} charIndex + * @param {Boolean} [returnCloneOrEmpty=false] + * @private + */ + _getStyleDeclaration: function(lineIndex, charIndex, returnCloneOrEmpty) { + if (this._styleMap) { + var map = this._styleMap[lineIndex]; + if (!map) { + return returnCloneOrEmpty ? { } : null; + } + lineIndex = map.line; + charIndex = map.offset + charIndex; + } + return this.callSuper('_getStyleDeclaration', lineIndex, charIndex, returnCloneOrEmpty); + }, + + /** + * @param {Number} lineIndex + * @param {Number} charIndex + * @param {Object} style + * @private + */ + _setStyleDeclaration: function(lineIndex, charIndex, style) { + var map = this._styleMap[lineIndex]; + lineIndex = map.line; + charIndex = map.offset + charIndex; + + this.styles[lineIndex][charIndex] = style; + }, + + /** + * @param {Number} lineIndex + * @param {Number} charIndex + * @private + */ + _deleteStyleDeclaration: function(lineIndex, charIndex) { + var map = this._styleMap[lineIndex]; + lineIndex = map.line; + charIndex = map.offset + charIndex; + + delete this.styles[lineIndex][charIndex]; + }, + + /** + * @param {Number} lineIndex + * @private + */ + _getLineStyle: function(lineIndex) { + var map = this._styleMap[lineIndex]; + return this.styles[map.line]; + }, + + /** + * @param {Number} lineIndex + * @param {Object} style + * @private + */ + _setLineStyle: function(lineIndex, style) { + var map = this._styleMap[lineIndex]; + this.styles[map.line] = style; + }, + + /** + * @param {Number} lineIndex + * @private + */ + _deleteLineStyle: function(lineIndex) { + var map = this._styleMap[lineIndex]; + delete this.styles[map.line]; + }, + + /** + * Wraps text using the 'width' property of Textbox. First this function + * splits text on newlines, so we preserve newlines entered by the user. + * Then it wraps each line using the width of the Textbox by calling + * _wrapLine(). + * @param {CanvasRenderingContext2D} ctx Context to use for measurements + * @param {String} text The string of text that is split into lines + * @returns {Array} Array of lines + */ + _wrapText: function(ctx, text) { + var lines = text.split(this._reNewline), wrapped = [], i; + + for (i = 0; i < lines.length; i++) { + wrapped = wrapped.concat(this._wrapLine(ctx, lines[i], i)); + } + + return wrapped; + }, + + /** + * Helper function to measure a string of text, given its lineIndex and charIndex offset + * + * @param {CanvasRenderingContext2D} ctx + * @param {String} text + * @param {number} lineIndex + * @param {number} charOffset + * @returns {number} + * @private + */ + _measureText: function(ctx, text, lineIndex, charOffset) { + var width = 0; + charOffset = charOffset || 0; + for (var i = 0, len = text.length; i < len; i++) { + width += this._getWidthOfChar(ctx, text[i], lineIndex, i + charOffset); + } + return width; + }, + + /** + * Wraps a line of text using the width of the Textbox and a context. + * @param {CanvasRenderingContext2D} ctx Context to use for measurements + * @param {String} text The string of text to split into lines + * @param {Number} lineIndex + * @returns {Array} Array of line(s) into which the given text is wrapped + * to. + */ + _wrapLine: function(ctx, text, lineIndex) { + var lineWidth = 0, + lines = [], + line = '', + words = text.split(' '), + word = '', + offset = 0, + infix = ' ', + wordWidth = 0, + infixWidth = 0, + largestWordWidth = 0, + lineJustStarted = true, + additionalSpace = this._getWidthOfCharSpacing(); + + for (var i = 0; i < words.length; i++) { + word = words[i]; + wordWidth = this._measureText(ctx, word, lineIndex, offset); + + offset += word.length; + + lineWidth += infixWidth + wordWidth - additionalSpace; + + if (lineWidth >= this.width && !lineJustStarted) { + lines.push(line); + line = ''; + lineWidth = wordWidth; + lineJustStarted = true; + } + else { + lineWidth += additionalSpace; + } + + if (!lineJustStarted) { + line += infix; + } + line += word; + + infixWidth = this._measureText(ctx, infix, lineIndex, offset); + offset++; + lineJustStarted = false; + // keep track of largest word + if (wordWidth > largestWordWidth) { + largestWordWidth = wordWidth; + } + } + + i && lines.push(line); + + if (largestWordWidth > this.dynamicMinWidth) { + this.dynamicMinWidth = largestWordWidth - additionalSpace; + } + + return lines; + }, + /** + * Gets lines of text to render in the Textbox. This function calculates + * text wrapping on the fly everytime it is called. + * @returns {Array} Array of lines in the Textbox. + * @override + */ + _splitTextIntoLines: function() { + var originalAlign = this.textAlign; + this.ctx.save(); + this._setTextStyles(this.ctx); + this.textAlign = 'left'; + var lines = this._wrapText(this.ctx, this.text); + this.textAlign = originalAlign; + this.ctx.restore(); + this._textLines = lines; + this._styleMap = this._generateStyleMap(); + return lines; + }, + + /** + * When part of a group, we don't want the Textbox's scale to increase if + * the group's increases. That's why we reduce the scale of the Textbox by + * the amount that the group's increases. This is to maintain the effective + * scale of the Textbox at 1, so that font-size values make sense. Otherwise + * the same font-size value would result in different actual size depending + * on the value of the scale. + * @param {String} key + * @param {*} value + */ + setOnGroup: function(key, value) { + if (key === 'scaleX') { + this.set('scaleX', Math.abs(1 / value)); + this.set('width', (this.get('width') * value) / + (typeof this.__oldScaleX === 'undefined' ? 1 : this.__oldScaleX)); + this.__oldScaleX = value; + } + }, + + /** + * Returns 2d representation (lineIndex and charIndex) of cursor (or selection start). + * Overrides the superclass function to take into account text wrapping. + * + * @param {Number} [selectionStart] Optional index. When not given, current selectionStart is used. + */ + get2DCursorLocation: function(selectionStart) { + if (typeof selectionStart === 'undefined') { + selectionStart = this.selectionStart; + } + + var numLines = this._textLines.length, + removed = 0; + + for (var i = 0; i < numLines; i++) { + var line = this._textLines[i], + lineLen = line.length; + + if (selectionStart <= removed + lineLen) { + return { + lineIndex: i, + charIndex: selectionStart - removed + }; + } + + removed += lineLen; + + if (this.text[removed] === '\n' || this.text[removed] === ' ') { + removed++; + } + } + + return { + lineIndex: numLines - 1, + charIndex: this._textLines[numLines - 1].length + }; + }, + + /** + * Overrides superclass function and uses text wrapping data to get cursor + * boundary offsets instead of the array of chars. + * @param {Array} chars Unused + * @param {String} typeOfBoundaries Can be 'cursor' or 'selection' + * @returns {Object} Object with 'top', 'left', and 'lineLeft' properties set. + */ + _getCursorBoundariesOffsets: function(chars, typeOfBoundaries) { + var topOffset = 0, + leftOffset = 0, + cursorLocation = this.get2DCursorLocation(), + lineChars = this._textLines[cursorLocation.lineIndex].split(''), + lineLeftOffset = this._getLineLeftOffset(this._getLineWidth(this.ctx, cursorLocation.lineIndex)); + + for (var i = 0; i < cursorLocation.charIndex; i++) { + leftOffset += this._getWidthOfChar(this.ctx, lineChars[i], cursorLocation.lineIndex, i); + } + + for (i = 0; i < cursorLocation.lineIndex; i++) { + topOffset += this._getHeightOfLine(this.ctx, i); + } + + if (typeOfBoundaries === 'cursor') { + topOffset += (1 - this._fontSizeFraction) * this._getHeightOfLine(this.ctx, cursorLocation.lineIndex) + / this.lineHeight - this.getCurrentCharFontSize(cursorLocation.lineIndex, cursorLocation.charIndex) + * (1 - this._fontSizeFraction); + } + + return { + top: topOffset, + left: leftOffset, + lineLeft: lineLeftOffset + }; + }, + + getMinWidth: function() { + return Math.max(this.minWidth, this.dynamicMinWidth); + }, + + /** + * Returns object representation of an instance + * @method toObject + * @param {Array} [propertiesToInclude] Any properties that you might want to additionally include in the output + * @return {Object} object representation of an instance + */ + toObject: function(propertiesToInclude) { + return fabric.util.object.extend(this.callSuper('toObject', propertiesToInclude), { + minWidth: this.minWidth + }); + } + }); + /** + * Returns fabric.Textbox instance from an object representation + * @static + * @memberOf fabric.Textbox + * @param {Object} object Object to create an instance from + * @param {Function} [callback] Callback to invoke when an fabric.Textbox instance is created + * @return {fabric.Textbox} instance of fabric.Textbox + */ + fabric.Textbox.fromObject = function(object, callback) { + var textbox = new fabric.Textbox(object.text, clone(object)); + callback && callback(textbox); + return textbox; + }; + /** + * Returns the default controls visibility required for Textboxes. + * @returns {Object} + */ + fabric.Textbox.getTextboxControlVisibility = function() { + return { + tl: false, + tr: false, + br: false, + bl: false, + ml: true, + mt: false, + mr: true, + mb: false, + mtr: true + }; + }; + +})(typeof exports !== 'undefined' ? exports : this); + + +(function() { + + /** + * Override _setObjectScale and add Textbox specific resizing behavior. Resizing + * a Textbox doesn't scale text, it only changes width and makes text wrap automatically. + */ + var setObjectScaleOverridden = fabric.Canvas.prototype._setObjectScale; + + fabric.Canvas.prototype._setObjectScale = function(localMouse, transform, + lockScalingX, lockScalingY, by, lockScalingFlip, _dim) { + + var t = transform.target; + if (t instanceof fabric.Textbox) { + var w = t.width * ((localMouse.x / transform.scaleX) / (t.width + t.strokeWidth)); + if (w >= t.getMinWidth()) { + t.set('width', w); + return true; + } + } + else { + return setObjectScaleOverridden.call(fabric.Canvas.prototype, localMouse, transform, + lockScalingX, lockScalingY, by, lockScalingFlip, _dim); + } + }; + + /** + * Sets controls of this group to the Textbox's special configuration if + * one is present in the group. Deletes _controlsVisibility otherwise, so that + * it gets initialized to default value at runtime. + */ + fabric.Group.prototype._refreshControlsVisibility = function() { + if (typeof fabric.Textbox === 'undefined') { + return; + } + for (var i = this._objects.length; i--;) { + if (this._objects[i] instanceof fabric.Textbox) { + this.setControlsVisibility(fabric.Textbox.getTextboxControlVisibility()); + return; + } + } + }; + + var clone = fabric.util.object.clone; + + fabric.util.object.extend(fabric.Textbox.prototype, /** @lends fabric.IText.prototype */ { + /** + * @private + */ + _removeExtraneousStyles: function() { + for (var prop in this._styleMap) { + if (!this._textLines[prop]) { + delete this.styles[this._styleMap[prop].line]; + } + } + }, + + /** + * Inserts style object for a given line/char index + * @param {Number} lineIndex Index of a line + * @param {Number} charIndex Index of a char + * @param {Object} [style] Style object to insert, if given + */ + insertCharStyleObject: function(lineIndex, charIndex, style) { + // adjust lineIndex and charIndex + var map = this._styleMap[lineIndex]; + lineIndex = map.line; + charIndex = map.offset + charIndex; + + fabric.IText.prototype.insertCharStyleObject.apply(this, [lineIndex, charIndex, style]); + }, + + /** + * Inserts new style object + * @param {Number} lineIndex Index of a line + * @param {Number} charIndex Index of a char + * @param {Boolean} isEndOfLine True if it's end of line + */ + insertNewlineStyleObject: function(lineIndex, charIndex, isEndOfLine) { + // adjust lineIndex and charIndex + var map = this._styleMap[lineIndex]; + lineIndex = map.line; + charIndex = map.offset + charIndex; + + fabric.IText.prototype.insertNewlineStyleObject.apply(this, [lineIndex, charIndex, isEndOfLine]); + }, + + /** + * Shifts line styles up or down. This function is slightly different than the one in + * itext_behaviour as it takes into account the styleMap. + * + * @param {Number} lineIndex Index of a line + * @param {Number} offset Can be -1 or +1 + */ + shiftLineStyles: function(lineIndex, offset) { + // shift all line styles by 1 upward + var clonedStyles = clone(this.styles), + map = this._styleMap[lineIndex]; + + // adjust line index + lineIndex = map.line; + + for (var line in this.styles) { + var numericLine = parseInt(line, 10); + + if (numericLine > lineIndex) { + this.styles[numericLine + offset] = clonedStyles[numericLine]; + + if (!clonedStyles[numericLine - offset]) { + delete this.styles[numericLine]; + } + } + } + //TODO: evaluate if delete old style lines with offset -1 + }, + + /** + * Figure out programatically the text on previous actual line (actual = separated by \n); + * + * @param {Number} lIndex + * @returns {String} + * @private + */ + _getTextOnPreviousLine: function(lIndex) { + var textOnPreviousLine = this._textLines[lIndex - 1]; + + while (this._styleMap[lIndex - 2] && this._styleMap[lIndex - 2].line === this._styleMap[lIndex - 1].line) { + textOnPreviousLine = this._textLines[lIndex - 2] + textOnPreviousLine; + + lIndex--; + } + + return textOnPreviousLine; + }, + + /** + * Removes style object + * @param {Boolean} isBeginningOfLine True if cursor is at the beginning of line + * @param {Number} [index] Optional index. When not given, current selectionStart is used. + */ + removeStyleObject: function(isBeginningOfLine, index) { + + var cursorLocation = this.get2DCursorLocation(index), + map = this._styleMap[cursorLocation.lineIndex], + lineIndex = map.line, + charIndex = map.offset + cursorLocation.charIndex; + this._removeStyleObject(isBeginningOfLine, cursorLocation, lineIndex, charIndex); + } + }); +})(); + + +(function() { + var override = fabric.IText.prototype._getNewSelectionStartFromOffset; + /** + * Overrides the IText implementation and adjusts character index as there is not always a linebreak + * + * @param {Number} mouseOffset + * @param {Number} prevWidth + * @param {Number} width + * @param {Number} index + * @param {Number} jlen + * @returns {Number} + */ + fabric.IText.prototype._getNewSelectionStartFromOffset = function(mouseOffset, prevWidth, width, index, jlen) { + index = override.call(this, mouseOffset, prevWidth, width, index, jlen); + + // the index passed into the function is padded by the amount of lines from _textLines (to account for \n) + // we need to remove this padding, and pad it by actual lines, and / or spaces that are meant to be there + var tmp = 0, + removed = 0; + + // account for removed characters + for (var i = 0; i < this._textLines.length; i++) { + tmp += this._textLines[i].length; + + if (tmp + removed >= index) { + break; + } + + if (this.text[tmp + removed] === '\n' || this.text[tmp + removed] === ' ') { + removed++; + } + } + + return index - i + removed; + }; +})(); + + +(function() { + + if (typeof document !== 'undefined' && typeof window !== 'undefined') { + return; + } + + var DOMParser = require('xmldom').DOMParser, + URL = require('url'), + HTTP = require('http'), + HTTPS = require('https'), + + Canvas = require('canvas'), + Image = require('canvas').Image; + + /** @private */ + function request(url, encoding, callback) { + var oURL = URL.parse(url); + + // detect if http or https is used + if ( !oURL.port ) { + oURL.port = ( oURL.protocol.indexOf('https:') === 0 ) ? 443 : 80; + } + + // assign request handler based on protocol + var reqHandler = (oURL.protocol.indexOf('https:') === 0 ) ? HTTPS : HTTP, + req = reqHandler.request({ + hostname: oURL.hostname, + port: oURL.port, + path: oURL.path, + method: 'GET' + }, function(response) { + var body = ''; + if (encoding) { + response.setEncoding(encoding); + } + response.on('end', function () { + callback(body); + }); + response.on('data', function (chunk) { + if (response.statusCode === 200) { + body += chunk; + } + }); + }); + + req.on('error', function(err) { + if (err.errno === process.ECONNREFUSED) { + fabric.log('ECONNREFUSED: connection refused to ' + oURL.hostname + ':' + oURL.port); + } + else { + fabric.log(err.message); + } + callback(null); + }); + + req.end(); + } + + /** @private */ + function requestFs(path, callback) { + var fs = require('fs'); + fs.readFile(path, function (err, data) { + if (err) { + fabric.log(err); + throw err; + } + else { + callback(data); + } + }); + } + + fabric.util.loadImage = function(url, callback, context) { + function createImageAndCallBack(data) { + if (data) { + img.src = new Buffer(data, 'binary'); + // preserving original url, which seems to be lost in node-canvas + img._src = url; + callback && callback.call(context, img); + } + else { + img = null; + callback && callback.call(context, null, true); + } + } + var img = new Image(); + if (url && (url instanceof Buffer || url.indexOf('data') === 0)) { + img.src = img._src = url; + callback && callback.call(context, img); + } + else if (url && url.indexOf('http') !== 0) { + requestFs(url, createImageAndCallBack); + } + else if (url) { + request(url, 'binary', createImageAndCallBack); + } + else { + callback && callback.call(context, url); + } + }; + + fabric.loadSVGFromURL = function(url, callback, reviver) { + url = url.replace(/^\n\s*/, '').replace(/\?.*$/, '').trim(); + if (url.indexOf('http') !== 0) { + requestFs(url, function(body) { + fabric.loadSVGFromString(body.toString(), callback, reviver); + }); + } + else { + request(url, '', function(body) { + fabric.loadSVGFromString(body, callback, reviver); + }); + } + }; + + fabric.loadSVGFromString = function(string, callback, reviver) { + var doc = new DOMParser().parseFromString(string); + fabric.parseSVGDocument(doc.documentElement, function(results, options) { + callback && callback(results, options); + }, reviver); + }; + + fabric.util.getScript = function(url, callback) { + request(url, '', function(body) { + // eslint-disable-next-line no-eval + eval(body); + callback && callback(); + }); + }; + + // fabric.util.createCanvasElement = function(_, width, height) { + // return new Canvas(width, height); + // } + + /** + * Only available when running fabric on node.js + * @param {Number} width Canvas width + * @param {Number} height Canvas height + * @param {Object} [options] Options to pass to FabricCanvas. + * @param {Object} [nodeCanvasOptions] Options to pass to NodeCanvas. + * @return {Object} wrapped canvas instance + */ + fabric.createCanvasForNode = function(width, height, options, nodeCanvasOptions) { + nodeCanvasOptions = nodeCanvasOptions || options; + + var canvasEl = fabric.document.createElement('canvas'), + nodeCanvas = new Canvas(width || 600, height || 600, nodeCanvasOptions), + nodeCacheCanvas = new Canvas(width || 600, height || 600, nodeCanvasOptions); + + // jsdom doesn't create style on canvas element, so here be temp. workaround + canvasEl.style = { }; + + canvasEl.width = nodeCanvas.width; + canvasEl.height = nodeCanvas.height; + options = options || { }; + options.nodeCanvas = nodeCanvas; + options.nodeCacheCanvas = nodeCacheCanvas; + var FabricCanvas = fabric.Canvas || fabric.StaticCanvas, + fabricCanvas = new FabricCanvas(canvasEl, options); + fabricCanvas.nodeCanvas = nodeCanvas; + fabricCanvas.nodeCacheCanvas = nodeCacheCanvas; + fabricCanvas.contextContainer = nodeCanvas.getContext('2d'); + fabricCanvas.contextCache = nodeCacheCanvas.getContext('2d'); + fabricCanvas.Font = Canvas.Font; + return fabricCanvas; + }; + + var originaInitStatic = fabric.StaticCanvas.prototype._initStatic; + fabric.StaticCanvas.prototype._initStatic = function(el, options) { + el = el || fabric.document.createElement('canvas'); + this.nodeCanvas = new Canvas(el.width, el.height); + this.nodeCacheCanvas = new Canvas(el.width, el.height); + originaInitStatic.call(this, el, options); + this.contextContainer = this.nodeCanvas.getContext('2d'); + this.contextCache = this.nodeCacheCanvas.getContext('2d'); + this.Font = Canvas.Font; + } + + /** @ignore */ + fabric.StaticCanvas.prototype.createPNGStream = function() { + return this.nodeCanvas.createPNGStream(); + }; + + fabric.StaticCanvas.prototype.createJPEGStream = function(opts) { + return this.nodeCanvas.createJPEGStream(opts); + }; + + fabric.StaticCanvas.prototype._initRetinaScaling = function() { + if (!this._isRetinaScaling()) { + return; + } + + this.lowerCanvasEl.setAttribute('width', this.width * fabric.devicePixelRatio); + this.lowerCanvasEl.setAttribute('height', this.height * fabric.devicePixelRatio); + this.nodeCanvas.width = this.width * fabric.devicePixelRatio; + this.nodeCanvas.height = this.height * fabric.devicePixelRatio; + this.contextContainer.scale(fabric.devicePixelRatio, fabric.devicePixelRatio); + return this; + }; + if (fabric.Canvas) { + fabric.Canvas.prototype._initRetinaScaling = fabric.StaticCanvas.prototype._initRetinaScaling; + } + + var origSetBackstoreDimension = fabric.StaticCanvas.prototype._setBackstoreDimension; + fabric.StaticCanvas.prototype._setBackstoreDimension = function(prop, value) { + origSetBackstoreDimension.call(this, prop, value); + this.nodeCanvas[prop] = value; + return this; + }; + if (fabric.Canvas) { + fabric.Canvas.prototype._setBackstoreDimension = fabric.StaticCanvas.prototype._setBackstoreDimension; + } + +})(); + diff --git a/app/bower_components/fabric.js/dist/fabric.min.js b/app/bower_components/fabric.js/dist/fabric.min.js new file mode 100644 index 0000000..ae1a1e8 --- /dev/null +++ b/app/bower_components/fabric.js/dist/fabric.min.js @@ -0,0 +1,8 @@ +var fabric=fabric||{version:"1.6.6"};"undefined"!=typeof exports&&(exports.fabric=fabric),"undefined"!=typeof document&&"undefined"!=typeof window?(fabric.document=document,fabric.window=window,window.fabric=fabric):(fabric.document=require("jsdom").jsdom(""),fabric.document.createWindow?fabric.window=fabric.document.createWindow():fabric.window=fabric.document.parentWindow),fabric.isTouchSupported="ontouchstart"in fabric.document.documentElement,fabric.isLikelyNode="undefined"!=typeof Buffer&&"undefined"==typeof window,fabric.SHARED_ATTRIBUTES=["display","transform","fill","fill-opacity","fill-rule","opacity","stroke","stroke-dasharray","stroke-linecap","stroke-linejoin","stroke-miterlimit","stroke-opacity","stroke-width","id"],fabric.DPI=96,fabric.reNum="(?:[-+]?(?:\\d+|\\d*\\.\\d+)(?:e[-+]?\\d+)?)",fabric.fontPaths={},fabric.charWidthsCache={},fabric.devicePixelRatio=fabric.window.devicePixelRatio||fabric.window.webkitDevicePixelRatio||fabric.window.mozDevicePixelRatio||1,function(){function t(t,e){if(this.__eventListeners[t]){var i=this.__eventListeners[t];e?i[i.indexOf(e)]=!1:fabric.util.array.fill(i,!1)}}function e(t,e){if(this.__eventListeners||(this.__eventListeners={}),1===arguments.length)for(var i in t)this.on(i,t[i]);else this.__eventListeners[t]||(this.__eventListeners[t]=[]),this.__eventListeners[t].push(e);return this}function i(e,i){if(this.__eventListeners){if(0===arguments.length)for(e in this.__eventListeners)t.call(this,e);else if(1===arguments.length&&"object"==typeof arguments[0])for(var r in e)t.call(this,r,e[r]);else t.call(this,e,i);return this}}function r(t,e){if(this.__eventListeners){var i=this.__eventListeners[t];if(i){for(var r=0,n=i.length;r-1},complexity:function(){return this.getObjects().reduce(function(t,e){return t+=e.complexity?e.complexity():0},0)}},function(t){var e=Math.sqrt,i=Math.atan2,r=Math.pow,n=Math.abs,s=Math.PI/180;fabric.util={removeFromArray:function(t,e){var i=t.indexOf(e);return i!==-1&&t.splice(i,1),t},getRandomInt:function(t,e){return Math.floor(Math.random()*(e-t+1))+t},degreesToRadians:function(t){return t*s},radiansToDegrees:function(t){return t/s},rotatePoint:function(t,e,i){t.subtractEquals(e);var r=fabric.util.rotateVector(t,i);return new fabric.Point(r.x,r.y).addEquals(e)},rotateVector:function(t,e){var i=Math.sin(e),r=Math.cos(e),n=t.x*r-t.y*i,s=t.x*i+t.y*r;return{x:n,y:s}},transformPoint:function(t,e,i){return i?new fabric.Point(e[0]*t.x+e[2]*t.y,e[1]*t.x+e[3]*t.y):new fabric.Point(e[0]*t.x+e[2]*t.y+e[4],e[1]*t.x+e[3]*t.y+e[5])},makeBoundingBoxFromPoints:function(t){var e=[t[0].x,t[1].x,t[2].x,t[3].x],i=fabric.util.array.min(e),r=fabric.util.array.max(e),n=Math.abs(i-r),s=[t[0].y,t[1].y,t[2].y,t[3].y],o=fabric.util.array.min(s),a=fabric.util.array.max(s),h=Math.abs(o-a);return{left:i,top:o,width:n,height:h}},invertTransform:function(t){var e=1/(t[0]*t[3]-t[1]*t[2]),i=[e*t[3],-e*t[1],-e*t[2],e*t[0]],r=fabric.util.transformPoint({x:t[4],y:t[5]},i,!0);return i[4]=-r.x,i[5]=-r.y,i},toFixed:function(t,e){return parseFloat(Number(t).toFixed(e))},parseUnit:function(t,e){var i=/\D{0,2}$/.exec(t),r=parseFloat(t);switch(e||(e=fabric.Text.DEFAULT_SVG_FONT_SIZE),i[0]){case"mm":return r*fabric.DPI/25.4;case"cm":return r*fabric.DPI/2.54;case"in":return r*fabric.DPI;case"pt":return r*fabric.DPI/72;case"pc":return r*fabric.DPI/72*12;case"em":return r*e;default:return r}},falseFunction:function(){return!1},getKlass:function(t,e){return t=fabric.util.string.camelize(t.charAt(0).toUpperCase()+t.slice(1)),fabric.util.resolveNamespace(e)[t]},resolveNamespace:function(e){if(!e)return fabric;var i,r=e.split("."),n=r.length,s=t||fabric.window;for(i=0;ir;)r+=a[d++%f],r>l&&(r=l),t[g?"lineTo":"moveTo"](r,0),g=!g;t.restore()},createCanvasElement:function(t){return t||(t=fabric.document.createElement("canvas")),t.getContext||"undefined"==typeof G_vmlCanvasManager||G_vmlCanvasManager.initElement(t),t},createImage:function(){return fabric.isLikelyNode?new(require("canvas").Image):fabric.document.createElement("img")},createAccessors:function(t){var e,i,r,n,s,o=t.prototype;for(e=o.stateProperties.length;e--;)i=o.stateProperties[e],r=i.charAt(0).toUpperCase()+i.slice(1),n="set"+r,s="get"+r,o[s]||(o[s]=function(t){return new Function('return this.get("'+t+'")')}(i)),o[n]||(o[n]=function(t){return new Function("value",'return this.set("'+t+'", value)')}(i))},clipContext:function(t,e){e.save(),e.beginPath(),t.clipTo(e),e.clip()},multiplyTransformMatrices:function(t,e,i){return[t[0]*e[0]+t[2]*e[1],t[1]*e[0]+t[3]*e[1],t[0]*e[2]+t[2]*e[3],t[1]*e[2]+t[3]*e[3],i?0:t[0]*e[4]+t[2]*e[5]+t[4],i?0:t[1]*e[4]+t[3]*e[5]+t[5]]},qrDecompose:function(t){var n=i(t[1],t[0]),o=r(t[0],2)+r(t[1],2),a=e(o),h=(t[0]*t[3]-t[2]*t[1])/a,c=i(t[0]*t[2]+t[1]*t[3],o);return{angle:n/s,scaleX:a,scaleY:h,skewX:c/s,skewY:0,translateX:t[4],translateY:t[5]}},customTransformMatrix:function(t,e,i){var r=[1,0,n(Math.tan(i*s)),1],o=[n(t),0,0,n(e)];return fabric.util.multiplyTransformMatrices(o,r,!0)},resetObjectTransform:function(t){t.scaleX=1,t.scaleY=1,t.skewX=0,t.skewY=0,t.flipX=!1,t.flipY=!1,t.setAngle(0)},getFunctionBody:function(t){return(String(t).match(/function[^{]*\{([\s\S]*)\}/)||{})[1]},isTransparent:function(t,e,i,r){r>0&&(e>r?e-=r:e=0,i>r?i-=r:i=0);var n,s,o=!0,a=t.getImageData(e,i,2*r||1,2*r||1),h=a.data.length;for(n=3;n0?I-=2*f:1===c&&I<0&&(I+=2*f);for(var D=Math.ceil(Math.abs(I/f*2)),E=[],L=I/D,R=8/3*Math.sin(L/4)*Math.sin(L/4)/Math.sin(L/2),F=P+L,B=0;B=n?s-n:2*Math.PI-(n-s)}function r(t,e,i,r,n,s,h,c){var l=a.call(arguments);if(o[l])return o[l];var u,f,d,g,p,v,b,m,y=Math.sqrt,_=Math.min,x=Math.max,S=Math.abs,C=[],w=[[],[]];f=6*t-12*i+6*n,u=-3*t+9*i-9*n+3*h,d=3*i-3*t;for(var O=0;O<2;++O)if(O>0&&(f=6*e-12*r+6*s,u=-3*e+9*r-9*s+3*c,d=3*r-3*e),S(u)<1e-12){if(S(f)<1e-12)continue;g=-d/f,0=e})}function i(t,e){return n(t,e,function(t,e){return t>>0;if(0===i)return-1;var r=0;if(arguments.length>0&&(r=Number(arguments[1]),r!==r?r=0:0!==r&&r!==Number.POSITIVE_INFINITY&&r!==Number.NEGATIVE_INFINITY&&(r=(r>0||-1)*Math.floor(Math.abs(r)))),r>=i)return-1;for(var n=r>=0?r:Math.max(i-Math.abs(r),0);n>>0;i>>0;r>>0;i>>0;i>>0;n>>0,r=0;if(arguments.length>1)e=arguments[1];else for(;;){if(r in this){e=this[r++];break}if(++r>=i)throw new TypeError}for(;r/g,">")}String.prototype.trim||(String.prototype.trim=function(){return this.replace(/^[\s\xA0]+/,"").replace(/[\s\xA0]+$/,"")}),fabric.util.string={camelize:t,capitalize:e,escapeXml:i}}(),function(){var t=Array.prototype.slice,e=Function.prototype.apply,i=function(){};Function.prototype.bind||(Function.prototype.bind=function(r){var n,s=this,o=t.call(arguments,1);return n=o.length?function(){return e.call(s,this instanceof i?this:r,o.concat(t.call(arguments)))}:function(){return e.call(s,this instanceof i?this:r,arguments)},i.prototype=this.prototype,n.prototype=new i,n})}(),function(){function t(){}function e(t){var e=this.constructor.superclass.prototype[t];return arguments.length>1?e.apply(this,r.call(arguments,1)):e.call(this)}function i(){function i(){this.initialize.apply(this,arguments)}var s=null,a=r.call(arguments,0);"function"==typeof a[0]&&(s=a.shift()),i.superclass=s,i.subclasses=[],s&&(t.prototype=s.prototype,i.prototype=new t,s.subclasses.push(i));for(var h=0,c=a.length;h-1?t.prototype[r]=function(t){return function(){var r=this.constructor.superclass;this.constructor.superclass=i;var n=e[t].apply(this,arguments);if(this.constructor.superclass=r,"initialize"!==t)return n}}(r):t.prototype[r]=e[r],s&&(e.toString!==Object.prototype.toString&&(t.prototype.toString=e.toString),e.valueOf!==Object.prototype.valueOf&&(t.prototype.valueOf=e.valueOf))};fabric.util.createClass=i}(),function(){function t(t){var e,i,r=Array.prototype.slice.call(arguments,1),n=r.length;for(i=0;i-1?s(t,e.match(/opacity:\s*(\d?\.?\d*)/)[1]):t;for(var r in e)if("opacity"===r)s(t,e[r]);else{var n="float"===r||"cssFloat"===r?"undefined"==typeof i.styleFloat?"cssFloat":"styleFloat":r;i[n]=e[r]}return t}var e=fabric.document.createElement("div"),i="string"==typeof e.style.opacity,r="string"==typeof e.style.filter,n=/alpha\s*\(\s*opacity\s*=\s*([^\)]+)\)/,s=function(t){return t};i?s=function(t,e){return t.style.opacity=e,t}:r&&(s=function(t,e){var i=t.style;return t.currentStyle&&!t.currentStyle.hasLayout&&(i.zoom=1),n.test(i.filter)?(e=e>=.9999?"":"alpha(opacity="+100*e+")",i.filter=i.filter.replace(n,e)):i.filter+=" alpha(opacity="+100*e+")",t}),fabric.util.setStyle=t}(),function(){function t(t){return"string"==typeof t?fabric.document.getElementById(t):t}function e(t,e){var i=fabric.document.createElement(t);for(var r in e)"class"===r?i.className=e[r]:"for"===r?i.htmlFor=e[r]:i.setAttribute(r,e[r]);return i}function i(t,e){t&&(" "+t.className+" ").indexOf(" "+e+" ")===-1&&(t.className+=(t.className?" ":"")+e)}function r(t,i,r){return"string"==typeof i&&(i=e(i,r)),t.parentNode&&t.parentNode.replaceChild(i,t),i.appendChild(t),i}function n(t){for(var e=0,i=0,r=fabric.document.documentElement,n=fabric.document.body||{scrollLeft:0,scrollTop:0};t&&(t.parentNode||t.host)&&(t=t.parentNode||t.host,t===fabric.document?(e=n.scrollLeft||r.scrollLeft||0,i=n.scrollTop||r.scrollTop||0):(e+=t.scrollLeft||0,i+=t.scrollTop||0),1!==t.nodeType||"fixed"!==fabric.util.getElementStyle(t,"position")););return{left:e,top:i}}function s(t){var e,i,r=t&&t.ownerDocument,s={left:0,top:0},o={left:0,top:0},a={borderLeftWidth:"left",borderTopWidth:"top",paddingLeft:"left",paddingTop:"top"};if(!r)return o;for(var h in a)o[a[h]]+=parseInt(c(t,h),10)||0;return e=r.documentElement,"undefined"!=typeof t.getBoundingClientRect&&(s=t.getBoundingClientRect()),i=n(t),{left:s.left+i.left-(e.clientLeft||0)+o.left,top:s.top+i.top-(e.clientTop||0)+o.top}}var o,a=Array.prototype.slice,h=function(t){return a.call(t,0)};try{o=h(fabric.document.childNodes)instanceof Array}catch(t){}o||(h=function(t){for(var e=new Array(t.length),i=t.length;i--;)e[i]=t[i];return e});var c;c=fabric.document.defaultView&&fabric.document.defaultView.getComputedStyle?function(t,e){var i=fabric.document.defaultView.getComputedStyle(t,null);return i?i[e]:void 0}:function(t,e){var i=t.style[e];return!i&&t.currentStyle&&(i=t.currentStyle[e]),i},function(){function t(t){return"undefined"!=typeof t.onselectstart&&(t.onselectstart=fabric.util.falseFunction),r?t.style[r]="none":"string"==typeof t.unselectable&&(t.unselectable="on"),t}function e(t){return"undefined"!=typeof t.onselectstart&&(t.onselectstart=null),r?t.style[r]="":"string"==typeof t.unselectable&&(t.unselectable=""),t}var i=fabric.document.documentElement.style,r="userSelect"in i?"userSelect":"MozUserSelect"in i?"MozUserSelect":"WebkitUserSelect"in i?"WebkitUserSelect":"KhtmlUserSelect"in i?"KhtmlUserSelect":"";fabric.util.makeElementUnselectable=t,fabric.util.makeElementSelectable=e}(),function(){function t(t,e){var i=fabric.document.getElementsByTagName("head")[0],r=fabric.document.createElement("script"),n=!0;r.onload=r.onreadystatechange=function(t){if(n){if("string"==typeof this.readyState&&"loaded"!==this.readyState&&"complete"!==this.readyState)return;n=!1,e(t||fabric.window.event),r=r.onload=r.onreadystatechange=null}},r.src=t,i.appendChild(r)}fabric.util.getScript=t}(),fabric.util.getById=t,fabric.util.toArray=h,fabric.util.makeElement=e,fabric.util.addClass=i,fabric.util.wrapElement=r,fabric.util.getScrollLeftTop=n,fabric.util.getElementOffset=s,fabric.util.getElementStyle=c}(),function(){function t(t,e){return t+(/\?/.test(t)?"&":"?")+e}function e(){}function i(i,n){n||(n={});var s=n.method?n.method.toUpperCase():"GET",o=n.onComplete||function(){},a=r(),h=n.body||n.parameters;return a.onreadystatechange=function(){4===a.readyState&&(o(a),a.onreadystatechange=e)},"GET"===s&&(h=null,"string"==typeof n.parameters&&(i=t(i,n.parameters))),a.open(s,i,!0),"POST"!==s&&"PUT"!==s||a.setRequestHeader("Content-Type","application/x-www-form-urlencoded"),a.send(h),a}var r=function(){for(var t=[function(){return new ActiveXObject("Microsoft.XMLHTTP")},function(){return new ActiveXObject("Msxml2.XMLHTTP")},function(){return new ActiveXObject("Msxml2.XMLHTTP.3.0")},function(){return new XMLHttpRequest}],e=t.length;e--;)try{var i=t[e]();if(i)return t[e]}catch(t){}}();fabric.util.request=i}(),fabric.log=function(){},fabric.warn=function(){},"undefined"!=typeof console&&["log","warn"].forEach(function(t){"undefined"!=typeof console[t]&&"function"==typeof console[t].apply&&(fabric[t]=function(){return console[t].apply(console,arguments)})}),function(){function t(t){e(function(i){t||(t={});var r,n=i||+new Date,s=t.duration||500,o=n+s,a=t.onChange||function(){},h=t.abort||function(){return!1},c=t.easing||function(t,e,i,r){return-i*Math.cos(t/r*(Math.PI/2))+i+e},l="startValue"in t?t.startValue:0,u="endValue"in t?t.endValue:100,f=t.byValue||u-l;t.onStart&&t.onStart(),function i(u){r=u||+new Date;var d=r>o?s:r-n;return h()?void(t.onComplete&&t.onComplete()):(a(c(d,l,f,s)),r>o?void(t.onComplete&&t.onComplete()):void e(i))}(n)})}function e(){return i.apply(fabric.window,arguments)}var i=fabric.window.requestAnimationFrame||fabric.window.webkitRequestAnimationFrame||fabric.window.mozRequestAnimationFrame||fabric.window.oRequestAnimationFrame||fabric.window.msRequestAnimationFrame||function(t){fabric.window.setTimeout(t,1e3/60)};fabric.util.animate=t,fabric.util.requestAnimFrame=e}(),function(){function t(t,e,i,r){return ta?a:o),1===o&&1===a&&0===h&&0===c&&0===f&&0===d)return y;if((f||d)&&(_=" translate("+x(f)+" "+x(d)+") "),r=_+" matrix("+o+" 0 0 "+a+" "+h*o+" "+c*a+") ","svg"===t.nodeName){for(n=t.ownerDocument.createElement("g");t.firstChild;)n.appendChild(t.firstChild);t.appendChild(n)}else n=t,r=n.getAttribute("transform")+r;return n.setAttribute("transform",r),y}function g(t){var e=t.objects,i=t.options;return e=e.map(function(t){return v[m(t.type)].fromObject(t)}),{objects:e,options:i}}function p(t,e,i){e[i]&&e[i].toSVG&&t.push('\t\n','\t\t\n\t\n')}var v=t.fabric||(t.fabric={}),b=v.util.object.extend,m=v.util.string.capitalize,y=v.util.object.clone,_=v.util.toFixed,x=v.util.parseUnit,S=v.util.multiplyTransformMatrices,C=/^(path|circle|polygon|polyline|ellipse|rect|line|image|text)$/i,w=/^(symbol|image|marker|pattern|view|svg)$/i,O=/^(?:pattern|defs|symbol|metadata)$/i,T=/^(symbol|g|a|svg)$/i,k={cx:"left",x:"left",r:"radius",cy:"top",y:"top",display:"visible",visibility:"visible",transform:"transformMatrix","fill-opacity":"fillOpacity","fill-rule":"fillRule","font-family":"fontFamily","font-size":"fontSize","font-style":"fontStyle","font-weight":"fontWeight","stroke-dasharray":"strokeDashArray","stroke-linecap":"strokeLineCap","stroke-linejoin":"strokeLineJoin","stroke-miterlimit":"strokeMiterLimit","stroke-opacity":"strokeOpacity","stroke-width":"strokeWidth","text-decoration":"textDecoration","text-anchor":"originX"},j={stroke:"strokeOpacity",fill:"fillOpacity"};v.cssRules={},v.gradientDefs={},v.parseTransformAttribute=function(){function t(t,e){var i=e[0],r=3===e.length?e[1]:0,n=3===e.length?e[2]:0;t[0]=Math.cos(i),t[1]=Math.sin(i),t[2]=-Math.sin(i),t[3]=Math.cos(i),t[4]=r-(t[0]*r+t[2]*n),t[5]=n-(t[1]*r+t[3]*n)}function e(t,e){var i=e[0],r=2===e.length?e[1]:e[0];t[0]=i,t[3]=r}function i(t,e){t[2]=Math.tan(v.util.degreesToRadians(e[0])); +}function r(t,e){t[1]=Math.tan(v.util.degreesToRadians(e[0]))}function n(t,e){t[4]=e[0],2===e.length&&(t[5]=e[1])}var s=[1,0,0,1,0,0],o=v.reNum,a="(?:\\s+,?\\s*|,\\s*)",h="(?:(skewX)\\s*\\(\\s*("+o+")\\s*\\))",c="(?:(skewY)\\s*\\(\\s*("+o+")\\s*\\))",l="(?:(rotate)\\s*\\(\\s*("+o+")(?:"+a+"("+o+")"+a+"("+o+"))?\\s*\\))",u="(?:(scale)\\s*\\(\\s*("+o+")(?:"+a+"("+o+"))?\\s*\\))",f="(?:(translate)\\s*\\(\\s*("+o+")(?:"+a+"("+o+"))?\\s*\\))",d="(?:(matrix)\\s*\\(\\s*("+o+")"+a+"("+o+")"+a+"("+o+")"+a+"("+o+")"+a+"("+o+")"+a+"("+o+")\\s*\\))",g="(?:"+d+"|"+f+"|"+u+"|"+l+"|"+h+"|"+c+")",p="(?:"+g+"(?:"+a+"*"+g+")*)",b="^\\s*(?:"+p+"?)\\s*$",m=new RegExp(b),y=new RegExp(g,"g");return function(o){var a=s.concat(),h=[];if(!o||o&&!m.test(o))return a;o.replace(y,function(o){var c=new RegExp(g).exec(o).filter(function(t){return!!t}),l=c[1],u=c.slice(2).map(parseFloat);switch(l){case"translate":n(a,u);break;case"rotate":u[0]=v.util.degreesToRadians(u[0]),t(a,u);break;case"scale":e(a,u);break;case"skewX":i(a,u);break;case"skewY":r(a,u);break;case"matrix":a=u}h.push(a.concat()),a=s.concat()});for(var c=h[0];h.length>1;)h.shift(),c=v.util.multiplyTransformMatrices(c,h[0]);return c}}();var M=new RegExp("^\\s*("+v.reNum+"+)\\s*,?\\s*("+v.reNum+"+)\\s*,?\\s*("+v.reNum+"+)\\s*,?\\s*("+v.reNum+"+)\\s*$");v.parseSVGDocument=function(){function t(t,e){for(;t&&(t=t.parentNode);)if(t.nodeName&&e.test(t.nodeName.replace("svg:",""))&&!t.getAttribute("instantiated_by_use"))return!0;return!1}return function(e,i,r){if(e){f(e);var n=new Date,s=v.Object.__uid++,o=d(e),a=v.util.toArray(e.getElementsByTagName("*"));if(o.svgUid=s,0===a.length&&v.isLikelyNode){a=e.selectNodes('//*[name(.)!="svg"]');for(var h=[],c=0,l=a.length;c/i,""))),n&&n.documentElement||e&&e(null),v.parseSVGDocument(n.documentElement,function(i,r){A.set(t,{objects:v.util.array.invoke(i,"toObject"),options:r}),e&&e(i,r)},i)}t=t.replace(/^\n\s*/,"").trim(),A.has(t,function(i){i?A.get(t,function(t){var i=g(t);e(i.objects,i.options)}):new v.util.request(t,{method:"get",onComplete:r})})},loadSVGFromString:function(t,e,i){t=t.trim();var r;if("undefined"!=typeof DOMParser){var n=new DOMParser;n&&n.parseFromString&&(r=n.parseFromString(t,"text/xml"))}else v.window.ActiveXObject&&(r=new ActiveXObject("Microsoft.XMLDOM"),r.async="false",r.loadXML(t.replace(//i,"")));v.parseSVGDocument(r.documentElement,function(t,i){e(t,i)},i)},createSVGFontFacesMarkup:function(t){for(var e,i,r,n,s,o,a,h="",c={},l=v.fontPaths,u=0,f=t.length;u',"","\n"].join("")),h},createSVGRefElementsMarkup:function(t){var e=[];return p(e,t,"backgroundColor"),p(e,t,"overlayColor"),e.join("")}})}("undefined"!=typeof exports?exports:this),fabric.ElementsParser=function(t,e,i,r){this.elements=t,this.callback=e,this.options=i,this.reviver=r,this.svgUid=i&&i.svgUid||0},fabric.ElementsParser.prototype.parse=function(){this.instances=new Array(this.elements.length),this.numElements=this.elements.length,this.createObjects()},fabric.ElementsParser.prototype.createObjects=function(){for(var t=0,e=this.elements.length;tt.x&&this.y>t.y},gte:function(t){return this.x>=t.x&&this.y>=t.y},lerp:function(t,i){return"undefined"==typeof i&&(i=.5),i=Math.max(Math.min(1,i),0),new e(this.x+(t.x-this.x)*i,this.y+(t.y-this.y)*i)},distanceFrom:function(t){var e=this.x-t.x,i=this.y-t.y;return Math.sqrt(e*e+i*i)},midPointFrom:function(t){return this.lerp(t)},min:function(t){return new e(Math.min(this.x,t.x),Math.min(this.y,t.y))},max:function(t){return new e(Math.max(this.x,t.x),Math.max(this.y,t.y))},toString:function(){return this.x+","+this.y},setXY:function(t,e){return this.x=t,this.y=e,this},setX:function(t){return this.x=t,this},setY:function(t){return this.y=t,this},setFromPoint:function(t){return this.x=t.x,this.y=t.y,this},swap:function(t){var e=this.x,i=this.y;this.x=t.x,this.y=t.y,t.x=e,t.y=i},clone:function(){return new e(this.x,this.y)}}))}("undefined"!=typeof exports?exports:this),function(t){"use strict";function e(t){this.status=t,this.points=[]}var i=t.fabric||(t.fabric={});return i.Intersection?void i.warn("fabric.Intersection is already defined"):(i.Intersection=e,i.Intersection.prototype={constructor:e,appendPoint:function(t){return this.points.push(t),this},appendPoints:function(t){return this.points=this.points.concat(t),this}},i.Intersection.intersectLineLine=function(t,r,n,s){var o,a=(s.x-n.x)*(t.y-n.y)-(s.y-n.y)*(t.x-n.x),h=(r.x-t.x)*(t.y-n.y)-(r.y-t.y)*(t.x-n.x),c=(s.y-n.y)*(r.x-t.x)-(s.x-n.x)*(r.y-t.y);if(0!==c){var l=a/c,u=h/c;0<=l&&l<=1&&0<=u&&u<=1?(o=new e("Intersection"),o.appendPoint(new i.Point(t.x+l*(r.x-t.x),t.y+l*(r.y-t.y)))):o=new e}else o=new e(0===a||0===h?"Coincident":"Parallel");return o},i.Intersection.intersectLinePolygon=function(t,i,r){for(var n,s,o,a=new e,h=r.length,c=0;c0&&(a.status="Intersection"),a},i.Intersection.intersectPolygonPolygon=function(t,i){for(var r=new e,n=t.length,s=0;s0&&(r.status="Intersection"),r},void(i.Intersection.intersectPolygonRectangle=function(t,r,n){var s=r.min(n),o=r.max(n),a=new i.Point(o.x,s.y),h=new i.Point(s.x,o.y),c=e.intersectLinePolygon(s,a,t),l=e.intersectLinePolygon(a,o,t),u=e.intersectLinePolygon(o,h,t),f=e.intersectLinePolygon(h,s,t),d=new e;return d.appendPoints(c.points),d.appendPoints(l.points),d.appendPoints(u.points),d.appendPoints(f.points),d.points.length>0&&(d.status="Intersection"),d}))}("undefined"!=typeof exports?exports:this),function(t){"use strict";function e(t){t?this._tryParsingColor(t):this.setSource([0,0,0,1])}function i(t,e,i){return i<0&&(i+=1),i>1&&(i-=1),i<1/6?t+6*(e-t)*i:i<.5?e:i<2/3?t+(e-t)*(2/3-i)*6:t}var r=t.fabric||(t.fabric={});return r.Color?void r.warn("fabric.Color is already defined."):(r.Color=e,r.Color.prototype={_tryParsingColor:function(t){var i;t in e.colorNameMap&&(t=e.colorNameMap[t]),"transparent"===t&&(i=[255,255,255,0]),i||(i=e.sourceFromHex(t)),i||(i=e.sourceFromRgb(t)),i||(i=e.sourceFromHsl(t)),i||(i=[0,0,0,1]),i&&this.setSource(i)},_rgbToHsl:function(t,e,i){t/=255,e/=255,i/=255;var n,s,o,a=r.util.array.max([t,e,i]),h=r.util.array.min([t,e,i]);if(o=(a+h)/2,a===h)n=s=0;else{var c=a-h;switch(s=o>.5?c/(2-a-h):c/(a+h),a){case t:n=(e-i)/c+(e1?1:s,n){var o=n.split(/\s*;\s*/);""===o[o.length-1]&&o.pop();for(var a=o.length;a--;){var h=o[a].split(/\s*:\s*/),c=h[0].trim(),l=h[1].trim();"stop-color"===c?e=l:"stop-opacity"===c&&(r=l)}}return e||(e=t.getAttribute("stop-color")||"rgb(0,0,0)"),r||(r=t.getAttribute("stop-opacity")),e=new fabric.Color(e),i=e.getAlpha(),r=isNaN(parseFloat(r))?1:parseFloat(r),r*=i,{offset:s,color:e.toRgb(),opacity:r}}function e(t){return{x1:t.getAttribute("x1")||0,y1:t.getAttribute("y1")||0,x2:t.getAttribute("x2")||"100%",y2:t.getAttribute("y2")||0}}function i(t){return{x1:t.getAttribute("fx")||t.getAttribute("cx")||"50%",y1:t.getAttribute("fy")||t.getAttribute("cy")||"50%",r1:0,x2:t.getAttribute("cx")||"50%",y2:t.getAttribute("cy")||"50%",r2:t.getAttribute("r")||"50%"}}function r(t,e,i){var r,n=0,s=1,o="";for(var a in e)"Infinity"===e[a]?e[a]=1:"-Infinity"===e[a]&&(e[a]=0),r=parseFloat(e[a],10),s="string"==typeof e[a]&&/^\d+%$/.test(e[a])?.01:1,"x1"===a||"x2"===a||"r2"===a?(s*="objectBoundingBox"===i?t.width:1,n="objectBoundingBox"===i?t.left||0:0):"y1"!==a&&"y2"!==a||(s*="objectBoundingBox"===i?t.height:1,n="objectBoundingBox"===i?t.top||0:0),e[a]=r*s+n;if("ellipse"===t.type&&null!==e.r2&&"objectBoundingBox"===i&&t.rx!==t.ry){var h=t.ry/t.rx;o=" scale(1, "+h+")",e.y1&&(e.y1/=h),e.y2&&(e.y2/=h)}return o}fabric.Gradient=fabric.util.createClass({offsetX:0,offsetY:0,initialize:function(t){t||(t={});var e={};this.id=fabric.Object.__uid++,this.type=t.type||"linear",e={x1:t.coords.x1||0,y1:t.coords.y1||0,x2:t.coords.x2||0,y2:t.coords.y2||0},"radial"===this.type&&(e.r1=t.coords.r1||0,e.r2=t.coords.r2||0),this.coords=e,this.colorStops=t.colorStops.slice(),t.gradientTransform&&(this.gradientTransform=t.gradientTransform),this.offsetX=t.offsetX||this.offsetX,this.offsetY=t.offsetY||this.offsetY},addColorStop:function(t){for(var e in t){var i=new fabric.Color(t[e]);this.colorStops.push({offset:e,color:i.toRgb(),opacity:i.getAlpha()})}return this},toObject:function(){return{type:this.type,coords:this.coords,colorStops:this.colorStops,offsetX:this.offsetX,offsetY:this.offsetY,gradientTransform:this.gradientTransform?this.gradientTransform.concat():this.gradientTransform}},toSVG:function(t){var e,i,r=fabric.util.object.clone(this.coords);if(this.colorStops.sort(function(t,e){return t.offset-e.offset}),!t.group||"path-group"!==t.group.type)for(var n in r)"x1"===n||"x2"===n||"r2"===n?r[n]+=this.offsetX-t.width/2:"y1"!==n&&"y2"!==n||(r[n]+=this.offsetY-t.height/2);i='id="SVGID_'+this.id+'" gradientUnits="userSpaceOnUse"',this.gradientTransform&&(i+=' gradientTransform="matrix('+this.gradientTransform.join(" ")+')" '),"linear"===this.type?e=["\n']:"radial"===this.type&&(e=["\n']);for(var s=0;s\n');return e.push("linear"===this.type?"\n":"\n"),e.join("")},toLive:function(t,e){var i,r,n=fabric.util.object.clone(this.coords);if(this.type){if(e.group&&"path-group"===e.group.type)for(r in n)"x1"===r||"x2"===r?n[r]+=-this.offsetX+e.width/2:"y1"!==r&&"y2"!==r||(n[r]+=-this.offsetY+e.height/2);"linear"===this.type?i=t.createLinearGradient(n.x1,n.y1,n.x2,n.y2):"radial"===this.type&&(i=t.createRadialGradient(n.x1,n.y1,n.r1,n.x2,n.y2,n.r2));for(var s=0,o=this.colorStops.length;s\n\n\n'},toLive:function(t){var e="function"==typeof this.source?this.source():this.source;if(!e)return"";if("undefined"!=typeof e.src){if(!e.complete)return"";if(0===e.naturalWidth||0===e.naturalHeight)return""}return t.createPattern(e,this.repeat)}}),function(t){"use strict";var e=t.fabric||(t.fabric={}),i=e.util.toFixed;return e.Shadow?void e.warn("fabric.Shadow is already defined."):(e.Shadow=e.util.createClass({color:"rgb(0,0,0)",blur:0,offsetX:0,offsetY:0,affectStroke:!1,includeDefaultValues:!0,initialize:function(t){"string"==typeof t&&(t=this._parseShadow(t));for(var i in t)this[i]=t[i];this.id=e.Object.__uid++},_parseShadow:function(t){var i=t.trim(),r=e.Shadow.reOffsetsAndBlur.exec(i)||[],n=i.replace(e.Shadow.reOffsetsAndBlur,"")||"rgb(0,0,0)";return{color:n.trim(),offsetX:parseInt(r[1],10)||0,offsetY:parseInt(r[2],10)||0,blur:parseInt(r[3],10)||0}},toString:function(){return[this.offsetX,this.offsetY,this.blur,this.color].join("px ")},toSVG:function(t){var r=40,n=40,s=e.Object.NUM_FRACTION_DIGITS,o=e.util.rotateVector({x:this.offsetX,y:this.offsetY},e.util.degreesToRadians(-t.angle)),a=20;return t.width&&t.height&&(r=100*i((Math.abs(o.x)+this.blur)/t.width,s)+a,n=100*i((Math.abs(o.y)+this.blur)/t.height,s)+a),t.flipX&&(o.x*=-1),t.flipY&&(o.y*=-1),'\n\t\n\t\n\t\n\t\n\t\n\t\t\n\t\t\n\t\n\n'},toObject:function(){if(this.includeDefaultValues)return{color:this.color,blur:this.blur,offsetX:this.offsetX,offsetY:this.offsetY,affectStroke:this.affectStroke};var t={},i=e.Shadow.prototype;return["color","blur","offsetX","offsetY","affectStroke"].forEach(function(e){this[e]!==i[e]&&(t[e]=this[e])},this),t}}),void(e.Shadow.reOffsetsAndBlur=/(?:\s|^)(-?\d+(?:px)?(?:\s?|$))?(-?\d+(?:px)?(?:\s?|$))?(\d+(?:px)?)?(?:\s?|$)(?:$|\s)/))}("undefined"!=typeof exports?exports:this),function(){"use strict";if(fabric.StaticCanvas)return void fabric.warn("fabric.StaticCanvas is already defined.");var t=fabric.util.object.extend,e=fabric.util.getElementOffset,i=fabric.util.removeFromArray,r=fabric.util.toFixed,n=new Error("Could not initialize `canvas` element");fabric.StaticCanvas=fabric.util.createClass({initialize:function(t,e){e||(e={}),this._initStatic(t,e)},backgroundColor:"",backgroundImage:null,overlayColor:"",overlayImage:null,includeDefaultValues:!0,stateful:!0,renderOnAddRemove:!0,clipTo:null,controlsAboveOverlay:!1,allowTouchScrolling:!1,imageSmoothingEnabled:!0,viewportTransform:[1,0,0,1,0,0],backgroundVpt:!0,overlayVpt:!0,onBeforeScaleRotate:function(){},enableRetinaScaling:!0,_initStatic:function(t,e){var i=fabric.StaticCanvas.prototype.renderAll.bind(this);this._objects=[],this._createLowerCanvas(t),this._initOptions(e),this._setImageSmoothing(),this.interactive||this._initRetinaScaling(),e.overlayImage&&this.setOverlayImage(e.overlayImage,i),e.backgroundImage&&this.setBackgroundImage(e.backgroundImage,i),e.backgroundColor&&this.setBackgroundColor(e.backgroundColor,i),e.overlayColor&&this.setOverlayColor(e.overlayColor,i),this.calcOffset()},_isRetinaScaling:function(){return 1!==fabric.devicePixelRatio&&this.enableRetinaScaling},getRetinaScaling:function(){return this._isRetinaScaling()?fabric.devicePixelRatio:1},_initRetinaScaling:function(){this._isRetinaScaling()&&(this.lowerCanvasEl.setAttribute("width",this.width*fabric.devicePixelRatio),this.lowerCanvasEl.setAttribute("height",this.height*fabric.devicePixelRatio),this.contextContainer.scale(fabric.devicePixelRatio,fabric.devicePixelRatio))},calcOffset:function(){return this._offset=e(this.lowerCanvasEl),this},setOverlayImage:function(t,e,i){return this.__setBgOverlayImage("overlayImage",t,e,i)},setBackgroundImage:function(t,e,i){return this.__setBgOverlayImage("backgroundImage",t,e,i)},setOverlayColor:function(t,e){return this.__setBgOverlayColor("overlayColor",t,e)},setBackgroundColor:function(t,e){return this.__setBgOverlayColor("backgroundColor",t,e)},_setImageSmoothing:function(){var t=this.getContext();t.imageSmoothingEnabled=t.imageSmoothingEnabled||t.webkitImageSmoothingEnabled||t.mozImageSmoothingEnabled||t.msImageSmoothingEnabled||t.oImageSmoothingEnabled,t.imageSmoothingEnabled=this.imageSmoothingEnabled},__setBgOverlayImage:function(t,e,i,r){return"string"==typeof e?fabric.util.loadImage(e,function(e){e&&(this[t]=new fabric.Image(e,r)),i&&i(e)},this,r&&r.crossOrigin):(r&&e.setOptions(r),this[t]=e,i&&i(e)),this},__setBgOverlayColor:function(t,e,i){if(e&&e.source){var r=this;fabric.util.loadImage(e.source,function(n){r[t]=new fabric.Pattern({source:n,repeat:e.repeat,offsetX:e.offsetX,offsetY:e.offsetY}),i&&i()})}else this[t]=e,i&&i();return this},_createCanvasElement:function(t){var e=fabric.util.createCanvasElement(t);if(e.style||(e.style={}),!e)throw n;if("undefined"==typeof e.getContext)throw n;return e},_initOptions:function(t){for(var e in t)this[e]=t[e];this.width=this.width||parseInt(this.lowerCanvasEl.width,10)||0,this.height=this.height||parseInt(this.lowerCanvasEl.height,10)||0,this.lowerCanvasEl.style&&(this.lowerCanvasEl.width=this.width,this.lowerCanvasEl.height=this.height,this.lowerCanvasEl.style.width=this.width+"px",this.lowerCanvasEl.style.height=this.height+"px",this.viewportTransform=this.viewportTransform.slice())},_createLowerCanvas:function(t){this.lowerCanvasEl=fabric.util.getById(t)||this._createCanvasElement(t),fabric.util.addClass(this.lowerCanvasEl,"lower-canvas"),this.interactive&&this._applyCanvasStyle(this.lowerCanvasEl),this.contextContainer=this.lowerCanvasEl.getContext("2d")},getWidth:function(){return this.width},getHeight:function(){return this.height},setWidth:function(t,e){return this.setDimensions({width:t},e)},setHeight:function(t,e){return this.setDimensions({height:t},e)},setDimensions:function(t,e){var i;e=e||{};for(var r in t)i=t[r],e.cssOnly||(this._setBackstoreDimension(r,t[r]),i+="px"),e.backstoreOnly||this._setCssDimension(r,i);return this._initRetinaScaling(),this._setImageSmoothing(),this.calcOffset(),e.cssOnly||this.renderAll(),this},_setBackstoreDimension:function(t,e){return this.lowerCanvasEl[t]=e,this.upperCanvasEl&&(this.upperCanvasEl[t]=e),this.cacheCanvasEl&&(this.cacheCanvasEl[t]=e),this[t]=e,this},_setCssDimension:function(t,e){return this.lowerCanvasEl.style[t]=e,this.upperCanvasEl&&(this.upperCanvasEl.style[t]=e),this.wrapperEl&&(this.wrapperEl.style[t]=e),this},getZoom:function(){return Math.sqrt(this.viewportTransform[0]*this.viewportTransform[3])},setViewportTransform:function(t){var e,i=this._activeGroup;this.viewportTransform=t;for(var r=0,n=this._objects.length;r"),i.join("")},_setSVGPreamble:function(t,e){e.suppressPreamble||t.push('\n','\n')},_setSVGHeader:function(t,e){var i,n=e.width||this.width,s=e.height||this.height,o='viewBox="0 0 '+this.width+" "+this.height+'" ',a=fabric.Object.NUM_FRACTION_DIGITS;e.viewBox?o='viewBox="'+e.viewBox.x+" "+e.viewBox.y+" "+e.viewBox.width+" "+e.viewBox.height+'" ':this.svgViewportTransformation&&(i=this.viewportTransform,o='viewBox="'+r(-i[4]/i[0],a)+" "+r(-i[5]/i[3],a)+" "+r(this.width/i[0],a)+" "+r(this.height/i[3],a)+'" '),t.push("\n',"Created with Fabric.js ",fabric.version,"\n","",fabric.createSVGFontFacesMarkup(this.getObjects()),fabric.createSVGRefElementsMarkup(this),"\n")},_setSVGObjects:function(t,e){for(var i,r=0,n=this.getObjects(),s=n.length;r
\n"):this[e]&&"overlayColor"===e&&t.push('\n")},sendToBack:function(t){if(!t)return this;var e,r,n,s=this._activeGroup;if(t===s)for(n=s._objects,e=n.length;e--;)r=n[e],i(this._objects,r),this._objects.unshift(r);else i(this._objects,t),this._objects.unshift(t);return this.renderAll&&this.renderAll()},bringToFront:function(t){if(!t)return this;var e,r,n,s=this._activeGroup;if(t===s)for(n=s._objects,e=0;e=0;--n){var s=t.intersectsWithObject(this._objects[n])||t.isContainedWithinObject(this._objects[n])||this._objects[n].isContainedWithinObject(t);if(s){r=n;break}}}else r=e-1;return r},bringForward:function(t,e){if(!t)return this;var r,n,s,o,a,h=this._activeGroup;if(t===h)for(a=h._objects,r=a.length;r--;)n=a[r],s=this._objects.indexOf(n),s!==this._objects.length-1&&(o=s+1,i(this._objects,n),this._objects.splice(o,0,n));else s=this._objects.indexOf(t),s!==this._objects.length-1&&(o=this._findNewUpperIndex(t,s,e),i(this._objects,t),this._objects.splice(o,0,t));return this.renderAll&&this.renderAll(),this},_findNewUpperIndex:function(t,e,i){var r;if(i){r=e;for(var n=e+1;n"}}),t(fabric.StaticCanvas.prototype,fabric.Observable),t(fabric.StaticCanvas.prototype,fabric.Collection),t(fabric.StaticCanvas.prototype,fabric.DataURLExporter),t(fabric.StaticCanvas,{EMPTY_JSON:'{"objects": [], "background": "white"}',supports:function(t){var e=fabric.util.createCanvasElement();if(!e||!e.getContext)return null;var i=e.getContext("2d");if(!i)return null;switch(t){case"getImageData":return"undefined"!=typeof i.getImageData;case"setLineDash":return"undefined"!=typeof i.setLineDash;case"toDataURL":return"undefined"!=typeof e.toDataURL;case"toDataURLWithQuality":try{return e.toDataURL("image/jpeg",0),!0}catch(t){}return!1;default:return null}}}),fabric.StaticCanvas.prototype.toJSON=fabric.StaticCanvas.prototype.toObject}(),fabric.BaseBrush=fabric.util.createClass({color:"rgb(0, 0, 0)",width:1,shadow:null,strokeLineCap:"round",strokeLineJoin:"round",strokeDashArray:null,setShadow:function(t){return this.shadow=new fabric.Shadow(t),this},_setBrushStyles:function(){var t=this.canvas.contextTop;t.strokeStyle=this.color,t.lineWidth=this.width,t.lineCap=this.strokeLineCap,t.lineJoin=this.strokeLineJoin,this.strokeDashArray&&fabric.StaticCanvas.supports("setLineDash")&&t.setLineDash(this.strokeDashArray)},_setShadow:function(){if(this.shadow){var t=this.canvas.contextTop;t.shadowColor=this.shadow.color,t.shadowBlur=this.shadow.blur,t.shadowOffsetX=this.shadow.offsetX,t.shadowOffsetY=this.shadow.offsetY}},_resetShadow:function(){var t=this.canvas.contextTop;t.shadowColor="",t.shadowBlur=t.shadowOffsetX=t.shadowOffsetY=0}}),function(){fabric.PencilBrush=fabric.util.createClass(fabric.BaseBrush,{initialize:function(t){this.canvas=t,this._points=[]},onMouseDown:function(t){this._prepareForDrawing(t),this._captureDrawingPath(t),this._render()},onMouseMove:function(t){this._captureDrawingPath(t),this.canvas.clearContext(this.canvas.contextTop),this._render()},onMouseUp:function(){this._finalizeAndAddPath()},_prepareForDrawing:function(t){var e=new fabric.Point(t.x,t.y);this._reset(),this._addPoint(e),this.canvas.contextTop.moveTo(e.x,e.y)},_addPoint:function(t){this._points.push(t)},_reset:function(){this._points.length=0,this._setBrushStyles(),this._setShadow()},_captureDrawingPath:function(t){var e=new fabric.Point(t.x,t.y);this._addPoint(e)},_render:function(){var t=this.canvas.contextTop,e=this.canvas.viewportTransform,i=this._points[0],r=this._points[1];t.save(),t.transform(e[0],e[1],e[2],e[3],e[4],e[5]),t.beginPath(),2===this._points.length&&i.x===r.x&&i.y===r.y&&(i.x-=.5,r.x+=.5),t.moveTo(i.x,i.y);for(var n=1,s=this._points.length;n0?1:-1,"y"===i&&(s=e.target.skewY,o="top",a="bottom",r="originY"),n[-1]=o,n[1]=a,e.target.flipX&&(c*=-1),e.target.flipY&&(c*=-1),0===s?(e.skewSign=-h*t*c,e[r]=n[-t]):(s=s>0?1:-1,e.skewSign=s,e[r]=n[s*h*c])},_skewObject:function(t,e,i){var r=this._currentTransform,n=r.target,s=!1,o=n.get("lockSkewingX"),a=n.get("lockSkewingY");if(o&&"x"===i||a&&"y"===i)return!1;var h,c,l=n.getCenterPoint(),u=n.toLocalPoint(new fabric.Point(t,e),"center","center")[i],f=n.toLocalPoint(new fabric.Point(r.lastX,r.lastY),"center","center")[i],d=n._getTransformedDimensions();return this._changeSkewTransformOrigin(u-f,r,i),h=n.toLocalPoint(new fabric.Point(t,e),r.originX,r.originY)[i],c=n.translateToOriginPoint(l,r.originX,r.originY),s=this._setObjectSkew(h,r,i,d),r.lastX=t,r.lastY=e,n.setPositionByOrigin(c,r.originX,r.originY),s},_setObjectSkew:function(t,e,i,r){var n,s,o,a,h,c,l,u,f,d=e.target,g=!1,p=e.skewSign;return"x"===i?(a="y",h="Y",c="X",u=0,f=d.skewY):(a="x",h="X",c="Y",u=d.skewX,f=0),o=d._getTransformedDimensions(u,f),l=2*Math.abs(t)-o[i],l<=2?n=0:(n=p*Math.atan(l/d["scale"+c]/(o[a]/d["scale"+h])),n=fabric.util.radiansToDegrees(n)),g=d["skew"+c]!==n,d.set("skew"+c,n),0!==d["skew"+h]&&(s=d._getTransformedDimensions(),n=r[a]/s[a]*d["scale"+h],d.set("scale"+h,n)),g},_scaleObject:function(t,e,i){var r=this._currentTransform,n=r.target,s=n.get("lockScalingX"),o=n.get("lockScalingY"),a=n.get("lockScalingFlip");if(s&&o)return!1;var h=n.translateToOriginPoint(n.getCenterPoint(),r.originX,r.originY),c=n.toLocalPoint(new fabric.Point(t,e),r.originX,r.originY),l=n._getTransformedDimensions(),u=!1;return this._setLocalMouse(c,r),u=this._setObjectScale(c,r,s,o,i,a,l),n.setPositionByOrigin(h,r.originX,r.originY),u},_setObjectScale:function(t,e,i,r,n,s,o){var a,h,c,l,u=e.target,f=!1,d=!1,g=!1;return c=t.x*u.scaleX/o.x,l=t.y*u.scaleY/o.y,a=u.scaleX!==c,h=u.scaleY!==l,s&&c<=0&&ci.padding?t.x<0?t.x+=i.padding:t.x-=i.padding:t.x=0,n(t.y)>i.padding?t.y<0?t.y+=i.padding:t.y-=i.padding:t.y=0},_rotateObject:function(t,e){var n=this._currentTransform;if(n.target.get("lockRotation"))return!1;var s=r(n.ey-n.top,n.ex-n.left),o=r(e-n.top,t-n.left),a=i(o-s+n.theta);return a<0&&(a=360+a),n.target.angle=a%360,!0},setCursor:function(t){this.upperCanvasEl.style.cursor=t},_resetObjectTransform:function(t){t.scaleX=1,t.scaleY=1,t.skewX=0,t.skewY=0,t.setAngle(0)},_drawSelection:function(t){var e=this._groupSelector,i=e.left,r=e.top,a=n(i),h=n(r);if(this.selectionColor&&(t.fillStyle=this.selectionColor,t.fillRect(e.ex-(i>0?0:-i),e.ey-(r>0?0:-r),a,h)),this.selectionLineWidth&&this.selectionBorderColor)if(t.lineWidth=this.selectionLineWidth,t.strokeStyle=this.selectionBorderColor,this.selectionDashArray.length>1&&!s){var c=e.ex+o-(i>0?0:a),l=e.ey+o-(r>0?0:h);t.beginPath(),fabric.util.drawDashedLine(t,c,l,c+a,l,this.selectionDashArray),fabric.util.drawDashedLine(t,c,l+h-1,c+a,l+h-1,this.selectionDashArray),fabric.util.drawDashedLine(t,c,l,c,l+h,this.selectionDashArray),fabric.util.drawDashedLine(t,c+a-1,l,c+a-1,l+h,this.selectionDashArray),t.closePath(),t.stroke()}else fabric.Object.prototype._setLineDash.call(this,t,this.selectionDashArray),t.strokeRect(e.ex+o-(i>0?0:a),e.ey+o-(r>0?0:h),a,h)},findTarget:function(t,e){if(!this.skipTargetFind){var i,r=!0,n=this.getPointer(t,r),s=this.getActiveGroup(),o=this.getActiveObject();if(s&&!e&&this._checkTarget(n,s))return this._fireOverOutEvents(s,t),s;if(o&&o._findTargetCorner(n))return this._fireOverOutEvents(o,t),o;if(o&&this._checkTarget(n,o)){if(!this.preserveObjectStacking)return this._fireOverOutEvents(o,t),o;i=o}this.targets=[];var a=this._searchPossibleTargets(this._objects,n);return t[this.altSelectionKey]&&a&&i&&a!==i&&(a=i),this._fireOverOutEvents(a,t),a}},_fireOverOutEvents:function(t,e){t?this._hoveredTarget!==t&&(this._hoveredTarget&&(this.fire("mouse:out",{target:this._hoveredTarget,e:e}),this._hoveredTarget.fire("mouseout")),this.fire("mouse:over",{target:t,e:e}),t.fire("mouseover"),this._hoveredTarget=t):this._hoveredTarget&&(this.fire("mouse:out",{target:this._hoveredTarget,e:e}),this._hoveredTarget.fire("mouseout"),this._hoveredTarget=null)},_checkTarget:function(t,e){if(e&&e.visible&&e.evented&&this.containsPoint(null,e,t)){if(!this.perPixelTargetFind&&!e.perPixelTargetFind||e.isEditing)return!0;var i=this.isTargetTransparent(e,t.x,t.y);if(!i)return!0}},_searchPossibleTargets:function(t,e){for(var i,r,n,s=t.length;s--;)if(this._checkTarget(e,t[s])){i=t[s],"group"===i.type&&i.subTargetCheck&&(r=this._normalizePointer(i,e),n=this._searchPossibleTargets(i._objects,r),n&&this.targets.push(n));break}return i},restorePointerVpt:function(t){return fabric.util.transformPoint(t,fabric.util.invertTransform(this.viewportTransform))},getPointer:function(e,i,r){r||(r=this.upperCanvasEl);var n,s=t(e),o=r.getBoundingClientRect(),a=o.width||0,h=o.height||0;return a&&h||("top"in o&&"bottom"in o&&(h=Math.abs(o.top-o.bottom)),"right"in o&&"left"in o&&(a=Math.abs(o.right-o.left))),this.calcOffset(),s.x=s.x-this._offset.left,s.y=s.y-this._offset.top,i||(s=this.restorePointerVpt(s)),n=0===a||0===h?{width:1,height:1}:{width:r.width/a,height:r.height/h},{x:s.x*n.width,y:s.y*n.height}},_createUpperCanvas:function(){var t=this.lowerCanvasEl.className.replace(/\s*lower-canvas\s*/,"");this.upperCanvasEl=this._createCanvasElement(),fabric.util.addClass(this.upperCanvasEl,"upper-canvas "+t),this.wrapperEl.appendChild(this.upperCanvasEl),this._copyCanvasStyle(this.lowerCanvasEl,this.upperCanvasEl),this._applyCanvasStyle(this.upperCanvasEl),this.contextTop=this.upperCanvasEl.getContext("2d")},_createCacheCanvas:function(){this.cacheCanvasEl=this._createCanvasElement(),this.cacheCanvasEl.setAttribute("width",this.width),this.cacheCanvasEl.setAttribute("height",this.height),this.contextCache=this.cacheCanvasEl.getContext("2d")},_initWrapperElement:function(){this.wrapperEl=fabric.util.wrapElement(this.lowerCanvasEl,"div",{class:this.containerClass}),fabric.util.setStyle(this.wrapperEl,{width:this.getWidth()+"px",height:this.getHeight()+"px",position:"relative"}),fabric.util.makeElementUnselectable(this.wrapperEl)},_applyCanvasStyle:function(t){var e=this.getWidth()||t.width,i=this.getHeight()||t.height;fabric.util.setStyle(t,{position:"absolute",width:e+"px",height:i+"px",left:0,top:0}),t.width=e,t.height=i,fabric.util.makeElementUnselectable(t)},_copyCanvasStyle:function(t,e){e.style.cssText=t.style.cssText},getSelectionContext:function(){return this.contextTop},getSelectionElement:function(){return this.upperCanvasEl},_setActiveObject:function(t){this._activeObject&&this._activeObject.set("active",!1),this._activeObject=t,t.set("active",!0)},setActiveObject:function(t,e){return this._setActiveObject(t),this.renderAll(),this.fire("object:selected",{target:t,e:e}),t.fire("selected",{e:e}),this},getActiveObject:function(){return this._activeObject},_onObjectRemoved:function(t){this.getActiveObject()===t&&(this.fire("before:selection:cleared",{target:t}),this._discardActiveObject(),this.fire("selection:cleared",{target:t}),t.fire("deselected")),this.callSuper("_onObjectRemoved",t)},_discardActiveObject:function(){this._activeObject&&this._activeObject.set("active",!1),this._activeObject=null},discardActiveObject:function(t){var e=this._activeObject;return this.fire("before:selection:cleared",{target:e,e:t}),this._discardActiveObject(),this.fire("selection:cleared",{e:t}),e&&e.fire("deselected",{e:t}),this},_setActiveGroup:function(t){this._activeGroup=t,t&&t.set("active",!0)},setActiveGroup:function(t,e){return this._setActiveGroup(t),t&&(this.fire("object:selected",{target:t,e:e}),t.fire("selected",{e:e})),this},getActiveGroup:function(){return this._activeGroup},_discardActiveGroup:function(){var t=this.getActiveGroup();t&&t.destroy(),this.setActiveGroup(null)},discardActiveGroup:function(t){var e=this.getActiveGroup();return this.fire("before:selection:cleared",{e:t,target:e}),this._discardActiveGroup(),this.fire("selection:cleared",{e:t}),this},deactivateAll:function(){for(var t=this.getObjects(),e=0,i=t.length;e1)){var r=this._groupSelector;r?(i=this.getPointer(t,!0),r.left=i.x-r.ex,r.top=i.y-r.ey,this.renderTop()):this._currentTransform?this._transformObject(t):(e=this.findTarget(t),this._setCursorFromEvent(t,e)),this._handleEvent(t,"move",e?e:null)}},__onMouseWheel:function(t){this.fire("mouse:wheel",{e:t})},_transformObject:function(t){var e=this.getPointer(t),i=this._currentTransform;i.reset=!1,i.target.isMoving=!0,this._beforeScaleTransform(t,i),this._performTransformAction(t,i,e),i.actionPerformed&&this.renderAll()},_performTransformAction:function(t,e,i){var r=i.x,n=i.y,s=e.target,o=e.action,a=!1;"rotate"===o?(a=this._rotateObject(r,n))&&this._fire("rotating",s,t):"scale"===o?(a=this._onScale(t,e,r,n))&&this._fire("scaling",s,t):"scaleX"===o?(a=this._scaleObject(r,n,"x"))&&this._fire("scaling",s,t):"scaleY"===o?(a=this._scaleObject(r,n,"y"))&&this._fire("scaling",s,t):"skewX"===o?(a=this._skewObject(r,n,"x"))&&this._fire("skewing",s,t):"skewY"===o?(a=this._skewObject(r,n,"y"))&&this._fire("skewing",s,t):(a=this._translateObject(r,n),a&&(this._fire("moving",s,t),this.setCursor(s.moveCursor||this.moveCursor))),e.actionPerformed=a},_fire:function(t,e,i){this.fire("object:"+t,{target:e,e:i}),e.fire(t,{e:i})},_beforeScaleTransform:function(t,e){if("scale"===e.action||"scaleX"===e.action||"scaleY"===e.action){var i=this._shouldCenterTransform(e.target);(i&&("center"!==e.originX||"center"!==e.originY)||!i&&"center"===e.originX&&"center"===e.originY)&&(this._resetCurrentTransform(),e.reset=!0)}},_onScale:function(t,e,i,r){return!t[this.uniScaleKey]&&!this.uniScaleTransform||e.target.get("lockUniScaling")?(e.reset||"scale"!==e.currentAction||this._resetCurrentTransform(),e.currentAction="scaleEqually",this._scaleObject(i,r,"equally")):(e.currentAction="scale",this._scaleObject(i,r))},_setCursorFromEvent:function(t,e){if(!e)return this.setCursor(this.defaultCursor),!1;var i=e.hoverCursor||this.hoverCursor;if(e.selectable){var r=this.getActiveGroup(),n=e._findTargetCorner&&(!r||!r.contains(e))&&e._findTargetCorner(this.getPointer(t,!0));n?this._setCornerCursor(n,e,t):this.setCursor(i)}else this.setCursor(i);return!0},_setCornerCursor:function(e,i,r){if(e in t)this.setCursor(this._getRotatedCornerCursor(e,i,r));else{if("mtr"!==e||!i.hasRotatingPoint)return this.setCursor(this.defaultCursor),!1;this.setCursor(this.rotationCursor)}},_getRotatedCornerCursor:function(e,i,r){var n=Math.round(i.getAngle()%360/45);return n<0&&(n+=8),n+=t[e],r[this.altActionKey]&&t[e]%2===0&&(n+=2),n%=8,this.cursorMap[n]}})}(),function(){var t=Math.min,e=Math.max;fabric.util.object.extend(fabric.Canvas.prototype,{_shouldGroup:function(t,e){var i=this.getActiveObject();return t[this.selectionKey]&&e&&e.selectable&&(this.getActiveGroup()||i&&i!==e)&&this.selection},_handleGrouping:function(t,e){var i=this.getActiveGroup();(e!==i||(e=this.findTarget(t,!0)))&&(i?this._updateActiveGroup(e,t):this._createActiveGroup(e,t),this._activeGroup&&this._activeGroup.saveCoords())},_updateActiveGroup:function(t,e){var i=this.getActiveGroup();if(i.contains(t)){if(i.removeWithUpdate(t),t.set("active",!1),1===i.size())return this.discardActiveGroup(e),void this.setActiveObject(i.item(0))}else i.addWithUpdate(t);this.fire("selection:created",{target:i,e:e}),i.set("active",!0)},_createActiveGroup:function(t,e){if(this._activeObject&&t!==this._activeObject){var i=this._createGroup(t);i.addWithUpdate(),this.setActiveGroup(i),this._activeObject=null,this.fire("selection:created",{target:i,e:e})}t.set("active",!0)},_createGroup:function(t){var e=this.getObjects(),i=e.indexOf(this._activeObject)1&&(e=new fabric.Group(e.reverse(),{canvas:this}),e.addWithUpdate(),this.setActiveGroup(e,t),e.saveCoords(),this.fire("selection:created",{target:e}),this.renderAll())},_collectObjects:function(){for(var i,r=[],n=this._groupSelector.ex,s=this._groupSelector.ey,o=n+this._groupSelector.left,a=s+this._groupSelector.top,h=new fabric.Point(t(n,o),t(s,a)),c=new fabric.Point(e(n,o),e(s,a)),l=n===o&&s===a,u=this._objects.length;u--&&(i=this._objects[u],!(i&&i.selectable&&i.visible&&(i.intersectsWithRect(h,c)||i.isContainedWithinRect(h,c)||i.containsPoint(h)||i.containsPoint(c))&&(i.set("active",!0),r.push(i),l))););return r},_maybeGroupObjects:function(t){this.selection&&this._groupSelector&&this._groupSelectedObjects(t);var e=this.getActiveGroup();e&&(e.setObjectsCoords().setCoords(),e.isMoving=!1,this.setCursor(this.defaultCursor)),this._groupSelector=null,this._currentTransform=null}})}(),function(){var t=fabric.StaticCanvas.supports("toDataURLWithQuality");fabric.util.object.extend(fabric.StaticCanvas.prototype,{toDataURL:function(t){t||(t={});var e=t.format||"png",i=t.quality||1,r=t.multiplier||1,n={left:t.left||0,top:t.top||0,width:t.width||0,height:t.height||0};return this.__toDataURLWithMultiplier(e,i,n,r)},__toDataURLWithMultiplier:function(t,e,i,r){var n=this.getWidth(),s=this.getHeight(),o=(i.width||this.getWidth())*r,a=(i.height||this.getHeight())*r,h=this.getZoom(),c=h*r,l=this.viewportTransform,u=(l[4]-i.left)*r,f=(l[5]-i.top)*r,d=[c,0,0,c,u,f],g=this.interactive;this.viewportTransform=d,this.interactive&&(this.interactive=!1),n!==o||s!==a?this.setDimensions({width:o,height:a}):this.renderAll();var p=this.__toDataURL(t,e,i);return g&&(this.interactive=g),this.viewportTransform=l,this.setDimensions({width:n,height:s}),p},__toDataURL:function(e,i){var r=this.contextContainer.canvas;"jpg"===e&&(e="jpeg");var n=t?r.toDataURL("image/"+e,i):r.toDataURL("image/"+e);return n},toDataURLWithMultiplier:function(t,e,i){return this.toDataURL({format:t,multiplier:e,quality:i})}})}(),fabric.util.object.extend(fabric.StaticCanvas.prototype,{loadFromDatalessJSON:function(t,e,i){return this.loadFromJSON(t,e,i)},loadFromJSON:function(t,e,i){if(t){var r="string"==typeof t?JSON.parse(t):fabric.util.object.clone(t);this.clear();var n=this;return this._enlivenObjects(r.objects,function(){n._setBgOverlay(r,function(){delete r.objects,delete r.backgroundImage,delete r.overlayImage,delete r.background,delete r.overlay;for(var t in r)n[t]=r[t];e&&e()})},i),this}},_setBgOverlay:function(t,e){var i=this,r={backgroundColor:!1,overlayColor:!1,backgroundImage:!1,overlayImage:!1};if(!(t.backgroundImage||t.overlayImage||t.background||t.overlay))return void(e&&e());var n=function(){r.backgroundImage&&r.overlayImage&&r.backgroundColor&&r.overlayColor&&(i.renderAll(),e&&e())};this.__setBgOverlay("backgroundImage",t.backgroundImage,r,n),this.__setBgOverlay("overlayImage",t.overlayImage,r,n),this.__setBgOverlay("backgroundColor",t.background,r,n),this.__setBgOverlay("overlayColor",t.overlay,r,n),n()},__setBgOverlay:function(t,e,i,r){var n=this;return e?void("backgroundImage"===t||"overlayImage"===t?fabric.Image.fromObject(e,function(e){n[t]=e,i[t]=!0,r&&r()}):this["set"+fabric.util.string.capitalize(t,!0)](e,function(){i[t]=!0,r&&r()})):void(i[t]=!0)},_enlivenObjects:function(t,e,i){var r=this;if(!t||0===t.length)return void(e&&e());var n=this.renderOnAddRemove;this.renderOnAddRemove=!1,fabric.util.enlivenObjects(t,function(t){t.forEach(function(t,e){r.insertAt(t,e)}),r.renderOnAddRemove=n,e&&e()},null,i)},_toDataURL:function(t,e){this.clone(function(i){e(i.toDataURL(t))})},_toDataURLWithMultiplier:function(t,e,i){this.clone(function(r){i(r.toDataURLWithMultiplier(t,e))})},clone:function(t,e){var i=JSON.stringify(this.toJSON(e));this.cloneWithoutData(function(e){e.loadFromJSON(i,function(){t&&t(e)})})},cloneWithoutData:function(t){var e=fabric.document.createElement("canvas");e.width=this.getWidth(),e.height=this.getHeight();var i=new fabric.Canvas(e);i.clipTo=this.clipTo,this.backgroundImage?(i.setBackgroundImage(this.backgroundImage.src,function(){i.renderAll(),t&&t(i)}),i.backgroundImageOpacity=this.backgroundImageOpacity,i.backgroundImageStretch=this.backgroundImageStretch):t&&t(i)}}),function(t){"use strict";var e=t.fabric||(t.fabric={}),i=e.util.object.extend,r=e.util.toFixed,n=e.util.string.capitalize,s=e.util.degreesToRadians,o=e.StaticCanvas.supports("setLineDash");e.Object||(e.Object=e.util.createClass({type:"object",originX:"left",originY:"top",top:0,left:0,width:0,height:0,scaleX:1,scaleY:1,flipX:!1,flipY:!1,opacity:1,angle:0,skewX:0,skewY:0,cornerSize:13,transparentCorners:!0,hoverCursor:null,moveCursor:null,padding:0,borderColor:"rgba(102,153,255,0.75)",borderDashArray:null,cornerColor:"rgba(102,153,255,0.5)",cornerStrokeColor:null,cornerStyle:"rect",cornerDashArray:null,centeredScaling:!1,centeredRotation:!0,fill:"rgb(0,0,0)",fillRule:"nonzero",globalCompositeOperation:"source-over",backgroundColor:"",selectionBackgroundColor:"",stroke:null,strokeWidth:1,strokeDashArray:null,strokeLineCap:"butt",strokeLineJoin:"miter",strokeMiterLimit:10,shadow:null,borderOpacityWhenMoving:.4,borderScaleFactor:1,transformMatrix:null,minScaleLimit:.01,selectable:!0,evented:!0,visible:!0,hasControls:!0,hasBorders:!0,hasRotatingPoint:!0,rotatingPointOffset:40,perPixelTargetFind:!1,includeDefaultValues:!0,clipTo:null,lockMovementX:!1,lockMovementY:!1,lockRotation:!1,lockScalingX:!1,lockScalingY:!1,lockUniScaling:!1,lockSkewingX:!1,lockSkewingY:!1,lockScalingFlip:!1,excludeFromExport:!1,stateProperties:"top left width height scaleX scaleY flipX flipY originX originY transformMatrix stroke strokeWidth strokeDashArray strokeLineCap strokeLineJoin strokeMiterLimit angle opacity fill fillRule globalCompositeOperation shadow clipTo visible backgroundColor skewX skewY".split(" "),initialize:function(t){t&&this.setOptions(t)},_initGradient:function(t){!t.fill||!t.fill.colorStops||t.fill instanceof e.Gradient||this.set("fill",new e.Gradient(t.fill)),!t.stroke||!t.stroke.colorStops||t.stroke instanceof e.Gradient||this.set("stroke",new e.Gradient(t.stroke))},_initPattern:function(t){!t.fill||!t.fill.source||t.fill instanceof e.Pattern||this.set("fill",new e.Pattern(t.fill)),!t.stroke||!t.stroke.source||t.stroke instanceof e.Pattern||this.set("stroke",new e.Pattern(t.stroke))},_initClipping:function(t){if(t.clipTo&&"string"==typeof t.clipTo){var i=e.util.getFunctionBody(t.clipTo);"undefined"!=typeof i&&(this.clipTo=new Function("ctx",i))}},setOptions:function(t){for(var e in t)this.set(e,t[e]);this._initGradient(t),this._initPattern(t),this._initClipping(t)},transform:function(t,e){this.group&&!this.group._transformDone&&this.group===this.canvas._activeGroup&&this.group.transform(t);var i=e?this._getLeftTopCoords():this.getCenterPoint();t.translate(i.x,i.y),t.rotate(s(this.angle)),t.scale(this.scaleX*(this.flipX?-1:1),this.scaleY*(this.flipY?-1:1)),t.transform(1,0,Math.tan(s(this.skewX)),1,0,0),t.transform(1,Math.tan(s(this.skewY)),0,1,0,0)},toObject:function(t){var i=e.Object.NUM_FRACTION_DIGITS,n={type:this.type,originX:this.originX,originY:this.originY,left:r(this.left,i),top:r(this.top,i),width:r(this.width,i),height:r(this.height,i),fill:this.fill&&this.fill.toObject?this.fill.toObject():this.fill,stroke:this.stroke&&this.stroke.toObject?this.stroke.toObject():this.stroke,strokeWidth:r(this.strokeWidth,i),strokeDashArray:this.strokeDashArray?this.strokeDashArray.concat():this.strokeDashArray,strokeLineCap:this.strokeLineCap,strokeLineJoin:this.strokeLineJoin,strokeMiterLimit:r(this.strokeMiterLimit,i),scaleX:r(this.scaleX,i),scaleY:r(this.scaleY,i),angle:r(this.getAngle(),i),flipX:this.flipX,flipY:this.flipY,opacity:r(this.opacity,i),shadow:this.shadow&&this.shadow.toObject?this.shadow.toObject():this.shadow,visible:this.visible,clipTo:this.clipTo&&String(this.clipTo),backgroundColor:this.backgroundColor,fillRule:this.fillRule,globalCompositeOperation:this.globalCompositeOperation,transformMatrix:this.transformMatrix?this.transformMatrix.concat():this.transformMatrix,skewX:r(this.skewX,i),skewY:r(this.skewY,i)};return this.includeDefaultValues||(n=this._removeDefaultValues(n)),e.util.populateWithProperties(this,n,t),n},toDatalessObject:function(t){return this.toObject(t)},_removeDefaultValues:function(t){var i=e.util.getKlass(t.type).prototype,r=i.stateProperties;return r.forEach(function(e){t[e]===i[e]&&delete t[e];var r="[object Array]"===Object.prototype.toString.call(t[e])&&"[object Array]"===Object.prototype.toString.call(i[e]);r&&0===t[e].length&&0===i[e].length&&delete t[e]}),t},toString:function(){return"#"},get:function(t){return this[t]},getObjectScaling:function(){var t=this.scaleX,e=this.scaleY;if(this.group){var i=this.group.getObjectScaling();t*=i.scaleX,e*=i.scaleY}return{scaleX:t,scaleY:e}},_setObject:function(t){for(var e in t)this._set(e,t[e])},set:function(t,e){return"object"==typeof t?this._setObject(t):"function"==typeof e&&"clipTo"!==t?this._set(t,e(this.get(t))):this._set(t,e),this},_set:function(t,i){var r="scaleX"===t||"scaleY"===t;return r&&(i=this._constrainScale(i)),"scaleX"===t&&i<0?(this.flipX=!this.flipX,i*=-1):"scaleY"===t&&i<0?(this.flipY=!this.flipY,i*=-1):"shadow"!==t||!i||i instanceof e.Shadow||(i=new e.Shadow(i)),this[t]=i,"width"!==t&&"height"!==t||(this.minScaleLimit=Math.min(.1,1/Math.max(this.width,this.height))),this},setOnGroup:function(){},toggle:function(t){var e=this.get(t);return"boolean"==typeof e&&this.set(t,!e),this},setSourcePath:function(t){return this.sourcePath=t,this},getViewportTransform:function(){return this.canvas&&this.canvas.viewportTransform?this.canvas.viewportTransform:[1,0,0,1,0,0]},render:function(t,i){0===this.width&&0===this.height||!this.visible||(t.save(),this._setupCompositeOperation(t),this.drawSelectionBackground(t),i||this.transform(t),this._setOpacity(t),this._setShadow(t),this._renderBackground(t),this._setStrokeStyles(t),this._setFillStyles(t),this.transformMatrix&&t.transform.apply(t,this.transformMatrix),this.clipTo&&e.util.clipContext(this,t),this._render(t,i),this.clipTo&&t.restore(),t.restore())},_renderBackground:function(t){this.backgroundColor&&(t.fillStyle=this.backgroundColor,t.fillRect(-this.width/2,-this.height/2,this.width,this.height),this._removeShadow(t))},_setOpacity:function(t){this.group&&this.group._setOpacity(t),t.globalAlpha*=this.opacity},_setStrokeStyles:function(t){this.stroke&&(t.lineWidth=this.strokeWidth,t.lineCap=this.strokeLineCap,t.lineJoin=this.strokeLineJoin,t.miterLimit=this.strokeMiterLimit,t.strokeStyle=this.stroke.toLive?this.stroke.toLive(t,this):this.stroke)},_setFillStyles:function(t){this.fill&&(t.fillStyle=this.fill.toLive?this.fill.toLive(t,this):this.fill)},_setLineDash:function(t,e,i){e&&(1&e.length&&e.push.apply(e,e),o?t.setLineDash(e):i&&i(t))},_renderControls:function(t,i){if(!(!this.active||i||this.group&&this.group!==this.canvas.getActiveGroup())){var r,n=this.getViewportTransform(),o=this.calcTransformMatrix();o=e.util.multiplyTransformMatrices(n,o),r=e.util.qrDecompose(o),t.save(),t.translate(r.translateX,r.translateY),t.lineWidth=1*this.borderScaleFactor,t.globalAlpha=this.isMoving?this.borderOpacityWhenMoving:1,this.group&&this.group===this.canvas.getActiveGroup()?(t.rotate(s(r.angle)),this.drawBordersInGroup(t,r)):(t.rotate(s(this.angle)),this.drawBorders(t)),this.drawControls(t),t.restore()}},_setShadow:function(t){if(this.shadow){var i=this.canvas&&this.canvas.viewportTransform[0]||1,r=this.canvas&&this.canvas.viewportTransform[3]||1,n=this.getObjectScaling();this.canvas&&this.canvas._isRetinaScaling()&&(i*=e.devicePixelRatio,r*=e.devicePixelRatio),t.shadowColor=this.shadow.color,t.shadowBlur=this.shadow.blur*(i+r)*(n.scaleX+n.scaleY)/4,t.shadowOffsetX=this.shadow.offsetX*i*n.scaleX,t.shadowOffsetY=this.shadow.offsetY*r*n.scaleY}},_removeShadow:function(t){this.shadow&&(t.shadowColor="",t.shadowBlur=t.shadowOffsetX=t.shadowOffsetY=0)},_renderFill:function(t){if(this.fill){if(t.save(),this.fill.gradientTransform){var e=this.fill.gradientTransform;t.transform.apply(t,e)}this.fill.toLive&&t.translate(-this.width/2+this.fill.offsetX||0,-this.height/2+this.fill.offsetY||0),"evenodd"===this.fillRule?t.fill("evenodd"):t.fill(),t.restore()}},_renderStroke:function(t){if(this.stroke&&0!==this.strokeWidth){if(this.shadow&&!this.shadow.affectStroke&&this._removeShadow(t),t.save(),this._setLineDash(t,this.strokeDashArray,this._renderDashedStroke),this.stroke.gradientTransform){var e=this.stroke.gradientTransform;t.transform.apply(t,e)}this.stroke.toLive&&t.translate(-this.width/2+this.stroke.offsetX||0,-this.height/2+this.stroke.offsetY||0),t.stroke(),t.restore()}},clone:function(t,i){return this.constructor.fromObject?this.constructor.fromObject(this.toObject(i),t):new e.Object(this.toObject(i))},cloneAsImage:function(t,i){var r=this.toDataURL(i);return e.util.loadImage(r,function(i){t&&t(new e.Image(i))}),this},toDataURL:function(t){t||(t={});var i=e.util.createCanvasElement(),r=this.getBoundingRect();i.width=r.width,i.height=r.height,e.util.wrapElement(i,"div");var n=new e.StaticCanvas(i,{enableRetinaScaling:t.enableRetinaScaling});"jpg"===t.format&&(t.format="jpeg"),"jpeg"===t.format&&(n.backgroundColor="#fff");var s={active:this.get("active"),left:this.getLeft(),top:this.getTop()};this.set("active",!1),this.setPositionByOrigin(new e.Point(n.getWidth()/2,n.getHeight()/2),"center","center");var o=this.canvas;n.add(this);var a=n.toDataURL(t);return this.set(s).setCoords(),this.canvas=o,n.dispose(),n=null,a},isType:function(t){return this.type===t},complexity:function(){return 0},toJSON:function(t){return this.toObject(t)},setGradient:function(t,i){i||(i={});var r={colorStops:[]};r.type=i.type||(i.r1||i.r2?"radial":"linear"),r.coords={x1:i.x1,y1:i.y1,x2:i.x2,y2:i.y2},(i.r1||i.r2)&&(r.coords.r1=i.r1,r.coords.r2=i.r2),i.gradientTransform&&(r.gradientTransform=i.gradientTransform);for(var n in i.colorStops){var s=new e.Color(i.colorStops[n]);r.colorStops.push({offset:n,color:s.toRgb(),opacity:s.getAlpha()})}return this.set(t,e.Gradient.forObject(this,r))},setPatternFill:function(t){return this.set("fill",new e.Pattern(t))},setShadow:function(t){return this.set("shadow",t?new e.Shadow(t):null)},setColor:function(t){return this.set("fill",t),this},setAngle:function(t){var e=("center"!==this.originX||"center"!==this.originY)&&this.centeredRotation;return e&&this._setOriginToCenter(),this.set("angle",t),e&&this._resetOrigin(),this},centerH:function(){return this.canvas&&this.canvas.centerObjectH(this),this},viewportCenterH:function(){return this.canvas&&this.canvas.viewportCenterObjectH(this),this},centerV:function(){return this.canvas&&this.canvas.centerObjectV(this),this},viewportCenterV:function(){return this.canvas&&this.canvas.viewportCenterObjectV(this),this},center:function(){return this.canvas&&this.canvas.centerObject(this),this},viewportCenter:function(){return this.canvas&&this.canvas.viewportCenterObject(this),this},remove:function(){return this.canvas&&this.canvas.remove(this),this},getLocalPointer:function(t,i){i=i||this.canvas.getPointer(t);var r=new e.Point(i.x,i.y),n=this._getLeftTopCoords();return this.angle&&(r=e.util.rotatePoint(r,n,e.util.degreesToRadians(-this.angle))),{x:r.x-n.x,y:r.y-n.y}},_setupCompositeOperation:function(t){this.globalCompositeOperation&&(t.globalCompositeOperation=this.globalCompositeOperation)}}),e.util.createAccessors(e.Object),e.Object.prototype.rotate=e.Object.prototype.setAngle,i(e.Object.prototype,e.Observable),e.Object.NUM_FRACTION_DIGITS=2,e.Object.__uid=0)}("undefined"!=typeof exports?exports:this),function(){var t=fabric.util.degreesToRadians,e={left:-.5,center:0,right:.5},i={top:-.5,center:0,bottom:.5};fabric.util.object.extend(fabric.Object.prototype,{translateToGivenOrigin:function(t,r,n,s,o){var a,h,c,l=t.x,u=t.y;return"string"==typeof r?r=e[r]:r-=.5,"string"==typeof s?s=e[s]:s-=.5,a=s-r,"string"==typeof n?n=i[n]:n-=.5,"string"==typeof o?o=i[o]:o-=.5,h=o-n,(a||h)&&(c=this._getTransformedDimensions(),l=t.x+a*c.x,u=t.y+h*c.y),new fabric.Point(l,u)},translateToCenterPoint:function(e,i,r){var n=this.translateToGivenOrigin(e,i,r,"center","center");return this.angle?fabric.util.rotatePoint(n,e,t(this.angle)):n},translateToOriginPoint:function(e,i,r){var n=this.translateToGivenOrigin(e,"center","center",i,r);return this.angle?fabric.util.rotatePoint(n,e,t(this.angle)):n},getCenterPoint:function(){var t=new fabric.Point(this.left,this.top);return this.translateToCenterPoint(t,this.originX,this.originY)},getPointByOrigin:function(t,e){var i=this.getCenterPoint();return this.translateToOriginPoint(i,t,e)},toLocalPoint:function(e,i,r){var n,s,o=this.getCenterPoint();return n="undefined"!=typeof i&&"undefined"!=typeof r?this.translateToGivenOrigin(o,"center","center",i,r):new fabric.Point(this.left,this.top),s=new fabric.Point(e.x,e.y),this.angle&&(s=fabric.util.rotatePoint(s,o,-t(this.angle))),s.subtractEquals(n)},setPositionByOrigin:function(t,e,i){var r=this.translateToCenterPoint(t,e,i),n=this.translateToOriginPoint(r,this.originX,this.originY);this.set("left",n.x),this.set("top",n.y)},adjustPosition:function(i){var r,n,s=t(this.angle),o=this.getWidth(),a=Math.cos(s)*o,h=Math.sin(s)*o;r="string"==typeof this.originX?e[this.originX]:this.originX-.5,n="string"==typeof i?e[i]:i-.5,this.left+=a*(n-r),this.top+=h*(n-r),this.setCoords(),this.originX=i},_setOriginToCenter:function(){this._originalOriginX=this.originX,this._originalOriginY=this.originY;var t=this.getCenterPoint();this.originX="center",this.originY="center",this.left=t.x,this.top=t.y},_resetOrigin:function(){var t=this.translateToOriginPoint(this.getCenterPoint(),this._originalOriginX,this._originalOriginY);this.originX=this._originalOriginX,this.originY=this._originalOriginY,this.left=t.x,this.top=t.y,this._originalOriginX=null,this._originalOriginY=null},_getLeftTopCoords:function(){return this.translateToOriginPoint(this.getCenterPoint(),"left","top")}})}(),function(){function t(t){return[new fabric.Point(t.tl.x,t.tl.y),new fabric.Point(t.tr.x,t.tr.y),new fabric.Point(t.br.x,t.br.y),new fabric.Point(t.bl.x,t.bl.y)]}var e=fabric.util.degreesToRadians,i=fabric.util.multiplyTransformMatrices;fabric.util.object.extend(fabric.Object.prototype,{oCoords:null,intersectsWithRect:function(e,i){var r=t(this.oCoords),n=fabric.Intersection.intersectPolygonRectangle(r,e,i);return"Intersection"===n.status},intersectsWithObject:function(e){var i=fabric.Intersection.intersectPolygonPolygon(t(this.oCoords),t(e.oCoords));return"Intersection"===i.status||e.isContainedWithinObject(this)||this.isContainedWithinObject(e)},isContainedWithinObject:function(e){for(var i=t(this.oCoords),r=0;r<4;r++)if(!e.containsPoint(i[r]))return!1;return!0},isContainedWithinRect:function(t,e){var i=this.getBoundingRect();return i.left>=t.x&&i.left+i.width<=e.x&&i.top>=t.y&&i.top+i.height<=e.y},containsPoint:function(t){this.oCoords||this.setCoords();var e=this._getImageLines(this.oCoords),i=this._findCrossPoints(t,e);return 0!==i&&i%2===1},_getImageLines:function(t){return{topline:{o:t.tl,d:t.tr},rightline:{o:t.tr,d:t.br},bottomline:{o:t.br,d:t.bl},leftline:{o:t.bl,d:t.tl}}},_findCrossPoints:function(t,e){var i,r,n,s,o,a,h=0;for(var c in e)if(a=e[c],!(a.o.y=t.y&&a.d.y>=t.y||(a.o.x===a.d.x&&a.o.x>=t.x?o=a.o.x:(i=0,r=(a.d.y-a.o.y)/(a.d.x-a.o.x),n=t.y-i*t.x,s=a.o.y-r*a.o.x,o=-(n-s)/(i-r)),o>=t.x&&(h+=1),2!==h)))break;return h},getBoundingRectWidth:function(){return this.getBoundingRect().width},getBoundingRectHeight:function(){return this.getBoundingRect().height},getBoundingRect:function(){return this.oCoords||this.setCoords(),fabric.util.makeBoundingBoxFromPoints([this.oCoords.tl,this.oCoords.tr,this.oCoords.br,this.oCoords.bl])},getWidth:function(){return this._getTransformedDimensions().x},getHeight:function(){return this._getTransformedDimensions().y},_constrainScale:function(t){return Math.abs(t)0?Math.atan(s/n):0,c=n/Math.cos(h)/2,l=Math.cos(h+t)*c,u=Math.sin(h+t)*c,f=fabric.util.transformPoint(this.getCenterPoint(),i),d=new fabric.Point(f.x-l,f.y-u),g=new fabric.Point(d.x+n*a,d.y+n*o),p=new fabric.Point(d.x-s*o,d.y+s*a),v=new fabric.Point(f.x+l,f.y+u),b=new fabric.Point((d.x+p.x)/2,(d.y+p.y)/2),m=new fabric.Point((g.x+d.x)/2,(g.y+d.y)/2),y=new fabric.Point((v.x+g.x)/2,(v.y+g.y)/2),_=new fabric.Point((v.x+p.x)/2,(v.y+p.y)/2),x=new fabric.Point(m.x+o*this.rotatingPointOffset,m.y-a*this.rotatingPointOffset);return this.oCoords={tl:d,tr:g,br:v,bl:p,ml:b,mt:m,mr:y,mb:_,mtr:x},this._setCornerCoords&&this._setCornerCoords(),this},_calcRotateMatrix:function(){ +if(this.angle){var t=e(this.angle),i=Math.cos(t),r=Math.sin(t);return[i,r,-r,i,0,0]}return[1,0,0,1,0,0]},calcTransformMatrix:function(){var t=this.getCenterPoint(),e=[1,0,0,1,t.x,t.y],r=this._calcRotateMatrix(),n=this._calcDimensionsTransformMatrix(this.skewX,this.skewY,!0),s=this.group?this.group.calcTransformMatrix():[1,0,0,1,0,0];return s=i(s,e),s=i(s,r),s=i(s,n)},_calcDimensionsTransformMatrix:function(t,r,n){var s=[1,0,Math.tan(e(t)),1],o=[1,Math.tan(e(r)),0,1],a=this.scaleX*(n&&this.flipX?-1:1),h=this.scaleY*(n&&this.flipY?-1:1),c=[a,0,0,h],l=i(c,s,!0);return i(l,o,!0)}})}(),fabric.util.object.extend(fabric.Object.prototype,{sendToBack:function(){return this.group?fabric.StaticCanvas.prototype.sendToBack.call(this.group,this):this.canvas.sendToBack(this),this},bringToFront:function(){return this.group?fabric.StaticCanvas.prototype.bringToFront.call(this.group,this):this.canvas.bringToFront(this),this},sendBackwards:function(t){return this.group?fabric.StaticCanvas.prototype.sendBackwards.call(this.group,this,t):this.canvas.sendBackwards(this,t),this},bringForward:function(t){return this.group?fabric.StaticCanvas.prototype.bringForward.call(this.group,this,t):this.canvas.bringForward(this,t),this},moveTo:function(t){return this.group?fabric.StaticCanvas.prototype.moveTo.call(this.group,this,t):this.canvas.moveTo(this,t),this}}),function(){function t(t,e){if(e){if(e.toLive)return t+": url(#SVGID_"+e.id+"); ";var i=new fabric.Color(e),r=t+": "+i.toRgb()+"; ",n=i.getAlpha();return 1!==n&&(r+=t+"-opacity: "+n.toString()+"; "),r}return t+": none; "}fabric.util.object.extend(fabric.Object.prototype,{getSvgStyles:function(e){var i=this.fillRule,r=this.strokeWidth?this.strokeWidth:"0",n=this.strokeDashArray?this.strokeDashArray.join(" "):"none",s=this.strokeLineCap?this.strokeLineCap:"butt",o=this.strokeLineJoin?this.strokeLineJoin:"miter",a=this.strokeMiterLimit?this.strokeMiterLimit:"4",h="undefined"!=typeof this.opacity?this.opacity:"1",c=this.visible?"":" visibility: hidden;",l=e?"":this.getSvgFilter(),u=t("fill",this.fill),f=t("stroke",this.stroke);return[f,"stroke-width: ",r,"; ","stroke-dasharray: ",n,"; ","stroke-linecap: ",s,"; ","stroke-linejoin: ",o,"; ","stroke-miterlimit: ",a,"; ",u,"fill-rule: ",i,"; ","opacity: ",h,";",l,c].join("")},getSvgFilter:function(){return this.shadow?"filter: url(#SVGID_"+this.shadow.id+");":""},getSvgId:function(){return this.id?'id="'+this.id+'" ':""},getSvgTransform:function(){if(this.group&&"path-group"===this.group.type)return"";var t=fabric.util.toFixed,e=this.getAngle(),i=this.getSkewX()%360,r=this.getSkewY()%360,n=this.getCenterPoint(),s=fabric.Object.NUM_FRACTION_DIGITS,o="path-group"===this.type?"":"translate("+t(n.x,s)+" "+t(n.y,s)+")",a=0!==e?" rotate("+t(e,s)+")":"",h=1===this.scaleX&&1===this.scaleY?"":" scale("+t(this.scaleX,s)+" "+t(this.scaleY,s)+")",c=0!==i?" skewX("+t(i,s)+")":"",l=0!==r?" skewY("+t(r,s)+")":"",u="path-group"===this.type?this.width:0,f=this.flipX?" matrix(-1 0 0 1 "+u+" 0) ":"",d="path-group"===this.type?this.height:0,g=this.flipY?" matrix(1 0 0 -1 0 "+d+")":"";return[o,a,h,f,g,c,l].join("")},getSvgTransformMatrix:function(){return this.transformMatrix?" matrix("+this.transformMatrix.join(" ")+") ":""},_createBaseSVGMarkup:function(){var t=[];return this.fill&&this.fill.toLive&&t.push(this.fill.toSVG(this,!1)),this.stroke&&this.stroke.toLive&&t.push(this.stroke.toSVG(this,!1)),this.shadow&&t.push(this.shadow.toSVG(this)),t}})}(),function(){function t(t,e,r){var n={},s=!0;r.forEach(function(e){n[e]=t[e]}),i(t[e],n,s)}function e(t,i){if(!fabric.isLikelyNode&&t instanceof Element)return t===i;if(t instanceof Array){if(t.length!==i.length)return!1;var r=i.concat().sort(),n=t.concat().sort();return!n.some(function(t,i){return!e(r[i],t)})}if(t instanceof Object){for(var s in t)if(!e(t[s],i[s]))return!1;return!0}return t===i}var i=fabric.util.object.extend;fabric.util.object.extend(fabric.Object.prototype,{hasStateChanged:function(){return!e(this.originalState,this)},saveState:function(e){return t(this,"originalState",this.stateProperties),e&&e.stateProperties&&t(this,"originalState",e.stateProperties),this},setupState:function(t){return this.originalState={},this.saveState(t),this}})}(),function(){var t=fabric.util.degreesToRadians,e=function(){return"undefined"!=typeof G_vmlCanvasManager};fabric.util.object.extend(fabric.Object.prototype,{_controlsVisibility:null,_findTargetCorner:function(t){if(!this.hasControls||!this.active)return!1;var e,i,r=t.x,n=t.y;this.__corner=0;for(var s in this.oCoords)if(this.isControlVisible(s)&&("mtr"!==s||this.hasRotatingPoint)&&(!this.get("lockUniScaling")||"mt"!==s&&"mr"!==s&&"mb"!==s&&"ml"!==s)&&(i=this._getImageLines(this.oCoords[s].corner),e=this._findCrossPoints({x:r,y:n},i),0!==e&&e%2===1))return this.__corner=s,s;return!1},_setCornerCoords:function(){var e,i,r=this.oCoords,n=t(45-this.angle),s=.707106*this.cornerSize,o=s*Math.cos(n),a=s*Math.sin(n);for(var h in r)e=r[h].x,i=r[h].y,r[h].corner={tl:{x:e-a,y:i-o},tr:{x:e+o,y:i-a},bl:{x:e-o,y:i+a},br:{x:e+a,y:i+o}}},_getNonTransformedDimensions:function(){var t=this.strokeWidth,e=this.width,i=this.height,r=!0,n=!0;return"line"===this.type&&"butt"===this.strokeLineCap&&(n=e,r=i),n&&(i+=i<0?-t:t),r&&(e+=e<0?-t:t),{x:e,y:i}},_getTransformedDimensions:function(t,e){"undefined"==typeof t&&(t=this.skewX),"undefined"==typeof e&&(e=this.skewY);var i,r,n=this._getNonTransformedDimensions(),s=n.x/2,o=n.y/2,a=[{x:-s,y:-o},{x:s,y:-o},{x:-s,y:o},{x:s,y:o}],h=this._calcDimensionsTransformMatrix(t,e,!1);for(i=0;i\n'),t?t(e.join("")):e.join("")},complexity:function(){return 1}}),i.Line.ATTRIBUTE_NAMES=i.SHARED_ATTRIBUTES.concat("x1 y1 x2 y2".split(" ")),i.Line.fromElement=function(t,e){var n=i.parseAttributes(t,i.Line.ATTRIBUTE_NAMES),s=[n.x1||0,n.y1||0,n.x2||0,n.y2||0];return new i.Line(s,r(n,e))},void(i.Line.fromObject=function(t,e){var r=[t.x1,t.y1,t.x2,t.y2],n=new i.Line(r,t);return e&&e(n),n}))}("undefined"!=typeof exports?exports:this),function(t){"use strict";function e(t){return"radius"in t&&t.radius>=0}var i=t.fabric||(t.fabric={}),r=Math.PI,n=i.util.object.extend;return i.Circle?void i.warn("fabric.Circle is already defined."):(i.Circle=i.util.createClass(i.Object,{type:"circle",radius:0,startAngle:0,endAngle:2*r,initialize:function(t){t=t||{},this.callSuper("initialize",t),this.set("radius",t.radius||0),this.startAngle=t.startAngle||this.startAngle,this.endAngle=t.endAngle||this.endAngle},_set:function(t,e){return this.callSuper("_set",t,e),"radius"===t&&this.setRadius(e),this},toObject:function(t){return n(this.callSuper("toObject",t),{radius:this.get("radius"),startAngle:this.startAngle,endAngle:this.endAngle})},toSVG:function(t){var e=this._createBaseSVGMarkup(),i=0,n=0,s=(this.endAngle-this.startAngle)%(2*r);if(0===s)this.group&&"path-group"===this.group.type&&(i=this.left+this.radius,n=this.top+this.radius),e.push("\n');else{var o=Math.cos(this.startAngle)*this.radius,a=Math.sin(this.startAngle)*this.radius,h=Math.cos(this.endAngle)*this.radius,c=Math.sin(this.endAngle)*this.radius,l=s>r?"1":"0";e.push('\n')}return t?t(e.join("")):e.join("")},_render:function(t,e){t.beginPath(),t.arc(e?this.left+this.radius:0,e?this.top+this.radius:0,this.radius,this.startAngle,this.endAngle,!1),this._renderFill(t),this._renderStroke(t)},getRadiusX:function(){return this.get("radius")*this.get("scaleX")},getRadiusY:function(){return this.get("radius")*this.get("scaleY")},setRadius:function(t){return this.radius=t,this.set("width",2*t).set("height",2*t)},complexity:function(){return 1}}),i.Circle.ATTRIBUTE_NAMES=i.SHARED_ATTRIBUTES.concat("cx cy r".split(" ")),i.Circle.fromElement=function(t,r){r||(r={});var s=i.parseAttributes(t,i.Circle.ATTRIBUTE_NAMES);if(!e(s))throw new Error("value of `r` attribute is required and can not be negative");s.left=s.left||0,s.top=s.top||0;var o=new i.Circle(n(s,r));return o.left-=o.radius,o.top-=o.radius,o},void(i.Circle.fromObject=function(t,e){var r=new i.Circle(t);return e&&e(r),r}))}("undefined"!=typeof exports?exports:this),function(t){"use strict";var e=t.fabric||(t.fabric={});return e.Triangle?void e.warn("fabric.Triangle is already defined"):(e.Triangle=e.util.createClass(e.Object,{type:"triangle",initialize:function(t){t=t||{},this.callSuper("initialize",t),this.set("width",t.width||100).set("height",t.height||100)},_render:function(t){var e=this.width/2,i=this.height/2;t.beginPath(),t.moveTo(-e,i),t.lineTo(0,-i),t.lineTo(e,i),t.closePath(),this._renderFill(t),this._renderStroke(t)},_renderDashedStroke:function(t){var i=this.width/2,r=this.height/2;t.beginPath(),e.util.drawDashedLine(t,-i,r,0,-r,this.strokeDashArray),e.util.drawDashedLine(t,0,-r,i,r,this.strokeDashArray),e.util.drawDashedLine(t,i,r,-i,r,this.strokeDashArray),t.closePath()},toSVG:function(t){var e=this._createBaseSVGMarkup(),i=this.width/2,r=this.height/2,n=[-i+" "+r,"0 "+-r,i+" "+r].join(",");return e.push("'),t?t(e.join("")):e.join("")},complexity:function(){return 1}}),void(e.Triangle.fromObject=function(t,i){var r=new e.Triangle(t);return i&&i(r),r}))}("undefined"!=typeof exports?exports:this),function(t){"use strict";var e=t.fabric||(t.fabric={}),i=2*Math.PI,r=e.util.object.extend;return e.Ellipse?void e.warn("fabric.Ellipse is already defined."):(e.Ellipse=e.util.createClass(e.Object,{type:"ellipse",rx:0,ry:0,initialize:function(t){t=t||{},this.callSuper("initialize",t),this.set("rx",t.rx||0),this.set("ry",t.ry||0)},_set:function(t,e){switch(this.callSuper("_set",t,e),t){case"rx":this.rx=e,this.set("width",2*e);break;case"ry":this.ry=e,this.set("height",2*e)}return this},getRx:function(){return this.get("rx")*this.get("scaleX")},getRy:function(){return this.get("ry")*this.get("scaleY")},toObject:function(t){return r(this.callSuper("toObject",t),{rx:this.get("rx"),ry:this.get("ry")})},toSVG:function(t){var e=this._createBaseSVGMarkup(),i=0,r=0;return this.group&&"path-group"===this.group.type&&(i=this.left+this.rx,r=this.top+this.ry),e.push("\n'),t?t(e.join("")):e.join("")},_render:function(t,e){t.beginPath(),t.save(),t.transform(1,0,0,this.ry/this.rx,0,0),t.arc(e?this.left+this.rx:0,e?(this.top+this.ry)*this.rx/this.ry:0,this.rx,0,i,!1),t.restore(),this._renderFill(t),this._renderStroke(t)},complexity:function(){return 1}}),e.Ellipse.ATTRIBUTE_NAMES=e.SHARED_ATTRIBUTES.concat("cx cy rx ry".split(" ")),e.Ellipse.fromElement=function(t,i){i||(i={});var n=e.parseAttributes(t,e.Ellipse.ATTRIBUTE_NAMES);n.left=n.left||0,n.top=n.top||0;var s=new e.Ellipse(r(n,i));return s.top-=s.ry,s.left-=s.rx,s},void(e.Ellipse.fromObject=function(t,i){var r=new e.Ellipse(t);return i&&i(r),r}))}("undefined"!=typeof exports?exports:this),function(t){"use strict";var e=t.fabric||(t.fabric={}),i=e.util.object.extend;if(e.Rect)return void e.warn("fabric.Rect is already defined");var r=e.Object.prototype.stateProperties.concat();r.push("rx","ry","x","y"),e.Rect=e.util.createClass(e.Object,{stateProperties:r,type:"rect",rx:0,ry:0,strokeDashArray:null,initialize:function(t){t=t||{},this.callSuper("initialize",t),this._initRxRy()},_initRxRy:function(){this.rx&&!this.ry?this.ry=this.rx:this.ry&&!this.rx&&(this.rx=this.ry)},_render:function(t,e){if(1===this.width&&1===this.height)return void t.fillRect(-.5,-.5,1,1);var i=this.rx?Math.min(this.rx,this.width/2):0,r=this.ry?Math.min(this.ry,this.height/2):0,n=this.width,s=this.height,o=e?this.left:-this.width/2,a=e?this.top:-this.height/2,h=0!==i||0!==r,c=.4477152502;t.beginPath(),t.moveTo(o+i,a),t.lineTo(o+n-i,a),h&&t.bezierCurveTo(o+n-c*i,a,o+n,a+c*r,o+n,a+r),t.lineTo(o+n,a+s-r),h&&t.bezierCurveTo(o+n,a+s-c*r,o+n-c*i,a+s,o+n-i,a+s),t.lineTo(o+i,a+s),h&&t.bezierCurveTo(o+c*i,a+s,o,a+s-c*r,o,a+s-r),t.lineTo(o,a+r),h&&t.bezierCurveTo(o,a+c*r,o+c*i,a,o+i,a),t.closePath(),this._renderFill(t),this._renderStroke(t)},_renderDashedStroke:function(t){var i=-this.width/2,r=-this.height/2,n=this.width,s=this.height;t.beginPath(),e.util.drawDashedLine(t,i,r,i+n,r,this.strokeDashArray),e.util.drawDashedLine(t,i+n,r,i+n,r+s,this.strokeDashArray),e.util.drawDashedLine(t,i+n,r+s,i,r+s,this.strokeDashArray),e.util.drawDashedLine(t,i,r+s,i,r,this.strokeDashArray),t.closePath()},toObject:function(t){var e=i(this.callSuper("toObject",t),{rx:this.get("rx")||0,ry:this.get("ry")||0});return this.includeDefaultValues||this._removeDefaultValues(e),e},toSVG:function(t){var e=this._createBaseSVGMarkup(),i=this.left,r=this.top;return this.group&&"path-group"===this.group.type||(i=-this.width/2,r=-this.height/2),e.push("\n'),t?t(e.join("")):e.join("")},complexity:function(){return 1}}),e.Rect.ATTRIBUTE_NAMES=e.SHARED_ATTRIBUTES.concat("x y rx ry width height".split(" ")),e.Rect.fromElement=function(t,r){if(!t)return null;r=r||{};var n=e.parseAttributes(t,e.Rect.ATTRIBUTE_NAMES);n.left=n.left||0,n.top=n.top||0;var s=new e.Rect(i(r?e.util.object.clone(r):{},n));return s.visible=s.visible&&s.width>0&&s.height>0,s},e.Rect.fromObject=function(t,i){var r=new e.Rect(t);return i&&i(r),r}}("undefined"!=typeof exports?exports:this),function(t){"use strict";var e=t.fabric||(t.fabric={});return e.Polyline?void e.warn("fabric.Polyline is already defined"):(e.Polyline=e.util.createClass(e.Object,{type:"polyline",points:null,minX:0,minY:0,initialize:function(t,i){return e.Polygon.prototype.initialize.call(this,t,i)},_calcDimensions:function(){return e.Polygon.prototype._calcDimensions.call(this)},toObject:function(t){return e.Polygon.prototype.toObject.call(this,t)},toSVG:function(t){return e.Polygon.prototype.toSVG.call(this,t)},_render:function(t,i){e.Polygon.prototype.commonRender.call(this,t,i)&&(this._renderFill(t),this._renderStroke(t))},_renderDashedStroke:function(t){var i,r;t.beginPath();for(var n=0,s=this.points.length;n\n'),t?t(r.join("")):r.join("")},_render:function(t,e){this.commonRender(t,e)&&(this._renderFill(t),(this.stroke||this.strokeDashArray)&&(t.closePath(),this._renderStroke(t)))},commonRender:function(t,e){var i,r=this.points.length;if(!r||isNaN(this.points[r-1].y))return!1;e||t.translate(-this.pathOffset.x,-this.pathOffset.y),t.beginPath(),t.moveTo(this.points[0].x,this.points[0].y);for(var n=0;n"},toObject:function(t){var e=n(this.callSuper("toObject",t),{path:this.path.map(function(t){return t.slice()}),pathOffset:this.pathOffset});return this.sourcePath&&(e.sourcePath=this.sourcePath),this.transformMatrix&&(e.transformMatrix=this.transformMatrix),e},toDatalessObject:function(t){var e=this.toObject(t);return this.sourcePath&&(e.path=this.sourcePath),delete e.sourcePath,e},toSVG:function(t){for(var e=[],i=this._createBaseSVGMarkup(),r="",n=0,s=this.path.length;n\n"),t?t(i.join("")):i.join("")},complexity:function(){return this.path.length},_parsePath:function(){for(var t,e,i,r,n,s=[],o=[],c=/([-+]?((\d+\.\d+)|((\d+)|(\.\d+)))(?:e[-+]?\d+)?)/gi,l=0,u=this.path.length;lp)for(var b=1,m=n.length;b\n");for(var s=0,o=e.length;s\n"),t?t(n.join("")):n.join("")},toString:function(){return"#"},isSameColor:function(){var t=this.getObjects()[0].get("fill")||"";return"string"==typeof t&&(t=t.toLowerCase(),this.getObjects().every(function(e){var i=e.get("fill")||"";return"string"==typeof i&&i.toLowerCase()===t}))},complexity:function(){return this.paths.reduce(function(t,e){return t+(e&&e.complexity?e.complexity():0)},0)},getObjects:function(){return this.paths}}),e.PathGroup.fromObject=function(t,i){"string"==typeof t.paths?e.loadSVGFromURL(t.paths,function(r){var n=t.paths;delete t.paths;var s=e.util.groupSVGElements(r,t,n);i(s)}):e.util.enlivenObjects(t.paths,function(r){delete t.paths,i(new e.PathGroup(r,t))})},void(e.PathGroup.async=!0))}("undefined"!=typeof exports?exports:this),function(t){"use strict";var e=t.fabric||(t.fabric={}),i=e.util.object.extend,r=e.util.array.min,n=e.util.array.max,s=e.util.array.invoke;if(!e.Group){var o={lockMovementX:!0,lockMovementY:!0,lockRotation:!0,lockScalingX:!0,lockScalingY:!0,lockUniScaling:!0};e.Group=e.util.createClass(e.Object,e.Collection,{type:"group",strokeWidth:0,subTargetCheck:!1,initialize:function(t,e,i){e=e||{},this._objects=[],i&&this.callSuper("initialize",e),this._objects=t||[];for(var r=this._objects.length;r--;)this._objects[r].group=this;this.originalState={},e.originX&&(this.originX=e.originX),e.originY&&(this.originY=e.originY),i?this._updateObjectsCoords(!0):(this._calcBounds(),this._updateObjectsCoords(),this.callSuper("initialize",e)),this.setCoords(),this.saveCoords()},_updateObjectsCoords:function(t){for(var e=this._objects.length;e--;)this._updateObjectCoords(this._objects[e],t)},_updateObjectCoords:function(t,e){if(t.__origHasControls=t.hasControls,t.hasControls=!1,!e){var i=t.getLeft(),r=t.getTop(),n=this.getCenterPoint();t.set({originalLeft:i,originalTop:r,left:i-n.x,top:r-n.y}),t.setCoords()}},toString:function(){return"#"},addWithUpdate:function(t){return this._restoreObjectsState(),e.util.resetObjectTransform(this),t&&(this._objects.push(t),t.group=this,t._set("canvas",this.canvas)),this.forEachObject(this._setObjectActive,this),this._calcBounds(),this._updateObjectsCoords(),this},_setObjectActive:function(t){t.set("active",!0),t.group=this},removeWithUpdate:function(t){return this._restoreObjectsState(),e.util.resetObjectTransform(this),this.forEachObject(this._setObjectActive,this),this.remove(t),this._calcBounds(),this._updateObjectsCoords(),this},_onObjectAdded:function(t){t.group=this,t._set("canvas",this.canvas)},_onObjectRemoved:function(t){delete t.group,t.set("active",!1)},delegatedProperties:{fill:!0,stroke:!0,strokeWidth:!0,fontFamily:!0,fontWeight:!0,fontSize:!0,fontStyle:!0,lineHeight:!0,textDecoration:!0,textAlign:!0,backgroundColor:!0},_set:function(t,e){var i=this._objects.length;if(this.delegatedProperties[t]||"canvas"===t)for(;i--;)this._objects[i].set(t,e);else for(;i--;)this._objects[i].setOnGroup(t,e);this.callSuper("_set",t,e)},toObject:function(t){return i(this.callSuper("toObject",t),{objects:s(this._objects,"toObject",t)})},render:function(t){if(this.visible){t.save(),this.transformMatrix&&t.transform.apply(t,this.transformMatrix),this.transform(t),this._setShadow(t),this.clipTo&&e.util.clipContext(this,t),this._transformDone=!0;for(var i=0,r=this._objects.length;i\n');for(var i=0,r=this._objects.length;i\n"),t?t(e.join("")):e.join("")},get:function(t){if(t in o){if(this[t])return this[t];for(var e=0,i=this._objects.length;e\n',"\n"),this.stroke||this.strokeDashArray){var o=this.fill;this.fill=null,e.push("\n'),this.fill=o}return e.push("
\n"),t?t(e.join("")):e.join("")},getSrc:function(t){var e=t?this._element:this._originalElement;return e?fabric.isLikelyNode?e._src:e.src:this.src||""},setSrc:function(t,e,i){fabric.util.loadImage(t,function(t){return this.setElement(t,e,i)},this,i&&i.crossOrigin)},toString:function(){return'#'},applyFilters:function(t,e,i,r){if(e=e||this.filters,i=i||this._originalElement){var n,s,o=fabric.util.createImage(),a=this.canvas?this.canvas.getRetinaScaling():fabric.devicePixelRatio,h=this.minimumScaleTrigger/a,c=this;if(0===e.length)return this._element=i,t&&t(this),i;var l=fabric.util.createCanvasElement();return l.width=i.width,l.height=i.height,l.getContext("2d").drawImage(i,0,0,i.width,i.height),e.forEach(function(t){t&&(r?(n=c.scaleX0?90*Math.round((t-1)/90):90*Math.round(t/90)},straighten:function(){return this.setAngle(this._getAngleValueForStraighten()),this},fxStraighten:function(t){t=t||{};var e=function(){},i=t.onComplete||e,r=t.onChange||e,n=this;return fabric.util.animate({startValue:this.get("angle"),endValue:this._getAngleValueForStraighten(),duration:this.FX_DURATION,onChange:function(t){n.setAngle(t),r()},onComplete:function(){n.setCoords(),i()},onStart:function(){n.set("active",!1)}}),this}}),fabric.util.object.extend(fabric.StaticCanvas.prototype,{straightenObject:function(t){return t.straighten(),this.renderAll(),this},fxStraightenObject:function(t){return t.fxStraighten({onChange:this.renderAll.bind(this)}),this}}),fabric.Image.filters=fabric.Image.filters||{},fabric.Image.filters.BaseFilter=fabric.util.createClass({type:"BaseFilter",initialize:function(t){t&&this.setOptions(t)},setOptions:function(t){for(var e in t)this[e]=t[e]},toObject:function(){return{type:this.type}},toJSON:function(){return this.toObject()}}),function(t){"use strict";var e=t.fabric||(t.fabric={}),i=e.util.object.extend,r=e.Image.filters,n=e.util.createClass;r.Brightness=n(r.BaseFilter,{type:"Brightness",initialize:function(t){t=t||{},this.brightness=t.brightness||0},applyTo:function(t){for(var e=t.getContext("2d"),i=e.getImageData(0,0,t.width,t.height),r=i.data,n=this.brightness,s=0,o=r.length;sb||o<0||o>v||(h=4*(a*v+o),c=l[C*d+w],e+=p[h]*c,i+=p[h+1]*c,r+=p[h+2]*c,n+=p[h+3]*c);y[s]=e,y[s+1]=i,y[s+2]=r,y[s+3]=n+_*(255-n)}u.putImageData(m,0,0)},toObject:function(){return i(this.callSuper("toObject"),{opaque:this.opaque,matrix:this.matrix})}}),e.Image.filters.Convolute.fromObject=function(t){return new e.Image.filters.Convolute(t)}}("undefined"!=typeof exports?exports:this),function(t){"use strict";var e=t.fabric||(t.fabric={}),i=e.util.object.extend,r=e.Image.filters,n=e.util.createClass;r.GradientTransparency=n(r.BaseFilter,{type:"GradientTransparency",initialize:function(t){t=t||{},this.threshold=t.threshold||100},applyTo:function(t){for(var e=t.getContext("2d"),i=e.getImageData(0,0,t.width,t.height),r=i.data,n=this.threshold,s=r.length,o=0,a=r.length;o-1?t.channel:0},applyTo:function(t){if(this.mask){var i,r=t.getContext("2d"),n=r.getImageData(0,0,t.width,t.height),s=n.data,o=this.mask.getElement(),a=e.util.createCanvasElement(),h=this.channel,c=n.width*n.height*4;a.width=t.width,a.height=t.height,a.getContext("2d").drawImage(o,0,0,t.width,t.height);var l=a.getContext("2d").getImageData(0,0,t.width,t.height),u=l.data;for(i=0;ic&&i>c&&r>c&&l(e-i)i&&(l=2,f=-1),a>n&&(u=2,d=-1),h=c.getImageData(0,0,i,n),t.width=o(s,i),t.height=o(a,n),c.putImageData(h,0,0);!g||!p;)i=v,n=b,s*ft)return 0;if(e*=Math.PI,s(e)<1e-16)return 1;var i=e/t;return h(e)*h(i)/e/i}}function f(t){var h,c,u,d,g,j,M,A,P,I,D;for(T.x=(t+.5)*y,k.x=r(T.x),h=0;h=e)){I=r(1e3*s(c-T.x)),O[I]||(O[I]={});for(var E=k.y-w;E<=k.y+w;E++)E<0||E>=o||(D=r(1e3*s(E-T.y)),O[I][D]||(O[I][D]=m(n(i(I*x,2)+i(D*S,2))/1e3)),u=O[I][D],u>0&&(d=4*(E*e+c),g+=u,j+=u*v[d],M+=u*v[d+1],A+=u*v[d+2],P+=u*v[d+3]))}d=4*(h*a+t),b[d]=j/g,b[d+1]=M/g,b[d+2]=A/g,b[d+3]=P/g}return++t1&&L<-1||(x=2*L*L*L-3*L*L+1,x>0&&(E=4*(D+M*e),k+=x*p[E+3],C+=x,p[E+3]<255&&(x=x*p[E+3]/250),w+=x*p[E],O+=x*p[E+1],T+=x*p[E+2],S+=x))}b[_]=w/S,b[_+1]=O/S,b[_+2]=T/S,b[_+3]=k/C}return v},toObject:function(){return{type:this.type,scaleX:this.scaleX,scaleY:this.scaleY,resizeType:this.resizeType,lanczosLobes:this.lanczosLobes}}}),e.Image.filters.Resize.fromObject=function(t){return new e.Image.filters.Resize(t)}}("undefined"!=typeof exports?exports:this),function(t){"use strict";var e=t.fabric||(t.fabric={}),i=e.util.object.extend,r=e.Image.filters,n=e.util.createClass;r.ColorMatrix=n(r.BaseFilter,{type:"ColorMatrix",initialize:function(t){t||(t={}),this.matrix=t.matrix||[1,0,0,0,0,0,1,0,0,0,0,0,1,0,0,0,0,0,1,0]},applyTo:function(t){var e,i,r,n,s,o=t.getContext("2d"),a=o.getImageData(0,0,t.width,t.height),h=a.data,c=h.length,l=this.matrix;for(e=0;e'},_render:function(t){this.clipTo&&e.util.clipContext(this,t),this._setOpacity(t),this._setShadow(t),this._setupCompositeOperation(t),this._renderTextBackground(t),this._setStrokeStyles(t),this._setFillStyles(t),this._renderText(t),this._renderTextDecoration(t),this.clipTo&&t.restore()},_renderText:function(t){this._renderTextFill(t),this._renderTextStroke(t)},_setTextStyles:function(t){t.textBaseline="alphabetic",t.font=this._getFontDeclaration()},_getTextHeight:function(){return this._getHeightOfSingleLine()+(this._textLines.length-1)*this._getHeightOfLine()},_getTextWidth:function(t){for(var e=this._getLineWidth(t,0),i=1,r=this._textLines.length;ie&&(e=n)}return e},_getNonTransformedDimensions:function(){return{x:this.width,y:this.height}},_renderChars:function(t,e,i,r,n){var s,o,a=t.slice(0,-4);if(this[a].toLive){var h=-this.width/2+this[a].offsetX||0,c=-this.height/2+this[a].offsetY||0;e.save(),e.translate(h,c),r-=h,n-=c}if(0!==this.charSpacing){var l=this._getWidthOfCharSpacing();i=i.split("");for(var u=0,f=i.length;u0?o:0}else e[t](i,r,n);this[a].toLive&&e.restore()},_renderTextLine:function(t,e,i,r,n,s){n-=this.fontSize*this._fontSizeFraction;var o=this._getLineWidth(e,s);if("justify"!==this.textAlign||this.width0?u/f:0,g=0,p=0,v=h.length;p0?n:0},_getLeftOffset:function(){return-this.width/2},_getTopOffset:function(){return-this.height/2},isEmptyStyles:function(){return!0},_renderTextCommon:function(t,e){for(var i=0,r=this._getLeftOffset(),n=this._getTopOffset(),s=0,o=this._textLines.length;s0&&(r=this._getLineLeftOffset(i),t.fillRect(this._getLeftOffset()+r,this._getTopOffset()+n,i,e/this.lineHeight)),n+=e;this._removeShadow(t)}},_getLineLeftOffset:function(t){return"center"===this.textAlign?(this.width-t)/2:"right"===this.textAlign?this.width-t:0},_clearCache:function(){this.__lineWidths=[],this.__lineHeights=[]},_shouldClearCache:function(){var t=!1;if(this._forceClearCache)return this._forceClearCache=!1,!0;for(var e in this._dimensionAffectingProps)this["__"+e]!==this[e]&&(this["__"+e]=this[e],t=!0);return t},_getLineWidth:function(t,e){if(this.__lineWidths[e])return this.__lineWidths[e]===-1?this.width:this.__lineWidths[e];var i,r,n=this._textLines[e];return i=""===n?0:this._measureLine(t,e),this.__lineWidths[e]=i,i&&"justify"===this.textAlign&&(r=n.split(/\s+/),r.length>1&&(this.__lineWidths[e]=-1)),i},_getWidthOfCharSpacing:function(){return 0!==this.charSpacing?this.fontSize*this.charSpacing/1e3:0},_measureLine:function(t,e){var i,r,n=this._textLines[e],s=t.measureText(n).width,o=0;return 0!==this.charSpacing&&(i=n.split("").length,o=(i-1)*this._getWidthOfCharSpacing()),r=s+o,r>0?r:0},_renderTextDecoration:function(t){function e(e){var n,s,o,a,h,c,l,u=0;for(n=0,s=r._textLines.length;n-1&&n.push(.85),this.textDecoration.indexOf("line-through")>-1&&n.push(.43),this.textDecoration.indexOf("overline")>-1&&n.push(-.12),n.length>0&&e(n)}},_getFontDeclaration:function(){return[e.isLikelyNode?this.fontWeight:this.fontStyle,e.isLikelyNode?this.fontStyle:this.fontWeight,this.fontSize+"px",e.isLikelyNode?'"'+this.fontFamily+'"':this.fontFamily].join(" ")},render:function(t,e){this.visible&&(t.save(),this._setTextStyles(t),this._shouldClearCache()&&this._initDimensions(t),this.drawSelectionBackground(t),e||this.transform(t),this.transformMatrix&&t.transform.apply(t,this.transformMatrix),this.group&&"path-group"===this.group.type&&t.translate(this.left,this.top),this._render(t),t.restore())},_splitTextIntoLines:function(){return this.text.split(this._reNewline)},toObject:function(t){var e=i(this.callSuper("toObject",t),{text:this.text,fontSize:this.fontSize,fontWeight:this.fontWeight,fontFamily:this.fontFamily,fontStyle:this.fontStyle,lineHeight:this.lineHeight,textDecoration:this.textDecoration,textAlign:this.textAlign,textBackgroundColor:this.textBackgroundColor,charSpacing:this.charSpacing});return this.includeDefaultValues||this._removeDefaultValues(e),e},toSVG:function(t){this.ctx||(this.ctx=e.util.createCanvasElement().getContext("2d"));var i=this._createBaseSVGMarkup(),r=this._getSVGLeftTopOffsets(this.ctx),n=this._getSVGTextAndBg(r.textTop,r.textLeft);return this._wrapSVGTextAndBg(i,n),t?t(i.join("")):i.join("")},_getSVGLeftTopOffsets:function(t){var e=this._getHeightOfLine(t,0),i=-this.width/2,r=0;return{textLeft:i+(this.group&&"path-group"===this.group.type?this.left:0),textTop:r+(this.group&&"path-group"===this.group.type?-this.top:0),lineTop:e}},_wrapSVGTextAndBg:function(t,e){var i=!0,r=this.getSvgFilter(),n=""===r?"":' style="'+r+'"';t.push("\t\n",e.textBgRects.join(""),"\t\t\n',e.textSpans.join(""),"\t\t\n","\t\n")},_getSVGTextAndBg:function(t,e){var i=[],r=[],n=0;this._setSVGBg(r);for(var s=0,o=this._textLines.length;s",e.util.string.escapeXml(this._textLines[t]),"\n")},_setSVGTextLineJustifed:function(t,i,r,o){var a=e.util.createCanvasElement().getContext("2d");this._setTextStyles(a);var h,c,l=this._textLines[t],u=l.split(/\s+/),f=this._getWidthOfWords(a,u.join("")),d=this.width-f,g=u.length-1,p=g>0?d/g:0,v=this._getFillAttributes(this.fill);for(o+=this._getLineLeftOffset(this._getLineWidth(a,t)),t=0,c=u.length;t",e.util.string.escapeXml(h),"\n"),o+=this._getWidthOfWords(a,h)+p},_setSVGTextLineBg:function(t,e,i,r,o){t.push("\t\t\n')},_setSVGBg:function(t){this.backgroundColor&&t.push("\t\t\n')},_getFillAttributes:function(t){var i=t&&"string"==typeof t?new e.Color(t):"";return i&&i.getSource()&&1!==i.getAlpha()?'opacity="'+i.getAlpha()+'" fill="'+i.setAlpha(1).toRgb()+'"':'fill="'+t+'"'},_set:function(t,e){this.callSuper("_set",t,e),t in this._dimensionAffectingProps&&(this._initDimensions(),this.setCoords())},complexity:function(){return 1}}),e.Text.ATTRIBUTE_NAMES=e.SHARED_ATTRIBUTES.concat("x y dx dy font-family font-style font-weight font-size text-decoration text-anchor".split(" ")),e.Text.DEFAULT_SVG_FONT_SIZE=16,e.Text.fromElement=function(t,i){if(!t)return null;var r=e.parseAttributes(t,e.Text.ATTRIBUTE_NAMES);i=e.util.object.extend(i?e.util.object.clone(i):{},r),i.top=i.top||0,i.left=i.left||0,"dx"in r&&(i.left+=r.dx),"dy"in r&&(i.top+=r.dy),"fontSize"in i||(i.fontSize=e.Text.DEFAULT_SVG_FONT_SIZE),i.originX||(i.originX="left");var n="";"textContent"in t?n=t.textContent:"firstChild"in t&&null!==t.firstChild&&"data"in t.firstChild&&null!==t.firstChild.data&&(n=t.firstChild.data),n=n.replace(/^\s+|\s+$|\n+/g,"").replace(/\s+/g," ");var s=new e.Text(n,i),o=s.getHeight()/s.height,a=(s.height+s.strokeWidth)*s.lineHeight-s.height,h=a*o,c=s.getHeight()+h,l=0;return"left"===s.originX&&(l=s.getWidth()/2),"right"===s.originX&&(l=-s.getWidth()/2),s.set({left:s.getLeft()+l,top:s.getTop()-c/2+s.fontSize*(.18+s._fontSizeFraction)/s.lineHeight}),s},e.Text.fromObject=function(t,i){var n=new e.Text(t.text,r(t));return i&&i(n),n},e.util.createAccessors(e.Text)}("undefined"!=typeof exports?exports:this),function(){var t=fabric.util.object.clone;fabric.IText=fabric.util.createClass(fabric.Text,fabric.Observable,{type:"i-text",selectionStart:0,selectionEnd:0,selectionColor:"rgba(17,119,255,0.3)",isEditing:!1,editable:!0,editingBorderColor:"rgba(102,153,255,0.25)",cursorWidth:2,cursorColor:"#333",cursorDelay:1e3,cursorDuration:600,styles:null,caching:!0,_reSpace:/\s|\n/,_currentCursorOpacity:0,_selectionDirection:null,_abortCursorAnimation:!1,__widthOfSpace:[],initialize:function(t,e){this.styles=e?e.styles||{}:{},this.callSuper("initialize",t,e),this.initBehavior()},_clearCache:function(){this.callSuper("_clearCache"),this.__widthOfSpace=[]},isEmptyStyles:function(){if(!this.styles)return!0;var t=this.styles;for(var e in t)for(var i in t[e])for(var r in t[e][i])return!1;return!0},setSelectionStart:function(t){t=Math.max(t,0),this._updateAndFire("selectionStart",t)},setSelectionEnd:function(t){t=Math.min(t,this.text.length),this._updateAndFire("selectionEnd",t)},_updateAndFire:function(t,e){this[t]!==e&&(this._fireSelectionChanged(),this[t]=e),this._updateTextarea()},_fireSelectionChanged:function(){this.fire("selection:changed"),this.canvas&&this.canvas.fire("text:selection:changed",{target:this})},getSelectionStyles:function(t,e){if(2===arguments.length){for(var i=[],r=t;r0?a:0,lineLeft:r},this.cursorOffsetCache=i,this.cursorOffsetCache},renderCursor:function(t,e){var i=this.get2DCursorLocation(),r=i.lineIndex,n=i.charIndex,s=this.getCurrentCharFontSize(r,n),o=0===r&&0===n?this._getLineLeftOffset(this._getLineWidth(e,r)):t.leftOffset,a=this.scaleX*this.canvas.getZoom(),h=this.cursorWidth/a;e.fillStyle=this.getCurrentCharColor(r,n),e.globalAlpha=this.__isMousedown?1:this._currentCursorOpacity,e.fillRect(t.left+o-h/2,t.top+t.topOffset,h,s)},renderSelection:function(t,e,i){i.fillStyle=this.selectionColor;for(var r=this.get2DCursorLocation(this.selectionStart),n=this.get2DCursorLocation(this.selectionEnd),s=r.lineIndex,o=n.lineIndex,a=s;a<=o;a++){var h=this._getLineLeftOffset(this._getLineWidth(i,a))||0,c=this._getHeightOfLine(this.ctx,a),l=0,u=0,f=this._textLines[a];if(a===s){for(var d=0,g=f.length;d=r.charIndex&&(a!==o||ds&&a1)&&(c/=this.lineHeight),i.fillRect(e.left+h,e.top+e.topOffset,u>0?u:0,c),e.topOffset+=l}},_renderChars:function(t,e,i,r,n,s,o){if(this.isEmptyStyles())return this._renderCharsFast(t,e,i,r,n);o=o||0;var a,h,c=this._getHeightOfLine(e,s),l="";e.save(),n-=c/this.lineHeight*this._fontSizeFraction;for(var u=o,f=i.length+o;u<=f;u++)a=a||this.getCurrentCharStyle(s,u),h=this.getCurrentCharStyle(s,u+1),(this._hasStyleChanged(a,h)||u===f)&&(this._renderChar(t,e,s,u-1,l,r,n,c),l="",a=h),l+=i[u-o];e.restore()},_renderCharsFast:function(t,e,i,r,n){"fillText"===t&&this.fill&&this.callSuper("_renderChars",t,e,i,r,n),"strokeText"===t&&(this.stroke&&this.strokeWidth>0||this.skipFillStrokeCheck)&&this.callSuper("_renderChars",t,e,i,r,n)},_renderChar:function(t,e,i,r,n,s,o,a){var h,c,l,u,f,d,g,p,v,b=this._getStyleDeclaration(i,r);if(b?(c=this._getHeightOfChar(e,n,i,r),u=b.stroke,l=b.fill,d=b.textDecoration):c=this.fontSize,u=(u||this.stroke)&&"strokeText"===t,l=(l||this.fill)&&"fillText"===t,b&&e.save(),h=this._applyCharStylesGetWidth(e,n,i,r,b||null),d=d||this.textDecoration,b&&b.textBackgroundColor&&this._removeShadow(e),0!==this.charSpacing){p=this._getWidthOfCharSpacing(),g=n.split(""),h=0;for(var m,y=0,_=g.length;y<_;y++)m=g[y],l&&e.fillText(m,s+h,o),u&&e.strokeText(m,s+h,o),v=e.measureText(m).width+p,h+=v>0?v:0}else l&&e.fillText(n,s,o),u&&e.strokeText(n,s,o);(d||""!==d)&&(f=this._fontSizeFraction*a/this.lineHeight,this._renderCharDecoration(e,d,s,o,f,h,c)),b&&e.restore(),e.translate(h,0)},_hasStyleChanged:function(t,e){return t.fill!==e.fill||t.fontSize!==e.fontSize||t.textBackgroundColor!==e.textBackgroundColor||t.textDecoration!==e.textDecoration||t.fontFamily!==e.fontFamily||t.fontWeight!==e.fontWeight||t.fontStyle!==e.fontStyle||t.stroke!==e.stroke||t.strokeWidth!==e.strokeWidth},_renderCharDecoration:function(t,e,i,r,n,s,o){if(e){var a,h,c=o/15,l={underline:r+o/10,"line-through":r-o*(this._fontSizeFraction+this._fontSizeMult-1)+c,overline:r-(this._fontSizeMult-this._fontSizeFraction)*o},u=["underline","line-through","overline"];for(a=0;a-1&&t.fillRect(i,l[h],s,c)}},_renderTextLine:function(t,e,i,r,n,s){this.isEmptyStyles()||(n+=this.fontSize*(this._fontSizeFraction+.03)),this.callSuper("_renderTextLine",t,e,i,r,n,s)},_renderTextDecoration:function(t){if(this.isEmptyStyles())return this.callSuper("_renderTextDecoration",t)},_renderTextLinesBackground:function(t){this.callSuper("_renderTextLinesBackground",t);for(var e,i,r,n,s,o,a=0,h=this._getLeftOffset(),c=this._getTopOffset(),l=0,u=this._textLines.length;l0?n:0},_getHeightOfChar:function(t,e,i){var r=this._getStyleDeclaration(e,i);return r&&r.fontSize?r.fontSize:this.fontSize},_getWidthOfCharsAt:function(t,e,i){var r,n,s=0;for(r=0;r0?i:0},_getWidthOfSpace:function(t,e){if(this.__widthOfSpace[e])return this.__widthOfSpace[e];var i=this._textLines[e],r=this._getWidthOfWords(t,i,e,0),n=this.width-r,s=i.length-i.replace(this._reSpacesAndTabs,"").length,o=Math.max(n/s,t.measureText(" ").width);return this.__widthOfSpace[e]=o,o},_getWidthOfWords:function(t,e,i,r){for(var n=0,s=0;sr&&(r=o)}return this.__lineHeights[e]=r*this.lineHeight*this._fontSizeMult,this.__lineHeights[e]},_getTextHeight:function(t){for(var e,i=0,r=0,n=this._textLines.length;r-1;)e++,i--;return t-e},findWordBoundaryRight:function(t){var e=0,i=t;if(this._reSpace.test(this.text.charAt(i)))for(;this._reSpace.test(this.text.charAt(i));)e++,i++;for(;/\S/.test(this.text.charAt(i))&&i-1;)e++,i--;return t-e},findLineBoundaryRight:function(t){for(var e=0,i=t;!/\n/.test(this.text.charAt(i))&&i0&&ithis.__selectionStartOnMouseDown?(this.selectionStart=this.__selectionStartOnMouseDown,this.selectionEnd=e):(this.selectionStart=e,this.selectionEnd=this.__selectionStartOnMouseDown),this.selectionStart===i&&this.selectionEnd===r||(this._fireSelectionChanged(),this._updateTextarea(),this.renderCursorOrSelection()))}},_setEditingProps:function(){this.hoverCursor="text",this.canvas&&(this.canvas.defaultCursor=this.canvas.moveCursor="text"),this.borderColor=this.editingBorderColor,this.hasControls=this.selectable=!1,this.lockMovementX=this.lockMovementY=!0},_updateTextarea:function(){if(this.hiddenTextarea&&!this.inCompositionMode&&(this.cursorOffsetCache={},this.hiddenTextarea.value=this.text,this.hiddenTextarea.selectionStart=this.selectionStart,this.hiddenTextarea.selectionEnd=this.selectionEnd,this.selectionStart===this.selectionEnd)){var t=this._calcTextareaPosition();this.hiddenTextarea.style.left=t.left,this.hiddenTextarea.style.top=t.top,this.hiddenTextarea.style.fontSize=t.fontSize}},_calcTextareaPosition:function(){if(!this.canvas)return{x:1,y:1};var t=this.text.split(""),e=this._getCursorBoundaries(t,"cursor"),i=this.get2DCursorLocation(),r=i.lineIndex,n=i.charIndex,s=this.getCurrentCharFontSize(r,n),o=0===r&&0===n?this._getLineLeftOffset(this._getLineWidth(this.ctx,r)):e.leftOffset,a=this.calcTransformMatrix(),h={x:e.left+o,y:e.top+e.topOffset+s},c=this.canvas.upperCanvasEl,l=c.width-s,u=c.height-s;return h=fabric.util.transformPoint(h,a),h=fabric.util.transformPoint(h,this.canvas.viewportTransform),h.x<0&&(h.x=0),h.x>l&&(h.x=l),h.y<0&&(h.y=0),h.y>u&&(h.y=u),h.x+=this.canvas._offset.left,h.y+=this.canvas._offset.top,{left:h.x+"px",top:h.y+"px",fontSize:s}},_saveEditingProps:function(){this._savedProps={hasControls:this.hasControls,borderColor:this.borderColor,lockMovementX:this.lockMovementX,lockMovementY:this.lockMovementY,hoverCursor:this.hoverCursor,defaultCursor:this.canvas&&this.canvas.defaultCursor,moveCursor:this.canvas&&this.canvas.moveCursor +}},_restoreEditingProps:function(){this._savedProps&&(this.hoverCursor=this._savedProps.overCursor,this.hasControls=this._savedProps.hasControls,this.borderColor=this._savedProps.borderColor,this.lockMovementX=this._savedProps.lockMovementX,this.lockMovementY=this._savedProps.lockMovementY,this.canvas&&(this.canvas.defaultCursor=this._savedProps.defaultCursor,this.canvas.moveCursor=this._savedProps.moveCursor))},exitEditing:function(){var t=this._textBeforeEdit!==this.text;return this.selected=!1,this.isEditing=!1,this.selectable=!0,this.selectionEnd=this.selectionStart,this.hiddenTextarea&&this.canvas&&this.hiddenTextarea.parentNode.removeChild(this.hiddenTextarea),this.hiddenTextarea=null,this.abortCursorAnimation(),this._restoreEditingProps(),this._currentCursorOpacity=0,this.fire("editing:exited"),t&&this.fire("modified"),this.canvas&&(this.canvas.off("mouse:move",this.mouseMoveHandler),this.canvas.fire("text:editing:exited",{target:this}),t&&this.canvas.fire("object:modified",{target:this})),this},_removeExtraneousStyles:function(){for(var t in this.styles)this._textLines[t]||delete this.styles[t]},_removeCharsFromTo:function(t,e){for(;e!==t;)this._removeSingleCharAndStyle(t+1),e--;this.selectionStart=t,this.selectionEnd=t},_removeSingleCharAndStyle:function(t){var e="\n"===this.text[t-1],i=e?t:t-1;this.removeStyleObject(e,i),this.text=this.text.slice(0,t-1)+this.text.slice(t),this._textLines=this._splitTextIntoLines()},insertChars:function(t,e){var i;if(this.selectionEnd-this.selectionStart>1&&this._removeCharsFromTo(this.selectionStart,this.selectionEnd),!e&&this.isEmptyStyles())return void this.insertChar(t,!1);for(var r=0,n=t.length;r=i&&(s[parseInt(o,10)-i]=this.styles[e][o],delete this.styles[e][o]);this.styles[e+1]=s}this._forceClearCache=!0},insertCharStyleObject:function(e,i,r){var n=this.styles[e],s=t(n);0!==i||r||(i=1);for(var o in s){var a=parseInt(o,10);a>=i&&(n[a+1]=s[a],s[a-1]||delete n[a])}this.styles[e][i]=r||t(n[i-1]),this._forceClearCache=!0},insertStyleObjects:function(t,e,i){var r=this.get2DCursorLocation(),n=r.lineIndex,s=r.charIndex;this._getLineStyle(n)||this._setLineStyle(n,{}),"\n"===t?this.insertNewlineStyleObject(n,s,e):this.insertCharStyleObject(n,s,i)},shiftLineStyles:function(e,i){var r=t(this.styles);for(var n in this.styles){var s=parseInt(n,10);s>e&&(this.styles[s+i]=r[s],r[s-i]||delete this.styles[s])}},removeStyleObject:function(t,e){var i=this.get2DCursorLocation(e),r=i.lineIndex,n=i.charIndex;this._removeStyleObject(t,i,r,n)},_getTextOnPreviousLine:function(t){return this._textLines[t-1]},_removeStyleObject:function(e,i,r,n){if(e){var s=this._getTextOnPreviousLine(i.lineIndex),o=s?s.length:0;this.styles[r-1]||(this.styles[r-1]={});for(n in this.styles[r])this.styles[r-1][parseInt(n,10)+o]=this.styles[r][n];this.shiftLineStyles(i.lineIndex,-1)}else{var a=this.styles[r];a&&delete a[n];var h=t(a);for(var c in h){var l=parseInt(c,10);l>=n&&0!==l&&(a[l-1]=h[l],delete a[l])}}},insertNewline:function(){this.insertChars("\n")},setSelectionStartEndWithShift:function(t,e,i){i<=t?(e===t?this._selectionDirection="left":"right"===this._selectionDirection&&(this._selectionDirection="left",this.selectionEnd=t),this.selectionStart=i):i>t&&it?this.selectionStart=t:this.selectionStart<0&&(this.selectionStart=0),this.selectionEnd>t?this.selectionEnd=t:this.selectionEnd<0&&(this.selectionEnd=0)}})}(),fabric.util.object.extend(fabric.IText.prototype,{initDoubleClickSimulation:function(){this.__lastClickTime=+new Date,this.__lastLastClickTime=+new Date,this.__lastPointer={},this.on("mousedown",this.onMouseDown.bind(this))},onMouseDown:function(t){this.__newClickTime=+new Date;var e=this.canvas.getPointer(t.e);this.isTripleClick(e)?(this.fire("tripleclick",t),this._stopEvent(t.e)):this.isDoubleClick(e)&&(this.fire("dblclick",t),this._stopEvent(t.e)),this.__lastLastClickTime=this.__lastClickTime,this.__lastClickTime=this.__newClickTime,this.__lastPointer=e,this.__lastIsEditing=this.isEditing,this.__lastSelected=this.selected},isDoubleClick:function(t){return this.__newClickTime-this.__lastClickTime<500&&this.__lastPointer.x===t.x&&this.__lastPointer.y===t.y&&this.__lastIsEditing},isTripleClick:function(t){return this.__newClickTime-this.__lastClickTime<500&&this.__lastClickTime-this.__lastLastClickTime<500&&this.__lastPointer.x===t.x&&this.__lastPointer.y===t.y},_stopEvent:function(t){t.preventDefault&&t.preventDefault(),t.stopPropagation&&t.stopPropagation()},initCursorSelectionHandlers:function(){this.initSelectedHandler(),this.initMousedownHandler(),this.initMouseupHandler(),this.initClicks()},initClicks:function(){this.on("dblclick",function(t){this.selectWord(this.getSelectionStartFromPointer(t.e))}),this.on("tripleclick",function(t){this.selectLine(this.getSelectionStartFromPointer(t.e))})},initMousedownHandler:function(){this.on("mousedown",function(t){if(this.editable){var e=this.canvas.getPointer(t.e);this.__mousedownX=e.x,this.__mousedownY=e.y,this.__isMousedown=!0,this.selected&&this.setCursorByClick(t.e),this.isEditing&&(this.__selectionStartOnMouseDown=this.selectionStart,this.selectionStart===this.selectionEnd&&this.abortCursorAnimation(),this.renderCursorOrSelection())}})},_isObjectMoved:function(t){var e=this.canvas.getPointer(t);return this.__mousedownX!==e.x||this.__mousedownY!==e.y},initMouseupHandler:function(){this.on("mouseup",function(t){this.__isMousedown=!1,this.editable&&!this._isObjectMoved(t.e)&&(this.__lastSelected&&!this.__corner&&(this.enterEditing(t.e),this.selectionStart===this.selectionEnd?this.initDelayedCursor(!0):this.renderCursorOrSelection()),this.selected=!0)})},setCursorByClick:function(t){var e=this.getSelectionStartFromPointer(t),i=this.selectionStart,r=this.selectionEnd;t.shiftKey?this.setSelectionStartEndWithShift(i,r,e):(this.selectionStart=e,this.selectionEnd=e),this._fireSelectionChanged(),this._updateTextarea()},getSelectionStartFromPointer:function(t){for(var e,i,r=this.getLocalPointer(t),n=0,s=0,o=0,a=0,h=0,c=this._textLines.length;hs?0:1,h=r+a;return this.flipX&&(h=n-h),h>this.text.length&&(h=this.text.length),h}}),fabric.util.object.extend(fabric.IText.prototype,{initHiddenTextarea:function(){this.hiddenTextarea=fabric.document.createElement("textarea"),this.hiddenTextarea.setAttribute("autocapitalize","off");var t=this._calcTextareaPosition();this.hiddenTextarea.style.cssText="position: absolute; top: "+t.top+"; left: "+t.left+"; opacity: 0; width: 0px; height: 0px; z-index: -999;",fabric.document.body.appendChild(this.hiddenTextarea),fabric.util.addListener(this.hiddenTextarea,"keydown",this.onKeyDown.bind(this)),fabric.util.addListener(this.hiddenTextarea,"keyup",this.onKeyUp.bind(this)),fabric.util.addListener(this.hiddenTextarea,"input",this.onInput.bind(this)),fabric.util.addListener(this.hiddenTextarea,"copy",this.copy.bind(this)),fabric.util.addListener(this.hiddenTextarea,"cut",this.cut.bind(this)),fabric.util.addListener(this.hiddenTextarea,"paste",this.paste.bind(this)),fabric.util.addListener(this.hiddenTextarea,"compositionstart",this.onCompositionStart.bind(this)),fabric.util.addListener(this.hiddenTextarea,"compositionupdate",this.onCompositionUpdate.bind(this)),fabric.util.addListener(this.hiddenTextarea,"compositionend",this.onCompositionEnd.bind(this)),!this._clickHandlerInitialized&&this.canvas&&(fabric.util.addListener(this.canvas.upperCanvasEl,"click",this.onClick.bind(this)),this._clickHandlerInitialized=!0)},_keysMap:{8:"removeChars",9:"exitEditing",27:"exitEditing",13:"insertNewline",33:"moveCursorUp",34:"moveCursorDown",35:"moveCursorRight",36:"moveCursorLeft",37:"moveCursorLeft",38:"moveCursorUp",39:"moveCursorRight",40:"moveCursorDown",46:"forwardDelete"},_ctrlKeysMapUp:{67:"copy",88:"cut"},_ctrlKeysMapDown:{65:"selectAll"},onClick:function(){this.hiddenTextarea&&this.hiddenTextarea.focus()},onKeyDown:function(t){if(this.isEditing){if(t.keyCode in this._keysMap)this[this._keysMap[t.keyCode]](t);else{if(!(t.keyCode in this._ctrlKeysMapDown&&(t.ctrlKey||t.metaKey)))return;this[this._ctrlKeysMapDown[t.keyCode]](t)}t.stopImmediatePropagation(),t.preventDefault(),this.canvas&&this.canvas.renderAll()}},onKeyUp:function(t){return!this.isEditing||this._copyDone?void(this._copyDone=!1):void(t.keyCode in this._ctrlKeysMapUp&&(t.ctrlKey||t.metaKey)&&(this[this._ctrlKeysMapUp[t.keyCode]](t),t.stopImmediatePropagation(),t.preventDefault(),this.canvas&&this.canvas.renderAll()))},onInput:function(t){if(this.isEditing&&!this.inCompositionMode){var e,i,r,n=this.selectionStart||0,s=this.selectionEnd||0,o=this.text.length,a=this.hiddenTextarea.value.length;a>o?(r="left"===this._selectionDirection?s:n,e=a-o,i=this.hiddenTextarea.value.slice(r,r+e)):(e=a-o+s-n,i=this.hiddenTextarea.value.slice(n,n+e)),this.insertChars(i),t.stopPropagation()}},onCompositionStart:function(){this.inCompositionMode=!0,this.prevCompositionLength=0,this.compositionStart=this.selectionStart},onCompositionEnd:function(){this.inCompositionMode=!1},onCompositionUpdate:function(t){var e=t.data;this.selectionStart=this.compositionStart,this.selectionEnd=this.selectionEnd===this.selectionStart?this.compositionStart+this.prevCompositionLength:this.selectionEnd,this.insertChars(e,!1),this.prevCompositionLength=e.length},forwardDelete:function(t){if(this.selectionStart===this.selectionEnd){if(this.selectionStart===this.text.length)return;this.moveCursorRight(t)}this.removeChars(t)},copy:function(t){if(this.selectionStart!==this.selectionEnd){var e=this.getSelectedText(),i=this._getClipboardData(t);i&&i.setData("text",e),fabric.copiedText=e,fabric.copiedTextStyle=this.getSelectionStyles(this.selectionStart,this.selectionEnd),t.stopImmediatePropagation(),t.preventDefault(),this._copyDone=!0}},paste:function(t){var e=null,i=this._getClipboardData(t),r=!0;i?(e=i.getData("text").replace(/\r/g,""),fabric.copiedTextStyle&&fabric.copiedText===e||(r=!1)):e=fabric.copiedText,e&&this.insertChars(e,r),t.stopImmediatePropagation(),t.preventDefault()},cut:function(t){this.selectionStart!==this.selectionEnd&&(this.copy(t),this.removeChars(t))},_getClipboardData:function(t){return t&&t.clipboardData||fabric.window.clipboardData},_getWidthBeforeCursor:function(t,e){for(var i,r=this._textLines[t].slice(0,e),n=this._getLineWidth(this.ctx,t),s=this._getLineLeftOffset(n),o=0,a=r.length;oe){i=!0;var f=o-u,d=o,g=Math.abs(f-e),p=Math.abs(d-e);a=p=this.text.length&&this.selectionEnd>=this.text.length||this._moveCursorUpOrDown("Down",t)},moveCursorUp:function(t){0===this.selectionStart&&0===this.selectionEnd||this._moveCursorUpOrDown("Up",t)},_moveCursorUpOrDown:function(t,e){var i="get"+t+"CursorOffset",r=this[i](e,"right"===this._selectionDirection);e.shiftKey?this.moveCursorWithShift(r):this.moveCursorWithoutShift(r),0!==r&&(this.setSelectionInBoundaries(),this.abortCursorAnimation(),this._currentCursorOpacity=1,this.initDelayedCursor(),this._fireSelectionChanged(),this._updateTextarea())},moveCursorWithShift:function(t){var e="left"===this._selectionDirection?this.selectionStart+t:this.selectionEnd+t;return this.setSelectionStartEndWithShift(this.selectionStart,this.selectionEnd,e),0!==t},moveCursorWithoutShift:function(t){return t<0?(this.selectionStart+=t,this.selectionEnd=this.selectionStart):(this.selectionEnd+=t,this.selectionStart=this.selectionEnd),0!==t},moveCursorLeft:function(t){0===this.selectionStart&&0===this.selectionEnd||this._moveCursorLeftOrRight("Left",t)},_move:function(t,e,i){var r;if(t.altKey)r=this["findWordBoundary"+i](this[e]);else{if(!t.metaKey&&35!==t.keyCode&&36!==t.keyCode)return this[e]+="Left"===i?-1:1,!0;r=this["findLineBoundary"+i](this[e])}if(void 0!==typeof r&&this[e]!==r)return this[e]=r,!0},_moveLeft:function(t,e){return this._move(t,e,"Left")},_moveRight:function(t,e){return this._move(t,e,"Right")},moveCursorLeftWithoutShift:function(t){var e=!0;return this._selectionDirection="left",this.selectionEnd===this.selectionStart&&0!==this.selectionStart&&(e=this._moveLeft(t,"selectionStart")),this.selectionEnd=this.selectionStart,e},moveCursorLeftWithShift:function(t){return"right"===this._selectionDirection&&this.selectionStart!==this.selectionEnd?this._moveLeft(t,"selectionEnd"):0!==this.selectionStart?(this._selectionDirection="left",this._moveLeft(t,"selectionStart")):void 0},moveCursorRight:function(t){this.selectionStart>=this.text.length&&this.selectionEnd>=this.text.length||this._moveCursorLeftOrRight("Right",t)},_moveCursorLeftOrRight:function(t,e){var i="moveCursor"+t+"With";this._currentCursorOpacity=1,i+=e.shiftKey?"Shift":"outShift",this[i](e)&&(this.abortCursorAnimation(),this.initDelayedCursor(),this._fireSelectionChanged(),this._updateTextarea())},moveCursorRightWithShift:function(t){return"left"===this._selectionDirection&&this.selectionStart!==this.selectionEnd?this._moveRight(t,"selectionStart"):this.selectionEnd!==this.text.length?(this._selectionDirection="right",this._moveRight(t,"selectionEnd")):void 0},moveCursorRightWithoutShift:function(t){var e=!0;return this._selectionDirection="right",this.selectionStart===this.selectionEnd?(e=this._moveRight(t,"selectionStart"),this.selectionEnd=this.selectionStart):this.selectionStart=this.selectionEnd,e},removeChars:function(t){this.selectionStart===this.selectionEnd?this._removeCharsNearCursor(t):this._removeCharsFromTo(this.selectionStart,this.selectionEnd),this.setSelectionEnd(this.selectionStart),this._removeExtraneousStyles(),this.canvas&&this.canvas.renderAll(),this.setCoords(),this.fire("changed"),this.canvas&&this.canvas.fire("text:changed",{target:this})},_removeCharsNearCursor:function(t){if(0!==this.selectionStart)if(t.metaKey){var e=this.findLineBoundaryLeft(this.selectionStart);this._removeCharsFromTo(e,this.selectionStart),this.setSelectionStart(e)}else if(t.altKey){var i=this.findWordBoundaryLeft(this.selectionStart);this._removeCharsFromTo(i,this.selectionStart),this.setSelectionStart(i)}else this._removeSingleCharAndStyle(this.selectionStart),this.setSelectionStart(this.selectionStart-1)}}),function(){var t=fabric.util.toFixed,e=fabric.Object.NUM_FRACTION_DIGITS;fabric.util.object.extend(fabric.IText.prototype,{_setSVGTextLineText:function(t,e,i,r,n,s){this._getLineStyle(t)?this._setSVGTextLineChars(t,e,i,r,s):fabric.Text.prototype._setSVGTextLineText.call(this,t,e,i,r,n)},_setSVGTextLineChars:function(t,e,i,r,n){for(var s=this._textLines[t],o=0,a=this._getLineLeftOffset(this._getLineWidth(this.ctx,t))-this.width/2,h=this._getSVGLineTopOffset(t),c=this._getHeightOfLine(this.ctx,t),l=0,u=s.length;l\n'].join("")},_createTextCharSpan:function(i,r,n,s,o){var a=this.getSvgStyles.call(fabric.util.object.extend({visible:!0,fill:this.fill,stroke:this.stroke,type:"text",getSvgFilter:fabric.Object.prototype.getSvgFilter},r));return['\t\t\t',fabric.util.string.escapeXml(i),"\n"].join("")}})}(),function(t){"use strict";var e=t.fabric||(t.fabric={}),i=e.util.object.clone;e.Textbox=e.util.createClass(e.IText,e.Observable,{type:"textbox",minWidth:20,dynamicMinWidth:2,__cachedLines:null,lockScalingY:!0,lockScalingFlip:!0,initialize:function(t,i){this.ctx=e.util.createCanvasElement().getContext("2d"),this.callSuper("initialize",t,i),this.setControlsVisibility(e.Textbox.getTextboxControlVisibility()),this._dimensionAffectingProps.width=!0},_initDimensions:function(t){this.__skipDimension||(t||(t=e.util.createCanvasElement().getContext("2d"),this._setTextStyles(t)),this.dynamicMinWidth=0,this._textLines=this._splitTextIntoLines(),this.dynamicMinWidth>this.width&&this._set("width",this.dynamicMinWidth),this._clearCache(),this.height=this._getTextHeight(t))},_generateStyleMap:function(){for(var t=0,e=0,i=0,r={},n=0;n0?(e=0,i++,t++):" "===this.text[i]&&n>0&&(e++,i++),r[n]={line:t,offset:e},i+=this._textLines[n].length,e+=this._textLines[n].length;return r},_getStyleDeclaration:function(t,e,i){if(this._styleMap){var r=this._styleMap[t];if(!r)return i?{}:null;t=r.line,e=r.offset+e}return this.callSuper("_getStyleDeclaration",t,e,i)},_setStyleDeclaration:function(t,e,i){var r=this._styleMap[t];t=r.line,e=r.offset+e,this.styles[t][e]=i},_deleteStyleDeclaration:function(t,e){var i=this._styleMap[t];t=i.line,e=i.offset+e,delete this.styles[t][e]},_getLineStyle:function(t){var e=this._styleMap[t];return this.styles[e.line]},_setLineStyle:function(t,e){var i=this._styleMap[t];this.styles[i.line]=e},_deleteLineStyle:function(t){var e=this._styleMap[t];delete this.styles[e.line]},_wrapText:function(t,e){var i,r=e.split(this._reNewline),n=[];for(i=0;i=this.width&&!d?(n.push(s),s="",r=l,d=!0):r+=g,d||(s+=c),s+=a,u=this._measureText(t,c,i,h),h++,d=!1,l>f&&(f=l);return p&&n.push(s),f>this.dynamicMinWidth&&(this.dynamicMinWidth=f-g),n},_splitTextIntoLines:function(){var t=this.textAlign;this.ctx.save(),this._setTextStyles(this.ctx),this.textAlign="left";var e=this._wrapText(this.ctx,this.text);return this.textAlign=t,this.ctx.restore(),this._textLines=e,this._styleMap=this._generateStyleMap(),e},setOnGroup:function(t,e){"scaleX"===t&&(this.set("scaleX",Math.abs(1/e)),this.set("width",this.get("width")*e/("undefined"==typeof this.__oldScaleX?1:this.__oldScaleX)),this.__oldScaleX=e)},get2DCursorLocation:function(t){"undefined"==typeof t&&(t=this.selectionStart);for(var e=this._textLines.length,i=0,r=0;r=h.getMinWidth()?(h.set("width",c),!0):void 0},fabric.Group.prototype._refreshControlsVisibility=function(){if("undefined"!=typeof fabric.Textbox)for(var t=this._objects.length;t--;)if(this._objects[t]instanceof fabric.Textbox)return void this.setControlsVisibility(fabric.Textbox.getTextboxControlVisibility())};var e=fabric.util.object.clone;fabric.util.object.extend(fabric.Textbox.prototype,{_removeExtraneousStyles:function(){for(var t in this._styleMap)this._textLines[t]||delete this.styles[this._styleMap[t].line]},insertCharStyleObject:function(t,e,i){var r=this._styleMap[t];t=r.line,e=r.offset+e,fabric.IText.prototype.insertCharStyleObject.apply(this,[t,e,i])},insertNewlineStyleObject:function(t,e,i){var r=this._styleMap[t];t=r.line,e=r.offset+e,fabric.IText.prototype.insertNewlineStyleObject.apply(this,[t,e,i])},shiftLineStyles:function(t,i){var r=e(this.styles),n=this._styleMap[t];t=n.line;for(var s in this.styles){var o=parseInt(s,10);o>t&&(this.styles[o+i]=r[o],r[o-i]||delete this.styles[o])}},_getTextOnPreviousLine:function(t){for(var e=this._textLines[t-1];this._styleMap[t-2]&&this._styleMap[t-2].line===this._styleMap[t-1].line;)e=this._textLines[t-2]+e,t--;return e},removeStyleObject:function(t,e){var i=this.get2DCursorLocation(e),r=this._styleMap[i.lineIndex],n=r.line,s=r.offset+i.charIndex;this._removeStyleObject(t,i,n,s)}})}(),function(){var t=fabric.IText.prototype._getNewSelectionStartFromOffset;fabric.IText.prototype._getNewSelectionStartFromOffset=function(e,i,r,n,s){n=t.call(this,e,i,r,n,s);for(var o=0,a=0,h=0;h=n));h++)"\n"!==this.text[o+a]&&" "!==this.text[o+a]||a++;return n-h+a}}(),function(){function request(t,e,i){var r=URL.parse(t);r.port||(r.port=0===r.protocol.indexOf("https:")?443:80);var n=0===r.protocol.indexOf("https:")?HTTPS:HTTP,s=n.request({hostname:r.hostname,port:r.port,path:r.path,method:"GET"},function(t){var r="";e&&t.setEncoding(e),t.on("end",function(){i(r)}),t.on("data",function(e){200===t.statusCode&&(r+=e)})});s.on("error",function(t){t.errno===process.ECONNREFUSED?fabric.log("ECONNREFUSED: connection refused to "+r.hostname+":"+r.port):fabric.log(t.message),i(null)}),s.end()}function requestFs(t,e){var i=require("fs");i.readFile(t,function(t,i){if(t)throw fabric.log(t),t;e(i)})}if("undefined"==typeof document||"undefined"==typeof window){var DOMParser=require("xmldom").DOMParser,URL=require("url"),HTTP=require("http"),HTTPS=require("https"),Canvas=require("canvas"),Image=require("canvas").Image;fabric.util.loadImage=function(t,e,i){function r(r){r?(n.src=new Buffer(r,"binary"),n._src=t,e&&e.call(i,n)):(n=null,e&&e.call(i,null,!0))}var n=new Image;t&&(t instanceof Buffer||0===t.indexOf("data"))?(n.src=n._src=t,e&&e.call(i,n)):t&&0!==t.indexOf("http")?requestFs(t,r):t?request(t,"binary",r):e&&e.call(i,t)},fabric.loadSVGFromURL=function(t,e,i){t=t.replace(/^\n\s*/,"").replace(/\?.*$/,"").trim(),0!==t.indexOf("http")?requestFs(t,function(t){fabric.loadSVGFromString(t.toString(),e,i)}):request(t,"",function(t){fabric.loadSVGFromString(t,e,i)})},fabric.loadSVGFromString=function(t,e,i){var r=(new DOMParser).parseFromString(t);fabric.parseSVGDocument(r.documentElement,function(t,i){e&&e(t,i)},i)},fabric.util.getScript=function(url,callback){request(url,"",function(body){eval(body),callback&&callback()})},fabric.createCanvasForNode=function(t,e,i,r){r=r||i;var n=fabric.document.createElement("canvas"),s=new Canvas(t||600,e||600,r),o=new Canvas(t||600,e||600,r);n.style={},n.width=s.width,n.height=s.height,i=i||{},i.nodeCanvas=s,i.nodeCacheCanvas=o;var a=fabric.Canvas||fabric.StaticCanvas,h=new a(n,i);return h.nodeCanvas=s,h.nodeCacheCanvas=o,h.contextContainer=s.getContext("2d"),h.contextCache=o.getContext("2d"),h.Font=Canvas.Font,h};var originaInitStatic=fabric.StaticCanvas.prototype._initStatic;fabric.StaticCanvas.prototype._initStatic=function(t,e){t=t||fabric.document.createElement("canvas"),this.nodeCanvas=new Canvas(t.width,t.height),this.nodeCacheCanvas=new Canvas(t.width,t.height),originaInitStatic.call(this,t,e),this.contextContainer=this.nodeCanvas.getContext("2d"),this.contextCache=this.nodeCacheCanvas.getContext("2d"),this.Font=Canvas.Font},fabric.StaticCanvas.prototype.createPNGStream=function(){return this.nodeCanvas.createPNGStream()},fabric.StaticCanvas.prototype.createJPEGStream=function(t){return this.nodeCanvas.createJPEGStream(t)},fabric.StaticCanvas.prototype._initRetinaScaling=function(){if(this._isRetinaScaling())return this.lowerCanvasEl.setAttribute("width",this.width*fabric.devicePixelRatio),this.lowerCanvasEl.setAttribute("height",this.height*fabric.devicePixelRatio),this.nodeCanvas.width=this.width*fabric.devicePixelRatio,this.nodeCanvas.height=this.height*fabric.devicePixelRatio,this.contextContainer.scale(fabric.devicePixelRatio,fabric.devicePixelRatio),this},fabric.Canvas&&(fabric.Canvas.prototype._initRetinaScaling=fabric.StaticCanvas.prototype._initRetinaScaling);var origSetBackstoreDimension=fabric.StaticCanvas.prototype._setBackstoreDimension;fabric.StaticCanvas.prototype._setBackstoreDimension=function(t,e){return origSetBackstoreDimension.call(this,t,e),this.nodeCanvas[t]=e,this},fabric.Canvas&&(fabric.Canvas.prototype._setBackstoreDimension=fabric.StaticCanvas.prototype._setBackstoreDimension)}}(); \ No newline at end of file diff --git a/app/bower_components/fabric.js/dist/fabric.min.js.gz b/app/bower_components/fabric.js/dist/fabric.min.js.gz new file mode 100644 index 0000000000000000000000000000000000000000..1702e9e6b3f73b4180aecc0a7046c448c58e95da GIT binary patch literal 68001 zcmV(zK<2+6iwFq&@dH=@17=}ja%p2OZE0>UYI6Y8y?KAzMzSdS|NRsaW=00c<|Z$b zfP(pK*-m_p9s5|y;!88S5ZM$FQvd^ik~kv2`>U#6(2YfsGv~bfdy}z<-nZ)N>grmq z!gOyQo~O|?5I@`P?G;b6D2aV%(0$f@=In;fI-c=)6!V$0ALN@APv(34W|gFQc5vXz zudY>%$Lb2rlIi-A$N9lQUFvld&ywqrD{APf%z^q~GC|}E#19icrPlpQB`N=N9i`lL z{>Wy@rQ>z!*L9BeUwt?}{rvIu-XgzTK0lIwc{qE1)Du7F$!r4w`9m2TkChtePE#J{ z{8upsyQg<$bv^&?%&RbkACXzN8fB-+db&7SuW;`9EO3%I$CxY+)7**Ty>d0`A~3#O_%`SHc4*RRfAoSuGq`|{`0*C)Z)nMK)Z z8EzcrkJV%wC!wP*2^FE>F(?;M2U=;yTN?KhcwxVr$&0Ic0pD>WMR(gh5#YE=HW*y{PvB z6cmIB)13h> z-HFxS!Kefve>l&0dKI28VKXQ6&3(?YJXwj9D8BF`HiwhQPZ^xCoF(%)#N=soalunR z-R)eB<&Tr)l2gOM?U`7a%pXr!IGg##Ce;%tvk;th!_{iJu@jhHO$DS${DG2Q%w~M1 z*Eff$|G4WKjFNqv^rj!`yV>b=VQ@V=&$Y_5Wy zJeaylS6KwW!UTv`=2d}e9&n8wi}_3uqX4jV20&{;HLx^lm^mAi2PwK;8K#W3tG#!f zqQ>FFU|++DB`UYptC)zWW*QncsYDpC*w8P)B_))>iaPx2R;;5;@{tAjzP&%nyPE4= z&AV6upvHXX0YK*bvZlek%D4dNA$Rura+PmPn2`AqZCA?3IoPo*`WLS$)LdW+ltc)d z1OF7M>+f#u{OjKn2D$ zi7QdVFR-i$p1Z{ki}|&>EKvP!+Pz_EcjI;8n9((=E{FT`?xq#Nf?_CYVaDfoCYsTPHgrxTcl%kV3InE=Xxll*0JgTO}>*=r}@e4In&Fq=74Mn8w*=P~?D z0QRfI@1>f)nxybX%%$2HZq!LVm`%~jMzpdKt!zXqn+Z!AS^*LuY-k0N7DX#bCseR< zyX5m6iIrsKCycI3uxtw+T`Y2cvBMMm3Qq7-wSqNMGU&NE%{X+glhY(afAM@AbBbgg z{2j>OLs*Fx7MPUg#D)?V;3vmr+rZCL#KmmCUu<_s2|5VY5hUW*hD88q$s4%#%ED8y#yeR*};XNSAL_qzOsPm#h%1EbR1 z8)ny0K85=LTqn31+bO@vyRTlqdGYhR)3cLbemHyc;V1Zb`@dhq6d?(II}J1LTwXf9 z>}c95ZmPY*r`;z*$}w%q(S0g&!1cH;he%xI^~L{rDAT7+>8*jx!p$D=Aso@+dYS7e zJQx7A@HcYus;3c9*NBk+a~Wn?{UYTSNWd)~_9RdemwX9Fs+-gG`bF;capitqt$2D2 z9diLicQZo!fUcQ^BYBoAulP?;L$(T$jua<*Io>xZ2cW+9xhH!hY9sU;!Ga4)Eq9%+ zgF82sM>wLu(p`LrR8ti6hY^rO?RMm40nli07o8|5hEo6_XZH3oyx=9Q$WqabTy^6r zi2zCu4!EGJV8?pmOo*)+6MQJD5vb`HF2LAAV622$M~p+znec;y8u@C0X_X zu2K<9HdKR604c|Kyo}&>SEV7Cj8tK{%eZ z+y9uu5&C=yV@QJ~m3cQ(>8-##1iRryKya13SxUr*QH(7vd`!XUNIKpP*(far3IP z*?m;HAG*$?cHVyEc#pgtZXl>E7L~>KSLR%W%QbhHRcTgK%JwLOsvG8Y8LcFkl;{Ai zb_VaBb3popH4w0{2y6?EDfo>*dPZ*ILddZ^F7x24s||=i$;B4=6#~`KEu&H-Cz0@b%g6GmWZ#6QsEge-<=4tm_&O%%!~?Hx10c@qhtt z7I*GEgoCaHM-m(0Q9QZDAi?7f0H3yLU4LN?|^RxJb243J4y4W7 z?WFbP)*XMzzMM>2-j`j^BaSvK8uFoN0OH-ShSo`+_wgiqo{o4YNPP}Hjvx?W04PvN zC=!<17i13fl@Q@8AhwW6#|~R5J`{-`1gfx$gqXruh|uET@i0DGKueiS1>68tW=GIo zLd|O0jNV%0^LJeg77B=Mu4Cr-G=8IWw|Qr;i>Dy zK(1mDKH>`hvL~J|;;~cJ3{Tm2I>RkC@F6|H1h{F3%jhEh%}>S0XFtYmv*cm=hM@Zm zU`2X4v>{bJKbM{t;VyGzIAO3*6kjKI)6HoffQ4chI@+xsVxdVp%IVWeNP*(R0~{z+C{HIvsTe z{=jP$MX10@8)}xpUGH&AuiU%d6VDFyj1U}O zZ-S5QckCt1@5`fC!6?3&3NJ-7I# zmqFBuTUVVF*7m%;060uB+>R(b1u$HyTLfjcixF8ZfNv87@x5lcEXO?CEH9GMw!pk`T!9$N5Qy{F4qU74hhR+{!?cSwmh}^!jF)=C@tY@kEOR>M8+{0~Qm!*=_F2YviNXDn94v7!_z%0xvRDoUZE3@VyZMJdL@g2A=zXn@)2 zE_>q6RS@5MqIk`R7eQy%o3sAW#lgYF(cs|VScnu{cmk1}2lLjv^Q1Lvt=aie9|-cx zVB?-60J@!d`_k*Vhb_1q_K#Kv2P>n36+$Is=@?nA4i2u2ELUE!$xqo=_6OjdV|879 z5xgJ1$7{+(a6EoL0qivBT(HyNj~4!y!%*?}0w(k^{a(O4UeND?T?5StWdI|7mHD~O zpX&UX%s++v1Iqt(NF`suWn9F;7Z1V&j@9=1nsyk+@HSf5L!x5(XmzWt7Yptu8VXUZm6F3MF?% z@u->wF_QKP`~dL_Bong87w`j=`V@Wu;Vt0@u-zJdo=wkq}_p5i9c1t1EzoRa6ypA%V()kX5;?hND`HKmkA zV(9ct1Nrh+2(19FWhqR4I)Z{eE(5Zy;YZ}`e*AFq_Vn#9ug~88^yckPZ%;p4sXx8` z;YBGG8gb!1yxn#b;cdL_Bk7uYbgz4Ec3go^96)@3l=_OMaHEbJT zZGz^mF-QANljNy~O4+;peogPPO;<%iP{$A|^^G+ln}KHtI|7a| z(D0Cup$1d$R><~^0eC0F^OT2QcaYw06N0Egj5~qM0SlDDohw);GO`)q`Obc$CNYiR z7Nw;96a_AluiVcWTyFe`0S@x{?yiGhy%nbjNBcDoAqNKtT^ZcsrpVlpZya78L|Sy% z%0TOZ$%qN+1ZDA%PXV9Q7Z*o{et{#fftf@c$pIw*%%n=FSoNSTFXpT{x4CP|4CO9R z;TW+qCse!_2Dkhs=kW}ta=J`ne)lvMRRa92mMALF>$KgjH|kx~6C%j%vz}*s$1y1r zn-ppmU2uW4(C<2a@d?@9CD$sOO)Ay(_5eES9E6vvq2m>?4#obtPI4>yk;uGCGAsIs zqL+5w=M;H?kvsX!YP`Ir(IxER+IUlLz?MsuHUEz6?wc2I3+XY(Y*NSnof1kLMu>$3 zw@NMqS2$cnc}M}ycm_fK+vU=a%1bU}p=&8D#skH^HmW0RPa*?wHo(qk+!AI$cfXuAcm=k%ONAw>CmF9qWbX28=ItE-F z<&#Rbh~_XGKxi974KfOzQ-G7K3LZAbYja>ueN>wIoMlGo;$T)NcL8VqR7)ug7e~|K z0?xI>jaWEdKwAZ!W?eDVOaRQ+Cj_x)cE(&te0MQZV46;Fya9B7C+-mSJ2bYoA#9;K zVSNDHTO|+T1C0ddlcU0pL8hBDo{LWiRqFKaaT zhrqQE(b>O4e8+}s9UT;(`1((>1Rv&g70IMhJu)`XUx5CGRjIjSF-dn430ml*9zv@a z#*h)T1Og@9&o$r((LlD}``sOB+`JW}%yu1rjg#xx`+KjO^DIYk)hZCzQy#aAFrF=W z3g_Z=3X9HXKgtNfa@jTUU2fz{LlBVN&)CH_VJNFk>s zW8@_yEjUz}=1>{xUiWuGyqlWhOIA+F-^jZ;tQMzyY6oZORMN-*VvCU(;UjMMN^;&% z{A8LY%jG*h&rg$8p_Xua<6l8H+Q?a(=WOGji%_1djGkt;T!cefzd*PWvLZRbkpskI ze8Fd=BFr<#mzgq0lgNZ_i0#y$jN~uOXU8?Z)n_#Ewp(P4`S^!WF7a1UU6=sPVbh>O zHK~hdv7)Ay&Dq&Hj{aQpx35t8*$85#;_K|pX`{9o5@o~vO8r1s8A#Y5ouTWx}c&^ z(To?N+P0f>vkQESSmFH5NA9w6j^*8Q$LYF`>bPuOle=b2x`5};N=+E=hbR+24BZ&t z4ljiG82*sTE`9*4$tdK?jwhZJzvWN_?u0Ty&?u8LRM3c9aY=#5XEooJ~lQwkz>yK!PN2z8GsDI>&*+EOm|* zl@M7-!n)NJGNz9(Bu(8)P2K)VcKlX;1X^%8AB&bJ!whk%7>S-gl^CQj!GP(l3{msU z89hk}SEtsz#es}rVg}>#+{HLtnxrB0XSnPN1AOIUBVNjWTPS8@wZ{GjRLLcYaED(R#H@0Vf4RYn`Gz;t9qImbwuE=rVg3Zjv?1*hk%e zCCO!g)Ucpml^VW>Qh5A%(ET3%H*#PBXt1v8lG7ga`z_vfJcp?=T8Ce=ix9bazKRB5 z+-t5SFY}VP=x>lefH_!MEG?I(Ap!QS1cR5Gx2T5h=M}mRV8KVDx(hi?WIio<8nEBK&KTgv{A~k*x8UMq5`SG zZe|V4&!=m3ncT&C|oAWv!f#~)q-aQPYgF)=p|$1 zfKA#$$@492N}!8St7p)M>yy3>ak#8ji2E9$+FT2CKqrpr*#874IpN!eG~xvYBw{FL zBcqF?yiayqE=d--zFs>K7fqb93~!m@u32Q1s}A|-3Mwyt4cxXx-GL(I_i{7@FwE1< zZ4xXhcbzG2K!otjE59r4rbGomg*#Mgv)d^4C$cUnzpJG(SXs7%<1GR&u*Sn0k&4sd zw7Ri{vg$7pzdks)BT*3O^e=3iL?}ig#4&cYs>brDg=~tu z6Vbb{b>QM7tQAFie$npUL#!4ylQ`pOnTD*55eBnjENozD`FboJss5%DDGcvdPs;9E z)`yfSHDE@dwKE6xyzGa7f2YTSRbzMVuXK#M)v)aLwigW{QMU#X{DkU2!)?*XjPRZJ z$-jOsXRzaZ=T|cKRmoO~_MQL4^S+X?91G{L#qva>2eR8go5RgnL#~q|4}Z|TqM0(v zUT#jq3#1TS2kr4W9!lU<591P54F^}W%1P}Sg&>qVF@8YC*@l$q1f#4h`xMjP>e`Ff zNGN-PWe*MQ3<(udx$R46%@=$X`hy=NjhwN9YevU57L|xA*UUJU#u0te1zC%x*51hyP}= z?&EI1xhQ7J^Oc;k-2`okS$e=oM9E_xPH@)~M(|ADcR?~Cx7+5FQLXaPN}Fb|pGg%e z3e(d2Y2CSs4}S@sgJZyj7qFUG%$d{}K=5wwC{K?(HSeQEvUq?*l?v(}8t1D{U^%-h zBg{v4;+!>+JcgaCNIeIsJ&(+lXuECWD!qbDMS6v^bxM%C-9GITbF-b1!X#{Z+H<8X zzks9=E+DxTUsyWiR=wGll=4U8W zrqbuhDD%^fl5*W!xE`6wAPP*OMp3N_!9~V*L%2W9*pkgzMgq9WLrM{u%t>n;PH|hl zsxTcTp~HSNDG6porFTHNcV5KNC9U`yM27WNS3f-@>t*t<2jxp1R$JDT&AcyJMF26M zMwdKU;|V$7k9*JhrFZU->M9d?#zasX_t1AH=CdnJU7i@f?F`~ z3^hcTx1tVg9j|3H*~`1DvL=Ex$f)Ha=cbpUNO|5uqi`m9kydA=7o@#ImLCmZ+=o~M z3UMF5p{7o7D5^QMs;S@wY!_?tR0WkMV+)7aeMEIPtNP?Yy`+A2N*#r|?5>9Qbk*+c z;@%0Znbhe6yIVK0HIuviW~8f&u4}qqD1VlV8U^RoHnE?&Sy`+Fb$F%4npN5qy9kC_ z25~WqR_TlC+!1S-w<9R;c8nT2PzAPMn*CK{`$bJ|X+g^U61@^@Q*N@;$vs*jW8YoX z!L+GttstyCS?7%lq{?Yfv&voG1!Bfp$!c=dvR_G3pjV#8jVm=^#ho|_2Hk)52T#8P zilUGAgt7|FUP{DY53WW7E4m#IL!e#4p!>L$NhTK%@e8OsEX;XyxI2aMWM13Q$T}-D z4#h=B^+8y?N>v~9+g?PM7RJ@)HU^G6 zi!ug=++G`YMcd%m-~8ptgC#typT4Z+LhlFNr(WYE?nSuz-KVW$GW}_FOm0*@TB26g znU)7Og@K{Xfhmm5Sd^1OJz4{w*3XJbH%yM!V+Lw<-MEcl+=(qPJN~xXOw_AtY{zBT zz5a$uOPIjTsb)8BL6)b7Pd(LXuY#*9xv(QP>i$sO-kno7?c}Uav1Z=Wa$YfYM}yvB z_n%KkF!+CVpFTT$iYEkiCO zvK1ZwT0>dEl#T!nKL9)xWA!2C6k|H6ih~$Bundw8t{gnL#lLUk|5}H$I-4=&gBvdz zSmMJvzq3e37jY$Bz(hm$6|6bIHL(E)f~Zd5c3I=``aGIGr0-VmMX9Lhm54~0o{u#5 zV`Hok%&aj$M51$}$=a~UjlqSP8zZJN;sg!GEmdX;t&6-Ap3Cs-n^oe^R8|UI6j>>} zQqvHnQ~yd24@2k1=rDY#YF&m|4ujq3iesW z)Ek*QKYQZsdL zJpTshlhpI^p@r>d&}8;g_!C_9f!2(zJC^Z0h=B43i3ZiZ42}O7^9iz_Xkkfk&dyr! z|5f7tRksX4n54~gkg#cO9#j_W%XSJGiFLYk9Z$W4AOqzJT|c1ZN74!x!mA{jL6RzG zu*MfE0QgJ{fx(3W;P}(UIYjOX86^A4XsL0sm=r|NK++M{a(O6g9&nOm3>qF{B4MIc zDh%Br+@5-d#=3POEjH-TP)i$r$y!2-OWEu~<+3_;ft(Rox5rG%)#i?P)%(HbSt^6poL(*vFSVK!PDqXo{M_|ph&MrV~L46Z1z1%Ba&~Oq^Zr zZ%#XFJML(I9CrToqVvDMeCbTup3_hj?7N~a?-n4TE68$nKSjg&lgHQzOlzb!e!I3P81t@9ytW72>$%<=3= zYZgr3?ktXrB}4+F7$e<*4#BQ2eEcHA^!;J6cu|2TmEgFxHWQ$T30nr!Qu8;ZgpEj81vt}7uS*)r2=^|&yq2iO?Bt+%IRd*hxSx)cWL+{dh{x;LR z;VQV?75$lhLw{gR@Fi1s1L%ZJCB|6bQj)n6ftfVA3XB1vfMom1Up;8>FdRFd>00l~ zW93vKQ3t-QHR3$dbL| z3JSf7`1Q*K;GHGG0G4FHgl1_Uwof^)@XCi~vdbyL@dUbJtR%^;G^-?R)E+A*tg7Zl z#pZ!+x1Vjd``1!xpx6x%>1MEwLR9^|hsON&mk_&#a)W;VAGqdA<9p3u>l_@MvkmIt zoB_m0(xabO_sIa@jAPJJ^;VASI;pQ(9#6&2lk%jn~il4donOQUG&bQkc%G$zWSSa$w zoqMz`Z`>Jtczd)j&LHZNE>(~vfj}SrbJ`*0T(lDUowhI?$6n#XgC*?JHO@ zW|tt+1W?o{rbL`5|k=Vr%2 z?{^ovzt~Qrbh_l*RkGY%Br*M>^MWm3E~8b(w<+p9Qw)uKi?-rDpkUZFR*`Kk&y%H0 zx(w5=Jl)D!+2T>Og^fzNKLn&utWY+4!oe_GV3qu<^b3qY)tT{WB7}ZWuNq=r6%jH^7*7{T>J)sh z9s47=6?IjbBtuTtn(csBhCSI?EziA+w9P%`swb=;%wzdra!qsg-2`+gc@G$Pn z7Z-m7aUx?p5B2kP#?N1`)e^v&P7R0ihWz@ znJ6ttw3?z#eSgSz(aHt2;?m#&+WXy7dbHCE z?)b4Avb86y>j_tK0vsJOoEtQ4zcra>&MSop2pykS6L8x&epH+A+40j#f`BW>4}yMg^<5ak&v5_9 z7&&j(=>N*Hy6D}8=q!-5W=Ivzebno<#xd5__4Wh0N=_b`mbk_f$uQ9jtm)BmIBmDR z#dtaiLijTbgT+qy*l2coOd~s%wu0_m1em@L2;PWQ*4ynG;?{~GZAgBgGq%WuPQtwc zA;+X)(Bi`tPTUVhBzD4huTWWzPfjR8Boq9p>2}w)Z(*$qglrSk-Ha}|Uer!ZPm}EGtFq*hgzCx-snE5H1{eNt%iSO2uXH zXW0QlH?!m6Dlwx!a5q^Z`3%2*15oc)I?ZTM^2+zG@w*plsxHQvcDCpY;?L)!- z`Y2Tqq*0Iv4}chc9^(TedSHbugzi^i3q|8+lVM7BzVtnU+%@W`UnOgaUUv;XR17_h zeLF&03{y9i0R7j(M%9txUK4~KODGPn5kJZswwMa!(IlgRpP;wu5>z%gaRXwFyyu0f z%8cfH@FZFq5x8+GxiGSnlkEAU^F>dJtKFh5fP4}RwOPkuNQ$gMG7cx?T(tR}fvj&= zUqR3|jXOn6*tB?w04hP)JtvD}_?W2uZvZAiJ7e~PgY;L2g@#LuOT{ftl$oYqkQUOr zlkS+c=SY4pn(OyndRBpXsC$mj3SDSplmgp26=MLW>WnEpGZI%0Cnb=`rRbQInYxDb z)b!wBs(}r4^6mDE%d@xLUfto(SJHH`f@^*0OrP>LEDf&YS+M7~T8*ht- zp=@THkXGllFoAm7uAx!n)F~Gw_%>F&8y|)A7$#kp;&X8qnHy4jZ@bko!$q(tX5~xo zOG~ER?n6C_=;kW)p%0}Ey0M>@09g?7CQq5ImvLC$3@aL-6-G2OJ1v*CE-pt2B&R@4xzReERw0 zYXvIqm$Cf(GVxlY=VF3|1V&{D+by|C7FGnR*Ce-6z;xLRbM=B8pytI3$dzI3y(_G| zqbNq6h(Y7aseBcI!a69tMlb;EERLMz%QXS1wO(!<`ueVZ5 zz!AZ(B8RkC0*C6h2>(=K(M%2Ev);|+64qI~qBQ}gn?4W_(-I)28W8^q?A6@B-Ksqq zV=D2njD83(q=#ahcp{9aJbNFeU)QVJqr-4lEX;j6M2x|W^NMHzbhe95&4j+FM1$+2 z`EaeR)dEfNv3@7_6zd&G4e}p zJf8S_j~q5*&ZD7`o~2WN52ZRGZ8@GzAlWO@cVAFN8ecM8ryyJwq>(?y7fc!;nH>xS zM8c)mdH#qwNBiUBS1(RqjIpi-b0(ALQ0GyP3Ou)}h4aZ+?oWKK&i|SP7u3~Qiw3UH zod|Qz!|7La`403v3ZtUHh)77Tc)AQXDwgX;cWAf$8(f469R!;?45~yVna|)dSCBJd za~iJE*uy}$&QKUB5dKeKZ(YI81TsPdB@>2(l*RXU+uzmqz>s96&1Ukrq-A$ur6@BE z51D<`Mu;djUSGb}ov+Cz$3tr+FiGZm_xH^zP;U^S&vx1!9jZz1K@U3HP5tE#t z17#Al)01=~R{YEw4uBXALK|8rOevrkgK$-bKYg8nHU?s`VvW5$5mv#86xG&!R97sBc|b+5vmdmC z#RQo+40+|9P8ogTTY`;%?O^k}6y4w9INEvk=~1fBGYzxcrG`WgyIAx_okyF1@6`I# z3fB~#F^K6v<}4t97E@eDP7|fLm4iSC)hGj@awmaNTi>e|=|#=|H3v z-WYt&!r83Gw>%k};bQbR?Yw&<2LYcOm;*Ec{^uGf*1DpyP+*jT?+tzL7(Ta!>5GT7 zs@wF8Vh?DyXjQejKF`x|n%~!Cr|5D=3{;i8uhot*+D>J(Cl794x9*k8KA;Ch`?7WQ zW_Vw_EmgFI?W$7uwb;@vwsecL=qj4=``YWNf<0_cl)109o^GwDTjPH==O?+!8+p8J zD71mQN$nbl5=Tb#}+^qh&>^)CS%Dk{vQfrl( z)GE49k=L&sP%1~)?f?n{mBp+b2l(hlAk`bM6{&3mu^SP)fmm8Ffe!I*Tys${_LB6m zN4rVkx5Cr`Z}E0SHC{$DLSB^`%_+gry9A(7+zerQgrXY^y5TW95;i9c1uF_~?yCsq ztXh$Z)D>wDLB|E@O;dhX zts14780|W&yB*3&QVTw8r~;xmPFfJ{q#wQNjF})Q3**i4+pdle(-jspNgn2FeQ%^g z5*=eb^t679YN#2fT5At&GehIqZDvAkSu4Uk%1fs=y{Fy1kYYsQ4I%gBG8zS&k*=Hz zvlit8PS&$4_cT%g6u!iNCW&eq;9z0kBASR1*AR+{VVyf}Ccj#Qj4+ig0yh;1#mbq= zQ`*Qm4UF=tOvh+Pl^IG!Tm6z5_NHtdEPB&n|0q}<94wE5!NCE1uMZB^@I7*qKmev= zju-i?U1Kg?a!@BIG3-`*S@Z+pUW7#-;D5fXR9p&G3nU1#-I9vJ$T^0(rf@*UD6rua^uj@@Z{;QeEP zFVeia*i?H=@6_h3WNsqiM|V3^0A)CI4%JpHPjT2hMmfH^VVW;JVtBFULrSIQn6#Od zt}v=Jhw$TOIL3Ga)4^+J(?y0SDwEoST&O{+7m>7PkZIE()14sP?-?mt@($yRWqD&M zgFGpnbM*L|(n%G2a(NY4CV*BEr=r;#BO0-7g3;5aQD-pf9HsXf(nElxoF1{7W^IA# z^QLrI6-=Lr)l!f$vnP3~CYhBImQ4xkri8hXP+h25(?ZSuht8srU?t`0M#?8i9e>Xk z#}v;`NQ=WA_k|qrq-tlbux4_EV~E=5CL?-|#umuL5Q~lmy=SAm{S3|7^+7A5$!^t6M3y?e!kNzp}Wq(R9GYs2ViO+fRs{m@^$g(lLgV#pZGElyYggI z2#;t;c0SM{BqSsE?tQo-kwQCaoKHL^gh++V2I*Z9g*-ld`jn}E`1Bf~7fO6bpxH)3 z=|_HpG7vQ>pDxZDQhv;qMoO_{C}mb!Po#j)(u?!c1PWCjx_SZjjEkR$eugIMPR*x4 z-0@>7Iq?Xcn`wX;R2s=125#71c)dfY1dbX&^N1BS8*mzgorRLa&4T1Pz{#}d9(Eww z^Wh5%vrq`=?&W?Q0PI9wZwfGU6pfzweN#Agk7I@ifD1Alnh6mm!U`15rbY>vPw+iO-SfLOl=cAekRt5DB*HWMHb3DL5}1-tg~5{V4qVq z-IlA3!oX6xK<$tF6G8Tm2kPT+fX9m zhHiTSNlu%qra3kJ5BkEk|DoG_z<9o;(eTbz%R}ZjmDZW`4^ls;dnifKpJ>ZI?%)~9 z=m=XAQhmhfLn}U1L_!yKR!&*DnH9Z7M^aM6%o_#sw=$Q z74&#ybOUWV4G#Ya<$qdVp7Rut_L2O`y;0vs++6N!#PGjV_f@`&{u<>A8{L@Ru{l|l zmUm#owQ__4-32sD<32#rcArY`-_|&#WS|a*fZ4;N$HNfc-o;(ez?|7QoV45lS^`Aj zQNXmt1(!6Y%43W4{ZF0RDgX4t%P{Euj<{+>-o@N6v)ciCyhFL-?w48H8-4i)Nm#MJ zoQM%ROS?$MG|1%ry=Qdj$CG#1A;cwihsw=-`A2=sx3$J^ps~M=fIRDbA9m)G+wXQ; z{r$}Neqww>XHYRzRb$dD!EN~GI`o~t_4{w&e-1lGNT)FV55sFNgP1&DPZwE)1>U?7 zF&8Onj{fbtKK_S6UJCM<%6~`IEu%{=Tf^XGm?lX~`9*Vac(swuVew=cU2$0*CMPLc zG^f^IJjICBI$bTftN=@-d?q`G$yv07{Qwcief-a1IS-ezJDB^LwlwA!qu=o5GP#x! zP(cBDb3usJIT+%UsL)uIa4RaYl7b4IsbvMZgmhb+T_ZY@YX>yeb9?_#{*^J#8v%9V z4}h{R#{=f@$+NRj$6-w!hYfWc7IkE19gl13c-&COV_k>b_G4X9N=R7;V>_4$ls$ej z85x48820?ZWLH@u)MAmJRuYf`-?V&^x~^Nka#gmdCzp7Emaj16MTE4eNq`5w_Ya^t z+whM*dhib@YAX-Sy*a_Du}E-@wz57hXD!x3*`5^?coIwt8hjZ{j{>B-TkfJg0IIva z=uBG+xMLr-rk&+57Gk0-Y!7;mg*`C}3fXV^>|ja_MGfm+qNp(@tHhwlcxipp`t?N` zP_8e0+DU*MziEBNjjMKjOI4BJgR!{$#w+%$c;(Iuak9TTXc<;&I4hEDyM1DWU@Lyt zoR|rRiHk6OkprF3Honn4A}LKE;n!z}#Dgg^4~)zMJM$rXf=9HG`OwIGXlH)Ho)Pb6 zWMqGAWPfaDf5yJ^dY9w}#!)LB(*TxgIg@m*BQ(KZZ+ zFwSJvA-V#aosM|0^hKoM33o~&tINVJB$A=LX3lh7X!{5+y2RMcLd|Rs>61LBwvwYQdCKzkDuiTp|f9T?3cAJSgOIdo%DW zW}ybc{L`kIw2?_Sht*PtG#g~aiEXOs8%po*ENa2SwS_iC zp>*Ka_TQ?wCfTf_nw;v?UCA(l={&s;J7fU(5FN)U5SN~406{>$zu(5N$t4_efbS9h z2?oB?DW{-*9;VUt%zy=qBtj&s@qkR_dcOnVuD315d82NB;13wCxp;5Eb(CMJ_!_xc zD{zEVyYi=rX36k880Eqs4^$D~k!LBKY5H(FAPDV~@hOCeeQN3M282nUds@iJ3nw(d zXl~M0)+THAjlQ3q4mZ?=tX^%DB+dfkR#W0qwo%X_b`44OSnf20C#{k z0vBY(fOj`!&li4rK*nJBP=pULywh)0C806P5u}vXL%W);+||DUz>2TW@P)7tk+7zH zeYX5Cp&FQYeU4_T`jW0Tr4oZ#%nK~I(87d)1Y$o*F zCP2x=RT6@l%t|CwOgPd7QYjhlIbPNRVIG(fvb9y@x3-=BcdW|)DMW2k7 z5}!K?t@aLKjKL!`{RUI@_SM;=wnQ84N6wy_(|Y@Dk68W0izl~7d)3V*ZG*V7k?N8P z9f>`-o;>oLy+{H6g&x`1)4X;$p1O5*j(YYgqxOyuvG!_UtfgQB`~DrW6|xy_B;TRU^) z$C@aKch&^DF~VSspcf<9!WZ1D8vwtkv;76zTEr!S zkKGz-0tJ+sVqs*{A#PMjPgV|Iam$8FEqqNkk}7q}){VtZ3%jRmj;d}z=9VmT;0dHn zLO}iR-v0FZ#it)Wy?FKZ^-rgE@<@TE1~3zyC!>(;Gnmkq(DFp6RIPz%7EBe$%#a5# zmoj|rbUZ^tbc-M*nVhAdd@sz^)etL4nnaN@p-I5ZHObP+=%%8n6$nEPE#Bdx#bQ#? zN9FvB8e&p5+vF-lRN%E209hA128m@7%%mm+^8pQx(mhguEWj5n$25sZT&`e;bk)0xVo&+){{~T zI5R4n`>^5#*IB%q4$b z6sTyt=EyZtIVu;HBF|?#k8xk|>Td${n63T$$oP_%chS*N9w^oDBGU8g9m5wEct`T7 zyom87vZ^hj#DzreJb4x7;m@Dm3A<@^DTuvqMWmlI3Ejp-KK!22e2)n3o0;NU-BKhx zAgfQD`ou^g+o{Cz(u9BE!ZP%m%8CXf^>8{#xJCy+Zlc-Gtup+ZJLE{ zr){FHYivvF5^@pja%u_MWh2tc<_)A zCM2v4mWYpF*)@pHjwJW%|7PB`5e&DiLgYxKY(Lzx?Ior zD?Sg`OW__o^Yr$p?$RzAH?rkK0BbewxXS#)>Sj;e73*+&8azQ;&rgtJujl`#pWmOo z`SjxW^zDbA&R)I!;qB=OX#fbbE@Xc77mhk9Xr;>P)W$wh7;iAo+R3{l)=qX(54DRa z$=^Yyw7^aDP=)vX$aS^1@T7a=we^V62e&YmpLy*N#!}6`DP@<&^D#e?4)bNSLgFGp zEyvD4MSZ5Ijfi@5B(#Z}5H=v(4q@znm?##7RNIHG*rWIx%9GN!M$IxyDzXS8{d4|9 zxXv<|DTGJZG0-GoO1ilrZ)5g~Uqxh!jSd7?4{xNu;GW&bArdOLYgDZWxZj)Ih)PIR z01NERHY#Q#V^W?0P6(U?%R@i0N>N-@2G_-8wl~MWg5iQy6wuff3=ztT_J5Kr%8?~} zsOwBtJPmU!7sbw=&itOI(s@Aqk6g(6hVV9Xm_7gmdC>eQ6cF?7(0MONorm0VQ3 zk~&oBSy-YNx!CQ+4t+S|*h0{hV#e%-LK2e<;c0B9<>{3GfFoXTnS+hPk8DwYeTFZy zT4z!WETu+z19}a5Bxtw&-E%u5A!xU{@kSIm z+Wy^x&!+ey)`*9Xzi+=}UhgkU5m*O0tgt$V0nbI#<1oGoGt-u>x}VvHwvoC1=$5P1 z$UI^8wX5KWi0NaIl`MQUp@a-soGJ17m7@(||LS#`0;+b7ll5}87bhryst)wM|1+g7 z|DQc+lf}_?AK0wO5d@PK_TC9j3~NR`pA}LrhOsIB*R9I zCb|VRdiZ?3#P1Yln5Q4&7qi(XnmUY}0+v5bL?!62GfkG+i*rc)Alg8pC`38L(_}qe zoJ=8oi6=ACO4$6#Ws<kLVvN76ax5UnqeAgZ4yE`B zKDvIQqt>=I%&DnQJdffKGf{u~%$VO=!@M<%Y8e{A*?F;CcF&`DMkr3c#hpnjZzzu} zA|$(2IJU%klzOOG;}61ajFKYno&oH>wI<8eHeUeMhGa8MJ|94Xycu9jmUQS#Lvyif^+l z;Oh0VWPnQeVG&bA->rsT$Z5Q*F6k{!WE6pWYC{AeO`e8;($lVxi)bjsnkqxPdwO{r zCtN;u@tR3d`URyeP|+l_>cd_5^1|9Oj=5tTCQ4DYrTy{kHJ7%NRk;cOcUVQR>lM4j zHZ>>AZn5fq{MK5_mhEK4Rm9b-1amB4!$tRNwI@T+5RW2U*ZllzRBFmdzD)kroR&2v zCABH6v44b->ylt5s%uQZvj*#6?;E$%u z(=OWA%s!A?CDbiN-w_C5@&uB$#jr}QN~_IN0|*r`$Cps5QgC{eXgTuA8-`Tjf}`#3 z(vTF7N%3rB#k1vQhAppL4!FKp%jxh;&bl#B&s3;_(JIqu0)v#E<23)ShR8EZpxsw` z9j2#sB=5u*5qbOE%NJ>Ky%(3*cLg9A8%5_;{4jZH$fdhWen{Rp$Z7hpI0}N|bGy}? zm6~HfunHs}#=!o8@qKp zwcLnOWM;ncl&u{4LCw?}_}@94IYM=lxX(?;J1rGu6AbC5d}4{{j4RbwIoTk~s|e;R zBh+^*gjJ!aJR-~O+*e-8q81etiFMbDArAl{l)cvH9%^@{6MWMJJRL7L$RAgi0z9>| z9IiULYByz=9dKJaK(JIqIOP(>b?M_QGs{I5#;d|x_ln&?we7qWdCFmkbOLk zE*?Aiog+YWoAPCdkXLTj9EH)f>L@zevR`#0JejbLHt|jS;2g4I+`pT0oWyp z1+)CcY{q9*B0#a?q(RyB3K>yCh8+=;>&P=(v5~7#KaWzpvkH!Uh^;v6HV;#D$3=!* zWe$<#8C??mzM4*1RSJe`L!~OwV>6Dg&iGJU%Oge%7KQQ=sB@W`-zj* zzR;fg@3F#G;KvVa2*-7L?cx zR496F=hz;XHHLFyU;Cm4N6!N?+7Aw_8z#h=Q^PbHS(GifI@Cfp3$Fyi(5FV1=y)}T z>H%a`r)=rxWC|TkYa`+2qT+&@vNHQ$UKgqth*=t5AIk!I_-c%1-Bt%grA7XKyG4oc z=8##>H`wQ8jj^8t2lroNSmYS()nx)g>{rypJApgsD0msAMJe ziVA7E-XTNzU>z?d@Op2jVZ7@epsWwtRB=XZ>aglf4}OQ5#2N_ zANyb8P^s(5FaHBQsa<6*0LiHK4sO0|w)7(Zz-y28FVTF_L8&PL02`lFdIg*1tO4XK z%{#z^A5nG&CAv3)_w91#h@y`EXrvv49O{y1*?*jT_^EL(71`88*9uUVcc9Ago*aI; zg@-aG%G;HGOFec;QC}%rQC*>o9%vtGcEuUx*=fjfrQ{qw45UJ!K|c?mCk^WYyh>JU z^iGbpy*{QWx0FX*a3mSM;-*I5%13a?hMV^BbB7ys6cHg22bA}CO=2uN&-RE|ewI_M zEB7?wVr6uz^4uZ(s!95zDo`QqJ=7(!`e-DB<)t5)^=^qr*U(5qUFZ;4Jlm94r_MEK zagO?Rw--rNm14VUYDRaaY7?!c3_ELd_Tzu?&>vJ%OU>3M={C(&ul6cOjg_x=bs5dd z)s@H+v?vKx1eGjy4QOBU>Y~EY5Wb@K`xW_9x=dKg{E^{xOh7T(iTUM+k0}o?&zI=a zP~Qe))vW?GkF+M&*QR(Iqr3c%C z*?mqPhYJ1A(gc-7u)5iLwE_Y)QyK7Kn5uhpG`hK5?m=T2$&e1ZeP@ry(*(8WP{)>c zRcO0)em;HE`A%xp!W}n69a40c?d*+ERFXZ?E(`adlY1Y3e);b0@t)J^^?rSP-0QtM zeYFR@+#7TUz257eoINPvEb@Hi_j=dY*WK&K-6Xx}Ng>Uw2YGv#7s}zF2ZQb`pOFG_ zF=VmwwVJQ7(m9d5dnp{ORZe8Id|FF_M|g(6Oi*!RufHc{R^@A&((^4eB_6S`r1MoH zEj{F2S?S2EA9XHd0G&iYNhPH&@8J9I zzwc2hyehnW|@eoKNI#F&_3N&A4z@kB3WvcD}X7L6N@AS7->X) zhN_H#gZq)ESDfIPIY%>|O`jjryXS208VHKLHv+o;$Y91Kq{%U&cSp)k-Xo#tJbSM5 zG3sqb*w!Ypv0i;T;N*_w0 z;uJfxPsX*@4@QdLJshv0KE9H)zqp;U$0{gZk zQS{$A{{E036>|V+-1{Z^CXTWc*UBKZ9eLtg=Th=J}0y-evym!2Qdt2e@9`@bI^?`hHkQnIuEe*s8~cE1Hk+W@3T zbweAr+yDOn+qMa|_>z8_)HB5%x(u9_f!#O# zm#ghRp&I&4ly6+P4SD|F?VjQ{s;i^L;}Z)9_om%*2UX?rI%Ts$F^B1!Cf*rP9Q(mV zfF_c!-w!S#4HO6hoSvrZ%CXzm??0Y?J|p(=qg(k7pE>^Cc*6F~CoGr(GVAW_;O4bn z3GKUY7d!TZeSqzD-x48K{sZBPCAmkuB8o{RBP*-)aFYv1HqM0<2gI>Eep>dgsg(%H z!l2Gcu5272#nI~2t1w&KUDU`ZN@`;eca<}2MwCk7&ik)*xI|;AKDs5>W(5i>6AlUU z_x@P%3kQXo_WOm4a%uNqe=wX0CaZ7EkZIznL0v3QaPjZaDO1cr!#K}N7{$vJ$gF04 zLd$}|9{%5Rm@>VZ2}1yMs}>%(aaxbV6%-(dGh+WEiQ-Z;&Od2O${OJ6R<$f(3B?La z3&snRwrF5Vf#QhhX*+9pQxb9=N-X0vSq<~9=#qF5m#73)!169yj{3DCCQi{XQfUOn z9K1}#0hd!Tju~-!2DB)KwRmcix)x}AQfNy>xOEk(yKrej3yo zc|47lcW;{V?qc;?xk`3NX!I({pTYwwOXBw^{`4xjj;qDaR&bXOQw{{@t2DeOJ4otu zo`x&fG+f5Ry?x=9gn95Rmes#cuIl`6-BE{{>Z&kRc?}vH{dr|Bqb3GvieALC7qc0) zh)`S^XU&mS^X7a*-hqdzeIZ6JsqC3_7s^Wm(*5oVqKF>RIk_U&h3Zzqa`CF5wK_n{ z%b}9|D`6~CE?y!xdWo*A#$T8PW87Mp<)OPt`3{o_RW7y?(iVe6espTb3?{=maUU1G zK{50M#n1~BL%&Z9WpqhA7qg!8izpW0zz&tENP99-E*pK0r|7ghB8TH?cY{oKbj{v< ziY8Fou{D5=3b{}^(;|- zJxlWwSLP>f4<SS^)DY+f$$D{azaHe^R9MA@+04gx50S$Cn0MLOy8#LHc zlVc!q3^2z~*-L%D=P+5=QJ)+9tjy$tr%zS=UufP|)*FdRY5v5oXrz8DvFK?`V}Xf0 z$~9oPwL`0SRHUTjW@p1d?foM8y1B=JDE;R1JMm zBC6_Wj52{$MPD>p?Fj9w2WE?gr9ZY!GkohmN^o6P|q|t&| z3$a*E-wZfvWM_U*kM{?P`y3%ij5zJiDebfJ88npXmj zN1wsNS;5)+m(lGEwMFxde+Zw6)IuKU&tJkcLUkC3N@)Neqy_x_0ZUeSbO~r$yo|3_ z(ooUE@ppzDKVGckuMfDM8kzt5u^52UiLT$Z8PE6LY#&(o|3hq7ohyy<3X-~vzER&9 z^KCGnoapiqHoE`tA26$Ar?wu?&eX2YinX|b}iWV*&D zL0PYQAXLiZ?}O6LrVYr`l6qR%#&+3Y ztcX2LUWt6LSA>P^Jd6(k7b|nwEUSIjZFm|4a-!C$o>Ys9`Sw59cH zhLR)Dc5x7R)^S8;RSVlMa7|H>|H(JLLjsWS!( zFK8sCIt{gMGEb}RAeezt8K~>TOp-6x%CLccEf3L-INPH?hfklfy?*zx=M*^$)-2ow zbnHvm0z5Tqp|ZuFQZ4V)+caGG7ASmsyiPMLixi?mqCIwulrK<`G6J*Hk728j0O5X7Y3PJbF;j@g1qmdEaxy;c2cdqEMuXp@Li?-860>`Bkivo;QPo=Zs2zXHlD!Q6StK+2%8lL~;hfLd#BA zz)^KLC<>V>Rt_0@l%Yt!8l??3K!gg5-mXf1&jKSEX#u*7YcyAaSH|JLWniRs#a(TW zQ-eKtafq z0HOhpoZtMsE4TyUQdkrIjnU8NO2TJARs7m6fDsh^xg7mjnr|p#g>?lq^-#o-%QwaH zTA*=wq4;iSxXV6!BS(1s5Z)+o@=i*|mjfeq zgb(HGjQ@5LUBp2LeJ~qgbj?()3LSJf=SiL?mu6j`Rb8J;b$wQK=~e^HrO}0T6m-AH zXH1)nGD=huKa2Nr!T?pPY^I}hJo$sjAQ%N{hh_~5Q)q#9$SFURP(m3o$|Z?W3lK>v zRhulvGS9!g@iQPhH}H3}V+EoT7tYi}OLQczERMzFB!%tmlID21+Ir(Jgz7a2y%&CP zy^?=|vMGf~d;Y2ldSuGm7I7YA+rO+xnkKo+oLpv@le;5Z0#m(%b6*UY+C}-FrbUAh zF2YO@P8spB@}h{Cu1xh=p-Ch|@gylwQ^{oY(5$q!$^dDY#_}j_mMI2QRihWvl%&3S8MxD zgsKGPYm#wJsL};5y?lW(D^PK81s=haimQ~bK6aAFOxP90cm$But|u8+QAm2DzdtMc z49+FFU`3~{x&AsAUn3Oj`hUrL*Y38BWKs0{{uMI!+73ZBDN?qR8B#EpV<$7-H%@Xa zCu1EAuMR{)A|@1|0HiE#S?9Okdh{C&ik3aEb(3YW(eGz~zv1tO9y3cZ@8)QpL}9DE?j*KW=$q z=W=h}F-K{A)r@1U+>W`fVbr~;gTRxlS5{mVS8FLRN-%)#+8iP|alQQ5!gWv(CJvcKtN^k|}9p-3E1 zK0u*JTY7`#1RO2MD}aRNiYRoLZ@aDGX1001NxNif$j z=Yr`$olSLf78pmACjl{}Iujj*APCS!QGEQE5WNn|o*uz0>5lVRXuy$Law?(L_;z5P zKFJD)qJwA!3JF7@>k{sYMXZ2mpAQT|)ukOV8IF2GF^h*|Ah(_m__IaY?`ZYUYXm2c z2b5?yEOZ}_(XsSNZ#azs5j=sPMCj7WG2o1S06Ou!-ymh zf6S7KuqRri-47%QYz8@{kyaO?XKyi69@!luYvgZzRs2xEL2IzCOpM#QsWKETIKQ_r zY;y!xf`5;jDw;z@rwWnBc}eG%VSC?{T+_a8uY2cg%4@OPs7j4;l$r>{?x1sf4ISPU zTsxOr1`FvcsZx4_*uC}wdn4wN9R7Q>>CF=nry>tpg_||h&)2M}JK)QO9+{P{Fs`>) zi*qs8=Sp1Q2D^&QMpnob@198;j@pKf@^K61paqa%9S>lY=X@mLJV1^c%JH6Z9Al2T zgbL^J059J8mX(AKMX(R$I~@A?Tt&SCr+j%BA58LiFly)VRYyN^w3qwy6NzecXVd+5 zagt1}sKqow|E-Wt@6+ zxr`9h1zbXm_-rs?Ljp$O-_xT`J^r``IXM1%fQ1Y^s>hED4^%X7{s8<4?$+7Ej~_v) zZF9axAt~S97&S!_S$KdjlYbn^?H8oc`2g%rETe`KxCr-a?VLcYu66`jQ(sC}sUv8P z-#H$?IsUn@#xRRl{hQ8OqCWeG#w;OfqoR)Y5d};{E3=W`5h0mpcMVuYR1N^J9 z!S03j;6Os!lG2tc4KKktrM1%E*U558j?;m#gZrbLg)Vjw{m(de9-vvVLs(K!-;HTPx__clZAKrZ-}8^RpG?|AI6 zcxza`0(B4iuuo}e-@_c6uVa{Eu7@i@OhU32QUn~{$(9v2Lug#yE=sT#sDK1`xW_i$ zPi3GBSbi<}y-I#>gd|MAYq>ksK5TevEVbq+2NGbq7Nl!saaaRW*2EvP3Wr%2t90a~ z9ouQgY!K2+pl@}_)N(i=RECLdiSBy5XUz{*w11sLO~O+;9~1t_3DX^-W^Qydh;e#c zY0Y9b+<-dw+G^)m@&cr+g#k@L0z*NEvFUtj4Uv3XYgF7$q!uChpp#lmca*EbA+=M7 zGjD&v_^lD7)<`!^jq&g{R%6Gqv5no>vD4VGY%IrqM$fbURWe7@gcIr_{zc~?GIE4c zVeTgi9Ac|((G3;dxJ5T^(M>$Smmgx9G}3l?6YC8w#az)08oVh^7c8rDSypigxl?p; zf`lvt(f0}NGrW+?b}AEAIyQ;3cG0W45Rc@!#%&Xt$s~UA^#C25>n;%K9w+|=@n{Y} zFgaT}2Fv8Dbikiae@1!Zm3j)}`3Q3+SMtoq#IMr&Z7$u?f#AeISP|6Pe<2v@@XK2BRLicZHQ| zm;4QA0$kFO|Nf|@CA9a~y4Xd8o%416>otgg!GKV8UJta?hkUnwK79Q6QN>d^i*Zcd zLX9dxgb9a*Q9Q5(s+!u8aE`nYYV1J$=^T3rrvY)4Sr^curcT^nzPmuW9_ygcgX`hC z9$LPeK-)|8yR9BaN6=E8Wy?3NnNVXHIM9&U&&Up=W;RQba^j&K5u? zRN2`wWgh{?0lU!FS zCmCPcl>)AtqGDNMg8k?e>y_m{sa{5;qg0C=I4O2DSWD!{W60XCk=diGSCu(MuZ`(@ zw}Dt$(Ef*xBG?lY<6M?-+SY?@VhOMcLRAC1yxCkVTZGh-RcK*O-Pq1Sg*H#B zDGoBmfM^jCz)y_`SIJr4`b^Tko%7cG5mS&OeJ&(Cfjs_)d?Knad2;`YnsrC2^sw zY7YRhDzq`}fkrzYKZZmmd@_1pP{aX$wHI2*xLqKc)+_p)0qF>)S!6k)u4JjiE=9SZ z93j9_K)6s;fbLhy{hjoq&d6Z}*nFit->DSRFoIq;N|{u|6+{+)0%Ju3i4&zAsr1=~ zcOw~9N^O=zC6&r9_To;k=uJmy)sP4dd`Ty-+L^8;x!E9G=KANHp&;y!$z`e)1@`}1 zb!<<#@VPJ07D0UjD9R;dc5RE>U8fGwqEFcvn!QtMvD(Qe{^s+Si)=X$RG=kSi>rIQ z@`~odVV}OCtVWhFa3TWUeCxvG0Zj+X0qfQ|t!F3tXSFJ`v-Jut5850pORso`GQ5Ra zj!P_Otkm~7P)}gAbVYwB#u=7FpaxD4$pwNHJw+EKb2Ly)ERolU-ULUpl9&`;Yh6dgtxX-e#&+mIcy|ypUEHYF zh`!h&8XTvP0neX~w^eF>o>jA?oO_b}R%Q3qBD2j?Jr5S5pcT@*VM&KlfyV0^8((Di zkf}|vwLOpLWfymzt#+N`6!yty&NEj)6iIECRVwc`v%85$(0B+b70;5iGTC&T{92k% z6Z0hSFu9xX!RM!TfV{p0&kyDCcT}yQ>v+!Lsf=kxV18F+u~94I4N{Vl+uEpINNyva zw2xqYh1yHueWdt7J8dJL)p<%22Dp-^%%Vs{Ge5?cNE#3DBGpa-4l{BLup%cD-sy9n zc$>Ss(p#1PBooFm$A8MzU(59-iegAr>h0X3r zXPWsJvA>t9HRrZbay9*TFl3g>;hEA&{+~vl9{9@ zxl-CitL@rFTEPC!=*2@nzXO8O_@PAZC0lAqrwS_h74_wCEv6QVyW2L%#ny@QNf3oP z-0vHT-7M_3+-U%7v@2H&E_PVy6ju7~&RBd&&}vOUAwFv9XCf3NNKp31R<1uurXlrw zh>jHPm{sqJ^=xs(3j4@1cB}9nqWA@v9B(0uIkq5{A&(^i7CRM@O-CPXc{X|~&X%KR;&M6qTCA3%Z|*$n1<8D_t^nU~fpb4N6f&RrK7c?t@J*u> zxBPJZCb=4&wDMk=R6a}wt~41Penk%x=uWt!6uP!Gl0gZPUF@o zKA>?8u2;ge{4ITB#t`3)9vYxrZVG4{u*yKHTWS=#kY|*yb zlu@o_?0tu_;`+t*hn?v^oQaN|uTW)rR^wVsD0^)K#EmJ9Ge^fau17T%0Pqm|5uwc1 zDUSnjRuOz#bBG1U(ZsH>Gg|`9KEyX?+u5PJnJ80cf@LuSuXCmN%w0{c88Znjm6!8>DYO~vTIY&(u zVwzP6ewu=2rv|uxPCAol<|s7sKpjbnvBlL0h;F#-&bkbS&BipRl6h0i_x6{!X%=c3 zttqLcnfalWZ>p0Lt$OI&l+_F0R9dC+~v{GENg>X89TYXvQT1W>`#K26#Y1PS9f#nhXCbIEOQUwvw$f{cO&qd zJmBgXwF6_M66>qoCS>d2taJB^%Qesw9m(|Bn z>b18SO=FRQ{1jzfoaC1Li}Ib$QRqM@NIkDXL-Ze!U-GRc+{q6oqkq9kJt(Y%0WW8N05;5 z&!bGabN6juX^@J;&0t_s)W;XmCRKzR?Nijt-M>MxxlLp8hR#*P!BX}*9%-Y$Atk*) z?@_HcXCWk30eJkF!vKr5kh^2oOAR)wq~7{+BU9^+M@(;D=T;Tu5m}3XDt{_2(M=1E+eUe(tS?VA%G3sw!j2z5qSeUQekX$6 zsAMgxQGQp)#ai7IEeN1N8#|t(H6yf$2jjwc_b$-0^+_?Um$01qJk$mo+7ncpE@cHi zY3p5o(6Xm>A3CQ}Fpw2H-yb7$xV`eXyM$d8Y73pOmxx|2P-+I{zzFx715y-xl)fzH z*?HzX*5f<7o(7p3NpEjkt#+HKm1~=vGm{HPSM>dRJ&q zn`{pk;_N3pUn0?QH01z3dB8k#oP8U6Zh#Oi!XF|RQ)nK)-a>&(M&B;$J_3L^*2C_wFiNcY~4!f@5W=bVc~ z1S~Y+fYx0fKCAKiDr9h>l%ILSyEK;>(iyhzg z8n9H7k!U~4EZc2>mSh?Yc>EadOj#|9aafO?=FKo@?us%%1CJWsVcEu97)w@T@dZKb zj%rlbEt?4=QGd^d(z*~fhJ)OFccdZKgnc)ny+XPi@g-~*n_ZETk16tRsVP#tCWYFR zAAe`f_Wm?_)hNnC><8+Yo~uc4s!-QvRHGL{Xytnh?WJj5nv&dTI2KvkZ(BRc{#YBxxdtolkl>AbD8jG$TjwbO~2Wd z)VktT66lFji7x0FM5IMQ^MY-=>?LhUE~>?wC2dgkjWY>JR-1^3EbMqYFixbBbNJSG z$n92lgaIL~40RqFXj89}yutV|VSw&silIjX*`6vtLn zTehxdk_Rin-wQd(_x0b&9&<&~%97&b+vg9}leKB92yc*J4Gl$=;U4c|37BKh7juY2 zcATi-quN**{IPtn$e~*?L_u1(tZy^dl|Ihn01A#Y4%Gapv~65Rh$8Q5VRvl#3E+%! zWVx`hXf@tUn$D<2kF|oi@T;n6JL9-fzH$|XW)m&KG08A@I>dz|b^(It`f{brG6P|^ zNUFE;7NG%t+Iod@xlV2(Y2rH2v)cHWNG7dlGO6Asr)O+KCqnB!`%j-~G31<#0p;EJ z59q0$n(QCLD?=xxQ;M#xla=o3bSM!0P+H*A($O0OVM{R>r2 z_;p<$Zb(KO@DZ`?nr{gxMgX>HsFfPiqMxnO%Qnm)!;K6@6P@PmhY3sdMY~YdR=QaS zEDPwM)hE3U!R^`Bnt}R#(2n=)K~vRAWo_*DKdknZxeIP-6gDVcHH`Kyq;Y3=X$vJ{ zbg}Rvg8iJ{{1lpo=+H_f4~>(PdM>e=j!ssAQBB8KD4n{Pbq2L>mhvhe0{B_;!&Ga zUv4o3d zZ2SnpI@TV{1CD!la-S7CD+s{0DwWYwtF|0i84sM+bF1?N?^A^V^h$xkPkZifLSeSM zzFZZrl2!7{+aGYj{udAh*$SwF`*9qnIt$a$^|`BnF9+!PQuAT4+X>P=S4b|S-s|t& z_{Wb!d}8Te!hB>`%M5Mh57Fkn^#6rFXs?Gof5Bh;kOnj?Yd+F!hB4`L=R)06XW(yi zV}y|AsM;hN^EBD6^$lcLrsb4f3;+%7Om)-C9(76p4(&|$*)NP47P`v+T@*gCcv8>K>?Mq(RD!17R#uq=`}G77N8Wm;ALee~0h zTRW!;U`CmKC+x_O!=ROR)KQV&>6R7;T1~JFDn(a_J&ytdnJtUlVAk~F){d-~TNieu z`4To&uC9o(uS}|0us0|6z_%A@o^Y9L05`J|rINKNs3Xp_Q?b{$)Fz?edc0VZy_Qpp zBdw5cP)7O5Y8nHTJjFW;?RlbyIH~?F{a&liHquN0m~YQqw`b@OR<@|Wy+K%6)b|}f z!>s)AqS+ujD}I|SR%+yk5%7rAg4qh{egi1EWjBD|-iWL$%BXJUNW#e0qnCYj1)KISG>ShcW(v!Mo0x8i6ZGKS>N=LD2nYc1y~?*oh{42jaa4S>IJ_7-XT_9Zz-4C`%VzPnX#RLI!>ph9~gA%gbZcAGwXg?MbVv8 z$vwAJs8VErwylfML)qw26C0soLFh#{0Pl(HeAAY9AYCv}c5E8Os*Cjs8*(fFr0%Vh z*}Dk&A}Fh2`e4-(ptd~;f9X+P*_o66zX3T&rHwNmtxT20Gao^eOmvGvlrD=?WW%t8 zn8Z>j%uvBQs1qi@zI9{Up{)I?oH@tIl^Dcn$s*!Fc?EyEN@jpv#Gy)MTD{QG3Xaok z5iBIr0366h?;__=wANL+hwDFEwG0hHbA+Uc3?hX>yq`LfLw4BNv}y5uc9YKObs-FD z=(U#(akG=1cg0(FyF-t^4V0K=L7Uc|Pd74HWl&WrtuT`5%3H*7M)D1?rQN+rQyI$R z8ym>5C3PglqzR>g@-jD6?&SdDpdAi!0gr|_=oaUtfi$w!LEh%k_uN2wof}AZfJdlG zF?=HGE>uSVY_0bk5;YL!6_me~uY!R%GiKmNt@7e5X%7bnV)*QdIC%C<4EoN*OA3G!Wk;&9R4K6RmuG}ZvxB@6s( ztUWLC|4GZDB`%i5S+aatT#{8pI0HbsPz9~3SeLW3$CjdfA}2cm9Q8do^WXUp|Gl`2KQCd+k76*EBPemm|Av5@1r zP(_$M!ryWmz4yL#e)Djwb4Ukx-uJOr1G=-qsPu-qPH(n12y`%#gcnik5io-chJv7C z4`IX}L5Mwu4|@z9_~&?!AOrn9-jg6l{vPjnE4jxTWzX7vd*0^TbN1byyW#fyjkZUi zXHSBnJv>W$>Ok!^9iu(ontQxTdvdqzdB!yId_J zcKXxRiZ}-=Wp4IQ=xEJ-7)SLr^1guzT@>igu-PM+@(O7i8Vew4D|82qTIGFJi_*eC zz9{Bu5%b@qOSd1Wo~ryRP$L}lnvpAVZ$q3f&=e;`YN$UaD_ER-`$!p#g-0nXXd0wU zzGsZ4fzbE@O}N7|jd-Jb30uZ{8fAWimbkAo9AuL5Vnp{gLJ?WVx5a#;Yly}nal}mV zu_W4t-BiT^M_k>sP^9{f%t^}K7dA}hiVcv-`E;t}%k8ad1P85EbtBbe&^}*n6N;Ah zw;q`fOMLMapvdyDb9>?20sAQdWUM=%y!o{lYMz#Ey#ub zt^v&?XCy3d*Otb>*&}eI9Q{aNJM1w`DlH%gob-kxrBf%pg_+c2PK}f+dFuBNPyiAn zK<|yRF@idfZ%F8YmpzpE7%~rJc4YrGh*;vrlMjbK{_^JZ`?oJ%zI*-CkEgF*|LOI+ zBV?%)^2oFha_SWJNHI$2TH%mZva41U_SZ+D ztUNk$5{g6?@htHg)Ttg8W@V94K1Sx{z_>bg<_y8a(>NIMFYQgP`sz33pan?0G*QBb>~<<6sqitDj}9kHg7488o+4wj z<|AuW94Sr#`p3ds7?6igE|}5vU9zG)SqEljBS&O*gw;LP)InFgE1^Y~zF#-q;T>E)S(y$W zOLLpI5~8gX2uts5@3i+~Nv9T?MCet}M7QF(SkFwlv{BD!siG!dijv9%Yfu!^DuuOc zsET}3B_Jo$Y%}C`myC;gBci=>WV5wx_0p300MG%~K_Y4FHtOfu6+C{N9S$ZIvJ*eD z0DDGm;%#aFT7hG$z_BSn5Sm7gLZ}}be4D}3qpIp`p?>p-Y5vcR!YK*ZP(t!CtFiTCxm!1`Z-1Ob-pna z*pCB+(SKlHk@{PSHaxPgX5zr2WLMkLTv}h%FG@{}I36_(rzv-chS0YQ6DX`yo>hC`tKizp0)b$*>LjoaPX4X%c7J@CF)pr)={Gq{gsxO z*Nf%VBI(37<|&OUTZQQoYIb?>MOS4%+T75`;)z@0mU8XTB!flG!G}6Dbe9@>q^Wl6BAEz2s zNlC&_o{AJNyJAA3ys8F3!bT{WC^v*_58VSlBwQeEMG-53e5Hps%OjWfP}7Q+m#gJH zv<7XBvrse__0B!ZfUXn@A(av~8#l`gv1gRv)K5&mm#@+pLBF(J5EnuMM~in+n(%vJ zeH=%^-lxM3A5@>`?j8!|6_J_r6RSv_gD)i*YZDo7pGd$A43nia92N!6C6oSju52Kb zsGHQtnDL6?t}v07nS2}UNi>iFOVB_FV_;GMGxa#odcMnX+J`+Ez6rx2dYr zta_WSvOLjw5v%LK=9#D0u$$=B;w@g7q722-hN6KI(2i|_dM3d*e}21MyUAw|(P?Mh zGU~K*iGg=z;5gcUs!Q@S%6q3UyC;0#$vUd2m;E@9{kT)A?8kSS01Pal!#HTWBW$(2 zA^E-Zx-l>i1|el|s}PW5MzD>#5Kz33997Sphz&?Y?j7^?}4_?05G0oYDbGFjPKI$>5>=eK*3z={`AkF zVjauPker|6;jo!{KAIrvIHbNilpku3)n;Q)>@S;Ji0th5tY%ZDt?TLB)Az2Z%ze+A zI=OgNjrVSEt!jcYS@a@?jlK6^WWA5LN*7Dk|Cjg^=^qjMBglE;F7-AuWU z(8sO+JU>5|J*(nd#-{YkidNEy_(ed)<4a7NUj$SXnYXypTB8A9auw>?vP;NsH*6V1 zE}?V@ZHYhu36a}^Px}WjAZ4pX1tQxFqm;tVwVnS+dNI!(Sv7|Xiv6ryRSv7JxPU%L zr%5lZyEBv5S{=OVtn8KN1Wq1fQ> zW+-kB@cTe)@ON`?C#;$fLs2CmGR72PA`W881gE72MyX&eHV))81{iZ>=4IBaH-nQ( zo-EqgZ9DxWM~2c5VJ8KQk@aqaciOWg?_)x99HB;Pxhs#G|*Q!f6c^{r8L-9ex%s)mAc|}5$*ntTlw>+u*$dyui~FAmk)PB zq4zI8y;8SmsB&)h*N67>*DXE$q)J0Q{WZ|jhjw&JKR>sdPSuP!eoB>=2LsD<<_`tj zxHbRu40L0~a4_VsWm=LUv3aR&_>e9Ar5SS`_}NNNjOJSV!X8|N$)!N*NfRKt*Qd(e1%S8hT20J z&p{kWQD91B?RqLzRi))MnG_M*q$c76lYDx*&gMuf2F;13Bw|-howJI(#`FK?-GS;OCrdiC%nqRI*E)01*KDtj^Xww7K^DoC%Uql(g#xayVlT=^uAGq|fq zdAOEhQb2k!9Tk+mh>Kn>+R4X{3&cNW=3r@@A)Q-Ve-V$Qn{;MsJlzF^H;$@3pRlD^ zD+wr`E=$O$!MF+IY{3cUj3ErRcH}4as@i9sjL$esvQh5z&@vnNpdQwGM@2uohpvED z{o%N-5RVlYU1K!D2fH(*pgIu2laxoDavE3*$`Kttf6h&N@FJ2ISJ7F`pO8e z0iLbx?c{NTv|uQ@oNQauqG3%(yUe+$0+tBSEGWs-*;iB*H|+=*tmwI00_yEo>$4SV z?vfEJlq_LH*&`0Oc|C311LWMYzSHf+Dz|JDi+*Jd3%ECJ)RXiq;0A>rC-c9pE8Xdl z&7F`B3aB1#kKI~%rRkIK)Ag*VfDr8z0Mh8Yg2lt{aY)ii@;Pt+EE^*Crig5tZVnx&2sEe4z^3? zy2Pj5A7jzgD(=Nf1FkoEuy_@)m3lRj1_75QE3Kh^1&7rzSZ@$pO1kD+y=t}$FWej3 z=!8H2(rBxXr#7M0pENbf)i0i>sBYLo1@~5lL_Mhkt^R7sc4?QvI~=*LoL)AhpK;J=hV@VH9Ob?+Lg%`HZF~-V21VagnvIsQ!2&6T$wd(`DqUPv9ts$PFFzN{ z%|$^*T?k?UsI)9EwCqAHa^iv#c59%O-0t{dSo(h5rE&Sw_PdUkkNRlrQ6_tYb{T87 zYHUJL(r!(8@GfsibB3i23Dsu0j0fZL@aeehb|W&D=vl(a09jT#?vI9+rNE$xovql4 z$Dx*IlI?*!M>v26ehA1*=Jg?(bH+$GeVAb*!(GM9#ta)|Us^q`6NYlEM&&}&v9`@A z=pb?E@u{ZrCP_)Ep=r67Wl?cU?CDL71K*NREP$;14H+Jp3InVxB$<$#Il3*-e#}zL z@u$3Fy2?r^Ddh}On5HsGXEF)EAI_VVAZuIR-LY>MyW62fQsk5XN(y#_+AlL?V5Yb+ z5+I9aXp|}G7yZp4Ek@FxbMWIwij`|b(G>ppk+R>Q{U?aL!8G`!#Rd|IK1S^%?fZj9RA1hvt>m?3}V7dlQR^#IHW2a z3Czjra4_lB<42*WJC@rGvZ2GWtH_Neo1m0hmsZt5S0;5uGO3pOⅈ}eI4sB54n{c zd{=mDQj-G>ZQp$l$9G?xcsQJgv*TSOoAcN3zV_t%uu9cd0vcPC1yc1G;Nx?Q>81|R zVlJAHT$J_(mn>(b6Cf=ZJ8YLcE(yW_nl+ZTU1PnU@<_eoY0_uq5JvE|i1X)z2^S$< zsr@`cW%M}T*Vz{MXt*@R7Ts0UnTfTjR>qt=IGTRL--fONO*yYq!{-1=m*O0N<~kA= z^>l!=-Mo_sfWPotMB*x#r&j^thk2?_5{c_zJ6&q03+>0;<{K60fVq zWOsKr0cmZP~?m7@!BR*tU4*>ZFxE|;S-ak&~@ipz4e5tnD9Q}`@L05Eye8l%iq zi}m_sM{A%!o1BduOFbUz==_HgZ{cIpaFpy#UD_L7j_L$4hF&Q$7QU8|u0VD`2C;!! zt?lD9)^!nm*xyW@6KoHzZJsJH$sA~3{*l29DIe+JFPZIs~c*A3n=27V9Y~5h$K(B|cdLRDEZ6EidvEqVFDXw4onI*B8Dxzsm>E z8mda3*GOJY{D@I&&=QWK!ae%Te}n6T3}ui(o3y0>yQ2d!sYfXjGet-#!q4wmpGoWz zMoVH6j2*R}wg3nReLfMAz{@nTKSr%#OU#r}Rnk(Lv|6JUn-0myH0ItSo6pmH+yanI zsp?XN)%ZSJvRKMGHZn76Az%l`mH`T@)B2u27c#lWO7yVhNJ z>RD(4@+^=v!3HpwdpfNg@|?o#w^YTi=S`Jn^T}7)JZ^o}m7m?OT64>3j5{1)`+|3e<^}+{M$ z7PAgT9O^yxn>Mf!G=@2Dqu56U0BMguHuMqU`9i)Ll-QH%7nq*PRJ1I$h=;0bMtvSX zb|a4YxG;H%rLDZCNh`l(5+J&k0*wo6EQr)fYT=rBQbz=UBb8&&96!kN- z1(mNouUOUsbldVM`Gx~D%!c0V@zIiA6248U6i(rrr2NfQeC6GK;<_)W+v-pv?Ic2J zCqSiql|LFPWu35_34Np~L5SNs^h-Y&hfM+GXbM2; z)Muo}k4)U?PS=(iEi`#vv+9TJw{*Grksa9ED$h~~T;nPDOhG#Fb|$)KrM3xc%;6bv zt&B<^N@&?YS%v6VMY&=^&5u)03ORgVrnae2tqSl6$efc5-8;a<`8`sOKNQQlVg-77 z%YZqlrXqtsp(hM`pm)y0PaWxb$U~Utp1giw9!aWOJ!n#HrWjz|l>=7?lTv-=z1MO| z>I>YlCZXJ}y0NI15Uiq>(~_@UUwIw!kZz|c+`HT#?TOZ4&fEM0G)bVc{0#ZJq`3F1!LsN*v*w!1*DqqWu4Vd9shG2xfqO(q;D%nn>4iht zab_cr)-w$6X^W2(83&}YonIL@Y*#2@rrc|(w}P63E%ZI6ZuYu2xQ`#90xAy}$YrTR zXF9Z`P-Gc#XnsC})7R$_MG70KJ*1)Vr`VtrRu&1m@nO&MOPcG$NKZ~Bl%14EL&t4d zkXI}x+Uga~c>C!yTL=|EZU39WH^af#%+xa`L;;tnI+`Vh-WJt2GR1Nu@V{Ua=V@G? zET$+(%YlucAK7)}0m6XOUIIhTdIbu{QAD?(h~y60f|P?Ix)>pIP?2tNCq0_|SmeRi zk|wh!mYR5K*+oz|q0|g2(Gqn|_YNO4MAjW-1NHz>OmQ3_u!wC=mTkzHbvx_E8NIrU zkeP^H2fA^pBXC$aC^@2ghC{Tqb?}X}5k9)ahQ$|&P%id)V7Px$$4Zp8v~$y>65b1l z>iz-x)#-2GH;GT6|Gf$Zfa?fhD@f5Mwz!)r4%~f=N*6Xh)@>vp3A z?!s+P1DGxr#x+g6+w))|Ww3cipbWNrpOg&D@T*BPM>q5eV?DMvO>ss(oJ;cGoNpUu zja^S}>{m9slJ#|y^2L1KKHx(wP5QzG+hDrGxo$N;Z!&IcEAs~-J%O!pDm6mKTjV!) zeWJ4YQZ;36qm~#jE||(kw&8w`-m>uL$&?(AGHvAwK$6o|$M8baB*>g>ZKI?E0zY^@ z@HwsIrY-v)gilyH^Nn|?On0Wz@e{Ufrm}d*kBN1Y1Gu|xx*1u{-gFtuHKq+}_AM;q z&&?{mp7Ce0T5oETbAvOJ#V9Ns!vTPFH%Q?O3X7TWKb>l**EYd8n5JY;nBm zpQR}4mXJ8-N^vv?qEcoW_=_*Z(0i63?<7^Kt57Pv8j;?%#;<+*McO^ysw}nxysfo1OaB?Hv;!j^AJK>awY@ZHqM`Y-+(rNW-M7ncDacbBb^(+l` z85%5Fd%Hr}x3+r1B+j;WypGq|5c-hTlZdbc$_=PV_UD{;5efpZ&qd~js}V&;D>&ow5bqx;(q<7PaNq(Y?(JSy#26gBh95RHfwJ^ z4eNi>bjeprd&&k|=jRBksEyJwR&uv>8dZy*G?hlb+?~j~2TA(K`S6}Mlk$R`O;tdG zK7L#?UTY^yjsog-;A;w85$tt_JISI7O{Va)Ry@Qs$J9k*;(55WhAJuFE>Lp-@}gh-Scuvq@mi*&kUJ zjbN|--<5X$-RdI&h-R^sw-AU>;;K@D0XHJj{n1Gd1DYD!IWToCw4c;MVd(C&jE8_vc3w6fLrnVa|)55vY+bF7$?w++-D5@uScIZma%W5n|-- z3k~N0&I?FsDy?0J1q9DwITjGFL7D{*EL;?KN)|C1x>t;BX?rwitn=6;28v8m{$%I; z-Tt$V{;p*4giH8d^eIp2NH3W(ZW(i7rBM8;Tn`aW@AT zci`ruxF=JKUZ(d4sRN+wz*=!(q}#I8Yee!X?&g5Wyc?xKAq}0mxi&J_M&%;qQ%2Gd zi=VJV?~x`LSeI0)pDH#D>ZlTiB8zClVyA3bOcgk8M|Jb)sc+sz&phUAk!rpOJ!+!I zQA_6Aon)#i$m9Rqj?~_(Nw05$B z8KV{{tF>T#{28cs;8=HHV>+;LJ0LBn+dUwJu(<=Q6GuI$TL4d`sDe!_-(y9=bIa57 zAI^ZV&ib1`G>IlWvf?!dNNH@jv5y~DuD|YNIYTfYpJT8ml1W>lb+eMUu42`eXyFXv zpxJHKpp}zXo1-;uG~ukgVo^dsFvhX0DJ@-EHRam&rftKrNlhp)UYDoAf&gXmfosFO zWXKFABSkxJDNX@|4uUo{J$`kAdm{Bl*7lF2%B?Mo)%qK;hJ%S}cnZ529?HN03E8Vh zu#Jk}$avV19RuY${bxvxbS#k8AwvmHCNz#vdAT4?UPoja5ATQ^Z;KKy3iPo}(nw9q z5)!^5d=x8_1Hvlhkg#Go9IRdr$aUhflQ1J02MkZNV4K|S)*){6y_UZ5NdOZ%_tniX zZha-l3gB0*y^Z|Z(AUj@Ogo@7`L&_1iuNr;ST#!9`4Oh;hX5~+{iYd;)|x3_wf3L? zHUA27O%PvJGIh}?wdCuznqM5=k>6UJkp7Ez@7})t_Lq0xo&NaZ&38wLoBa93+wWeT z>VzXDUIjoN<^cu|Beq=#>bel~mLgxV3o#jFWbCK@#R^7pwqBu7M?*L8ZR8|}xkrPr zIm|l$-W6#a-c=Lg-*B*jTBo zxD-bFikwKJ6Y;y~VfL}Mq2gK+2~8`mE5ZuM*8zP#j|cZ6ql!P92hmc4RlX#?ZxFBK zqyT2wXVj9@cR?;Cb6Ifr(U~riYA>XRUFZ)74?1O|BT969q6EJhP|KB#9?FRmYR=eN zFoSc|Hr-z8L*Jz;f^)0R#VZ|@Io0Pw@iEy$b}XYh{+1%!+GonPyCvU#x7^CvHt#aB z#mJt1f6#g{+%ZNE1@6c(f%T5tPJKPE+33I8u=o+am!l(qwFD8NSYErb`-?s=7C!w7S z3HG#Xg;&Pvv}NYs_W-2vZ4$+2*z)UxY1eo!69E!N8CIvQW^xVUAx zpe?COanM;s93iPairEbf;>+xl5TV%(z=pljM}lNc4QNowEWA>itF9UlqHu=@L_R`k zTmX?}@qy5u@5-_O=zon2&OJap{!jUT_7YVa-rr^V`#LMr`CgLG_ht!P9mQ(zEQP`s z30pTGOTGpFAb!O>3Hl44isMVT5O=MelRC0Shzcs&iwm_s3oL7YYjn(-qAduS)0l^N zm8f0#g%B@!jfGJuBlq^M%-H%P;Yz8CE2+c=KAb7-S=}deDfQ5$mCW1vV%U&8AS)*B zK7Jey2Hr_oX~$)l7J_2VeXqP;Ir6>D(qKKZN@$6L_3TfX=m>%B4!L&W3}kMv%dNdm z8yEyV6xbM`ae^>gpsCz|?HPP(F*1bET&%`~cnEg3ZB_t%I_YI}(UzixdR;gS{#Hs{ zqGcTriBw&&{jv~Nbwz|XUc~vAy1MaZ{%k6kz>+zm4S*@L0h7sXfhO|a^$!D0uzp4k zM_b7b(s^nByX7*ws=~larZrJ|y6`TrE9I;}>)oIw=S|ZC!b3>98zSd!EK-i5Hx#|W z=pZfT2tEaAv6U2pf)<$WDR1I5gkPjeu8Fg6RQ8RN-C!T7<1v9Tq(%kD3pvPU7g z=R!_I7^nIS2IXyeGjcnJYwEW7Im97Z3H(%!UXbLw5v5P=Z7fnx?#o7655TRW^#J5b zTJOdXdp8(YZcN1HUx&@N8^z&z*rUeT-i#d2z8WaRHB%@zM4hy2GcBpV8(GUn(<)eB z#?*)>8M)*Aen0ru0IG(*r}v}pH?XQM3U8`wz~O5yXHb-9*0D;npFZRZ->&I#Mj zZERaPbCH#_k*Ap%bh~2gns#C(QE!^=>Q3Ef_Au_f&Qvr1#M>-*gOQ~Zl=W0n;-MQ1 z(}SqDR2UBVOK`POwf6A1lpq7I8@gOt7$6ZVYG?Z`=v6xc^o{Ptk|3(N6g_-S8MXcF zoAMMR-`>34&_l8MsF|ZKZu9^v?LQOvZzzV2I#YQwafLg|8|%$}{{Zdam8xHU){Xsg&v|oOKe2N36N}gacq7-p zZxS1(%*b>0yI_kBaB|UbgP6trr%%86X87#j*`SdmD!Lh~PDmoC=;l3&Ss zEnlw7Yn3+ZK&pU{NV>C5DMO`O1H@Elu{>M{rOL8gU$+vn-EQU7Bx8d0=#r*B)vl?5 z`xYv%`>#eM=i%>4{<&*e#@+%p?};60L!{F(nBh+*@~8~`?N$#d3#GD$lvO1^QJKt07v-FR6G5^!{bg*j*4kyeU2j%e&c= zI37=moC6=>qiUNuwj_U}?k&8j$7NhkRKOZ2DXbt*a-0&^?V5}pC|49BT+QnaL8AuNSREdrJSCwHG9>$f- z+Y-#MV&v=+h2IAFbKEEuX`IY*ix)+1p`50Su?;A&P|cEO-~faw^h%jp?;-j_b*cPz z*Mfxo);b`wS3v+xgjouehVy@kz85gNH$e&k-32As6(W)XE34k_@!kA%@?gcp;I_n7Okr3IeiDGAn_d-5h_e!p= z_!py(4da(gB_ioV^JzyVXnH(#%=eA`Q``tuk(Iv3eM`(!?z=QDVK!Qb`DGkLWDhU}6xpk*3!{!$oxt;u`v z_|n4T%lp~Uv}3F*o}wErcH1UmSje49Hu4M%GQbz9ZZzzoCbXIGoc`|qXSe4%z?Lt=D2e98C?h?Vho$?_BkPj1 zaLsxl2h;Oe2KS>c&U_oZ1(CuBpe{!cWLq*uM^XV(<_jHA!v^YT_a>Rb1oGE0tB!Fw}_ji*hEC`1W#iAeQiNF&c_% z_%|DUEvnH|@jLumL3}d$=1wdyUu)SCZ$_;jT6Y%816wqV@1S^MBeDaDJ7GErz7^x& zha)-Yh4E@d=nA4StY9})Z1L6!&mJ31o#LgWXg_)PW9xA?S&aa$B&!**VJXnwKe_y$ z<>Go){k}@3C;zYY(b>PqEX)QUSrz(2)iHeKLqccV(!5hnKrJ+j+)P)+x|~sVBjS9d zHDQD1D#ZfxN+mNQqvYEm*CU|~k7WQ^IUQL30?K}&#CrMj^QCFEAR zZKXb@&;#Y2)J6rBN?UWD(I5(27bJZ^)i5HfG?=Dlk8O+1*sj!M+mee~_K{le8+PZz zuw1@4aE)KWO`PQOz>2al9CpT80e+XjzeS7=js|ECTdZTWXC1g&=k-Ww?sQjCf^(=E zot%p>H{b%2ugqL1^x)#~YTWH!Xz7yFWI4H*ij=Gjkd(->HClAz6m|V)_{Yyg)twoPCsgi@KLwL5 zQp@!343r(AwFOvC<|^;mhrhHAnNrlHXvVJBr5|1KSL=gVIRn(QG@_QBNd z*zcj)s}E__|9zdzOVYphTHdzk|H~hCpq_{Je5HCmR6RckPwW5s{oU&RX?@W6-tqW` zJidQ?`$=mAB#=55;)J?F9id65DW@}sC$77oY5r!~g}hU!ugeFKAk8<<+`jmvdS$It zr>wG8dq zT~>ZByDZb9=D58BTr%{IBZ@D@7c1}MiS4;giQ*PnFh&tlVwbg;U6xtwvTWC9Z-1o# zqG$@t&aU=>Gy#QnC2>a-_-7XHw@-TA>7?EM>%9BdKKzM3QW$>tGm6@iQA(Nca}oh9 zDDm#vURfTl$4l5N)TTuxoGgiPD-ZB6g42`X^cAuo+8d8&K=G%ub{UPMf>$v^OnIE6 z`t@v)lrL88K{VCaHzVh&it+j3e0+}kG`8$P6({EashLriMjt=sTye_#^@1)hK;e^< z3-r8Fd;nwvjz&A0it8AW^^YGfklUBbMtZ~NSCMM}EFPj0QPuw0;pOZ`M+J&c;Pt@JbSaWC$XnTm+LS0~pRg zoYfcX`tS@$m1`piZ>`z&lnwA`QsulGqxBsz$KM0qK^}E-E^~x4EKD7K(w}u%KLyB+ zc|#$fH0I%y%X)8@G2j^Syq5Ki-|MD~Ktkm4d3S}lKo!p+0Jr}I#XP}HgfUO2h9{+5 z5?4Q+6Q0vP7juERsZ-R{g}5R!udrM>G+%i{1orD0_lug64eihjHKLn<7@v&DRlh6M zZ;8&$f>=5X6GsT>+y$U<=RK$ue&@Zb=$?*H^Uj!QygY3~HEj?bn1LhgrtIY3xr=7L z?B$>-AM%vfNQwFk)(3Te!`pTMP!vuFcC3y%g&iVKd-yS@>GKGRT=lk6y$wyTM(96l zdbf@89k23`SNWgT4J0oD6}%{C-htB7E9h{pm?~HiRRA@2`LGhysS_FxZGr0N_57OG zvytRDkC%{PeK(6&aKF}EcmZOVNKCE|SnEQCH;7itlye5aPI___TK^UdA`Qjrb7XlBo2hK&fc>CN}1gkX*%=n(6*QzVG0*wEba2xrV8T zxUn2r(uFl?>z5BCvp5pz3;o&=jU;CuaDzGEzvzhMm$yHtthz<*51A9jCF2Pa^Om`T z@+4>lMwA{ayV7027j8MyPk6>UY0XVosPqHafQqr(1jQ?BMeXtGY>T$qBE6EEF7RBcn zO;nmE6a~mQQaz-6QZ@Bbk#ARd7u{>F!%BLP+JjR z136R1*~xl}#_ijB_j|5FN|+w<2q}SfiGY2k!W%T!XW6j4Om3tJVImli@!?pn^wMXr zXaPo*@=G9viOB@Cy^mPQScia^bcj$Cf&3w#=^H73gS?k0X4dnR|d0 zmf(Ree4(DDJmGumtZ9`Y_q-jJKq+P3kt>zB3OaytI^}3In($pv4H;&WeT%Tgr&K%S zIZ7_sMMFD^J`oz6DpSG^BPOWie2)@G?h11dyRI6Q+8!$L`w=8y!_f_oaFIGIqQSXUMT459%9o@SAVr!;N#ry}AgouI^)4eI>rS zmuIC}Q(?}Ps;EW0DdP*0#OhMD+p5E2TmfuS-Tf>296*zU&R*RoUBZId%sQ`aPQ zCVhmq6$WgEKn`nbYX;q?g>1(8>r=`VOd1gQ%3zz?nXyb6JGgr_R){haW7rL-O=8s* zV(}se+!#%_qaG6FO7mrQo#txcLQT4j2ph4cp%QsOM1X}@^CbKWV%PVHi`zIjo1W^^ zSd?F)TlDqxrnsg_eUGkR?1*C(p}fhdZ|NH9z4xv28}Cu*MrJG<-70;R_ThX>H-ZX9 zm)N<5{h{Xd`b_%SU8J+$MvsO~GFhajVx#S+Je9;*&y=5~dxXzb5f|B40?sm3dz8>O zyh=GK9hBda-?6+Qr%IMcQ33KZ)(Mf$bL{3h)_IO$%dkk$>H2C8HOoUFsQ}ouBjq3{ zSV_Av;FP9jO6{6t1MXa>Q`T6jXAGJCK0U>W z`?GOl2S?FzYA2kp7`E9X%fEuOs?N?i`)uLdIN=P~4o5`qR;@f19c4m&LfKI%==RHc zIm!%U1cWwsWcb6(@ZD|~Fnd&Nx_$9RP3H5zWUIw5G*iuvwj@d{SC5@_Yo%mJRF{dt zO&I2BDLcKK(iaO1#~cUvAOyI@PD@*A!{LY8UXnMa5J*L3@b?RHdLv|;pT4;n&$sJx zANoDlIs>=+NOPey)8BO>A20{TRnNnwq>%ULi}~DkPEQlEbt2@# z2(w&3ALo`Wj$2~WJW|FtOo*=r_&kT>`h9YlEjQ}xFU-l5U+8;JhY>5M3kz=XKkIBr zn!ZYBMX4`5jCrxlF6iUT^>8~PdHg!DX!|GiAey4e10y_HO#z9N6N(5T(UTV8s6idj zj+%6&N6PIPe_|)Aod1()%pJ9cWRoKgEc*oKzcs6Zit5^46?ux@&;xvl+NvLxjG?QYV|^G<2CT8bZwXu#k*gB3_?F*?7yX-F(nmX<>Y;ei-#`qS@YFBH=r4Q5S~fE8j8tDZ zn`qFu0lI+;b>o>f5GKN!H}$+xL$$}06}gO%)7bK9P^_tEhVjoHWSeN5Ze`5 zZ@{S2!)%=5fjzG=1WbjGl%Z0@ornvzZpSV>Gw4*f>Bb{W9WLKGIdJn&}iBYML zC48uw{*@=DZ90|!%m^j}{l7pY@5P$oE!`;;qe!&o`w z4Lg)=HU+5!jT5Ba-ov#)fnx|miOZt8X&0PQ)g^s>F zqm|iKmMB>~(4G^|30BZOD^aitN`3Fe-p3}zNXeR)?a*XE-qPEmW4ah05HsP-(L|h%sS&C$d(NGgccw)x97BCYg58Ux78NmSM>4 zg{dI@?dA`z0E(s$u0R#v#jd3zv(YRbAx+Yppfk83P!z+la|T1wm&m_vy`?iw*rC!j z&O5Opvqh!D$6BRjWn>*tHZKZ*)TZ{zKn-_VW#=B&TUE}qLC&LchMR<2gR8)4eN;Mk zl@Bn~&BXwT!s_}mQOC|5M)6j}o#jx5PeYuGLLG!y8an+{>!3h>6c4oydavzRc{5kY z%2V*^0fy`?NNjD(Dz-X{_Bsm4yP@VTVCPG3}4_`HB@dgYM> zWnvEZX#kQMF+ilj43VU{6+~ES*sx?>9pBz-(7x*zw%4j`H0hoccMl}DU}ZwbW#V83 zqaX^UDZGgU*je>M_FKB#{8-G>NecHA)D5_|f;VniHJo(j5@=|+m%E-GrE74A)1JK=%a*tODV;g$y2aYVyl_j{-jr- z-c?!$^HxMy08d6n4lPt+RR#fF(=A<20D8{koqV{MsNe{1diil|;*p5TJIUdYFY_dV zYn;C-{ECPG&^Nqw!LJxUM?H8}Pbp!yOAO(W!Vrk%#r~H~EsBX`p$mu^$lEcNGp4V| zSWTG-ox65{2Q5ZBkl(J)&jAx4dV1iHu>Gt2;$?A(fD#3`QO;N|Zy_F)#Ne_hmbi#` z(PuaTMZd`LfZ7z$?iC1KoB`;aFg-?TQIrH@s(BxJiFUY_K{b2Jx*I9O@+Ljc@;Th> zaK_MDP`1U~f4Rlne~UCd^?hz#sbrMSr7KFZ;jBb4YbJ*nCC#q1Ii(C)^Ke$7_D4g> zGYXNLik+0F>Ad2N)Q+TM7K;TSi6i--<0c+kiN}hlaL7oy!s=ZRYBmkc8iZfOTN){G zSh)j4jxUnt%;tcy!z9wGyhpS2GJGtwL4Gq=OyL+e@e<+leF9jM(!@L9DN(4DHDl_c zr&+0|A4B!lHmZ@k2ASVg0dzQ9TgO1nMiq?$YIwhRfaH`%;4RDhOkGbkXQiLL%7xe4WTG6w2H zOjtP@=4N|kLxr5x%?V@>GbA#_iYSHLm7`pSj>*maDGA&Vt3k?r?7;I-NQv)^(RO9# zJ7ZKXT$)&0KB8k^v-nE10mK{E3i)hyS~8zAPqNlc_a1n8baeXi#gD(fI8r@fUYIM? zLwi&611()5TUNrFEfX&{i4vtWNSPM@3NoI&%&Ko8w2LnJmEx1xbKrB(9Ym6RjNhKwE$1X4ANpd6z6P*3YC*j zsBssE3k|y=mNG`Y?DC@Jp$?j>u4%h?ONMgh7H@P3+kpNfZeUi|Nil6HlzJA&)ju1;Fk@TUmBfldj$q1lc=s>oj$^^ms>w~vRP z^vc)tjORXXnPVbuQCfiZLEYOa}A>fAis%h@1!p&iRZ$jNSF51*{r)lsGF(n{rUJ|Tb z0f|RA62>f&{DQvuN>d|sE^460Q8?(9+`LoIEXPUgBpNnTKDUy#4n)k?QZSYBe*gaT z)h};fynFrAk3#jx8CP!25(R0wWNTLP_hZg|6LkqmEE<0cQR!^N;s8zo}|-w1%Ebumc?9}3gZ_4=PKdtv;$$q zuZtz%5e*wqr|-7^imT-JHTISR(mJ*@cqjvakPZa@Ka{_N={?(1I7S@AOqp-s8qtVc zefyrr>s_|*JhrZO3Rb_DtM*dypwY|}MV~L>@@dbJ-oJ{^dCOlzfGa$MkYvGJLcLwq|QG9HI4_!T9FzY<$!0Y8Cw>h&ws}LO{L0ydEE+Examz+G*c( zuDeIDWl7SEd|M;GM@yi+gz(G5`S_(($p?u00C686E{SitFMDY4{;2x_ev`w&$B)VL zvyUGO3>D9>VS6pGp#&Ntfy(8{%g(&}VJgyYe08#zc4i`@5S&{GmmEI8aL(Z;5RS$h zIN@ar*&javEY3&vi3~)@aygV zfU~d5{+k^AKb6Tm1Hy)0T7k|;^Vy~W3WT!m1`t+2VN{D^ImZVG75?~fIQR!%NV;9P zkJMcRX8>)$>#M0aOvVLYO$F~y*qohq)hnX?>Wkk=x<@0ogW*jXn*9gt&rmi0z^&@; z$uhJjGwkDr_~LQd&cYj!(_8o57oq)w8)Jw4lf$;4{e#$QvKF&dtlOTx5Xt^vZ5a;)eBT_o-X4P#1#+3lW89a-t^`tlAq^D{49L&axFC>TS1IN)aN^ zFRc~vuYcBmEV8PJV5GF&PJ2$(toZkS7R8sk08HBw3CwFqAYASJXFaA1lYCyF23x11 zi@mFF_O8C#A=GdcJbb@X2S=u_;T=u0{Qz8$%Ke+rDI`OdG;%0Z@{SBLH2#C{W5^#< z;g27mhWB28_Ym5Hvv{$~9$dyV-h*qcw@}ROHD3S)+Dkvfl$6=49q`8=P&4Ud0H{IhJQ zy(~IhaHy1_OorN62zLE|Z8BOzss3IZ1ffPda>gD$4b~2Lz=5zz|EsYPj?$|vX&^Ky zZ7ZGmr3iznPH7fQX=ZW%Ne7>`y8UN=!~mib{o#;;=!_1*Xx1GL27(je;~9q!Fbw;+ z3B#_hG7b3CNlz;FueYiP+m`jS7Zd28o$&RCNxR*9 zGqj_H)^YInWTP%vAkL&DA>@niEFQ5 zpZW47U$HLYxxJm2@s>WaQFby!vOF0~JN6t9>N)h{5Dz`@;%4!%=R`2#d%>K9BA%m> zsRV!U1T824CkUef4=p+~!AWu6P2>lhiK@Hk%*Nhp()s7!v^4aQnFXO1(jGwge#I^J zfQuE2{hMH!Z`R9I279%M^Cy!(@0{Ip9=;6jSlB0^-01}HrcLCgg}vE{OE?nya65~F z_9sRRO~e6398km;#|Zs>+Q0&nEAoJCsfzxcw&w15z_+kc^9D44(jLCuBuppuA4sC# zj~~&Z7;zqpImY4-^1*ZP8@MS=aa*4GoqLyDGjo*&uHPe(;V;C;)fV6{%dWA<=Ic^Z9LK5i2e-`%F5_)0=FB?Zs6mBWS{{ z#zm*ppKt*tot!|6?W7G>JI!V3VXr;xRZ$22W|69cA`6NvBUKYcCKQ=FPTycrWo1g6 z2cLesxx8iwrelFclVKBw#>C|ot$n|#B^P0iPqUSY%k%`yuYJIjU z6M#DCOt*(_fuWdK#*j}?8;iriWH4H&+Gq4RQ}r(CbLn(ADSy*5tA|#Jz(f=xFbRop zd$?p-Pp87ZatnlvKy;bJ--YRwchK}pVoLqt1ailkFdc>)+9Cj52XK98$H2v#r z9lFkzebyq3*X?DHNkz|X^Z!OoT(L1(FA@%qu*SDK@AJBa^--;-6rw6&MtjzO$Qmv$Zs#C>ThGuh;a%&wb z6Hhy;use0g3Ef(S%oFH>a+y>Z??`xY*B)MjQUtrWV!Ks%BF#9wG7i{pFrzL?M^at%}=QTi{h^Wc$VG z^OdrvKt^QJ4g;&7Ukh}~b~sFX!>?72p)_ch?rSp}=L-ue$wbQD-B5>!YW~cjPt_2&l#3a=cK^p5OI1aeF}- zPa)%mGHxRBKm0fN_XhsGfPX*3zgY}5^Ks8J+J|Bh%1+2^V*Pvo$6$_Kq?hHoQjo0FD z@TYTqGM|b!GK8q*3l#?J@@Ex(GL51;s$kJcxTtNl_LwF&BPp0wD z`xnwuOSii^OeVN^qpLf93=9AgBrR&YGDTafSD_T#i~wLRm>fBauQ+fCmzxbK>3TvC z<6b*TELvYW;wC=W_wpS1QODwCJZo<{wFXd7`vWAMhLe6m$0qOa&u{QY>qfN^U8-FQ zzNM918^g6}IO!l34z;)xOh9+AsikzF{_Z+_Ghq->}UBd1@1tRsmwW!YX!k_!4Klf|c9Av%s90E%We99Tf@C;liHGn`C z>9XMn+F?z!tz=jyWRv5sd4`96q zu(Ajb+m{3>mjD*a_9fhG<2Q#8H-xD18>^WYan=4?ul)vdNBidhJ)wRqxe%}87o8UZ zA={?2h{mrDAqC1W#;>qT3>K^Q&%O35F1!{$#CiL5_q)z_(fEhw!^e+*IP47p0K!S_ z{DA-Wp5Wi^P}~rV`wmC*s`~~}!{55Fldev_13)BRLRfJ45XeEud7~47hJ~B-gUme@ zKdEv64Bx3R0K+2)0~9Nd^J(y^}$Je826#R5q%vKS7U7;n<9; zN~=4JZJVfL8$I{XL>DEmL82h>#Jl@JPqK`H{#)>liF?D=-5QmTbdF}0o@*SUu4|-q zjBI_QdbmLY$&&yI!3X3W@4%(QH$#F1C@mzF5F9Ng>nU-jo)Q=Ql(28>$Lr zjYC=Gkm?-DN}tHgveu!jb|~u|QpLkRPRE6dEGM5W{@@ahI){Kk1qXhbHwsh z3D;$_avvq{$}g9dt#t4orB{0J?2nzc(+L!Ti1yp0qywovCozh)YM#b7MgL89@KLftdjfSCw*Qb~A2NNn zEnKPERyv5T9{5%+5;U%VQ6`s7Pw-z{6uCbbc6v_FwumHaMlXsXOBrM-fE+2&}W|A!p5(i%=E46 zyACan&}g>$WxYL}XP0S?#%5lepF<3K)`Fp+J3h~&p6hGR^~1Nt+aCVT7D;)8!XD%? z)^)k(`1l)=`L-X^4_MD=|F7lbulYVkVd=E`|C;;O?zW93!SDMkWb7P?FhGg4liY+9 z#N+sp>zO3ZiS2unku^FH35l3c00)2^doBI&H=hkXuv39 ze5A-QjADM+38K3Btkfx3Xpp!)`SUbsgw&t{j=bzpm zn^@`oMIoAkq2k`wPV{xSJV-=m^U9?tIj6#sFRQMm4DE@Zc+F4q`BFRQXF_~*(}UG$ zUqbuR?d1HXY3t^n!tYycd4030X;*qX##AS)6Ab8jK;hKI{x+VC@n>=nrF$H=m~4}% zT_5{CSXHRNUE?Cs?jVIN%XOd=W)YKa)=w$WUD*|{VB6=iKg%EJ8|$>#ExPd$R0fbQ zD>vD+7D_YcS?31AE^6ptmB79=nK*(_Kis>iwKbgps{%)~1>%k@A_?$C(Uo&_Dv66` zcF_y?1*2c(a`-Z|nAu#tQCFapDDmp@b&0;ADELC044e}psifgJe&|&cRZN!xJ@-6P zRAsCr&kIU(%51Ftjk=xccvLDze5j2wo>nI)Dg**H);`k3pnk3^?c}~#gs_h0Ny(?J zpd_W{p$TFlV_5=5^*w^8l^7ps8zI??GDRRvhhN1?Q|L6uuvtHr@1;ZIr5%qTQDy4O zOV}5`QJ^#@M1fQ0cPInzBN;TLFtH#9%XAKO@-SPb)i9gip}%kC0GHheVjL?2QUd3z z%crIYIae-~?zpz7MSk#U(^!MkfJ7~K1>mE1ZE}QmZlly+m4A{;wjy0>&;DtP zhv$a-(_O)$EcJ0k%{GAV&Cw-X{wUmA!@u{sfHp0oBRY-tQ2bt=&d>Ju=f`?!<9U)y z^K5y#K1;)M%3&d|h;b(*Y<(losYJ3!=ZRMAzY~X)m+W)?joe1IrwX~Jl;k3`!%0c3 zFxyu#1mOw!aO18=FFOtV1?W|1>wYfdyuYG@=c5kmC`)8muQ!)gr}{1}+vnHo?xTAT zsNxh_+U$6^F|X^&fl?^2pEYI^l-?TLK=E*Tu&?0gNbH+uVf5dj7;Ks4LSksBT^Vn{ zL)UH0_c!LSan7ZSW#^2;{^?xG?X*3Et+#^3Dw8F)TEfPT*{m8U+J`aP z%8Md}u);tmDm1nj#exS@vRvKw&RPqKQ6lH_#EN zY?@7pKu}g6oG|L)!2zpfozv zML(TY`E*vD4NB|P7^1b1qu(ZV+5oZDOl(?*aoMaVrP7Kk1_g_)#LV@??iW!yngAlK zj@xOaNZ%zEaj+dKKeA+o!j?$AG$Gts#Zs~TDQQ|zkNidz?Q^RpmkZ7UN z%RMY%dgkZR`0E(W=vQ}l{4OydQ&A5sYEx2&6jgm1sH8nV5f{I~JshF$r~Q2y|NQXV zuj6!MMXUoPF5FF5OQ-HvkGIqX1Rv;gcsPCpSAjZXBl2~xE&zxB;h&__!j7G!&(J?v zyamm$P5VjRjq^X7d~MYcdiyh=wpqN#lEr%r4yHF+s(+1*Lcvni{r^b~b5bVvh>*(SvqAH6 z(v#+1O$^mR$0kIm=Jf2R0Qq)-rb}Qfx=&16beuO!+IJgC5xK(||Ht#qSZhAD; zmo(JEgCF1T!QO{h)n(r5;b3*_00?4anN?g|W=aUQJgL}YsfHffJqST!G2~h^96->T zlquV>ljcrHwVaM@yQ)SgkTd0R{hrZpT}B7nNs4J75A&q4`KT%uU+=qZ#`yB~Apf1J z6bl+3JX_)k6_vrf4{#&k0c>H)BD8TesFOY>NQil&Ku9`swC@hmgO8%6rB2Z`k!#6g z91)Np4L0QoVhOs$T9OqX7VSJ=7r$MvT&dk@cLwEQ1LLsOwhhnQTOh^nz1Mwd_BbO% zb8(BZU;@?%$8xp5_X%9!F&rmrZ_U5= ztZZn#%{>QWl`*b2f-c0jOb^rq%g;INVzJR^x1*%PxS%BIJPSTt>43lO5Y`uZ{zBaNB$TzWB z0r4uoOf$=YL<~2w=FDL*I_5@Vf1gaGnR}+$fp+(vDn zIG7x$B1ljih$RcXr`b~ti$tkl3vOkZYBry%-lP?zR1mFrmjI1I0ndxUS8NHtxA?HP z__)U?z&%5f?J+uQPZM{04h1EC=hb{!H+FUG{R|&3|MPh^ z{zm2Z#qJ~4?*pwtiF#|ovK=Pn2k{HfpF%r_;)s>AfT|}@bQnMnPE3ifgpB^89z{tH zk4*fB3DM#M#@xjC)gm!LWnp-yMT?In18P(H$C#;KLT(8!%2E?8*(NyQP(&={->8!O z&V-hrxEk^KF(tJvx=kw?4ix3xEO8QDmQC9|U6!i_71-ZLkW$ETlLLnkb)Kn!l^iHb z+R-8)ubYZ*qRPA+{tIsATln{Hx9=)cq(ly{&cs_AlJ?|mTIn=K@Q=}aPkQ~6if-|d zMm2dhP~V9q8;u`w1U%FgmRbI=h8x#vFG2er9f+CW3Y1@~Kuvb>R6*PhB9O3_^VsEv zZb1>x_Y=KaDGx6)=yR3gGn7)`5ju#6^P@)zCu9%D-zFil^~e%yLI-#J90eVwi#@`i zD)vQ+7&YejbO5w|b(dN++mrdcXxqAJl|u7psb?#JRA1=Isfun#TEu;!?3f0l3WxXV z0z+!%7pp=U%alW*pxY`Iq=-E@G6~PC1^+44XPc`FxC8!{j>q4n==f%I_&APGvtm(p zq)a?c3;4vYP?xw6$=?HtE*h(e(W7+y^<&w_qpzV6rph^aB!9^&|NHUd$Ev`yVwHcK zjEl$Ww~EmC4f+=qx*epwJJ07!so$*hl_zkFZb^X|>NarPpHdT2ixQ@LuIKx#Y{Z9D z1sH(RQ zF71I%=AxY12qHGM3Mwvwg^DV~M)&Ih4#^up$%MWz0>qWIRF0Odlukc_TL5a^AOWM; zE?l3Am^j_EIWDFRy1o$Pyk;la%?}!elJA(tDinS6Oq|jm>$%o5ZW&(~8{m4p72Oms zQ8JcR#4o3B-98;qcRPBT#7Z=1Z#l&q;hRM8n9c=-rNl^nRoF^X($;kJdhJrv;@In8 zS|~=A-AR$UJa12*VI;%4S`~vlw++yqT8~9)1Ia%HWUczu_7q69`Ezi+c*&Bj7i)Ic zI@D8t6y5ue0fUhDEB4o`#XpTfgEXX*8GmOs3ri;QBVoJkZilFUvvv)QX5eY*hKgwJzzEv{1TCOr94hMwP@UbHTy_GHy1ITiMG= zT`g-S*DN@)I(%Oiek=FIvlIY$K7m0?gT91L zio#qHJ@=yIAi4qy3ASP}8%@v+kCHBEsW>r-)GvufjgTBQdqoNOQn~OM6iidWK!(z2 z2#Bm5*|=`Oq_N6OV9rGJdII7%n*x*BOG&>jD}J-GO!O~+Y~X@FIbcZMFRcctl=zlK z#1G4kk`pg3UXXew^h;WA>*7VEu54&b2{+qB{i+U04PZym9 z`(^=-4W+^Kyew@2u7O|m<4vtf0NtqbLEMOvI1o*`GODkYU}Xuq@ki2((KZMbaS6zspMDKOcyNbkmr^~b1 z0E^dKg_g(@NfPV>E~wm>mEd+_@;PW(c=bY|Yuc~ryh-j*={JD7Gc)n3g3%7feFDuM z(>m6wE14K7S~qYw2RMm`{k_F$SdX(+qyfYGmBRWkg?t!h-RlZ1b(hn#GLn*Uj2{5u`6((s&)@@e5300hvX7;kZSwW=@j)f3?+UGP)N_NV%$ zEf)2k)od&;{ScoiEtvAYKqmDNMNJ*?!s)M^3W|}`!UPC(J1!g5boeuj$v zIr5_o>tT_h(cYz!E~{{HixZfR-otn#;UL$yw~J%WBtZACJ;<(1FVXj9o-R<1erz|k z+@aER0Rz1>IN@d+P7v0eIKz{6e?LF2;~PiXZlHO4`}I^8hkj}U5MjN@W~mJrH%)bo zqh4cZFkSDy!(V0dbl@Q0El(1gMcR;gTH|&SEL2jc@7dagu;Ys&V}p#= z#_lcEXLV~ViECy_oYd2s<4hP6=UFbv(ZEY%(55#UTlVB9<5;fS`7&=QS#dE@IpX&A z26uusxnnRPa6k+2T3Qic=VGdWFHrqIK{MxJeKrkQC2N=lt;CHHA>Ood^DuKnpRYpg z5vyIcVHx6yR&0AimxMnVDYE{LaxGjVVBXVZG5;gpyJ4tJ*G()m7C0cG#Q}dxVi9Y- z(hKC%$lb1P3S!pijo1F5B#3gz>Ba3WifT}4X%T)hLaP^>wEHZ}w<1itVGNRucnmHR zW}-uswmO5#jjj`iBZ;p?{EZdPS^;8k4a6}j$)z_03=Kk)@!qljzgG7D>l7}S_kiHu zE1Q42X@SAKhDGvp0N{(z2!DZRR$ZemW_jq_A-l($Ir}JJgW|ruL`(-4;)UgE!11bp zzPMae;t-??$9O&6CW>BYTMAC13;Bl$^NB2AhE(nhImVl-)nwW~U+ zHbY`33(G3BxKf5jQ28EOrw{8pKqRNkHp&@GYAl#U0AP5f0)eS@1aqk$n4h7UkhFSQ z3S%c`Bvz&?e2JpJggeioxX0Z^=+3{r9VortJ|$ZXsl(CZIPPQatG?NNKrevpwtBlz zBjNtIbF+IGR&SXBtA@=Qel5Smh!YWH;&5_^^Kb-lA7=SZSI0NgmGGP2Z+5YY14fyv zvy?DirEhfvpSl+;QPwI3V24e&SDRQFrGddEOk!cYB3>RZ$dP%y;p$$cm+(s7-><{> z*PzX+)627zo3ICqa>Mau(j=j)tbKxXD)l%|@-$Qg?bNA6G7g!O!}-e!aq-ZX;D;fX z0hRiCPt`5BWE1ifSY=Hp(fnIe&c6EPkpdrw@sWfpCKB~h~DD#!F+#z35ZY= zprjR}@B-#cJ&n?p_KPu4pQITjAtWgzl_f2>P{rJl5h(UAXRO>vUqdtXA?0uJ?)cGfipSULlOu#VMM zHyhA#n8rz*0sm>PKeZ=2Mt%*<5Br`}#S~>U;6F{#f6BLg$4R9D`^8$tpUQT~IdaZ< z)kve6F|&e1>;J>l_uKexw?)RYN&#v*GBqEdU)X;f}`>rHh9z*(?UZ|EA499y_-Bps27Rl ztrQBh=-A5U)R^w6uyA*$jK8PcD_-A2R1I{C3x_JqMPs~uW>0PV#^O(PZ=)~{Z}7Ik zLTYG0G8hjBv!+)b=u-yaZYdP`NJg6-O`GGAw75dvFHRdExcdY|WG81J*lzT(;q3(# z9JCC!F36g~^KMmWEr4ylH?|680wWruH=kLlR*-M8UKcK0G1GVA;^bO0w%m*~-f)G* z5*nWss5Dt|>#hb?P_YMxrB*x-o}konK4M&XAGN9N*#z~~Mf;BGnLCTDPU|f`>I4!{ zG_;gxPTOPc1w=bggKO`!#V`%mIYu`{%5GUNiznBq)f%%UGOkq|zlvT}WHp~OAhxr#9fuo=+r75t|`yG5Ze=(M6hC-Q>aYK7Z)uIe8&T3|Szk>*r> zAXrr?U2>M`0sybMyBmCl%|T!~))2M#_4E_hQTLRQG4sh{Q7rzRSBn)n2GHrh68|-n zBczX70xCv`h+cfDHqwqyQ{T?Sv7shOy2I|_9K9e^mE!Pafag1;jt^1H9I0T^VytK~6 zfb`(`cJa)*~sZbiokd}_Q29YwqN~80- z!pcv{2)8T94}w)YK+O>)r*5b!`&711(9Wt@plKDET=^G>DuRd;uJ}XQ2O2pAlx^T{ zO+PJ^jaZqYPK+2JZ@Dtf-rja_o1>svS=3lVFy=A=Wp7I(MtHRE)xP&;r=Vblf^+~< zqBdYR;mdQeDDuJ?@9ztxZh8NNifA==D>du8wfHts1Crat+biiPv{8;8!B)X7h#Q3N zJ-QRftgl#jJB4eXqsqDRG0BVp#neLvdIL5)Z)arV(9|FGOdZfX4jNakRIBHj0|pny zKUs<;+y}~OxSHZ-xanf%?o_>21J$j3-OLVKW?PX*8{rPy!m>8AP0xg-A`5uo+li>y zAKeEs=)*(xg!`XXEGheZjvNyWIHJsIMZRX`d#B$bFJy+N4b+N-?T07i?T$hg1jgr& z4qCp1n-X8bQj7Q_>2~^uV}vJT$lTb<_qyP8na+`)@dVkxF_~dbcPu=OizG?Q;gDWG z)1!B+kd{f{<-**9_}xzzOAnY&>3%VtRyOZ(8$PLoEwEi zYoM2B`}>6%K!N8yZ{|zBi+X+Z@3JA_Su%sQm~@K$V#6h^GK_6iy*o^&58ln*4bP6I z4=T}CLn|~2L#|A+BHW}VcT6id-3O%qJb-#*X+SY1N5%pp;C%f^fB`fzHP_{#4=R8V z2I4L^B3s^t%7=oZzQJzG;JeP0Qj8JRt_~@NwASCt#iFS62$enQ(n^N+-2A59vW({_ z9+6#;zaH)B3LO^t_)@K%lz^vBYT8_=SfyGY_ z4`^VuFZU@>7cxB-4Wt3^yU+K}eK8xx5ONXt&ftqa(A*Sv1_3`1G!^sI#iwi(W{g3b zZca??Scyj@2iuA?3Q2Z5*KCwQ)1Z2B8M8^c6M4Q!OZ!&UHVl;gLy`S85Aem z3eAGn`rB#+FhYU$xI1ExZO!-D5SL1(%o~H-LV4W%qWCwCrE^Jsdc7^RMD;sSJCmUv zEfi%P%Z2bGEQ|9T;;Hafu%eM=nP8}I>RnPyx?Tnr$ zq?QIx`kffC4wynV@HTo>A!Eu)h1P@8Kh+EE)}!Af-@&u*(Z8~b2%R#ajT(AB^i|W_ zkEiTvvK~9n*?cuuJ^UgkK9F~)+dqmlgjcYRIS~(*LRVsB`m~{pQ6VuhYP4Jrj40^7 zM&6A&4&6BYI2qq@FE+LZgOrJ(JX8CQ+3NrQX&a|r$z&o|1We=zaGtB=Wd@*;mNPX# z$g`bE-~yam2l-~bhI1($m!_+1E``c%dIR4}>0nGzzDrBmr2Q_?r7&2c4cC?uyz77~ zh~?pjV~n5!|7Romd9so}QJe1Yqs;v%azCEj$e%Ynp9goebV4k;*Ll2*`CTP$ z_g;41_IokJeRS@db&kjw1B*x@A$e^K5dy)-Q$|kXC}SgEIHt4Uyga6{S~ap0qxg7O?}>DkHR#Y3vKS77 z421xPH|uo&ero}~sA7w$^K;q_$7eu%6f*$ca6FZyJ++5T2%Qm96*2zoIH4os=aR9G zo80jyJAqN*fc-KjB!wJ z1`R`fFpin2JSi!8YDpA=OBo8(>ryZ?sRPsjO1)N5-4SXJ$0Rl~IX&u|{tEk3W&x!_ zYw1^jwe?rm2ixwe&8NvW8q&m#-fQ+4lFXK|Y{lD!e%^*(u*~)I4qQ2bdG6==u*ctF ze_h5b(rYc_88Ik%I_P3L%kt7_SfjT-C7M-=_gkaZT{xj;WdRt_o=3h-~67e8>Dl)%G}(aQ4D(Q+pjA;*nX*j-~q zt`ilqnlW_X?{_jQE(GKBFt{{S0@0&$2&^U3bK{%atW4#pa0)lsdW|YtqxPgQX8g1Q zZGsCxF^*4L*p@*;p*=&kn0K?@&r43RkriM^UuD4Qj9&n$V*9H4r77N*KoWUU5=*_8 z(Lb=W45`t3DA03)u?}WlQ~h2om!9Z+e5Q2bCL`;#HbW0@VG`jj3LfcV5V%I&!l(8s zCbf+`nzPeNUWzUn<=_S)hinpgkZs+<6kY{#;d5+F`l!LcDr$?(aimKDo0ZvEbJ|#| z6Eq%0yn(ES{B(tLT%uvAZgqv5$hj8+`mvgf8bl(RjOPg%uFQXy-SRcg)prJT3|o`-PV8B zY(*o%nHBDYX|&GLy{tlx?X0IVmmr5o<8Bt}y$gYbSX`mfqrh0bhG`WiURt10EIC4r zb>sxmk)kKfjn`r^lw?IJO$%k1vMQ+r z>Wn}r^KJX67wh$5w|Ic6CTz~^mOub;oiI8oS) zx?@`g(Ltdd?}&yL7ppC;^aC`s5NU9A0ssjuf|dAE^Ly0eP5k6#lnM!dG87ARUC-v+ ze<`cZ6gcW|bz&#*+N5K8C zcJSkwfG&^cZ^F#W;d+G-yAnS zrR&BAF=v&v{YLJp-x59cNOtJus$BmzTMREJmwfoYr4I)6aRxW??QM(yfAGB)z)R9! zD>-`MX(>;Z=>nbdBzG`2XzaNDyjF%|Xb0N}IqSET71>ipFfKN95cJ?EIS_{*h6U`K zatL3rcj}WCHDh51HA!w^MuH&9@v~|OE4n;!he3I6A{4ya7zAX~!^PI4^p&J+k)Uj8 zQO_v|j*Qv$T*i4NmNS-9%xO=Rr_+)A22p;~!4X>n9u@(jqWbbuMuz)rHJy3eVoDY% zZKlaye$mz|=y1A+$_#sv@J*aV(>+pkpafDAffN}=a+>6%*Xxf;5f489LPL5?^S?5lHQfD5qDDa`%}K2eEN10F|lowem9AjhDek?`kRw5emsdRj%buVh9sk8 z@)pk8mOjvs-!S;3?V9q!O8rpahmiHMP zVv2S@u+!kBBtqM70nOWWA7JFm$Op+=cOBAy1waI=lWwEU+o)FyTE3P9F&BCap*R25 ze-B}D?VDvvX-!CTTDyEbsb_;G+sfmgwUa6>vV2&pS6Z-Dp(W9zO(H{nL4~9pRy$Ox z(kjtxR4&gc157cw``l|R!1;0@thpt)!YuDc0*6u*n>+1>mcr@Zii+9a``D=_ZpP4q znPMG>RiZ*e+^QcU%pU^n&4TSE{ZR5H9R8ves28*e(uIEJSl7bmhKJlzmcLyX@;r3z zE<%-p1EOzZOiK|*?J%?l!J&mXAljUhd0m5hY<*E9C}8FBvJmmFijICugOS2`T-AzH zS>dPI@mSa!vOjdDH}cQJk_@4vs|g}u0~?%lJvYogZO}1Yi9*>Dr@(-~1AI3k|-HF({`lfqX^OSK-HwV#`Ng9EmWa}(^iWwf#>08%Ry+FMfUHCR9k%1BUr zFz2OiZ{>{t1ZovMqVi1UOit(?2jd#?C|NGEsXNm;b%hl?EWkptW6U}%Bw@n=cUYtD zs`@ye*664@Yf$ZJJEth^&@sR9iio=ih@+>>#%N2NHnk`(RCy|vZqOAf9c7^@@wL3T zRmx@Hn9(n{w~xOf5t5`-`Zz-RXYeqVUG zhTE14C`7ejL$8pDl9}YgrNwGwy=*=2z318YUD};(IOGi}K{4)jj~IxWxOX5FsU6k`-8OWBx^lGnrqs=Ve8{9u=GhlQ7Lgvi#7?> zb|N8D6%WXri&~W+&2l^nTAC+eV-UZfC+fqwd6h#iJED5M0eenq{_1fe3@D!*k>IWA zGZj`&CiV2ge1#_9zv(9tVzk990A}!n-dWlj077oIt4e^ zm(PZJf=?N{OWeCJ#WBOl^Y-qe+u65WJi13_=twLIAZRyj7mB>->Af}~p^5gLzFm}C zcO>9u8>Rr+Q9S9H|74{p~uzW)}K3?6@{`1jxgpKG*f zOL7(Go~~%S_io8AfOs~jS%<)4;g?>>?0Vbobg!m`G6iw19m9?X`&W~-@-tfcNXMCS z9G`Ch=@C88mG^OH!YS{_wY1$)SkPmR_XREPY$II*DVLAggM?$EIFx9GGcm*d!U8Q! z`xeAiy5eBGp7w-z#MzDJXRvS@d6x5edrSHCDf z6mYaus?aDr{Q2!q=P!PJ^7PHiS3jRWd-=o5H?Kd#BRvJ$`Nt1$*DRPxH}cD&kNA^Nw6_Y^KPsfjHP#b`{@o|%fflQAQVVr3IQbJ zu2cgG-FJz>)`+7815B2O!Y4~w%fMs{(@~JwLTzA=)5~yly{dl@-(L-^-qU%yz>ZN* zad9U(iw^KMxap+m7}Mss6V~QibsbHpoN{~7^phOqq(}vbCijWSSssbf8>54e_b?Yk zX2MngV=?m6gLmD#?ila?J&Y2UMF(ja3|)8-?R~)9ZqOt-zQ-ZqqezhaL7{5~TUTV# zMivEXnIuYxwAKq?OJz=uk8m(2@2Z2d!~d?!3Ozx2v%=jMm{-h=3vun=Ux~|99QuCL z_33@tmKUpH@?exA7-S?S47)4>)TuaQ6p|TH%S6i2L@zJO73t<$*wdgPUg!?}K}|XI z0sdVJ6H@T4lG=uE8-(vc+OU9cvjhAdUW#aN(Lus9jhrh&G1oy9C)mIwic%JcO0>|T zhc8{9;z2rP5u&OvNe4}7{OJ@IvEyX$aK2W0p zlmHv)z|sv9K^6~-cAl?`->z54iI0wt2=K7kBDUG2H623}(G6VF*uuPvls(y@XkEm? zqfZKBS;Di)593nM#dJ}BP`P3|KV9W*J1E4JnHI2d+M;=n+WkO-=}iXJqV&3~M9j-a zqjd4Hf@Pimq?6L~a||a~5INOSd^>V3C8HPqj@z33ez7Xom{e*_GJeyksCR(2oY6|9 zHK8&aliM`uDLi__h)f+}$Fz?TbxTgG3U^Nbz*ASQ;Ke!65IU3w&+sXWu~J$gZc)M@ zS{U$?%S$A7r28ImdkUX|^yE~<0`G+LbBq+POW;D{zt5R75)WEdOk!1$?ktp23%Q4v z52u9_Ln0{CF{B3~N{ND1j0&OhW}w<$vM7&s{3tCLt_nC~f)Yao!=QiZ5pyN|=?<+8 zrq!`CPaQUkd6!l%WAZYMf%XQ}PLiY@l$u0)!BWW65^k~Mv^lNLGP+hLow`%ubyy}I zX;vv|Ra$Jw)baVYg|Ae`-pUJ%e9zNvYjYsX8i6N1qcalRYG@9s(gW zMGV?4aWs2J%o-A7-yUSMZ)_nCD|&2yHu>6n8|i>)$c-b%nCi7C6?RcndMZNO!4X6k z?%JC>g@CLua>G1V^{^8a$_)dnl_o@4Wx_oMpJ>Ww3-a!p+uPC9yo69|&;$ZJt|=H` zf51PC4=7{)@y^xQyj^R%g*rt+FkJVw1_{PFgl89|3E?mNmTw=R=EzJ4F1xGXXmt3< zbPW?*AJ=LYYnVZv)u-#TRM{`_(25<<7$w>+Et4!)xTQ(5n`AY-N*l@7m5BPmVm6Sk zm^K!JZ?Y8)E1p25t8@W3Pn%@(7`0JyEugl0oU0y_l-%^KPA*aBJX>ifuJvmP`nfy_ zT?dL;>t0Ql!z&T)#=na;xJ#fwuTw=X$Z)OUJ5iQluF$Bm$wLLi8U4@ zMjTD^4q${}~llqPhntq4*k%x3}UTRvs;lgx! zC}65lW+*~z3ztGPAx%3Nw0<&Lor?gc=D8J$ZrYjK9^I(u!tm6^otu{UK;Y4=QOgo8 zkDVTInFpp%-3lYlbq)T#5PvDyEw~`o5rVEIPWoyW?o{fi{KxfF7yanf#xo z-_HOSFFc25EC53Ibh=|XD>f`=vsD91#% zBZo*+T*B?U^q=>9&20l_y=o2=ocKlOV&m(FWH%g6WBvY;nLuLqgVpms8sIUM=0(l^R5ayRjiHgyOw<4)hC_fRIwIL6>D^= zSob+qtjVe34o(ewX+QF7ICUp7d~~K+Q#_I8W^^%3)>vds<4^~W&X5mb!mkxy#t)=3 z2yL+YHpp$yAzuDyphF)biid#Tyj~rWBZOCQ6D_-L-As}1N^21DrWThSy9e1Zf`@m!WK%5=Gm*C ze!<~w<#A=&4Jqf|cEnX^Y3P9#miNN){sGkK%{Rjbn_1#Zrv#igJx5e1rWVib+cn{v%AJ~&J%uG>XE{{vr|0s@%IVSqkw zpyl`ZN_^@n`}^u^z`?-9f-mX@W0W|6z_&AT$V+*bY;irLk8De)Ks1fA$Ztj?^uv$; zk$uyK+-W7qIugK1A*f_O!*40*Qxd2RZaGKF;iWqPf7(OSgN?mfgbIHsmK`C15uFFnD5CarnX1Ro&Tsf<-0prFR-u!I^ zI3=}rSHT%opRk`VOK5C8_1wkM$Eyd_0(QUr`~x77BER-oNPF&hof?C9w=Vwum*-v| z-Ih*Fok6#?8`?C#79A{!)W&dlBZ9InTdT~#c09ML|1>^?9Oq>*(ZnfTl1u=+Oz|-zbirVf0&7N_6#$;lA PHBSF8<-!WuXxak+xs>sT literal 0 HcmV?d00001 diff --git a/app/bower_components/fabric.js/dist/fabric.require.js b/app/bower_components/fabric.js/dist/fabric.require.js new file mode 100644 index 0000000..6767b8e --- /dev/null +++ b/app/bower_components/fabric.js/dist/fabric.require.js @@ -0,0 +1,12541 @@ +var fabric = fabric || { + version: "1.6.6" +}; + +if (typeof exports !== "undefined") { + exports.fabric = fabric; +} + +if (typeof document !== "undefined" && typeof window !== "undefined") { + fabric.document = document; + fabric.window = window; + window.fabric = fabric; +} else { + fabric.document = require("jsdom").jsdom(""); + if (fabric.document.createWindow) { + fabric.window = fabric.document.createWindow(); + } else { + fabric.window = fabric.document.parentWindow; + } +} + +fabric.isTouchSupported = "ontouchstart" in fabric.document.documentElement; + +fabric.isLikelyNode = typeof Buffer !== "undefined" && typeof window === "undefined"; + +fabric.SHARED_ATTRIBUTES = [ "display", "transform", "fill", "fill-opacity", "fill-rule", "opacity", "stroke", "stroke-dasharray", "stroke-linecap", "stroke-linejoin", "stroke-miterlimit", "stroke-opacity", "stroke-width", "id" ]; + +fabric.DPI = 96; + +fabric.reNum = "(?:[-+]?(?:\\d+|\\d*\\.\\d+)(?:e[-+]?\\d+)?)"; + +fabric.fontPaths = {}; + +fabric.charWidthsCache = {}; + +fabric.devicePixelRatio = fabric.window.devicePixelRatio || fabric.window.webkitDevicePixelRatio || fabric.window.mozDevicePixelRatio || 1; + +(function() { + function _removeEventListener(eventName, handler) { + if (!this.__eventListeners[eventName]) { + return; + } + var eventListener = this.__eventListeners[eventName]; + if (handler) { + eventListener[eventListener.indexOf(handler)] = false; + } else { + fabric.util.array.fill(eventListener, false); + } + } + function observe(eventName, handler) { + if (!this.__eventListeners) { + this.__eventListeners = {}; + } + if (arguments.length === 1) { + for (var prop in eventName) { + this.on(prop, eventName[prop]); + } + } else { + if (!this.__eventListeners[eventName]) { + this.__eventListeners[eventName] = []; + } + this.__eventListeners[eventName].push(handler); + } + return this; + } + function stopObserving(eventName, handler) { + if (!this.__eventListeners) { + return; + } + if (arguments.length === 0) { + for (eventName in this.__eventListeners) { + _removeEventListener.call(this, eventName); + } + } else if (arguments.length === 1 && typeof arguments[0] === "object") { + for (var prop in eventName) { + _removeEventListener.call(this, prop, eventName[prop]); + } + } else { + _removeEventListener.call(this, eventName, handler); + } + return this; + } + function fire(eventName, options) { + if (!this.__eventListeners) { + return; + } + var listenersForEvent = this.__eventListeners[eventName]; + if (!listenersForEvent) { + return; + } + for (var i = 0, len = listenersForEvent.length; i < len; i++) { + listenersForEvent[i] && listenersForEvent[i].call(this, options || {}); + } + this.__eventListeners[eventName] = listenersForEvent.filter(function(value) { + return value !== false; + }); + return this; + } + fabric.Observable = { + observe: observe, + stopObserving: stopObserving, + fire: fire, + on: observe, + off: stopObserving, + trigger: fire + }; +})(); + +fabric.Collection = { + _objects: [], + add: function() { + this._objects.push.apply(this._objects, arguments); + if (this._onObjectAdded) { + for (var i = 0, length = arguments.length; i < length; i++) { + this._onObjectAdded(arguments[i]); + } + } + this.renderOnAddRemove && this.renderAll(); + return this; + }, + insertAt: function(object, index, nonSplicing) { + var objects = this.getObjects(); + if (nonSplicing) { + objects[index] = object; + } else { + objects.splice(index, 0, object); + } + this._onObjectAdded && this._onObjectAdded(object); + this.renderOnAddRemove && this.renderAll(); + return this; + }, + remove: function() { + var objects = this.getObjects(), index, somethingRemoved = false; + for (var i = 0, length = arguments.length; i < length; i++) { + index = objects.indexOf(arguments[i]); + if (index !== -1) { + somethingRemoved = true; + objects.splice(index, 1); + this._onObjectRemoved && this._onObjectRemoved(arguments[i]); + } + } + this.renderOnAddRemove && somethingRemoved && this.renderAll(); + return this; + }, + forEachObject: function(callback, context) { + var objects = this.getObjects(); + for (var i = 0, len = objects.length; i < len; i++) { + callback.call(context, objects[i], i, objects); + } + return this; + }, + getObjects: function(type) { + if (typeof type === "undefined") { + return this._objects; + } + return this._objects.filter(function(o) { + return o.type === type; + }); + }, + item: function(index) { + return this.getObjects()[index]; + }, + isEmpty: function() { + return this.getObjects().length === 0; + }, + size: function() { + return this.getObjects().length; + }, + contains: function(object) { + return this.getObjects().indexOf(object) > -1; + }, + complexity: function() { + return this.getObjects().reduce(function(memo, current) { + memo += current.complexity ? current.complexity() : 0; + return memo; + }, 0); + } +}; + +(function(global) { + var sqrt = Math.sqrt, atan2 = Math.atan2, pow = Math.pow, abs = Math.abs, PiBy180 = Math.PI / 180; + fabric.util = { + removeFromArray: function(array, value) { + var idx = array.indexOf(value); + if (idx !== -1) { + array.splice(idx, 1); + } + return array; + }, + getRandomInt: function(min, max) { + return Math.floor(Math.random() * (max - min + 1)) + min; + }, + degreesToRadians: function(degrees) { + return degrees * PiBy180; + }, + radiansToDegrees: function(radians) { + return radians / PiBy180; + }, + rotatePoint: function(point, origin, radians) { + point.subtractEquals(origin); + var v = fabric.util.rotateVector(point, radians); + return new fabric.Point(v.x, v.y).addEquals(origin); + }, + rotateVector: function(vector, radians) { + var sin = Math.sin(radians), cos = Math.cos(radians), rx = vector.x * cos - vector.y * sin, ry = vector.x * sin + vector.y * cos; + return { + x: rx, + y: ry + }; + }, + transformPoint: function(p, t, ignoreOffset) { + if (ignoreOffset) { + return new fabric.Point(t[0] * p.x + t[2] * p.y, t[1] * p.x + t[3] * p.y); + } + return new fabric.Point(t[0] * p.x + t[2] * p.y + t[4], t[1] * p.x + t[3] * p.y + t[5]); + }, + makeBoundingBoxFromPoints: function(points) { + var xPoints = [ points[0].x, points[1].x, points[2].x, points[3].x ], minX = fabric.util.array.min(xPoints), maxX = fabric.util.array.max(xPoints), width = Math.abs(minX - maxX), yPoints = [ points[0].y, points[1].y, points[2].y, points[3].y ], minY = fabric.util.array.min(yPoints), maxY = fabric.util.array.max(yPoints), height = Math.abs(minY - maxY); + return { + left: minX, + top: minY, + width: width, + height: height + }; + }, + invertTransform: function(t) { + var a = 1 / (t[0] * t[3] - t[1] * t[2]), r = [ a * t[3], -a * t[1], -a * t[2], a * t[0] ], o = fabric.util.transformPoint({ + x: t[4], + y: t[5] + }, r, true); + r[4] = -o.x; + r[5] = -o.y; + return r; + }, + toFixed: function(number, fractionDigits) { + return parseFloat(Number(number).toFixed(fractionDigits)); + }, + parseUnit: function(value, fontSize) { + var unit = /\D{0,2}$/.exec(value), number = parseFloat(value); + if (!fontSize) { + fontSize = fabric.Text.DEFAULT_SVG_FONT_SIZE; + } + switch (unit[0]) { + case "mm": + return number * fabric.DPI / 25.4; + + case "cm": + return number * fabric.DPI / 2.54; + + case "in": + return number * fabric.DPI; + + case "pt": + return number * fabric.DPI / 72; + + case "pc": + return number * fabric.DPI / 72 * 12; + + case "em": + return number * fontSize; + + default: + return number; + } + }, + falseFunction: function() { + return false; + }, + getKlass: function(type, namespace) { + type = fabric.util.string.camelize(type.charAt(0).toUpperCase() + type.slice(1)); + return fabric.util.resolveNamespace(namespace)[type]; + }, + resolveNamespace: function(namespace) { + if (!namespace) { + return fabric; + } + var parts = namespace.split("."), len = parts.length, i, obj = global || fabric.window; + for (i = 0; i < len; ++i) { + obj = obj[parts[i]]; + } + return obj; + }, + loadImage: function(url, callback, context, crossOrigin) { + if (!url) { + callback && callback.call(context, url); + return; + } + var img = fabric.util.createImage(); + img.onload = function() { + callback && callback.call(context, img); + img = img.onload = img.onerror = null; + }; + img.onerror = function() { + fabric.log("Error loading " + img.src); + callback && callback.call(context, null, true); + img = img.onload = img.onerror = null; + }; + if (url.indexOf("data") !== 0 && crossOrigin) { + img.crossOrigin = crossOrigin; + } + img.src = url; + }, + enlivenObjects: function(objects, callback, namespace, reviver) { + objects = objects || []; + function onLoaded() { + if (++numLoadedObjects === numTotalObjects) { + callback && callback(enlivenedObjects); + } + } + var enlivenedObjects = [], numLoadedObjects = 0, numTotalObjects = objects.length; + if (!numTotalObjects) { + callback && callback(enlivenedObjects); + return; + } + objects.forEach(function(o, index) { + if (!o || !o.type) { + onLoaded(); + return; + } + var klass = fabric.util.getKlass(o.type, namespace); + if (klass.async) { + klass.fromObject(o, function(obj, error) { + if (!error) { + enlivenedObjects[index] = obj; + reviver && reviver(o, enlivenedObjects[index]); + } + onLoaded(); + }); + } else { + enlivenedObjects[index] = klass.fromObject(o); + reviver && reviver(o, enlivenedObjects[index]); + onLoaded(); + } + }); + }, + groupSVGElements: function(elements, options, path) { + var object; + object = new fabric.PathGroup(elements, options); + if (typeof path !== "undefined") { + object.setSourcePath(path); + } + return object; + }, + populateWithProperties: function(source, destination, properties) { + if (properties && Object.prototype.toString.call(properties) === "[object Array]") { + for (var i = 0, len = properties.length; i < len; i++) { + if (properties[i] in source) { + destination[properties[i]] = source[properties[i]]; + } + } + } + }, + drawDashedLine: function(ctx, x, y, x2, y2, da) { + var dx = x2 - x, dy = y2 - y, len = sqrt(dx * dx + dy * dy), rot = atan2(dy, dx), dc = da.length, di = 0, draw = true; + ctx.save(); + ctx.translate(x, y); + ctx.moveTo(0, 0); + ctx.rotate(rot); + x = 0; + while (len > x) { + x += da[di++ % dc]; + if (x > len) { + x = len; + } + ctx[draw ? "lineTo" : "moveTo"](x, 0); + draw = !draw; + } + ctx.restore(); + }, + createCanvasElement: function(canvasEl) { + canvasEl || (canvasEl = fabric.document.createElement("canvas")); + if (!canvasEl.getContext && typeof G_vmlCanvasManager !== "undefined") { + G_vmlCanvasManager.initElement(canvasEl); + } + return canvasEl; + }, + createImage: function() { + return fabric.isLikelyNode ? new (require("canvas").Image)() : fabric.document.createElement("img"); + }, + createAccessors: function(klass) { + var proto = klass.prototype, i, propName, capitalizedPropName, setterName, getterName; + for (i = proto.stateProperties.length; i--; ) { + propName = proto.stateProperties[i]; + capitalizedPropName = propName.charAt(0).toUpperCase() + propName.slice(1); + setterName = "set" + capitalizedPropName; + getterName = "get" + capitalizedPropName; + if (!proto[getterName]) { + proto[getterName] = function(property) { + return new Function('return this.get("' + property + '")'); + }(propName); + } + if (!proto[setterName]) { + proto[setterName] = function(property) { + return new Function("value", 'return this.set("' + property + '", value)'); + }(propName); + } + } + }, + clipContext: function(receiver, ctx) { + ctx.save(); + ctx.beginPath(); + receiver.clipTo(ctx); + ctx.clip(); + }, + multiplyTransformMatrices: function(a, b, is2x2) { + return [ a[0] * b[0] + a[2] * b[1], a[1] * b[0] + a[3] * b[1], a[0] * b[2] + a[2] * b[3], a[1] * b[2] + a[3] * b[3], is2x2 ? 0 : a[0] * b[4] + a[2] * b[5] + a[4], is2x2 ? 0 : a[1] * b[4] + a[3] * b[5] + a[5] ]; + }, + qrDecompose: function(a) { + var angle = atan2(a[1], a[0]), denom = pow(a[0], 2) + pow(a[1], 2), scaleX = sqrt(denom), scaleY = (a[0] * a[3] - a[2] * a[1]) / scaleX, skewX = atan2(a[0] * a[2] + a[1] * a[3], denom); + return { + angle: angle / PiBy180, + scaleX: scaleX, + scaleY: scaleY, + skewX: skewX / PiBy180, + skewY: 0, + translateX: a[4], + translateY: a[5] + }; + }, + customTransformMatrix: function(scaleX, scaleY, skewX) { + var skewMatrixX = [ 1, 0, abs(Math.tan(skewX * PiBy180)), 1 ], scaleMatrix = [ abs(scaleX), 0, 0, abs(scaleY) ]; + return fabric.util.multiplyTransformMatrices(scaleMatrix, skewMatrixX, true); + }, + resetObjectTransform: function(target) { + target.scaleX = 1; + target.scaleY = 1; + target.skewX = 0; + target.skewY = 0; + target.flipX = false; + target.flipY = false; + target.setAngle(0); + }, + getFunctionBody: function(fn) { + return (String(fn).match(/function[^{]*\{([\s\S]*)\}/) || {})[1]; + }, + isTransparent: function(ctx, x, y, tolerance) { + if (tolerance > 0) { + if (x > tolerance) { + x -= tolerance; + } else { + x = 0; + } + if (y > tolerance) { + y -= tolerance; + } else { + y = 0; + } + } + var _isTransparent = true, i, temp, imageData = ctx.getImageData(x, y, tolerance * 2 || 1, tolerance * 2 || 1), l = imageData.data.length; + for (i = 3; i < l; i += 4) { + temp = imageData.data[i]; + _isTransparent = temp <= 0; + if (_isTransparent === false) { + break; + } + } + imageData = null; + return _isTransparent; + }, + parsePreserveAspectRatioAttribute: function(attribute) { + var meetOrSlice = "meet", alignX = "Mid", alignY = "Mid", aspectRatioAttrs = attribute.split(" "), align; + if (aspectRatioAttrs && aspectRatioAttrs.length) { + meetOrSlice = aspectRatioAttrs.pop(); + if (meetOrSlice !== "meet" && meetOrSlice !== "slice") { + align = meetOrSlice; + meetOrSlice = "meet"; + } else if (aspectRatioAttrs.length) { + align = aspectRatioAttrs.pop(); + } + } + alignX = align !== "none" ? align.slice(1, 4) : "none"; + alignY = align !== "none" ? align.slice(5, 8) : "none"; + return { + meetOrSlice: meetOrSlice, + alignX: alignX, + alignY: alignY + }; + }, + clearFabricFontCache: function(fontFamily) { + if (!fontFamily) { + fabric.charWidthsCache = {}; + } else if (fabric.charWidthsCache[fontFamily]) { + delete fabric.charWidthsCache[fontFamily]; + } + } + }; +})(typeof exports !== "undefined" ? exports : this); + +(function() { + var arcToSegmentsCache = {}, segmentToBezierCache = {}, boundsOfCurveCache = {}, _join = Array.prototype.join; + function arcToSegments(toX, toY, rx, ry, large, sweep, rotateX) { + var argsString = _join.call(arguments); + if (arcToSegmentsCache[argsString]) { + return arcToSegmentsCache[argsString]; + } + var PI = Math.PI, th = rotateX * PI / 180, sinTh = Math.sin(th), cosTh = Math.cos(th), fromX = 0, fromY = 0; + rx = Math.abs(rx); + ry = Math.abs(ry); + var px = -cosTh * toX * .5 - sinTh * toY * .5, py = -cosTh * toY * .5 + sinTh * toX * .5, rx2 = rx * rx, ry2 = ry * ry, py2 = py * py, px2 = px * px, pl = rx2 * ry2 - rx2 * py2 - ry2 * px2, root = 0; + if (pl < 0) { + var s = Math.sqrt(1 - pl / (rx2 * ry2)); + rx *= s; + ry *= s; + } else { + root = (large === sweep ? -1 : 1) * Math.sqrt(pl / (rx2 * py2 + ry2 * px2)); + } + var cx = root * rx * py / ry, cy = -root * ry * px / rx, cx1 = cosTh * cx - sinTh * cy + toX * .5, cy1 = sinTh * cx + cosTh * cy + toY * .5, mTheta = calcVectorAngle(1, 0, (px - cx) / rx, (py - cy) / ry), dtheta = calcVectorAngle((px - cx) / rx, (py - cy) / ry, (-px - cx) / rx, (-py - cy) / ry); + if (sweep === 0 && dtheta > 0) { + dtheta -= 2 * PI; + } else if (sweep === 1 && dtheta < 0) { + dtheta += 2 * PI; + } + var segments = Math.ceil(Math.abs(dtheta / PI * 2)), result = [], mDelta = dtheta / segments, mT = 8 / 3 * Math.sin(mDelta / 4) * Math.sin(mDelta / 4) / Math.sin(mDelta / 2), th3 = mTheta + mDelta; + for (var i = 0; i < segments; i++) { + result[i] = segmentToBezier(mTheta, th3, cosTh, sinTh, rx, ry, cx1, cy1, mT, fromX, fromY); + fromX = result[i][4]; + fromY = result[i][5]; + mTheta = th3; + th3 += mDelta; + } + arcToSegmentsCache[argsString] = result; + return result; + } + function segmentToBezier(th2, th3, cosTh, sinTh, rx, ry, cx1, cy1, mT, fromX, fromY) { + var argsString2 = _join.call(arguments); + if (segmentToBezierCache[argsString2]) { + return segmentToBezierCache[argsString2]; + } + var costh2 = Math.cos(th2), sinth2 = Math.sin(th2), costh3 = Math.cos(th3), sinth3 = Math.sin(th3), toX = cosTh * rx * costh3 - sinTh * ry * sinth3 + cx1, toY = sinTh * rx * costh3 + cosTh * ry * sinth3 + cy1, cp1X = fromX + mT * (-cosTh * rx * sinth2 - sinTh * ry * costh2), cp1Y = fromY + mT * (-sinTh * rx * sinth2 + cosTh * ry * costh2), cp2X = toX + mT * (cosTh * rx * sinth3 + sinTh * ry * costh3), cp2Y = toY + mT * (sinTh * rx * sinth3 - cosTh * ry * costh3); + segmentToBezierCache[argsString2] = [ cp1X, cp1Y, cp2X, cp2Y, toX, toY ]; + return segmentToBezierCache[argsString2]; + } + function calcVectorAngle(ux, uy, vx, vy) { + var ta = Math.atan2(uy, ux), tb = Math.atan2(vy, vx); + if (tb >= ta) { + return tb - ta; + } else { + return 2 * Math.PI - (ta - tb); + } + } + fabric.util.drawArc = function(ctx, fx, fy, coords) { + var rx = coords[0], ry = coords[1], rot = coords[2], large = coords[3], sweep = coords[4], tx = coords[5], ty = coords[6], segs = [ [], [], [], [] ], segsNorm = arcToSegments(tx - fx, ty - fy, rx, ry, large, sweep, rot); + for (var i = 0, len = segsNorm.length; i < len; i++) { + segs[i][0] = segsNorm[i][0] + fx; + segs[i][1] = segsNorm[i][1] + fy; + segs[i][2] = segsNorm[i][2] + fx; + segs[i][3] = segsNorm[i][3] + fy; + segs[i][4] = segsNorm[i][4] + fx; + segs[i][5] = segsNorm[i][5] + fy; + ctx.bezierCurveTo.apply(ctx, segs[i]); + } + }; + fabric.util.getBoundsOfArc = function(fx, fy, rx, ry, rot, large, sweep, tx, ty) { + var fromX = 0, fromY = 0, bound, bounds = [], segs = arcToSegments(tx - fx, ty - fy, rx, ry, large, sweep, rot); + for (var i = 0, len = segs.length; i < len; i++) { + bound = getBoundsOfCurve(fromX, fromY, segs[i][0], segs[i][1], segs[i][2], segs[i][3], segs[i][4], segs[i][5]); + bounds.push({ + x: bound[0].x + fx, + y: bound[0].y + fy + }); + bounds.push({ + x: bound[1].x + fx, + y: bound[1].y + fy + }); + fromX = segs[i][4]; + fromY = segs[i][5]; + } + return bounds; + }; + function getBoundsOfCurve(x0, y0, x1, y1, x2, y2, x3, y3) { + var argsString = _join.call(arguments); + if (boundsOfCurveCache[argsString]) { + return boundsOfCurveCache[argsString]; + } + var sqrt = Math.sqrt, min = Math.min, max = Math.max, abs = Math.abs, tvalues = [], bounds = [ [], [] ], a, b, c, t, t1, t2, b2ac, sqrtb2ac; + b = 6 * x0 - 12 * x1 + 6 * x2; + a = -3 * x0 + 9 * x1 - 9 * x2 + 3 * x3; + c = 3 * x1 - 3 * x0; + for (var i = 0; i < 2; ++i) { + if (i > 0) { + b = 6 * y0 - 12 * y1 + 6 * y2; + a = -3 * y0 + 9 * y1 - 9 * y2 + 3 * y3; + c = 3 * y1 - 3 * y0; + } + if (abs(a) < 1e-12) { + if (abs(b) < 1e-12) { + continue; + } + t = -c / b; + if (0 < t && t < 1) { + tvalues.push(t); + } + continue; + } + b2ac = b * b - 4 * c * a; + if (b2ac < 0) { + continue; + } + sqrtb2ac = sqrt(b2ac); + t1 = (-b + sqrtb2ac) / (2 * a); + if (0 < t1 && t1 < 1) { + tvalues.push(t1); + } + t2 = (-b - sqrtb2ac) / (2 * a); + if (0 < t2 && t2 < 1) { + tvalues.push(t2); + } + } + var x, y, j = tvalues.length, jlen = j, mt; + while (j--) { + t = tvalues[j]; + mt = 1 - t; + x = mt * mt * mt * x0 + 3 * mt * mt * t * x1 + 3 * mt * t * t * x2 + t * t * t * x3; + bounds[0][j] = x; + y = mt * mt * mt * y0 + 3 * mt * mt * t * y1 + 3 * mt * t * t * y2 + t * t * t * y3; + bounds[1][j] = y; + } + bounds[0][jlen] = x0; + bounds[1][jlen] = y0; + bounds[0][jlen + 1] = x3; + bounds[1][jlen + 1] = y3; + var result = [ { + x: min.apply(null, bounds[0]), + y: min.apply(null, bounds[1]) + }, { + x: max.apply(null, bounds[0]), + y: max.apply(null, bounds[1]) + } ]; + boundsOfCurveCache[argsString] = result; + return result; + } + fabric.util.getBoundsOfCurve = getBoundsOfCurve; +})(); + +(function() { + var slice = Array.prototype.slice; + if (!Array.prototype.indexOf) { + Array.prototype.indexOf = function(searchElement) { + if (this === void 0 || this === null) { + throw new TypeError(); + } + var t = Object(this), len = t.length >>> 0; + if (len === 0) { + return -1; + } + var n = 0; + if (arguments.length > 0) { + n = Number(arguments[1]); + if (n !== n) { + n = 0; + } else if (n !== 0 && n !== Number.POSITIVE_INFINITY && n !== Number.NEGATIVE_INFINITY) { + n = (n > 0 || -1) * Math.floor(Math.abs(n)); + } + } + if (n >= len) { + return -1; + } + var k = n >= 0 ? n : Math.max(len - Math.abs(n), 0); + for (;k < len; k++) { + if (k in t && t[k] === searchElement) { + return k; + } + } + return -1; + }; + } + if (!Array.prototype.forEach) { + Array.prototype.forEach = function(fn, context) { + for (var i = 0, len = this.length >>> 0; i < len; i++) { + if (i in this) { + fn.call(context, this[i], i, this); + } + } + }; + } + if (!Array.prototype.map) { + Array.prototype.map = function(fn, context) { + var result = []; + for (var i = 0, len = this.length >>> 0; i < len; i++) { + if (i in this) { + result[i] = fn.call(context, this[i], i, this); + } + } + return result; + }; + } + if (!Array.prototype.every) { + Array.prototype.every = function(fn, context) { + for (var i = 0, len = this.length >>> 0; i < len; i++) { + if (i in this && !fn.call(context, this[i], i, this)) { + return false; + } + } + return true; + }; + } + if (!Array.prototype.some) { + Array.prototype.some = function(fn, context) { + for (var i = 0, len = this.length >>> 0; i < len; i++) { + if (i in this && fn.call(context, this[i], i, this)) { + return true; + } + } + return false; + }; + } + if (!Array.prototype.filter) { + Array.prototype.filter = function(fn, context) { + var result = [], val; + for (var i = 0, len = this.length >>> 0; i < len; i++) { + if (i in this) { + val = this[i]; + if (fn.call(context, val, i, this)) { + result.push(val); + } + } + } + return result; + }; + } + if (!Array.prototype.reduce) { + Array.prototype.reduce = function(fn) { + var len = this.length >>> 0, i = 0, rv; + if (arguments.length > 1) { + rv = arguments[1]; + } else { + do { + if (i in this) { + rv = this[i++]; + break; + } + if (++i >= len) { + throw new TypeError(); + } + } while (true); + } + for (;i < len; i++) { + if (i in this) { + rv = fn.call(null, rv, this[i], i, this); + } + } + return rv; + }; + } + function invoke(array, method) { + var args = slice.call(arguments, 2), result = []; + for (var i = 0, len = array.length; i < len; i++) { + result[i] = args.length ? array[i][method].apply(array[i], args) : array[i][method].call(array[i]); + } + return result; + } + function max(array, byProperty) { + return find(array, byProperty, function(value1, value2) { + return value1 >= value2; + }); + } + function min(array, byProperty) { + return find(array, byProperty, function(value1, value2) { + return value1 < value2; + }); + } + function fill(array, value) { + var k = array.length; + while (k--) { + array[k] = value; + } + return array; + } + function find(array, byProperty, condition) { + if (!array || array.length === 0) { + return; + } + var i = array.length - 1, result = byProperty ? array[i][byProperty] : array[i]; + if (byProperty) { + while (i--) { + if (condition(array[i][byProperty], result)) { + result = array[i][byProperty]; + } + } + } else { + while (i--) { + if (condition(array[i], result)) { + result = array[i]; + } + } + } + return result; + } + fabric.util.array = { + fill: fill, + invoke: invoke, + min: min, + max: max + }; +})(); + +(function() { + function extend(destination, source, deep) { + if (deep) { + if (!fabric.isLikelyNode && source instanceof Element) { + destination = source; + } else if (source instanceof Array) { + destination = source.map(function(v) { + return clone(v, deep); + }); + } else if (source instanceof Object) { + for (var property in source) { + destination[property] = clone(source[property], deep); + } + } else { + destination = source; + } + } else { + for (var property in source) { + destination[property] = source[property]; + } + } + return destination; + } + function clone(object, deep) { + return extend({}, object, deep); + } + fabric.util.object = { + extend: extend, + clone: clone + }; +})(); + +(function() { + if (!String.prototype.trim) { + String.prototype.trim = function() { + return this.replace(/^[\s\xA0]+/, "").replace(/[\s\xA0]+$/, ""); + }; + } + function camelize(string) { + return string.replace(/-+(.)?/g, function(match, character) { + return character ? character.toUpperCase() : ""; + }); + } + function capitalize(string, firstLetterOnly) { + return string.charAt(0).toUpperCase() + (firstLetterOnly ? string.slice(1) : string.slice(1).toLowerCase()); + } + function escapeXml(string) { + return string.replace(/&/g, "&").replace(/"/g, """).replace(/'/g, "'").replace(//g, ">"); + } + fabric.util.string = { + camelize: camelize, + capitalize: capitalize, + escapeXml: escapeXml + }; +})(); + +(function() { + var slice = Array.prototype.slice, apply = Function.prototype.apply, Dummy = function() {}; + if (!Function.prototype.bind) { + Function.prototype.bind = function(thisArg) { + var _this = this, args = slice.call(arguments, 1), bound; + if (args.length) { + bound = function() { + return apply.call(_this, this instanceof Dummy ? this : thisArg, args.concat(slice.call(arguments))); + }; + } else { + bound = function() { + return apply.call(_this, this instanceof Dummy ? this : thisArg, arguments); + }; + } + Dummy.prototype = this.prototype; + bound.prototype = new Dummy(); + return bound; + }; + } +})(); + +(function() { + var slice = Array.prototype.slice, emptyFunction = function() {}, IS_DONTENUM_BUGGY = function() { + for (var p in { + toString: 1 + }) { + if (p === "toString") { + return false; + } + } + return true; + }(), addMethods = function(klass, source, parent) { + for (var property in source) { + if (property in klass.prototype && typeof klass.prototype[property] === "function" && (source[property] + "").indexOf("callSuper") > -1) { + klass.prototype[property] = function(property) { + return function() { + var superclass = this.constructor.superclass; + this.constructor.superclass = parent; + var returnValue = source[property].apply(this, arguments); + this.constructor.superclass = superclass; + if (property !== "initialize") { + return returnValue; + } + }; + }(property); + } else { + klass.prototype[property] = source[property]; + } + if (IS_DONTENUM_BUGGY) { + if (source.toString !== Object.prototype.toString) { + klass.prototype.toString = source.toString; + } + if (source.valueOf !== Object.prototype.valueOf) { + klass.prototype.valueOf = source.valueOf; + } + } + } + }; + function Subclass() {} + function callSuper(methodName) { + var fn = this.constructor.superclass.prototype[methodName]; + return arguments.length > 1 ? fn.apply(this, slice.call(arguments, 1)) : fn.call(this); + } + function createClass() { + var parent = null, properties = slice.call(arguments, 0); + if (typeof properties[0] === "function") { + parent = properties.shift(); + } + function klass() { + this.initialize.apply(this, arguments); + } + klass.superclass = parent; + klass.subclasses = []; + if (parent) { + Subclass.prototype = parent.prototype; + klass.prototype = new Subclass(); + parent.subclasses.push(klass); + } + for (var i = 0, length = properties.length; i < length; i++) { + addMethods(klass, properties[i], parent); + } + if (!klass.prototype.initialize) { + klass.prototype.initialize = emptyFunction; + } + klass.prototype.constructor = klass; + klass.prototype.callSuper = callSuper; + return klass; + } + fabric.util.createClass = createClass; +})(); + +(function() { + var unknown = "unknown"; + function areHostMethods(object) { + var methodNames = Array.prototype.slice.call(arguments, 1), t, i, len = methodNames.length; + for (i = 0; i < len; i++) { + t = typeof object[methodNames[i]]; + if (!/^(?:function|object|unknown)$/.test(t)) { + return false; + } + } + return true; + } + var getElement, setElement, getUniqueId = function() { + var uid = 0; + return function(element) { + return element.__uniqueID || (element.__uniqueID = "uniqueID__" + uid++); + }; + }(); + (function() { + var elements = {}; + getElement = function(uid) { + return elements[uid]; + }; + setElement = function(uid, element) { + elements[uid] = element; + }; + })(); + function createListener(uid, handler) { + return { + handler: handler, + wrappedHandler: createWrappedHandler(uid, handler) + }; + } + function createWrappedHandler(uid, handler) { + return function(e) { + handler.call(getElement(uid), e || fabric.window.event); + }; + } + function createDispatcher(uid, eventName) { + return function(e) { + if (handlers[uid] && handlers[uid][eventName]) { + var handlersForEvent = handlers[uid][eventName]; + for (var i = 0, len = handlersForEvent.length; i < len; i++) { + handlersForEvent[i].call(this, e || fabric.window.event); + } + } + }; + } + var shouldUseAddListenerRemoveListener = areHostMethods(fabric.document.documentElement, "addEventListener", "removeEventListener") && areHostMethods(fabric.window, "addEventListener", "removeEventListener"), shouldUseAttachEventDetachEvent = areHostMethods(fabric.document.documentElement, "attachEvent", "detachEvent") && areHostMethods(fabric.window, "attachEvent", "detachEvent"), listeners = {}, handlers = {}, addListener, removeListener; + if (shouldUseAddListenerRemoveListener) { + addListener = function(element, eventName, handler) { + element.addEventListener(eventName, handler, false); + }; + removeListener = function(element, eventName, handler) { + element.removeEventListener(eventName, handler, false); + }; + } else if (shouldUseAttachEventDetachEvent) { + addListener = function(element, eventName, handler) { + var uid = getUniqueId(element); + setElement(uid, element); + if (!listeners[uid]) { + listeners[uid] = {}; + } + if (!listeners[uid][eventName]) { + listeners[uid][eventName] = []; + } + var listener = createListener(uid, handler); + listeners[uid][eventName].push(listener); + element.attachEvent("on" + eventName, listener.wrappedHandler); + }; + removeListener = function(element, eventName, handler) { + var uid = getUniqueId(element), listener; + if (listeners[uid] && listeners[uid][eventName]) { + for (var i = 0, len = listeners[uid][eventName].length; i < len; i++) { + listener = listeners[uid][eventName][i]; + if (listener && listener.handler === handler) { + element.detachEvent("on" + eventName, listener.wrappedHandler); + listeners[uid][eventName][i] = null; + } + } + } + }; + } else { + addListener = function(element, eventName, handler) { + var uid = getUniqueId(element); + if (!handlers[uid]) { + handlers[uid] = {}; + } + if (!handlers[uid][eventName]) { + handlers[uid][eventName] = []; + var existingHandler = element["on" + eventName]; + if (existingHandler) { + handlers[uid][eventName].push(existingHandler); + } + element["on" + eventName] = createDispatcher(uid, eventName); + } + handlers[uid][eventName].push(handler); + }; + removeListener = function(element, eventName, handler) { + var uid = getUniqueId(element); + if (handlers[uid] && handlers[uid][eventName]) { + var handlersForEvent = handlers[uid][eventName]; + for (var i = 0, len = handlersForEvent.length; i < len; i++) { + if (handlersForEvent[i] === handler) { + handlersForEvent.splice(i, 1); + } + } + } + }; + } + fabric.util.addListener = addListener; + fabric.util.removeListener = removeListener; + function getPointer(event) { + event || (event = fabric.window.event); + var element = event.target || (typeof event.srcElement !== unknown ? event.srcElement : null), scroll = fabric.util.getScrollLeftTop(element); + return { + x: pointerX(event) + scroll.left, + y: pointerY(event) + scroll.top + }; + } + var pointerX = function(event) { + return typeof event.clientX !== unknown ? event.clientX : 0; + }, pointerY = function(event) { + return typeof event.clientY !== unknown ? event.clientY : 0; + }; + function _getPointer(event, pageProp, clientProp) { + var touchProp = event.type === "touchend" ? "changedTouches" : "touches"; + return event[touchProp] && event[touchProp][0] ? event[touchProp][0][pageProp] - (event[touchProp][0][pageProp] - event[touchProp][0][clientProp]) || event[clientProp] : event[clientProp]; + } + if (fabric.isTouchSupported) { + pointerX = function(event) { + return _getPointer(event, "pageX", "clientX"); + }; + pointerY = function(event) { + return _getPointer(event, "pageY", "clientY"); + }; + } + fabric.util.getPointer = getPointer; + fabric.util.object.extend(fabric.util, fabric.Observable); +})(); + +(function() { + function setStyle(element, styles) { + var elementStyle = element.style; + if (!elementStyle) { + return element; + } + if (typeof styles === "string") { + element.style.cssText += ";" + styles; + return styles.indexOf("opacity") > -1 ? setOpacity(element, styles.match(/opacity:\s*(\d?\.?\d*)/)[1]) : element; + } + for (var property in styles) { + if (property === "opacity") { + setOpacity(element, styles[property]); + } else { + var normalizedProperty = property === "float" || property === "cssFloat" ? typeof elementStyle.styleFloat === "undefined" ? "cssFloat" : "styleFloat" : property; + elementStyle[normalizedProperty] = styles[property]; + } + } + return element; + } + var parseEl = fabric.document.createElement("div"), supportsOpacity = typeof parseEl.style.opacity === "string", supportsFilters = typeof parseEl.style.filter === "string", reOpacity = /alpha\s*\(\s*opacity\s*=\s*([^\)]+)\)/, setOpacity = function(element) { + return element; + }; + if (supportsOpacity) { + setOpacity = function(element, value) { + element.style.opacity = value; + return element; + }; + } else if (supportsFilters) { + setOpacity = function(element, value) { + var es = element.style; + if (element.currentStyle && !element.currentStyle.hasLayout) { + es.zoom = 1; + } + if (reOpacity.test(es.filter)) { + value = value >= .9999 ? "" : "alpha(opacity=" + value * 100 + ")"; + es.filter = es.filter.replace(reOpacity, value); + } else { + es.filter += " alpha(opacity=" + value * 100 + ")"; + } + return element; + }; + } + fabric.util.setStyle = setStyle; +})(); + +(function() { + var _slice = Array.prototype.slice; + function getById(id) { + return typeof id === "string" ? fabric.document.getElementById(id) : id; + } + var sliceCanConvertNodelists, toArray = function(arrayLike) { + return _slice.call(arrayLike, 0); + }; + try { + sliceCanConvertNodelists = toArray(fabric.document.childNodes) instanceof Array; + } catch (err) {} + if (!sliceCanConvertNodelists) { + toArray = function(arrayLike) { + var arr = new Array(arrayLike.length), i = arrayLike.length; + while (i--) { + arr[i] = arrayLike[i]; + } + return arr; + }; + } + function makeElement(tagName, attributes) { + var el = fabric.document.createElement(tagName); + for (var prop in attributes) { + if (prop === "class") { + el.className = attributes[prop]; + } else if (prop === "for") { + el.htmlFor = attributes[prop]; + } else { + el.setAttribute(prop, attributes[prop]); + } + } + return el; + } + function addClass(element, className) { + if (element && (" " + element.className + " ").indexOf(" " + className + " ") === -1) { + element.className += (element.className ? " " : "") + className; + } + } + function wrapElement(element, wrapper, attributes) { + if (typeof wrapper === "string") { + wrapper = makeElement(wrapper, attributes); + } + if (element.parentNode) { + element.parentNode.replaceChild(wrapper, element); + } + wrapper.appendChild(element); + return wrapper; + } + function getScrollLeftTop(element) { + var left = 0, top = 0, docElement = fabric.document.documentElement, body = fabric.document.body || { + scrollLeft: 0, + scrollTop: 0 + }; + while (element && (element.parentNode || element.host)) { + element = element.parentNode || element.host; + if (element === fabric.document) { + left = body.scrollLeft || docElement.scrollLeft || 0; + top = body.scrollTop || docElement.scrollTop || 0; + } else { + left += element.scrollLeft || 0; + top += element.scrollTop || 0; + } + if (element.nodeType === 1 && fabric.util.getElementStyle(element, "position") === "fixed") { + break; + } + } + return { + left: left, + top: top + }; + } + function getElementOffset(element) { + var docElem, doc = element && element.ownerDocument, box = { + left: 0, + top: 0 + }, offset = { + left: 0, + top: 0 + }, scrollLeftTop, offsetAttributes = { + borderLeftWidth: "left", + borderTopWidth: "top", + paddingLeft: "left", + paddingTop: "top" + }; + if (!doc) { + return offset; + } + for (var attr in offsetAttributes) { + offset[offsetAttributes[attr]] += parseInt(getElementStyle(element, attr), 10) || 0; + } + docElem = doc.documentElement; + if (typeof element.getBoundingClientRect !== "undefined") { + box = element.getBoundingClientRect(); + } + scrollLeftTop = getScrollLeftTop(element); + return { + left: box.left + scrollLeftTop.left - (docElem.clientLeft || 0) + offset.left, + top: box.top + scrollLeftTop.top - (docElem.clientTop || 0) + offset.top + }; + } + var getElementStyle; + if (fabric.document.defaultView && fabric.document.defaultView.getComputedStyle) { + getElementStyle = function(element, attr) { + var style = fabric.document.defaultView.getComputedStyle(element, null); + return style ? style[attr] : undefined; + }; + } else { + getElementStyle = function(element, attr) { + var value = element.style[attr]; + if (!value && element.currentStyle) { + value = element.currentStyle[attr]; + } + return value; + }; + } + (function() { + var style = fabric.document.documentElement.style, selectProp = "userSelect" in style ? "userSelect" : "MozUserSelect" in style ? "MozUserSelect" : "WebkitUserSelect" in style ? "WebkitUserSelect" : "KhtmlUserSelect" in style ? "KhtmlUserSelect" : ""; + function makeElementUnselectable(element) { + if (typeof element.onselectstart !== "undefined") { + element.onselectstart = fabric.util.falseFunction; + } + if (selectProp) { + element.style[selectProp] = "none"; + } else if (typeof element.unselectable === "string") { + element.unselectable = "on"; + } + return element; + } + function makeElementSelectable(element) { + if (typeof element.onselectstart !== "undefined") { + element.onselectstart = null; + } + if (selectProp) { + element.style[selectProp] = ""; + } else if (typeof element.unselectable === "string") { + element.unselectable = ""; + } + return element; + } + fabric.util.makeElementUnselectable = makeElementUnselectable; + fabric.util.makeElementSelectable = makeElementSelectable; + })(); + (function() { + function getScript(url, callback) { + var headEl = fabric.document.getElementsByTagName("head")[0], scriptEl = fabric.document.createElement("script"), loading = true; + scriptEl.onload = scriptEl.onreadystatechange = function(e) { + if (loading) { + if (typeof this.readyState === "string" && this.readyState !== "loaded" && this.readyState !== "complete") { + return; + } + loading = false; + callback(e || fabric.window.event); + scriptEl = scriptEl.onload = scriptEl.onreadystatechange = null; + } + }; + scriptEl.src = url; + headEl.appendChild(scriptEl); + } + fabric.util.getScript = getScript; + })(); + fabric.util.getById = getById; + fabric.util.toArray = toArray; + fabric.util.makeElement = makeElement; + fabric.util.addClass = addClass; + fabric.util.wrapElement = wrapElement; + fabric.util.getScrollLeftTop = getScrollLeftTop; + fabric.util.getElementOffset = getElementOffset; + fabric.util.getElementStyle = getElementStyle; +})(); + +(function() { + function addParamToUrl(url, param) { + return url + (/\?/.test(url) ? "&" : "?") + param; + } + var makeXHR = function() { + var factories = [ function() { + return new ActiveXObject("Microsoft.XMLHTTP"); + }, function() { + return new ActiveXObject("Msxml2.XMLHTTP"); + }, function() { + return new ActiveXObject("Msxml2.XMLHTTP.3.0"); + }, function() { + return new XMLHttpRequest(); + } ]; + for (var i = factories.length; i--; ) { + try { + var req = factories[i](); + if (req) { + return factories[i]; + } + } catch (err) {} + } + }(); + function emptyFn() {} + function request(url, options) { + options || (options = {}); + var method = options.method ? options.method.toUpperCase() : "GET", onComplete = options.onComplete || function() {}, xhr = makeXHR(), body = options.body || options.parameters; + xhr.onreadystatechange = function() { + if (xhr.readyState === 4) { + onComplete(xhr); + xhr.onreadystatechange = emptyFn; + } + }; + if (method === "GET") { + body = null; + if (typeof options.parameters === "string") { + url = addParamToUrl(url, options.parameters); + } + } + xhr.open(method, url, true); + if (method === "POST" || method === "PUT") { + xhr.setRequestHeader("Content-Type", "application/x-www-form-urlencoded"); + } + xhr.send(body); + return xhr; + } + fabric.util.request = request; +})(); + +fabric.log = function() {}; + +fabric.warn = function() {}; + +if (typeof console !== "undefined") { + [ "log", "warn" ].forEach(function(methodName) { + if (typeof console[methodName] !== "undefined" && typeof console[methodName].apply === "function") { + fabric[methodName] = function() { + return console[methodName].apply(console, arguments); + }; + } + }); +} + +(function() { + function animate(options) { + requestAnimFrame(function(timestamp) { + options || (options = {}); + var start = timestamp || +new Date(), duration = options.duration || 500, finish = start + duration, time, onChange = options.onChange || function() {}, abort = options.abort || function() { + return false; + }, easing = options.easing || function(t, b, c, d) { + return -c * Math.cos(t / d * (Math.PI / 2)) + c + b; + }, startValue = "startValue" in options ? options.startValue : 0, endValue = "endValue" in options ? options.endValue : 100, byValue = options.byValue || endValue - startValue; + options.onStart && options.onStart(); + (function tick(ticktime) { + time = ticktime || +new Date(); + var currentTime = time > finish ? duration : time - start; + if (abort()) { + options.onComplete && options.onComplete(); + return; + } + onChange(easing(currentTime, startValue, byValue, duration)); + if (time > finish) { + options.onComplete && options.onComplete(); + return; + } + requestAnimFrame(tick); + })(start); + }); + } + var _requestAnimFrame = fabric.window.requestAnimationFrame || fabric.window.webkitRequestAnimationFrame || fabric.window.mozRequestAnimationFrame || fabric.window.oRequestAnimationFrame || fabric.window.msRequestAnimationFrame || function(callback) { + fabric.window.setTimeout(callback, 1e3 / 60); + }; + function requestAnimFrame() { + return _requestAnimFrame.apply(fabric.window, arguments); + } + fabric.util.animate = animate; + fabric.util.requestAnimFrame = requestAnimFrame; +})(); + +(function() { + function normalize(a, c, p, s) { + if (a < Math.abs(c)) { + a = c; + s = p / 4; + } else { + if (c === 0 && a === 0) { + s = p / (2 * Math.PI) * Math.asin(1); + } else { + s = p / (2 * Math.PI) * Math.asin(c / a); + } + } + return { + a: a, + c: c, + p: p, + s: s + }; + } + function elastic(opts, t, d) { + return opts.a * Math.pow(2, 10 * (t -= 1)) * Math.sin((t * d - opts.s) * (2 * Math.PI) / opts.p); + } + function easeOutCubic(t, b, c, d) { + return c * ((t = t / d - 1) * t * t + 1) + b; + } + function easeInOutCubic(t, b, c, d) { + t /= d / 2; + if (t < 1) { + return c / 2 * t * t * t + b; + } + return c / 2 * ((t -= 2) * t * t + 2) + b; + } + function easeInQuart(t, b, c, d) { + return c * (t /= d) * t * t * t + b; + } + function easeOutQuart(t, b, c, d) { + return -c * ((t = t / d - 1) * t * t * t - 1) + b; + } + function easeInOutQuart(t, b, c, d) { + t /= d / 2; + if (t < 1) { + return c / 2 * t * t * t * t + b; + } + return -c / 2 * ((t -= 2) * t * t * t - 2) + b; + } + function easeInQuint(t, b, c, d) { + return c * (t /= d) * t * t * t * t + b; + } + function easeOutQuint(t, b, c, d) { + return c * ((t = t / d - 1) * t * t * t * t + 1) + b; + } + function easeInOutQuint(t, b, c, d) { + t /= d / 2; + if (t < 1) { + return c / 2 * t * t * t * t * t + b; + } + return c / 2 * ((t -= 2) * t * t * t * t + 2) + b; + } + function easeInSine(t, b, c, d) { + return -c * Math.cos(t / d * (Math.PI / 2)) + c + b; + } + function easeOutSine(t, b, c, d) { + return c * Math.sin(t / d * (Math.PI / 2)) + b; + } + function easeInOutSine(t, b, c, d) { + return -c / 2 * (Math.cos(Math.PI * t / d) - 1) + b; + } + function easeInExpo(t, b, c, d) { + return t === 0 ? b : c * Math.pow(2, 10 * (t / d - 1)) + b; + } + function easeOutExpo(t, b, c, d) { + return t === d ? b + c : c * (-Math.pow(2, -10 * t / d) + 1) + b; + } + function easeInOutExpo(t, b, c, d) { + if (t === 0) { + return b; + } + if (t === d) { + return b + c; + } + t /= d / 2; + if (t < 1) { + return c / 2 * Math.pow(2, 10 * (t - 1)) + b; + } + return c / 2 * (-Math.pow(2, -10 * --t) + 2) + b; + } + function easeInCirc(t, b, c, d) { + return -c * (Math.sqrt(1 - (t /= d) * t) - 1) + b; + } + function easeOutCirc(t, b, c, d) { + return c * Math.sqrt(1 - (t = t / d - 1) * t) + b; + } + function easeInOutCirc(t, b, c, d) { + t /= d / 2; + if (t < 1) { + return -c / 2 * (Math.sqrt(1 - t * t) - 1) + b; + } + return c / 2 * (Math.sqrt(1 - (t -= 2) * t) + 1) + b; + } + function easeInElastic(t, b, c, d) { + var s = 1.70158, p = 0, a = c; + if (t === 0) { + return b; + } + t /= d; + if (t === 1) { + return b + c; + } + if (!p) { + p = d * .3; + } + var opts = normalize(a, c, p, s); + return -elastic(opts, t, d) + b; + } + function easeOutElastic(t, b, c, d) { + var s = 1.70158, p = 0, a = c; + if (t === 0) { + return b; + } + t /= d; + if (t === 1) { + return b + c; + } + if (!p) { + p = d * .3; + } + var opts = normalize(a, c, p, s); + return opts.a * Math.pow(2, -10 * t) * Math.sin((t * d - opts.s) * (2 * Math.PI) / opts.p) + opts.c + b; + } + function easeInOutElastic(t, b, c, d) { + var s = 1.70158, p = 0, a = c; + if (t === 0) { + return b; + } + t /= d / 2; + if (t === 2) { + return b + c; + } + if (!p) { + p = d * (.3 * 1.5); + } + var opts = normalize(a, c, p, s); + if (t < 1) { + return -.5 * elastic(opts, t, d) + b; + } + return opts.a * Math.pow(2, -10 * (t -= 1)) * Math.sin((t * d - opts.s) * (2 * Math.PI) / opts.p) * .5 + opts.c + b; + } + function easeInBack(t, b, c, d, s) { + if (s === undefined) { + s = 1.70158; + } + return c * (t /= d) * t * ((s + 1) * t - s) + b; + } + function easeOutBack(t, b, c, d, s) { + if (s === undefined) { + s = 1.70158; + } + return c * ((t = t / d - 1) * t * ((s + 1) * t + s) + 1) + b; + } + function easeInOutBack(t, b, c, d, s) { + if (s === undefined) { + s = 1.70158; + } + t /= d / 2; + if (t < 1) { + return c / 2 * (t * t * (((s *= 1.525) + 1) * t - s)) + b; + } + return c / 2 * ((t -= 2) * t * (((s *= 1.525) + 1) * t + s) + 2) + b; + } + function easeInBounce(t, b, c, d) { + return c - easeOutBounce(d - t, 0, c, d) + b; + } + function easeOutBounce(t, b, c, d) { + if ((t /= d) < 1 / 2.75) { + return c * (7.5625 * t * t) + b; + } else if (t < 2 / 2.75) { + return c * (7.5625 * (t -= 1.5 / 2.75) * t + .75) + b; + } else if (t < 2.5 / 2.75) { + return c * (7.5625 * (t -= 2.25 / 2.75) * t + .9375) + b; + } else { + return c * (7.5625 * (t -= 2.625 / 2.75) * t + .984375) + b; + } + } + function easeInOutBounce(t, b, c, d) { + if (t < d / 2) { + return easeInBounce(t * 2, 0, c, d) * .5 + b; + } + return easeOutBounce(t * 2 - d, 0, c, d) * .5 + c * .5 + b; + } + fabric.util.ease = { + easeInQuad: function(t, b, c, d) { + return c * (t /= d) * t + b; + }, + easeOutQuad: function(t, b, c, d) { + return -c * (t /= d) * (t - 2) + b; + }, + easeInOutQuad: function(t, b, c, d) { + t /= d / 2; + if (t < 1) { + return c / 2 * t * t + b; + } + return -c / 2 * (--t * (t - 2) - 1) + b; + }, + easeInCubic: function(t, b, c, d) { + return c * (t /= d) * t * t + b; + }, + easeOutCubic: easeOutCubic, + easeInOutCubic: easeInOutCubic, + easeInQuart: easeInQuart, + easeOutQuart: easeOutQuart, + easeInOutQuart: easeInOutQuart, + easeInQuint: easeInQuint, + easeOutQuint: easeOutQuint, + easeInOutQuint: easeInOutQuint, + easeInSine: easeInSine, + easeOutSine: easeOutSine, + easeInOutSine: easeInOutSine, + easeInExpo: easeInExpo, + easeOutExpo: easeOutExpo, + easeInOutExpo: easeInOutExpo, + easeInCirc: easeInCirc, + easeOutCirc: easeOutCirc, + easeInOutCirc: easeInOutCirc, + easeInElastic: easeInElastic, + easeOutElastic: easeOutElastic, + easeInOutElastic: easeInOutElastic, + easeInBack: easeInBack, + easeOutBack: easeOutBack, + easeInOutBack: easeInOutBack, + easeInBounce: easeInBounce, + easeOutBounce: easeOutBounce, + easeInOutBounce: easeInOutBounce + }; +})(); + +(function(global) { + "use strict"; + var fabric = global.fabric || (global.fabric = {}), extend = fabric.util.object.extend, capitalize = fabric.util.string.capitalize, clone = fabric.util.object.clone, toFixed = fabric.util.toFixed, parseUnit = fabric.util.parseUnit, multiplyTransformMatrices = fabric.util.multiplyTransformMatrices, reAllowedSVGTagNames = /^(path|circle|polygon|polyline|ellipse|rect|line|image|text)$/i, reViewBoxTagNames = /^(symbol|image|marker|pattern|view|svg)$/i, reNotAllowedAncestors = /^(?:pattern|defs|symbol|metadata)$/i, reAllowedParents = /^(symbol|g|a|svg)$/i, attributesMap = { + cx: "left", + x: "left", + r: "radius", + cy: "top", + y: "top", + display: "visible", + visibility: "visible", + transform: "transformMatrix", + "fill-opacity": "fillOpacity", + "fill-rule": "fillRule", + "font-family": "fontFamily", + "font-size": "fontSize", + "font-style": "fontStyle", + "font-weight": "fontWeight", + "stroke-dasharray": "strokeDashArray", + "stroke-linecap": "strokeLineCap", + "stroke-linejoin": "strokeLineJoin", + "stroke-miterlimit": "strokeMiterLimit", + "stroke-opacity": "strokeOpacity", + "stroke-width": "strokeWidth", + "text-decoration": "textDecoration", + "text-anchor": "originX" + }, colorAttributes = { + stroke: "strokeOpacity", + fill: "fillOpacity" + }; + fabric.cssRules = {}; + fabric.gradientDefs = {}; + function normalizeAttr(attr) { + if (attr in attributesMap) { + return attributesMap[attr]; + } + return attr; + } + function normalizeValue(attr, value, parentAttributes, fontSize) { + var isArray = Object.prototype.toString.call(value) === "[object Array]", parsed; + if ((attr === "fill" || attr === "stroke") && value === "none") { + value = ""; + } else if (attr === "strokeDashArray") { + value = value.replace(/,/g, " ").split(/\s+/).map(function(n) { + return parseFloat(n); + }); + } else if (attr === "transformMatrix") { + if (parentAttributes && parentAttributes.transformMatrix) { + value = multiplyTransformMatrices(parentAttributes.transformMatrix, fabric.parseTransformAttribute(value)); + } else { + value = fabric.parseTransformAttribute(value); + } + } else if (attr === "visible") { + value = value === "none" || value === "hidden" ? false : true; + if (parentAttributes && parentAttributes.visible === false) { + value = false; + } + } else if (attr === "originX") { + value = value === "start" ? "left" : value === "end" ? "right" : "center"; + } else { + parsed = isArray ? value.map(parseUnit) : parseUnit(value, fontSize); + } + return !isArray && isNaN(parsed) ? value : parsed; + } + function _setStrokeFillOpacity(attributes) { + for (var attr in colorAttributes) { + if (typeof attributes[colorAttributes[attr]] === "undefined" || attributes[attr] === "") { + continue; + } + if (typeof attributes[attr] === "undefined") { + if (!fabric.Object.prototype[attr]) { + continue; + } + attributes[attr] = fabric.Object.prototype[attr]; + } + if (attributes[attr].indexOf("url(") === 0) { + continue; + } + var color = new fabric.Color(attributes[attr]); + attributes[attr] = color.setAlpha(toFixed(color.getAlpha() * attributes[colorAttributes[attr]], 2)).toRgba(); + } + return attributes; + } + function _getMultipleNodes(doc, nodeNames) { + var nodeName, nodeArray = [], nodeList; + for (var i = 0; i < nodeNames.length; i++) { + nodeName = nodeNames[i]; + nodeList = doc.getElementsByTagName(nodeName); + nodeArray = nodeArray.concat(Array.prototype.slice.call(nodeList)); + } + return nodeArray; + } + fabric.parseTransformAttribute = function() { + function rotateMatrix(matrix, args) { + var angle = args[0], x = args.length === 3 ? args[1] : 0, y = args.length === 3 ? args[2] : 0; + matrix[0] = Math.cos(angle); + matrix[1] = Math.sin(angle); + matrix[2] = -Math.sin(angle); + matrix[3] = Math.cos(angle); + matrix[4] = x - (matrix[0] * x + matrix[2] * y); + matrix[5] = y - (matrix[1] * x + matrix[3] * y); + } + function scaleMatrix(matrix, args) { + var multiplierX = args[0], multiplierY = args.length === 2 ? args[1] : args[0]; + matrix[0] = multiplierX; + matrix[3] = multiplierY; + } + function skewXMatrix(matrix, args) { + matrix[2] = Math.tan(fabric.util.degreesToRadians(args[0])); + } + function skewYMatrix(matrix, args) { + matrix[1] = Math.tan(fabric.util.degreesToRadians(args[0])); + } + function translateMatrix(matrix, args) { + matrix[4] = args[0]; + if (args.length === 2) { + matrix[5] = args[1]; + } + } + var iMatrix = [ 1, 0, 0, 1, 0, 0 ], number = fabric.reNum, commaWsp = "(?:\\s+,?\\s*|,\\s*)", skewX = "(?:(skewX)\\s*\\(\\s*(" + number + ")\\s*\\))", skewY = "(?:(skewY)\\s*\\(\\s*(" + number + ")\\s*\\))", rotate = "(?:(rotate)\\s*\\(\\s*(" + number + ")(?:" + commaWsp + "(" + number + ")" + commaWsp + "(" + number + "))?\\s*\\))", scale = "(?:(scale)\\s*\\(\\s*(" + number + ")(?:" + commaWsp + "(" + number + "))?\\s*\\))", translate = "(?:(translate)\\s*\\(\\s*(" + number + ")(?:" + commaWsp + "(" + number + "))?\\s*\\))", matrix = "(?:(matrix)\\s*\\(\\s*" + "(" + number + ")" + commaWsp + "(" + number + ")" + commaWsp + "(" + number + ")" + commaWsp + "(" + number + ")" + commaWsp + "(" + number + ")" + commaWsp + "(" + number + ")" + "\\s*\\))", transform = "(?:" + matrix + "|" + translate + "|" + scale + "|" + rotate + "|" + skewX + "|" + skewY + ")", transforms = "(?:" + transform + "(?:" + commaWsp + "*" + transform + ")*" + ")", transformList = "^\\s*(?:" + transforms + "?)\\s*$", reTransformList = new RegExp(transformList), reTransform = new RegExp(transform, "g"); + return function(attributeValue) { + var matrix = iMatrix.concat(), matrices = []; + if (!attributeValue || attributeValue && !reTransformList.test(attributeValue)) { + return matrix; + } + attributeValue.replace(reTransform, function(match) { + var m = new RegExp(transform).exec(match).filter(function(match) { + return !!match; + }), operation = m[1], args = m.slice(2).map(parseFloat); + switch (operation) { + case "translate": + translateMatrix(matrix, args); + break; + + case "rotate": + args[0] = fabric.util.degreesToRadians(args[0]); + rotateMatrix(matrix, args); + break; + + case "scale": + scaleMatrix(matrix, args); + break; + + case "skewX": + skewXMatrix(matrix, args); + break; + + case "skewY": + skewYMatrix(matrix, args); + break; + + case "matrix": + matrix = args; + break; + } + matrices.push(matrix.concat()); + matrix = iMatrix.concat(); + }); + var combinedMatrix = matrices[0]; + while (matrices.length > 1) { + matrices.shift(); + combinedMatrix = fabric.util.multiplyTransformMatrices(combinedMatrix, matrices[0]); + } + return combinedMatrix; + }; + }(); + function parseStyleString(style, oStyle) { + var attr, value; + style.replace(/;\s*$/, "").split(";").forEach(function(chunk) { + var pair = chunk.split(":"); + attr = normalizeAttr(pair[0].trim().toLowerCase()); + value = normalizeValue(attr, pair[1].trim()); + oStyle[attr] = value; + }); + } + function parseStyleObject(style, oStyle) { + var attr, value; + for (var prop in style) { + if (typeof style[prop] === "undefined") { + continue; + } + attr = normalizeAttr(prop.toLowerCase()); + value = normalizeValue(attr, style[prop]); + oStyle[attr] = value; + } + } + function getGlobalStylesForElement(element, svgUid) { + var styles = {}; + for (var rule in fabric.cssRules[svgUid]) { + if (elementMatchesRule(element, rule.split(" "))) { + for (var property in fabric.cssRules[svgUid][rule]) { + styles[property] = fabric.cssRules[svgUid][rule][property]; + } + } + } + return styles; + } + function elementMatchesRule(element, selectors) { + var firstMatching, parentMatching = true; + firstMatching = selectorMatches(element, selectors.pop()); + if (firstMatching && selectors.length) { + parentMatching = doesSomeParentMatch(element, selectors); + } + return firstMatching && parentMatching && selectors.length === 0; + } + function doesSomeParentMatch(element, selectors) { + var selector, parentMatching = true; + while (element.parentNode && element.parentNode.nodeType === 1 && selectors.length) { + if (parentMatching) { + selector = selectors.pop(); + } + element = element.parentNode; + parentMatching = selectorMatches(element, selector); + } + return selectors.length === 0; + } + function selectorMatches(element, selector) { + var nodeName = element.nodeName, classNames = element.getAttribute("class"), id = element.getAttribute("id"), matcher; + matcher = new RegExp("^" + nodeName, "i"); + selector = selector.replace(matcher, ""); + if (id && selector.length) { + matcher = new RegExp("#" + id + "(?![a-zA-Z\\-]+)", "i"); + selector = selector.replace(matcher, ""); + } + if (classNames && selector.length) { + classNames = classNames.split(" "); + for (var i = classNames.length; i--; ) { + matcher = new RegExp("\\." + classNames[i] + "(?![a-zA-Z\\-]+)", "i"); + selector = selector.replace(matcher, ""); + } + } + return selector.length === 0; + } + function elementById(doc, id) { + var el; + doc.getElementById && (el = doc.getElementById(id)); + if (el) { + return el; + } + var node, i, nodelist = doc.getElementsByTagName("*"); + for (i = 0; i < nodelist.length; i++) { + node = nodelist[i]; + if (id === node.getAttribute("id")) { + return node; + } + } + } + function parseUseDirectives(doc) { + var nodelist = _getMultipleNodes(doc, [ "use", "svg:use" ]), i = 0; + while (nodelist.length && i < nodelist.length) { + var el = nodelist[i], xlink = el.getAttribute("xlink:href").substr(1), x = el.getAttribute("x") || 0, y = el.getAttribute("y") || 0, el2 = elementById(doc, xlink).cloneNode(true), currentTrans = (el2.getAttribute("transform") || "") + " translate(" + x + ", " + y + ")", parentNode, oldLength = nodelist.length, attr, j, attrs, l; + applyViewboxTransform(el2); + if (/^svg$/i.test(el2.nodeName)) { + var el3 = el2.ownerDocument.createElement("g"); + for (j = 0, attrs = el2.attributes, l = attrs.length; j < l; j++) { + attr = attrs.item(j); + el3.setAttribute(attr.nodeName, attr.nodeValue); + } + while (el2.firstChild) { + el3.appendChild(el2.firstChild); + } + el2 = el3; + } + for (j = 0, attrs = el.attributes, l = attrs.length; j < l; j++) { + attr = attrs.item(j); + if (attr.nodeName === "x" || attr.nodeName === "y" || attr.nodeName === "xlink:href") { + continue; + } + if (attr.nodeName === "transform") { + currentTrans = attr.nodeValue + " " + currentTrans; + } else { + el2.setAttribute(attr.nodeName, attr.nodeValue); + } + } + el2.setAttribute("transform", currentTrans); + el2.setAttribute("instantiated_by_use", "1"); + el2.removeAttribute("id"); + parentNode = el.parentNode; + parentNode.replaceChild(el2, el); + if (nodelist.length === oldLength) { + i++; + } + } + } + var reViewBoxAttrValue = new RegExp("^" + "\\s*(" + fabric.reNum + "+)\\s*,?" + "\\s*(" + fabric.reNum + "+)\\s*,?" + "\\s*(" + fabric.reNum + "+)\\s*,?" + "\\s*(" + fabric.reNum + "+)\\s*" + "$"); + function applyViewboxTransform(element) { + var viewBoxAttr = element.getAttribute("viewBox"), scaleX = 1, scaleY = 1, minX = 0, minY = 0, viewBoxWidth, viewBoxHeight, matrix, el, widthAttr = element.getAttribute("width"), heightAttr = element.getAttribute("height"), x = element.getAttribute("x") || 0, y = element.getAttribute("y") || 0, preserveAspectRatio = element.getAttribute("preserveAspectRatio") || "", missingViewBox = !viewBoxAttr || !reViewBoxTagNames.test(element.nodeName) || !(viewBoxAttr = viewBoxAttr.match(reViewBoxAttrValue)), missingDimAttr = !widthAttr || !heightAttr || widthAttr === "100%" || heightAttr === "100%", toBeParsed = missingViewBox && missingDimAttr, parsedDim = {}, translateMatrix = ""; + parsedDim.width = 0; + parsedDim.height = 0; + parsedDim.toBeParsed = toBeParsed; + if (toBeParsed) { + return parsedDim; + } + if (missingViewBox) { + parsedDim.width = parseUnit(widthAttr); + parsedDim.height = parseUnit(heightAttr); + return parsedDim; + } + minX = -parseFloat(viewBoxAttr[1]); + minY = -parseFloat(viewBoxAttr[2]); + viewBoxWidth = parseFloat(viewBoxAttr[3]); + viewBoxHeight = parseFloat(viewBoxAttr[4]); + if (!missingDimAttr) { + parsedDim.width = parseUnit(widthAttr); + parsedDim.height = parseUnit(heightAttr); + scaleX = parsedDim.width / viewBoxWidth; + scaleY = parsedDim.height / viewBoxHeight; + } else { + parsedDim.width = viewBoxWidth; + parsedDim.height = viewBoxHeight; + } + preserveAspectRatio = fabric.util.parsePreserveAspectRatioAttribute(preserveAspectRatio); + if (preserveAspectRatio.alignX !== "none") { + scaleY = scaleX = scaleX > scaleY ? scaleY : scaleX; + } + if (scaleX === 1 && scaleY === 1 && minX === 0 && minY === 0 && x === 0 && y === 0) { + return parsedDim; + } + if (x || y) { + translateMatrix = " translate(" + parseUnit(x) + " " + parseUnit(y) + ") "; + } + matrix = translateMatrix + " matrix(" + scaleX + " 0" + " 0 " + scaleY + " " + minX * scaleX + " " + minY * scaleY + ") "; + if (element.nodeName === "svg") { + el = element.ownerDocument.createElement("g"); + while (element.firstChild) { + el.appendChild(element.firstChild); + } + element.appendChild(el); + } else { + el = element; + matrix = el.getAttribute("transform") + matrix; + } + el.setAttribute("transform", matrix); + return parsedDim; + } + fabric.parseSVGDocument = function() { + function hasAncestorWithNodeName(element, nodeName) { + while (element && (element = element.parentNode)) { + if (element.nodeName && nodeName.test(element.nodeName.replace("svg:", "")) && !element.getAttribute("instantiated_by_use")) { + return true; + } + } + return false; + } + return function(doc, callback, reviver) { + if (!doc) { + return; + } + parseUseDirectives(doc); + var startTime = new Date(), svgUid = fabric.Object.__uid++, options = applyViewboxTransform(doc), descendants = fabric.util.toArray(doc.getElementsByTagName("*")); + options.svgUid = svgUid; + if (descendants.length === 0 && fabric.isLikelyNode) { + descendants = doc.selectNodes('//*[name(.)!="svg"]'); + var arr = []; + for (var i = 0, len = descendants.length; i < len; i++) { + arr[i] = descendants[i]; + } + descendants = arr; + } + var elements = descendants.filter(function(el) { + applyViewboxTransform(el); + return reAllowedSVGTagNames.test(el.nodeName.replace("svg:", "")) && !hasAncestorWithNodeName(el, reNotAllowedAncestors); + }); + if (!elements || elements && !elements.length) { + callback && callback([], {}); + return; + } + fabric.gradientDefs[svgUid] = fabric.getGradientDefs(doc); + fabric.cssRules[svgUid] = fabric.getCSSRules(doc); + fabric.parseElements(elements, function(instances) { + fabric.documentParsingTime = new Date() - startTime; + if (callback) { + callback(instances, options); + } + }, clone(options), reviver); + }; + }(); + var svgCache = { + has: function(name, callback) { + callback(false); + }, + get: function() {}, + set: function() {} + }; + function _enlivenCachedObject(cachedObject) { + var objects = cachedObject.objects, options = cachedObject.options; + objects = objects.map(function(o) { + return fabric[capitalize(o.type)].fromObject(o); + }); + return { + objects: objects, + options: options + }; + } + function _createSVGPattern(markup, canvas, property) { + if (canvas[property] && canvas[property].toSVG) { + markup.push('\t\n', '\t\t\n\t\n'); + } + } + var reFontDeclaration = new RegExp("(normal|italic)?\\s*(normal|small-caps)?\\s*" + "(normal|bold|bolder|lighter|100|200|300|400|500|600|700|800|900)?\\s*(" + fabric.reNum + "(?:px|cm|mm|em|pt|pc|in)*)(?:\\/(normal|" + fabric.reNum + "))?\\s+(.*)"); + extend(fabric, { + parseFontDeclaration: function(value, oStyle) { + var match = value.match(reFontDeclaration); + if (!match) { + return; + } + var fontStyle = match[1], fontWeight = match[3], fontSize = match[4], lineHeight = match[5], fontFamily = match[6]; + if (fontStyle) { + oStyle.fontStyle = fontStyle; + } + if (fontWeight) { + oStyle.fontWeight = isNaN(parseFloat(fontWeight)) ? fontWeight : parseFloat(fontWeight); + } + if (fontSize) { + oStyle.fontSize = parseUnit(fontSize); + } + if (fontFamily) { + oStyle.fontFamily = fontFamily; + } + if (lineHeight) { + oStyle.lineHeight = lineHeight === "normal" ? 1 : lineHeight; + } + }, + getGradientDefs: function(doc) { + var tagArray = [ "linearGradient", "radialGradient", "svg:linearGradient", "svg:radialGradient" ], elList = _getMultipleNodes(doc, tagArray), el, j = 0, id, xlink, gradientDefs = {}, idsToXlinkMap = {}; + j = elList.length; + while (j--) { + el = elList[j]; + xlink = el.getAttribute("xlink:href"); + id = el.getAttribute("id"); + if (xlink) { + idsToXlinkMap[id] = xlink.substr(1); + } + gradientDefs[id] = el; + } + for (id in idsToXlinkMap) { + var el2 = gradientDefs[idsToXlinkMap[id]].cloneNode(true); + el = gradientDefs[id]; + while (el2.firstChild) { + el.appendChild(el2.firstChild); + } + } + return gradientDefs; + }, + parseAttributes: function(element, attributes, svgUid) { + if (!element) { + return; + } + var value, parentAttributes = {}, fontSize; + if (typeof svgUid === "undefined") { + svgUid = element.getAttribute("svgUid"); + } + if (element.parentNode && reAllowedParents.test(element.parentNode.nodeName)) { + parentAttributes = fabric.parseAttributes(element.parentNode, attributes, svgUid); + } + fontSize = parentAttributes && parentAttributes.fontSize || element.getAttribute("font-size") || fabric.Text.DEFAULT_SVG_FONT_SIZE; + var ownAttributes = attributes.reduce(function(memo, attr) { + value = element.getAttribute(attr); + if (value) { + attr = normalizeAttr(attr); + value = normalizeValue(attr, value, parentAttributes, fontSize); + memo[attr] = value; + } + return memo; + }, {}); + ownAttributes = extend(ownAttributes, extend(getGlobalStylesForElement(element, svgUid), fabric.parseStyleAttribute(element))); + if (ownAttributes.font) { + fabric.parseFontDeclaration(ownAttributes.font, ownAttributes); + } + return _setStrokeFillOpacity(extend(parentAttributes, ownAttributes)); + }, + parseElements: function(elements, callback, options, reviver) { + new fabric.ElementsParser(elements, callback, options, reviver).parse(); + }, + parseStyleAttribute: function(element) { + var oStyle = {}, style = element.getAttribute("style"); + if (!style) { + return oStyle; + } + if (typeof style === "string") { + parseStyleString(style, oStyle); + } else { + parseStyleObject(style, oStyle); + } + return oStyle; + }, + parsePointsAttribute: function(points) { + if (!points) { + return null; + } + points = points.replace(/,/g, " ").trim(); + points = points.split(/\s+/); + var parsedPoints = [], i, len; + i = 0; + len = points.length; + for (;i < len; i += 2) { + parsedPoints.push({ + x: parseFloat(points[i]), + y: parseFloat(points[i + 1]) + }); + } + return parsedPoints; + }, + getCSSRules: function(doc) { + var styles = doc.getElementsByTagName("style"), allRules = {}, rules; + for (var i = 0, len = styles.length; i < len; i++) { + var styleContents = styles[i].textContent || styles[i].text; + styleContents = styleContents.replace(/\/\*[\s\S]*?\*\//g, ""); + if (styleContents.trim() === "") { + continue; + } + rules = styleContents.match(/[^{]*\{[\s\S]*?\}/g); + rules = rules.map(function(rule) { + return rule.trim(); + }); + rules.forEach(function(rule) { + var match = rule.match(/([\s\S]*?)\s*\{([^}]*)\}/), ruleObj = {}, declaration = match[2].trim(), propertyValuePairs = declaration.replace(/;$/, "").split(/\s*;\s*/); + for (var i = 0, len = propertyValuePairs.length; i < len; i++) { + var pair = propertyValuePairs[i].split(/\s*:\s*/), property = normalizeAttr(pair[0]), value = normalizeValue(property, pair[1], pair[0]); + ruleObj[property] = value; + } + rule = match[1]; + rule.split(",").forEach(function(_rule) { + _rule = _rule.replace(/^svg/i, "").trim(); + if (_rule === "") { + return; + } + if (allRules[_rule]) { + fabric.util.object.extend(allRules[_rule], ruleObj); + } else { + allRules[_rule] = fabric.util.object.clone(ruleObj); + } + }); + }); + } + return allRules; + }, + loadSVGFromURL: function(url, callback, reviver) { + url = url.replace(/^\n\s*/, "").trim(); + svgCache.has(url, function(hasUrl) { + if (hasUrl) { + svgCache.get(url, function(value) { + var enlivedRecord = _enlivenCachedObject(value); + callback(enlivedRecord.objects, enlivedRecord.options); + }); + } else { + new fabric.util.request(url, { + method: "get", + onComplete: onComplete + }); + } + }); + function onComplete(r) { + var xml = r.responseXML; + if (xml && !xml.documentElement && fabric.window.ActiveXObject && r.responseText) { + xml = new ActiveXObject("Microsoft.XMLDOM"); + xml.async = "false"; + xml.loadXML(r.responseText.replace(//i, "")); + } + if (!xml || !xml.documentElement) { + callback && callback(null); + } + fabric.parseSVGDocument(xml.documentElement, function(results, options) { + svgCache.set(url, { + objects: fabric.util.array.invoke(results, "toObject"), + options: options + }); + callback && callback(results, options); + }, reviver); + } + }, + loadSVGFromString: function(string, callback, reviver) { + string = string.trim(); + var doc; + if (typeof DOMParser !== "undefined") { + var parser = new DOMParser(); + if (parser && parser.parseFromString) { + doc = parser.parseFromString(string, "text/xml"); + } + } else if (fabric.window.ActiveXObject) { + doc = new ActiveXObject("Microsoft.XMLDOM"); + doc.async = "false"; + doc.loadXML(string.replace(//i, "")); + } + fabric.parseSVGDocument(doc.documentElement, function(results, options) { + callback(results, options); + }, reviver); + }, + createSVGFontFacesMarkup: function(objects) { + var markup = "", fontList = {}, obj, fontFamily, style, row, rowIndex, _char, charIndex, fontPaths = fabric.fontPaths; + for (var i = 0, len = objects.length; i < len; i++) { + obj = objects[i]; + fontFamily = obj.fontFamily; + if (obj.type.indexOf("text") === -1 || fontList[fontFamily] || !fontPaths[fontFamily]) { + continue; + } + fontList[fontFamily] = true; + if (!obj.styles) { + continue; + } + style = obj.styles; + for (rowIndex in style) { + row = style[rowIndex]; + for (charIndex in row) { + _char = row[charIndex]; + fontFamily = _char.fontFamily; + if (!fontList[fontFamily] && fontPaths[fontFamily]) { + fontList[fontFamily] = true; + } + } + } + } + for (var j in fontList) { + markup += [ "\t\t@font-face {\n", "\t\t\tfont-family: '", j, "';\n", "\t\t\tsrc: url('", fontPaths[j], "');\n", "\t\t}\n" ].join(""); + } + if (markup) { + markup = [ '\t\n" ].join(""); + } + return markup; + }, + createSVGRefElementsMarkup: function(canvas) { + var markup = []; + _createSVGPattern(markup, canvas, "backgroundColor"); + _createSVGPattern(markup, canvas, "overlayColor"); + return markup.join(""); + } + }); +})(typeof exports !== "undefined" ? exports : this); + +fabric.ElementsParser = function(elements, callback, options, reviver) { + this.elements = elements; + this.callback = callback; + this.options = options; + this.reviver = reviver; + this.svgUid = options && options.svgUid || 0; +}; + +fabric.ElementsParser.prototype.parse = function() { + this.instances = new Array(this.elements.length); + this.numElements = this.elements.length; + this.createObjects(); +}; + +fabric.ElementsParser.prototype.createObjects = function() { + for (var i = 0, len = this.elements.length; i < len; i++) { + this.elements[i].setAttribute("svgUid", this.svgUid); + (function(_obj, i) { + setTimeout(function() { + _obj.createObject(_obj.elements[i], i); + }, 0); + })(this, i); + } +}; + +fabric.ElementsParser.prototype.createObject = function(el, index) { + var klass = fabric[fabric.util.string.capitalize(el.tagName.replace("svg:", ""))]; + if (klass && klass.fromElement) { + try { + this._createObject(klass, el, index); + } catch (err) { + fabric.log(err); + } + } else { + this.checkIfDone(); + } +}; + +fabric.ElementsParser.prototype._createObject = function(klass, el, index) { + if (klass.async) { + klass.fromElement(el, this.createCallback(index, el), this.options); + } else { + var obj = klass.fromElement(el, this.options); + this.resolveGradient(obj, "fill"); + this.resolveGradient(obj, "stroke"); + this.reviver && this.reviver(el, obj); + this.instances[index] = obj; + this.checkIfDone(); + } +}; + +fabric.ElementsParser.prototype.createCallback = function(index, el) { + var _this = this; + return function(obj) { + _this.resolveGradient(obj, "fill"); + _this.resolveGradient(obj, "stroke"); + _this.reviver && _this.reviver(el, obj); + _this.instances[index] = obj; + _this.checkIfDone(); + }; +}; + +fabric.ElementsParser.prototype.resolveGradient = function(obj, property) { + var instanceFillValue = obj.get(property); + if (!/^url\(/.test(instanceFillValue)) { + return; + } + var gradientId = instanceFillValue.slice(5, instanceFillValue.length - 1); + if (fabric.gradientDefs[this.svgUid][gradientId]) { + obj.set(property, fabric.Gradient.fromElement(fabric.gradientDefs[this.svgUid][gradientId], obj)); + } +}; + +fabric.ElementsParser.prototype.checkIfDone = function() { + if (--this.numElements === 0) { + this.instances = this.instances.filter(function(el) { + return el != null; + }); + this.callback(this.instances); + } +}; + +(function(global) { + "use strict"; + var fabric = global.fabric || (global.fabric = {}); + if (fabric.Point) { + fabric.warn("fabric.Point is already defined"); + return; + } + fabric.Point = Point; + function Point(x, y) { + this.x = x; + this.y = y; + } + Point.prototype = { + type: "point", + constructor: Point, + add: function(that) { + return new Point(this.x + that.x, this.y + that.y); + }, + addEquals: function(that) { + this.x += that.x; + this.y += that.y; + return this; + }, + scalarAdd: function(scalar) { + return new Point(this.x + scalar, this.y + scalar); + }, + scalarAddEquals: function(scalar) { + this.x += scalar; + this.y += scalar; + return this; + }, + subtract: function(that) { + return new Point(this.x - that.x, this.y - that.y); + }, + subtractEquals: function(that) { + this.x -= that.x; + this.y -= that.y; + return this; + }, + scalarSubtract: function(scalar) { + return new Point(this.x - scalar, this.y - scalar); + }, + scalarSubtractEquals: function(scalar) { + this.x -= scalar; + this.y -= scalar; + return this; + }, + multiply: function(scalar) { + return new Point(this.x * scalar, this.y * scalar); + }, + multiplyEquals: function(scalar) { + this.x *= scalar; + this.y *= scalar; + return this; + }, + divide: function(scalar) { + return new Point(this.x / scalar, this.y / scalar); + }, + divideEquals: function(scalar) { + this.x /= scalar; + this.y /= scalar; + return this; + }, + eq: function(that) { + return this.x === that.x && this.y === that.y; + }, + lt: function(that) { + return this.x < that.x && this.y < that.y; + }, + lte: function(that) { + return this.x <= that.x && this.y <= that.y; + }, + gt: function(that) { + return this.x > that.x && this.y > that.y; + }, + gte: function(that) { + return this.x >= that.x && this.y >= that.y; + }, + lerp: function(that, t) { + if (typeof t === "undefined") { + t = .5; + } + t = Math.max(Math.min(1, t), 0); + return new Point(this.x + (that.x - this.x) * t, this.y + (that.y - this.y) * t); + }, + distanceFrom: function(that) { + var dx = this.x - that.x, dy = this.y - that.y; + return Math.sqrt(dx * dx + dy * dy); + }, + midPointFrom: function(that) { + return this.lerp(that); + }, + min: function(that) { + return new Point(Math.min(this.x, that.x), Math.min(this.y, that.y)); + }, + max: function(that) { + return new Point(Math.max(this.x, that.x), Math.max(this.y, that.y)); + }, + toString: function() { + return this.x + "," + this.y; + }, + setXY: function(x, y) { + this.x = x; + this.y = y; + return this; + }, + setX: function(x) { + this.x = x; + return this; + }, + setY: function(y) { + this.y = y; + return this; + }, + setFromPoint: function(that) { + this.x = that.x; + this.y = that.y; + return this; + }, + swap: function(that) { + var x = this.x, y = this.y; + this.x = that.x; + this.y = that.y; + that.x = x; + that.y = y; + }, + clone: function() { + return new Point(this.x, this.y); + } + }; +})(typeof exports !== "undefined" ? exports : this); + +(function(global) { + "use strict"; + var fabric = global.fabric || (global.fabric = {}); + if (fabric.Intersection) { + fabric.warn("fabric.Intersection is already defined"); + return; + } + function Intersection(status) { + this.status = status; + this.points = []; + } + fabric.Intersection = Intersection; + fabric.Intersection.prototype = { + constructor: Intersection, + appendPoint: function(point) { + this.points.push(point); + return this; + }, + appendPoints: function(points) { + this.points = this.points.concat(points); + return this; + } + }; + fabric.Intersection.intersectLineLine = function(a1, a2, b1, b2) { + var result, uaT = (b2.x - b1.x) * (a1.y - b1.y) - (b2.y - b1.y) * (a1.x - b1.x), ubT = (a2.x - a1.x) * (a1.y - b1.y) - (a2.y - a1.y) * (a1.x - b1.x), uB = (b2.y - b1.y) * (a2.x - a1.x) - (b2.x - b1.x) * (a2.y - a1.y); + if (uB !== 0) { + var ua = uaT / uB, ub = ubT / uB; + if (0 <= ua && ua <= 1 && 0 <= ub && ub <= 1) { + result = new Intersection("Intersection"); + result.appendPoint(new fabric.Point(a1.x + ua * (a2.x - a1.x), a1.y + ua * (a2.y - a1.y))); + } else { + result = new Intersection(); + } + } else { + if (uaT === 0 || ubT === 0) { + result = new Intersection("Coincident"); + } else { + result = new Intersection("Parallel"); + } + } + return result; + }; + fabric.Intersection.intersectLinePolygon = function(a1, a2, points) { + var result = new Intersection(), length = points.length, b1, b2, inter; + for (var i = 0; i < length; i++) { + b1 = points[i]; + b2 = points[(i + 1) % length]; + inter = Intersection.intersectLineLine(a1, a2, b1, b2); + result.appendPoints(inter.points); + } + if (result.points.length > 0) { + result.status = "Intersection"; + } + return result; + }; + fabric.Intersection.intersectPolygonPolygon = function(points1, points2) { + var result = new Intersection(), length = points1.length; + for (var i = 0; i < length; i++) { + var a1 = points1[i], a2 = points1[(i + 1) % length], inter = Intersection.intersectLinePolygon(a1, a2, points2); + result.appendPoints(inter.points); + } + if (result.points.length > 0) { + result.status = "Intersection"; + } + return result; + }; + fabric.Intersection.intersectPolygonRectangle = function(points, r1, r2) { + var min = r1.min(r2), max = r1.max(r2), topRight = new fabric.Point(max.x, min.y), bottomLeft = new fabric.Point(min.x, max.y), inter1 = Intersection.intersectLinePolygon(min, topRight, points), inter2 = Intersection.intersectLinePolygon(topRight, max, points), inter3 = Intersection.intersectLinePolygon(max, bottomLeft, points), inter4 = Intersection.intersectLinePolygon(bottomLeft, min, points), result = new Intersection(); + result.appendPoints(inter1.points); + result.appendPoints(inter2.points); + result.appendPoints(inter3.points); + result.appendPoints(inter4.points); + if (result.points.length > 0) { + result.status = "Intersection"; + } + return result; + }; +})(typeof exports !== "undefined" ? exports : this); + +(function(global) { + "use strict"; + var fabric = global.fabric || (global.fabric = {}); + if (fabric.Color) { + fabric.warn("fabric.Color is already defined."); + return; + } + function Color(color) { + if (!color) { + this.setSource([ 0, 0, 0, 1 ]); + } else { + this._tryParsingColor(color); + } + } + fabric.Color = Color; + fabric.Color.prototype = { + _tryParsingColor: function(color) { + var source; + if (color in Color.colorNameMap) { + color = Color.colorNameMap[color]; + } + if (color === "transparent") { + source = [ 255, 255, 255, 0 ]; + } + if (!source) { + source = Color.sourceFromHex(color); + } + if (!source) { + source = Color.sourceFromRgb(color); + } + if (!source) { + source = Color.sourceFromHsl(color); + } + if (!source) { + source = [ 0, 0, 0, 1 ]; + } + if (source) { + this.setSource(source); + } + }, + _rgbToHsl: function(r, g, b) { + r /= 255; + g /= 255; + b /= 255; + var h, s, l, max = fabric.util.array.max([ r, g, b ]), min = fabric.util.array.min([ r, g, b ]); + l = (max + min) / 2; + if (max === min) { + h = s = 0; + } else { + var d = max - min; + s = l > .5 ? d / (2 - max - min) : d / (max + min); + switch (max) { + case r: + h = (g - b) / d + (g < b ? 6 : 0); + break; + + case g: + h = (b - r) / d + 2; + break; + + case b: + h = (r - g) / d + 4; + break; + } + h /= 6; + } + return [ Math.round(h * 360), Math.round(s * 100), Math.round(l * 100) ]; + }, + getSource: function() { + return this._source; + }, + setSource: function(source) { + this._source = source; + }, + toRgb: function() { + var source = this.getSource(); + return "rgb(" + source[0] + "," + source[1] + "," + source[2] + ")"; + }, + toRgba: function() { + var source = this.getSource(); + return "rgba(" + source[0] + "," + source[1] + "," + source[2] + "," + source[3] + ")"; + }, + toHsl: function() { + var source = this.getSource(), hsl = this._rgbToHsl(source[0], source[1], source[2]); + return "hsl(" + hsl[0] + "," + hsl[1] + "%," + hsl[2] + "%)"; + }, + toHsla: function() { + var source = this.getSource(), hsl = this._rgbToHsl(source[0], source[1], source[2]); + return "hsla(" + hsl[0] + "," + hsl[1] + "%," + hsl[2] + "%," + source[3] + ")"; + }, + toHex: function() { + var source = this.getSource(), r, g, b; + r = source[0].toString(16); + r = r.length === 1 ? "0" + r : r; + g = source[1].toString(16); + g = g.length === 1 ? "0" + g : g; + b = source[2].toString(16); + b = b.length === 1 ? "0" + b : b; + return r.toUpperCase() + g.toUpperCase() + b.toUpperCase(); + }, + getAlpha: function() { + return this.getSource()[3]; + }, + setAlpha: function(alpha) { + var source = this.getSource(); + source[3] = alpha; + this.setSource(source); + return this; + }, + toGrayscale: function() { + var source = this.getSource(), average = parseInt((source[0] * .3 + source[1] * .59 + source[2] * .11).toFixed(0), 10), currentAlpha = source[3]; + this.setSource([ average, average, average, currentAlpha ]); + return this; + }, + toBlackWhite: function(threshold) { + var source = this.getSource(), average = (source[0] * .3 + source[1] * .59 + source[2] * .11).toFixed(0), currentAlpha = source[3]; + threshold = threshold || 127; + average = Number(average) < Number(threshold) ? 0 : 255; + this.setSource([ average, average, average, currentAlpha ]); + return this; + }, + overlayWith: function(otherColor) { + if (!(otherColor instanceof Color)) { + otherColor = new Color(otherColor); + } + var result = [], alpha = this.getAlpha(), otherAlpha = .5, source = this.getSource(), otherSource = otherColor.getSource(); + for (var i = 0; i < 3; i++) { + result.push(Math.round(source[i] * (1 - otherAlpha) + otherSource[i] * otherAlpha)); + } + result[3] = alpha; + this.setSource(result); + return this; + } + }; + fabric.Color.reRGBa = /^rgba?\(\s*(\d{1,3}(?:\.\d+)?\%?)\s*,\s*(\d{1,3}(?:\.\d+)?\%?)\s*,\s*(\d{1,3}(?:\.\d+)?\%?)\s*(?:\s*,\s*(\d+(?:\.\d+)?)\s*)?\)$/; + fabric.Color.reHSLa = /^hsla?\(\s*(\d{1,3})\s*,\s*(\d{1,3}\%)\s*,\s*(\d{1,3}\%)\s*(?:\s*,\s*(\d+(?:\.\d+)?)\s*)?\)$/; + fabric.Color.reHex = /^#?([0-9a-f]{8}|[0-9a-f]{6}|[0-9a-f]{4}|[0-9a-f]{3})$/i; + fabric.Color.colorNameMap = { + aqua: "#00FFFF", + black: "#000000", + blue: "#0000FF", + fuchsia: "#FF00FF", + gray: "#808080", + grey: "#808080", + green: "#008000", + lime: "#00FF00", + maroon: "#800000", + navy: "#000080", + olive: "#808000", + orange: "#FFA500", + purple: "#800080", + red: "#FF0000", + silver: "#C0C0C0", + teal: "#008080", + white: "#FFFFFF", + yellow: "#FFFF00" + }; + function hue2rgb(p, q, t) { + if (t < 0) { + t += 1; + } + if (t > 1) { + t -= 1; + } + if (t < 1 / 6) { + return p + (q - p) * 6 * t; + } + if (t < 1 / 2) { + return q; + } + if (t < 2 / 3) { + return p + (q - p) * (2 / 3 - t) * 6; + } + return p; + } + fabric.Color.fromRgb = function(color) { + return Color.fromSource(Color.sourceFromRgb(color)); + }; + fabric.Color.sourceFromRgb = function(color) { + var match = color.match(Color.reRGBa); + if (match) { + var r = parseInt(match[1], 10) / (/%$/.test(match[1]) ? 100 : 1) * (/%$/.test(match[1]) ? 255 : 1), g = parseInt(match[2], 10) / (/%$/.test(match[2]) ? 100 : 1) * (/%$/.test(match[2]) ? 255 : 1), b = parseInt(match[3], 10) / (/%$/.test(match[3]) ? 100 : 1) * (/%$/.test(match[3]) ? 255 : 1); + return [ parseInt(r, 10), parseInt(g, 10), parseInt(b, 10), match[4] ? parseFloat(match[4]) : 1 ]; + } + }; + fabric.Color.fromRgba = Color.fromRgb; + fabric.Color.fromHsl = function(color) { + return Color.fromSource(Color.sourceFromHsl(color)); + }; + fabric.Color.sourceFromHsl = function(color) { + var match = color.match(Color.reHSLa); + if (!match) { + return; + } + var h = (parseFloat(match[1]) % 360 + 360) % 360 / 360, s = parseFloat(match[2]) / (/%$/.test(match[2]) ? 100 : 1), l = parseFloat(match[3]) / (/%$/.test(match[3]) ? 100 : 1), r, g, b; + if (s === 0) { + r = g = b = l; + } else { + var q = l <= .5 ? l * (s + 1) : l + s - l * s, p = l * 2 - q; + r = hue2rgb(p, q, h + 1 / 3); + g = hue2rgb(p, q, h); + b = hue2rgb(p, q, h - 1 / 3); + } + return [ Math.round(r * 255), Math.round(g * 255), Math.round(b * 255), match[4] ? parseFloat(match[4]) : 1 ]; + }; + fabric.Color.fromHsla = Color.fromHsl; + fabric.Color.fromHex = function(color) { + return Color.fromSource(Color.sourceFromHex(color)); + }; + fabric.Color.sourceFromHex = function(color) { + if (color.match(Color.reHex)) { + var value = color.slice(color.indexOf("#") + 1), isShortNotation = value.length === 3 || value.length === 4, isRGBa = value.length === 8 || value.length === 4, r = isShortNotation ? value.charAt(0) + value.charAt(0) : value.substring(0, 2), g = isShortNotation ? value.charAt(1) + value.charAt(1) : value.substring(2, 4), b = isShortNotation ? value.charAt(2) + value.charAt(2) : value.substring(4, 6), a = isRGBa ? isShortNotation ? value.charAt(3) + value.charAt(3) : value.substring(6, 8) : "FF"; + return [ parseInt(r, 16), parseInt(g, 16), parseInt(b, 16), parseFloat((parseInt(a, 16) / 255).toFixed(2)) ]; + } + }; + fabric.Color.fromSource = function(source) { + var oColor = new Color(); + oColor.setSource(source); + return oColor; + }; +})(typeof exports !== "undefined" ? exports : this); + +(function() { + function getColorStop(el) { + var style = el.getAttribute("style"), offset = el.getAttribute("offset") || 0, color, colorAlpha, opacity; + offset = parseFloat(offset) / (/%$/.test(offset) ? 100 : 1); + offset = offset < 0 ? 0 : offset > 1 ? 1 : offset; + if (style) { + var keyValuePairs = style.split(/\s*;\s*/); + if (keyValuePairs[keyValuePairs.length - 1] === "") { + keyValuePairs.pop(); + } + for (var i = keyValuePairs.length; i--; ) { + var split = keyValuePairs[i].split(/\s*:\s*/), key = split[0].trim(), value = split[1].trim(); + if (key === "stop-color") { + color = value; + } else if (key === "stop-opacity") { + opacity = value; + } + } + } + if (!color) { + color = el.getAttribute("stop-color") || "rgb(0,0,0)"; + } + if (!opacity) { + opacity = el.getAttribute("stop-opacity"); + } + color = new fabric.Color(color); + colorAlpha = color.getAlpha(); + opacity = isNaN(parseFloat(opacity)) ? 1 : parseFloat(opacity); + opacity *= colorAlpha; + return { + offset: offset, + color: color.toRgb(), + opacity: opacity + }; + } + function getLinearCoords(el) { + return { + x1: el.getAttribute("x1") || 0, + y1: el.getAttribute("y1") || 0, + x2: el.getAttribute("x2") || "100%", + y2: el.getAttribute("y2") || 0 + }; + } + function getRadialCoords(el) { + return { + x1: el.getAttribute("fx") || el.getAttribute("cx") || "50%", + y1: el.getAttribute("fy") || el.getAttribute("cy") || "50%", + r1: 0, + x2: el.getAttribute("cx") || "50%", + y2: el.getAttribute("cy") || "50%", + r2: el.getAttribute("r") || "50%" + }; + } + fabric.Gradient = fabric.util.createClass({ + offsetX: 0, + offsetY: 0, + initialize: function(options) { + options || (options = {}); + var coords = {}; + this.id = fabric.Object.__uid++; + this.type = options.type || "linear"; + coords = { + x1: options.coords.x1 || 0, + y1: options.coords.y1 || 0, + x2: options.coords.x2 || 0, + y2: options.coords.y2 || 0 + }; + if (this.type === "radial") { + coords.r1 = options.coords.r1 || 0; + coords.r2 = options.coords.r2 || 0; + } + this.coords = coords; + this.colorStops = options.colorStops.slice(); + if (options.gradientTransform) { + this.gradientTransform = options.gradientTransform; + } + this.offsetX = options.offsetX || this.offsetX; + this.offsetY = options.offsetY || this.offsetY; + }, + addColorStop: function(colorStop) { + for (var position in colorStop) { + var color = new fabric.Color(colorStop[position]); + this.colorStops.push({ + offset: position, + color: color.toRgb(), + opacity: color.getAlpha() + }); + } + return this; + }, + toObject: function() { + return { + type: this.type, + coords: this.coords, + colorStops: this.colorStops, + offsetX: this.offsetX, + offsetY: this.offsetY, + gradientTransform: this.gradientTransform ? this.gradientTransform.concat() : this.gradientTransform + }; + }, + toSVG: function(object) { + var coords = fabric.util.object.clone(this.coords), markup, commonAttributes; + this.colorStops.sort(function(a, b) { + return a.offset - b.offset; + }); + if (!(object.group && object.group.type === "path-group")) { + for (var prop in coords) { + if (prop === "x1" || prop === "x2" || prop === "r2") { + coords[prop] += this.offsetX - object.width / 2; + } else if (prop === "y1" || prop === "y2") { + coords[prop] += this.offsetY - object.height / 2; + } + } + } + commonAttributes = 'id="SVGID_' + this.id + '" gradientUnits="userSpaceOnUse"'; + if (this.gradientTransform) { + commonAttributes += ' gradientTransform="matrix(' + this.gradientTransform.join(" ") + ')" '; + } + if (this.type === "linear") { + markup = [ "\n' ]; + } else if (this.type === "radial") { + markup = [ "\n' ]; + } + for (var i = 0; i < this.colorStops.length; i++) { + markup.push("\n'); + } + markup.push(this.type === "linear" ? "\n" : "\n"); + return markup.join(""); + }, + toLive: function(ctx, object) { + var gradient, prop, coords = fabric.util.object.clone(this.coords); + if (!this.type) { + return; + } + if (object.group && object.group.type === "path-group") { + for (prop in coords) { + if (prop === "x1" || prop === "x2") { + coords[prop] += -this.offsetX + object.width / 2; + } else if (prop === "y1" || prop === "y2") { + coords[prop] += -this.offsetY + object.height / 2; + } + } + } + if (this.type === "linear") { + gradient = ctx.createLinearGradient(coords.x1, coords.y1, coords.x2, coords.y2); + } else if (this.type === "radial") { + gradient = ctx.createRadialGradient(coords.x1, coords.y1, coords.r1, coords.x2, coords.y2, coords.r2); + } + for (var i = 0, len = this.colorStops.length; i < len; i++) { + var color = this.colorStops[i].color, opacity = this.colorStops[i].opacity, offset = this.colorStops[i].offset; + if (typeof opacity !== "undefined") { + color = new fabric.Color(color).setAlpha(opacity).toRgba(); + } + gradient.addColorStop(parseFloat(offset), color); + } + return gradient; + } + }); + fabric.util.object.extend(fabric.Gradient, { + fromElement: function(el, instance) { + var colorStopEls = el.getElementsByTagName("stop"), type, gradientUnits = el.getAttribute("gradientUnits") || "objectBoundingBox", gradientTransform = el.getAttribute("gradientTransform"), colorStops = [], coords, ellipseMatrix; + if (el.nodeName === "linearGradient" || el.nodeName === "LINEARGRADIENT") { + type = "linear"; + } else { + type = "radial"; + } + if (type === "linear") { + coords = getLinearCoords(el); + } else if (type === "radial") { + coords = getRadialCoords(el); + } + for (var i = colorStopEls.length; i--; ) { + colorStops.push(getColorStop(colorStopEls[i])); + } + ellipseMatrix = _convertPercentUnitsToValues(instance, coords, gradientUnits); + var gradient = new fabric.Gradient({ + type: type, + coords: coords, + colorStops: colorStops, + offsetX: -instance.left, + offsetY: -instance.top + }); + if (gradientTransform || ellipseMatrix !== "") { + gradient.gradientTransform = fabric.parseTransformAttribute((gradientTransform || "") + ellipseMatrix); + } + return gradient; + }, + forObject: function(obj, options) { + options || (options = {}); + _convertPercentUnitsToValues(obj, options.coords, "userSpaceOnUse"); + return new fabric.Gradient(options); + } + }); + function _convertPercentUnitsToValues(object, options, gradientUnits) { + var propValue, addFactor = 0, multFactor = 1, ellipseMatrix = ""; + for (var prop in options) { + if (options[prop] === "Infinity") { + options[prop] = 1; + } else if (options[prop] === "-Infinity") { + options[prop] = 0; + } + propValue = parseFloat(options[prop], 10); + if (typeof options[prop] === "string" && /^\d+%$/.test(options[prop])) { + multFactor = .01; + } else { + multFactor = 1; + } + if (prop === "x1" || prop === "x2" || prop === "r2") { + multFactor *= gradientUnits === "objectBoundingBox" ? object.width : 1; + addFactor = gradientUnits === "objectBoundingBox" ? object.left || 0 : 0; + } else if (prop === "y1" || prop === "y2") { + multFactor *= gradientUnits === "objectBoundingBox" ? object.height : 1; + addFactor = gradientUnits === "objectBoundingBox" ? object.top || 0 : 0; + } + options[prop] = propValue * multFactor + addFactor; + } + if (object.type === "ellipse" && options.r2 !== null && gradientUnits === "objectBoundingBox" && object.rx !== object.ry) { + var scaleFactor = object.ry / object.rx; + ellipseMatrix = " scale(1, " + scaleFactor + ")"; + if (options.y1) { + options.y1 /= scaleFactor; + } + if (options.y2) { + options.y2 /= scaleFactor; + } + } + return ellipseMatrix; + } +})(); + +fabric.Pattern = fabric.util.createClass({ + repeat: "repeat", + offsetX: 0, + offsetY: 0, + initialize: function(options) { + options || (options = {}); + this.id = fabric.Object.__uid++; + if (options.source) { + if (typeof options.source === "string") { + if (typeof fabric.util.getFunctionBody(options.source) !== "undefined") { + this.source = new Function(fabric.util.getFunctionBody(options.source)); + } else { + var _this = this; + this.source = fabric.util.createImage(); + fabric.util.loadImage(options.source, function(img) { + _this.source = img; + }); + } + } else { + this.source = options.source; + } + } + if (options.repeat) { + this.repeat = options.repeat; + } + if (options.offsetX) { + this.offsetX = options.offsetX; + } + if (options.offsetY) { + this.offsetY = options.offsetY; + } + }, + toObject: function() { + var source; + if (typeof this.source === "function") { + source = String(this.source); + } else if (typeof this.source.src === "string") { + source = this.source.src; + } else if (typeof this.source === "object" && this.source.toDataURL) { + source = this.source.toDataURL(); + } + return { + source: source, + repeat: this.repeat, + offsetX: this.offsetX, + offsetY: this.offsetY + }; + }, + toSVG: function(object) { + var patternSource = typeof this.source === "function" ? this.source() : this.source, patternWidth = patternSource.width / object.getWidth(), patternHeight = patternSource.height / object.getHeight(), patternOffsetX = this.offsetX / object.getWidth(), patternOffsetY = this.offsetY / object.getHeight(), patternImgSrc = ""; + if (this.repeat === "repeat-x" || this.repeat === "no-repeat") { + patternHeight = 1; + } + if (this.repeat === "repeat-y" || this.repeat === "no-repeat") { + patternWidth = 1; + } + if (patternSource.src) { + patternImgSrc = patternSource.src; + } else if (patternSource.toDataURL) { + patternImgSrc = patternSource.toDataURL(); + } + return '\n' + '\n' + "\n"; + }, + toLive: function(ctx) { + var source = typeof this.source === "function" ? this.source() : this.source; + if (!source) { + return ""; + } + if (typeof source.src !== "undefined") { + if (!source.complete) { + return ""; + } + if (source.naturalWidth === 0 || source.naturalHeight === 0) { + return ""; + } + } + return ctx.createPattern(source, this.repeat); + } +}); + +(function(global) { + "use strict"; + var fabric = global.fabric || (global.fabric = {}), toFixed = fabric.util.toFixed; + if (fabric.Shadow) { + fabric.warn("fabric.Shadow is already defined."); + return; + } + fabric.Shadow = fabric.util.createClass({ + color: "rgb(0,0,0)", + blur: 0, + offsetX: 0, + offsetY: 0, + affectStroke: false, + includeDefaultValues: true, + initialize: function(options) { + if (typeof options === "string") { + options = this._parseShadow(options); + } + for (var prop in options) { + this[prop] = options[prop]; + } + this.id = fabric.Object.__uid++; + }, + _parseShadow: function(shadow) { + var shadowStr = shadow.trim(), offsetsAndBlur = fabric.Shadow.reOffsetsAndBlur.exec(shadowStr) || [], color = shadowStr.replace(fabric.Shadow.reOffsetsAndBlur, "") || "rgb(0,0,0)"; + return { + color: color.trim(), + offsetX: parseInt(offsetsAndBlur[1], 10) || 0, + offsetY: parseInt(offsetsAndBlur[2], 10) || 0, + blur: parseInt(offsetsAndBlur[3], 10) || 0 + }; + }, + toString: function() { + return [ this.offsetX, this.offsetY, this.blur, this.color ].join("px "); + }, + toSVG: function(object) { + var fBoxX = 40, fBoxY = 40, NUM_FRACTION_DIGITS = fabric.Object.NUM_FRACTION_DIGITS, offset = fabric.util.rotateVector({ + x: this.offsetX, + y: this.offsetY + }, fabric.util.degreesToRadians(-object.angle)), BLUR_BOX = 20; + if (object.width && object.height) { + fBoxX = toFixed((Math.abs(offset.x) + this.blur) / object.width, NUM_FRACTION_DIGITS) * 100 + BLUR_BOX; + fBoxY = toFixed((Math.abs(offset.y) + this.blur) / object.height, NUM_FRACTION_DIGITS) * 100 + BLUR_BOX; + } + if (object.flipX) { + offset.x *= -1; + } + if (object.flipY) { + offset.y *= -1; + } + return '\n" + '\t\n' + '\t\n' + '\t\n' + '\t\n' + "\t\n" + "\t\t\n" + '\t\t\n' + "\t\n" + "\n"; + }, + toObject: function() { + if (this.includeDefaultValues) { + return { + color: this.color, + blur: this.blur, + offsetX: this.offsetX, + offsetY: this.offsetY, + affectStroke: this.affectStroke + }; + } + var obj = {}, proto = fabric.Shadow.prototype; + [ "color", "blur", "offsetX", "offsetY", "affectStroke" ].forEach(function(prop) { + if (this[prop] !== proto[prop]) { + obj[prop] = this[prop]; + } + }, this); + return obj; + } + }); + fabric.Shadow.reOffsetsAndBlur = /(?:\s|^)(-?\d+(?:px)?(?:\s?|$))?(-?\d+(?:px)?(?:\s?|$))?(\d+(?:px)?)?(?:\s?|$)(?:$|\s)/; +})(typeof exports !== "undefined" ? exports : this); + +(function() { + "use strict"; + if (fabric.StaticCanvas) { + fabric.warn("fabric.StaticCanvas is already defined."); + return; + } + var extend = fabric.util.object.extend, getElementOffset = fabric.util.getElementOffset, removeFromArray = fabric.util.removeFromArray, toFixed = fabric.util.toFixed, CANVAS_INIT_ERROR = new Error("Could not initialize `canvas` element"); + fabric.StaticCanvas = fabric.util.createClass({ + initialize: function(el, options) { + options || (options = {}); + this._initStatic(el, options); + }, + backgroundColor: "", + backgroundImage: null, + overlayColor: "", + overlayImage: null, + includeDefaultValues: true, + stateful: true, + renderOnAddRemove: true, + clipTo: null, + controlsAboveOverlay: false, + allowTouchScrolling: false, + imageSmoothingEnabled: true, + viewportTransform: [ 1, 0, 0, 1, 0, 0 ], + backgroundVpt: true, + overlayVpt: true, + onBeforeScaleRotate: function() {}, + enableRetinaScaling: true, + _initStatic: function(el, options) { + var cb = fabric.StaticCanvas.prototype.renderAll.bind(this); + this._objects = []; + this._createLowerCanvas(el); + this._initOptions(options); + this._setImageSmoothing(); + if (!this.interactive) { + this._initRetinaScaling(); + } + if (options.overlayImage) { + this.setOverlayImage(options.overlayImage, cb); + } + if (options.backgroundImage) { + this.setBackgroundImage(options.backgroundImage, cb); + } + if (options.backgroundColor) { + this.setBackgroundColor(options.backgroundColor, cb); + } + if (options.overlayColor) { + this.setOverlayColor(options.overlayColor, cb); + } + this.calcOffset(); + }, + _isRetinaScaling: function() { + return fabric.devicePixelRatio !== 1 && this.enableRetinaScaling; + }, + getRetinaScaling: function() { + return this._isRetinaScaling() ? fabric.devicePixelRatio : 1; + }, + _initRetinaScaling: function() { + if (!this._isRetinaScaling()) { + return; + } + this.lowerCanvasEl.setAttribute("width", this.width * fabric.devicePixelRatio); + this.lowerCanvasEl.setAttribute("height", this.height * fabric.devicePixelRatio); + this.contextContainer.scale(fabric.devicePixelRatio, fabric.devicePixelRatio); + }, + calcOffset: function() { + this._offset = getElementOffset(this.lowerCanvasEl); + return this; + }, + setOverlayImage: function(image, callback, options) { + return this.__setBgOverlayImage("overlayImage", image, callback, options); + }, + setBackgroundImage: function(image, callback, options) { + return this.__setBgOverlayImage("backgroundImage", image, callback, options); + }, + setOverlayColor: function(overlayColor, callback) { + return this.__setBgOverlayColor("overlayColor", overlayColor, callback); + }, + setBackgroundColor: function(backgroundColor, callback) { + return this.__setBgOverlayColor("backgroundColor", backgroundColor, callback); + }, + _setImageSmoothing: function() { + var ctx = this.getContext(); + ctx.imageSmoothingEnabled = ctx.imageSmoothingEnabled || ctx.webkitImageSmoothingEnabled || ctx.mozImageSmoothingEnabled || ctx.msImageSmoothingEnabled || ctx.oImageSmoothingEnabled; + ctx.imageSmoothingEnabled = this.imageSmoothingEnabled; + }, + __setBgOverlayImage: function(property, image, callback, options) { + if (typeof image === "string") { + fabric.util.loadImage(image, function(img) { + img && (this[property] = new fabric.Image(img, options)); + callback && callback(img); + }, this, options && options.crossOrigin); + } else { + options && image.setOptions(options); + this[property] = image; + callback && callback(image); + } + return this; + }, + __setBgOverlayColor: function(property, color, callback) { + if (color && color.source) { + var _this = this; + fabric.util.loadImage(color.source, function(img) { + _this[property] = new fabric.Pattern({ + source: img, + repeat: color.repeat, + offsetX: color.offsetX, + offsetY: color.offsetY + }); + callback && callback(); + }); + } else { + this[property] = color; + callback && callback(); + } + return this; + }, + _createCanvasElement: function(canvasEl) { + var element = fabric.util.createCanvasElement(canvasEl); + if (!element.style) { + element.style = {}; + } + if (!element) { + throw CANVAS_INIT_ERROR; + } + if (typeof element.getContext === "undefined") { + throw CANVAS_INIT_ERROR; + } + return element; + }, + _initOptions: function(options) { + for (var prop in options) { + this[prop] = options[prop]; + } + this.width = this.width || parseInt(this.lowerCanvasEl.width, 10) || 0; + this.height = this.height || parseInt(this.lowerCanvasEl.height, 10) || 0; + if (!this.lowerCanvasEl.style) { + return; + } + this.lowerCanvasEl.width = this.width; + this.lowerCanvasEl.height = this.height; + this.lowerCanvasEl.style.width = this.width + "px"; + this.lowerCanvasEl.style.height = this.height + "px"; + this.viewportTransform = this.viewportTransform.slice(); + }, + _createLowerCanvas: function(canvasEl) { + this.lowerCanvasEl = fabric.util.getById(canvasEl) || this._createCanvasElement(canvasEl); + fabric.util.addClass(this.lowerCanvasEl, "lower-canvas"); + if (this.interactive) { + this._applyCanvasStyle(this.lowerCanvasEl); + } + this.contextContainer = this.lowerCanvasEl.getContext("2d"); + }, + getWidth: function() { + return this.width; + }, + getHeight: function() { + return this.height; + }, + setWidth: function(value, options) { + return this.setDimensions({ + width: value + }, options); + }, + setHeight: function(value, options) { + return this.setDimensions({ + height: value + }, options); + }, + setDimensions: function(dimensions, options) { + var cssValue; + options = options || {}; + for (var prop in dimensions) { + cssValue = dimensions[prop]; + if (!options.cssOnly) { + this._setBackstoreDimension(prop, dimensions[prop]); + cssValue += "px"; + } + if (!options.backstoreOnly) { + this._setCssDimension(prop, cssValue); + } + } + this._initRetinaScaling(); + this._setImageSmoothing(); + this.calcOffset(); + if (!options.cssOnly) { + this.renderAll(); + } + return this; + }, + _setBackstoreDimension: function(prop, value) { + this.lowerCanvasEl[prop] = value; + if (this.upperCanvasEl) { + this.upperCanvasEl[prop] = value; + } + if (this.cacheCanvasEl) { + this.cacheCanvasEl[prop] = value; + } + this[prop] = value; + return this; + }, + _setCssDimension: function(prop, value) { + this.lowerCanvasEl.style[prop] = value; + if (this.upperCanvasEl) { + this.upperCanvasEl.style[prop] = value; + } + if (this.wrapperEl) { + this.wrapperEl.style[prop] = value; + } + return this; + }, + getZoom: function() { + return Math.sqrt(this.viewportTransform[0] * this.viewportTransform[3]); + }, + setViewportTransform: function(vpt) { + var activeGroup = this._activeGroup, object; + this.viewportTransform = vpt; + for (var i = 0, len = this._objects.length; i < len; i++) { + object = this._objects[i]; + object.group || object.setCoords(); + } + if (activeGroup) { + activeGroup.setCoords(); + } + this.renderAll(); + return this; + }, + zoomToPoint: function(point, value) { + var before = point, vpt = this.viewportTransform.slice(0); + point = fabric.util.transformPoint(point, fabric.util.invertTransform(this.viewportTransform)); + vpt[0] = value; + vpt[3] = value; + var after = fabric.util.transformPoint(point, vpt); + vpt[4] += before.x - after.x; + vpt[5] += before.y - after.y; + return this.setViewportTransform(vpt); + }, + setZoom: function(value) { + this.zoomToPoint(new fabric.Point(0, 0), value); + return this; + }, + absolutePan: function(point) { + var vpt = this.viewportTransform.slice(0); + vpt[4] = -point.x; + vpt[5] = -point.y; + return this.setViewportTransform(vpt); + }, + relativePan: function(point) { + return this.absolutePan(new fabric.Point(-point.x - this.viewportTransform[4], -point.y - this.viewportTransform[5])); + }, + getElement: function() { + return this.lowerCanvasEl; + }, + _onObjectAdded: function(obj) { + this.stateful && obj.setupState(); + obj._set("canvas", this); + obj.setCoords(); + this.fire("object:added", { + target: obj + }); + obj.fire("added"); + }, + _onObjectRemoved: function(obj) { + this.fire("object:removed", { + target: obj + }); + obj.fire("removed"); + delete obj.canvas; + }, + clearContext: function(ctx) { + ctx.clearRect(0, 0, this.width, this.height); + return this; + }, + getContext: function() { + return this.contextContainer; + }, + clear: function() { + this._objects.length = 0; + this.backgroundImage = null; + this.overlayImage = null; + this.backgroundColor = ""; + this.overlayColor = ""; + if (this._hasITextHandlers) { + this.off("selection:cleared", this._canvasITextSelectionClearedHanlder); + this.off("object:selected", this._canvasITextSelectionClearedHanlder); + this.off("mouse:up", this._mouseUpITextHandler); + this._iTextInstances = null; + this._hasITextHandlers = false; + } + this.clearContext(this.contextContainer); + this.fire("canvas:cleared"); + this.renderAll(); + return this; + }, + renderAll: function() { + var canvasToDrawOn = this.contextContainer; + this.renderCanvas(canvasToDrawOn, this._objects); + return this; + }, + renderCanvas: function(ctx, objects) { + this.clearContext(ctx); + this.fire("before:render"); + if (this.clipTo) { + fabric.util.clipContext(this, ctx); + } + this._renderBackground(ctx); + ctx.save(); + ctx.transform.apply(ctx, this.viewportTransform); + this._renderObjects(ctx, objects); + ctx.restore(); + if (!this.controlsAboveOverlay && this.interactive) { + this.drawControls(ctx); + } + if (this.clipTo) { + ctx.restore(); + } + this._renderOverlay(ctx); + if (this.controlsAboveOverlay && this.interactive) { + this.drawControls(ctx); + } + this.fire("after:render"); + }, + _renderObjects: function(ctx, objects) { + for (var i = 0, length = objects.length; i < length; ++i) { + objects[i] && objects[i].render(ctx); + } + }, + _renderBackgroundOrOverlay: function(ctx, property) { + var object = this[property + "Color"]; + if (object) { + ctx.fillStyle = object.toLive ? object.toLive(ctx) : object; + ctx.fillRect(object.offsetX || 0, object.offsetY || 0, this.width, this.height); + } + object = this[property + "Image"]; + if (object) { + if (this[property + "Vpt"]) { + ctx.save(); + ctx.transform.apply(ctx, this.viewportTransform); + } + object.render(ctx); + this[property + "Vpt"] && ctx.restore(); + } + }, + _renderBackground: function(ctx) { + this._renderBackgroundOrOverlay(ctx, "background"); + }, + _renderOverlay: function(ctx) { + this._renderBackgroundOrOverlay(ctx, "overlay"); + }, + getCenter: function() { + return { + top: this.getHeight() / 2, + left: this.getWidth() / 2 + }; + }, + centerObjectH: function(object) { + return this._centerObject(object, new fabric.Point(this.getCenter().left, object.getCenterPoint().y)); + }, + centerObjectV: function(object) { + return this._centerObject(object, new fabric.Point(object.getCenterPoint().x, this.getCenter().top)); + }, + centerObject: function(object) { + var center = this.getCenter(); + return this._centerObject(object, new fabric.Point(center.left, center.top)); + }, + viewportCenterObject: function(object) { + var vpCenter = this.getVpCenter(); + return this._centerObject(object, vpCenter); + }, + viewportCenterObjectH: function(object) { + var vpCenter = this.getVpCenter(); + this._centerObject(object, new fabric.Point(vpCenter.x, object.getCenterPoint().y)); + return this; + }, + viewportCenterObjectV: function(object) { + var vpCenter = this.getVpCenter(); + return this._centerObject(object, new fabric.Point(object.getCenterPoint().x, vpCenter.y)); + }, + getVpCenter: function() { + var center = this.getCenter(), iVpt = fabric.util.invertTransform(this.viewportTransform); + return fabric.util.transformPoint({ + x: center.left, + y: center.top + }, iVpt); + }, + _centerObject: function(object, center) { + object.setPositionByOrigin(center, "center", "center"); + this.renderAll(); + return this; + }, + toDatalessJSON: function(propertiesToInclude) { + return this.toDatalessObject(propertiesToInclude); + }, + toObject: function(propertiesToInclude) { + return this._toObjectMethod("toObject", propertiesToInclude); + }, + toDatalessObject: function(propertiesToInclude) { + return this._toObjectMethod("toDatalessObject", propertiesToInclude); + }, + _toObjectMethod: function(methodName, propertiesToInclude) { + var data = { + objects: this._toObjects(methodName, propertiesToInclude) + }; + extend(data, this.__serializeBgOverlay(propertiesToInclude)); + fabric.util.populateWithProperties(this, data, propertiesToInclude); + return data; + }, + _toObjects: function(methodName, propertiesToInclude) { + return this.getObjects().filter(function(object) { + return !object.excludeFromExport; + }).map(function(instance) { + return this._toObject(instance, methodName, propertiesToInclude); + }, this); + }, + _toObject: function(instance, methodName, propertiesToInclude) { + var originalValue; + if (!this.includeDefaultValues) { + originalValue = instance.includeDefaultValues; + instance.includeDefaultValues = false; + } + var object = instance[methodName](propertiesToInclude); + if (!this.includeDefaultValues) { + instance.includeDefaultValues = originalValue; + } + return object; + }, + __serializeBgOverlay: function(propertiesToInclude) { + var data = { + background: this.backgroundColor && this.backgroundColor.toObject ? this.backgroundColor.toObject(propertiesToInclude) : this.backgroundColor + }; + if (this.overlayColor) { + data.overlay = this.overlayColor.toObject ? this.overlayColor.toObject(propertiesToInclude) : this.overlayColor; + } + if (this.backgroundImage) { + data.backgroundImage = this.backgroundImage.toObject(propertiesToInclude); + } + if (this.overlayImage) { + data.overlayImage = this.overlayImage.toObject(propertiesToInclude); + } + return data; + }, + svgViewportTransformation: true, + toSVG: function(options, reviver) { + options || (options = {}); + var markup = []; + this._setSVGPreamble(markup, options); + this._setSVGHeader(markup, options); + this._setSVGBgOverlayColor(markup, "backgroundColor"); + this._setSVGBgOverlayImage(markup, "backgroundImage", reviver); + this._setSVGObjects(markup, reviver); + this._setSVGBgOverlayColor(markup, "overlayColor"); + this._setSVGBgOverlayImage(markup, "overlayImage", reviver); + markup.push(""); + return markup.join(""); + }, + _setSVGPreamble: function(markup, options) { + if (options.suppressPreamble) { + return; + } + markup.push('\n', '\n'); + }, + _setSVGHeader: function(markup, options) { + var width = options.width || this.width, height = options.height || this.height, vpt, viewBox = 'viewBox="0 0 ' + this.width + " " + this.height + '" ', NUM_FRACTION_DIGITS = fabric.Object.NUM_FRACTION_DIGITS; + if (options.viewBox) { + viewBox = 'viewBox="' + options.viewBox.x + " " + options.viewBox.y + " " + options.viewBox.width + " " + options.viewBox.height + '" '; + } else { + if (this.svgViewportTransformation) { + vpt = this.viewportTransform; + viewBox = 'viewBox="' + toFixed(-vpt[4] / vpt[0], NUM_FRACTION_DIGITS) + " " + toFixed(-vpt[5] / vpt[3], NUM_FRACTION_DIGITS) + " " + toFixed(this.width / vpt[0], NUM_FRACTION_DIGITS) + " " + toFixed(this.height / vpt[3], NUM_FRACTION_DIGITS) + '" '; + } + } + markup.push("\n', "Created with Fabric.js ", fabric.version, "\n", "", fabric.createSVGFontFacesMarkup(this.getObjects()), fabric.createSVGRefElementsMarkup(this), "\n"); + }, + _setSVGObjects: function(markup, reviver) { + var instance; + for (var i = 0, objects = this.getObjects(), len = objects.length; i < len; i++) { + instance = objects[i]; + if (instance.excludeFromExport) { + continue; + } + this._setSVGObject(markup, instance, reviver); + } + }, + _setSVGObject: function(markup, instance, reviver) { + markup.push(instance.toSVG(reviver)); + }, + _setSVGBgOverlayImage: function(markup, property, reviver) { + if (this[property] && this[property].toSVG) { + markup.push(this[property].toSVG(reviver)); + } + }, + _setSVGBgOverlayColor: function(markup, property) { + if (this[property] && this[property].source) { + markup.push('\n"); + } else if (this[property] && property === "overlayColor") { + markup.push('\n"); + } + }, + sendToBack: function(object) { + if (!object) { + return this; + } + var activeGroup = this._activeGroup, i, obj, objs; + if (object === activeGroup) { + objs = activeGroup._objects; + for (i = objs.length; i--; ) { + obj = objs[i]; + removeFromArray(this._objects, obj); + this._objects.unshift(obj); + } + } else { + removeFromArray(this._objects, object); + this._objects.unshift(object); + } + return this.renderAll && this.renderAll(); + }, + bringToFront: function(object) { + if (!object) { + return this; + } + var activeGroup = this._activeGroup, i, obj, objs; + if (object === activeGroup) { + objs = activeGroup._objects; + for (i = 0; i < objs.length; i++) { + obj = objs[i]; + removeFromArray(this._objects, obj); + this._objects.push(obj); + } + } else { + removeFromArray(this._objects, object); + this._objects.push(object); + } + return this.renderAll && this.renderAll(); + }, + sendBackwards: function(object, intersecting) { + if (!object) { + return this; + } + var activeGroup = this._activeGroup, i, obj, idx, newIdx, objs; + if (object === activeGroup) { + objs = activeGroup._objects; + for (i = 0; i < objs.length; i++) { + obj = objs[i]; + idx = this._objects.indexOf(obj); + if (idx !== 0) { + newIdx = idx - 1; + removeFromArray(this._objects, obj); + this._objects.splice(newIdx, 0, obj); + } + } + } else { + idx = this._objects.indexOf(object); + if (idx !== 0) { + newIdx = this._findNewLowerIndex(object, idx, intersecting); + removeFromArray(this._objects, object); + this._objects.splice(newIdx, 0, object); + } + } + this.renderAll && this.renderAll(); + return this; + }, + _findNewLowerIndex: function(object, idx, intersecting) { + var newIdx; + if (intersecting) { + newIdx = idx; + for (var i = idx - 1; i >= 0; --i) { + var isIntersecting = object.intersectsWithObject(this._objects[i]) || object.isContainedWithinObject(this._objects[i]) || this._objects[i].isContainedWithinObject(object); + if (isIntersecting) { + newIdx = i; + break; + } + } + } else { + newIdx = idx - 1; + } + return newIdx; + }, + bringForward: function(object, intersecting) { + if (!object) { + return this; + } + var activeGroup = this._activeGroup, i, obj, idx, newIdx, objs; + if (object === activeGroup) { + objs = activeGroup._objects; + for (i = objs.length; i--; ) { + obj = objs[i]; + idx = this._objects.indexOf(obj); + if (idx !== this._objects.length - 1) { + newIdx = idx + 1; + removeFromArray(this._objects, obj); + this._objects.splice(newIdx, 0, obj); + } + } + } else { + idx = this._objects.indexOf(object); + if (idx !== this._objects.length - 1) { + newIdx = this._findNewUpperIndex(object, idx, intersecting); + removeFromArray(this._objects, object); + this._objects.splice(newIdx, 0, object); + } + } + this.renderAll && this.renderAll(); + return this; + }, + _findNewUpperIndex: function(object, idx, intersecting) { + var newIdx; + if (intersecting) { + newIdx = idx; + for (var i = idx + 1; i < this._objects.length; ++i) { + var isIntersecting = object.intersectsWithObject(this._objects[i]) || object.isContainedWithinObject(this._objects[i]) || this._objects[i].isContainedWithinObject(object); + if (isIntersecting) { + newIdx = i; + break; + } + } + } else { + newIdx = idx + 1; + } + return newIdx; + }, + moveTo: function(object, index) { + removeFromArray(this._objects, object); + this._objects.splice(index, 0, object); + return this.renderAll && this.renderAll(); + }, + dispose: function() { + this.clear(); + return this; + }, + toString: function() { + return "#"; + } + }); + extend(fabric.StaticCanvas.prototype, fabric.Observable); + extend(fabric.StaticCanvas.prototype, fabric.Collection); + extend(fabric.StaticCanvas.prototype, fabric.DataURLExporter); + extend(fabric.StaticCanvas, { + EMPTY_JSON: '{"objects": [], "background": "white"}', + supports: function(methodName) { + var el = fabric.util.createCanvasElement(); + if (!el || !el.getContext) { + return null; + } + var ctx = el.getContext("2d"); + if (!ctx) { + return null; + } + switch (methodName) { + case "getImageData": + return typeof ctx.getImageData !== "undefined"; + + case "setLineDash": + return typeof ctx.setLineDash !== "undefined"; + + case "toDataURL": + return typeof el.toDataURL !== "undefined"; + + case "toDataURLWithQuality": + try { + el.toDataURL("image/jpeg", 0); + return true; + } catch (e) {} + return false; + + default: + return null; + } + } + }); + fabric.StaticCanvas.prototype.toJSON = fabric.StaticCanvas.prototype.toObject; +})(); + +fabric.BaseBrush = fabric.util.createClass({ + color: "rgb(0, 0, 0)", + width: 1, + shadow: null, + strokeLineCap: "round", + strokeLineJoin: "round", + strokeDashArray: null, + setShadow: function(options) { + this.shadow = new fabric.Shadow(options); + return this; + }, + _setBrushStyles: function() { + var ctx = this.canvas.contextTop; + ctx.strokeStyle = this.color; + ctx.lineWidth = this.width; + ctx.lineCap = this.strokeLineCap; + ctx.lineJoin = this.strokeLineJoin; + if (this.strokeDashArray && fabric.StaticCanvas.supports("setLineDash")) { + ctx.setLineDash(this.strokeDashArray); + } + }, + _setShadow: function() { + if (!this.shadow) { + return; + } + var ctx = this.canvas.contextTop; + ctx.shadowColor = this.shadow.color; + ctx.shadowBlur = this.shadow.blur; + ctx.shadowOffsetX = this.shadow.offsetX; + ctx.shadowOffsetY = this.shadow.offsetY; + }, + _resetShadow: function() { + var ctx = this.canvas.contextTop; + ctx.shadowColor = ""; + ctx.shadowBlur = ctx.shadowOffsetX = ctx.shadowOffsetY = 0; + } +}); + +(function() { + fabric.PencilBrush = fabric.util.createClass(fabric.BaseBrush, { + initialize: function(canvas) { + this.canvas = canvas; + this._points = []; + }, + onMouseDown: function(pointer) { + this._prepareForDrawing(pointer); + this._captureDrawingPath(pointer); + this._render(); + }, + onMouseMove: function(pointer) { + this._captureDrawingPath(pointer); + this.canvas.clearContext(this.canvas.contextTop); + this._render(); + }, + onMouseUp: function() { + this._finalizeAndAddPath(); + }, + _prepareForDrawing: function(pointer) { + var p = new fabric.Point(pointer.x, pointer.y); + this._reset(); + this._addPoint(p); + this.canvas.contextTop.moveTo(p.x, p.y); + }, + _addPoint: function(point) { + this._points.push(point); + }, + _reset: function() { + this._points.length = 0; + this._setBrushStyles(); + this._setShadow(); + }, + _captureDrawingPath: function(pointer) { + var pointerPoint = new fabric.Point(pointer.x, pointer.y); + this._addPoint(pointerPoint); + }, + _render: function() { + var ctx = this.canvas.contextTop, v = this.canvas.viewportTransform, p1 = this._points[0], p2 = this._points[1]; + ctx.save(); + ctx.transform(v[0], v[1], v[2], v[3], v[4], v[5]); + ctx.beginPath(); + if (this._points.length === 2 && p1.x === p2.x && p1.y === p2.y) { + p1.x -= .5; + p2.x += .5; + } + ctx.moveTo(p1.x, p1.y); + for (var i = 1, len = this._points.length; i < len; i++) { + var midPoint = p1.midPointFrom(p2); + ctx.quadraticCurveTo(p1.x, p1.y, midPoint.x, midPoint.y); + p1 = this._points[i]; + p2 = this._points[i + 1]; + } + ctx.lineTo(p1.x, p1.y); + ctx.stroke(); + ctx.restore(); + }, + convertPointsToSVGPath: function(points) { + var path = [], p1 = new fabric.Point(points[0].x, points[0].y), p2 = new fabric.Point(points[1].x, points[1].y); + path.push("M ", points[0].x, " ", points[0].y, " "); + for (var i = 1, len = points.length; i < len; i++) { + var midPoint = p1.midPointFrom(p2); + path.push("Q ", p1.x, " ", p1.y, " ", midPoint.x, " ", midPoint.y, " "); + p1 = new fabric.Point(points[i].x, points[i].y); + if (i + 1 < points.length) { + p2 = new fabric.Point(points[i + 1].x, points[i + 1].y); + } + } + path.push("L ", p1.x, " ", p1.y, " "); + return path; + }, + createPath: function(pathData) { + var path = new fabric.Path(pathData, { + fill: null, + stroke: this.color, + strokeWidth: this.width, + strokeLineCap: this.strokeLineCap, + strokeLineJoin: this.strokeLineJoin, + strokeDashArray: this.strokeDashArray, + originX: "center", + originY: "center" + }); + if (this.shadow) { + this.shadow.affectStroke = true; + path.setShadow(this.shadow); + } + return path; + }, + _finalizeAndAddPath: function() { + var ctx = this.canvas.contextTop; + ctx.closePath(); + var pathData = this.convertPointsToSVGPath(this._points).join(""); + if (pathData === "M 0 0 Q 0 0 0 0 L 0 0") { + this.canvas.renderAll(); + return; + } + var path = this.createPath(pathData); + this.canvas.add(path); + path.setCoords(); + this.canvas.clearContext(this.canvas.contextTop); + this._resetShadow(); + this.canvas.renderAll(); + this.canvas.fire("path:created", { + path: path + }); + } + }); +})(); + +fabric.CircleBrush = fabric.util.createClass(fabric.BaseBrush, { + width: 10, + initialize: function(canvas) { + this.canvas = canvas; + this.points = []; + }, + drawDot: function(pointer) { + var point = this.addPoint(pointer), ctx = this.canvas.contextTop, v = this.canvas.viewportTransform; + ctx.save(); + ctx.transform(v[0], v[1], v[2], v[3], v[4], v[5]); + ctx.fillStyle = point.fill; + ctx.beginPath(); + ctx.arc(point.x, point.y, point.radius, 0, Math.PI * 2, false); + ctx.closePath(); + ctx.fill(); + ctx.restore(); + }, + onMouseDown: function(pointer) { + this.points.length = 0; + this.canvas.clearContext(this.canvas.contextTop); + this._setShadow(); + this.drawDot(pointer); + }, + onMouseMove: function(pointer) { + this.drawDot(pointer); + }, + onMouseUp: function() { + var originalRenderOnAddRemove = this.canvas.renderOnAddRemove; + this.canvas.renderOnAddRemove = false; + var circles = []; + for (var i = 0, len = this.points.length; i < len; i++) { + var point = this.points[i], circle = new fabric.Circle({ + radius: point.radius, + left: point.x, + top: point.y, + originX: "center", + originY: "center", + fill: point.fill + }); + this.shadow && circle.setShadow(this.shadow); + circles.push(circle); + } + var group = new fabric.Group(circles, { + originX: "center", + originY: "center" + }); + group.canvas = this.canvas; + this.canvas.add(group); + this.canvas.fire("path:created", { + path: group + }); + this.canvas.clearContext(this.canvas.contextTop); + this._resetShadow(); + this.canvas.renderOnAddRemove = originalRenderOnAddRemove; + this.canvas.renderAll(); + }, + addPoint: function(pointer) { + var pointerPoint = new fabric.Point(pointer.x, pointer.y), circleRadius = fabric.util.getRandomInt(Math.max(0, this.width - 20), this.width + 20) / 2, circleColor = new fabric.Color(this.color).setAlpha(fabric.util.getRandomInt(0, 100) / 100).toRgba(); + pointerPoint.radius = circleRadius; + pointerPoint.fill = circleColor; + this.points.push(pointerPoint); + return pointerPoint; + } +}); + +fabric.SprayBrush = fabric.util.createClass(fabric.BaseBrush, { + width: 10, + density: 20, + dotWidth: 1, + dotWidthVariance: 1, + randomOpacity: false, + optimizeOverlapping: true, + initialize: function(canvas) { + this.canvas = canvas; + this.sprayChunks = []; + }, + onMouseDown: function(pointer) { + this.sprayChunks.length = 0; + this.canvas.clearContext(this.canvas.contextTop); + this._setShadow(); + this.addSprayChunk(pointer); + this.render(); + }, + onMouseMove: function(pointer) { + this.addSprayChunk(pointer); + this.render(); + }, + onMouseUp: function() { + var originalRenderOnAddRemove = this.canvas.renderOnAddRemove; + this.canvas.renderOnAddRemove = false; + var rects = []; + for (var i = 0, ilen = this.sprayChunks.length; i < ilen; i++) { + var sprayChunk = this.sprayChunks[i]; + for (var j = 0, jlen = sprayChunk.length; j < jlen; j++) { + var rect = new fabric.Rect({ + width: sprayChunk[j].width, + height: sprayChunk[j].width, + left: sprayChunk[j].x + 1, + top: sprayChunk[j].y + 1, + originX: "center", + originY: "center", + fill: this.color + }); + this.shadow && rect.setShadow(this.shadow); + rects.push(rect); + } + } + if (this.optimizeOverlapping) { + rects = this._getOptimizedRects(rects); + } + var group = new fabric.Group(rects, { + originX: "center", + originY: "center" + }); + group.canvas = this.canvas; + this.canvas.add(group); + this.canvas.fire("path:created", { + path: group + }); + this.canvas.clearContext(this.canvas.contextTop); + this._resetShadow(); + this.canvas.renderOnAddRemove = originalRenderOnAddRemove; + this.canvas.renderAll(); + }, + _getOptimizedRects: function(rects) { + var uniqueRects = {}, key; + for (var i = 0, len = rects.length; i < len; i++) { + key = rects[i].left + "" + rects[i].top; + if (!uniqueRects[key]) { + uniqueRects[key] = rects[i]; + } + } + var uniqueRectsArray = []; + for (key in uniqueRects) { + uniqueRectsArray.push(uniqueRects[key]); + } + return uniqueRectsArray; + }, + render: function() { + var ctx = this.canvas.contextTop; + ctx.fillStyle = this.color; + var v = this.canvas.viewportTransform; + ctx.save(); + ctx.transform(v[0], v[1], v[2], v[3], v[4], v[5]); + for (var i = 0, len = this.sprayChunkPoints.length; i < len; i++) { + var point = this.sprayChunkPoints[i]; + if (typeof point.opacity !== "undefined") { + ctx.globalAlpha = point.opacity; + } + ctx.fillRect(point.x, point.y, point.width, point.width); + } + ctx.restore(); + }, + addSprayChunk: function(pointer) { + this.sprayChunkPoints = []; + var x, y, width, radius = this.width / 2; + for (var i = 0; i < this.density; i++) { + x = fabric.util.getRandomInt(pointer.x - radius, pointer.x + radius); + y = fabric.util.getRandomInt(pointer.y - radius, pointer.y + radius); + if (this.dotWidthVariance) { + width = fabric.util.getRandomInt(Math.max(1, this.dotWidth - this.dotWidthVariance), this.dotWidth + this.dotWidthVariance); + } else { + width = this.dotWidth; + } + var point = new fabric.Point(x, y); + point.width = width; + if (this.randomOpacity) { + point.opacity = fabric.util.getRandomInt(0, 100) / 100; + } + this.sprayChunkPoints.push(point); + } + this.sprayChunks.push(this.sprayChunkPoints); + } +}); + +fabric.PatternBrush = fabric.util.createClass(fabric.PencilBrush, { + getPatternSrc: function() { + var dotWidth = 20, dotDistance = 5, patternCanvas = fabric.document.createElement("canvas"), patternCtx = patternCanvas.getContext("2d"); + patternCanvas.width = patternCanvas.height = dotWidth + dotDistance; + patternCtx.fillStyle = this.color; + patternCtx.beginPath(); + patternCtx.arc(dotWidth / 2, dotWidth / 2, dotWidth / 2, 0, Math.PI * 2, false); + patternCtx.closePath(); + patternCtx.fill(); + return patternCanvas; + }, + getPatternSrcFunction: function() { + return String(this.getPatternSrc).replace("this.color", '"' + this.color + '"'); + }, + getPattern: function() { + return this.canvas.contextTop.createPattern(this.source || this.getPatternSrc(), "repeat"); + }, + _setBrushStyles: function() { + this.callSuper("_setBrushStyles"); + this.canvas.contextTop.strokeStyle = this.getPattern(); + }, + createPath: function(pathData) { + var path = this.callSuper("createPath", pathData), topLeft = path._getLeftTopCoords().scalarAdd(path.strokeWidth / 2); + path.stroke = new fabric.Pattern({ + source: this.source || this.getPatternSrcFunction(), + offsetX: -topLeft.x, + offsetY: -topLeft.y + }); + return path; + } +}); + +(function() { + var getPointer = fabric.util.getPointer, degreesToRadians = fabric.util.degreesToRadians, radiansToDegrees = fabric.util.radiansToDegrees, atan2 = Math.atan2, abs = Math.abs, supportLineDash = fabric.StaticCanvas.supports("setLineDash"), STROKE_OFFSET = .5; + fabric.Canvas = fabric.util.createClass(fabric.StaticCanvas, { + initialize: function(el, options) { + options || (options = {}); + this._initStatic(el, options); + this._initInteractive(); + this._createCacheCanvas(); + }, + uniScaleTransform: false, + uniScaleKey: "shiftKey", + centeredScaling: false, + centeredRotation: false, + centeredKey: "altKey", + altActionKey: "shiftKey", + interactive: true, + selection: true, + selectionKey: "shiftKey", + altSelectionKey: null, + selectionColor: "rgba(100, 100, 255, 0.3)", + selectionDashArray: [], + selectionBorderColor: "rgba(255, 255, 255, 0.3)", + selectionLineWidth: 1, + hoverCursor: "move", + moveCursor: "move", + defaultCursor: "default", + freeDrawingCursor: "crosshair", + rotationCursor: "crosshair", + containerClass: "canvas-container", + perPixelTargetFind: false, + targetFindTolerance: 0, + skipTargetFind: false, + isDrawingMode: false, + preserveObjectStacking: false, + stopContextMenu: false, + fireRightClick: false, + _initInteractive: function() { + this._currentTransform = null; + this._groupSelector = null; + this._initWrapperElement(); + this._createUpperCanvas(); + this._initEventListeners(); + this._initRetinaScaling(); + this.freeDrawingBrush = fabric.PencilBrush && new fabric.PencilBrush(this); + this.calcOffset(); + }, + _chooseObjectsToRender: function() { + var activeGroup = this.getActiveGroup(), activeObject = this.getActiveObject(), object, objsToRender = [], activeGroupObjects = []; + if ((activeGroup || activeObject) && !this.preserveObjectStacking) { + for (var i = 0, length = this._objects.length; i < length; i++) { + object = this._objects[i]; + if ((!activeGroup || !activeGroup.contains(object)) && object !== activeObject) { + objsToRender.push(object); + } else { + activeGroupObjects.push(object); + } + } + if (activeGroup) { + activeGroup._set("_objects", activeGroupObjects); + objsToRender.push(activeGroup); + } + activeObject && objsToRender.push(activeObject); + } else { + objsToRender = this._objects; + } + return objsToRender; + }, + renderAll: function() { + if (this.selection && !this._groupSelector && !this.isDrawingMode) { + this.clearContext(this.contextTop); + } + var canvasToDrawOn = this.contextContainer; + this.renderCanvas(canvasToDrawOn, this._chooseObjectsToRender()); + return this; + }, + renderTop: function() { + var ctx = this.contextTop; + this.clearContext(ctx); + if (this.selection && this._groupSelector) { + this._drawSelection(ctx); + } + this.fire("after:render"); + return this; + }, + _resetCurrentTransform: function() { + var t = this._currentTransform; + t.target.set({ + scaleX: t.original.scaleX, + scaleY: t.original.scaleY, + skewX: t.original.skewX, + skewY: t.original.skewY, + left: t.original.left, + top: t.original.top + }); + if (this._shouldCenterTransform(t.target)) { + if (t.action === "rotate") { + this._setOriginToCenter(t.target); + } else { + if (t.originX !== "center") { + if (t.originX === "right") { + t.mouseXSign = -1; + } else { + t.mouseXSign = 1; + } + } + if (t.originY !== "center") { + if (t.originY === "bottom") { + t.mouseYSign = -1; + } else { + t.mouseYSign = 1; + } + } + t.originX = "center"; + t.originY = "center"; + } + } else { + t.originX = t.original.originX; + t.originY = t.original.originY; + } + }, + containsPoint: function(e, target, point) { + var ignoreZoom = true, pointer = point || this.getPointer(e, ignoreZoom), xy; + if (target.group && target.group === this.getActiveGroup()) { + xy = this._normalizePointer(target.group, pointer); + } else { + xy = { + x: pointer.x, + y: pointer.y + }; + } + return target.containsPoint(xy) || target._findTargetCorner(pointer); + }, + _normalizePointer: function(object, pointer) { + var m = object.calcTransformMatrix(), invertedM = fabric.util.invertTransform(m), vpt = this.viewportTransform, vptPointer = this.restorePointerVpt(pointer), p = fabric.util.transformPoint(vptPointer, invertedM); + return fabric.util.transformPoint(p, vpt); + }, + isTargetTransparent: function(target, x, y) { + var hasBorders = target.hasBorders, transparentCorners = target.transparentCorners, ctx = this.contextCache, originalColor = target.selectionBackgroundColor; + target.hasBorders = target.transparentCorners = false; + target.selectionBackgroundColor = ""; + ctx.save(); + ctx.transform.apply(ctx, this.viewportTransform); + target.render(ctx); + ctx.restore(); + target.active && target._renderControls(ctx); + target.hasBorders = hasBorders; + target.transparentCorners = transparentCorners; + target.selectionBackgroundColor = originalColor; + var isTransparent = fabric.util.isTransparent(ctx, x, y, this.targetFindTolerance); + this.clearContext(ctx); + return isTransparent; + }, + _shouldClearSelection: function(e, target) { + var activeGroup = this.getActiveGroup(), activeObject = this.getActiveObject(); + return !target || target && activeGroup && !activeGroup.contains(target) && activeGroup !== target && !e[this.selectionKey] || target && !target.evented || target && !target.selectable && activeObject && activeObject !== target; + }, + _shouldCenterTransform: function(target) { + if (!target) { + return; + } + var t = this._currentTransform, centerTransform; + if (t.action === "scale" || t.action === "scaleX" || t.action === "scaleY") { + centerTransform = this.centeredScaling || target.centeredScaling; + } else if (t.action === "rotate") { + centerTransform = this.centeredRotation || target.centeredRotation; + } + return centerTransform ? !t.altKey : t.altKey; + }, + _getOriginFromCorner: function(target, corner) { + var origin = { + x: target.originX, + y: target.originY + }; + if (corner === "ml" || corner === "tl" || corner === "bl") { + origin.x = "right"; + } else if (corner === "mr" || corner === "tr" || corner === "br") { + origin.x = "left"; + } + if (corner === "tl" || corner === "mt" || corner === "tr") { + origin.y = "bottom"; + } else if (corner === "bl" || corner === "mb" || corner === "br") { + origin.y = "top"; + } + return origin; + }, + _getActionFromCorner: function(target, corner, e) { + if (!corner) { + return "drag"; + } + switch (corner) { + case "mtr": + return "rotate"; + + case "ml": + case "mr": + return e[this.altActionKey] ? "skewY" : "scaleX"; + + case "mt": + case "mb": + return e[this.altActionKey] ? "skewX" : "scaleY"; + + default: + return "scale"; + } + }, + _setupCurrentTransform: function(e, target) { + if (!target) { + return; + } + var pointer = this.getPointer(e), corner = target._findTargetCorner(this.getPointer(e, true)), action = this._getActionFromCorner(target, corner, e), origin = this._getOriginFromCorner(target, corner); + this._currentTransform = { + target: target, + action: action, + corner: corner, + scaleX: target.scaleX, + scaleY: target.scaleY, + skewX: target.skewX, + skewY: target.skewY, + offsetX: pointer.x - target.left, + offsetY: pointer.y - target.top, + originX: origin.x, + originY: origin.y, + ex: pointer.x, + ey: pointer.y, + lastX: pointer.x, + lastY: pointer.y, + left: target.left, + top: target.top, + theta: degreesToRadians(target.angle), + width: target.width * target.scaleX, + mouseXSign: 1, + mouseYSign: 1, + shiftKey: e.shiftKey, + altKey: e[this.centeredKey] + }; + this._currentTransform.original = { + left: target.left, + top: target.top, + scaleX: target.scaleX, + scaleY: target.scaleY, + skewX: target.skewX, + skewY: target.skewY, + originX: origin.x, + originY: origin.y + }; + this._resetCurrentTransform(); + }, + _translateObject: function(x, y) { + var transform = this._currentTransform, target = transform.target, newLeft = x - transform.offsetX, newTop = y - transform.offsetY, moveX = !target.get("lockMovementX") && target.left !== newLeft, moveY = !target.get("lockMovementY") && target.top !== newTop; + moveX && target.set("left", newLeft); + moveY && target.set("top", newTop); + return moveX || moveY; + }, + _changeSkewTransformOrigin: function(mouseMove, t, by) { + var property = "originX", origins = { + 0: "center" + }, skew = t.target.skewX, originA = "left", originB = "right", corner = t.corner === "mt" || t.corner === "ml" ? 1 : -1, flipSign = 1; + mouseMove = mouseMove > 0 ? 1 : -1; + if (by === "y") { + skew = t.target.skewY; + originA = "top"; + originB = "bottom"; + property = "originY"; + } + origins[-1] = originA; + origins[1] = originB; + t.target.flipX && (flipSign *= -1); + t.target.flipY && (flipSign *= -1); + if (skew === 0) { + t.skewSign = -corner * mouseMove * flipSign; + t[property] = origins[-mouseMove]; + } else { + skew = skew > 0 ? 1 : -1; + t.skewSign = skew; + t[property] = origins[skew * corner * flipSign]; + } + }, + _skewObject: function(x, y, by) { + var t = this._currentTransform, target = t.target, skewed = false, lockSkewingX = target.get("lockSkewingX"), lockSkewingY = target.get("lockSkewingY"); + if (lockSkewingX && by === "x" || lockSkewingY && by === "y") { + return false; + } + var center = target.getCenterPoint(), actualMouseByCenter = target.toLocalPoint(new fabric.Point(x, y), "center", "center")[by], lastMouseByCenter = target.toLocalPoint(new fabric.Point(t.lastX, t.lastY), "center", "center")[by], actualMouseByOrigin, constraintPosition, dim = target._getTransformedDimensions(); + this._changeSkewTransformOrigin(actualMouseByCenter - lastMouseByCenter, t, by); + actualMouseByOrigin = target.toLocalPoint(new fabric.Point(x, y), t.originX, t.originY)[by]; + constraintPosition = target.translateToOriginPoint(center, t.originX, t.originY); + skewed = this._setObjectSkew(actualMouseByOrigin, t, by, dim); + t.lastX = x; + t.lastY = y; + target.setPositionByOrigin(constraintPosition, t.originX, t.originY); + return skewed; + }, + _setObjectSkew: function(localMouse, transform, by, _dim) { + var target = transform.target, newValue, skewed = false, skewSign = transform.skewSign, newDim, dimNoSkew, otherBy, _otherBy, _by, newDimMouse, skewX, skewY; + if (by === "x") { + otherBy = "y"; + _otherBy = "Y"; + _by = "X"; + skewX = 0; + skewY = target.skewY; + } else { + otherBy = "x"; + _otherBy = "X"; + _by = "Y"; + skewX = target.skewX; + skewY = 0; + } + dimNoSkew = target._getTransformedDimensions(skewX, skewY); + newDimMouse = 2 * Math.abs(localMouse) - dimNoSkew[by]; + if (newDimMouse <= 2) { + newValue = 0; + } else { + newValue = skewSign * Math.atan(newDimMouse / target["scale" + _by] / (dimNoSkew[otherBy] / target["scale" + _otherBy])); + newValue = fabric.util.radiansToDegrees(newValue); + } + skewed = target["skew" + _by] !== newValue; + target.set("skew" + _by, newValue); + if (target["skew" + _otherBy] !== 0) { + newDim = target._getTransformedDimensions(); + newValue = _dim[otherBy] / newDim[otherBy] * target["scale" + _otherBy]; + target.set("scale" + _otherBy, newValue); + } + return skewed; + }, + _scaleObject: function(x, y, by) { + var t = this._currentTransform, target = t.target, lockScalingX = target.get("lockScalingX"), lockScalingY = target.get("lockScalingY"), lockScalingFlip = target.get("lockScalingFlip"); + if (lockScalingX && lockScalingY) { + return false; + } + var constraintPosition = target.translateToOriginPoint(target.getCenterPoint(), t.originX, t.originY), localMouse = target.toLocalPoint(new fabric.Point(x, y), t.originX, t.originY), dim = target._getTransformedDimensions(), scaled = false; + this._setLocalMouse(localMouse, t); + scaled = this._setObjectScale(localMouse, t, lockScalingX, lockScalingY, by, lockScalingFlip, dim); + target.setPositionByOrigin(constraintPosition, t.originX, t.originY); + return scaled; + }, + _setObjectScale: function(localMouse, transform, lockScalingX, lockScalingY, by, lockScalingFlip, _dim) { + var target = transform.target, forbidScalingX = false, forbidScalingY = false, scaled = false, changeX, changeY, scaleX, scaleY; + scaleX = localMouse.x * target.scaleX / _dim.x; + scaleY = localMouse.y * target.scaleY / _dim.y; + changeX = target.scaleX !== scaleX; + changeY = target.scaleY !== scaleY; + if (lockScalingFlip && scaleX <= 0 && scaleX < target.scaleX) { + forbidScalingX = true; + } + if (lockScalingFlip && scaleY <= 0 && scaleY < target.scaleY) { + forbidScalingY = true; + } + if (by === "equally" && !lockScalingX && !lockScalingY) { + forbidScalingX || forbidScalingY || (scaled = this._scaleObjectEqually(localMouse, target, transform, _dim)); + } else if (!by) { + forbidScalingX || lockScalingX || target.set("scaleX", scaleX) && (scaled = scaled || changeX); + forbidScalingY || lockScalingY || target.set("scaleY", scaleY) && (scaled = scaled || changeY); + } else if (by === "x" && !target.get("lockUniScaling")) { + forbidScalingX || lockScalingX || target.set("scaleX", scaleX) && (scaled = scaled || changeX); + } else if (by === "y" && !target.get("lockUniScaling")) { + forbidScalingY || lockScalingY || target.set("scaleY", scaleY) && (scaled = scaled || changeY); + } + transform.newScaleX = scaleX; + transform.newScaleY = scaleY; + forbidScalingX || forbidScalingY || this._flipObject(transform, by); + return scaled; + }, + _scaleObjectEqually: function(localMouse, target, transform, _dim) { + var dist = localMouse.y + localMouse.x, lastDist = _dim.y * transform.original.scaleY / target.scaleY + _dim.x * transform.original.scaleX / target.scaleX, scaled; + transform.newScaleX = transform.original.scaleX * dist / lastDist; + transform.newScaleY = transform.original.scaleY * dist / lastDist; + scaled = transform.newScaleX !== target.scaleX || transform.newScaleY !== target.scaleY; + target.set("scaleX", transform.newScaleX); + target.set("scaleY", transform.newScaleY); + return scaled; + }, + _flipObject: function(transform, by) { + if (transform.newScaleX < 0 && by !== "y") { + if (transform.originX === "left") { + transform.originX = "right"; + } else if (transform.originX === "right") { + transform.originX = "left"; + } + } + if (transform.newScaleY < 0 && by !== "x") { + if (transform.originY === "top") { + transform.originY = "bottom"; + } else if (transform.originY === "bottom") { + transform.originY = "top"; + } + } + }, + _setLocalMouse: function(localMouse, t) { + var target = t.target; + if (t.originX === "right") { + localMouse.x *= -1; + } else if (t.originX === "center") { + localMouse.x *= t.mouseXSign * 2; + if (localMouse.x < 0) { + t.mouseXSign = -t.mouseXSign; + } + } + if (t.originY === "bottom") { + localMouse.y *= -1; + } else if (t.originY === "center") { + localMouse.y *= t.mouseYSign * 2; + if (localMouse.y < 0) { + t.mouseYSign = -t.mouseYSign; + } + } + if (abs(localMouse.x) > target.padding) { + if (localMouse.x < 0) { + localMouse.x += target.padding; + } else { + localMouse.x -= target.padding; + } + } else { + localMouse.x = 0; + } + if (abs(localMouse.y) > target.padding) { + if (localMouse.y < 0) { + localMouse.y += target.padding; + } else { + localMouse.y -= target.padding; + } + } else { + localMouse.y = 0; + } + }, + _rotateObject: function(x, y) { + var t = this._currentTransform; + if (t.target.get("lockRotation")) { + return false; + } + var lastAngle = atan2(t.ey - t.top, t.ex - t.left), curAngle = atan2(y - t.top, x - t.left), angle = radiansToDegrees(curAngle - lastAngle + t.theta); + if (angle < 0) { + angle = 360 + angle; + } + t.target.angle = angle % 360; + return true; + }, + setCursor: function(value) { + this.upperCanvasEl.style.cursor = value; + }, + _resetObjectTransform: function(target) { + target.scaleX = 1; + target.scaleY = 1; + target.skewX = 0; + target.skewY = 0; + target.setAngle(0); + }, + _drawSelection: function(ctx) { + var groupSelector = this._groupSelector, left = groupSelector.left, top = groupSelector.top, aleft = abs(left), atop = abs(top); + if (this.selectionColor) { + ctx.fillStyle = this.selectionColor; + ctx.fillRect(groupSelector.ex - (left > 0 ? 0 : -left), groupSelector.ey - (top > 0 ? 0 : -top), aleft, atop); + } + if (!this.selectionLineWidth || !this.selectionBorderColor) { + return; + } + ctx.lineWidth = this.selectionLineWidth; + ctx.strokeStyle = this.selectionBorderColor; + if (this.selectionDashArray.length > 1 && !supportLineDash) { + var px = groupSelector.ex + STROKE_OFFSET - (left > 0 ? 0 : aleft), py = groupSelector.ey + STROKE_OFFSET - (top > 0 ? 0 : atop); + ctx.beginPath(); + fabric.util.drawDashedLine(ctx, px, py, px + aleft, py, this.selectionDashArray); + fabric.util.drawDashedLine(ctx, px, py + atop - 1, px + aleft, py + atop - 1, this.selectionDashArray); + fabric.util.drawDashedLine(ctx, px, py, px, py + atop, this.selectionDashArray); + fabric.util.drawDashedLine(ctx, px + aleft - 1, py, px + aleft - 1, py + atop, this.selectionDashArray); + ctx.closePath(); + ctx.stroke(); + } else { + fabric.Object.prototype._setLineDash.call(this, ctx, this.selectionDashArray); + ctx.strokeRect(groupSelector.ex + STROKE_OFFSET - (left > 0 ? 0 : aleft), groupSelector.ey + STROKE_OFFSET - (top > 0 ? 0 : atop), aleft, atop); + } + }, + findTarget: function(e, skipGroup) { + if (this.skipTargetFind) { + return; + } + var ignoreZoom = true, pointer = this.getPointer(e, ignoreZoom), activeGroup = this.getActiveGroup(), activeObject = this.getActiveObject(), activeTarget; + if (activeGroup && !skipGroup && this._checkTarget(pointer, activeGroup)) { + this._fireOverOutEvents(activeGroup, e); + return activeGroup; + } + if (activeObject && activeObject._findTargetCorner(pointer)) { + this._fireOverOutEvents(activeObject, e); + return activeObject; + } + if (activeObject && this._checkTarget(pointer, activeObject)) { + if (!this.preserveObjectStacking) { + this._fireOverOutEvents(activeObject, e); + return activeObject; + } else { + activeTarget = activeObject; + } + } + this.targets = []; + var target = this._searchPossibleTargets(this._objects, pointer); + if (e[this.altSelectionKey] && target && activeTarget && target !== activeTarget) { + target = activeTarget; + } + this._fireOverOutEvents(target, e); + return target; + }, + _fireOverOutEvents: function(target, e) { + if (target) { + if (this._hoveredTarget !== target) { + if (this._hoveredTarget) { + this.fire("mouse:out", { + target: this._hoveredTarget, + e: e + }); + this._hoveredTarget.fire("mouseout"); + } + this.fire("mouse:over", { + target: target, + e: e + }); + target.fire("mouseover"); + this._hoveredTarget = target; + } + } else if (this._hoveredTarget) { + this.fire("mouse:out", { + target: this._hoveredTarget, + e: e + }); + this._hoveredTarget.fire("mouseout"); + this._hoveredTarget = null; + } + }, + _checkTarget: function(pointer, obj) { + if (obj && obj.visible && obj.evented && this.containsPoint(null, obj, pointer)) { + if ((this.perPixelTargetFind || obj.perPixelTargetFind) && !obj.isEditing) { + var isTransparent = this.isTargetTransparent(obj, pointer.x, pointer.y); + if (!isTransparent) { + return true; + } + } else { + return true; + } + } + }, + _searchPossibleTargets: function(objects, pointer) { + var target, i = objects.length, normalizedPointer, subTarget; + while (i--) { + if (this._checkTarget(pointer, objects[i])) { + target = objects[i]; + if (target.type === "group" && target.subTargetCheck) { + normalizedPointer = this._normalizePointer(target, pointer); + subTarget = this._searchPossibleTargets(target._objects, normalizedPointer); + subTarget && this.targets.push(subTarget); + } + break; + } + } + return target; + }, + restorePointerVpt: function(pointer) { + return fabric.util.transformPoint(pointer, fabric.util.invertTransform(this.viewportTransform)); + }, + getPointer: function(e, ignoreZoom, upperCanvasEl) { + if (!upperCanvasEl) { + upperCanvasEl = this.upperCanvasEl; + } + var pointer = getPointer(e), bounds = upperCanvasEl.getBoundingClientRect(), boundsWidth = bounds.width || 0, boundsHeight = bounds.height || 0, cssScale; + if (!boundsWidth || !boundsHeight) { + if ("top" in bounds && "bottom" in bounds) { + boundsHeight = Math.abs(bounds.top - bounds.bottom); + } + if ("right" in bounds && "left" in bounds) { + boundsWidth = Math.abs(bounds.right - bounds.left); + } + } + this.calcOffset(); + pointer.x = pointer.x - this._offset.left; + pointer.y = pointer.y - this._offset.top; + if (!ignoreZoom) { + pointer = this.restorePointerVpt(pointer); + } + if (boundsWidth === 0 || boundsHeight === 0) { + cssScale = { + width: 1, + height: 1 + }; + } else { + cssScale = { + width: upperCanvasEl.width / boundsWidth, + height: upperCanvasEl.height / boundsHeight + }; + } + return { + x: pointer.x * cssScale.width, + y: pointer.y * cssScale.height + }; + }, + _createUpperCanvas: function() { + var lowerCanvasClass = this.lowerCanvasEl.className.replace(/\s*lower-canvas\s*/, ""); + this.upperCanvasEl = this._createCanvasElement(); + fabric.util.addClass(this.upperCanvasEl, "upper-canvas " + lowerCanvasClass); + this.wrapperEl.appendChild(this.upperCanvasEl); + this._copyCanvasStyle(this.lowerCanvasEl, this.upperCanvasEl); + this._applyCanvasStyle(this.upperCanvasEl); + this.contextTop = this.upperCanvasEl.getContext("2d"); + }, + _createCacheCanvas: function() { + this.cacheCanvasEl = this._createCanvasElement(); + this.cacheCanvasEl.setAttribute("width", this.width); + this.cacheCanvasEl.setAttribute("height", this.height); + this.contextCache = this.cacheCanvasEl.getContext("2d"); + }, + _initWrapperElement: function() { + this.wrapperEl = fabric.util.wrapElement(this.lowerCanvasEl, "div", { + class: this.containerClass + }); + fabric.util.setStyle(this.wrapperEl, { + width: this.getWidth() + "px", + height: this.getHeight() + "px", + position: "relative" + }); + fabric.util.makeElementUnselectable(this.wrapperEl); + }, + _applyCanvasStyle: function(element) { + var width = this.getWidth() || element.width, height = this.getHeight() || element.height; + fabric.util.setStyle(element, { + position: "absolute", + width: width + "px", + height: height + "px", + left: 0, + top: 0 + }); + element.width = width; + element.height = height; + fabric.util.makeElementUnselectable(element); + }, + _copyCanvasStyle: function(fromEl, toEl) { + toEl.style.cssText = fromEl.style.cssText; + }, + getSelectionContext: function() { + return this.contextTop; + }, + getSelectionElement: function() { + return this.upperCanvasEl; + }, + _setActiveObject: function(object) { + if (this._activeObject) { + this._activeObject.set("active", false); + } + this._activeObject = object; + object.set("active", true); + }, + setActiveObject: function(object, e) { + this._setActiveObject(object); + this.renderAll(); + this.fire("object:selected", { + target: object, + e: e + }); + object.fire("selected", { + e: e + }); + return this; + }, + getActiveObject: function() { + return this._activeObject; + }, + _onObjectRemoved: function(obj) { + if (this.getActiveObject() === obj) { + this.fire("before:selection:cleared", { + target: obj + }); + this._discardActiveObject(); + this.fire("selection:cleared", { + target: obj + }); + obj.fire("deselected"); + } + this.callSuper("_onObjectRemoved", obj); + }, + _discardActiveObject: function() { + if (this._activeObject) { + this._activeObject.set("active", false); + } + this._activeObject = null; + }, + discardActiveObject: function(e) { + var activeObject = this._activeObject; + this.fire("before:selection:cleared", { + target: activeObject, + e: e + }); + this._discardActiveObject(); + this.fire("selection:cleared", { + e: e + }); + activeObject && activeObject.fire("deselected", { + e: e + }); + return this; + }, + _setActiveGroup: function(group) { + this._activeGroup = group; + if (group) { + group.set("active", true); + } + }, + setActiveGroup: function(group, e) { + this._setActiveGroup(group); + if (group) { + this.fire("object:selected", { + target: group, + e: e + }); + group.fire("selected", { + e: e + }); + } + return this; + }, + getActiveGroup: function() { + return this._activeGroup; + }, + _discardActiveGroup: function() { + var g = this.getActiveGroup(); + if (g) { + g.destroy(); + } + this.setActiveGroup(null); + }, + discardActiveGroup: function(e) { + var g = this.getActiveGroup(); + this.fire("before:selection:cleared", { + e: e, + target: g + }); + this._discardActiveGroup(); + this.fire("selection:cleared", { + e: e + }); + return this; + }, + deactivateAll: function() { + var allObjects = this.getObjects(), i = 0, len = allObjects.length; + for (;i < len; i++) { + allObjects[i].set("active", false); + } + this._discardActiveGroup(); + this._discardActiveObject(); + return this; + }, + deactivateAllWithDispatch: function(e) { + var activeGroup = this.getActiveGroup(), activeObject = this.getActiveObject(); + if (activeObject || activeGroup) { + this.fire("before:selection:cleared", { + target: activeObject || activeGroup, + e: e + }); + } + this.deactivateAll(); + if (activeObject || activeGroup) { + this.fire("selection:cleared", { + e: e, + target: activeObject + }); + activeObject && activeObject.fire("deselected"); + } + return this; + }, + dispose: function() { + this.callSuper("dispose"); + var wrapper = this.wrapperEl; + this.removeListeners(); + wrapper.removeChild(this.upperCanvasEl); + wrapper.removeChild(this.lowerCanvasEl); + delete this.upperCanvasEl; + if (wrapper.parentNode) { + wrapper.parentNode.replaceChild(this.lowerCanvasEl, this.wrapperEl); + } + delete this.wrapperEl; + return this; + }, + clear: function() { + this.discardActiveGroup(); + this.discardActiveObject(); + this.clearContext(this.contextTop); + return this.callSuper("clear"); + }, + drawControls: function(ctx) { + var activeGroup = this.getActiveGroup(); + if (activeGroup) { + activeGroup._renderControls(ctx); + } else { + this._drawObjectsControls(ctx); + } + }, + _drawObjectsControls: function(ctx) { + for (var i = 0, len = this._objects.length; i < len; ++i) { + if (!this._objects[i] || !this._objects[i].active) { + continue; + } + this._objects[i]._renderControls(ctx); + } + }, + _toObject: function(instance, methodName, propertiesToInclude) { + var originalProperties = this._realizeGroupTransformOnObject(instance), object = this.callSuper("_toObject", instance, methodName, propertiesToInclude); + this._unwindGroupTransformOnObject(instance, originalProperties); + return object; + }, + _realizeGroupTransformOnObject: function(instance) { + var layoutProps = [ "angle", "flipX", "flipY", "height", "left", "scaleX", "scaleY", "top", "width" ]; + if (instance.group && instance.group === this.getActiveGroup()) { + var originalValues = {}; + layoutProps.forEach(function(prop) { + originalValues[prop] = instance[prop]; + }); + this.getActiveGroup().realizeTransform(instance); + return originalValues; + } else { + return null; + } + }, + _unwindGroupTransformOnObject: function(instance, originalValues) { + if (originalValues) { + instance.set(originalValues); + } + }, + _setSVGObject: function(markup, instance, reviver) { + var originalProperties; + originalProperties = this._realizeGroupTransformOnObject(instance); + this.callSuper("_setSVGObject", markup, instance, reviver); + this._unwindGroupTransformOnObject(instance, originalProperties); + } + }); + for (var prop in fabric.StaticCanvas) { + if (prop !== "prototype") { + fabric.Canvas[prop] = fabric.StaticCanvas[prop]; + } + } + if (fabric.isTouchSupported) { + fabric.Canvas.prototype._setCursorFromEvent = function() {}; + } + fabric.Element = fabric.Canvas; +})(); + +(function() { + var cursorOffset = { + mt: 0, + tr: 1, + mr: 2, + br: 3, + mb: 4, + bl: 5, + ml: 6, + tl: 7 + }, addListener = fabric.util.addListener, removeListener = fabric.util.removeListener; + fabric.util.object.extend(fabric.Canvas.prototype, { + cursorMap: [ "n-resize", "ne-resize", "e-resize", "se-resize", "s-resize", "sw-resize", "w-resize", "nw-resize" ], + _initEventListeners: function() { + this._bindEvents(); + addListener(fabric.window, "resize", this._onResize); + addListener(this.upperCanvasEl, "mousedown", this._onMouseDown); + addListener(this.upperCanvasEl, "mousemove", this._onMouseMove); + addListener(this.upperCanvasEl, "mouseout", this._onMouseOut); + addListener(this.upperCanvasEl, "wheel", this._onMouseWheel); + addListener(this.upperCanvasEl, "contextmenu", this._onContextMenu); + addListener(this.upperCanvasEl, "touchstart", this._onMouseDown); + addListener(this.upperCanvasEl, "touchmove", this._onMouseMove); + if (typeof eventjs !== "undefined" && "add" in eventjs) { + eventjs.add(this.upperCanvasEl, "gesture", this._onGesture); + eventjs.add(this.upperCanvasEl, "drag", this._onDrag); + eventjs.add(this.upperCanvasEl, "orientation", this._onOrientationChange); + eventjs.add(this.upperCanvasEl, "shake", this._onShake); + eventjs.add(this.upperCanvasEl, "longpress", this._onLongPress); + } + }, + _bindEvents: function() { + this._onMouseDown = this._onMouseDown.bind(this); + this._onMouseMove = this._onMouseMove.bind(this); + this._onMouseUp = this._onMouseUp.bind(this); + this._onResize = this._onResize.bind(this); + this._onGesture = this._onGesture.bind(this); + this._onDrag = this._onDrag.bind(this); + this._onShake = this._onShake.bind(this); + this._onLongPress = this._onLongPress.bind(this); + this._onOrientationChange = this._onOrientationChange.bind(this); + this._onMouseWheel = this._onMouseWheel.bind(this); + this._onMouseOut = this._onMouseOut.bind(this); + this._onContextMenu = this._onContextMenu.bind(this); + }, + removeListeners: function() { + removeListener(fabric.window, "resize", this._onResize); + removeListener(this.upperCanvasEl, "mousedown", this._onMouseDown); + removeListener(this.upperCanvasEl, "mousemove", this._onMouseMove); + removeListener(this.upperCanvasEl, "mouseout", this._onMouseOut); + removeListener(this.upperCanvasEl, "wheel", this._onMouseWheel); + removeListener(this.upperCanvasEl, "contextmenu", this._onContextMenu); + removeListener(this.upperCanvasEl, "touchstart", this._onMouseDown); + removeListener(this.upperCanvasEl, "touchmove", this._onMouseMove); + if (typeof eventjs !== "undefined" && "remove" in eventjs) { + eventjs.remove(this.upperCanvasEl, "gesture", this._onGesture); + eventjs.remove(this.upperCanvasEl, "drag", this._onDrag); + eventjs.remove(this.upperCanvasEl, "orientation", this._onOrientationChange); + eventjs.remove(this.upperCanvasEl, "shake", this._onShake); + eventjs.remove(this.upperCanvasEl, "longpress", this._onLongPress); + } + }, + _onGesture: function(e, self) { + this.__onTransformGesture && this.__onTransformGesture(e, self); + }, + _onDrag: function(e, self) { + this.__onDrag && this.__onDrag(e, self); + }, + _onMouseWheel: function(e) { + this.__onMouseWheel(e); + }, + _onMouseOut: function(e) { + var target = this._hoveredTarget; + this.fire("mouse:out", { + target: target, + e: e + }); + this._hoveredTarget = null; + target && target.fire("mouseout", { + e: e + }); + }, + _onOrientationChange: function(e, self) { + this.__onOrientationChange && this.__onOrientationChange(e, self); + }, + _onShake: function(e, self) { + this.__onShake && this.__onShake(e, self); + }, + _onLongPress: function(e, self) { + this.__onLongPress && this.__onLongPress(e, self); + }, + _onContextMenu: function(e) { + if (this.stopContextMenu) { + e.stopPropagation(); + e.preventDefault(); + } + return false; + }, + _onMouseDown: function(e) { + this.__onMouseDown(e); + addListener(fabric.document, "touchend", this._onMouseUp); + addListener(fabric.document, "touchmove", this._onMouseMove); + removeListener(this.upperCanvasEl, "mousemove", this._onMouseMove); + removeListener(this.upperCanvasEl, "touchmove", this._onMouseMove); + if (e.type === "touchstart") { + removeListener(this.upperCanvasEl, "mousedown", this._onMouseDown); + } else { + addListener(fabric.document, "mouseup", this._onMouseUp); + addListener(fabric.document, "mousemove", this._onMouseMove); + } + }, + _onMouseUp: function(e) { + this.__onMouseUp(e); + removeListener(fabric.document, "mouseup", this._onMouseUp); + removeListener(fabric.document, "touchend", this._onMouseUp); + removeListener(fabric.document, "mousemove", this._onMouseMove); + removeListener(fabric.document, "touchmove", this._onMouseMove); + addListener(this.upperCanvasEl, "mousemove", this._onMouseMove); + addListener(this.upperCanvasEl, "touchmove", this._onMouseMove); + if (e.type === "touchend") { + var _this = this; + setTimeout(function() { + addListener(_this.upperCanvasEl, "mousedown", _this._onMouseDown); + }, 400); + } + }, + _onMouseMove: function(e) { + !this.allowTouchScrolling && e.preventDefault && e.preventDefault(); + this.__onMouseMove(e); + }, + _onResize: function() { + this.calcOffset(); + }, + _shouldRender: function(target, pointer) { + var activeObject = this.getActiveGroup() || this.getActiveObject(); + return !!(target && (target.isMoving || target !== activeObject) || !target && !!activeObject || !target && !activeObject && !this._groupSelector || pointer && this._previousPointer && this.selection && (pointer.x !== this._previousPointer.x || pointer.y !== this._previousPointer.y)); + }, + __onMouseUp: function(e) { + var target, searchTarget = true, transform = this._currentTransform, groupSelector = this._groupSelector, isClick = !groupSelector || groupSelector.left === 0 && groupSelector.top === 0; + if (this.isDrawingMode && this._isCurrentlyDrawing) { + this._onMouseUpInDrawingMode(e); + return; + } + if (transform) { + this._finalizeCurrentTransform(); + searchTarget = !transform.actionPerformed; + } + target = searchTarget ? this.findTarget(e, true) : transform.target; + var shouldRender = this._shouldRender(target, this.getPointer(e)); + if (target || !isClick) { + this._maybeGroupObjects(e); + } else { + this._groupSelector = null; + this._currentTransform = null; + } + if (target) { + target.isMoving = false; + } + this._handleCursorAndEvent(e, target, "up"); + target && (target.__corner = 0); + shouldRender && this.renderAll(); + }, + _handleCursorAndEvent: function(e, target, eventType) { + this._setCursorFromEvent(e, target); + this._handleEvent(e, eventType, target ? target : null); + }, + _handleEvent: function(e, eventType, targetObj) { + var target = typeof targetObj === undefined ? this.findTarget(e) : targetObj, targets = this.targets || [], options = { + e: e, + target: target, + subTargets: targets + }; + this.fire("mouse:" + eventType, options); + target && target.fire("mouse" + eventType, options); + for (var i = 0; i < targets.length; i++) { + targets[i].fire("mouse" + eventType, options); + } + }, + _finalizeCurrentTransform: function() { + var transform = this._currentTransform, target = transform.target; + if (target._scaling) { + target._scaling = false; + } + target.setCoords(); + this._restoreOriginXY(target); + if (transform.actionPerformed || this.stateful && target.hasStateChanged()) { + this.fire("object:modified", { + target: target + }); + target.fire("modified"); + } + }, + _restoreOriginXY: function(target) { + if (this._previousOriginX && this._previousOriginY) { + var originPoint = target.translateToOriginPoint(target.getCenterPoint(), this._previousOriginX, this._previousOriginY); + target.originX = this._previousOriginX; + target.originY = this._previousOriginY; + target.left = originPoint.x; + target.top = originPoint.y; + this._previousOriginX = null; + this._previousOriginY = null; + } + }, + _onMouseDownInDrawingMode: function(e) { + this._isCurrentlyDrawing = true; + this.discardActiveObject(e).renderAll(); + if (this.clipTo) { + fabric.util.clipContext(this, this.contextTop); + } + var pointer = this.getPointer(e); + this.freeDrawingBrush.onMouseDown(pointer); + this._handleEvent(e, "down"); + }, + _onMouseMoveInDrawingMode: function(e) { + if (this._isCurrentlyDrawing) { + var pointer = this.getPointer(e); + this.freeDrawingBrush.onMouseMove(pointer); + } + this.setCursor(this.freeDrawingCursor); + this._handleEvent(e, "move"); + }, + _onMouseUpInDrawingMode: function(e) { + this._isCurrentlyDrawing = false; + if (this.clipTo) { + this.contextTop.restore(); + } + this.freeDrawingBrush.onMouseUp(); + this._handleEvent(e, "up"); + }, + __onMouseDown: function(e) { + var isRightClick = "which" in e ? e.which === 3 : e.button === 2; + if (isRightClick) { + if (this.fireRightClick) { + this._handleEvent(e, "down", target ? target : null); + } + return; + } + if (this.isDrawingMode) { + this._onMouseDownInDrawingMode(e); + return; + } + if (this._currentTransform) { + return; + } + var target = this.findTarget(e), pointer = this.getPointer(e, true); + this._previousPointer = pointer; + var shouldRender = this._shouldRender(target, pointer), shouldGroup = this._shouldGroup(e, target); + if (this._shouldClearSelection(e, target)) { + this._clearSelection(e, target, pointer); + } else if (shouldGroup) { + this._handleGrouping(e, target); + target = this.getActiveGroup(); + } + if (target) { + if (target.selectable && (target.__corner || !shouldGroup)) { + this._beforeTransform(e, target); + this._setupCurrentTransform(e, target); + } + if (target !== this.getActiveGroup() && target !== this.getActiveObject()) { + this.deactivateAll(); + target.selectable && this.setActiveObject(target, e); + } + } + this._handleEvent(e, "down", target ? target : null); + shouldRender && this.renderAll(); + }, + _beforeTransform: function(e, target) { + this.stateful && target.saveState(); + if (target._findTargetCorner(this.getPointer(e))) { + this.onBeforeScaleRotate(target); + } + }, + _clearSelection: function(e, target, pointer) { + this.deactivateAllWithDispatch(e); + if (target && target.selectable) { + this.setActiveObject(target, e); + } else if (this.selection) { + this._groupSelector = { + ex: pointer.x, + ey: pointer.y, + top: 0, + left: 0 + }; + } + }, + _setOriginToCenter: function(target) { + this._previousOriginX = this._currentTransform.target.originX; + this._previousOriginY = this._currentTransform.target.originY; + var center = target.getCenterPoint(); + target.originX = "center"; + target.originY = "center"; + target.left = center.x; + target.top = center.y; + this._currentTransform.left = target.left; + this._currentTransform.top = target.top; + }, + _setCenterToOrigin: function(target) { + var originPoint = target.translateToOriginPoint(target.getCenterPoint(), this._previousOriginX, this._previousOriginY); + target.originX = this._previousOriginX; + target.originY = this._previousOriginY; + target.left = originPoint.x; + target.top = originPoint.y; + this._previousOriginX = null; + this._previousOriginY = null; + }, + __onMouseMove: function(e) { + var target, pointer; + if (this.isDrawingMode) { + this._onMouseMoveInDrawingMode(e); + return; + } + if (typeof e.touches !== "undefined" && e.touches.length > 1) { + return; + } + var groupSelector = this._groupSelector; + if (groupSelector) { + pointer = this.getPointer(e, true); + groupSelector.left = pointer.x - groupSelector.ex; + groupSelector.top = pointer.y - groupSelector.ey; + this.renderTop(); + } else if (!this._currentTransform) { + target = this.findTarget(e); + this._setCursorFromEvent(e, target); + } else { + this._transformObject(e); + } + this._handleEvent(e, "move", target ? target : null); + }, + __onMouseWheel: function(e) { + this.fire("mouse:wheel", { + e: e + }); + }, + _transformObject: function(e) { + var pointer = this.getPointer(e), transform = this._currentTransform; + transform.reset = false; + transform.target.isMoving = true; + this._beforeScaleTransform(e, transform); + this._performTransformAction(e, transform, pointer); + transform.actionPerformed && this.renderAll(); + }, + _performTransformAction: function(e, transform, pointer) { + var x = pointer.x, y = pointer.y, target = transform.target, action = transform.action, actionPerformed = false; + if (action === "rotate") { + (actionPerformed = this._rotateObject(x, y)) && this._fire("rotating", target, e); + } else if (action === "scale") { + (actionPerformed = this._onScale(e, transform, x, y)) && this._fire("scaling", target, e); + } else if (action === "scaleX") { + (actionPerformed = this._scaleObject(x, y, "x")) && this._fire("scaling", target, e); + } else if (action === "scaleY") { + (actionPerformed = this._scaleObject(x, y, "y")) && this._fire("scaling", target, e); + } else if (action === "skewX") { + (actionPerformed = this._skewObject(x, y, "x")) && this._fire("skewing", target, e); + } else if (action === "skewY") { + (actionPerformed = this._skewObject(x, y, "y")) && this._fire("skewing", target, e); + } else { + actionPerformed = this._translateObject(x, y); + if (actionPerformed) { + this._fire("moving", target, e); + this.setCursor(target.moveCursor || this.moveCursor); + } + } + transform.actionPerformed = actionPerformed; + }, + _fire: function(eventName, target, e) { + this.fire("object:" + eventName, { + target: target, + e: e + }); + target.fire(eventName, { + e: e + }); + }, + _beforeScaleTransform: function(e, transform) { + if (transform.action === "scale" || transform.action === "scaleX" || transform.action === "scaleY") { + var centerTransform = this._shouldCenterTransform(transform.target); + if (centerTransform && (transform.originX !== "center" || transform.originY !== "center") || !centerTransform && transform.originX === "center" && transform.originY === "center") { + this._resetCurrentTransform(); + transform.reset = true; + } + } + }, + _onScale: function(e, transform, x, y) { + if ((e[this.uniScaleKey] || this.uniScaleTransform) && !transform.target.get("lockUniScaling")) { + transform.currentAction = "scale"; + return this._scaleObject(x, y); + } else { + if (!transform.reset && transform.currentAction === "scale") { + this._resetCurrentTransform(); + } + transform.currentAction = "scaleEqually"; + return this._scaleObject(x, y, "equally"); + } + }, + _setCursorFromEvent: function(e, target) { + if (!target) { + this.setCursor(this.defaultCursor); + return false; + } + var hoverCursor = target.hoverCursor || this.hoverCursor; + if (!target.selectable) { + this.setCursor(hoverCursor); + } else { + var activeGroup = this.getActiveGroup(), corner = target._findTargetCorner && (!activeGroup || !activeGroup.contains(target)) && target._findTargetCorner(this.getPointer(e, true)); + if (!corner) { + this.setCursor(hoverCursor); + } else { + this._setCornerCursor(corner, target, e); + } + } + return true; + }, + _setCornerCursor: function(corner, target, e) { + if (corner in cursorOffset) { + this.setCursor(this._getRotatedCornerCursor(corner, target, e)); + } else if (corner === "mtr" && target.hasRotatingPoint) { + this.setCursor(this.rotationCursor); + } else { + this.setCursor(this.defaultCursor); + return false; + } + }, + _getRotatedCornerCursor: function(corner, target, e) { + var n = Math.round(target.getAngle() % 360 / 45); + if (n < 0) { + n += 8; + } + n += cursorOffset[corner]; + if (e[this.altActionKey] && cursorOffset[corner] % 2 === 0) { + n += 2; + } + n %= 8; + return this.cursorMap[n]; + } + }); +})(); + +(function() { + var min = Math.min, max = Math.max; + fabric.util.object.extend(fabric.Canvas.prototype, { + _shouldGroup: function(e, target) { + var activeObject = this.getActiveObject(); + return e[this.selectionKey] && target && target.selectable && (this.getActiveGroup() || activeObject && activeObject !== target) && this.selection; + }, + _handleGrouping: function(e, target) { + var activeGroup = this.getActiveGroup(); + if (target === activeGroup) { + target = this.findTarget(e, true); + if (!target) { + return; + } + } + if (activeGroup) { + this._updateActiveGroup(target, e); + } else { + this._createActiveGroup(target, e); + } + if (this._activeGroup) { + this._activeGroup.saveCoords(); + } + }, + _updateActiveGroup: function(target, e) { + var activeGroup = this.getActiveGroup(); + if (activeGroup.contains(target)) { + activeGroup.removeWithUpdate(target); + target.set("active", false); + if (activeGroup.size() === 1) { + this.discardActiveGroup(e); + this.setActiveObject(activeGroup.item(0)); + return; + } + } else { + activeGroup.addWithUpdate(target); + } + this.fire("selection:created", { + target: activeGroup, + e: e + }); + activeGroup.set("active", true); + }, + _createActiveGroup: function(target, e) { + if (this._activeObject && target !== this._activeObject) { + var group = this._createGroup(target); + group.addWithUpdate(); + this.setActiveGroup(group); + this._activeObject = null; + this.fire("selection:created", { + target: group, + e: e + }); + } + target.set("active", true); + }, + _createGroup: function(target) { + var objects = this.getObjects(), isActiveLower = objects.indexOf(this._activeObject) < objects.indexOf(target), groupObjects = isActiveLower ? [ this._activeObject, target ] : [ target, this._activeObject ]; + this._activeObject.isEditing && this._activeObject.exitEditing(); + return new fabric.Group(groupObjects, { + canvas: this + }); + }, + _groupSelectedObjects: function(e) { + var group = this._collectObjects(); + if (group.length === 1) { + this.setActiveObject(group[0], e); + } else if (group.length > 1) { + group = new fabric.Group(group.reverse(), { + canvas: this + }); + group.addWithUpdate(); + this.setActiveGroup(group, e); + group.saveCoords(); + this.fire("selection:created", { + target: group + }); + this.renderAll(); + } + }, + _collectObjects: function() { + var group = [], currentObject, x1 = this._groupSelector.ex, y1 = this._groupSelector.ey, x2 = x1 + this._groupSelector.left, y2 = y1 + this._groupSelector.top, selectionX1Y1 = new fabric.Point(min(x1, x2), min(y1, y2)), selectionX2Y2 = new fabric.Point(max(x1, x2), max(y1, y2)), isClick = x1 === x2 && y1 === y2; + for (var i = this._objects.length; i--; ) { + currentObject = this._objects[i]; + if (!currentObject || !currentObject.selectable || !currentObject.visible) { + continue; + } + if (currentObject.intersectsWithRect(selectionX1Y1, selectionX2Y2) || currentObject.isContainedWithinRect(selectionX1Y1, selectionX2Y2) || currentObject.containsPoint(selectionX1Y1) || currentObject.containsPoint(selectionX2Y2)) { + currentObject.set("active", true); + group.push(currentObject); + if (isClick) { + break; + } + } + } + return group; + }, + _maybeGroupObjects: function(e) { + if (this.selection && this._groupSelector) { + this._groupSelectedObjects(e); + } + var activeGroup = this.getActiveGroup(); + if (activeGroup) { + activeGroup.setObjectsCoords().setCoords(); + activeGroup.isMoving = false; + this.setCursor(this.defaultCursor); + } + this._groupSelector = null; + this._currentTransform = null; + } + }); +})(); + +(function() { + var supportQuality = fabric.StaticCanvas.supports("toDataURLWithQuality"); + fabric.util.object.extend(fabric.StaticCanvas.prototype, { + toDataURL: function(options) { + options || (options = {}); + var format = options.format || "png", quality = options.quality || 1, multiplier = options.multiplier || 1, cropping = { + left: options.left || 0, + top: options.top || 0, + width: options.width || 0, + height: options.height || 0 + }; + return this.__toDataURLWithMultiplier(format, quality, cropping, multiplier); + }, + __toDataURLWithMultiplier: function(format, quality, cropping, multiplier) { + var origWidth = this.getWidth(), origHeight = this.getHeight(), scaledWidth = (cropping.width || this.getWidth()) * multiplier, scaledHeight = (cropping.height || this.getHeight()) * multiplier, zoom = this.getZoom(), newZoom = zoom * multiplier, vp = this.viewportTransform, translateX = (vp[4] - cropping.left) * multiplier, translateY = (vp[5] - cropping.top) * multiplier, newVp = [ newZoom, 0, 0, newZoom, translateX, translateY ], originalInteractive = this.interactive; + this.viewportTransform = newVp; + this.interactive && (this.interactive = false); + if (origWidth !== scaledWidth || origHeight !== scaledHeight) { + this.setDimensions({ + width: scaledWidth, + height: scaledHeight + }); + } else { + this.renderAll(); + } + var data = this.__toDataURL(format, quality, cropping); + originalInteractive && (this.interactive = originalInteractive); + this.viewportTransform = vp; + this.setDimensions({ + width: origWidth, + height: origHeight + }); + return data; + }, + __toDataURL: function(format, quality) { + var canvasEl = this.contextContainer.canvas; + if (format === "jpg") { + format = "jpeg"; + } + var data = supportQuality ? canvasEl.toDataURL("image/" + format, quality) : canvasEl.toDataURL("image/" + format); + return data; + }, + toDataURLWithMultiplier: function(format, multiplier, quality) { + return this.toDataURL({ + format: format, + multiplier: multiplier, + quality: quality + }); + } + }); +})(); + +fabric.util.object.extend(fabric.StaticCanvas.prototype, { + loadFromDatalessJSON: function(json, callback, reviver) { + return this.loadFromJSON(json, callback, reviver); + }, + loadFromJSON: function(json, callback, reviver) { + if (!json) { + return; + } + var serialized = typeof json === "string" ? JSON.parse(json) : fabric.util.object.clone(json); + this.clear(); + var _this = this; + this._enlivenObjects(serialized.objects, function() { + _this._setBgOverlay(serialized, function() { + delete serialized.objects; + delete serialized.backgroundImage; + delete serialized.overlayImage; + delete serialized.background; + delete serialized.overlay; + for (var prop in serialized) { + _this[prop] = serialized[prop]; + } + callback && callback(); + }); + }, reviver); + return this; + }, + _setBgOverlay: function(serialized, callback) { + var _this = this, loaded = { + backgroundColor: false, + overlayColor: false, + backgroundImage: false, + overlayImage: false + }; + if (!serialized.backgroundImage && !serialized.overlayImage && !serialized.background && !serialized.overlay) { + callback && callback(); + return; + } + var cbIfLoaded = function() { + if (loaded.backgroundImage && loaded.overlayImage && loaded.backgroundColor && loaded.overlayColor) { + _this.renderAll(); + callback && callback(); + } + }; + this.__setBgOverlay("backgroundImage", serialized.backgroundImage, loaded, cbIfLoaded); + this.__setBgOverlay("overlayImage", serialized.overlayImage, loaded, cbIfLoaded); + this.__setBgOverlay("backgroundColor", serialized.background, loaded, cbIfLoaded); + this.__setBgOverlay("overlayColor", serialized.overlay, loaded, cbIfLoaded); + cbIfLoaded(); + }, + __setBgOverlay: function(property, value, loaded, callback) { + var _this = this; + if (!value) { + loaded[property] = true; + return; + } + if (property === "backgroundImage" || property === "overlayImage") { + fabric.Image.fromObject(value, function(img) { + _this[property] = img; + loaded[property] = true; + callback && callback(); + }); + } else { + this["set" + fabric.util.string.capitalize(property, true)](value, function() { + loaded[property] = true; + callback && callback(); + }); + } + }, + _enlivenObjects: function(objects, callback, reviver) { + var _this = this; + if (!objects || objects.length === 0) { + callback && callback(); + return; + } + var renderOnAddRemove = this.renderOnAddRemove; + this.renderOnAddRemove = false; + fabric.util.enlivenObjects(objects, function(enlivenedObjects) { + enlivenedObjects.forEach(function(obj, index) { + _this.insertAt(obj, index); + }); + _this.renderOnAddRemove = renderOnAddRemove; + callback && callback(); + }, null, reviver); + }, + _toDataURL: function(format, callback) { + this.clone(function(clone) { + callback(clone.toDataURL(format)); + }); + }, + _toDataURLWithMultiplier: function(format, multiplier, callback) { + this.clone(function(clone) { + callback(clone.toDataURLWithMultiplier(format, multiplier)); + }); + }, + clone: function(callback, properties) { + var data = JSON.stringify(this.toJSON(properties)); + this.cloneWithoutData(function(clone) { + clone.loadFromJSON(data, function() { + callback && callback(clone); + }); + }); + }, + cloneWithoutData: function(callback) { + var el = fabric.document.createElement("canvas"); + el.width = this.getWidth(); + el.height = this.getHeight(); + var clone = new fabric.Canvas(el); + clone.clipTo = this.clipTo; + if (this.backgroundImage) { + clone.setBackgroundImage(this.backgroundImage.src, function() { + clone.renderAll(); + callback && callback(clone); + }); + clone.backgroundImageOpacity = this.backgroundImageOpacity; + clone.backgroundImageStretch = this.backgroundImageStretch; + } else { + callback && callback(clone); + } + } +}); + +(function(global) { + "use strict"; + var fabric = global.fabric || (global.fabric = {}), extend = fabric.util.object.extend, toFixed = fabric.util.toFixed, capitalize = fabric.util.string.capitalize, degreesToRadians = fabric.util.degreesToRadians, supportsLineDash = fabric.StaticCanvas.supports("setLineDash"); + if (fabric.Object) { + return; + } + fabric.Object = fabric.util.createClass({ + type: "object", + originX: "left", + originY: "top", + top: 0, + left: 0, + width: 0, + height: 0, + scaleX: 1, + scaleY: 1, + flipX: false, + flipY: false, + opacity: 1, + angle: 0, + skewX: 0, + skewY: 0, + cornerSize: 13, + transparentCorners: true, + hoverCursor: null, + moveCursor: null, + padding: 0, + borderColor: "rgba(102,153,255,0.75)", + borderDashArray: null, + cornerColor: "rgba(102,153,255,0.5)", + cornerStrokeColor: null, + cornerStyle: "rect", + cornerDashArray: null, + centeredScaling: false, + centeredRotation: true, + fill: "rgb(0,0,0)", + fillRule: "nonzero", + globalCompositeOperation: "source-over", + backgroundColor: "", + selectionBackgroundColor: "", + stroke: null, + strokeWidth: 1, + strokeDashArray: null, + strokeLineCap: "butt", + strokeLineJoin: "miter", + strokeMiterLimit: 10, + shadow: null, + borderOpacityWhenMoving: .4, + borderScaleFactor: 1, + transformMatrix: null, + minScaleLimit: .01, + selectable: true, + evented: true, + visible: true, + hasControls: true, + hasBorders: true, + hasRotatingPoint: true, + rotatingPointOffset: 40, + perPixelTargetFind: false, + includeDefaultValues: true, + clipTo: null, + lockMovementX: false, + lockMovementY: false, + lockRotation: false, + lockScalingX: false, + lockScalingY: false, + lockUniScaling: false, + lockSkewingX: false, + lockSkewingY: false, + lockScalingFlip: false, + excludeFromExport: false, + stateProperties: ("top left width height scaleX scaleY flipX flipY originX originY transformMatrix " + "stroke strokeWidth strokeDashArray strokeLineCap strokeLineJoin strokeMiterLimit " + "angle opacity fill fillRule globalCompositeOperation shadow clipTo visible backgroundColor " + "skewX skewY").split(" "), + initialize: function(options) { + if (options) { + this.setOptions(options); + } + }, + _initGradient: function(options) { + if (options.fill && options.fill.colorStops && !(options.fill instanceof fabric.Gradient)) { + this.set("fill", new fabric.Gradient(options.fill)); + } + if (options.stroke && options.stroke.colorStops && !(options.stroke instanceof fabric.Gradient)) { + this.set("stroke", new fabric.Gradient(options.stroke)); + } + }, + _initPattern: function(options) { + if (options.fill && options.fill.source && !(options.fill instanceof fabric.Pattern)) { + this.set("fill", new fabric.Pattern(options.fill)); + } + if (options.stroke && options.stroke.source && !(options.stroke instanceof fabric.Pattern)) { + this.set("stroke", new fabric.Pattern(options.stroke)); + } + }, + _initClipping: function(options) { + if (!options.clipTo || typeof options.clipTo !== "string") { + return; + } + var functionBody = fabric.util.getFunctionBody(options.clipTo); + if (typeof functionBody !== "undefined") { + this.clipTo = new Function("ctx", functionBody); + } + }, + setOptions: function(options) { + for (var prop in options) { + this.set(prop, options[prop]); + } + this._initGradient(options); + this._initPattern(options); + this._initClipping(options); + }, + transform: function(ctx, fromLeft) { + if (this.group && !this.group._transformDone && this.group === this.canvas._activeGroup) { + this.group.transform(ctx); + } + var center = fromLeft ? this._getLeftTopCoords() : this.getCenterPoint(); + ctx.translate(center.x, center.y); + ctx.rotate(degreesToRadians(this.angle)); + ctx.scale(this.scaleX * (this.flipX ? -1 : 1), this.scaleY * (this.flipY ? -1 : 1)); + ctx.transform(1, 0, Math.tan(degreesToRadians(this.skewX)), 1, 0, 0); + ctx.transform(1, Math.tan(degreesToRadians(this.skewY)), 0, 1, 0, 0); + }, + toObject: function(propertiesToInclude) { + var NUM_FRACTION_DIGITS = fabric.Object.NUM_FRACTION_DIGITS, object = { + type: this.type, + originX: this.originX, + originY: this.originY, + left: toFixed(this.left, NUM_FRACTION_DIGITS), + top: toFixed(this.top, NUM_FRACTION_DIGITS), + width: toFixed(this.width, NUM_FRACTION_DIGITS), + height: toFixed(this.height, NUM_FRACTION_DIGITS), + fill: this.fill && this.fill.toObject ? this.fill.toObject() : this.fill, + stroke: this.stroke && this.stroke.toObject ? this.stroke.toObject() : this.stroke, + strokeWidth: toFixed(this.strokeWidth, NUM_FRACTION_DIGITS), + strokeDashArray: this.strokeDashArray ? this.strokeDashArray.concat() : this.strokeDashArray, + strokeLineCap: this.strokeLineCap, + strokeLineJoin: this.strokeLineJoin, + strokeMiterLimit: toFixed(this.strokeMiterLimit, NUM_FRACTION_DIGITS), + scaleX: toFixed(this.scaleX, NUM_FRACTION_DIGITS), + scaleY: toFixed(this.scaleY, NUM_FRACTION_DIGITS), + angle: toFixed(this.getAngle(), NUM_FRACTION_DIGITS), + flipX: this.flipX, + flipY: this.flipY, + opacity: toFixed(this.opacity, NUM_FRACTION_DIGITS), + shadow: this.shadow && this.shadow.toObject ? this.shadow.toObject() : this.shadow, + visible: this.visible, + clipTo: this.clipTo && String(this.clipTo), + backgroundColor: this.backgroundColor, + fillRule: this.fillRule, + globalCompositeOperation: this.globalCompositeOperation, + transformMatrix: this.transformMatrix ? this.transformMatrix.concat() : this.transformMatrix, + skewX: toFixed(this.skewX, NUM_FRACTION_DIGITS), + skewY: toFixed(this.skewY, NUM_FRACTION_DIGITS) + }; + if (!this.includeDefaultValues) { + object = this._removeDefaultValues(object); + } + fabric.util.populateWithProperties(this, object, propertiesToInclude); + return object; + }, + toDatalessObject: function(propertiesToInclude) { + return this.toObject(propertiesToInclude); + }, + _removeDefaultValues: function(object) { + var prototype = fabric.util.getKlass(object.type).prototype, stateProperties = prototype.stateProperties; + stateProperties.forEach(function(prop) { + if (object[prop] === prototype[prop]) { + delete object[prop]; + } + var isArray = Object.prototype.toString.call(object[prop]) === "[object Array]" && Object.prototype.toString.call(prototype[prop]) === "[object Array]"; + if (isArray && object[prop].length === 0 && prototype[prop].length === 0) { + delete object[prop]; + } + }); + return object; + }, + toString: function() { + return "#"; + }, + get: function(property) { + return this[property]; + }, + getObjectScaling: function() { + var scaleX = this.scaleX, scaleY = this.scaleY; + if (this.group) { + var scaling = this.group.getObjectScaling(); + scaleX *= scaling.scaleX; + scaleY *= scaling.scaleY; + } + return { + scaleX: scaleX, + scaleY: scaleY + }; + }, + _setObject: function(obj) { + for (var prop in obj) { + this._set(prop, obj[prop]); + } + }, + set: function(key, value) { + if (typeof key === "object") { + this._setObject(key); + } else { + if (typeof value === "function" && key !== "clipTo") { + this._set(key, value(this.get(key))); + } else { + this._set(key, value); + } + } + return this; + }, + _set: function(key, value) { + var shouldConstrainValue = key === "scaleX" || key === "scaleY"; + if (shouldConstrainValue) { + value = this._constrainScale(value); + } + if (key === "scaleX" && value < 0) { + this.flipX = !this.flipX; + value *= -1; + } else if (key === "scaleY" && value < 0) { + this.flipY = !this.flipY; + value *= -1; + } else if (key === "shadow" && value && !(value instanceof fabric.Shadow)) { + value = new fabric.Shadow(value); + } + this[key] = value; + if (key === "width" || key === "height") { + this.minScaleLimit = Math.min(.1, 1 / Math.max(this.width, this.height)); + } + return this; + }, + setOnGroup: function() {}, + toggle: function(property) { + var value = this.get(property); + if (typeof value === "boolean") { + this.set(property, !value); + } + return this; + }, + setSourcePath: function(value) { + this.sourcePath = value; + return this; + }, + getViewportTransform: function() { + if (this.canvas && this.canvas.viewportTransform) { + return this.canvas.viewportTransform; + } + return [ 1, 0, 0, 1, 0, 0 ]; + }, + render: function(ctx, noTransform) { + if (this.width === 0 && this.height === 0 || !this.visible) { + return; + } + ctx.save(); + this._setupCompositeOperation(ctx); + this.drawSelectionBackground(ctx); + if (!noTransform) { + this.transform(ctx); + } + this._setOpacity(ctx); + this._setShadow(ctx); + this._renderBackground(ctx); + this._setStrokeStyles(ctx); + this._setFillStyles(ctx); + if (this.transformMatrix) { + ctx.transform.apply(ctx, this.transformMatrix); + } + this.clipTo && fabric.util.clipContext(this, ctx); + this._render(ctx, noTransform); + this.clipTo && ctx.restore(); + ctx.restore(); + }, + _renderBackground: function(ctx) { + if (!this.backgroundColor) { + return; + } + ctx.fillStyle = this.backgroundColor; + ctx.fillRect(-this.width / 2, -this.height / 2, this.width, this.height); + this._removeShadow(ctx); + }, + _setOpacity: function(ctx) { + if (this.group) { + this.group._setOpacity(ctx); + } + ctx.globalAlpha *= this.opacity; + }, + _setStrokeStyles: function(ctx) { + if (this.stroke) { + ctx.lineWidth = this.strokeWidth; + ctx.lineCap = this.strokeLineCap; + ctx.lineJoin = this.strokeLineJoin; + ctx.miterLimit = this.strokeMiterLimit; + ctx.strokeStyle = this.stroke.toLive ? this.stroke.toLive(ctx, this) : this.stroke; + } + }, + _setFillStyles: function(ctx) { + if (this.fill) { + ctx.fillStyle = this.fill.toLive ? this.fill.toLive(ctx, this) : this.fill; + } + }, + _setLineDash: function(ctx, dashArray, alternative) { + if (!dashArray) { + return; + } + if (1 & dashArray.length) { + dashArray.push.apply(dashArray, dashArray); + } + if (supportsLineDash) { + ctx.setLineDash(dashArray); + } else { + alternative && alternative(ctx); + } + }, + _renderControls: function(ctx, noTransform) { + if (!this.active || noTransform || this.group && this.group !== this.canvas.getActiveGroup()) { + return; + } + var vpt = this.getViewportTransform(), matrix = this.calcTransformMatrix(), options; + matrix = fabric.util.multiplyTransformMatrices(vpt, matrix); + options = fabric.util.qrDecompose(matrix); + ctx.save(); + ctx.translate(options.translateX, options.translateY); + ctx.lineWidth = 1 * this.borderScaleFactor; + ctx.globalAlpha = this.isMoving ? this.borderOpacityWhenMoving : 1; + if (this.group && this.group === this.canvas.getActiveGroup()) { + ctx.rotate(degreesToRadians(options.angle)); + this.drawBordersInGroup(ctx, options); + } else { + ctx.rotate(degreesToRadians(this.angle)); + this.drawBorders(ctx); + } + this.drawControls(ctx); + ctx.restore(); + }, + _setShadow: function(ctx) { + if (!this.shadow) { + return; + } + var multX = this.canvas && this.canvas.viewportTransform[0] || 1, multY = this.canvas && this.canvas.viewportTransform[3] || 1, scaling = this.getObjectScaling(); + if (this.canvas && this.canvas._isRetinaScaling()) { + multX *= fabric.devicePixelRatio; + multY *= fabric.devicePixelRatio; + } + ctx.shadowColor = this.shadow.color; + ctx.shadowBlur = this.shadow.blur * (multX + multY) * (scaling.scaleX + scaling.scaleY) / 4; + ctx.shadowOffsetX = this.shadow.offsetX * multX * scaling.scaleX; + ctx.shadowOffsetY = this.shadow.offsetY * multY * scaling.scaleY; + }, + _removeShadow: function(ctx) { + if (!this.shadow) { + return; + } + ctx.shadowColor = ""; + ctx.shadowBlur = ctx.shadowOffsetX = ctx.shadowOffsetY = 0; + }, + _renderFill: function(ctx) { + if (!this.fill) { + return; + } + ctx.save(); + if (this.fill.gradientTransform) { + var g = this.fill.gradientTransform; + ctx.transform.apply(ctx, g); + } + if (this.fill.toLive) { + ctx.translate(-this.width / 2 + this.fill.offsetX || 0, -this.height / 2 + this.fill.offsetY || 0); + } + if (this.fillRule === "evenodd") { + ctx.fill("evenodd"); + } else { + ctx.fill(); + } + ctx.restore(); + }, + _renderStroke: function(ctx) { + if (!this.stroke || this.strokeWidth === 0) { + return; + } + if (this.shadow && !this.shadow.affectStroke) { + this._removeShadow(ctx); + } + ctx.save(); + this._setLineDash(ctx, this.strokeDashArray, this._renderDashedStroke); + if (this.stroke.gradientTransform) { + var g = this.stroke.gradientTransform; + ctx.transform.apply(ctx, g); + } + if (this.stroke.toLive) { + ctx.translate(-this.width / 2 + this.stroke.offsetX || 0, -this.height / 2 + this.stroke.offsetY || 0); + } + ctx.stroke(); + ctx.restore(); + }, + clone: function(callback, propertiesToInclude) { + if (this.constructor.fromObject) { + return this.constructor.fromObject(this.toObject(propertiesToInclude), callback); + } + return new fabric.Object(this.toObject(propertiesToInclude)); + }, + cloneAsImage: function(callback, options) { + var dataUrl = this.toDataURL(options); + fabric.util.loadImage(dataUrl, function(img) { + if (callback) { + callback(new fabric.Image(img)); + } + }); + return this; + }, + toDataURL: function(options) { + options || (options = {}); + var el = fabric.util.createCanvasElement(), boundingRect = this.getBoundingRect(); + el.width = boundingRect.width; + el.height = boundingRect.height; + fabric.util.wrapElement(el, "div"); + var canvas = new fabric.StaticCanvas(el, { + enableRetinaScaling: options.enableRetinaScaling + }); + if (options.format === "jpg") { + options.format = "jpeg"; + } + if (options.format === "jpeg") { + canvas.backgroundColor = "#fff"; + } + var origParams = { + active: this.get("active"), + left: this.getLeft(), + top: this.getTop() + }; + this.set("active", false); + this.setPositionByOrigin(new fabric.Point(canvas.getWidth() / 2, canvas.getHeight() / 2), "center", "center"); + var originalCanvas = this.canvas; + canvas.add(this); + var data = canvas.toDataURL(options); + this.set(origParams).setCoords(); + this.canvas = originalCanvas; + canvas.dispose(); + canvas = null; + return data; + }, + isType: function(type) { + return this.type === type; + }, + complexity: function() { + return 0; + }, + toJSON: function(propertiesToInclude) { + return this.toObject(propertiesToInclude); + }, + setGradient: function(property, options) { + options || (options = {}); + var gradient = { + colorStops: [] + }; + gradient.type = options.type || (options.r1 || options.r2 ? "radial" : "linear"); + gradient.coords = { + x1: options.x1, + y1: options.y1, + x2: options.x2, + y2: options.y2 + }; + if (options.r1 || options.r2) { + gradient.coords.r1 = options.r1; + gradient.coords.r2 = options.r2; + } + options.gradientTransform && (gradient.gradientTransform = options.gradientTransform); + for (var position in options.colorStops) { + var color = new fabric.Color(options.colorStops[position]); + gradient.colorStops.push({ + offset: position, + color: color.toRgb(), + opacity: color.getAlpha() + }); + } + return this.set(property, fabric.Gradient.forObject(this, gradient)); + }, + setPatternFill: function(options) { + return this.set("fill", new fabric.Pattern(options)); + }, + setShadow: function(options) { + return this.set("shadow", options ? new fabric.Shadow(options) : null); + }, + setColor: function(color) { + this.set("fill", color); + return this; + }, + setAngle: function(angle) { + var shouldCenterOrigin = (this.originX !== "center" || this.originY !== "center") && this.centeredRotation; + if (shouldCenterOrigin) { + this._setOriginToCenter(); + } + this.set("angle", angle); + if (shouldCenterOrigin) { + this._resetOrigin(); + } + return this; + }, + centerH: function() { + this.canvas && this.canvas.centerObjectH(this); + return this; + }, + viewportCenterH: function() { + this.canvas && this.canvas.viewportCenterObjectH(this); + return this; + }, + centerV: function() { + this.canvas && this.canvas.centerObjectV(this); + return this; + }, + viewportCenterV: function() { + this.canvas && this.canvas.viewportCenterObjectV(this); + return this; + }, + center: function() { + this.canvas && this.canvas.centerObject(this); + return this; + }, + viewportCenter: function() { + this.canvas && this.canvas.viewportCenterObject(this); + return this; + }, + remove: function() { + this.canvas && this.canvas.remove(this); + return this; + }, + getLocalPointer: function(e, pointer) { + pointer = pointer || this.canvas.getPointer(e); + var pClicked = new fabric.Point(pointer.x, pointer.y), objectLeftTop = this._getLeftTopCoords(); + if (this.angle) { + pClicked = fabric.util.rotatePoint(pClicked, objectLeftTop, fabric.util.degreesToRadians(-this.angle)); + } + return { + x: pClicked.x - objectLeftTop.x, + y: pClicked.y - objectLeftTop.y + }; + }, + _setupCompositeOperation: function(ctx) { + if (this.globalCompositeOperation) { + ctx.globalCompositeOperation = this.globalCompositeOperation; + } + } + }); + fabric.util.createAccessors(fabric.Object); + fabric.Object.prototype.rotate = fabric.Object.prototype.setAngle; + extend(fabric.Object.prototype, fabric.Observable); + fabric.Object.NUM_FRACTION_DIGITS = 2; + fabric.Object.__uid = 0; +})(typeof exports !== "undefined" ? exports : this); + +(function() { + var degreesToRadians = fabric.util.degreesToRadians, originXOffset = { + left: -.5, + center: 0, + right: .5 + }, originYOffset = { + top: -.5, + center: 0, + bottom: .5 + }; + fabric.util.object.extend(fabric.Object.prototype, { + translateToGivenOrigin: function(point, fromOriginX, fromOriginY, toOriginX, toOriginY) { + var x = point.x, y = point.y, offsetX, offsetY, dim; + if (typeof fromOriginX === "string") { + fromOriginX = originXOffset[fromOriginX]; + } else { + fromOriginX -= .5; + } + if (typeof toOriginX === "string") { + toOriginX = originXOffset[toOriginX]; + } else { + toOriginX -= .5; + } + offsetX = toOriginX - fromOriginX; + if (typeof fromOriginY === "string") { + fromOriginY = originYOffset[fromOriginY]; + } else { + fromOriginY -= .5; + } + if (typeof toOriginY === "string") { + toOriginY = originYOffset[toOriginY]; + } else { + toOriginY -= .5; + } + offsetY = toOriginY - fromOriginY; + if (offsetX || offsetY) { + dim = this._getTransformedDimensions(); + x = point.x + offsetX * dim.x; + y = point.y + offsetY * dim.y; + } + return new fabric.Point(x, y); + }, + translateToCenterPoint: function(point, originX, originY) { + var p = this.translateToGivenOrigin(point, originX, originY, "center", "center"); + if (this.angle) { + return fabric.util.rotatePoint(p, point, degreesToRadians(this.angle)); + } + return p; + }, + translateToOriginPoint: function(center, originX, originY) { + var p = this.translateToGivenOrigin(center, "center", "center", originX, originY); + if (this.angle) { + return fabric.util.rotatePoint(p, center, degreesToRadians(this.angle)); + } + return p; + }, + getCenterPoint: function() { + var leftTop = new fabric.Point(this.left, this.top); + return this.translateToCenterPoint(leftTop, this.originX, this.originY); + }, + getPointByOrigin: function(originX, originY) { + var center = this.getCenterPoint(); + return this.translateToOriginPoint(center, originX, originY); + }, + toLocalPoint: function(point, originX, originY) { + var center = this.getCenterPoint(), p, p2; + if (typeof originX !== "undefined" && typeof originY !== "undefined") { + p = this.translateToGivenOrigin(center, "center", "center", originX, originY); + } else { + p = new fabric.Point(this.left, this.top); + } + p2 = new fabric.Point(point.x, point.y); + if (this.angle) { + p2 = fabric.util.rotatePoint(p2, center, -degreesToRadians(this.angle)); + } + return p2.subtractEquals(p); + }, + setPositionByOrigin: function(pos, originX, originY) { + var center = this.translateToCenterPoint(pos, originX, originY), position = this.translateToOriginPoint(center, this.originX, this.originY); + this.set("left", position.x); + this.set("top", position.y); + }, + adjustPosition: function(to) { + var angle = degreesToRadians(this.angle), hypotFull = this.getWidth(), xFull = Math.cos(angle) * hypotFull, yFull = Math.sin(angle) * hypotFull, offsetFrom, offsetTo; + if (typeof this.originX === "string") { + offsetFrom = originXOffset[this.originX]; + } else { + offsetFrom = this.originX - .5; + } + if (typeof to === "string") { + offsetTo = originXOffset[to]; + } else { + offsetTo = to - .5; + } + this.left += xFull * (offsetTo - offsetFrom); + this.top += yFull * (offsetTo - offsetFrom); + this.setCoords(); + this.originX = to; + }, + _setOriginToCenter: function() { + this._originalOriginX = this.originX; + this._originalOriginY = this.originY; + var center = this.getCenterPoint(); + this.originX = "center"; + this.originY = "center"; + this.left = center.x; + this.top = center.y; + }, + _resetOrigin: function() { + var originPoint = this.translateToOriginPoint(this.getCenterPoint(), this._originalOriginX, this._originalOriginY); + this.originX = this._originalOriginX; + this.originY = this._originalOriginY; + this.left = originPoint.x; + this.top = originPoint.y; + this._originalOriginX = null; + this._originalOriginY = null; + }, + _getLeftTopCoords: function() { + return this.translateToOriginPoint(this.getCenterPoint(), "left", "top"); + } + }); +})(); + +(function() { + function getCoords(oCoords) { + return [ new fabric.Point(oCoords.tl.x, oCoords.tl.y), new fabric.Point(oCoords.tr.x, oCoords.tr.y), new fabric.Point(oCoords.br.x, oCoords.br.y), new fabric.Point(oCoords.bl.x, oCoords.bl.y) ]; + } + var degreesToRadians = fabric.util.degreesToRadians, multiplyMatrices = fabric.util.multiplyTransformMatrices; + fabric.util.object.extend(fabric.Object.prototype, { + oCoords: null, + intersectsWithRect: function(pointTL, pointBR) { + var oCoords = getCoords(this.oCoords), intersection = fabric.Intersection.intersectPolygonRectangle(oCoords, pointTL, pointBR); + return intersection.status === "Intersection"; + }, + intersectsWithObject: function(other) { + var intersection = fabric.Intersection.intersectPolygonPolygon(getCoords(this.oCoords), getCoords(other.oCoords)); + return intersection.status === "Intersection" || other.isContainedWithinObject(this) || this.isContainedWithinObject(other); + }, + isContainedWithinObject: function(other) { + var points = getCoords(this.oCoords), i = 0; + for (;i < 4; i++) { + if (!other.containsPoint(points[i])) { + return false; + } + } + return true; + }, + isContainedWithinRect: function(pointTL, pointBR) { + var boundingRect = this.getBoundingRect(); + return boundingRect.left >= pointTL.x && boundingRect.left + boundingRect.width <= pointBR.x && boundingRect.top >= pointTL.y && boundingRect.top + boundingRect.height <= pointBR.y; + }, + containsPoint: function(point) { + if (!this.oCoords) { + this.setCoords(); + } + var lines = this._getImageLines(this.oCoords), xPoints = this._findCrossPoints(point, lines); + return xPoints !== 0 && xPoints % 2 === 1; + }, + _getImageLines: function(oCoords) { + return { + topline: { + o: oCoords.tl, + d: oCoords.tr + }, + rightline: { + o: oCoords.tr, + d: oCoords.br + }, + bottomline: { + o: oCoords.br, + d: oCoords.bl + }, + leftline: { + o: oCoords.bl, + d: oCoords.tl + } + }; + }, + _findCrossPoints: function(point, oCoords) { + var b1, b2, a1, a2, xi, xcount = 0, iLine; + for (var lineKey in oCoords) { + iLine = oCoords[lineKey]; + if (iLine.o.y < point.y && iLine.d.y < point.y) { + continue; + } + if (iLine.o.y >= point.y && iLine.d.y >= point.y) { + continue; + } + if (iLine.o.x === iLine.d.x && iLine.o.x >= point.x) { + xi = iLine.o.x; + } else { + b1 = 0; + b2 = (iLine.d.y - iLine.o.y) / (iLine.d.x - iLine.o.x); + a1 = point.y - b1 * point.x; + a2 = iLine.o.y - b2 * iLine.o.x; + xi = -(a1 - a2) / (b1 - b2); + } + if (xi >= point.x) { + xcount += 1; + } + if (xcount === 2) { + break; + } + } + return xcount; + }, + getBoundingRectWidth: function() { + return this.getBoundingRect().width; + }, + getBoundingRectHeight: function() { + return this.getBoundingRect().height; + }, + getBoundingRect: function() { + this.oCoords || this.setCoords(); + return fabric.util.makeBoundingBoxFromPoints([ this.oCoords.tl, this.oCoords.tr, this.oCoords.br, this.oCoords.bl ]); + }, + getWidth: function() { + return this._getTransformedDimensions().x; + }, + getHeight: function() { + return this._getTransformedDimensions().y; + }, + _constrainScale: function(value) { + if (Math.abs(value) < this.minScaleLimit) { + if (value < 0) { + return -this.minScaleLimit; + } else { + return this.minScaleLimit; + } + } + return value; + }, + scale: function(value) { + value = this._constrainScale(value); + if (value < 0) { + this.flipX = !this.flipX; + this.flipY = !this.flipY; + value *= -1; + } + this.scaleX = value; + this.scaleY = value; + this.setCoords(); + return this; + }, + scaleToWidth: function(value) { + var boundingRectFactor = this.getBoundingRect().width / this.getWidth(); + return this.scale(value / this.width / boundingRectFactor); + }, + scaleToHeight: function(value) { + var boundingRectFactor = this.getBoundingRect().height / this.getHeight(); + return this.scale(value / this.height / boundingRectFactor); + }, + setCoords: function() { + var theta = degreesToRadians(this.angle), vpt = this.getViewportTransform(), dim = this._calculateCurrentDimensions(), currentWidth = dim.x, currentHeight = dim.y; + if (currentWidth < 0) { + currentWidth = Math.abs(currentWidth); + } + var sinTh = Math.sin(theta), cosTh = Math.cos(theta), _angle = currentWidth > 0 ? Math.atan(currentHeight / currentWidth) : 0, _hypotenuse = currentWidth / Math.cos(_angle) / 2, offsetX = Math.cos(_angle + theta) * _hypotenuse, offsetY = Math.sin(_angle + theta) * _hypotenuse, coords = fabric.util.transformPoint(this.getCenterPoint(), vpt), tl = new fabric.Point(coords.x - offsetX, coords.y - offsetY), tr = new fabric.Point(tl.x + currentWidth * cosTh, tl.y + currentWidth * sinTh), bl = new fabric.Point(tl.x - currentHeight * sinTh, tl.y + currentHeight * cosTh), br = new fabric.Point(coords.x + offsetX, coords.y + offsetY), ml = new fabric.Point((tl.x + bl.x) / 2, (tl.y + bl.y) / 2), mt = new fabric.Point((tr.x + tl.x) / 2, (tr.y + tl.y) / 2), mr = new fabric.Point((br.x + tr.x) / 2, (br.y + tr.y) / 2), mb = new fabric.Point((br.x + bl.x) / 2, (br.y + bl.y) / 2), mtr = new fabric.Point(mt.x + sinTh * this.rotatingPointOffset, mt.y - cosTh * this.rotatingPointOffset); + this.oCoords = { + tl: tl, + tr: tr, + br: br, + bl: bl, + ml: ml, + mt: mt, + mr: mr, + mb: mb, + mtr: mtr + }; + this._setCornerCoords && this._setCornerCoords(); + return this; + }, + _calcRotateMatrix: function() { + if (this.angle) { + var theta = degreesToRadians(this.angle), cos = Math.cos(theta), sin = Math.sin(theta); + return [ cos, sin, -sin, cos, 0, 0 ]; + } + return [ 1, 0, 0, 1, 0, 0 ]; + }, + calcTransformMatrix: function() { + var center = this.getCenterPoint(), translateMatrix = [ 1, 0, 0, 1, center.x, center.y ], rotateMatrix = this._calcRotateMatrix(), dimensionMatrix = this._calcDimensionsTransformMatrix(this.skewX, this.skewY, true), matrix = this.group ? this.group.calcTransformMatrix() : [ 1, 0, 0, 1, 0, 0 ]; + matrix = multiplyMatrices(matrix, translateMatrix); + matrix = multiplyMatrices(matrix, rotateMatrix); + matrix = multiplyMatrices(matrix, dimensionMatrix); + return matrix; + }, + _calcDimensionsTransformMatrix: function(skewX, skewY, flipping) { + var skewMatrixX = [ 1, 0, Math.tan(degreesToRadians(skewX)), 1 ], skewMatrixY = [ 1, Math.tan(degreesToRadians(skewY)), 0, 1 ], scaleX = this.scaleX * (flipping && this.flipX ? -1 : 1), scaleY = this.scaleY * (flipping && this.flipY ? -1 : 1), scaleMatrix = [ scaleX, 0, 0, scaleY ], m = multiplyMatrices(scaleMatrix, skewMatrixX, true); + return multiplyMatrices(m, skewMatrixY, true); + } + }); +})(); + +fabric.util.object.extend(fabric.Object.prototype, { + sendToBack: function() { + if (this.group) { + fabric.StaticCanvas.prototype.sendToBack.call(this.group, this); + } else { + this.canvas.sendToBack(this); + } + return this; + }, + bringToFront: function() { + if (this.group) { + fabric.StaticCanvas.prototype.bringToFront.call(this.group, this); + } else { + this.canvas.bringToFront(this); + } + return this; + }, + sendBackwards: function(intersecting) { + if (this.group) { + fabric.StaticCanvas.prototype.sendBackwards.call(this.group, this, intersecting); + } else { + this.canvas.sendBackwards(this, intersecting); + } + return this; + }, + bringForward: function(intersecting) { + if (this.group) { + fabric.StaticCanvas.prototype.bringForward.call(this.group, this, intersecting); + } else { + this.canvas.bringForward(this, intersecting); + } + return this; + }, + moveTo: function(index) { + if (this.group) { + fabric.StaticCanvas.prototype.moveTo.call(this.group, this, index); + } else { + this.canvas.moveTo(this, index); + } + return this; + } +}); + +(function() { + function getSvgColorString(prop, value) { + if (!value) { + return prop + ": none; "; + } else if (value.toLive) { + return prop + ": url(#SVGID_" + value.id + "); "; + } else { + var color = new fabric.Color(value), str = prop + ": " + color.toRgb() + "; ", opacity = color.getAlpha(); + if (opacity !== 1) { + str += prop + "-opacity: " + opacity.toString() + "; "; + } + return str; + } + } + fabric.util.object.extend(fabric.Object.prototype, { + getSvgStyles: function(skipShadow) { + var fillRule = this.fillRule, strokeWidth = this.strokeWidth ? this.strokeWidth : "0", strokeDashArray = this.strokeDashArray ? this.strokeDashArray.join(" ") : "none", strokeLineCap = this.strokeLineCap ? this.strokeLineCap : "butt", strokeLineJoin = this.strokeLineJoin ? this.strokeLineJoin : "miter", strokeMiterLimit = this.strokeMiterLimit ? this.strokeMiterLimit : "4", opacity = typeof this.opacity !== "undefined" ? this.opacity : "1", visibility = this.visible ? "" : " visibility: hidden;", filter = skipShadow ? "" : this.getSvgFilter(), fill = getSvgColorString("fill", this.fill), stroke = getSvgColorString("stroke", this.stroke); + return [ stroke, "stroke-width: ", strokeWidth, "; ", "stroke-dasharray: ", strokeDashArray, "; ", "stroke-linecap: ", strokeLineCap, "; ", "stroke-linejoin: ", strokeLineJoin, "; ", "stroke-miterlimit: ", strokeMiterLimit, "; ", fill, "fill-rule: ", fillRule, "; ", "opacity: ", opacity, ";", filter, visibility ].join(""); + }, + getSvgFilter: function() { + return this.shadow ? "filter: url(#SVGID_" + this.shadow.id + ");" : ""; + }, + getSvgId: function() { + return this.id ? 'id="' + this.id + '" ' : ""; + }, + getSvgTransform: function() { + if (this.group && this.group.type === "path-group") { + return ""; + } + var toFixed = fabric.util.toFixed, angle = this.getAngle(), skewX = this.getSkewX() % 360, skewY = this.getSkewY() % 360, center = this.getCenterPoint(), NUM_FRACTION_DIGITS = fabric.Object.NUM_FRACTION_DIGITS, translatePart = this.type === "path-group" ? "" : "translate(" + toFixed(center.x, NUM_FRACTION_DIGITS) + " " + toFixed(center.y, NUM_FRACTION_DIGITS) + ")", anglePart = angle !== 0 ? " rotate(" + toFixed(angle, NUM_FRACTION_DIGITS) + ")" : "", scalePart = this.scaleX === 1 && this.scaleY === 1 ? "" : " scale(" + toFixed(this.scaleX, NUM_FRACTION_DIGITS) + " " + toFixed(this.scaleY, NUM_FRACTION_DIGITS) + ")", skewXPart = skewX !== 0 ? " skewX(" + toFixed(skewX, NUM_FRACTION_DIGITS) + ")" : "", skewYPart = skewY !== 0 ? " skewY(" + toFixed(skewY, NUM_FRACTION_DIGITS) + ")" : "", addTranslateX = this.type === "path-group" ? this.width : 0, flipXPart = this.flipX ? " matrix(-1 0 0 1 " + addTranslateX + " 0) " : "", addTranslateY = this.type === "path-group" ? this.height : 0, flipYPart = this.flipY ? " matrix(1 0 0 -1 0 " + addTranslateY + ")" : ""; + return [ translatePart, anglePart, scalePart, flipXPart, flipYPart, skewXPart, skewYPart ].join(""); + }, + getSvgTransformMatrix: function() { + return this.transformMatrix ? " matrix(" + this.transformMatrix.join(" ") + ") " : ""; + }, + _createBaseSVGMarkup: function() { + var markup = []; + if (this.fill && this.fill.toLive) { + markup.push(this.fill.toSVG(this, false)); + } + if (this.stroke && this.stroke.toLive) { + markup.push(this.stroke.toSVG(this, false)); + } + if (this.shadow) { + markup.push(this.shadow.toSVG(this)); + } + return markup; + } + }); +})(); + +(function() { + var extend = fabric.util.object.extend; + function saveProps(origin, destination, props) { + var tmpObj = {}, deep = true; + props.forEach(function(prop) { + tmpObj[prop] = origin[prop]; + }); + extend(origin[destination], tmpObj, deep); + } + function _isEqual(origValue, currentValue) { + if (!fabric.isLikelyNode && origValue instanceof Element) { + return origValue === currentValue; + } else if (origValue instanceof Array) { + if (origValue.length !== currentValue.length) { + return false; + } + var _currentValue = currentValue.concat().sort(), _origValue = origValue.concat().sort(); + return !_origValue.some(function(v, i) { + return !_isEqual(_currentValue[i], v); + }); + } else if (origValue instanceof Object) { + for (var key in origValue) { + if (!_isEqual(origValue[key], currentValue[key])) { + return false; + } + } + return true; + } else { + return origValue === currentValue; + } + } + fabric.util.object.extend(fabric.Object.prototype, { + hasStateChanged: function() { + return !_isEqual(this.originalState, this); + }, + saveState: function(options) { + saveProps(this, "originalState", this.stateProperties); + if (options && options.stateProperties) { + saveProps(this, "originalState", options.stateProperties); + } + return this; + }, + setupState: function(options) { + this.originalState = {}; + this.saveState(options); + return this; + } + }); +})(); + +(function() { + var degreesToRadians = fabric.util.degreesToRadians, isVML = function() { + return typeof G_vmlCanvasManager !== "undefined"; + }; + fabric.util.object.extend(fabric.Object.prototype, { + _controlsVisibility: null, + _findTargetCorner: function(pointer) { + if (!this.hasControls || !this.active) { + return false; + } + var ex = pointer.x, ey = pointer.y, xPoints, lines; + this.__corner = 0; + for (var i in this.oCoords) { + if (!this.isControlVisible(i)) { + continue; + } + if (i === "mtr" && !this.hasRotatingPoint) { + continue; + } + if (this.get("lockUniScaling") && (i === "mt" || i === "mr" || i === "mb" || i === "ml")) { + continue; + } + lines = this._getImageLines(this.oCoords[i].corner); + xPoints = this._findCrossPoints({ + x: ex, + y: ey + }, lines); + if (xPoints !== 0 && xPoints % 2 === 1) { + this.__corner = i; + return i; + } + } + return false; + }, + _setCornerCoords: function() { + var coords = this.oCoords, newTheta = degreesToRadians(45 - this.angle), cornerHypotenuse = this.cornerSize * .707106, cosHalfOffset = cornerHypotenuse * Math.cos(newTheta), sinHalfOffset = cornerHypotenuse * Math.sin(newTheta), x, y; + for (var point in coords) { + x = coords[point].x; + y = coords[point].y; + coords[point].corner = { + tl: { + x: x - sinHalfOffset, + y: y - cosHalfOffset + }, + tr: { + x: x + cosHalfOffset, + y: y - sinHalfOffset + }, + bl: { + x: x - cosHalfOffset, + y: y + sinHalfOffset + }, + br: { + x: x + sinHalfOffset, + y: y + cosHalfOffset + } + }; + } + }, + _getNonTransformedDimensions: function() { + var strokeWidth = this.strokeWidth, w = this.width, h = this.height, addStrokeToW = true, addStrokeToH = true; + if (this.type === "line" && this.strokeLineCap === "butt") { + addStrokeToH = w; + addStrokeToW = h; + } + if (addStrokeToH) { + h += h < 0 ? -strokeWidth : strokeWidth; + } + if (addStrokeToW) { + w += w < 0 ? -strokeWidth : strokeWidth; + } + return { + x: w, + y: h + }; + }, + _getTransformedDimensions: function(skewX, skewY) { + if (typeof skewX === "undefined") { + skewX = this.skewX; + } + if (typeof skewY === "undefined") { + skewY = this.skewY; + } + var dimensions = this._getNonTransformedDimensions(), dimX = dimensions.x / 2, dimY = dimensions.y / 2, points = [ { + x: -dimX, + y: -dimY + }, { + x: dimX, + y: -dimY + }, { + x: -dimX, + y: dimY + }, { + x: dimX, + y: dimY + } ], i, transformMatrix = this._calcDimensionsTransformMatrix(skewX, skewY, false), bbox; + for (i = 0; i < points.length; i++) { + points[i] = fabric.util.transformPoint(points[i], transformMatrix); + } + bbox = fabric.util.makeBoundingBoxFromPoints(points); + return { + x: bbox.width, + y: bbox.height + }; + }, + _calculateCurrentDimensions: function() { + var vpt = this.getViewportTransform(), dim = this._getTransformedDimensions(), w = dim.x, h = dim.y, p = fabric.util.transformPoint(new fabric.Point(w, h), vpt, true); + return p.scalarAdd(2 * this.padding); + }, + drawSelectionBackground: function(ctx) { + if (!this.selectionBackgroundColor || this.group || !this.active) { + return this; + } + ctx.save(); + var center = this.getCenterPoint(), wh = this._calculateCurrentDimensions(), vpt = this.canvas.viewportTransform; + ctx.translate(center.x, center.y); + ctx.scale(1 / vpt[0], 1 / vpt[3]); + ctx.rotate(degreesToRadians(this.angle)); + ctx.fillStyle = this.selectionBackgroundColor; + ctx.fillRect(-wh.x / 2, -wh.y / 2, wh.x, wh.y); + ctx.restore(); + return this; + }, + drawBorders: function(ctx) { + if (!this.hasBorders) { + return this; + } + var wh = this._calculateCurrentDimensions(), strokeWidth = 1 / this.borderScaleFactor, width = wh.x + strokeWidth, height = wh.y + strokeWidth; + ctx.save(); + ctx.strokeStyle = this.borderColor; + this._setLineDash(ctx, this.borderDashArray, null); + ctx.strokeRect(-width / 2, -height / 2, width, height); + if (this.hasRotatingPoint && this.isControlVisible("mtr") && !this.get("lockRotation") && this.hasControls) { + var rotateHeight = -height / 2; + ctx.beginPath(); + ctx.moveTo(0, rotateHeight); + ctx.lineTo(0, rotateHeight - this.rotatingPointOffset); + ctx.closePath(); + ctx.stroke(); + } + ctx.restore(); + return this; + }, + drawBordersInGroup: function(ctx, options) { + if (!this.hasBorders) { + return this; + } + var p = this._getNonTransformedDimensions(), matrix = fabric.util.customTransformMatrix(options.scaleX, options.scaleY, options.skewX), wh = fabric.util.transformPoint(p, matrix), strokeWidth = 1 / this.borderScaleFactor, width = wh.x + strokeWidth + 2 * this.padding, height = wh.y + strokeWidth + 2 * this.padding; + ctx.save(); + this._setLineDash(ctx, this.borderDashArray, null); + ctx.strokeStyle = this.borderColor; + ctx.strokeRect(-width / 2, -height / 2, width, height); + ctx.restore(); + return this; + }, + drawControls: function(ctx) { + if (!this.hasControls) { + return this; + } + var wh = this._calculateCurrentDimensions(), width = wh.x, height = wh.y, scaleOffset = this.cornerSize, left = -(width + scaleOffset) / 2, top = -(height + scaleOffset) / 2, methodName = this.transparentCorners ? "stroke" : "fill"; + ctx.save(); + ctx.strokeStyle = ctx.fillStyle = this.cornerColor; + if (!this.transparentCorners) { + ctx.strokeStyle = this.cornerStrokeColor; + } + this._setLineDash(ctx, this.cornerDashArray, null); + this._drawControl("tl", ctx, methodName, left, top); + this._drawControl("tr", ctx, methodName, left + width, top); + this._drawControl("bl", ctx, methodName, left, top + height); + this._drawControl("br", ctx, methodName, left + width, top + height); + if (!this.get("lockUniScaling")) { + this._drawControl("mt", ctx, methodName, left + width / 2, top); + this._drawControl("mb", ctx, methodName, left + width / 2, top + height); + this._drawControl("mr", ctx, methodName, left + width, top + height / 2); + this._drawControl("ml", ctx, methodName, left, top + height / 2); + } + if (this.hasRotatingPoint) { + this._drawControl("mtr", ctx, methodName, left + width / 2, top - this.rotatingPointOffset); + } + ctx.restore(); + return this; + }, + _drawControl: function(control, ctx, methodName, left, top) { + if (!this.isControlVisible(control)) { + return; + } + var size = this.cornerSize, stroke = !this.transparentCorners && this.cornerStrokeColor; + switch (this.cornerStyle) { + case "circle": + ctx.beginPath(); + ctx.arc(left + size / 2, top + size / 2, size / 2, 0, 2 * Math.PI, false); + ctx[methodName](); + if (stroke) { + ctx.stroke(); + } + break; + + default: + isVML() || this.transparentCorners || ctx.clearRect(left, top, size, size); + ctx[methodName + "Rect"](left, top, size, size); + if (stroke) { + ctx.strokeRect(left, top, size, size); + } + } + }, + isControlVisible: function(controlName) { + return this._getControlsVisibility()[controlName]; + }, + setControlVisible: function(controlName, visible) { + this._getControlsVisibility()[controlName] = visible; + return this; + }, + setControlsVisibility: function(options) { + options || (options = {}); + for (var p in options) { + this.setControlVisible(p, options[p]); + } + return this; + }, + _getControlsVisibility: function() { + if (!this._controlsVisibility) { + this._controlsVisibility = { + tl: true, + tr: true, + br: true, + bl: true, + ml: true, + mt: true, + mr: true, + mb: true, + mtr: true + }; + } + return this._controlsVisibility; + } + }); +})(); + +fabric.util.object.extend(fabric.StaticCanvas.prototype, { + FX_DURATION: 500, + fxCenterObjectH: function(object, callbacks) { + callbacks = callbacks || {}; + var empty = function() {}, onComplete = callbacks.onComplete || empty, onChange = callbacks.onChange || empty, _this = this; + fabric.util.animate({ + startValue: object.get("left"), + endValue: this.getCenter().left, + duration: this.FX_DURATION, + onChange: function(value) { + object.set("left", value); + _this.renderAll(); + onChange(); + }, + onComplete: function() { + object.setCoords(); + onComplete(); + } + }); + return this; + }, + fxCenterObjectV: function(object, callbacks) { + callbacks = callbacks || {}; + var empty = function() {}, onComplete = callbacks.onComplete || empty, onChange = callbacks.onChange || empty, _this = this; + fabric.util.animate({ + startValue: object.get("top"), + endValue: this.getCenter().top, + duration: this.FX_DURATION, + onChange: function(value) { + object.set("top", value); + _this.renderAll(); + onChange(); + }, + onComplete: function() { + object.setCoords(); + onComplete(); + } + }); + return this; + }, + fxRemove: function(object, callbacks) { + callbacks = callbacks || {}; + var empty = function() {}, onComplete = callbacks.onComplete || empty, onChange = callbacks.onChange || empty, _this = this; + fabric.util.animate({ + startValue: object.get("opacity"), + endValue: 0, + duration: this.FX_DURATION, + onStart: function() { + object.set("active", false); + }, + onChange: function(value) { + object.set("opacity", value); + _this.renderAll(); + onChange(); + }, + onComplete: function() { + _this.remove(object); + onComplete(); + } + }); + return this; + } +}); + +fabric.util.object.extend(fabric.Object.prototype, { + animate: function() { + if (arguments[0] && typeof arguments[0] === "object") { + var propsToAnimate = [], prop, skipCallbacks; + for (prop in arguments[0]) { + propsToAnimate.push(prop); + } + for (var i = 0, len = propsToAnimate.length; i < len; i++) { + prop = propsToAnimate[i]; + skipCallbacks = i !== len - 1; + this._animate(prop, arguments[0][prop], arguments[1], skipCallbacks); + } + } else { + this._animate.apply(this, arguments); + } + return this; + }, + _animate: function(property, to, options, skipCallbacks) { + var _this = this, propPair; + to = to.toString(); + if (!options) { + options = {}; + } else { + options = fabric.util.object.clone(options); + } + if (~property.indexOf(".")) { + propPair = property.split("."); + } + var currentValue = propPair ? this.get(propPair[0])[propPair[1]] : this.get(property); + if (!("from" in options)) { + options.from = currentValue; + } + if (~to.indexOf("=")) { + to = currentValue + parseFloat(to.replace("=", "")); + } else { + to = parseFloat(to); + } + fabric.util.animate({ + startValue: options.from, + endValue: to, + byValue: options.by, + easing: options.easing, + duration: options.duration, + abort: options.abort && function() { + return options.abort.call(_this); + }, + onChange: function(value) { + if (propPair) { + _this[propPair[0]][propPair[1]] = value; + } else { + _this.set(property, value); + } + if (skipCallbacks) { + return; + } + options.onChange && options.onChange(); + }, + onComplete: function() { + if (skipCallbacks) { + return; + } + _this.setCoords(); + options.onComplete && options.onComplete(); + } + }); + } +}); + +(function(global) { + "use strict"; + var fabric = global.fabric || (global.fabric = {}), extend = fabric.util.object.extend, coordProps = { + x1: 1, + x2: 1, + y1: 1, + y2: 1 + }, supportsLineDash = fabric.StaticCanvas.supports("setLineDash"); + if (fabric.Line) { + fabric.warn("fabric.Line is already defined"); + return; + } + fabric.Line = fabric.util.createClass(fabric.Object, { + type: "line", + x1: 0, + y1: 0, + x2: 0, + y2: 0, + initialize: function(points, options) { + options = options || {}; + if (!points) { + points = [ 0, 0, 0, 0 ]; + } + this.callSuper("initialize", options); + this.set("x1", points[0]); + this.set("y1", points[1]); + this.set("x2", points[2]); + this.set("y2", points[3]); + this._setWidthHeight(options); + }, + _setWidthHeight: function(options) { + options || (options = {}); + this.width = Math.abs(this.x2 - this.x1); + this.height = Math.abs(this.y2 - this.y1); + this.left = "left" in options ? options.left : this._getLeftToOriginX(); + this.top = "top" in options ? options.top : this._getTopToOriginY(); + }, + _set: function(key, value) { + this.callSuper("_set", key, value); + if (typeof coordProps[key] !== "undefined") { + this._setWidthHeight(); + } + return this; + }, + _getLeftToOriginX: makeEdgeToOriginGetter({ + origin: "originX", + axis1: "x1", + axis2: "x2", + dimension: "width" + }, { + nearest: "left", + center: "center", + farthest: "right" + }), + _getTopToOriginY: makeEdgeToOriginGetter({ + origin: "originY", + axis1: "y1", + axis2: "y2", + dimension: "height" + }, { + nearest: "top", + center: "center", + farthest: "bottom" + }), + _render: function(ctx, noTransform) { + ctx.beginPath(); + if (noTransform) { + var cp = this.getCenterPoint(); + ctx.translate(cp.x - this.strokeWidth / 2, cp.y - this.strokeWidth / 2); + } + if (!this.strokeDashArray || this.strokeDashArray && supportsLineDash) { + var p = this.calcLinePoints(); + ctx.moveTo(p.x1, p.y1); + ctx.lineTo(p.x2, p.y2); + } + ctx.lineWidth = this.strokeWidth; + var origStrokeStyle = ctx.strokeStyle; + ctx.strokeStyle = this.stroke || ctx.fillStyle; + this.stroke && this._renderStroke(ctx); + ctx.strokeStyle = origStrokeStyle; + }, + _renderDashedStroke: function(ctx) { + var p = this.calcLinePoints(); + ctx.beginPath(); + fabric.util.drawDashedLine(ctx, p.x1, p.y1, p.x2, p.y2, this.strokeDashArray); + ctx.closePath(); + }, + toObject: function(propertiesToInclude) { + return extend(this.callSuper("toObject", propertiesToInclude), this.calcLinePoints()); + }, + calcLinePoints: function() { + var xMult = this.x1 <= this.x2 ? -1 : 1, yMult = this.y1 <= this.y2 ? -1 : 1, x1 = xMult * this.width * .5, y1 = yMult * this.height * .5, x2 = xMult * this.width * -.5, y2 = yMult * this.height * -.5; + return { + x1: x1, + x2: x2, + y1: y1, + y2: y2 + }; + }, + toSVG: function(reviver) { + var markup = this._createBaseSVGMarkup(), p = { + x1: this.x1, + x2: this.x2, + y1: this.y1, + y2: this.y2 + }; + if (!(this.group && this.group.type === "path-group")) { + p = this.calcLinePoints(); + } + markup.push("\n'); + return reviver ? reviver(markup.join("")) : markup.join(""); + }, + complexity: function() { + return 1; + } + }); + fabric.Line.ATTRIBUTE_NAMES = fabric.SHARED_ATTRIBUTES.concat("x1 y1 x2 y2".split(" ")); + fabric.Line.fromElement = function(element, options) { + var parsedAttributes = fabric.parseAttributes(element, fabric.Line.ATTRIBUTE_NAMES), points = [ parsedAttributes.x1 || 0, parsedAttributes.y1 || 0, parsedAttributes.x2 || 0, parsedAttributes.y2 || 0 ]; + return new fabric.Line(points, extend(parsedAttributes, options)); + }; + fabric.Line.fromObject = function(object, callback) { + var points = [ object.x1, object.y1, object.x2, object.y2 ], line = new fabric.Line(points, object); + callback && callback(line); + return line; + }; + function makeEdgeToOriginGetter(propertyNames, originValues) { + var origin = propertyNames.origin, axis1 = propertyNames.axis1, axis2 = propertyNames.axis2, dimension = propertyNames.dimension, nearest = originValues.nearest, center = originValues.center, farthest = originValues.farthest; + return function() { + switch (this.get(origin)) { + case nearest: + return Math.min(this.get(axis1), this.get(axis2)); + + case center: + return Math.min(this.get(axis1), this.get(axis2)) + .5 * this.get(dimension); + + case farthest: + return Math.max(this.get(axis1), this.get(axis2)); + } + }; + } +})(typeof exports !== "undefined" ? exports : this); + +(function(global) { + "use strict"; + var fabric = global.fabric || (global.fabric = {}), pi = Math.PI, extend = fabric.util.object.extend; + if (fabric.Circle) { + fabric.warn("fabric.Circle is already defined."); + return; + } + fabric.Circle = fabric.util.createClass(fabric.Object, { + type: "circle", + radius: 0, + startAngle: 0, + endAngle: pi * 2, + initialize: function(options) { + options = options || {}; + this.callSuper("initialize", options); + this.set("radius", options.radius || 0); + this.startAngle = options.startAngle || this.startAngle; + this.endAngle = options.endAngle || this.endAngle; + }, + _set: function(key, value) { + this.callSuper("_set", key, value); + if (key === "radius") { + this.setRadius(value); + } + return this; + }, + toObject: function(propertiesToInclude) { + return extend(this.callSuper("toObject", propertiesToInclude), { + radius: this.get("radius"), + startAngle: this.startAngle, + endAngle: this.endAngle + }); + }, + toSVG: function(reviver) { + var markup = this._createBaseSVGMarkup(), x = 0, y = 0, angle = (this.endAngle - this.startAngle) % (2 * pi); + if (angle === 0) { + if (this.group && this.group.type === "path-group") { + x = this.left + this.radius; + y = this.top + this.radius; + } + markup.push("\n'); + } else { + var startX = Math.cos(this.startAngle) * this.radius, startY = Math.sin(this.startAngle) * this.radius, endX = Math.cos(this.endAngle) * this.radius, endY = Math.sin(this.endAngle) * this.radius, largeFlag = angle > pi ? "1" : "0"; + markup.push('\n'); + } + return reviver ? reviver(markup.join("")) : markup.join(""); + }, + _render: function(ctx, noTransform) { + ctx.beginPath(); + ctx.arc(noTransform ? this.left + this.radius : 0, noTransform ? this.top + this.radius : 0, this.radius, this.startAngle, this.endAngle, false); + this._renderFill(ctx); + this._renderStroke(ctx); + }, + getRadiusX: function() { + return this.get("radius") * this.get("scaleX"); + }, + getRadiusY: function() { + return this.get("radius") * this.get("scaleY"); + }, + setRadius: function(value) { + this.radius = value; + return this.set("width", value * 2).set("height", value * 2); + }, + complexity: function() { + return 1; + } + }); + fabric.Circle.ATTRIBUTE_NAMES = fabric.SHARED_ATTRIBUTES.concat("cx cy r".split(" ")); + fabric.Circle.fromElement = function(element, options) { + options || (options = {}); + var parsedAttributes = fabric.parseAttributes(element, fabric.Circle.ATTRIBUTE_NAMES); + if (!isValidRadius(parsedAttributes)) { + throw new Error("value of `r` attribute is required and can not be negative"); + } + parsedAttributes.left = parsedAttributes.left || 0; + parsedAttributes.top = parsedAttributes.top || 0; + var obj = new fabric.Circle(extend(parsedAttributes, options)); + obj.left -= obj.radius; + obj.top -= obj.radius; + return obj; + }; + function isValidRadius(attributes) { + return "radius" in attributes && attributes.radius >= 0; + } + fabric.Circle.fromObject = function(object, callback) { + var circle = new fabric.Circle(object); + callback && callback(circle); + return circle; + }; +})(typeof exports !== "undefined" ? exports : this); + +(function(global) { + "use strict"; + var fabric = global.fabric || (global.fabric = {}); + if (fabric.Triangle) { + fabric.warn("fabric.Triangle is already defined"); + return; + } + fabric.Triangle = fabric.util.createClass(fabric.Object, { + type: "triangle", + initialize: function(options) { + options = options || {}; + this.callSuper("initialize", options); + this.set("width", options.width || 100).set("height", options.height || 100); + }, + _render: function(ctx) { + var widthBy2 = this.width / 2, heightBy2 = this.height / 2; + ctx.beginPath(); + ctx.moveTo(-widthBy2, heightBy2); + ctx.lineTo(0, -heightBy2); + ctx.lineTo(widthBy2, heightBy2); + ctx.closePath(); + this._renderFill(ctx); + this._renderStroke(ctx); + }, + _renderDashedStroke: function(ctx) { + var widthBy2 = this.width / 2, heightBy2 = this.height / 2; + ctx.beginPath(); + fabric.util.drawDashedLine(ctx, -widthBy2, heightBy2, 0, -heightBy2, this.strokeDashArray); + fabric.util.drawDashedLine(ctx, 0, -heightBy2, widthBy2, heightBy2, this.strokeDashArray); + fabric.util.drawDashedLine(ctx, widthBy2, heightBy2, -widthBy2, heightBy2, this.strokeDashArray); + ctx.closePath(); + }, + toSVG: function(reviver) { + var markup = this._createBaseSVGMarkup(), widthBy2 = this.width / 2, heightBy2 = this.height / 2, points = [ -widthBy2 + " " + heightBy2, "0 " + -heightBy2, widthBy2 + " " + heightBy2 ].join(","); + markup.push("'); + return reviver ? reviver(markup.join("")) : markup.join(""); + }, + complexity: function() { + return 1; + } + }); + fabric.Triangle.fromObject = function(object, callback) { + var triangle = new fabric.Triangle(object); + callback && callback(triangle); + return triangle; + }; +})(typeof exports !== "undefined" ? exports : this); + +(function(global) { + "use strict"; + var fabric = global.fabric || (global.fabric = {}), piBy2 = Math.PI * 2, extend = fabric.util.object.extend; + if (fabric.Ellipse) { + fabric.warn("fabric.Ellipse is already defined."); + return; + } + fabric.Ellipse = fabric.util.createClass(fabric.Object, { + type: "ellipse", + rx: 0, + ry: 0, + initialize: function(options) { + options = options || {}; + this.callSuper("initialize", options); + this.set("rx", options.rx || 0); + this.set("ry", options.ry || 0); + }, + _set: function(key, value) { + this.callSuper("_set", key, value); + switch (key) { + case "rx": + this.rx = value; + this.set("width", value * 2); + break; + + case "ry": + this.ry = value; + this.set("height", value * 2); + break; + } + return this; + }, + getRx: function() { + return this.get("rx") * this.get("scaleX"); + }, + getRy: function() { + return this.get("ry") * this.get("scaleY"); + }, + toObject: function(propertiesToInclude) { + return extend(this.callSuper("toObject", propertiesToInclude), { + rx: this.get("rx"), + ry: this.get("ry") + }); + }, + toSVG: function(reviver) { + var markup = this._createBaseSVGMarkup(), x = 0, y = 0; + if (this.group && this.group.type === "path-group") { + x = this.left + this.rx; + y = this.top + this.ry; + } + markup.push("\n'); + return reviver ? reviver(markup.join("")) : markup.join(""); + }, + _render: function(ctx, noTransform) { + ctx.beginPath(); + ctx.save(); + ctx.transform(1, 0, 0, this.ry / this.rx, 0, 0); + ctx.arc(noTransform ? this.left + this.rx : 0, noTransform ? (this.top + this.ry) * this.rx / this.ry : 0, this.rx, 0, piBy2, false); + ctx.restore(); + this._renderFill(ctx); + this._renderStroke(ctx); + }, + complexity: function() { + return 1; + } + }); + fabric.Ellipse.ATTRIBUTE_NAMES = fabric.SHARED_ATTRIBUTES.concat("cx cy rx ry".split(" ")); + fabric.Ellipse.fromElement = function(element, options) { + options || (options = {}); + var parsedAttributes = fabric.parseAttributes(element, fabric.Ellipse.ATTRIBUTE_NAMES); + parsedAttributes.left = parsedAttributes.left || 0; + parsedAttributes.top = parsedAttributes.top || 0; + var ellipse = new fabric.Ellipse(extend(parsedAttributes, options)); + ellipse.top -= ellipse.ry; + ellipse.left -= ellipse.rx; + return ellipse; + }; + fabric.Ellipse.fromObject = function(object, callback) { + var ellipse = new fabric.Ellipse(object); + callback && callback(ellipse); + return ellipse; + }; +})(typeof exports !== "undefined" ? exports : this); + +(function(global) { + "use strict"; + var fabric = global.fabric || (global.fabric = {}), extend = fabric.util.object.extend; + if (fabric.Rect) { + fabric.warn("fabric.Rect is already defined"); + return; + } + var stateProperties = fabric.Object.prototype.stateProperties.concat(); + stateProperties.push("rx", "ry", "x", "y"); + fabric.Rect = fabric.util.createClass(fabric.Object, { + stateProperties: stateProperties, + type: "rect", + rx: 0, + ry: 0, + strokeDashArray: null, + initialize: function(options) { + options = options || {}; + this.callSuper("initialize", options); + this._initRxRy(); + }, + _initRxRy: function() { + if (this.rx && !this.ry) { + this.ry = this.rx; + } else if (this.ry && !this.rx) { + this.rx = this.ry; + } + }, + _render: function(ctx, noTransform) { + if (this.width === 1 && this.height === 1) { + ctx.fillRect(-.5, -.5, 1, 1); + return; + } + var rx = this.rx ? Math.min(this.rx, this.width / 2) : 0, ry = this.ry ? Math.min(this.ry, this.height / 2) : 0, w = this.width, h = this.height, x = noTransform ? this.left : -this.width / 2, y = noTransform ? this.top : -this.height / 2, isRounded = rx !== 0 || ry !== 0, k = 1 - .5522847498; + ctx.beginPath(); + ctx.moveTo(x + rx, y); + ctx.lineTo(x + w - rx, y); + isRounded && ctx.bezierCurveTo(x + w - k * rx, y, x + w, y + k * ry, x + w, y + ry); + ctx.lineTo(x + w, y + h - ry); + isRounded && ctx.bezierCurveTo(x + w, y + h - k * ry, x + w - k * rx, y + h, x + w - rx, y + h); + ctx.lineTo(x + rx, y + h); + isRounded && ctx.bezierCurveTo(x + k * rx, y + h, x, y + h - k * ry, x, y + h - ry); + ctx.lineTo(x, y + ry); + isRounded && ctx.bezierCurveTo(x, y + k * ry, x + k * rx, y, x + rx, y); + ctx.closePath(); + this._renderFill(ctx); + this._renderStroke(ctx); + }, + _renderDashedStroke: function(ctx) { + var x = -this.width / 2, y = -this.height / 2, w = this.width, h = this.height; + ctx.beginPath(); + fabric.util.drawDashedLine(ctx, x, y, x + w, y, this.strokeDashArray); + fabric.util.drawDashedLine(ctx, x + w, y, x + w, y + h, this.strokeDashArray); + fabric.util.drawDashedLine(ctx, x + w, y + h, x, y + h, this.strokeDashArray); + fabric.util.drawDashedLine(ctx, x, y + h, x, y, this.strokeDashArray); + ctx.closePath(); + }, + toObject: function(propertiesToInclude) { + var object = extend(this.callSuper("toObject", propertiesToInclude), { + rx: this.get("rx") || 0, + ry: this.get("ry") || 0 + }); + if (!this.includeDefaultValues) { + this._removeDefaultValues(object); + } + return object; + }, + toSVG: function(reviver) { + var markup = this._createBaseSVGMarkup(), x = this.left, y = this.top; + if (!(this.group && this.group.type === "path-group")) { + x = -this.width / 2; + y = -this.height / 2; + } + markup.push("\n'); + return reviver ? reviver(markup.join("")) : markup.join(""); + }, + complexity: function() { + return 1; + } + }); + fabric.Rect.ATTRIBUTE_NAMES = fabric.SHARED_ATTRIBUTES.concat("x y rx ry width height".split(" ")); + fabric.Rect.fromElement = function(element, options) { + if (!element) { + return null; + } + options = options || {}; + var parsedAttributes = fabric.parseAttributes(element, fabric.Rect.ATTRIBUTE_NAMES); + parsedAttributes.left = parsedAttributes.left || 0; + parsedAttributes.top = parsedAttributes.top || 0; + var rect = new fabric.Rect(extend(options ? fabric.util.object.clone(options) : {}, parsedAttributes)); + rect.visible = rect.visible && rect.width > 0 && rect.height > 0; + return rect; + }; + fabric.Rect.fromObject = function(object, callback) { + var rect = new fabric.Rect(object); + callback && callback(rect); + return rect; + }; +})(typeof exports !== "undefined" ? exports : this); + +(function(global) { + "use strict"; + var fabric = global.fabric || (global.fabric = {}); + if (fabric.Polyline) { + fabric.warn("fabric.Polyline is already defined"); + return; + } + fabric.Polyline = fabric.util.createClass(fabric.Object, { + type: "polyline", + points: null, + minX: 0, + minY: 0, + initialize: function(points, options) { + return fabric.Polygon.prototype.initialize.call(this, points, options); + }, + _calcDimensions: function() { + return fabric.Polygon.prototype._calcDimensions.call(this); + }, + toObject: function(propertiesToInclude) { + return fabric.Polygon.prototype.toObject.call(this, propertiesToInclude); + }, + toSVG: function(reviver) { + return fabric.Polygon.prototype.toSVG.call(this, reviver); + }, + _render: function(ctx, noTransform) { + if (!fabric.Polygon.prototype.commonRender.call(this, ctx, noTransform)) { + return; + } + this._renderFill(ctx); + this._renderStroke(ctx); + }, + _renderDashedStroke: function(ctx) { + var p1, p2; + ctx.beginPath(); + for (var i = 0, len = this.points.length; i < len; i++) { + p1 = this.points[i]; + p2 = this.points[i + 1] || p1; + fabric.util.drawDashedLine(ctx, p1.x, p1.y, p2.x, p2.y, this.strokeDashArray); + } + }, + complexity: function() { + return this.get("points").length; + } + }); + fabric.Polyline.ATTRIBUTE_NAMES = fabric.SHARED_ATTRIBUTES.concat(); + fabric.Polyline.fromElement = function(element, options) { + if (!element) { + return null; + } + options || (options = {}); + var points = fabric.parsePointsAttribute(element.getAttribute("points")), parsedAttributes = fabric.parseAttributes(element, fabric.Polyline.ATTRIBUTE_NAMES); + return new fabric.Polyline(points, fabric.util.object.extend(parsedAttributes, options)); + }; + fabric.Polyline.fromObject = function(object, callback) { + var polyline = new fabric.Polyline(object.points, object); + callback && callback(polyline); + return polyline; + }; +})(typeof exports !== "undefined" ? exports : this); + +(function(global) { + "use strict"; + var fabric = global.fabric || (global.fabric = {}), extend = fabric.util.object.extend, min = fabric.util.array.min, max = fabric.util.array.max, toFixed = fabric.util.toFixed; + if (fabric.Polygon) { + fabric.warn("fabric.Polygon is already defined"); + return; + } + fabric.Polygon = fabric.util.createClass(fabric.Object, { + type: "polygon", + points: null, + minX: 0, + minY: 0, + initialize: function(points, options) { + options = options || {}; + this.points = points || []; + this.callSuper("initialize", options); + this._calcDimensions(); + if (!("top" in options)) { + this.top = this.minY; + } + if (!("left" in options)) { + this.left = this.minX; + } + this.pathOffset = { + x: this.minX + this.width / 2, + y: this.minY + this.height / 2 + }; + }, + _calcDimensions: function() { + var points = this.points, minX = min(points, "x"), minY = min(points, "y"), maxX = max(points, "x"), maxY = max(points, "y"); + this.width = maxX - minX || 0; + this.height = maxY - minY || 0; + this.minX = minX || 0; + this.minY = minY || 0; + }, + toObject: function(propertiesToInclude) { + return extend(this.callSuper("toObject", propertiesToInclude), { + points: this.points.concat() + }); + }, + toSVG: function(reviver) { + var points = [], addTransform, markup = this._createBaseSVGMarkup(); + for (var i = 0, len = this.points.length; i < len; i++) { + points.push(toFixed(this.points[i].x, 2), ",", toFixed(this.points[i].y, 2), " "); + } + if (!(this.group && this.group.type === "path-group")) { + addTransform = " translate(" + -this.pathOffset.x + ", " + -this.pathOffset.y + ") "; + } + markup.push("<", this.type, " ", this.getSvgId(), 'points="', points.join(""), '" style="', this.getSvgStyles(), '" transform="', this.getSvgTransform(), addTransform, " ", this.getSvgTransformMatrix(), '"/>\n'); + return reviver ? reviver(markup.join("")) : markup.join(""); + }, + _render: function(ctx, noTransform) { + if (!this.commonRender(ctx, noTransform)) { + return; + } + this._renderFill(ctx); + if (this.stroke || this.strokeDashArray) { + ctx.closePath(); + this._renderStroke(ctx); + } + }, + commonRender: function(ctx, noTransform) { + var point, len = this.points.length; + if (!len || isNaN(this.points[len - 1].y)) { + return false; + } + noTransform || ctx.translate(-this.pathOffset.x, -this.pathOffset.y); + ctx.beginPath(); + ctx.moveTo(this.points[0].x, this.points[0].y); + for (var i = 0; i < len; i++) { + point = this.points[i]; + ctx.lineTo(point.x, point.y); + } + return true; + }, + _renderDashedStroke: function(ctx) { + fabric.Polyline.prototype._renderDashedStroke.call(this, ctx); + ctx.closePath(); + }, + complexity: function() { + return this.points.length; + } + }); + fabric.Polygon.ATTRIBUTE_NAMES = fabric.SHARED_ATTRIBUTES.concat(); + fabric.Polygon.fromElement = function(element, options) { + if (!element) { + return null; + } + options || (options = {}); + var points = fabric.parsePointsAttribute(element.getAttribute("points")), parsedAttributes = fabric.parseAttributes(element, fabric.Polygon.ATTRIBUTE_NAMES); + return new fabric.Polygon(points, extend(parsedAttributes, options)); + }; + fabric.Polygon.fromObject = function(object, callback) { + var polygon = new fabric.Polygon(object.points, object); + callback && callback(polygon); + return polygon; + }; +})(typeof exports !== "undefined" ? exports : this); + +(function(global) { + "use strict"; + var fabric = global.fabric || (global.fabric = {}), min = fabric.util.array.min, max = fabric.util.array.max, extend = fabric.util.object.extend, _toString = Object.prototype.toString, drawArc = fabric.util.drawArc, commandLengths = { + m: 2, + l: 2, + h: 1, + v: 1, + c: 6, + s: 4, + q: 4, + t: 2, + a: 7 + }, repeatedCommands = { + m: "l", + M: "L" + }; + if (fabric.Path) { + fabric.warn("fabric.Path is already defined"); + return; + } + fabric.Path = fabric.util.createClass(fabric.Object, { + type: "path", + path: null, + minX: 0, + minY: 0, + initialize: function(path, options) { + options = options || {}; + this.setOptions(options); + if (!path) { + path = []; + } + var fromArray = _toString.call(path) === "[object Array]"; + this.path = fromArray ? path : path.match && path.match(/[mzlhvcsqta][^mzlhvcsqta]*/gi); + if (!this.path) { + return; + } + if (!fromArray) { + this.path = this._parsePath(); + } + this._setPositionDimensions(options); + if (options.sourcePath) { + this.setSourcePath(options.sourcePath); + } + }, + _setPositionDimensions: function(options) { + var calcDim = this._parseDimensions(); + this.minX = calcDim.left; + this.minY = calcDim.top; + this.width = calcDim.width; + this.height = calcDim.height; + if (typeof options.left === "undefined") { + this.left = calcDim.left + (this.originX === "center" ? this.width / 2 : this.originX === "right" ? this.width : 0); + } + if (typeof options.top === "undefined") { + this.top = calcDim.top + (this.originY === "center" ? this.height / 2 : this.originY === "bottom" ? this.height : 0); + } + this.pathOffset = this.pathOffset || { + x: this.minX + this.width / 2, + y: this.minY + this.height / 2 + }; + }, + _renderPathCommands: function(ctx) { + var current, previous = null, subpathStartX = 0, subpathStartY = 0, x = 0, y = 0, controlX = 0, controlY = 0, tempX, tempY, l = -this.pathOffset.x, t = -this.pathOffset.y; + if (this.group && this.group.type === "path-group") { + l = 0; + t = 0; + } + ctx.beginPath(); + for (var i = 0, len = this.path.length; i < len; ++i) { + current = this.path[i]; + switch (current[0]) { + case "l": + x += current[1]; + y += current[2]; + ctx.lineTo(x + l, y + t); + break; + + case "L": + x = current[1]; + y = current[2]; + ctx.lineTo(x + l, y + t); + break; + + case "h": + x += current[1]; + ctx.lineTo(x + l, y + t); + break; + + case "H": + x = current[1]; + ctx.lineTo(x + l, y + t); + break; + + case "v": + y += current[1]; + ctx.lineTo(x + l, y + t); + break; + + case "V": + y = current[1]; + ctx.lineTo(x + l, y + t); + break; + + case "m": + x += current[1]; + y += current[2]; + subpathStartX = x; + subpathStartY = y; + ctx.moveTo(x + l, y + t); + break; + + case "M": + x = current[1]; + y = current[2]; + subpathStartX = x; + subpathStartY = y; + ctx.moveTo(x + l, y + t); + break; + + case "c": + tempX = x + current[5]; + tempY = y + current[6]; + controlX = x + current[3]; + controlY = y + current[4]; + ctx.bezierCurveTo(x + current[1] + l, y + current[2] + t, controlX + l, controlY + t, tempX + l, tempY + t); + x = tempX; + y = tempY; + break; + + case "C": + x = current[5]; + y = current[6]; + controlX = current[3]; + controlY = current[4]; + ctx.bezierCurveTo(current[1] + l, current[2] + t, controlX + l, controlY + t, x + l, y + t); + break; + + case "s": + tempX = x + current[3]; + tempY = y + current[4]; + if (previous[0].match(/[CcSs]/) === null) { + controlX = x; + controlY = y; + } else { + controlX = 2 * x - controlX; + controlY = 2 * y - controlY; + } + ctx.bezierCurveTo(controlX + l, controlY + t, x + current[1] + l, y + current[2] + t, tempX + l, tempY + t); + controlX = x + current[1]; + controlY = y + current[2]; + x = tempX; + y = tempY; + break; + + case "S": + tempX = current[3]; + tempY = current[4]; + if (previous[0].match(/[CcSs]/) === null) { + controlX = x; + controlY = y; + } else { + controlX = 2 * x - controlX; + controlY = 2 * y - controlY; + } + ctx.bezierCurveTo(controlX + l, controlY + t, current[1] + l, current[2] + t, tempX + l, tempY + t); + x = tempX; + y = tempY; + controlX = current[1]; + controlY = current[2]; + break; + + case "q": + tempX = x + current[3]; + tempY = y + current[4]; + controlX = x + current[1]; + controlY = y + current[2]; + ctx.quadraticCurveTo(controlX + l, controlY + t, tempX + l, tempY + t); + x = tempX; + y = tempY; + break; + + case "Q": + tempX = current[3]; + tempY = current[4]; + ctx.quadraticCurveTo(current[1] + l, current[2] + t, tempX + l, tempY + t); + x = tempX; + y = tempY; + controlX = current[1]; + controlY = current[2]; + break; + + case "t": + tempX = x + current[1]; + tempY = y + current[2]; + if (previous[0].match(/[QqTt]/) === null) { + controlX = x; + controlY = y; + } else { + controlX = 2 * x - controlX; + controlY = 2 * y - controlY; + } + ctx.quadraticCurveTo(controlX + l, controlY + t, tempX + l, tempY + t); + x = tempX; + y = tempY; + break; + + case "T": + tempX = current[1]; + tempY = current[2]; + if (previous[0].match(/[QqTt]/) === null) { + controlX = x; + controlY = y; + } else { + controlX = 2 * x - controlX; + controlY = 2 * y - controlY; + } + ctx.quadraticCurveTo(controlX + l, controlY + t, tempX + l, tempY + t); + x = tempX; + y = tempY; + break; + + case "a": + drawArc(ctx, x + l, y + t, [ current[1], current[2], current[3], current[4], current[5], current[6] + x + l, current[7] + y + t ]); + x += current[6]; + y += current[7]; + break; + + case "A": + drawArc(ctx, x + l, y + t, [ current[1], current[2], current[3], current[4], current[5], current[6] + l, current[7] + t ]); + x = current[6]; + y = current[7]; + break; + + case "z": + case "Z": + x = subpathStartX; + y = subpathStartY; + ctx.closePath(); + break; + } + previous = current; + } + }, + _render: function(ctx) { + this._renderPathCommands(ctx); + this._renderFill(ctx); + this._renderStroke(ctx); + }, + toString: function() { + return "#"; + }, + toObject: function(propertiesToInclude) { + var o = extend(this.callSuper("toObject", propertiesToInclude), { + path: this.path.map(function(item) { + return item.slice(); + }), + pathOffset: this.pathOffset + }); + if (this.sourcePath) { + o.sourcePath = this.sourcePath; + } + if (this.transformMatrix) { + o.transformMatrix = this.transformMatrix; + } + return o; + }, + toDatalessObject: function(propertiesToInclude) { + var o = this.toObject(propertiesToInclude); + if (this.sourcePath) { + o.path = this.sourcePath; + } + delete o.sourcePath; + return o; + }, + toSVG: function(reviver) { + var chunks = [], markup = this._createBaseSVGMarkup(), addTransform = ""; + for (var i = 0, len = this.path.length; i < len; i++) { + chunks.push(this.path[i].join(" ")); + } + var path = chunks.join(" "); + if (!(this.group && this.group.type === "path-group")) { + addTransform = " translate(" + -this.pathOffset.x + ", " + -this.pathOffset.y + ") "; + } + markup.push("\n"); + return reviver ? reviver(markup.join("")) : markup.join(""); + }, + complexity: function() { + return this.path.length; + }, + _parsePath: function() { + var result = [], coords = [], currentPath, parsed, re = /([-+]?((\d+\.\d+)|((\d+)|(\.\d+)))(?:e[-+]?\d+)?)/gi, match, coordsStr; + for (var i = 0, coordsParsed, len = this.path.length; i < len; i++) { + currentPath = this.path[i]; + coordsStr = currentPath.slice(1).trim(); + coords.length = 0; + while (match = re.exec(coordsStr)) { + coords.push(match[0]); + } + coordsParsed = [ currentPath.charAt(0) ]; + for (var j = 0, jlen = coords.length; j < jlen; j++) { + parsed = parseFloat(coords[j]); + if (!isNaN(parsed)) { + coordsParsed.push(parsed); + } + } + var command = coordsParsed[0], commandLength = commandLengths[command.toLowerCase()], repeatedCommand = repeatedCommands[command] || command; + if (coordsParsed.length - 1 > commandLength) { + for (var k = 1, klen = coordsParsed.length; k < klen; k += commandLength) { + result.push([ command ].concat(coordsParsed.slice(k, k + commandLength))); + command = repeatedCommand; + } + } else { + result.push(coordsParsed); + } + } + return result; + }, + _parseDimensions: function() { + var aX = [], aY = [], current, previous = null, subpathStartX = 0, subpathStartY = 0, x = 0, y = 0, controlX = 0, controlY = 0, tempX, tempY, bounds; + for (var i = 0, len = this.path.length; i < len; ++i) { + current = this.path[i]; + switch (current[0]) { + case "l": + x += current[1]; + y += current[2]; + bounds = []; + break; + + case "L": + x = current[1]; + y = current[2]; + bounds = []; + break; + + case "h": + x += current[1]; + bounds = []; + break; + + case "H": + x = current[1]; + bounds = []; + break; + + case "v": + y += current[1]; + bounds = []; + break; + + case "V": + y = current[1]; + bounds = []; + break; + + case "m": + x += current[1]; + y += current[2]; + subpathStartX = x; + subpathStartY = y; + bounds = []; + break; + + case "M": + x = current[1]; + y = current[2]; + subpathStartX = x; + subpathStartY = y; + bounds = []; + break; + + case "c": + tempX = x + current[5]; + tempY = y + current[6]; + controlX = x + current[3]; + controlY = y + current[4]; + bounds = fabric.util.getBoundsOfCurve(x, y, x + current[1], y + current[2], controlX, controlY, tempX, tempY); + x = tempX; + y = tempY; + break; + + case "C": + x = current[5]; + y = current[6]; + controlX = current[3]; + controlY = current[4]; + bounds = fabric.util.getBoundsOfCurve(x, y, current[1], current[2], controlX, controlY, x, y); + break; + + case "s": + tempX = x + current[3]; + tempY = y + current[4]; + if (previous[0].match(/[CcSs]/) === null) { + controlX = x; + controlY = y; + } else { + controlX = 2 * x - controlX; + controlY = 2 * y - controlY; + } + bounds = fabric.util.getBoundsOfCurve(x, y, controlX, controlY, x + current[1], y + current[2], tempX, tempY); + controlX = x + current[1]; + controlY = y + current[2]; + x = tempX; + y = tempY; + break; + + case "S": + tempX = current[3]; + tempY = current[4]; + if (previous[0].match(/[CcSs]/) === null) { + controlX = x; + controlY = y; + } else { + controlX = 2 * x - controlX; + controlY = 2 * y - controlY; + } + bounds = fabric.util.getBoundsOfCurve(x, y, controlX, controlY, current[1], current[2], tempX, tempY); + x = tempX; + y = tempY; + controlX = current[1]; + controlY = current[2]; + break; + + case "q": + tempX = x + current[3]; + tempY = y + current[4]; + controlX = x + current[1]; + controlY = y + current[2]; + bounds = fabric.util.getBoundsOfCurve(x, y, controlX, controlY, controlX, controlY, tempX, tempY); + x = tempX; + y = tempY; + break; + + case "Q": + controlX = current[1]; + controlY = current[2]; + bounds = fabric.util.getBoundsOfCurve(x, y, controlX, controlY, controlX, controlY, current[3], current[4]); + x = current[3]; + y = current[4]; + break; + + case "t": + tempX = x + current[1]; + tempY = y + current[2]; + if (previous[0].match(/[QqTt]/) === null) { + controlX = x; + controlY = y; + } else { + controlX = 2 * x - controlX; + controlY = 2 * y - controlY; + } + bounds = fabric.util.getBoundsOfCurve(x, y, controlX, controlY, controlX, controlY, tempX, tempY); + x = tempX; + y = tempY; + break; + + case "T": + tempX = current[1]; + tempY = current[2]; + if (previous[0].match(/[QqTt]/) === null) { + controlX = x; + controlY = y; + } else { + controlX = 2 * x - controlX; + controlY = 2 * y - controlY; + } + bounds = fabric.util.getBoundsOfCurve(x, y, controlX, controlY, controlX, controlY, tempX, tempY); + x = tempX; + y = tempY; + break; + + case "a": + bounds = fabric.util.getBoundsOfArc(x, y, current[1], current[2], current[3], current[4], current[5], current[6] + x, current[7] + y); + x += current[6]; + y += current[7]; + break; + + case "A": + bounds = fabric.util.getBoundsOfArc(x, y, current[1], current[2], current[3], current[4], current[5], current[6], current[7]); + x = current[6]; + y = current[7]; + break; + + case "z": + case "Z": + x = subpathStartX; + y = subpathStartY; + break; + } + previous = current; + bounds.forEach(function(point) { + aX.push(point.x); + aY.push(point.y); + }); + aX.push(x); + aY.push(y); + } + var minX = min(aX) || 0, minY = min(aY) || 0, maxX = max(aX) || 0, maxY = max(aY) || 0, deltaX = maxX - minX, deltaY = maxY - minY, o = { + left: minX, + top: minY, + width: deltaX, + height: deltaY + }; + return o; + } + }); + fabric.Path.fromObject = function(object, callback) { + var path; + if (typeof object.path === "string") { + fabric.loadSVGFromURL(object.path, function(elements) { + var pathUrl = object.path; + path = elements[0]; + delete object.path; + fabric.util.object.extend(path, object); + path.setSourcePath(pathUrl); + callback && callback(path); + }); + } else { + path = new fabric.Path(object.path, object); + callback && callback(path); + return path; + } + }; + fabric.Path.ATTRIBUTE_NAMES = fabric.SHARED_ATTRIBUTES.concat([ "d" ]); + fabric.Path.fromElement = function(element, callback, options) { + var parsedAttributes = fabric.parseAttributes(element, fabric.Path.ATTRIBUTE_NAMES); + callback && callback(new fabric.Path(parsedAttributes.d, extend(parsedAttributes, options))); + }; + fabric.Path.async = true; +})(typeof exports !== "undefined" ? exports : this); + +(function(global) { + "use strict"; + var fabric = global.fabric || (global.fabric = {}), extend = fabric.util.object.extend, invoke = fabric.util.array.invoke, parentToObject = fabric.Object.prototype.toObject; + if (fabric.PathGroup) { + fabric.warn("fabric.PathGroup is already defined"); + return; + } + fabric.PathGroup = fabric.util.createClass(fabric.Path, { + type: "path-group", + fill: "", + initialize: function(paths, options) { + options = options || {}; + this.paths = paths || []; + for (var i = this.paths.length; i--; ) { + this.paths[i].group = this; + } + if (options.toBeParsed) { + this.parseDimensionsFromPaths(options); + delete options.toBeParsed; + } + this.setOptions(options); + this.setCoords(); + if (options.sourcePath) { + this.setSourcePath(options.sourcePath); + } + }, + parseDimensionsFromPaths: function(options) { + var points, p, xC = [], yC = [], path, height, width, m; + for (var j = this.paths.length; j--; ) { + path = this.paths[j]; + height = path.height + path.strokeWidth; + width = path.width + path.strokeWidth; + points = [ { + x: path.left, + y: path.top + }, { + x: path.left + width, + y: path.top + }, { + x: path.left, + y: path.top + height + }, { + x: path.left + width, + y: path.top + height + } ]; + m = this.paths[j].transformMatrix; + for (var i = 0; i < points.length; i++) { + p = points[i]; + if (m) { + p = fabric.util.transformPoint(p, m, false); + } + xC.push(p.x); + yC.push(p.y); + } + } + options.width = Math.max.apply(null, xC); + options.height = Math.max.apply(null, yC); + }, + render: function(ctx) { + if (!this.visible) { + return; + } + ctx.save(); + if (this.transformMatrix) { + ctx.transform.apply(ctx, this.transformMatrix); + } + this.transform(ctx); + this._setShadow(ctx); + this.clipTo && fabric.util.clipContext(this, ctx); + ctx.translate(-this.width / 2, -this.height / 2); + for (var i = 0, l = this.paths.length; i < l; ++i) { + this.paths[i].render(ctx, true); + } + this.clipTo && ctx.restore(); + ctx.restore(); + }, + _set: function(prop, value) { + if (prop === "fill" && value && this.isSameColor()) { + var i = this.paths.length; + while (i--) { + this.paths[i]._set(prop, value); + } + } + return this.callSuper("_set", prop, value); + }, + toObject: function(propertiesToInclude) { + var o = extend(parentToObject.call(this, propertiesToInclude), { + paths: invoke(this.getObjects(), "toObject", propertiesToInclude) + }); + if (this.sourcePath) { + o.sourcePath = this.sourcePath; + } + return o; + }, + toDatalessObject: function(propertiesToInclude) { + var o = this.toObject(propertiesToInclude); + if (this.sourcePath) { + o.paths = this.sourcePath; + } + return o; + }, + toSVG: function(reviver) { + var objects = this.getObjects(), p = this.getPointByOrigin("left", "top"), translatePart = "translate(" + p.x + " " + p.y + ")", markup = this._createBaseSVGMarkup(); + markup.push("\n"); + for (var i = 0, len = objects.length; i < len; i++) { + markup.push("\t", objects[i].toSVG(reviver)); + } + markup.push("\n"); + return reviver ? reviver(markup.join("")) : markup.join(""); + }, + toString: function() { + return "#"; + }, + isSameColor: function() { + var firstPathFill = this.getObjects()[0].get("fill") || ""; + if (typeof firstPathFill !== "string") { + return false; + } + firstPathFill = firstPathFill.toLowerCase(); + return this.getObjects().every(function(path) { + var pathFill = path.get("fill") || ""; + return typeof pathFill === "string" && pathFill.toLowerCase() === firstPathFill; + }); + }, + complexity: function() { + return this.paths.reduce(function(total, path) { + return total + (path && path.complexity ? path.complexity() : 0); + }, 0); + }, + getObjects: function() { + return this.paths; + } + }); + fabric.PathGroup.fromObject = function(object, callback) { + if (typeof object.paths === "string") { + fabric.loadSVGFromURL(object.paths, function(elements) { + var pathUrl = object.paths; + delete object.paths; + var pathGroup = fabric.util.groupSVGElements(elements, object, pathUrl); + callback(pathGroup); + }); + } else { + fabric.util.enlivenObjects(object.paths, function(enlivenedObjects) { + delete object.paths; + callback(new fabric.PathGroup(enlivenedObjects, object)); + }); + } + }; + fabric.PathGroup.async = true; +})(typeof exports !== "undefined" ? exports : this); + +(function(global) { + "use strict"; + var fabric = global.fabric || (global.fabric = {}), extend = fabric.util.object.extend, min = fabric.util.array.min, max = fabric.util.array.max, invoke = fabric.util.array.invoke; + if (fabric.Group) { + return; + } + var _lockProperties = { + lockMovementX: true, + lockMovementY: true, + lockRotation: true, + lockScalingX: true, + lockScalingY: true, + lockUniScaling: true + }; + fabric.Group = fabric.util.createClass(fabric.Object, fabric.Collection, { + type: "group", + strokeWidth: 0, + subTargetCheck: false, + initialize: function(objects, options, isAlreadyGrouped) { + options = options || {}; + this._objects = []; + isAlreadyGrouped && this.callSuper("initialize", options); + this._objects = objects || []; + for (var i = this._objects.length; i--; ) { + this._objects[i].group = this; + } + this.originalState = {}; + if (options.originX) { + this.originX = options.originX; + } + if (options.originY) { + this.originY = options.originY; + } + if (isAlreadyGrouped) { + this._updateObjectsCoords(true); + } else { + this._calcBounds(); + this._updateObjectsCoords(); + this.callSuper("initialize", options); + } + this.setCoords(); + this.saveCoords(); + }, + _updateObjectsCoords: function(skipCoordsChange) { + for (var i = this._objects.length; i--; ) { + this._updateObjectCoords(this._objects[i], skipCoordsChange); + } + }, + _updateObjectCoords: function(object, skipCoordsChange) { + object.__origHasControls = object.hasControls; + object.hasControls = false; + if (skipCoordsChange) { + return; + } + var objectLeft = object.getLeft(), objectTop = object.getTop(), center = this.getCenterPoint(); + object.set({ + originalLeft: objectLeft, + originalTop: objectTop, + left: objectLeft - center.x, + top: objectTop - center.y + }); + object.setCoords(); + }, + toString: function() { + return "#"; + }, + addWithUpdate: function(object) { + this._restoreObjectsState(); + fabric.util.resetObjectTransform(this); + if (object) { + this._objects.push(object); + object.group = this; + object._set("canvas", this.canvas); + } + this.forEachObject(this._setObjectActive, this); + this._calcBounds(); + this._updateObjectsCoords(); + return this; + }, + _setObjectActive: function(object) { + object.set("active", true); + object.group = this; + }, + removeWithUpdate: function(object) { + this._restoreObjectsState(); + fabric.util.resetObjectTransform(this); + this.forEachObject(this._setObjectActive, this); + this.remove(object); + this._calcBounds(); + this._updateObjectsCoords(); + return this; + }, + _onObjectAdded: function(object) { + object.group = this; + object._set("canvas", this.canvas); + }, + _onObjectRemoved: function(object) { + delete object.group; + object.set("active", false); + }, + delegatedProperties: { + fill: true, + stroke: true, + strokeWidth: true, + fontFamily: true, + fontWeight: true, + fontSize: true, + fontStyle: true, + lineHeight: true, + textDecoration: true, + textAlign: true, + backgroundColor: true + }, + _set: function(key, value) { + var i = this._objects.length; + if (this.delegatedProperties[key] || key === "canvas") { + while (i--) { + this._objects[i].set(key, value); + } + } else { + while (i--) { + this._objects[i].setOnGroup(key, value); + } + } + this.callSuper("_set", key, value); + }, + toObject: function(propertiesToInclude) { + return extend(this.callSuper("toObject", propertiesToInclude), { + objects: invoke(this._objects, "toObject", propertiesToInclude) + }); + }, + render: function(ctx) { + if (!this.visible) { + return; + } + ctx.save(); + if (this.transformMatrix) { + ctx.transform.apply(ctx, this.transformMatrix); + } + this.transform(ctx); + this._setShadow(ctx); + this.clipTo && fabric.util.clipContext(this, ctx); + this._transformDone = true; + for (var i = 0, len = this._objects.length; i < len; i++) { + this._renderObject(this._objects[i], ctx); + } + this.clipTo && ctx.restore(); + ctx.restore(); + this._transformDone = false; + }, + _renderControls: function(ctx, noTransform) { + this.callSuper("_renderControls", ctx, noTransform); + for (var i = 0, len = this._objects.length; i < len; i++) { + this._objects[i]._renderControls(ctx); + } + }, + _renderObject: function(object, ctx) { + if (!object.visible) { + return; + } + var originalHasRotatingPoint = object.hasRotatingPoint; + object.hasRotatingPoint = false; + object.render(ctx); + object.hasRotatingPoint = originalHasRotatingPoint; + }, + _restoreObjectsState: function() { + this._objects.forEach(this._restoreObjectState, this); + return this; + }, + realizeTransform: function(object) { + var matrix = object.calcTransformMatrix(), options = fabric.util.qrDecompose(matrix), center = new fabric.Point(options.translateX, options.translateY); + object.scaleX = options.scaleX; + object.scaleY = options.scaleY; + object.skewX = options.skewX; + object.skewY = options.skewY; + object.angle = options.angle; + object.flipX = false; + object.flipY = false; + object.setPositionByOrigin(center, "center", "center"); + return object; + }, + _restoreObjectState: function(object) { + this.realizeTransform(object); + object.setCoords(); + object.hasControls = object.__origHasControls; + delete object.__origHasControls; + object.set("active", false); + delete object.group; + return this; + }, + destroy: function() { + return this._restoreObjectsState(); + }, + saveCoords: function() { + this._originalLeft = this.get("left"); + this._originalTop = this.get("top"); + return this; + }, + hasMoved: function() { + return this._originalLeft !== this.get("left") || this._originalTop !== this.get("top"); + }, + setObjectsCoords: function() { + this.forEachObject(function(object) { + object.setCoords(); + }); + return this; + }, + _calcBounds: function(onlyWidthHeight) { + var aX = [], aY = [], o, prop, props = [ "tr", "br", "bl", "tl" ], i = 0, iLen = this._objects.length, j, jLen = props.length; + for (;i < iLen; ++i) { + o = this._objects[i]; + o.setCoords(); + for (j = 0; j < jLen; j++) { + prop = props[j]; + aX.push(o.oCoords[prop].x); + aY.push(o.oCoords[prop].y); + } + } + this.set(this._getBounds(aX, aY, onlyWidthHeight)); + }, + _getBounds: function(aX, aY, onlyWidthHeight) { + var ivt = fabric.util.invertTransform(this.getViewportTransform()), minXY = fabric.util.transformPoint(new fabric.Point(min(aX), min(aY)), ivt), maxXY = fabric.util.transformPoint(new fabric.Point(max(aX), max(aY)), ivt), obj = { + width: maxXY.x - minXY.x || 0, + height: maxXY.y - minXY.y || 0 + }; + if (!onlyWidthHeight) { + obj.left = minXY.x || 0; + obj.top = minXY.y || 0; + if (this.originX === "center") { + obj.left += obj.width / 2; + } + if (this.originX === "right") { + obj.left += obj.width; + } + if (this.originY === "center") { + obj.top += obj.height / 2; + } + if (this.originY === "bottom") { + obj.top += obj.height; + } + } + return obj; + }, + toSVG: function(reviver) { + var markup = this._createBaseSVGMarkup(); + markup.push("\n'); + for (var i = 0, len = this._objects.length; i < len; i++) { + markup.push("\t", this._objects[i].toSVG(reviver)); + } + markup.push("\n"); + return reviver ? reviver(markup.join("")) : markup.join(""); + }, + get: function(prop) { + if (prop in _lockProperties) { + if (this[prop]) { + return this[prop]; + } else { + for (var i = 0, len = this._objects.length; i < len; i++) { + if (this._objects[i][prop]) { + return true; + } + } + return false; + } + } else { + if (prop in this.delegatedProperties) { + return this._objects[0] && this._objects[0].get(prop); + } + return this[prop]; + } + } + }); + fabric.Group.fromObject = function(object, callback) { + fabric.util.enlivenObjects(object.objects, function(enlivenedObjects) { + delete object.objects; + callback && callback(new fabric.Group(enlivenedObjects, object, true)); + }); + }; + fabric.Group.async = true; +})(typeof exports !== "undefined" ? exports : this); + +(function(global) { + "use strict"; + var extend = fabric.util.object.extend; + if (!global.fabric) { + global.fabric = {}; + } + if (global.fabric.Image) { + fabric.warn("fabric.Image is already defined."); + return; + } + var stateProperties = fabric.Object.prototype.stateProperties.concat(); + stateProperties.push("alignX", "alignY", "meetOrSlice"); + fabric.Image = fabric.util.createClass(fabric.Object, { + type: "image", + crossOrigin: "", + alignX: "none", + alignY: "none", + meetOrSlice: "meet", + strokeWidth: 0, + _lastScaleX: 1, + _lastScaleY: 1, + minimumScaleTrigger: .5, + stateProperties: stateProperties, + initialize: function(element, options, callback) { + options || (options = {}); + this.filters = []; + this.resizeFilters = []; + this.callSuper("initialize", options); + this._initElement(element, options, callback); + }, + getElement: function() { + return this._element; + }, + setElement: function(element, callback, options) { + var _callback, _this; + this._element = element; + this._originalElement = element; + this._initConfig(options); + if (this.resizeFilters.length === 0) { + _callback = callback; + } else { + _this = this; + _callback = function() { + _this.applyFilters(callback, _this.resizeFilters, _this._filteredEl || _this._originalElement, true); + }; + } + if (this.filters.length !== 0) { + this.applyFilters(_callback); + } else if (_callback) { + _callback(this); + } + return this; + }, + setCrossOrigin: function(value) { + this.crossOrigin = value; + this._element.crossOrigin = value; + return this; + }, + getOriginalSize: function() { + var element = this.getElement(); + return { + width: element.width, + height: element.height + }; + }, + _stroke: function(ctx) { + if (!this.stroke || this.strokeWidth === 0) { + return; + } + var w = this.width / 2, h = this.height / 2; + ctx.beginPath(); + ctx.moveTo(-w, -h); + ctx.lineTo(w, -h); + ctx.lineTo(w, h); + ctx.lineTo(-w, h); + ctx.lineTo(-w, -h); + ctx.closePath(); + }, + _renderDashedStroke: function(ctx) { + var x = -this.width / 2, y = -this.height / 2, w = this.width, h = this.height; + ctx.save(); + this._setStrokeStyles(ctx); + ctx.beginPath(); + fabric.util.drawDashedLine(ctx, x, y, x + w, y, this.strokeDashArray); + fabric.util.drawDashedLine(ctx, x + w, y, x + w, y + h, this.strokeDashArray); + fabric.util.drawDashedLine(ctx, x + w, y + h, x, y + h, this.strokeDashArray); + fabric.util.drawDashedLine(ctx, x, y + h, x, y, this.strokeDashArray); + ctx.closePath(); + ctx.restore(); + }, + toObject: function(propertiesToInclude) { + var filters = [], resizeFilters = [], scaleX = 1, scaleY = 1; + this.filters.forEach(function(filterObj) { + if (filterObj) { + if (filterObj.type === "Resize") { + scaleX *= filterObj.scaleX; + scaleY *= filterObj.scaleY; + } + filters.push(filterObj.toObject()); + } + }); + this.resizeFilters.forEach(function(filterObj) { + filterObj && resizeFilters.push(filterObj.toObject()); + }); + var object = extend(this.callSuper("toObject", propertiesToInclude), { + src: this.getSrc(), + filters: filters, + resizeFilters: resizeFilters, + crossOrigin: this.crossOrigin, + alignX: this.alignX, + alignY: this.alignY, + meetOrSlice: this.meetOrSlice + }); + object.width /= scaleX; + object.height /= scaleY; + if (!this.includeDefaultValues) { + this._removeDefaultValues(object); + } + return object; + }, + toSVG: function(reviver) { + var markup = this._createBaseSVGMarkup(), x = -this.width / 2, y = -this.height / 2, preserveAspectRatio = "none", filtered = true; + if (this.group && this.group.type === "path-group") { + x = this.left; + y = this.top; + } + if (this.alignX !== "none" && this.alignY !== "none") { + preserveAspectRatio = "x" + this.alignX + "Y" + this.alignY + " " + this.meetOrSlice; + } + markup.push('\n', "\n"); + if (this.stroke || this.strokeDashArray) { + var origFill = this.fill; + this.fill = null; + markup.push("\n'); + this.fill = origFill; + } + markup.push("\n"); + return reviver ? reviver(markup.join("")) : markup.join(""); + }, + getSrc: function(filtered) { + var element = filtered ? this._element : this._originalElement; + if (element) { + return fabric.isLikelyNode ? element._src : element.src; + } else { + return this.src || ""; + } + }, + setSrc: function(src, callback, options) { + fabric.util.loadImage(src, function(img) { + return this.setElement(img, callback, options); + }, this, options && options.crossOrigin); + }, + toString: function() { + return '#'; + }, + applyFilters: function(callback, filters, imgElement, forResizing) { + filters = filters || this.filters; + imgElement = imgElement || this._originalElement; + if (!imgElement) { + return; + } + var replacement = fabric.util.createImage(), retinaScaling = this.canvas ? this.canvas.getRetinaScaling() : fabric.devicePixelRatio, minimumScale = this.minimumScaleTrigger / retinaScaling, _this = this, scaleX, scaleY; + if (filters.length === 0) { + this._element = imgElement; + callback && callback(this); + return imgElement; + } + var canvasEl = fabric.util.createCanvasElement(); + canvasEl.width = imgElement.width; + canvasEl.height = imgElement.height; + canvasEl.getContext("2d").drawImage(imgElement, 0, 0, imgElement.width, imgElement.height); + filters.forEach(function(filter) { + if (!filter) { + return; + } + if (forResizing) { + scaleX = _this.scaleX < minimumScale ? _this.scaleX : 1; + scaleY = _this.scaleY < minimumScale ? _this.scaleY : 1; + if (scaleX * retinaScaling < 1) { + scaleX *= retinaScaling; + } + if (scaleY * retinaScaling < 1) { + scaleY *= retinaScaling; + } + } else { + scaleX = filter.scaleX; + scaleY = filter.scaleY; + } + filter.applyTo(canvasEl, scaleX, scaleY); + if (!forResizing && filter.type === "Resize") { + _this.width *= filter.scaleX; + _this.height *= filter.scaleY; + } + }); + replacement.width = canvasEl.width; + replacement.height = canvasEl.height; + if (fabric.isLikelyNode) { + replacement.src = canvasEl.toBuffer(undefined, fabric.Image.pngCompression); + _this._element = replacement; + !forResizing && (_this._filteredEl = replacement); + callback && callback(_this); + } else { + replacement.onload = function() { + _this._element = replacement; + !forResizing && (_this._filteredEl = replacement); + callback && callback(_this); + replacement.onload = canvasEl = null; + }; + replacement.src = canvasEl.toDataURL("image/png"); + } + return canvasEl; + }, + _render: function(ctx, noTransform) { + var x, y, imageMargins = this._findMargins(), elementToDraw; + x = noTransform ? this.left : -this.width / 2; + y = noTransform ? this.top : -this.height / 2; + if (this.meetOrSlice === "slice") { + ctx.beginPath(); + ctx.rect(x, y, this.width, this.height); + ctx.clip(); + } + if (this.isMoving === false && this.resizeFilters.length && this._needsResize()) { + this._lastScaleX = this.scaleX; + this._lastScaleY = this.scaleY; + elementToDraw = this.applyFilters(null, this.resizeFilters, this._filteredEl || this._originalElement, true); + } else { + elementToDraw = this._element; + } + elementToDraw && ctx.drawImage(elementToDraw, x + imageMargins.marginX, y + imageMargins.marginY, imageMargins.width, imageMargins.height); + this._stroke(ctx); + this._renderStroke(ctx); + }, + _needsResize: function() { + return this.scaleX !== this._lastScaleX || this.scaleY !== this._lastScaleY; + }, + _findMargins: function() { + var width = this.width, height = this.height, scales, scale, marginX = 0, marginY = 0; + if (this.alignX !== "none" || this.alignY !== "none") { + scales = [ this.width / this._element.width, this.height / this._element.height ]; + scale = this.meetOrSlice === "meet" ? Math.min.apply(null, scales) : Math.max.apply(null, scales); + width = this._element.width * scale; + height = this._element.height * scale; + if (this.alignX === "Mid") { + marginX = (this.width - width) / 2; + } + if (this.alignX === "Max") { + marginX = this.width - width; + } + if (this.alignY === "Mid") { + marginY = (this.height - height) / 2; + } + if (this.alignY === "Max") { + marginY = this.height - height; + } + } + return { + width: width, + height: height, + marginX: marginX, + marginY: marginY + }; + }, + _resetWidthHeight: function() { + var element = this.getElement(); + this.set("width", element.width); + this.set("height", element.height); + }, + _initElement: function(element, options, callback) { + this.setElement(fabric.util.getById(element), callback, options); + fabric.util.addClass(this.getElement(), fabric.Image.CSS_CANVAS); + }, + _initConfig: function(options) { + options || (options = {}); + this.setOptions(options); + this._setWidthHeight(options); + if (this._element && this.crossOrigin) { + this._element.crossOrigin = this.crossOrigin; + } + }, + _initFilters: function(filters, callback) { + if (filters && filters.length) { + fabric.util.enlivenObjects(filters, function(enlivenedObjects) { + callback && callback(enlivenedObjects); + }, "fabric.Image.filters"); + } else { + callback && callback(); + } + }, + _setWidthHeight: function(options) { + this.width = "width" in options ? options.width : this.getElement() ? this.getElement().width || 0 : 0; + this.height = "height" in options ? options.height : this.getElement() ? this.getElement().height || 0 : 0; + }, + complexity: function() { + return 1; + } + }); + fabric.Image.CSS_CANVAS = "canvas-img"; + fabric.Image.prototype.getSvgSrc = fabric.Image.prototype.getSrc; + fabric.Image.fromObject = function(object, callback) { + fabric.util.loadImage(object.src, function(img) { + fabric.Image.prototype._initFilters.call(object, object.filters, function(filters) { + object.filters = filters || []; + fabric.Image.prototype._initFilters.call(object, object.resizeFilters, function(resizeFilters) { + object.resizeFilters = resizeFilters || []; + return new fabric.Image(img, object, callback); + }); + }); + }, null, object.crossOrigin); + }; + fabric.Image.fromURL = function(url, callback, imgOptions) { + fabric.util.loadImage(url, function(img) { + callback && callback(new fabric.Image(img, imgOptions)); + }, null, imgOptions && imgOptions.crossOrigin); + }; + fabric.Image.ATTRIBUTE_NAMES = fabric.SHARED_ATTRIBUTES.concat("x y width height preserveAspectRatio xlink:href".split(" ")); + fabric.Image.fromElement = function(element, callback, options) { + var parsedAttributes = fabric.parseAttributes(element, fabric.Image.ATTRIBUTE_NAMES), preserveAR; + if (parsedAttributes.preserveAspectRatio) { + preserveAR = fabric.util.parsePreserveAspectRatioAttribute(parsedAttributes.preserveAspectRatio); + extend(parsedAttributes, preserveAR); + } + fabric.Image.fromURL(parsedAttributes["xlink:href"], callback, extend(options ? fabric.util.object.clone(options) : {}, parsedAttributes)); + }; + fabric.Image.async = true; + fabric.Image.pngCompression = 1; +})(typeof exports !== "undefined" ? exports : this); + +fabric.util.object.extend(fabric.Object.prototype, { + _getAngleValueForStraighten: function() { + var angle = this.getAngle() % 360; + if (angle > 0) { + return Math.round((angle - 1) / 90) * 90; + } + return Math.round(angle / 90) * 90; + }, + straighten: function() { + this.setAngle(this._getAngleValueForStraighten()); + return this; + }, + fxStraighten: function(callbacks) { + callbacks = callbacks || {}; + var empty = function() {}, onComplete = callbacks.onComplete || empty, onChange = callbacks.onChange || empty, _this = this; + fabric.util.animate({ + startValue: this.get("angle"), + endValue: this._getAngleValueForStraighten(), + duration: this.FX_DURATION, + onChange: function(value) { + _this.setAngle(value); + onChange(); + }, + onComplete: function() { + _this.setCoords(); + onComplete(); + }, + onStart: function() { + _this.set("active", false); + } + }); + return this; + } +}); + +fabric.util.object.extend(fabric.StaticCanvas.prototype, { + straightenObject: function(object) { + object.straighten(); + this.renderAll(); + return this; + }, + fxStraightenObject: function(object) { + object.fxStraighten({ + onChange: this.renderAll.bind(this) + }); + return this; + } +}); + +fabric.Image.filters = fabric.Image.filters || {}; + +fabric.Image.filters.BaseFilter = fabric.util.createClass({ + type: "BaseFilter", + initialize: function(options) { + if (options) { + this.setOptions(options); + } + }, + setOptions: function(options) { + for (var prop in options) { + this[prop] = options[prop]; + } + }, + toObject: function() { + return { + type: this.type + }; + }, + toJSON: function() { + return this.toObject(); + } +}); + +(function(global) { + "use strict"; + var fabric = global.fabric || (global.fabric = {}), extend = fabric.util.object.extend, filters = fabric.Image.filters, createClass = fabric.util.createClass; + filters.Brightness = createClass(filters.BaseFilter, { + type: "Brightness", + initialize: function(options) { + options = options || {}; + this.brightness = options.brightness || 0; + }, + applyTo: function(canvasEl) { + var context = canvasEl.getContext("2d"), imageData = context.getImageData(0, 0, canvasEl.width, canvasEl.height), data = imageData.data, brightness = this.brightness; + for (var i = 0, len = data.length; i < len; i += 4) { + data[i] += brightness; + data[i + 1] += brightness; + data[i + 2] += brightness; + } + context.putImageData(imageData, 0, 0); + }, + toObject: function() { + return extend(this.callSuper("toObject"), { + brightness: this.brightness + }); + } + }); + fabric.Image.filters.Brightness.fromObject = function(object) { + return new fabric.Image.filters.Brightness(object); + }; +})(typeof exports !== "undefined" ? exports : this); + +(function(global) { + "use strict"; + var fabric = global.fabric || (global.fabric = {}), extend = fabric.util.object.extend, filters = fabric.Image.filters, createClass = fabric.util.createClass; + filters.Convolute = createClass(filters.BaseFilter, { + type: "Convolute", + initialize: function(options) { + options = options || {}; + this.opaque = options.opaque; + this.matrix = options.matrix || [ 0, 0, 0, 0, 1, 0, 0, 0, 0 ]; + }, + applyTo: function(canvasEl) { + var weights = this.matrix, context = canvasEl.getContext("2d"), pixels = context.getImageData(0, 0, canvasEl.width, canvasEl.height), side = Math.round(Math.sqrt(weights.length)), halfSide = Math.floor(side / 2), src = pixels.data, sw = pixels.width, sh = pixels.height, output = context.createImageData(sw, sh), dst = output.data, alphaFac = this.opaque ? 1 : 0, r, g, b, a, dstOff, scx, scy, srcOff, wt; + for (var y = 0; y < sh; y++) { + for (var x = 0; x < sw; x++) { + dstOff = (y * sw + x) * 4; + r = 0; + g = 0; + b = 0; + a = 0; + for (var cy = 0; cy < side; cy++) { + for (var cx = 0; cx < side; cx++) { + scy = y + cy - halfSide; + scx = x + cx - halfSide; + if (scy < 0 || scy > sh || scx < 0 || scx > sw) { + continue; + } + srcOff = (scy * sw + scx) * 4; + wt = weights[cy * side + cx]; + r += src[srcOff] * wt; + g += src[srcOff + 1] * wt; + b += src[srcOff + 2] * wt; + a += src[srcOff + 3] * wt; + } + } + dst[dstOff] = r; + dst[dstOff + 1] = g; + dst[dstOff + 2] = b; + dst[dstOff + 3] = a + alphaFac * (255 - a); + } + } + context.putImageData(output, 0, 0); + }, + toObject: function() { + return extend(this.callSuper("toObject"), { + opaque: this.opaque, + matrix: this.matrix + }); + } + }); + fabric.Image.filters.Convolute.fromObject = function(object) { + return new fabric.Image.filters.Convolute(object); + }; +})(typeof exports !== "undefined" ? exports : this); + +(function(global) { + "use strict"; + var fabric = global.fabric || (global.fabric = {}), extend = fabric.util.object.extend, filters = fabric.Image.filters, createClass = fabric.util.createClass; + filters.GradientTransparency = createClass(filters.BaseFilter, { + type: "GradientTransparency", + initialize: function(options) { + options = options || {}; + this.threshold = options.threshold || 100; + }, + applyTo: function(canvasEl) { + var context = canvasEl.getContext("2d"), imageData = context.getImageData(0, 0, canvasEl.width, canvasEl.height), data = imageData.data, threshold = this.threshold, total = data.length; + for (var i = 0, len = data.length; i < len; i += 4) { + data[i + 3] = threshold + 255 * (total - i) / total; + } + context.putImageData(imageData, 0, 0); + }, + toObject: function() { + return extend(this.callSuper("toObject"), { + threshold: this.threshold + }); + } + }); + fabric.Image.filters.GradientTransparency.fromObject = function(object) { + return new fabric.Image.filters.GradientTransparency(object); + }; +})(typeof exports !== "undefined" ? exports : this); + +(function(global) { + "use strict"; + var fabric = global.fabric || (global.fabric = {}), filters = fabric.Image.filters, createClass = fabric.util.createClass; + filters.Grayscale = createClass(filters.BaseFilter, { + type: "Grayscale", + applyTo: function(canvasEl) { + var context = canvasEl.getContext("2d"), imageData = context.getImageData(0, 0, canvasEl.width, canvasEl.height), data = imageData.data, len = imageData.width * imageData.height * 4, index = 0, average; + while (index < len) { + average = (data[index] + data[index + 1] + data[index + 2]) / 3; + data[index] = average; + data[index + 1] = average; + data[index + 2] = average; + index += 4; + } + context.putImageData(imageData, 0, 0); + } + }); + fabric.Image.filters.Grayscale.fromObject = function() { + return new fabric.Image.filters.Grayscale(); + }; +})(typeof exports !== "undefined" ? exports : this); + +(function(global) { + "use strict"; + var fabric = global.fabric || (global.fabric = {}), filters = fabric.Image.filters, createClass = fabric.util.createClass; + filters.Invert = createClass(filters.BaseFilter, { + type: "Invert", + applyTo: function(canvasEl) { + var context = canvasEl.getContext("2d"), imageData = context.getImageData(0, 0, canvasEl.width, canvasEl.height), data = imageData.data, iLen = data.length, i; + for (i = 0; i < iLen; i += 4) { + data[i] = 255 - data[i]; + data[i + 1] = 255 - data[i + 1]; + data[i + 2] = 255 - data[i + 2]; + } + context.putImageData(imageData, 0, 0); + } + }); + fabric.Image.filters.Invert.fromObject = function() { + return new fabric.Image.filters.Invert(); + }; +})(typeof exports !== "undefined" ? exports : this); + +(function(global) { + "use strict"; + var fabric = global.fabric || (global.fabric = {}), extend = fabric.util.object.extend, filters = fabric.Image.filters, createClass = fabric.util.createClass; + filters.Mask = createClass(filters.BaseFilter, { + type: "Mask", + initialize: function(options) { + options = options || {}; + this.mask = options.mask; + this.channel = [ 0, 1, 2, 3 ].indexOf(options.channel) > -1 ? options.channel : 0; + }, + applyTo: function(canvasEl) { + if (!this.mask) { + return; + } + var context = canvasEl.getContext("2d"), imageData = context.getImageData(0, 0, canvasEl.width, canvasEl.height), data = imageData.data, maskEl = this.mask.getElement(), maskCanvasEl = fabric.util.createCanvasElement(), channel = this.channel, i, iLen = imageData.width * imageData.height * 4; + maskCanvasEl.width = canvasEl.width; + maskCanvasEl.height = canvasEl.height; + maskCanvasEl.getContext("2d").drawImage(maskEl, 0, 0, canvasEl.width, canvasEl.height); + var maskImageData = maskCanvasEl.getContext("2d").getImageData(0, 0, canvasEl.width, canvasEl.height), maskData = maskImageData.data; + for (i = 0; i < iLen; i += 4) { + data[i + 3] = maskData[i + channel]; + } + context.putImageData(imageData, 0, 0); + }, + toObject: function() { + return extend(this.callSuper("toObject"), { + mask: this.mask.toObject(), + channel: this.channel + }); + } + }); + fabric.Image.filters.Mask.fromObject = function(object, callback) { + fabric.util.loadImage(object.mask.src, function(img) { + object.mask = new fabric.Image(img, object.mask); + callback && callback(new fabric.Image.filters.Mask(object)); + }); + }; + fabric.Image.filters.Mask.async = true; +})(typeof exports !== "undefined" ? exports : this); + +(function(global) { + "use strict"; + var fabric = global.fabric || (global.fabric = {}), extend = fabric.util.object.extend, filters = fabric.Image.filters, createClass = fabric.util.createClass; + filters.Noise = createClass(filters.BaseFilter, { + type: "Noise", + initialize: function(options) { + options = options || {}; + this.noise = options.noise || 0; + }, + applyTo: function(canvasEl) { + var context = canvasEl.getContext("2d"), imageData = context.getImageData(0, 0, canvasEl.width, canvasEl.height), data = imageData.data, noise = this.noise, rand; + for (var i = 0, len = data.length; i < len; i += 4) { + rand = (.5 - Math.random()) * noise; + data[i] += rand; + data[i + 1] += rand; + data[i + 2] += rand; + } + context.putImageData(imageData, 0, 0); + }, + toObject: function() { + return extend(this.callSuper("toObject"), { + noise: this.noise + }); + } + }); + fabric.Image.filters.Noise.fromObject = function(object) { + return new fabric.Image.filters.Noise(object); + }; +})(typeof exports !== "undefined" ? exports : this); + +(function(global) { + "use strict"; + var fabric = global.fabric || (global.fabric = {}), extend = fabric.util.object.extend, filters = fabric.Image.filters, createClass = fabric.util.createClass; + filters.Pixelate = createClass(filters.BaseFilter, { + type: "Pixelate", + initialize: function(options) { + options = options || {}; + this.blocksize = options.blocksize || 4; + }, + applyTo: function(canvasEl) { + var context = canvasEl.getContext("2d"), imageData = context.getImageData(0, 0, canvasEl.width, canvasEl.height), data = imageData.data, iLen = imageData.height, jLen = imageData.width, index, i, j, r, g, b, a; + for (i = 0; i < iLen; i += this.blocksize) { + for (j = 0; j < jLen; j += this.blocksize) { + index = i * 4 * jLen + j * 4; + r = data[index]; + g = data[index + 1]; + b = data[index + 2]; + a = data[index + 3]; + for (var _i = i, _ilen = i + this.blocksize; _i < _ilen; _i++) { + for (var _j = j, _jlen = j + this.blocksize; _j < _jlen; _j++) { + index = _i * 4 * jLen + _j * 4; + data[index] = r; + data[index + 1] = g; + data[index + 2] = b; + data[index + 3] = a; + } + } + } + } + context.putImageData(imageData, 0, 0); + }, + toObject: function() { + return extend(this.callSuper("toObject"), { + blocksize: this.blocksize + }); + } + }); + fabric.Image.filters.Pixelate.fromObject = function(object) { + return new fabric.Image.filters.Pixelate(object); + }; +})(typeof exports !== "undefined" ? exports : this); + +(function(global) { + "use strict"; + var fabric = global.fabric || (global.fabric = {}), extend = fabric.util.object.extend, filters = fabric.Image.filters, createClass = fabric.util.createClass; + filters.RemoveWhite = createClass(filters.BaseFilter, { + type: "RemoveWhite", + initialize: function(options) { + options = options || {}; + this.threshold = options.threshold || 30; + this.distance = options.distance || 20; + }, + applyTo: function(canvasEl) { + var context = canvasEl.getContext("2d"), imageData = context.getImageData(0, 0, canvasEl.width, canvasEl.height), data = imageData.data, threshold = this.threshold, distance = this.distance, limit = 255 - threshold, abs = Math.abs, r, g, b; + for (var i = 0, len = data.length; i < len; i += 4) { + r = data[i]; + g = data[i + 1]; + b = data[i + 2]; + if (r > limit && g > limit && b > limit && abs(r - g) < distance && abs(r - b) < distance && abs(g - b) < distance) { + data[i + 3] = 0; + } + } + context.putImageData(imageData, 0, 0); + }, + toObject: function() { + return extend(this.callSuper("toObject"), { + threshold: this.threshold, + distance: this.distance + }); + } + }); + fabric.Image.filters.RemoveWhite.fromObject = function(object) { + return new fabric.Image.filters.RemoveWhite(object); + }; +})(typeof exports !== "undefined" ? exports : this); + +(function(global) { + "use strict"; + var fabric = global.fabric || (global.fabric = {}), filters = fabric.Image.filters, createClass = fabric.util.createClass; + filters.Sepia = createClass(filters.BaseFilter, { + type: "Sepia", + applyTo: function(canvasEl) { + var context = canvasEl.getContext("2d"), imageData = context.getImageData(0, 0, canvasEl.width, canvasEl.height), data = imageData.data, iLen = data.length, i, avg; + for (i = 0; i < iLen; i += 4) { + avg = .3 * data[i] + .59 * data[i + 1] + .11 * data[i + 2]; + data[i] = avg + 100; + data[i + 1] = avg + 50; + data[i + 2] = avg + 255; + } + context.putImageData(imageData, 0, 0); + } + }); + fabric.Image.filters.Sepia.fromObject = function() { + return new fabric.Image.filters.Sepia(); + }; +})(typeof exports !== "undefined" ? exports : this); + +(function(global) { + "use strict"; + var fabric = global.fabric || (global.fabric = {}), filters = fabric.Image.filters, createClass = fabric.util.createClass; + filters.Sepia2 = createClass(filters.BaseFilter, { + type: "Sepia2", + applyTo: function(canvasEl) { + var context = canvasEl.getContext("2d"), imageData = context.getImageData(0, 0, canvasEl.width, canvasEl.height), data = imageData.data, iLen = data.length, i, r, g, b; + for (i = 0; i < iLen; i += 4) { + r = data[i]; + g = data[i + 1]; + b = data[i + 2]; + data[i] = (r * .393 + g * .769 + b * .189) / 1.351; + data[i + 1] = (r * .349 + g * .686 + b * .168) / 1.203; + data[i + 2] = (r * .272 + g * .534 + b * .131) / 2.14; + } + context.putImageData(imageData, 0, 0); + } + }); + fabric.Image.filters.Sepia2.fromObject = function() { + return new fabric.Image.filters.Sepia2(); + }; +})(typeof exports !== "undefined" ? exports : this); + +(function(global) { + "use strict"; + var fabric = global.fabric || (global.fabric = {}), extend = fabric.util.object.extend, filters = fabric.Image.filters, createClass = fabric.util.createClass; + filters.Tint = createClass(filters.BaseFilter, { + type: "Tint", + initialize: function(options) { + options = options || {}; + this.color = options.color || "#000000"; + this.opacity = typeof options.opacity !== "undefined" ? options.opacity : new fabric.Color(this.color).getAlpha(); + }, + applyTo: function(canvasEl) { + var context = canvasEl.getContext("2d"), imageData = context.getImageData(0, 0, canvasEl.width, canvasEl.height), data = imageData.data, iLen = data.length, i, tintR, tintG, tintB, r, g, b, alpha1, source; + source = new fabric.Color(this.color).getSource(); + tintR = source[0] * this.opacity; + tintG = source[1] * this.opacity; + tintB = source[2] * this.opacity; + alpha1 = 1 - this.opacity; + for (i = 0; i < iLen; i += 4) { + r = data[i]; + g = data[i + 1]; + b = data[i + 2]; + data[i] = tintR + r * alpha1; + data[i + 1] = tintG + g * alpha1; + data[i + 2] = tintB + b * alpha1; + } + context.putImageData(imageData, 0, 0); + }, + toObject: function() { + return extend(this.callSuper("toObject"), { + color: this.color, + opacity: this.opacity + }); + } + }); + fabric.Image.filters.Tint.fromObject = function(object) { + return new fabric.Image.filters.Tint(object); + }; +})(typeof exports !== "undefined" ? exports : this); + +(function(global) { + "use strict"; + var fabric = global.fabric || (global.fabric = {}), extend = fabric.util.object.extend, filters = fabric.Image.filters, createClass = fabric.util.createClass; + filters.Multiply = createClass(filters.BaseFilter, { + type: "Multiply", + initialize: function(options) { + options = options || {}; + this.color = options.color || "#000000"; + }, + applyTo: function(canvasEl) { + var context = canvasEl.getContext("2d"), imageData = context.getImageData(0, 0, canvasEl.width, canvasEl.height), data = imageData.data, iLen = data.length, i, source; + source = new fabric.Color(this.color).getSource(); + for (i = 0; i < iLen; i += 4) { + data[i] *= source[0] / 255; + data[i + 1] *= source[1] / 255; + data[i + 2] *= source[2] / 255; + } + context.putImageData(imageData, 0, 0); + }, + toObject: function() { + return extend(this.callSuper("toObject"), { + color: this.color + }); + } + }); + fabric.Image.filters.Multiply.fromObject = function(object) { + return new fabric.Image.filters.Multiply(object); + }; +})(typeof exports !== "undefined" ? exports : this); + +(function(global) { + "use strict"; + var fabric = global.fabric, filters = fabric.Image.filters, createClass = fabric.util.createClass; + filters.Blend = createClass(filters.BaseFilter, { + type: "Blend", + initialize: function(options) { + options = options || {}; + this.color = options.color || "#000"; + this.image = options.image || false; + this.mode = options.mode || "multiply"; + this.alpha = options.alpha || 1; + }, + applyTo: function(canvasEl) { + var context = canvasEl.getContext("2d"), imageData = context.getImageData(0, 0, canvasEl.width, canvasEl.height), data = imageData.data, tr, tg, tb, r, g, b, _r, _g, _b, source, isImage = false; + if (this.image) { + isImage = true; + var _el = fabric.util.createCanvasElement(); + _el.width = this.image.width; + _el.height = this.image.height; + var tmpCanvas = new fabric.StaticCanvas(_el); + tmpCanvas.add(this.image); + var context2 = tmpCanvas.getContext("2d"); + source = context2.getImageData(0, 0, tmpCanvas.width, tmpCanvas.height).data; + } else { + source = new fabric.Color(this.color).getSource(); + tr = source[0] * this.alpha; + tg = source[1] * this.alpha; + tb = source[2] * this.alpha; + } + for (var i = 0, len = data.length; i < len; i += 4) { + r = data[i]; + g = data[i + 1]; + b = data[i + 2]; + if (isImage) { + tr = source[i] * this.alpha; + tg = source[i + 1] * this.alpha; + tb = source[i + 2] * this.alpha; + } + switch (this.mode) { + case "multiply": + data[i] = r * tr / 255; + data[i + 1] = g * tg / 255; + data[i + 2] = b * tb / 255; + break; + + case "screen": + data[i] = 1 - (1 - r) * (1 - tr); + data[i + 1] = 1 - (1 - g) * (1 - tg); + data[i + 2] = 1 - (1 - b) * (1 - tb); + break; + + case "add": + data[i] = Math.min(255, r + tr); + data[i + 1] = Math.min(255, g + tg); + data[i + 2] = Math.min(255, b + tb); + break; + + case "diff": + case "difference": + data[i] = Math.abs(r - tr); + data[i + 1] = Math.abs(g - tg); + data[i + 2] = Math.abs(b - tb); + break; + + case "subtract": + _r = r - tr; + _g = g - tg; + _b = b - tb; + data[i] = _r < 0 ? 0 : _r; + data[i + 1] = _g < 0 ? 0 : _g; + data[i + 2] = _b < 0 ? 0 : _b; + break; + + case "darken": + data[i] = Math.min(r, tr); + data[i + 1] = Math.min(g, tg); + data[i + 2] = Math.min(b, tb); + break; + + case "lighten": + data[i] = Math.max(r, tr); + data[i + 1] = Math.max(g, tg); + data[i + 2] = Math.max(b, tb); + break; + } + } + context.putImageData(imageData, 0, 0); + }, + toObject: function() { + return { + color: this.color, + image: this.image, + mode: this.mode, + alpha: this.alpha + }; + } + }); + fabric.Image.filters.Blend.fromObject = function(object) { + return new fabric.Image.filters.Blend(object); + }; +})(typeof exports !== "undefined" ? exports : this); + +(function(global) { + "use strict"; + var fabric = global.fabric || (global.fabric = {}), pow = Math.pow, floor = Math.floor, sqrt = Math.sqrt, abs = Math.abs, max = Math.max, round = Math.round, sin = Math.sin, ceil = Math.ceil, filters = fabric.Image.filters, createClass = fabric.util.createClass; + filters.Resize = createClass(filters.BaseFilter, { + type: "Resize", + resizeType: "hermite", + scaleX: 0, + scaleY: 0, + lanczosLobes: 3, + applyTo: function(canvasEl, scaleX, scaleY) { + if (scaleX === 1 && scaleY === 1) { + return; + } + this.rcpScaleX = 1 / scaleX; + this.rcpScaleY = 1 / scaleY; + var oW = canvasEl.width, oH = canvasEl.height, dW = round(oW * scaleX), dH = round(oH * scaleY), imageData; + if (this.resizeType === "sliceHack") { + imageData = this.sliceByTwo(canvasEl, oW, oH, dW, dH); + } + if (this.resizeType === "hermite") { + imageData = this.hermiteFastResize(canvasEl, oW, oH, dW, dH); + } + if (this.resizeType === "bilinear") { + imageData = this.bilinearFiltering(canvasEl, oW, oH, dW, dH); + } + if (this.resizeType === "lanczos") { + imageData = this.lanczosResize(canvasEl, oW, oH, dW, dH); + } + canvasEl.width = dW; + canvasEl.height = dH; + canvasEl.getContext("2d").putImageData(imageData, 0, 0); + }, + sliceByTwo: function(canvasEl, oW, oH, dW, dH) { + var context = canvasEl.getContext("2d"), imageData, multW = .5, multH = .5, signW = 1, signH = 1, doneW = false, doneH = false, stepW = oW, stepH = oH, tmpCanvas = fabric.util.createCanvasElement(), tmpCtx = tmpCanvas.getContext("2d"); + dW = floor(dW); + dH = floor(dH); + tmpCanvas.width = max(dW, oW); + tmpCanvas.height = max(dH, oH); + if (dW > oW) { + multW = 2; + signW = -1; + } + if (dH > oH) { + multH = 2; + signH = -1; + } + imageData = context.getImageData(0, 0, oW, oH); + canvasEl.width = max(dW, oW); + canvasEl.height = max(dH, oH); + context.putImageData(imageData, 0, 0); + while (!doneW || !doneH) { + oW = stepW; + oH = stepH; + if (dW * signW < floor(stepW * multW * signW)) { + stepW = floor(stepW * multW); + } else { + stepW = dW; + doneW = true; + } + if (dH * signH < floor(stepH * multH * signH)) { + stepH = floor(stepH * multH); + } else { + stepH = dH; + doneH = true; + } + imageData = context.getImageData(0, 0, oW, oH); + tmpCtx.putImageData(imageData, 0, 0); + context.clearRect(0, 0, stepW, stepH); + context.drawImage(tmpCanvas, 0, 0, oW, oH, 0, 0, stepW, stepH); + } + return context.getImageData(0, 0, dW, dH); + }, + lanczosResize: function(canvasEl, oW, oH, dW, dH) { + function lanczosCreate(lobes) { + return function(x) { + if (x > lobes) { + return 0; + } + x *= Math.PI; + if (abs(x) < 1e-16) { + return 1; + } + var xx = x / lobes; + return sin(x) * sin(xx) / x / xx; + }; + } + function process(u) { + var v, i, weight, idx, a, red, green, blue, alpha, fX, fY; + center.x = (u + .5) * ratioX; + icenter.x = floor(center.x); + for (v = 0; v < dH; v++) { + center.y = (v + .5) * ratioY; + icenter.y = floor(center.y); + a = 0; + red = 0; + green = 0; + blue = 0; + alpha = 0; + for (i = icenter.x - range2X; i <= icenter.x + range2X; i++) { + if (i < 0 || i >= oW) { + continue; + } + fX = floor(1e3 * abs(i - center.x)); + if (!cacheLanc[fX]) { + cacheLanc[fX] = {}; + } + for (var j = icenter.y - range2Y; j <= icenter.y + range2Y; j++) { + if (j < 0 || j >= oH) { + continue; + } + fY = floor(1e3 * abs(j - center.y)); + if (!cacheLanc[fX][fY]) { + cacheLanc[fX][fY] = lanczos(sqrt(pow(fX * rcpRatioX, 2) + pow(fY * rcpRatioY, 2)) / 1e3); + } + weight = cacheLanc[fX][fY]; + if (weight > 0) { + idx = (j * oW + i) * 4; + a += weight; + red += weight * srcData[idx]; + green += weight * srcData[idx + 1]; + blue += weight * srcData[idx + 2]; + alpha += weight * srcData[idx + 3]; + } + } + } + idx = (v * dW + u) * 4; + destData[idx] = red / a; + destData[idx + 1] = green / a; + destData[idx + 2] = blue / a; + destData[idx + 3] = alpha / a; + } + if (++u < dW) { + return process(u); + } else { + return destImg; + } + } + var context = canvasEl.getContext("2d"), srcImg = context.getImageData(0, 0, oW, oH), destImg = context.getImageData(0, 0, dW, dH), srcData = srcImg.data, destData = destImg.data, lanczos = lanczosCreate(this.lanczosLobes), ratioX = this.rcpScaleX, ratioY = this.rcpScaleY, rcpRatioX = 2 / this.rcpScaleX, rcpRatioY = 2 / this.rcpScaleY, range2X = ceil(ratioX * this.lanczosLobes / 2), range2Y = ceil(ratioY * this.lanczosLobes / 2), cacheLanc = {}, center = {}, icenter = {}; + return process(0); + }, + bilinearFiltering: function(canvasEl, oW, oH, dW, dH) { + var a, b, c, d, x, y, i, j, xDiff, yDiff, chnl, color, offset = 0, origPix, ratioX = this.rcpScaleX, ratioY = this.rcpScaleY, context = canvasEl.getContext("2d"), w4 = 4 * (oW - 1), img = context.getImageData(0, 0, oW, oH), pixels = img.data, destImage = context.getImageData(0, 0, dW, dH), destPixels = destImage.data; + for (i = 0; i < dH; i++) { + for (j = 0; j < dW; j++) { + x = floor(ratioX * j); + y = floor(ratioY * i); + xDiff = ratioX * j - x; + yDiff = ratioY * i - y; + origPix = 4 * (y * oW + x); + for (chnl = 0; chnl < 4; chnl++) { + a = pixels[origPix + chnl]; + b = pixels[origPix + 4 + chnl]; + c = pixels[origPix + w4 + chnl]; + d = pixels[origPix + w4 + 4 + chnl]; + color = a * (1 - xDiff) * (1 - yDiff) + b * xDiff * (1 - yDiff) + c * yDiff * (1 - xDiff) + d * xDiff * yDiff; + destPixels[offset++] = color; + } + } + } + return destImage; + }, + hermiteFastResize: function(canvasEl, oW, oH, dW, dH) { + var ratioW = this.rcpScaleX, ratioH = this.rcpScaleY, ratioWHalf = ceil(ratioW / 2), ratioHHalf = ceil(ratioH / 2), context = canvasEl.getContext("2d"), img = context.getImageData(0, 0, oW, oH), data = img.data, img2 = context.getImageData(0, 0, dW, dH), data2 = img2.data; + for (var j = 0; j < dH; j++) { + for (var i = 0; i < dW; i++) { + var x2 = (i + j * dW) * 4, weight = 0, weights = 0, weightsAlpha = 0, gxR = 0, gxG = 0, gxB = 0, gxA = 0, centerY = (j + .5) * ratioH; + for (var yy = floor(j * ratioH); yy < (j + 1) * ratioH; yy++) { + var dy = abs(centerY - (yy + .5)) / ratioHHalf, centerX = (i + .5) * ratioW, w0 = dy * dy; + for (var xx = floor(i * ratioW); xx < (i + 1) * ratioW; xx++) { + var dx = abs(centerX - (xx + .5)) / ratioWHalf, w = sqrt(w0 + dx * dx); + if (w > 1 && w < -1) { + continue; + } + weight = 2 * w * w * w - 3 * w * w + 1; + if (weight > 0) { + dx = 4 * (xx + yy * oW); + gxA += weight * data[dx + 3]; + weightsAlpha += weight; + if (data[dx + 3] < 255) { + weight = weight * data[dx + 3] / 250; + } + gxR += weight * data[dx]; + gxG += weight * data[dx + 1]; + gxB += weight * data[dx + 2]; + weights += weight; + } + } + } + data2[x2] = gxR / weights; + data2[x2 + 1] = gxG / weights; + data2[x2 + 2] = gxB / weights; + data2[x2 + 3] = gxA / weightsAlpha; + } + } + return img2; + }, + toObject: function() { + return { + type: this.type, + scaleX: this.scaleX, + scaleY: this.scaleY, + resizeType: this.resizeType, + lanczosLobes: this.lanczosLobes + }; + } + }); + fabric.Image.filters.Resize.fromObject = function(object) { + return new fabric.Image.filters.Resize(object); + }; +})(typeof exports !== "undefined" ? exports : this); + +(function(global) { + "use strict"; + var fabric = global.fabric || (global.fabric = {}), extend = fabric.util.object.extend, filters = fabric.Image.filters, createClass = fabric.util.createClass; + filters.ColorMatrix = createClass(filters.BaseFilter, { + type: "ColorMatrix", + initialize: function(options) { + options || (options = {}); + this.matrix = options.matrix || [ 1, 0, 0, 0, 0, 0, 1, 0, 0, 0, 0, 0, 1, 0, 0, 0, 0, 0, 1, 0 ]; + }, + applyTo: function(canvasEl) { + var context = canvasEl.getContext("2d"), imageData = context.getImageData(0, 0, canvasEl.width, canvasEl.height), data = imageData.data, iLen = data.length, i, r, g, b, a, m = this.matrix; + for (i = 0; i < iLen; i += 4) { + r = data[i]; + g = data[i + 1]; + b = data[i + 2]; + a = data[i + 3]; + data[i] = r * m[0] + g * m[1] + b * m[2] + a * m[3] + m[4]; + data[i + 1] = r * m[5] + g * m[6] + b * m[7] + a * m[8] + m[9]; + data[i + 2] = r * m[10] + g * m[11] + b * m[12] + a * m[13] + m[14]; + data[i + 3] = r * m[15] + g * m[16] + b * m[17] + a * m[18] + m[19]; + } + context.putImageData(imageData, 0, 0); + }, + toObject: function() { + return extend(this.callSuper("toObject"), { + type: this.type, + matrix: this.matrix + }); + } + }); + fabric.Image.filters.ColorMatrix.fromObject = function(object) { + return new fabric.Image.filters.ColorMatrix(object); + }; +})(typeof exports !== "undefined" ? exports : this); + +(function(global) { + "use strict"; + var fabric = global.fabric || (global.fabric = {}), extend = fabric.util.object.extend, filters = fabric.Image.filters, createClass = fabric.util.createClass; + filters.Contrast = createClass(filters.BaseFilter, { + type: "Contrast", + initialize: function(options) { + options = options || {}; + this.contrast = options.contrast || 0; + }, + applyTo: function(canvasEl) { + var context = canvasEl.getContext("2d"), imageData = context.getImageData(0, 0, canvasEl.width, canvasEl.height), data = imageData.data, contrastF = 259 * (this.contrast + 255) / (255 * (259 - this.contrast)); + for (var i = 0, len = data.length; i < len; i += 4) { + data[i] = contrastF * (data[i] - 128) + 128; + data[i + 1] = contrastF * (data[i + 1] - 128) + 128; + data[i + 2] = contrastF * (data[i + 2] - 128) + 128; + } + context.putImageData(imageData, 0, 0); + }, + toObject: function() { + return extend(this.callSuper("toObject"), { + contrast: this.contrast + }); + } + }); + fabric.Image.filters.Contrast.fromObject = function(object) { + return new fabric.Image.filters.Contrast(object); + }; +})(typeof exports !== "undefined" ? exports : this); + +(function(global) { + "use strict"; + var fabric = global.fabric || (global.fabric = {}), extend = fabric.util.object.extend, filters = fabric.Image.filters, createClass = fabric.util.createClass; + filters.Saturate = createClass(filters.BaseFilter, { + type: "Saturate", + initialize: function(options) { + options = options || {}; + this.saturate = options.saturate || 0; + this.loadProgram(); + }, + applyTo: function(canvasEl) { + var context = canvasEl.getContext("2d"), imageData = context.getImageData(0, 0, canvasEl.width, canvasEl.height), data = imageData.data, max, adjust = -this.saturate * .01; + for (var i = 0, len = data.length; i < len; i += 4) { + max = Math.max(data[i], data[i + 1], data[i + 2]); + data[i] += max !== data[i] ? (max - data[i]) * adjust : 0; + data[i + 1] += max !== data[i + 1] ? (max - data[i + 1]) * adjust : 0; + data[i + 2] += max !== data[i + 2] ? (max - data[i + 2]) * adjust : 0; + } + context.putImageData(imageData, 0, 0); + }, + toObject: function() { + return extend(this.callSuper("toObject"), { + saturate: this.saturate + }); + } + }); + fabric.Image.filters.Saturate.fromObject = function(object) { + return new fabric.Image.filters.Saturate(object); + }; +})(typeof exports !== "undefined" ? exports : this); + +(function(global) { + "use strict"; + var fabric = global.fabric || (global.fabric = {}), extend = fabric.util.object.extend, clone = fabric.util.object.clone, toFixed = fabric.util.toFixed, NUM_FRACTION_DIGITS = fabric.Object.NUM_FRACTION_DIGITS, MIN_TEXT_WIDTH = 2; + if (fabric.Text) { + fabric.warn("fabric.Text is already defined"); + return; + } + var stateProperties = fabric.Object.prototype.stateProperties.concat(); + stateProperties.push("fontFamily", "fontWeight", "fontSize", "text", "textDecoration", "textAlign", "fontStyle", "lineHeight", "textBackgroundColor"); + fabric.Text = fabric.util.createClass(fabric.Object, { + _dimensionAffectingProps: { + fontSize: true, + fontWeight: true, + fontFamily: true, + fontStyle: true, + lineHeight: true, + text: true, + charSpacing: true, + textAlign: true, + strokeWidth: false + }, + _reNewline: /\r?\n/, + _reSpacesAndTabs: /[ \t\r]+/g, + type: "text", + fontSize: 40, + fontWeight: "normal", + fontFamily: "Times New Roman", + textDecoration: "", + textAlign: "left", + fontStyle: "", + lineHeight: 1.16, + textBackgroundColor: "", + stateProperties: stateProperties, + stroke: null, + shadow: null, + _fontSizeFraction: .25, + _fontSizeMult: 1.13, + charSpacing: 0, + initialize: function(text, options) { + options = options || {}; + this.text = text; + this.__skipDimension = true; + this.setOptions(options); + this.__skipDimension = false; + this._initDimensions(); + }, + _initDimensions: function(ctx) { + if (this.__skipDimension) { + return; + } + if (!ctx) { + ctx = fabric.util.createCanvasElement().getContext("2d"); + this._setTextStyles(ctx); + } + this._textLines = this._splitTextIntoLines(); + this._clearCache(); + this.width = this._getTextWidth(ctx) || this.cursorWidth || MIN_TEXT_WIDTH; + this.height = this._getTextHeight(ctx); + }, + toString: function() { + return "#'; + }, + _render: function(ctx) { + this.clipTo && fabric.util.clipContext(this, ctx); + this._setOpacity(ctx); + this._setShadow(ctx); + this._setupCompositeOperation(ctx); + this._renderTextBackground(ctx); + this._setStrokeStyles(ctx); + this._setFillStyles(ctx); + this._renderText(ctx); + this._renderTextDecoration(ctx); + this.clipTo && ctx.restore(); + }, + _renderText: function(ctx) { + this._renderTextFill(ctx); + this._renderTextStroke(ctx); + }, + _setTextStyles: function(ctx) { + ctx.textBaseline = "alphabetic"; + ctx.font = this._getFontDeclaration(); + }, + _getTextHeight: function() { + return this._getHeightOfSingleLine() + (this._textLines.length - 1) * this._getHeightOfLine(); + }, + _getTextWidth: function(ctx) { + var maxWidth = this._getLineWidth(ctx, 0); + for (var i = 1, len = this._textLines.length; i < len; i++) { + var currentLineWidth = this._getLineWidth(ctx, i); + if (currentLineWidth > maxWidth) { + maxWidth = currentLineWidth; + } + } + return maxWidth; + }, + _getNonTransformedDimensions: function() { + return { + x: this.width, + y: this.height + }; + }, + _renderChars: function(method, ctx, chars, left, top) { + var shortM = method.slice(0, -4), char, width; + if (this[shortM].toLive) { + var offsetX = -this.width / 2 + this[shortM].offsetX || 0, offsetY = -this.height / 2 + this[shortM].offsetY || 0; + ctx.save(); + ctx.translate(offsetX, offsetY); + left -= offsetX; + top -= offsetY; + } + if (this.charSpacing !== 0) { + var additionalSpace = this._getWidthOfCharSpacing(); + chars = chars.split(""); + for (var i = 0, len = chars.length; i < len; i++) { + char = chars[i]; + width = ctx.measureText(char).width + additionalSpace; + ctx[method](char, left, top); + left += width > 0 ? width : 0; + } + } else { + ctx[method](chars, left, top); + } + this[shortM].toLive && ctx.restore(); + }, + _renderTextLine: function(method, ctx, line, left, top, lineIndex) { + top -= this.fontSize * this._fontSizeFraction; + var lineWidth = this._getLineWidth(ctx, lineIndex); + if (this.textAlign !== "justify" || this.width < lineWidth) { + this._renderChars(method, ctx, line, left, top, lineIndex); + return; + } + var words = line.split(/\s+/), charOffset = 0, wordsWidth = this._getWidthOfWords(ctx, words.join(""), lineIndex, 0), widthDiff = this.width - wordsWidth, numSpaces = words.length - 1, spaceWidth = numSpaces > 0 ? widthDiff / numSpaces : 0, leftOffset = 0, word; + for (var i = 0, len = words.length; i < len; i++) { + while (line[charOffset] === " " && charOffset < line.length) { + charOffset++; + } + word = words[i]; + this._renderChars(method, ctx, word, left + leftOffset, top, lineIndex, charOffset); + leftOffset += this._getWidthOfWords(ctx, word, lineIndex, charOffset) + spaceWidth; + charOffset += word.length; + } + }, + _getWidthOfWords: function(ctx, word) { + var width = ctx.measureText(word).width, charCount, additionalSpace; + if (this.charSpacing !== 0) { + charCount = word.split("").length; + additionalSpace = charCount * this._getWidthOfCharSpacing(); + width += additionalSpace; + } + return width > 0 ? width : 0; + }, + _getLeftOffset: function() { + return -this.width / 2; + }, + _getTopOffset: function() { + return -this.height / 2; + }, + isEmptyStyles: function() { + return true; + }, + _renderTextCommon: function(ctx, method) { + var lineHeights = 0, left = this._getLeftOffset(), top = this._getTopOffset(); + for (var i = 0, len = this._textLines.length; i < len; i++) { + var heightOfLine = this._getHeightOfLine(ctx, i), maxHeight = heightOfLine / this.lineHeight, lineWidth = this._getLineWidth(ctx, i), leftOffset = this._getLineLeftOffset(lineWidth); + this._renderTextLine(method, ctx, this._textLines[i], left + leftOffset, top + lineHeights + maxHeight, i); + lineHeights += heightOfLine; + } + }, + _renderTextFill: function(ctx) { + if (!this.fill && this.isEmptyStyles()) { + return; + } + this._renderTextCommon(ctx, "fillText"); + }, + _renderTextStroke: function(ctx) { + if ((!this.stroke || this.strokeWidth === 0) && this.isEmptyStyles()) { + return; + } + if (this.shadow && !this.shadow.affectStroke) { + this._removeShadow(ctx); + } + ctx.save(); + this._setLineDash(ctx, this.strokedashArray); + ctx.beginPath(); + this._renderTextCommon(ctx, "strokeText"); + ctx.closePath(); + ctx.restore(); + }, + _getHeightOfLine: function() { + return this._getHeightOfSingleLine() * this.lineHeight; + }, + _getHeightOfSingleLine: function() { + return this.fontSize * this._fontSizeMult; + }, + _renderTextBackground: function(ctx) { + this._renderBackground(ctx); + this._renderTextLinesBackground(ctx); + }, + _renderTextLinesBackground: function(ctx) { + if (!this.textBackgroundColor) { + return; + } + var lineTopOffset = 0, heightOfLine, lineWidth, lineLeftOffset; + ctx.fillStyle = this.textBackgroundColor; + for (var i = 0, len = this._textLines.length; i < len; i++) { + heightOfLine = this._getHeightOfLine(ctx, i); + lineWidth = this._getLineWidth(ctx, i); + if (lineWidth > 0) { + lineLeftOffset = this._getLineLeftOffset(lineWidth); + ctx.fillRect(this._getLeftOffset() + lineLeftOffset, this._getTopOffset() + lineTopOffset, lineWidth, heightOfLine / this.lineHeight); + } + lineTopOffset += heightOfLine; + } + this._removeShadow(ctx); + }, + _getLineLeftOffset: function(lineWidth) { + if (this.textAlign === "center") { + return (this.width - lineWidth) / 2; + } + if (this.textAlign === "right") { + return this.width - lineWidth; + } + return 0; + }, + _clearCache: function() { + this.__lineWidths = []; + this.__lineHeights = []; + }, + _shouldClearCache: function() { + var shouldClear = false; + if (this._forceClearCache) { + this._forceClearCache = false; + return true; + } + for (var prop in this._dimensionAffectingProps) { + if (this["__" + prop] !== this[prop]) { + this["__" + prop] = this[prop]; + shouldClear = true; + } + } + return shouldClear; + }, + _getLineWidth: function(ctx, lineIndex) { + if (this.__lineWidths[lineIndex]) { + return this.__lineWidths[lineIndex] === -1 ? this.width : this.__lineWidths[lineIndex]; + } + var width, wordCount, line = this._textLines[lineIndex]; + if (line === "") { + width = 0; + } else { + width = this._measureLine(ctx, lineIndex); + } + this.__lineWidths[lineIndex] = width; + if (width && this.textAlign === "justify") { + wordCount = line.split(/\s+/); + if (wordCount.length > 1) { + this.__lineWidths[lineIndex] = -1; + } + } + return width; + }, + _getWidthOfCharSpacing: function() { + if (this.charSpacing !== 0) { + return this.fontSize * this.charSpacing / 1e3; + } + return 0; + }, + _measureLine: function(ctx, lineIndex) { + var line = this._textLines[lineIndex], width = ctx.measureText(line).width, additionalSpace = 0, charCount, finalWidth; + if (this.charSpacing !== 0) { + charCount = line.split("").length; + additionalSpace = (charCount - 1) * this._getWidthOfCharSpacing(); + } + finalWidth = width + additionalSpace; + return finalWidth > 0 ? finalWidth : 0; + }, + _renderTextDecoration: function(ctx) { + if (!this.textDecoration) { + return; + } + var halfOfVerticalBox = this.height / 2, _this = this, offsets = []; + function renderLinesAtOffset(offsets) { + var i, lineHeight = 0, len, j, oLen, lineWidth, lineLeftOffset, heightOfLine; + for (i = 0, len = _this._textLines.length; i < len; i++) { + lineWidth = _this._getLineWidth(ctx, i); + lineLeftOffset = _this._getLineLeftOffset(lineWidth); + heightOfLine = _this._getHeightOfLine(ctx, i); + for (j = 0, oLen = offsets.length; j < oLen; j++) { + ctx.fillRect(_this._getLeftOffset() + lineLeftOffset, lineHeight + (_this._fontSizeMult - 1 + offsets[j]) * _this.fontSize - halfOfVerticalBox, lineWidth, _this.fontSize / 15); + } + lineHeight += heightOfLine; + } + } + if (this.textDecoration.indexOf("underline") > -1) { + offsets.push(.85); + } + if (this.textDecoration.indexOf("line-through") > -1) { + offsets.push(.43); + } + if (this.textDecoration.indexOf("overline") > -1) { + offsets.push(-.12); + } + if (offsets.length > 0) { + renderLinesAtOffset(offsets); + } + }, + _getFontDeclaration: function() { + return [ fabric.isLikelyNode ? this.fontWeight : this.fontStyle, fabric.isLikelyNode ? this.fontStyle : this.fontWeight, this.fontSize + "px", fabric.isLikelyNode ? '"' + this.fontFamily + '"' : this.fontFamily ].join(" "); + }, + render: function(ctx, noTransform) { + if (!this.visible) { + return; + } + ctx.save(); + this._setTextStyles(ctx); + if (this._shouldClearCache()) { + this._initDimensions(ctx); + } + this.drawSelectionBackground(ctx); + if (!noTransform) { + this.transform(ctx); + } + if (this.transformMatrix) { + ctx.transform.apply(ctx, this.transformMatrix); + } + if (this.group && this.group.type === "path-group") { + ctx.translate(this.left, this.top); + } + this._render(ctx); + ctx.restore(); + }, + _splitTextIntoLines: function() { + return this.text.split(this._reNewline); + }, + toObject: function(propertiesToInclude) { + var object = extend(this.callSuper("toObject", propertiesToInclude), { + text: this.text, + fontSize: this.fontSize, + fontWeight: this.fontWeight, + fontFamily: this.fontFamily, + fontStyle: this.fontStyle, + lineHeight: this.lineHeight, + textDecoration: this.textDecoration, + textAlign: this.textAlign, + textBackgroundColor: this.textBackgroundColor, + charSpacing: this.charSpacing + }); + if (!this.includeDefaultValues) { + this._removeDefaultValues(object); + } + return object; + }, + toSVG: function(reviver) { + if (!this.ctx) { + this.ctx = fabric.util.createCanvasElement().getContext("2d"); + } + var markup = this._createBaseSVGMarkup(), offsets = this._getSVGLeftTopOffsets(this.ctx), textAndBg = this._getSVGTextAndBg(offsets.textTop, offsets.textLeft); + this._wrapSVGTextAndBg(markup, textAndBg); + return reviver ? reviver(markup.join("")) : markup.join(""); + }, + _getSVGLeftTopOffsets: function(ctx) { + var lineTop = this._getHeightOfLine(ctx, 0), textLeft = -this.width / 2, textTop = 0; + return { + textLeft: textLeft + (this.group && this.group.type === "path-group" ? this.left : 0), + textTop: textTop + (this.group && this.group.type === "path-group" ? -this.top : 0), + lineTop: lineTop + }; + }, + _wrapSVGTextAndBg: function(markup, textAndBg) { + var noShadow = true, filter = this.getSvgFilter(), style = filter === "" ? "" : ' style="' + filter + '"'; + markup.push("\t\n", textAndBg.textBgRects.join(""), "\t\t\n', textAndBg.textSpans.join(""), "\t\t\n", "\t\n"); + }, + _getSVGTextAndBg: function(textTopOffset, textLeftOffset) { + var textSpans = [], textBgRects = [], height = 0; + this._setSVGBg(textBgRects); + for (var i = 0, len = this._textLines.length; i < len; i++) { + if (this.textBackgroundColor) { + this._setSVGTextLineBg(textBgRects, i, textLeftOffset, textTopOffset, height); + } + this._setSVGTextLineText(i, textSpans, height, textLeftOffset, textTopOffset, textBgRects); + height += this._getHeightOfLine(this.ctx, i); + } + return { + textSpans: textSpans, + textBgRects: textBgRects + }; + }, + _setSVGTextLineText: function(i, textSpans, height, textLeftOffset, textTopOffset) { + var yPos = this.fontSize * (this._fontSizeMult - this._fontSizeFraction) - textTopOffset + height - this.height / 2; + if (this.textAlign === "justify") { + this._setSVGTextLineJustifed(i, textSpans, yPos, textLeftOffset); + return; + } + textSpans.push('\t\t\t", fabric.util.string.escapeXml(this._textLines[i]), "\n"); + }, + _setSVGTextLineJustifed: function(i, textSpans, yPos, textLeftOffset) { + var ctx = fabric.util.createCanvasElement().getContext("2d"); + this._setTextStyles(ctx); + var line = this._textLines[i], words = line.split(/\s+/), wordsWidth = this._getWidthOfWords(ctx, words.join("")), widthDiff = this.width - wordsWidth, numSpaces = words.length - 1, spaceWidth = numSpaces > 0 ? widthDiff / numSpaces : 0, word, attributes = this._getFillAttributes(this.fill), len; + textLeftOffset += this._getLineLeftOffset(this._getLineWidth(ctx, i)); + for (i = 0, len = words.length; i < len; i++) { + word = words[i]; + textSpans.push('\t\t\t", fabric.util.string.escapeXml(word), "\n"); + textLeftOffset += this._getWidthOfWords(ctx, word) + spaceWidth; + } + }, + _setSVGTextLineBg: function(textBgRects, i, textLeftOffset, textTopOffset, height) { + textBgRects.push("\t\t\n'); + }, + _setSVGBg: function(textBgRects) { + if (this.backgroundColor) { + textBgRects.push("\t\t\n'); + } + }, + _getFillAttributes: function(value) { + var fillColor = value && typeof value === "string" ? new fabric.Color(value) : ""; + if (!fillColor || !fillColor.getSource() || fillColor.getAlpha() === 1) { + return 'fill="' + value + '"'; + } + return 'opacity="' + fillColor.getAlpha() + '" fill="' + fillColor.setAlpha(1).toRgb() + '"'; + }, + _set: function(key, value) { + this.callSuper("_set", key, value); + if (key in this._dimensionAffectingProps) { + this._initDimensions(); + this.setCoords(); + } + }, + complexity: function() { + return 1; + } + }); + fabric.Text.ATTRIBUTE_NAMES = fabric.SHARED_ATTRIBUTES.concat("x y dx dy font-family font-style font-weight font-size text-decoration text-anchor".split(" ")); + fabric.Text.DEFAULT_SVG_FONT_SIZE = 16; + fabric.Text.fromElement = function(element, options) { + if (!element) { + return null; + } + var parsedAttributes = fabric.parseAttributes(element, fabric.Text.ATTRIBUTE_NAMES); + options = fabric.util.object.extend(options ? fabric.util.object.clone(options) : {}, parsedAttributes); + options.top = options.top || 0; + options.left = options.left || 0; + if ("dx" in parsedAttributes) { + options.left += parsedAttributes.dx; + } + if ("dy" in parsedAttributes) { + options.top += parsedAttributes.dy; + } + if (!("fontSize" in options)) { + options.fontSize = fabric.Text.DEFAULT_SVG_FONT_SIZE; + } + if (!options.originX) { + options.originX = "left"; + } + var textContent = ""; + if (!("textContent" in element)) { + if ("firstChild" in element && element.firstChild !== null) { + if ("data" in element.firstChild && element.firstChild.data !== null) { + textContent = element.firstChild.data; + } + } + } else { + textContent = element.textContent; + } + textContent = textContent.replace(/^\s+|\s+$|\n+/g, "").replace(/\s+/g, " "); + var text = new fabric.Text(textContent, options), textHeightScaleFactor = text.getHeight() / text.height, lineHeightDiff = (text.height + text.strokeWidth) * text.lineHeight - text.height, scaledDiff = lineHeightDiff * textHeightScaleFactor, textHeight = text.getHeight() + scaledDiff, offX = 0; + if (text.originX === "left") { + offX = text.getWidth() / 2; + } + if (text.originX === "right") { + offX = -text.getWidth() / 2; + } + text.set({ + left: text.getLeft() + offX, + top: text.getTop() - textHeight / 2 + text.fontSize * (.18 + text._fontSizeFraction) / text.lineHeight + }); + return text; + }; + fabric.Text.fromObject = function(object, callback) { + var text = new fabric.Text(object.text, clone(object)); + callback && callback(text); + return text; + }; + fabric.util.createAccessors(fabric.Text); +})(typeof exports !== "undefined" ? exports : this); + +(function() { + var clone = fabric.util.object.clone; + fabric.IText = fabric.util.createClass(fabric.Text, fabric.Observable, { + type: "i-text", + selectionStart: 0, + selectionEnd: 0, + selectionColor: "rgba(17,119,255,0.3)", + isEditing: false, + editable: true, + editingBorderColor: "rgba(102,153,255,0.25)", + cursorWidth: 2, + cursorColor: "#333", + cursorDelay: 1e3, + cursorDuration: 600, + styles: null, + caching: true, + _reSpace: /\s|\n/, + _currentCursorOpacity: 0, + _selectionDirection: null, + _abortCursorAnimation: false, + __widthOfSpace: [], + initialize: function(text, options) { + this.styles = options ? options.styles || {} : {}; + this.callSuper("initialize", text, options); + this.initBehavior(); + }, + _clearCache: function() { + this.callSuper("_clearCache"); + this.__widthOfSpace = []; + }, + isEmptyStyles: function() { + if (!this.styles) { + return true; + } + var obj = this.styles; + for (var p1 in obj) { + for (var p2 in obj[p1]) { + for (var p3 in obj[p1][p2]) { + return false; + } + } + } + return true; + }, + setSelectionStart: function(index) { + index = Math.max(index, 0); + this._updateAndFire("selectionStart", index); + }, + setSelectionEnd: function(index) { + index = Math.min(index, this.text.length); + this._updateAndFire("selectionEnd", index); + }, + _updateAndFire: function(property, index) { + if (this[property] !== index) { + this._fireSelectionChanged(); + this[property] = index; + } + this._updateTextarea(); + }, + _fireSelectionChanged: function() { + this.fire("selection:changed"); + this.canvas && this.canvas.fire("text:selection:changed", { + target: this + }); + }, + getSelectionStyles: function(startIndex, endIndex) { + if (arguments.length === 2) { + var styles = []; + for (var i = startIndex; i < endIndex; i++) { + styles.push(this.getSelectionStyles(i)); + } + return styles; + } + var loc = this.get2DCursorLocation(startIndex), style = this._getStyleDeclaration(loc.lineIndex, loc.charIndex); + return style || {}; + }, + setSelectionStyles: function(styles) { + if (this.selectionStart === this.selectionEnd) { + this._extendStyles(this.selectionStart, styles); + } else { + for (var i = this.selectionStart; i < this.selectionEnd; i++) { + this._extendStyles(i, styles); + } + } + this._forceClearCache = true; + return this; + }, + _extendStyles: function(index, styles) { + var loc = this.get2DCursorLocation(index); + if (!this._getLineStyle(loc.lineIndex)) { + this._setLineStyle(loc.lineIndex, {}); + } + if (!this._getStyleDeclaration(loc.lineIndex, loc.charIndex)) { + this._setStyleDeclaration(loc.lineIndex, loc.charIndex, {}); + } + fabric.util.object.extend(this._getStyleDeclaration(loc.lineIndex, loc.charIndex), styles); + }, + _render: function(ctx) { + this.oldWidth = this.width; + this.oldHeight = this.height; + this.callSuper("_render", ctx); + this.ctx = ctx; + this.cursorOffsetCache = {}; + this.renderCursorOrSelection(); + }, + renderCursorOrSelection: function() { + if (!this.active || !this.isEditing) { + return; + } + var chars = this.text.split(""), boundaries, ctx; + if (this.canvas.contextTop) { + ctx = this.canvas.contextTop; + ctx.save(); + ctx.transform.apply(ctx, this.canvas.viewportTransform); + this.transform(ctx); + this.transformMatrix && ctx.transform.apply(ctx, this.transformMatrix); + this._clearTextArea(ctx); + } else { + ctx = this.ctx; + ctx.save(); + } + if (this.selectionStart === this.selectionEnd) { + boundaries = this._getCursorBoundaries(chars, "cursor"); + this.renderCursor(boundaries, ctx); + } else { + boundaries = this._getCursorBoundaries(chars, "selection"); + this.renderSelection(chars, boundaries, ctx); + } + ctx.restore(); + }, + _clearTextArea: function(ctx) { + var width = this.oldWidth + 4, height = this.oldHeight + 4; + ctx.clearRect(-width / 2, -height / 2, width, height); + }, + get2DCursorLocation: function(selectionStart) { + if (typeof selectionStart === "undefined") { + selectionStart = this.selectionStart; + } + var len = this._textLines.length; + for (var i = 0; i < len; i++) { + if (selectionStart <= this._textLines[i].length) { + return { + lineIndex: i, + charIndex: selectionStart + }; + } + selectionStart -= this._textLines[i].length + 1; + } + return { + lineIndex: i - 1, + charIndex: this._textLines[i - 1].length < selectionStart ? this._textLines[i - 1].length : selectionStart + }; + }, + getCurrentCharStyle: function(lineIndex, charIndex) { + var style = this._getStyleDeclaration(lineIndex, charIndex === 0 ? 0 : charIndex - 1); + return { + fontSize: style && style.fontSize || this.fontSize, + fill: style && style.fill || this.fill, + textBackgroundColor: style && style.textBackgroundColor || this.textBackgroundColor, + textDecoration: style && style.textDecoration || this.textDecoration, + fontFamily: style && style.fontFamily || this.fontFamily, + fontWeight: style && style.fontWeight || this.fontWeight, + fontStyle: style && style.fontStyle || this.fontStyle, + stroke: style && style.stroke || this.stroke, + strokeWidth: style && style.strokeWidth || this.strokeWidth + }; + }, + getCurrentCharFontSize: function(lineIndex, charIndex) { + var style = this._getStyleDeclaration(lineIndex, charIndex === 0 ? 0 : charIndex - 1); + return style && style.fontSize ? style.fontSize : this.fontSize; + }, + getCurrentCharColor: function(lineIndex, charIndex) { + var style = this._getStyleDeclaration(lineIndex, charIndex === 0 ? 0 : charIndex - 1); + return style && style.fill ? style.fill : this.cursorColor; + }, + _getCursorBoundaries: function(chars, typeOfBoundaries) { + var left = Math.round(this._getLeftOffset()), top = this._getTopOffset(), offsets = this._getCursorBoundariesOffsets(chars, typeOfBoundaries); + return { + left: left, + top: top, + leftOffset: offsets.left + offsets.lineLeft, + topOffset: offsets.top + }; + }, + _getCursorBoundariesOffsets: function(chars, typeOfBoundaries) { + if (this.cursorOffsetCache && "top" in this.cursorOffsetCache) { + return this.cursorOffsetCache; + } + var lineLeftOffset = 0, lineIndex = 0, charIndex = 0, topOffset = 0, leftOffset = 0, boundaries; + for (var i = 0; i < this.selectionStart; i++) { + if (chars[i] === "\n") { + leftOffset = 0; + topOffset += this._getHeightOfLine(this.ctx, lineIndex); + lineIndex++; + charIndex = 0; + } else { + leftOffset += this._getWidthOfChar(this.ctx, chars[i], lineIndex, charIndex); + charIndex++; + } + lineLeftOffset = this._getLineLeftOffset(this._getLineWidth(this.ctx, lineIndex)); + } + if (typeOfBoundaries === "cursor") { + topOffset += (1 - this._fontSizeFraction) * this._getHeightOfLine(this.ctx, lineIndex) / this.lineHeight - this.getCurrentCharFontSize(lineIndex, charIndex) * (1 - this._fontSizeFraction); + } + if (this.charSpacing !== 0 && charIndex === this._textLines[lineIndex].length) { + leftOffset -= this._getWidthOfCharSpacing(); + } + boundaries = { + top: topOffset, + left: leftOffset > 0 ? leftOffset : 0, + lineLeft: lineLeftOffset + }; + this.cursorOffsetCache = boundaries; + return this.cursorOffsetCache; + }, + renderCursor: function(boundaries, ctx) { + var cursorLocation = this.get2DCursorLocation(), lineIndex = cursorLocation.lineIndex, charIndex = cursorLocation.charIndex, charHeight = this.getCurrentCharFontSize(lineIndex, charIndex), leftOffset = lineIndex === 0 && charIndex === 0 ? this._getLineLeftOffset(this._getLineWidth(ctx, lineIndex)) : boundaries.leftOffset, multiplier = this.scaleX * this.canvas.getZoom(), cursorWidth = this.cursorWidth / multiplier; + ctx.fillStyle = this.getCurrentCharColor(lineIndex, charIndex); + ctx.globalAlpha = this.__isMousedown ? 1 : this._currentCursorOpacity; + ctx.fillRect(boundaries.left + leftOffset - cursorWidth / 2, boundaries.top + boundaries.topOffset, cursorWidth, charHeight); + }, + renderSelection: function(chars, boundaries, ctx) { + ctx.fillStyle = this.selectionColor; + var start = this.get2DCursorLocation(this.selectionStart), end = this.get2DCursorLocation(this.selectionEnd), startLine = start.lineIndex, endLine = end.lineIndex; + for (var i = startLine; i <= endLine; i++) { + var lineOffset = this._getLineLeftOffset(this._getLineWidth(ctx, i)) || 0, lineHeight = this._getHeightOfLine(this.ctx, i), realLineHeight = 0, boxWidth = 0, line = this._textLines[i]; + if (i === startLine) { + for (var j = 0, len = line.length; j < len; j++) { + if (j >= start.charIndex && (i !== endLine || j < end.charIndex)) { + boxWidth += this._getWidthOfChar(ctx, line[j], i, j); + } + if (j < start.charIndex) { + lineOffset += this._getWidthOfChar(ctx, line[j], i, j); + } + } + if (j === line.length) { + boxWidth -= this._getWidthOfCharSpacing(); + } + } else if (i > startLine && i < endLine) { + boxWidth += this._getLineWidth(ctx, i) || 5; + } else if (i === endLine) { + for (var j2 = 0, j2len = end.charIndex; j2 < j2len; j2++) { + boxWidth += this._getWidthOfChar(ctx, line[j2], i, j2); + } + if (end.charIndex === line.length) { + boxWidth -= this._getWidthOfCharSpacing(); + } + } + realLineHeight = lineHeight; + if (this.lineHeight < 1 || i === endLine && this.lineHeight > 1) { + lineHeight /= this.lineHeight; + } + ctx.fillRect(boundaries.left + lineOffset, boundaries.top + boundaries.topOffset, boxWidth > 0 ? boxWidth : 0, lineHeight); + boundaries.topOffset += realLineHeight; + } + }, + _renderChars: function(method, ctx, line, left, top, lineIndex, charOffset) { + if (this.isEmptyStyles()) { + return this._renderCharsFast(method, ctx, line, left, top); + } + charOffset = charOffset || 0; + var lineHeight = this._getHeightOfLine(ctx, lineIndex), prevStyle, thisStyle, charsToRender = ""; + ctx.save(); + top -= lineHeight / this.lineHeight * this._fontSizeFraction; + for (var i = charOffset, len = line.length + charOffset; i <= len; i++) { + prevStyle = prevStyle || this.getCurrentCharStyle(lineIndex, i); + thisStyle = this.getCurrentCharStyle(lineIndex, i + 1); + if (this._hasStyleChanged(prevStyle, thisStyle) || i === len) { + this._renderChar(method, ctx, lineIndex, i - 1, charsToRender, left, top, lineHeight); + charsToRender = ""; + prevStyle = thisStyle; + } + charsToRender += line[i - charOffset]; + } + ctx.restore(); + }, + _renderCharsFast: function(method, ctx, line, left, top) { + if (method === "fillText" && this.fill) { + this.callSuper("_renderChars", method, ctx, line, left, top); + } + if (method === "strokeText" && (this.stroke && this.strokeWidth > 0 || this.skipFillStrokeCheck)) { + this.callSuper("_renderChars", method, ctx, line, left, top); + } + }, + _renderChar: function(method, ctx, lineIndex, i, _char, left, top, lineHeight) { + var charWidth, charHeight, shouldFill, shouldStroke, decl = this._getStyleDeclaration(lineIndex, i), offset, textDecoration, chars, additionalSpace, _charWidth; + if (decl) { + charHeight = this._getHeightOfChar(ctx, _char, lineIndex, i); + shouldStroke = decl.stroke; + shouldFill = decl.fill; + textDecoration = decl.textDecoration; + } else { + charHeight = this.fontSize; + } + shouldStroke = (shouldStroke || this.stroke) && method === "strokeText"; + shouldFill = (shouldFill || this.fill) && method === "fillText"; + decl && ctx.save(); + charWidth = this._applyCharStylesGetWidth(ctx, _char, lineIndex, i, decl || null); + textDecoration = textDecoration || this.textDecoration; + if (decl && decl.textBackgroundColor) { + this._removeShadow(ctx); + } + if (this.charSpacing !== 0) { + additionalSpace = this._getWidthOfCharSpacing(); + chars = _char.split(""); + charWidth = 0; + for (var j = 0, len = chars.length, char; j < len; j++) { + char = chars[j]; + shouldFill && ctx.fillText(char, left + charWidth, top); + shouldStroke && ctx.strokeText(char, left + charWidth, top); + _charWidth = ctx.measureText(char).width + additionalSpace; + charWidth += _charWidth > 0 ? _charWidth : 0; + } + } else { + shouldFill && ctx.fillText(_char, left, top); + shouldStroke && ctx.strokeText(_char, left, top); + } + if (textDecoration || textDecoration !== "") { + offset = this._fontSizeFraction * lineHeight / this.lineHeight; + this._renderCharDecoration(ctx, textDecoration, left, top, offset, charWidth, charHeight); + } + decl && ctx.restore(); + ctx.translate(charWidth, 0); + }, + _hasStyleChanged: function(prevStyle, thisStyle) { + return prevStyle.fill !== thisStyle.fill || prevStyle.fontSize !== thisStyle.fontSize || prevStyle.textBackgroundColor !== thisStyle.textBackgroundColor || prevStyle.textDecoration !== thisStyle.textDecoration || prevStyle.fontFamily !== thisStyle.fontFamily || prevStyle.fontWeight !== thisStyle.fontWeight || prevStyle.fontStyle !== thisStyle.fontStyle || prevStyle.stroke !== thisStyle.stroke || prevStyle.strokeWidth !== thisStyle.strokeWidth; + }, + _renderCharDecoration: function(ctx, textDecoration, left, top, offset, charWidth, charHeight) { + if (!textDecoration) { + return; + } + var decorationWeight = charHeight / 15, positions = { + underline: top + charHeight / 10, + "line-through": top - charHeight * (this._fontSizeFraction + this._fontSizeMult - 1) + decorationWeight, + overline: top - (this._fontSizeMult - this._fontSizeFraction) * charHeight + }, decorations = [ "underline", "line-through", "overline" ], i, decoration; + for (i = 0; i < decorations.length; i++) { + decoration = decorations[i]; + if (textDecoration.indexOf(decoration) > -1) { + ctx.fillRect(left, positions[decoration], charWidth, decorationWeight); + } + } + }, + _renderTextLine: function(method, ctx, line, left, top, lineIndex) { + if (!this.isEmptyStyles()) { + top += this.fontSize * (this._fontSizeFraction + .03); + } + this.callSuper("_renderTextLine", method, ctx, line, left, top, lineIndex); + }, + _renderTextDecoration: function(ctx) { + if (this.isEmptyStyles()) { + return this.callSuper("_renderTextDecoration", ctx); + } + }, + _renderTextLinesBackground: function(ctx) { + this.callSuper("_renderTextLinesBackground", ctx); + var lineTopOffset = 0, heightOfLine, lineWidth, lineLeftOffset, leftOffset = this._getLeftOffset(), topOffset = this._getTopOffset(), line, _char, style; + for (var i = 0, len = this._textLines.length; i < len; i++) { + heightOfLine = this._getHeightOfLine(ctx, i); + line = this._textLines[i]; + if (line === "" || !this.styles || !this._getLineStyle(i)) { + lineTopOffset += heightOfLine; + continue; + } + lineWidth = this._getLineWidth(ctx, i); + lineLeftOffset = this._getLineLeftOffset(lineWidth); + for (var j = 0, jlen = line.length; j < jlen; j++) { + style = this._getStyleDeclaration(i, j); + if (!style || !style.textBackgroundColor) { + continue; + } + _char = line[j]; + ctx.fillStyle = style.textBackgroundColor; + ctx.fillRect(leftOffset + lineLeftOffset + this._getWidthOfCharsAt(ctx, i, j), topOffset + lineTopOffset, this._getWidthOfChar(ctx, _char, i, j) + 1, heightOfLine / this.lineHeight); + } + lineTopOffset += heightOfLine; + } + }, + _getCacheProp: function(_char, styleDeclaration) { + return _char + styleDeclaration.fontSize + styleDeclaration.fontWeight + styleDeclaration.fontStyle; + }, + _getFontCache: function(fontFamily) { + if (!fabric.charWidthsCache[fontFamily]) { + fabric.charWidthsCache[fontFamily] = {}; + } + return fabric.charWidthsCache[fontFamily]; + }, + _applyCharStylesGetWidth: function(ctx, _char, lineIndex, charIndex, decl) { + var charDecl = decl || this._getStyleDeclaration(lineIndex, charIndex), styleDeclaration = clone(charDecl), width, cacheProp, charWidthsCache; + this._applyFontStyles(styleDeclaration); + charWidthsCache = this._getFontCache(styleDeclaration.fontFamily); + cacheProp = this._getCacheProp(_char, styleDeclaration); + if (!charDecl && charWidthsCache[cacheProp] && this.caching) { + return charWidthsCache[cacheProp]; + } + if (typeof styleDeclaration.shadow === "string") { + styleDeclaration.shadow = new fabric.Shadow(styleDeclaration.shadow); + } + var fill = styleDeclaration.fill || this.fill; + ctx.fillStyle = fill.toLive ? fill.toLive(ctx, this) : fill; + if (styleDeclaration.stroke) { + ctx.strokeStyle = styleDeclaration.stroke && styleDeclaration.stroke.toLive ? styleDeclaration.stroke.toLive(ctx, this) : styleDeclaration.stroke; + } + ctx.lineWidth = styleDeclaration.strokeWidth || this.strokeWidth; + ctx.font = this._getFontDeclaration.call(styleDeclaration); + if (styleDeclaration.shadow) { + styleDeclaration.scaleX = this.scaleX; + styleDeclaration.scaleY = this.scaleY; + styleDeclaration.canvas = this.canvas; + styleDeclaration.getObjectScaling = this.getObjectScaling; + this._setShadow.call(styleDeclaration, ctx); + } + if (!this.caching || !charWidthsCache[cacheProp]) { + width = ctx.measureText(_char).width; + this.caching && (charWidthsCache[cacheProp] = width); + return width; + } + return charWidthsCache[cacheProp]; + }, + _applyFontStyles: function(styleDeclaration) { + if (!styleDeclaration.fontFamily) { + styleDeclaration.fontFamily = this.fontFamily; + } + if (!styleDeclaration.fontSize) { + styleDeclaration.fontSize = this.fontSize; + } + if (!styleDeclaration.fontWeight) { + styleDeclaration.fontWeight = this.fontWeight; + } + if (!styleDeclaration.fontStyle) { + styleDeclaration.fontStyle = this.fontStyle; + } + }, + _getStyleDeclaration: function(lineIndex, charIndex, returnCloneOrEmpty) { + if (returnCloneOrEmpty) { + return this.styles[lineIndex] && this.styles[lineIndex][charIndex] ? clone(this.styles[lineIndex][charIndex]) : {}; + } + return this.styles[lineIndex] && this.styles[lineIndex][charIndex] ? this.styles[lineIndex][charIndex] : null; + }, + _setStyleDeclaration: function(lineIndex, charIndex, style) { + this.styles[lineIndex][charIndex] = style; + }, + _deleteStyleDeclaration: function(lineIndex, charIndex) { + delete this.styles[lineIndex][charIndex]; + }, + _getLineStyle: function(lineIndex) { + return this.styles[lineIndex]; + }, + _setLineStyle: function(lineIndex, style) { + this.styles[lineIndex] = style; + }, + _deleteLineStyle: function(lineIndex) { + delete this.styles[lineIndex]; + }, + _getWidthOfChar: function(ctx, _char, lineIndex, charIndex) { + if (!this._isMeasuring && this.textAlign === "justify" && this._reSpacesAndTabs.test(_char)) { + return this._getWidthOfSpace(ctx, lineIndex); + } + ctx.save(); + var width = this._applyCharStylesGetWidth(ctx, _char, lineIndex, charIndex); + if (this.charSpacing !== 0) { + width += this._getWidthOfCharSpacing(); + } + ctx.restore(); + return width > 0 ? width : 0; + }, + _getHeightOfChar: function(ctx, lineIndex, charIndex) { + var style = this._getStyleDeclaration(lineIndex, charIndex); + return style && style.fontSize ? style.fontSize : this.fontSize; + }, + _getWidthOfCharsAt: function(ctx, lineIndex, charIndex) { + var width = 0, i, _char; + for (i = 0; i < charIndex; i++) { + _char = this._textLines[lineIndex][i]; + width += this._getWidthOfChar(ctx, _char, lineIndex, i); + } + return width; + }, + _measureLine: function(ctx, lineIndex) { + this._isMeasuring = true; + var width = this._getWidthOfCharsAt(ctx, lineIndex, this._textLines[lineIndex].length); + if (this.charSpacing !== 0) { + width -= this._getWidthOfCharSpacing(); + } + this._isMeasuring = false; + return width > 0 ? width : 0; + }, + _getWidthOfSpace: function(ctx, lineIndex) { + if (this.__widthOfSpace[lineIndex]) { + return this.__widthOfSpace[lineIndex]; + } + var line = this._textLines[lineIndex], wordsWidth = this._getWidthOfWords(ctx, line, lineIndex, 0), widthDiff = this.width - wordsWidth, numSpaces = line.length - line.replace(this._reSpacesAndTabs, "").length, width = Math.max(widthDiff / numSpaces, ctx.measureText(" ").width); + this.__widthOfSpace[lineIndex] = width; + return width; + }, + _getWidthOfWords: function(ctx, line, lineIndex, charOffset) { + var width = 0; + for (var charIndex = 0; charIndex < line.length; charIndex++) { + var _char = line[charIndex]; + if (!_char.match(/\s/)) { + width += this._getWidthOfChar(ctx, _char, lineIndex, charIndex + charOffset); + } + } + return width; + }, + _getHeightOfLine: function(ctx, lineIndex) { + if (this.__lineHeights[lineIndex]) { + return this.__lineHeights[lineIndex]; + } + var line = this._textLines[lineIndex], maxHeight = this._getHeightOfChar(ctx, lineIndex, 0); + for (var i = 1, len = line.length; i < len; i++) { + var currentCharHeight = this._getHeightOfChar(ctx, lineIndex, i); + if (currentCharHeight > maxHeight) { + maxHeight = currentCharHeight; + } + } + this.__lineHeights[lineIndex] = maxHeight * this.lineHeight * this._fontSizeMult; + return this.__lineHeights[lineIndex]; + }, + _getTextHeight: function(ctx) { + var lineHeight, height = 0; + for (var i = 0, len = this._textLines.length; i < len; i++) { + lineHeight = this._getHeightOfLine(ctx, i); + height += i === len - 1 ? lineHeight / this.lineHeight : lineHeight; + } + return height; + }, + toObject: function(propertiesToInclude) { + var clonedStyles = {}, i, j, row; + for (i in this.styles) { + row = this.styles[i]; + clonedStyles[i] = {}; + for (j in row) { + clonedStyles[i][j] = clone(row[j]); + } + } + return fabric.util.object.extend(this.callSuper("toObject", propertiesToInclude), { + styles: clonedStyles + }); + } + }); + fabric.IText.fromObject = function(object, callback) { + var iText = new fabric.IText(object.text, clone(object)); + callback && callback(iText); + return iText; + }; +})(); + +(function() { + var clone = fabric.util.object.clone; + fabric.util.object.extend(fabric.IText.prototype, { + initBehavior: function() { + this.initAddedHandler(); + this.initRemovedHandler(); + this.initCursorSelectionHandlers(); + this.initDoubleClickSimulation(); + this.mouseMoveHandler = this.mouseMoveHandler.bind(this); + }, + initSelectedHandler: function() { + this.on("selected", function() { + var _this = this; + setTimeout(function() { + _this.selected = true; + }, 100); + }); + }, + initAddedHandler: function() { + var _this = this; + this.on("added", function() { + var canvas = _this.canvas; + if (canvas) { + if (!canvas._hasITextHandlers) { + canvas._hasITextHandlers = true; + _this._initCanvasHandlers(canvas); + } + canvas._iTextInstances = canvas._iTextInstances || []; + canvas._iTextInstances.push(_this); + } + }); + }, + initRemovedHandler: function() { + var _this = this; + this.on("removed", function() { + var canvas = _this.canvas; + if (canvas) { + canvas._iTextInstances = canvas._iTextInstances || []; + fabric.util.removeFromArray(canvas._iTextInstances, _this); + if (canvas._iTextInstances.length === 0) { + canvas._hasITextHandlers = false; + _this._removeCanvasHandlers(canvas); + } + } + }); + }, + _initCanvasHandlers: function(canvas) { + canvas._canvasITextSelectionClearedHanlder = function() { + fabric.IText.prototype.exitEditingOnOthers(canvas); + }.bind(this); + canvas._mouseUpITextHandler = function() { + if (canvas._iTextInstances) { + canvas._iTextInstances.forEach(function(obj) { + obj.__isMousedown = false; + }); + } + }.bind(this); + canvas.on("selection:cleared", canvas._canvasITextSelectionClearedHanlder); + canvas.on("object:selected", canvas._canvasITextSelectionClearedHanlder); + canvas.on("mouse:up", canvas._mouseUpITextHandler); + }, + _removeCanvasHandlers: function(canvas) { + canvas.off("selection:cleared", canvas._canvasITextSelectionClearedHanlder); + canvas.off("object:selected", canvas._canvasITextSelectionClearedHanlder); + canvas.off("mouse:up", canvas._mouseUpITextHandler); + }, + _tick: function() { + this._currentTickState = this._animateCursor(this, 1, this.cursorDuration, "_onTickComplete"); + }, + _animateCursor: function(obj, targetOpacity, duration, completeMethod) { + var tickState; + tickState = { + isAborted: false, + abort: function() { + this.isAborted = true; + } + }; + obj.animate("_currentCursorOpacity", targetOpacity, { + duration: duration, + onComplete: function() { + if (!tickState.isAborted) { + obj[completeMethod](); + } + }, + onChange: function() { + if (obj.canvas && obj.selectionStart === obj.selectionEnd) { + obj.renderCursorOrSelection(); + } + }, + abort: function() { + return tickState.isAborted; + } + }); + return tickState; + }, + _onTickComplete: function() { + var _this = this; + if (this._cursorTimeout1) { + clearTimeout(this._cursorTimeout1); + } + this._cursorTimeout1 = setTimeout(function() { + _this._currentTickCompleteState = _this._animateCursor(_this, 0, this.cursorDuration / 2, "_tick"); + }, 100); + }, + initDelayedCursor: function(restart) { + var _this = this, delay = restart ? 0 : this.cursorDelay; + this.abortCursorAnimation(); + this._currentCursorOpacity = 1; + this._cursorTimeout2 = setTimeout(function() { + _this._tick(); + }, delay); + }, + abortCursorAnimation: function() { + var shouldClear = this._currentTickState || this._currentTickCompleteState; + this._currentTickState && this._currentTickState.abort(); + this._currentTickCompleteState && this._currentTickCompleteState.abort(); + clearTimeout(this._cursorTimeout1); + clearTimeout(this._cursorTimeout2); + this._currentCursorOpacity = 0; + if (shouldClear) { + this.canvas && this.canvas.clearContext(this.canvas.contextTop || this.ctx); + } + }, + selectAll: function() { + this.selectionStart = 0; + this.selectionEnd = this.text.length; + this._fireSelectionChanged(); + this._updateTextarea(); + }, + getSelectedText: function() { + return this.text.slice(this.selectionStart, this.selectionEnd); + }, + findWordBoundaryLeft: function(startFrom) { + var offset = 0, index = startFrom - 1; + if (this._reSpace.test(this.text.charAt(index))) { + while (this._reSpace.test(this.text.charAt(index))) { + offset++; + index--; + } + } + while (/\S/.test(this.text.charAt(index)) && index > -1) { + offset++; + index--; + } + return startFrom - offset; + }, + findWordBoundaryRight: function(startFrom) { + var offset = 0, index = startFrom; + if (this._reSpace.test(this.text.charAt(index))) { + while (this._reSpace.test(this.text.charAt(index))) { + offset++; + index++; + } + } + while (/\S/.test(this.text.charAt(index)) && index < this.text.length) { + offset++; + index++; + } + return startFrom + offset; + }, + findLineBoundaryLeft: function(startFrom) { + var offset = 0, index = startFrom - 1; + while (!/\n/.test(this.text.charAt(index)) && index > -1) { + offset++; + index--; + } + return startFrom - offset; + }, + findLineBoundaryRight: function(startFrom) { + var offset = 0, index = startFrom; + while (!/\n/.test(this.text.charAt(index)) && index < this.text.length) { + offset++; + index++; + } + return startFrom + offset; + }, + getNumNewLinesInSelectedText: function() { + var selectedText = this.getSelectedText(), numNewLines = 0; + for (var i = 0, len = selectedText.length; i < len; i++) { + if (selectedText[i] === "\n") { + numNewLines++; + } + } + return numNewLines; + }, + searchWordBoundary: function(selectionStart, direction) { + var index = this._reSpace.test(this.text.charAt(selectionStart)) ? selectionStart - 1 : selectionStart, _char = this.text.charAt(index), reNonWord = /[ \n\.,;!\?\-]/; + while (!reNonWord.test(_char) && index > 0 && index < this.text.length) { + index += direction; + _char = this.text.charAt(index); + } + if (reNonWord.test(_char) && _char !== "\n") { + index += direction === 1 ? 0 : 1; + } + return index; + }, + selectWord: function(selectionStart) { + selectionStart = selectionStart || this.selectionStart; + var newSelectionStart = this.searchWordBoundary(selectionStart, -1), newSelectionEnd = this.searchWordBoundary(selectionStart, 1); + this.selectionStart = newSelectionStart; + this.selectionEnd = newSelectionEnd; + this._fireSelectionChanged(); + this._updateTextarea(); + this.renderCursorOrSelection(); + }, + selectLine: function(selectionStart) { + selectionStart = selectionStart || this.selectionStart; + var newSelectionStart = this.findLineBoundaryLeft(selectionStart), newSelectionEnd = this.findLineBoundaryRight(selectionStart); + this.selectionStart = newSelectionStart; + this.selectionEnd = newSelectionEnd; + this._fireSelectionChanged(); + this._updateTextarea(); + }, + enterEditing: function(e) { + if (this.isEditing || !this.editable) { + return; + } + if (this.canvas) { + this.exitEditingOnOthers(this.canvas); + } + this.isEditing = true; + this.initHiddenTextarea(e); + this.hiddenTextarea.focus(); + this._updateTextarea(); + this._saveEditingProps(); + this._setEditingProps(); + this._textBeforeEdit = this.text; + this._tick(); + this.fire("editing:entered"); + if (!this.canvas) { + return this; + } + this.canvas.fire("text:editing:entered", { + target: this + }); + this.initMouseMoveHandler(); + this.canvas.renderAll(); + return this; + }, + exitEditingOnOthers: function(canvas) { + if (canvas._iTextInstances) { + canvas._iTextInstances.forEach(function(obj) { + obj.selected = false; + if (obj.isEditing) { + obj.exitEditing(); + } + }); + } + }, + initMouseMoveHandler: function() { + this.canvas.on("mouse:move", this.mouseMoveHandler); + }, + mouseMoveHandler: function(options) { + if (!this.__isMousedown || !this.isEditing) { + return; + } + var newSelectionStart = this.getSelectionStartFromPointer(options.e), currentStart = this.selectionStart, currentEnd = this.selectionEnd; + if (newSelectionStart === this.__selectionStartOnMouseDown) { + return; + } + if (newSelectionStart > this.__selectionStartOnMouseDown) { + this.selectionStart = this.__selectionStartOnMouseDown; + this.selectionEnd = newSelectionStart; + } else { + this.selectionStart = newSelectionStart; + this.selectionEnd = this.__selectionStartOnMouseDown; + } + if (this.selectionStart !== currentStart || this.selectionEnd !== currentEnd) { + this._fireSelectionChanged(); + this._updateTextarea(); + this.renderCursorOrSelection(); + } + }, + _setEditingProps: function() { + this.hoverCursor = "text"; + if (this.canvas) { + this.canvas.defaultCursor = this.canvas.moveCursor = "text"; + } + this.borderColor = this.editingBorderColor; + this.hasControls = this.selectable = false; + this.lockMovementX = this.lockMovementY = true; + }, + _updateTextarea: function() { + if (!this.hiddenTextarea || this.inCompositionMode) { + return; + } + this.cursorOffsetCache = {}; + this.hiddenTextarea.value = this.text; + this.hiddenTextarea.selectionStart = this.selectionStart; + this.hiddenTextarea.selectionEnd = this.selectionEnd; + if (this.selectionStart === this.selectionEnd) { + var style = this._calcTextareaPosition(); + this.hiddenTextarea.style.left = style.left; + this.hiddenTextarea.style.top = style.top; + this.hiddenTextarea.style.fontSize = style.fontSize; + } + }, + _calcTextareaPosition: function() { + if (!this.canvas) { + return { + x: 1, + y: 1 + }; + } + var chars = this.text.split(""), boundaries = this._getCursorBoundaries(chars, "cursor"), cursorLocation = this.get2DCursorLocation(), lineIndex = cursorLocation.lineIndex, charIndex = cursorLocation.charIndex, charHeight = this.getCurrentCharFontSize(lineIndex, charIndex), leftOffset = lineIndex === 0 && charIndex === 0 ? this._getLineLeftOffset(this._getLineWidth(this.ctx, lineIndex)) : boundaries.leftOffset, m = this.calcTransformMatrix(), p = { + x: boundaries.left + leftOffset, + y: boundaries.top + boundaries.topOffset + charHeight + }, upperCanvas = this.canvas.upperCanvasEl, maxWidth = upperCanvas.width - charHeight, maxHeight = upperCanvas.height - charHeight; + p = fabric.util.transformPoint(p, m); + p = fabric.util.transformPoint(p, this.canvas.viewportTransform); + if (p.x < 0) { + p.x = 0; + } + if (p.x > maxWidth) { + p.x = maxWidth; + } + if (p.y < 0) { + p.y = 0; + } + if (p.y > maxHeight) { + p.y = maxHeight; + } + p.x += this.canvas._offset.left; + p.y += this.canvas._offset.top; + return { + left: p.x + "px", + top: p.y + "px", + fontSize: charHeight + }; + }, + _saveEditingProps: function() { + this._savedProps = { + hasControls: this.hasControls, + borderColor: this.borderColor, + lockMovementX: this.lockMovementX, + lockMovementY: this.lockMovementY, + hoverCursor: this.hoverCursor, + defaultCursor: this.canvas && this.canvas.defaultCursor, + moveCursor: this.canvas && this.canvas.moveCursor + }; + }, + _restoreEditingProps: function() { + if (!this._savedProps) { + return; + } + this.hoverCursor = this._savedProps.overCursor; + this.hasControls = this._savedProps.hasControls; + this.borderColor = this._savedProps.borderColor; + this.lockMovementX = this._savedProps.lockMovementX; + this.lockMovementY = this._savedProps.lockMovementY; + if (this.canvas) { + this.canvas.defaultCursor = this._savedProps.defaultCursor; + this.canvas.moveCursor = this._savedProps.moveCursor; + } + }, + exitEditing: function() { + var isTextChanged = this._textBeforeEdit !== this.text; + this.selected = false; + this.isEditing = false; + this.selectable = true; + this.selectionEnd = this.selectionStart; + this.hiddenTextarea && this.canvas && this.hiddenTextarea.parentNode.removeChild(this.hiddenTextarea); + this.hiddenTextarea = null; + this.abortCursorAnimation(); + this._restoreEditingProps(); + this._currentCursorOpacity = 0; + this.fire("editing:exited"); + isTextChanged && this.fire("modified"); + if (this.canvas) { + this.canvas.off("mouse:move", this.mouseMoveHandler); + this.canvas.fire("text:editing:exited", { + target: this + }); + isTextChanged && this.canvas.fire("object:modified", { + target: this + }); + } + return this; + }, + _removeExtraneousStyles: function() { + for (var prop in this.styles) { + if (!this._textLines[prop]) { + delete this.styles[prop]; + } + } + }, + _removeCharsFromTo: function(start, end) { + while (end !== start) { + this._removeSingleCharAndStyle(start + 1); + end--; + } + this.selectionStart = start; + this.selectionEnd = start; + }, + _removeSingleCharAndStyle: function(index) { + var isBeginningOfLine = this.text[index - 1] === "\n", indexStyle = isBeginningOfLine ? index : index - 1; + this.removeStyleObject(isBeginningOfLine, indexStyle); + this.text = this.text.slice(0, index - 1) + this.text.slice(index); + this._textLines = this._splitTextIntoLines(); + }, + insertChars: function(_chars, useCopiedStyle) { + var style; + if (this.selectionEnd - this.selectionStart > 1) { + this._removeCharsFromTo(this.selectionStart, this.selectionEnd); + } + if (!useCopiedStyle && this.isEmptyStyles()) { + this.insertChar(_chars, false); + return; + } + for (var i = 0, len = _chars.length; i < len; i++) { + if (useCopiedStyle) { + style = fabric.copiedTextStyle[i]; + } + this.insertChar(_chars[i], i < len - 1, style); + } + }, + insertChar: function(_char, skipUpdate, styleObject) { + var isEndOfLine = this.text[this.selectionStart] === "\n"; + this.text = this.text.slice(0, this.selectionStart) + _char + this.text.slice(this.selectionEnd); + this._textLines = this._splitTextIntoLines(); + this.insertStyleObjects(_char, isEndOfLine, styleObject); + this.selectionStart += _char.length; + this.selectionEnd = this.selectionStart; + if (skipUpdate) { + return; + } + this._updateTextarea(); + this.setCoords(); + this._fireSelectionChanged(); + this.fire("changed"); + this.canvas && this.canvas.fire("text:changed", { + target: this + }); + this.canvas && this.canvas.renderAll(); + }, + insertNewlineStyleObject: function(lineIndex, charIndex, isEndOfLine) { + this.shiftLineStyles(lineIndex, +1); + if (!this.styles[lineIndex + 1]) { + this.styles[lineIndex + 1] = {}; + } + var currentCharStyle = {}, newLineStyles = {}; + if (this.styles[lineIndex] && this.styles[lineIndex][charIndex - 1]) { + currentCharStyle = this.styles[lineIndex][charIndex - 1]; + } + if (isEndOfLine) { + newLineStyles[0] = clone(currentCharStyle); + this.styles[lineIndex + 1] = newLineStyles; + } else { + for (var index in this.styles[lineIndex]) { + if (parseInt(index, 10) >= charIndex) { + newLineStyles[parseInt(index, 10) - charIndex] = this.styles[lineIndex][index]; + delete this.styles[lineIndex][index]; + } + } + this.styles[lineIndex + 1] = newLineStyles; + } + this._forceClearCache = true; + }, + insertCharStyleObject: function(lineIndex, charIndex, style) { + var currentLineStyles = this.styles[lineIndex], currentLineStylesCloned = clone(currentLineStyles); + if (charIndex === 0 && !style) { + charIndex = 1; + } + for (var index in currentLineStylesCloned) { + var numericIndex = parseInt(index, 10); + if (numericIndex >= charIndex) { + currentLineStyles[numericIndex + 1] = currentLineStylesCloned[numericIndex]; + if (!currentLineStylesCloned[numericIndex - 1]) { + delete currentLineStyles[numericIndex]; + } + } + } + this.styles[lineIndex][charIndex] = style || clone(currentLineStyles[charIndex - 1]); + this._forceClearCache = true; + }, + insertStyleObjects: function(_chars, isEndOfLine, styleObject) { + var cursorLocation = this.get2DCursorLocation(), lineIndex = cursorLocation.lineIndex, charIndex = cursorLocation.charIndex; + if (!this._getLineStyle(lineIndex)) { + this._setLineStyle(lineIndex, {}); + } + if (_chars === "\n") { + this.insertNewlineStyleObject(lineIndex, charIndex, isEndOfLine); + } else { + this.insertCharStyleObject(lineIndex, charIndex, styleObject); + } + }, + shiftLineStyles: function(lineIndex, offset) { + var clonedStyles = clone(this.styles); + for (var line in this.styles) { + var numericLine = parseInt(line, 10); + if (numericLine > lineIndex) { + this.styles[numericLine + offset] = clonedStyles[numericLine]; + if (!clonedStyles[numericLine - offset]) { + delete this.styles[numericLine]; + } + } + } + }, + removeStyleObject: function(isBeginningOfLine, index) { + var cursorLocation = this.get2DCursorLocation(index), lineIndex = cursorLocation.lineIndex, charIndex = cursorLocation.charIndex; + this._removeStyleObject(isBeginningOfLine, cursorLocation, lineIndex, charIndex); + }, + _getTextOnPreviousLine: function(lIndex) { + return this._textLines[lIndex - 1]; + }, + _removeStyleObject: function(isBeginningOfLine, cursorLocation, lineIndex, charIndex) { + if (isBeginningOfLine) { + var textOnPreviousLine = this._getTextOnPreviousLine(cursorLocation.lineIndex), newCharIndexOnPrevLine = textOnPreviousLine ? textOnPreviousLine.length : 0; + if (!this.styles[lineIndex - 1]) { + this.styles[lineIndex - 1] = {}; + } + for (charIndex in this.styles[lineIndex]) { + this.styles[lineIndex - 1][parseInt(charIndex, 10) + newCharIndexOnPrevLine] = this.styles[lineIndex][charIndex]; + } + this.shiftLineStyles(cursorLocation.lineIndex, -1); + } else { + var currentLineStyles = this.styles[lineIndex]; + if (currentLineStyles) { + delete currentLineStyles[charIndex]; + } + var currentLineStylesCloned = clone(currentLineStyles); + for (var i in currentLineStylesCloned) { + var numericIndex = parseInt(i, 10); + if (numericIndex >= charIndex && numericIndex !== 0) { + currentLineStyles[numericIndex - 1] = currentLineStylesCloned[numericIndex]; + delete currentLineStyles[numericIndex]; + } + } + } + }, + insertNewline: function() { + this.insertChars("\n"); + }, + setSelectionStartEndWithShift: function(start, end, newSelection) { + if (newSelection <= start) { + if (end === start) { + this._selectionDirection = "left"; + } else if (this._selectionDirection === "right") { + this._selectionDirection = "left"; + this.selectionEnd = start; + } + this.selectionStart = newSelection; + } else if (newSelection > start && newSelection < end) { + if (this._selectionDirection === "right") { + this.selectionEnd = newSelection; + } else { + this.selectionStart = newSelection; + } + } else { + if (end === start) { + this._selectionDirection = "right"; + } else if (this._selectionDirection === "left") { + this._selectionDirection = "right"; + this.selectionStart = end; + } + this.selectionEnd = newSelection; + } + }, + setSelectionInBoundaries: function() { + var length = this.text.length; + if (this.selectionStart > length) { + this.selectionStart = length; + } else if (this.selectionStart < 0) { + this.selectionStart = 0; + } + if (this.selectionEnd > length) { + this.selectionEnd = length; + } else if (this.selectionEnd < 0) { + this.selectionEnd = 0; + } + } + }); +})(); + +fabric.util.object.extend(fabric.IText.prototype, { + initDoubleClickSimulation: function() { + this.__lastClickTime = +new Date(); + this.__lastLastClickTime = +new Date(); + this.__lastPointer = {}; + this.on("mousedown", this.onMouseDown.bind(this)); + }, + onMouseDown: function(options) { + this.__newClickTime = +new Date(); + var newPointer = this.canvas.getPointer(options.e); + if (this.isTripleClick(newPointer)) { + this.fire("tripleclick", options); + this._stopEvent(options.e); + } else if (this.isDoubleClick(newPointer)) { + this.fire("dblclick", options); + this._stopEvent(options.e); + } + this.__lastLastClickTime = this.__lastClickTime; + this.__lastClickTime = this.__newClickTime; + this.__lastPointer = newPointer; + this.__lastIsEditing = this.isEditing; + this.__lastSelected = this.selected; + }, + isDoubleClick: function(newPointer) { + return this.__newClickTime - this.__lastClickTime < 500 && this.__lastPointer.x === newPointer.x && this.__lastPointer.y === newPointer.y && this.__lastIsEditing; + }, + isTripleClick: function(newPointer) { + return this.__newClickTime - this.__lastClickTime < 500 && this.__lastClickTime - this.__lastLastClickTime < 500 && this.__lastPointer.x === newPointer.x && this.__lastPointer.y === newPointer.y; + }, + _stopEvent: function(e) { + e.preventDefault && e.preventDefault(); + e.stopPropagation && e.stopPropagation(); + }, + initCursorSelectionHandlers: function() { + this.initSelectedHandler(); + this.initMousedownHandler(); + this.initMouseupHandler(); + this.initClicks(); + }, + initClicks: function() { + this.on("dblclick", function(options) { + this.selectWord(this.getSelectionStartFromPointer(options.e)); + }); + this.on("tripleclick", function(options) { + this.selectLine(this.getSelectionStartFromPointer(options.e)); + }); + }, + initMousedownHandler: function() { + this.on("mousedown", function(options) { + if (!this.editable) { + return; + } + var pointer = this.canvas.getPointer(options.e); + this.__mousedownX = pointer.x; + this.__mousedownY = pointer.y; + this.__isMousedown = true; + if (this.selected) { + this.setCursorByClick(options.e); + } + if (this.isEditing) { + this.__selectionStartOnMouseDown = this.selectionStart; + if (this.selectionStart === this.selectionEnd) { + this.abortCursorAnimation(); + } + this.renderCursorOrSelection(); + } + }); + }, + _isObjectMoved: function(e) { + var pointer = this.canvas.getPointer(e); + return this.__mousedownX !== pointer.x || this.__mousedownY !== pointer.y; + }, + initMouseupHandler: function() { + this.on("mouseup", function(options) { + this.__isMousedown = false; + if (!this.editable || this._isObjectMoved(options.e)) { + return; + } + if (this.__lastSelected && !this.__corner) { + this.enterEditing(options.e); + if (this.selectionStart === this.selectionEnd) { + this.initDelayedCursor(true); + } else { + this.renderCursorOrSelection(); + } + } + this.selected = true; + }); + }, + setCursorByClick: function(e) { + var newSelection = this.getSelectionStartFromPointer(e), start = this.selectionStart, end = this.selectionEnd; + if (e.shiftKey) { + this.setSelectionStartEndWithShift(start, end, newSelection); + } else { + this.selectionStart = newSelection; + this.selectionEnd = newSelection; + } + this._fireSelectionChanged(); + this._updateTextarea(); + }, + getSelectionStartFromPointer: function(e) { + var mouseOffset = this.getLocalPointer(e), prevWidth = 0, width = 0, height = 0, charIndex = 0, newSelectionStart, line; + for (var i = 0, len = this._textLines.length; i < len; i++) { + line = this._textLines[i]; + height += this._getHeightOfLine(this.ctx, i) * this.scaleY; + var widthOfLine = this._getLineWidth(this.ctx, i), lineLeftOffset = this._getLineLeftOffset(widthOfLine); + width = lineLeftOffset * this.scaleX; + for (var j = 0, jlen = line.length; j < jlen; j++) { + prevWidth = width; + width += this._getWidthOfChar(this.ctx, line[j], i, this.flipX ? jlen - j : j) * this.scaleX; + if (height <= mouseOffset.y || width <= mouseOffset.x) { + charIndex++; + continue; + } + return this._getNewSelectionStartFromOffset(mouseOffset, prevWidth, width, charIndex + i, jlen); + } + if (mouseOffset.y < height) { + return this._getNewSelectionStartFromOffset(mouseOffset, prevWidth, width, charIndex + i - 1, jlen); + } + } + if (typeof newSelectionStart === "undefined") { + return this.text.length; + } + }, + _getNewSelectionStartFromOffset: function(mouseOffset, prevWidth, width, index, jlen) { + var distanceBtwLastCharAndCursor = mouseOffset.x - prevWidth, distanceBtwNextCharAndCursor = width - mouseOffset.x, offset = distanceBtwNextCharAndCursor > distanceBtwLastCharAndCursor ? 0 : 1, newSelectionStart = index + offset; + if (this.flipX) { + newSelectionStart = jlen - newSelectionStart; + } + if (newSelectionStart > this.text.length) { + newSelectionStart = this.text.length; + } + return newSelectionStart; + } +}); + +fabric.util.object.extend(fabric.IText.prototype, { + initHiddenTextarea: function() { + this.hiddenTextarea = fabric.document.createElement("textarea"); + this.hiddenTextarea.setAttribute("autocapitalize", "off"); + var style = this._calcTextareaPosition(); + this.hiddenTextarea.style.cssText = "position: absolute; top: " + style.top + "; left: " + style.left + ";" + " opacity: 0; width: 0px; height: 0px; z-index: -999;"; + fabric.document.body.appendChild(this.hiddenTextarea); + fabric.util.addListener(this.hiddenTextarea, "keydown", this.onKeyDown.bind(this)); + fabric.util.addListener(this.hiddenTextarea, "keyup", this.onKeyUp.bind(this)); + fabric.util.addListener(this.hiddenTextarea, "input", this.onInput.bind(this)); + fabric.util.addListener(this.hiddenTextarea, "copy", this.copy.bind(this)); + fabric.util.addListener(this.hiddenTextarea, "cut", this.cut.bind(this)); + fabric.util.addListener(this.hiddenTextarea, "paste", this.paste.bind(this)); + fabric.util.addListener(this.hiddenTextarea, "compositionstart", this.onCompositionStart.bind(this)); + fabric.util.addListener(this.hiddenTextarea, "compositionupdate", this.onCompositionUpdate.bind(this)); + fabric.util.addListener(this.hiddenTextarea, "compositionend", this.onCompositionEnd.bind(this)); + if (!this._clickHandlerInitialized && this.canvas) { + fabric.util.addListener(this.canvas.upperCanvasEl, "click", this.onClick.bind(this)); + this._clickHandlerInitialized = true; + } + }, + _keysMap: { + 8: "removeChars", + 9: "exitEditing", + 27: "exitEditing", + 13: "insertNewline", + 33: "moveCursorUp", + 34: "moveCursorDown", + 35: "moveCursorRight", + 36: "moveCursorLeft", + 37: "moveCursorLeft", + 38: "moveCursorUp", + 39: "moveCursorRight", + 40: "moveCursorDown", + 46: "forwardDelete" + }, + _ctrlKeysMapUp: { + 67: "copy", + 88: "cut" + }, + _ctrlKeysMapDown: { + 65: "selectAll" + }, + onClick: function() { + this.hiddenTextarea && this.hiddenTextarea.focus(); + }, + onKeyDown: function(e) { + if (!this.isEditing) { + return; + } + if (e.keyCode in this._keysMap) { + this[this._keysMap[e.keyCode]](e); + } else if (e.keyCode in this._ctrlKeysMapDown && (e.ctrlKey || e.metaKey)) { + this[this._ctrlKeysMapDown[e.keyCode]](e); + } else { + return; + } + e.stopImmediatePropagation(); + e.preventDefault(); + this.canvas && this.canvas.renderAll(); + }, + onKeyUp: function(e) { + if (!this.isEditing || this._copyDone) { + this._copyDone = false; + return; + } + if (e.keyCode in this._ctrlKeysMapUp && (e.ctrlKey || e.metaKey)) { + this[this._ctrlKeysMapUp[e.keyCode]](e); + } else { + return; + } + e.stopImmediatePropagation(); + e.preventDefault(); + this.canvas && this.canvas.renderAll(); + }, + onInput: function(e) { + if (!this.isEditing || this.inCompositionMode) { + return; + } + var offset = this.selectionStart || 0, offsetEnd = this.selectionEnd || 0, textLength = this.text.length, newTextLength = this.hiddenTextarea.value.length, diff, charsToInsert, start; + if (newTextLength > textLength) { + start = this._selectionDirection === "left" ? offsetEnd : offset; + diff = newTextLength - textLength; + charsToInsert = this.hiddenTextarea.value.slice(start, start + diff); + } else { + diff = newTextLength - textLength + offsetEnd - offset; + charsToInsert = this.hiddenTextarea.value.slice(offset, offset + diff); + } + this.insertChars(charsToInsert); + e.stopPropagation(); + }, + onCompositionStart: function() { + this.inCompositionMode = true; + this.prevCompositionLength = 0; + this.compositionStart = this.selectionStart; + }, + onCompositionEnd: function() { + this.inCompositionMode = false; + }, + onCompositionUpdate: function(e) { + var data = e.data; + this.selectionStart = this.compositionStart; + this.selectionEnd = this.selectionEnd === this.selectionStart ? this.compositionStart + this.prevCompositionLength : this.selectionEnd; + this.insertChars(data, false); + this.prevCompositionLength = data.length; + }, + forwardDelete: function(e) { + if (this.selectionStart === this.selectionEnd) { + if (this.selectionStart === this.text.length) { + return; + } + this.moveCursorRight(e); + } + this.removeChars(e); + }, + copy: function(e) { + if (this.selectionStart === this.selectionEnd) { + return; + } + var selectedText = this.getSelectedText(), clipboardData = this._getClipboardData(e); + if (clipboardData) { + clipboardData.setData("text", selectedText); + } + fabric.copiedText = selectedText; + fabric.copiedTextStyle = this.getSelectionStyles(this.selectionStart, this.selectionEnd); + e.stopImmediatePropagation(); + e.preventDefault(); + this._copyDone = true; + }, + paste: function(e) { + var copiedText = null, clipboardData = this._getClipboardData(e), useCopiedStyle = true; + if (clipboardData) { + copiedText = clipboardData.getData("text").replace(/\r/g, ""); + if (!fabric.copiedTextStyle || fabric.copiedText !== copiedText) { + useCopiedStyle = false; + } + } else { + copiedText = fabric.copiedText; + } + if (copiedText) { + this.insertChars(copiedText, useCopiedStyle); + } + e.stopImmediatePropagation(); + e.preventDefault(); + }, + cut: function(e) { + if (this.selectionStart === this.selectionEnd) { + return; + } + this.copy(e); + this.removeChars(e); + }, + _getClipboardData: function(e) { + return e && e.clipboardData || fabric.window.clipboardData; + }, + _getWidthBeforeCursor: function(lineIndex, charIndex) { + var textBeforeCursor = this._textLines[lineIndex].slice(0, charIndex), widthOfLine = this._getLineWidth(this.ctx, lineIndex), widthBeforeCursor = this._getLineLeftOffset(widthOfLine), _char; + for (var i = 0, len = textBeforeCursor.length; i < len; i++) { + _char = textBeforeCursor[i]; + widthBeforeCursor += this._getWidthOfChar(this.ctx, _char, lineIndex, i); + } + return widthBeforeCursor; + }, + getDownCursorOffset: function(e, isRight) { + var selectionProp = this._getSelectionForOffset(e, isRight), cursorLocation = this.get2DCursorLocation(selectionProp), lineIndex = cursorLocation.lineIndex; + if (lineIndex === this._textLines.length - 1 || e.metaKey || e.keyCode === 34) { + return this.text.length - selectionProp; + } + var charIndex = cursorLocation.charIndex, widthBeforeCursor = this._getWidthBeforeCursor(lineIndex, charIndex), indexOnOtherLine = this._getIndexOnLine(lineIndex + 1, widthBeforeCursor), textAfterCursor = this._textLines[lineIndex].slice(charIndex); + return textAfterCursor.length + indexOnOtherLine + 2; + }, + _getSelectionForOffset: function(e, isRight) { + if (e.shiftKey && this.selectionStart !== this.selectionEnd && isRight) { + return this.selectionEnd; + } else { + return this.selectionStart; + } + }, + getUpCursorOffset: function(e, isRight) { + var selectionProp = this._getSelectionForOffset(e, isRight), cursorLocation = this.get2DCursorLocation(selectionProp), lineIndex = cursorLocation.lineIndex; + if (lineIndex === 0 || e.metaKey || e.keyCode === 33) { + return -selectionProp; + } + var charIndex = cursorLocation.charIndex, widthBeforeCursor = this._getWidthBeforeCursor(lineIndex, charIndex), indexOnOtherLine = this._getIndexOnLine(lineIndex - 1, widthBeforeCursor), textBeforeCursor = this._textLines[lineIndex].slice(0, charIndex); + return -this._textLines[lineIndex - 1].length + indexOnOtherLine - textBeforeCursor.length; + }, + _getIndexOnLine: function(lineIndex, width) { + var widthOfLine = this._getLineWidth(this.ctx, lineIndex), textOnLine = this._textLines[lineIndex], lineLeftOffset = this._getLineLeftOffset(widthOfLine), widthOfCharsOnLine = lineLeftOffset, indexOnLine = 0, foundMatch; + for (var j = 0, jlen = textOnLine.length; j < jlen; j++) { + var _char = textOnLine[j], widthOfChar = this._getWidthOfChar(this.ctx, _char, lineIndex, j); + widthOfCharsOnLine += widthOfChar; + if (widthOfCharsOnLine > width) { + foundMatch = true; + var leftEdge = widthOfCharsOnLine - widthOfChar, rightEdge = widthOfCharsOnLine, offsetFromLeftEdge = Math.abs(leftEdge - width), offsetFromRightEdge = Math.abs(rightEdge - width); + indexOnLine = offsetFromRightEdge < offsetFromLeftEdge ? j : j - 1; + break; + } + } + if (!foundMatch) { + indexOnLine = textOnLine.length - 1; + } + return indexOnLine; + }, + moveCursorDown: function(e) { + if (this.selectionStart >= this.text.length && this.selectionEnd >= this.text.length) { + return; + } + this._moveCursorUpOrDown("Down", e); + }, + moveCursorUp: function(e) { + if (this.selectionStart === 0 && this.selectionEnd === 0) { + return; + } + this._moveCursorUpOrDown("Up", e); + }, + _moveCursorUpOrDown: function(direction, e) { + var action = "get" + direction + "CursorOffset", offset = this[action](e, this._selectionDirection === "right"); + if (e.shiftKey) { + this.moveCursorWithShift(offset); + } else { + this.moveCursorWithoutShift(offset); + } + if (offset !== 0) { + this.setSelectionInBoundaries(); + this.abortCursorAnimation(); + this._currentCursorOpacity = 1; + this.initDelayedCursor(); + this._fireSelectionChanged(); + this._updateTextarea(); + } + }, + moveCursorWithShift: function(offset) { + var newSelection = this._selectionDirection === "left" ? this.selectionStart + offset : this.selectionEnd + offset; + this.setSelectionStartEndWithShift(this.selectionStart, this.selectionEnd, newSelection); + return offset !== 0; + }, + moveCursorWithoutShift: function(offset) { + if (offset < 0) { + this.selectionStart += offset; + this.selectionEnd = this.selectionStart; + } else { + this.selectionEnd += offset; + this.selectionStart = this.selectionEnd; + } + return offset !== 0; + }, + moveCursorLeft: function(e) { + if (this.selectionStart === 0 && this.selectionEnd === 0) { + return; + } + this._moveCursorLeftOrRight("Left", e); + }, + _move: function(e, prop, direction) { + var newValue; + if (e.altKey) { + newValue = this["findWordBoundary" + direction](this[prop]); + } else if (e.metaKey || e.keyCode === 35 || e.keyCode === 36) { + newValue = this["findLineBoundary" + direction](this[prop]); + } else { + this[prop] += direction === "Left" ? -1 : 1; + return true; + } + if (typeof newValue !== undefined && this[prop] !== newValue) { + this[prop] = newValue; + return true; + } + }, + _moveLeft: function(e, prop) { + return this._move(e, prop, "Left"); + }, + _moveRight: function(e, prop) { + return this._move(e, prop, "Right"); + }, + moveCursorLeftWithoutShift: function(e) { + var change = true; + this._selectionDirection = "left"; + if (this.selectionEnd === this.selectionStart && this.selectionStart !== 0) { + change = this._moveLeft(e, "selectionStart"); + } + this.selectionEnd = this.selectionStart; + return change; + }, + moveCursorLeftWithShift: function(e) { + if (this._selectionDirection === "right" && this.selectionStart !== this.selectionEnd) { + return this._moveLeft(e, "selectionEnd"); + } else if (this.selectionStart !== 0) { + this._selectionDirection = "left"; + return this._moveLeft(e, "selectionStart"); + } + }, + moveCursorRight: function(e) { + if (this.selectionStart >= this.text.length && this.selectionEnd >= this.text.length) { + return; + } + this._moveCursorLeftOrRight("Right", e); + }, + _moveCursorLeftOrRight: function(direction, e) { + var actionName = "moveCursor" + direction + "With"; + this._currentCursorOpacity = 1; + if (e.shiftKey) { + actionName += "Shift"; + } else { + actionName += "outShift"; + } + if (this[actionName](e)) { + this.abortCursorAnimation(); + this.initDelayedCursor(); + this._fireSelectionChanged(); + this._updateTextarea(); + } + }, + moveCursorRightWithShift: function(e) { + if (this._selectionDirection === "left" && this.selectionStart !== this.selectionEnd) { + return this._moveRight(e, "selectionStart"); + } else if (this.selectionEnd !== this.text.length) { + this._selectionDirection = "right"; + return this._moveRight(e, "selectionEnd"); + } + }, + moveCursorRightWithoutShift: function(e) { + var changed = true; + this._selectionDirection = "right"; + if (this.selectionStart === this.selectionEnd) { + changed = this._moveRight(e, "selectionStart"); + this.selectionEnd = this.selectionStart; + } else { + this.selectionStart = this.selectionEnd; + } + return changed; + }, + removeChars: function(e) { + if (this.selectionStart === this.selectionEnd) { + this._removeCharsNearCursor(e); + } else { + this._removeCharsFromTo(this.selectionStart, this.selectionEnd); + } + this.setSelectionEnd(this.selectionStart); + this._removeExtraneousStyles(); + this.canvas && this.canvas.renderAll(); + this.setCoords(); + this.fire("changed"); + this.canvas && this.canvas.fire("text:changed", { + target: this + }); + }, + _removeCharsNearCursor: function(e) { + if (this.selectionStart === 0) { + return; + } + if (e.metaKey) { + var leftLineBoundary = this.findLineBoundaryLeft(this.selectionStart); + this._removeCharsFromTo(leftLineBoundary, this.selectionStart); + this.setSelectionStart(leftLineBoundary); + } else if (e.altKey) { + var leftWordBoundary = this.findWordBoundaryLeft(this.selectionStart); + this._removeCharsFromTo(leftWordBoundary, this.selectionStart); + this.setSelectionStart(leftWordBoundary); + } else { + this._removeSingleCharAndStyle(this.selectionStart); + this.setSelectionStart(this.selectionStart - 1); + } + } +}); + +(function() { + var toFixed = fabric.util.toFixed, NUM_FRACTION_DIGITS = fabric.Object.NUM_FRACTION_DIGITS; + fabric.util.object.extend(fabric.IText.prototype, { + _setSVGTextLineText: function(lineIndex, textSpans, height, textLeftOffset, textTopOffset, textBgRects) { + if (!this._getLineStyle(lineIndex)) { + fabric.Text.prototype._setSVGTextLineText.call(this, lineIndex, textSpans, height, textLeftOffset, textTopOffset); + } else { + this._setSVGTextLineChars(lineIndex, textSpans, height, textLeftOffset, textBgRects); + } + }, + _setSVGTextLineChars: function(lineIndex, textSpans, height, textLeftOffset, textBgRects) { + var chars = this._textLines[lineIndex], charOffset = 0, lineLeftOffset = this._getLineLeftOffset(this._getLineWidth(this.ctx, lineIndex)) - this.width / 2, lineOffset = this._getSVGLineTopOffset(lineIndex), heightOfLine = this._getHeightOfLine(this.ctx, lineIndex); + for (var i = 0, len = chars.length; i < len; i++) { + var styleDecl = this._getStyleDeclaration(lineIndex, i) || {}; + textSpans.push(this._createTextCharSpan(chars[i], styleDecl, lineLeftOffset, lineOffset.lineTop + lineOffset.offset, charOffset)); + var charWidth = this._getWidthOfChar(this.ctx, chars[i], lineIndex, i); + if (styleDecl.textBackgroundColor) { + textBgRects.push(this._createTextCharBg(styleDecl, lineLeftOffset, lineOffset.lineTop, heightOfLine, charWidth, charOffset)); + } + charOffset += charWidth; + } + }, + _getSVGLineTopOffset: function(lineIndex) { + var lineTopOffset = 0, lastHeight = 0; + for (var j = 0; j < lineIndex; j++) { + lineTopOffset += this._getHeightOfLine(this.ctx, j); + } + lastHeight = this._getHeightOfLine(this.ctx, j); + return { + lineTop: lineTopOffset, + offset: (this._fontSizeMult - this._fontSizeFraction) * lastHeight / (this.lineHeight * this._fontSizeMult) + }; + }, + _createTextCharBg: function(styleDecl, lineLeftOffset, lineTopOffset, heightOfLine, charWidth, charOffset) { + return [ '\t\t\n' ].join(""); + }, + _createTextCharSpan: function(_char, styleDecl, lineLeftOffset, lineTopOffset, charOffset) { + var fillStyles = this.getSvgStyles.call(fabric.util.object.extend({ + visible: true, + fill: this.fill, + stroke: this.stroke, + type: "text", + getSvgFilter: fabric.Object.prototype.getSvgFilter + }, styleDecl)); + return [ '\t\t\t', fabric.util.string.escapeXml(_char), "\n" ].join(""); + } + }); +})(); + +(function(global) { + "use strict"; + var fabric = global.fabric || (global.fabric = {}), clone = fabric.util.object.clone; + fabric.Textbox = fabric.util.createClass(fabric.IText, fabric.Observable, { + type: "textbox", + minWidth: 20, + dynamicMinWidth: 2, + __cachedLines: null, + lockScalingY: true, + lockScalingFlip: true, + initialize: function(text, options) { + this.ctx = fabric.util.createCanvasElement().getContext("2d"); + this.callSuper("initialize", text, options); + this.setControlsVisibility(fabric.Textbox.getTextboxControlVisibility()); + this._dimensionAffectingProps.width = true; + }, + _initDimensions: function(ctx) { + if (this.__skipDimension) { + return; + } + if (!ctx) { + ctx = fabric.util.createCanvasElement().getContext("2d"); + this._setTextStyles(ctx); + } + this.dynamicMinWidth = 0; + this._textLines = this._splitTextIntoLines(); + if (this.dynamicMinWidth > this.width) { + this._set("width", this.dynamicMinWidth); + } + this._clearCache(); + this.height = this._getTextHeight(ctx); + }, + _generateStyleMap: function() { + var realLineCount = 0, realLineCharCount = 0, charCount = 0, map = {}; + for (var i = 0; i < this._textLines.length; i++) { + if (this.text[charCount] === "\n" && i > 0) { + realLineCharCount = 0; + charCount++; + realLineCount++; + } else if (this.text[charCount] === " " && i > 0) { + realLineCharCount++; + charCount++; + } + map[i] = { + line: realLineCount, + offset: realLineCharCount + }; + charCount += this._textLines[i].length; + realLineCharCount += this._textLines[i].length; + } + return map; + }, + _getStyleDeclaration: function(lineIndex, charIndex, returnCloneOrEmpty) { + if (this._styleMap) { + var map = this._styleMap[lineIndex]; + if (!map) { + return returnCloneOrEmpty ? {} : null; + } + lineIndex = map.line; + charIndex = map.offset + charIndex; + } + return this.callSuper("_getStyleDeclaration", lineIndex, charIndex, returnCloneOrEmpty); + }, + _setStyleDeclaration: function(lineIndex, charIndex, style) { + var map = this._styleMap[lineIndex]; + lineIndex = map.line; + charIndex = map.offset + charIndex; + this.styles[lineIndex][charIndex] = style; + }, + _deleteStyleDeclaration: function(lineIndex, charIndex) { + var map = this._styleMap[lineIndex]; + lineIndex = map.line; + charIndex = map.offset + charIndex; + delete this.styles[lineIndex][charIndex]; + }, + _getLineStyle: function(lineIndex) { + var map = this._styleMap[lineIndex]; + return this.styles[map.line]; + }, + _setLineStyle: function(lineIndex, style) { + var map = this._styleMap[lineIndex]; + this.styles[map.line] = style; + }, + _deleteLineStyle: function(lineIndex) { + var map = this._styleMap[lineIndex]; + delete this.styles[map.line]; + }, + _wrapText: function(ctx, text) { + var lines = text.split(this._reNewline), wrapped = [], i; + for (i = 0; i < lines.length; i++) { + wrapped = wrapped.concat(this._wrapLine(ctx, lines[i], i)); + } + return wrapped; + }, + _measureText: function(ctx, text, lineIndex, charOffset) { + var width = 0; + charOffset = charOffset || 0; + for (var i = 0, len = text.length; i < len; i++) { + width += this._getWidthOfChar(ctx, text[i], lineIndex, i + charOffset); + } + return width; + }, + _wrapLine: function(ctx, text, lineIndex) { + var lineWidth = 0, lines = [], line = "", words = text.split(" "), word = "", offset = 0, infix = " ", wordWidth = 0, infixWidth = 0, largestWordWidth = 0, lineJustStarted = true, additionalSpace = this._getWidthOfCharSpacing(); + for (var i = 0; i < words.length; i++) { + word = words[i]; + wordWidth = this._measureText(ctx, word, lineIndex, offset); + offset += word.length; + lineWidth += infixWidth + wordWidth - additionalSpace; + if (lineWidth >= this.width && !lineJustStarted) { + lines.push(line); + line = ""; + lineWidth = wordWidth; + lineJustStarted = true; + } else { + lineWidth += additionalSpace; + } + if (!lineJustStarted) { + line += infix; + } + line += word; + infixWidth = this._measureText(ctx, infix, lineIndex, offset); + offset++; + lineJustStarted = false; + if (wordWidth > largestWordWidth) { + largestWordWidth = wordWidth; + } + } + i && lines.push(line); + if (largestWordWidth > this.dynamicMinWidth) { + this.dynamicMinWidth = largestWordWidth - additionalSpace; + } + return lines; + }, + _splitTextIntoLines: function() { + var originalAlign = this.textAlign; + this.ctx.save(); + this._setTextStyles(this.ctx); + this.textAlign = "left"; + var lines = this._wrapText(this.ctx, this.text); + this.textAlign = originalAlign; + this.ctx.restore(); + this._textLines = lines; + this._styleMap = this._generateStyleMap(); + return lines; + }, + setOnGroup: function(key, value) { + if (key === "scaleX") { + this.set("scaleX", Math.abs(1 / value)); + this.set("width", this.get("width") * value / (typeof this.__oldScaleX === "undefined" ? 1 : this.__oldScaleX)); + this.__oldScaleX = value; + } + }, + get2DCursorLocation: function(selectionStart) { + if (typeof selectionStart === "undefined") { + selectionStart = this.selectionStart; + } + var numLines = this._textLines.length, removed = 0; + for (var i = 0; i < numLines; i++) { + var line = this._textLines[i], lineLen = line.length; + if (selectionStart <= removed + lineLen) { + return { + lineIndex: i, + charIndex: selectionStart - removed + }; + } + removed += lineLen; + if (this.text[removed] === "\n" || this.text[removed] === " ") { + removed++; + } + } + return { + lineIndex: numLines - 1, + charIndex: this._textLines[numLines - 1].length + }; + }, + _getCursorBoundariesOffsets: function(chars, typeOfBoundaries) { + var topOffset = 0, leftOffset = 0, cursorLocation = this.get2DCursorLocation(), lineChars = this._textLines[cursorLocation.lineIndex].split(""), lineLeftOffset = this._getLineLeftOffset(this._getLineWidth(this.ctx, cursorLocation.lineIndex)); + for (var i = 0; i < cursorLocation.charIndex; i++) { + leftOffset += this._getWidthOfChar(this.ctx, lineChars[i], cursorLocation.lineIndex, i); + } + for (i = 0; i < cursorLocation.lineIndex; i++) { + topOffset += this._getHeightOfLine(this.ctx, i); + } + if (typeOfBoundaries === "cursor") { + topOffset += (1 - this._fontSizeFraction) * this._getHeightOfLine(this.ctx, cursorLocation.lineIndex) / this.lineHeight - this.getCurrentCharFontSize(cursorLocation.lineIndex, cursorLocation.charIndex) * (1 - this._fontSizeFraction); + } + return { + top: topOffset, + left: leftOffset, + lineLeft: lineLeftOffset + }; + }, + getMinWidth: function() { + return Math.max(this.minWidth, this.dynamicMinWidth); + }, + toObject: function(propertiesToInclude) { + return fabric.util.object.extend(this.callSuper("toObject", propertiesToInclude), { + minWidth: this.minWidth + }); + } + }); + fabric.Textbox.fromObject = function(object, callback) { + var textbox = new fabric.Textbox(object.text, clone(object)); + callback && callback(textbox); + return textbox; + }; + fabric.Textbox.getTextboxControlVisibility = function() { + return { + tl: false, + tr: false, + br: false, + bl: false, + ml: true, + mt: false, + mr: true, + mb: false, + mtr: true + }; + }; +})(typeof exports !== "undefined" ? exports : this); + +(function() { + var setObjectScaleOverridden = fabric.Canvas.prototype._setObjectScale; + fabric.Canvas.prototype._setObjectScale = function(localMouse, transform, lockScalingX, lockScalingY, by, lockScalingFlip, _dim) { + var t = transform.target; + if (t instanceof fabric.Textbox) { + var w = t.width * (localMouse.x / transform.scaleX / (t.width + t.strokeWidth)); + if (w >= t.getMinWidth()) { + t.set("width", w); + return true; + } + } else { + return setObjectScaleOverridden.call(fabric.Canvas.prototype, localMouse, transform, lockScalingX, lockScalingY, by, lockScalingFlip, _dim); + } + }; + fabric.Group.prototype._refreshControlsVisibility = function() { + if (typeof fabric.Textbox === "undefined") { + return; + } + for (var i = this._objects.length; i--; ) { + if (this._objects[i] instanceof fabric.Textbox) { + this.setControlsVisibility(fabric.Textbox.getTextboxControlVisibility()); + return; + } + } + }; + var clone = fabric.util.object.clone; + fabric.util.object.extend(fabric.Textbox.prototype, { + _removeExtraneousStyles: function() { + for (var prop in this._styleMap) { + if (!this._textLines[prop]) { + delete this.styles[this._styleMap[prop].line]; + } + } + }, + insertCharStyleObject: function(lineIndex, charIndex, style) { + var map = this._styleMap[lineIndex]; + lineIndex = map.line; + charIndex = map.offset + charIndex; + fabric.IText.prototype.insertCharStyleObject.apply(this, [ lineIndex, charIndex, style ]); + }, + insertNewlineStyleObject: function(lineIndex, charIndex, isEndOfLine) { + var map = this._styleMap[lineIndex]; + lineIndex = map.line; + charIndex = map.offset + charIndex; + fabric.IText.prototype.insertNewlineStyleObject.apply(this, [ lineIndex, charIndex, isEndOfLine ]); + }, + shiftLineStyles: function(lineIndex, offset) { + var clonedStyles = clone(this.styles), map = this._styleMap[lineIndex]; + lineIndex = map.line; + for (var line in this.styles) { + var numericLine = parseInt(line, 10); + if (numericLine > lineIndex) { + this.styles[numericLine + offset] = clonedStyles[numericLine]; + if (!clonedStyles[numericLine - offset]) { + delete this.styles[numericLine]; + } + } + } + }, + _getTextOnPreviousLine: function(lIndex) { + var textOnPreviousLine = this._textLines[lIndex - 1]; + while (this._styleMap[lIndex - 2] && this._styleMap[lIndex - 2].line === this._styleMap[lIndex - 1].line) { + textOnPreviousLine = this._textLines[lIndex - 2] + textOnPreviousLine; + lIndex--; + } + return textOnPreviousLine; + }, + removeStyleObject: function(isBeginningOfLine, index) { + var cursorLocation = this.get2DCursorLocation(index), map = this._styleMap[cursorLocation.lineIndex], lineIndex = map.line, charIndex = map.offset + cursorLocation.charIndex; + this._removeStyleObject(isBeginningOfLine, cursorLocation, lineIndex, charIndex); + } + }); +})(); + +(function() { + var override = fabric.IText.prototype._getNewSelectionStartFromOffset; + fabric.IText.prototype._getNewSelectionStartFromOffset = function(mouseOffset, prevWidth, width, index, jlen) { + index = override.call(this, mouseOffset, prevWidth, width, index, jlen); + var tmp = 0, removed = 0; + for (var i = 0; i < this._textLines.length; i++) { + tmp += this._textLines[i].length; + if (tmp + removed >= index) { + break; + } + if (this.text[tmp + removed] === "\n" || this.text[tmp + removed] === " ") { + removed++; + } + } + return index - i + removed; + }; +})(); + +(function() { + if (typeof document !== "undefined" && typeof window !== "undefined") { + return; + } + var DOMParser = require("xmldom").DOMParser, URL = require("url"), HTTP = require("http"), HTTPS = require("https"), Canvas = require("canvas"), Image = require("canvas").Image; + function request(url, encoding, callback) { + var oURL = URL.parse(url); + if (!oURL.port) { + oURL.port = oURL.protocol.indexOf("https:") === 0 ? 443 : 80; + } + var reqHandler = oURL.protocol.indexOf("https:") === 0 ? HTTPS : HTTP, req = reqHandler.request({ + hostname: oURL.hostname, + port: oURL.port, + path: oURL.path, + method: "GET" + }, function(response) { + var body = ""; + if (encoding) { + response.setEncoding(encoding); + } + response.on("end", function() { + callback(body); + }); + response.on("data", function(chunk) { + if (response.statusCode === 200) { + body += chunk; + } + }); + }); + req.on("error", function(err) { + if (err.errno === process.ECONNREFUSED) { + fabric.log("ECONNREFUSED: connection refused to " + oURL.hostname + ":" + oURL.port); + } else { + fabric.log(err.message); + } + callback(null); + }); + req.end(); + } + function requestFs(path, callback) { + var fs = require("fs"); + fs.readFile(path, function(err, data) { + if (err) { + fabric.log(err); + throw err; + } else { + callback(data); + } + }); + } + fabric.util.loadImage = function(url, callback, context) { + function createImageAndCallBack(data) { + if (data) { + img.src = new Buffer(data, "binary"); + img._src = url; + callback && callback.call(context, img); + } else { + img = null; + callback && callback.call(context, null, true); + } + } + var img = new Image(); + if (url && (url instanceof Buffer || url.indexOf("data") === 0)) { + img.src = img._src = url; + callback && callback.call(context, img); + } else if (url && url.indexOf("http") !== 0) { + requestFs(url, createImageAndCallBack); + } else if (url) { + request(url, "binary", createImageAndCallBack); + } else { + callback && callback.call(context, url); + } + }; + fabric.loadSVGFromURL = function(url, callback, reviver) { + url = url.replace(/^\n\s*/, "").replace(/\?.*$/, "").trim(); + if (url.indexOf("http") !== 0) { + requestFs(url, function(body) { + fabric.loadSVGFromString(body.toString(), callback, reviver); + }); + } else { + request(url, "", function(body) { + fabric.loadSVGFromString(body, callback, reviver); + }); + } + }; + fabric.loadSVGFromString = function(string, callback, reviver) { + var doc = new DOMParser().parseFromString(string); + fabric.parseSVGDocument(doc.documentElement, function(results, options) { + callback && callback(results, options); + }, reviver); + }; + fabric.util.getScript = function(url, callback) { + request(url, "", function(body) { + eval(body); + callback && callback(); + }); + }; + fabric.createCanvasForNode = function(width, height, options, nodeCanvasOptions) { + nodeCanvasOptions = nodeCanvasOptions || options; + var canvasEl = fabric.document.createElement("canvas"), nodeCanvas = new Canvas(width || 600, height || 600, nodeCanvasOptions), nodeCacheCanvas = new Canvas(width || 600, height || 600, nodeCanvasOptions); + canvasEl.style = {}; + canvasEl.width = nodeCanvas.width; + canvasEl.height = nodeCanvas.height; + options = options || {}; + options.nodeCanvas = nodeCanvas; + options.nodeCacheCanvas = nodeCacheCanvas; + var FabricCanvas = fabric.Canvas || fabric.StaticCanvas, fabricCanvas = new FabricCanvas(canvasEl, options); + fabricCanvas.nodeCanvas = nodeCanvas; + fabricCanvas.nodeCacheCanvas = nodeCacheCanvas; + fabricCanvas.contextContainer = nodeCanvas.getContext("2d"); + fabricCanvas.contextCache = nodeCacheCanvas.getContext("2d"); + fabricCanvas.Font = Canvas.Font; + return fabricCanvas; + }; + var originaInitStatic = fabric.StaticCanvas.prototype._initStatic; + fabric.StaticCanvas.prototype._initStatic = function(el, options) { + el = el || fabric.document.createElement("canvas"); + this.nodeCanvas = new Canvas(el.width, el.height); + this.nodeCacheCanvas = new Canvas(el.width, el.height); + originaInitStatic.call(this, el, options); + this.contextContainer = this.nodeCanvas.getContext("2d"); + this.contextCache = this.nodeCacheCanvas.getContext("2d"); + this.Font = Canvas.Font; + }; + fabric.StaticCanvas.prototype.createPNGStream = function() { + return this.nodeCanvas.createPNGStream(); + }; + fabric.StaticCanvas.prototype.createJPEGStream = function(opts) { + return this.nodeCanvas.createJPEGStream(opts); + }; + fabric.StaticCanvas.prototype._initRetinaScaling = function() { + if (!this._isRetinaScaling()) { + return; + } + this.lowerCanvasEl.setAttribute("width", this.width * fabric.devicePixelRatio); + this.lowerCanvasEl.setAttribute("height", this.height * fabric.devicePixelRatio); + this.nodeCanvas.width = this.width * fabric.devicePixelRatio; + this.nodeCanvas.height = this.height * fabric.devicePixelRatio; + this.contextContainer.scale(fabric.devicePixelRatio, fabric.devicePixelRatio); + return this; + }; + if (fabric.Canvas) { + fabric.Canvas.prototype._initRetinaScaling = fabric.StaticCanvas.prototype._initRetinaScaling; + } + var origSetBackstoreDimension = fabric.StaticCanvas.prototype._setBackstoreDimension; + fabric.StaticCanvas.prototype._setBackstoreDimension = function(prop, value) { + origSetBackstoreDimension.call(this, prop, value); + this.nodeCanvas[prop] = value; + return this; + }; + if (fabric.Canvas) { + fabric.Canvas.prototype._setBackstoreDimension = fabric.StaticCanvas.prototype._setBackstoreDimension; + } +})(); + +window.fabric = fabric; + +if (typeof define === "function" && define.amd) { + define([], function() { + return fabric; + }); +} \ No newline at end of file diff --git a/app/bower_components/fabric.js/package.json b/app/bower_components/fabric.js/package.json new file mode 100644 index 0000000..5aa4aea --- /dev/null +++ b/app/bower_components/fabric.js/package.json @@ -0,0 +1,62 @@ +{ + "name": "fabric", + "description": "Object model for HTML5 canvas, and SVG-to-canvas parser. Backed by jsdom and node-canvas.", + "homepage": "http://fabricjs.com/", + "version": "1.6.6", + "author": "Juriy Zaytsev ", + "contributors": [ + { + "name": "Andrea Bogazzi", + "email": "andreabogazzi79@gmail.com" + } + ], + "keywords": [ + "canvas", + "graphic", + "graphics", + "SVG", + "node-canvas", + "parser", + "HTML5", + "object model" + ], + "browser" : { + "canvas" : false, + "fs": false, + "jsdom": false, + "xmldom": false + }, + "repository": { + "type": "git", + "url": "https://github.com/kangax/fabric.js" + }, + "bugs": { + "url": "https://github.com/kangax/fabric.js/issues" + }, + "license": "MIT", + "scripts": { + "build": "node build.js modules=ALL exclude=json,gestures", + "build_with_gestures": "node build.js modules=ALL exclude=json", + "test": "node test.js", + "lint": "eslint --config .eslintrc.json src", + "lint_tests": "eslint test/unit --config .eslintrc_tests", + "export_dist_to_site": "cp dist/fabric.js ../fabricjs.com/lib/fabric.js", + "export_tests_to_site": "cp test/unit/*.js ../fabricjs.com/test/unit", + "all": "npm run build && npm run test && npm run lint && npm run lint_tests && npm run export_dist_to_site && npm run export_tests_to_site" + }, + "optionalDependencies": { + "canvas": "1.4.x", + "jsdom": "3.x.x", + "xmldom": "0.1.x" + }, + "devDependencies": { + "uglify-js": "2.7.x", + "eslint": "2.x.x", + "qunit": "0.9.x", + "istanbul": "0.4.x" + }, + "engines": { + "node": ">=0.4.0" + }, + "main": "./dist/fabric.js" +} diff --git a/app/bower_components/fabric.js/testem.json b/app/bower_components/fabric.js/testem.json new file mode 100644 index 0000000..48f6828 --- /dev/null +++ b/app/bower_components/fabric.js/testem.json @@ -0,0 +1,18 @@ +{ + "serve_files": [ + "test/fixtures/test_script.js", + "dist/fabric.js", + "test/unit/*.js" + ], + "test_page": "tests.mustache?hidepassed", + "launch_in_dev": [ + "Chrome", "Node" + ], + "launchers": { + "Node": { + "command": "node test.js" + } + }, + "timeout": 540, + "parallel": 4 +} diff --git a/app/bower_components/fabric.js/tests.mustache b/app/bower_components/fabric.js/tests.mustache new file mode 100644 index 0000000..964e8c0 --- /dev/null +++ b/app/bower_components/fabric.js/tests.mustache @@ -0,0 +1,15 @@ + + + +Test'em + + +{{#serve_files}}{{/serve_files}} + +{{#styles}}{{/styles}} + + +
+
+ + diff --git a/app/bower_components/select2/.bower.json b/app/bower_components/select2/.bower.json new file mode 100644 index 0000000..711ae6d --- /dev/null +++ b/app/bower_components/select2/.bower.json @@ -0,0 +1,24 @@ +{ + "name": "select2", + "version": "3.4.8", + "main": [ + "select2.js", + "select2.css", + "select2.png", + "select2x2.png", + "select2-spinner.gif" + ], + "dependencies": { + "jquery": ">= 1.7.1" + }, + "homepage": "https://github.com/ivaynberg/select2", + "_release": "3.4.8", + "_resolution": { + "type": "version", + "tag": "3.4.8", + "commit": "ee0f36a47e2133b23330fbec740b2d3a17a0d9c2" + }, + "_source": "https://github.com/ivaynberg/select2.git", + "_target": "~3.4", + "_originalSource": "select2" +} \ No newline at end of file diff --git a/app/bower_components/select2/.gitignore b/app/bower_components/select2/.gitignore new file mode 100644 index 0000000..c6ef218 --- /dev/null +++ b/app/bower_components/select2/.gitignore @@ -0,0 +1,2 @@ +.idea + diff --git a/app/bower_components/select2/LICENSE b/app/bower_components/select2/LICENSE new file mode 100644 index 0000000..0247cc7 --- /dev/null +++ b/app/bower_components/select2/LICENSE @@ -0,0 +1,18 @@ +Copyright 2014 Igor Vaynberg + +Version: @@ver@@ Timestamp: @@timestamp@@ + +This software is licensed under the Apache License, Version 2.0 (the "Apache License") or the GNU +General Public License version 2 (the "GPL License"). You may choose either license to govern your +use of this software only upon the condition that you accept all of the terms of either the Apache +License or the GPL License. + +You may obtain a copy of the Apache License and the GPL License at: + +http://www.apache.org/licenses/LICENSE-2.0 +http://www.gnu.org/licenses/gpl-2.0.html + +Unless required by applicable law or agreed to in writing, software distributed under the Apache License +or the GPL Licesnse is distributed on an "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, +either express or implied. See the Apache License and the GPL License for the specific language governing +permissions and limitations under the Apache License and the GPL License. diff --git a/app/bower_components/select2/README.md b/app/bower_components/select2/README.md new file mode 100644 index 0000000..406fe79 --- /dev/null +++ b/app/bower_components/select2/README.md @@ -0,0 +1,90 @@ +Select2 +======= + +Select2 is a jQuery-based replacement for select boxes. It supports searching, remote data sets, and infinite scrolling of results. + +To get started, checkout examples and documentation at http://ivaynberg.github.com/select2 + +Use cases +--------- + +* Enhancing native selects with search. +* Enhancing native selects with a better multi-select interface. +* Loading data from JavaScript: easily load items via ajax and have them searchable. +* Nesting optgroups: native selects only support one level of nested. Select2 does not have this restriction. +* Tagging: ability to add new items on the fly. +* Working with large, remote datasets: ability to partially load a dataset based on the search term. +* Paging of large datasets: easy support for loading more pages when the results are scrolled to the end. +* Templating: support for custom rendering of results and selections. + +Browser compatibility +--------------------- +* IE 8+ +* Chrome 8+ +* Firefox 10+ +* Safari 3+ +* Opera 10.6+ + +Usage +----- +You can source Select2 directly from a [CDN like JSDliver](http://www.jsdelivr.com/#!select2), [download it from this GitHub repo](https://github.com/ivaynberg/select2/tags), or use one of the integrations below. + +Integrations +------------ + +* [Wicket-Select2](https://github.com/ivaynberg/wicket-select2) (Java / [Apache Wicket](http://wicket.apache.org)) +* [select2-rails](https://github.com/argerim/select2-rails) (Ruby on Rails) +* [AngularUI](http://angular-ui.github.com/#directives-select2) ([AngularJS](angularjs.org)) +* [Django](https://github.com/applegrew/django-select2) +* [Symfony](https://github.com/19Gerhard85/sfSelect2WidgetsPlugin) +* [Symfony2](https://github.com/avocode/FormExtensions) +* [Bootstrap 2](https://github.com/t0m/select2-bootstrap-css) and [Bootstrap 3](https://github.com/t0m/select2-bootstrap-css/tree/bootstrap3) (CSS skins) +* [Meteor](https://github.com/nate-strauser/meteor-select2) (modern reactive JavaScript framework; + [Bootstrap 3 skin](https://github.com/esperadomedia/meteor-select2-bootstrap3-css/)) +* [Yii 2.x](http://demos.krajee.com/widgets#select2) +* [Yii 1.x](https://github.com/tonybolzan/yii-select2) + +Internationalization (i18n) +--------------------------- + +Select2 supports multiple languages by simply including the right +language JS file (`select2_locale_it.js`, `select2_locale_nl.js`, etc.). + +Missing a language? Just copy `select2_locale_en.js.template`, translate +it, and make a pull request back to Select2 here on GitHub. + +Bug tracker +----------- + +Have a bug? Please create an issue here on GitHub! + +https://github.com/ivaynberg/select2/issues + +Mailing list +------------ + +Have a question? Ask on our mailing list! + +select2@googlegroups.com + +https://groups.google.com/d/forum/select2 + + +Copyright and license +--------------------- + +Copyright 2012 Igor Vaynberg + +This software is licensed under the Apache License, Version 2.0 (the "Apache License") or the GNU +General Public License version 2 (the "GPL License"). You may choose either license to govern your +use of this software only upon the condition that you accept all of the terms of either the Apache +License or the GPL License. + +You may obtain a copy of the Apache License and the GPL License in the LICENSE file, or at: + +http://www.apache.org/licenses/LICENSE-2.0 +http://www.gnu.org/licenses/gpl-2.0.html + +Unless required by applicable law or agreed to in writing, software distributed under the Apache License +or the GPL License is distributed on an "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, +either express or implied. See the Apache License and the GPL License for the specific language governing +permissions and limitations under the Apache License and the GPL License. diff --git a/app/bower_components/select2/bower.json b/app/bower_components/select2/bower.json new file mode 100644 index 0000000..80e8596 --- /dev/null +++ b/app/bower_components/select2/bower.json @@ -0,0 +1,8 @@ +{ + "name": "select2", + "version": "3.4.8", + "main": ["select2.js", "select2.css", "select2.png", "select2x2.png", "select2-spinner.gif"], + "dependencies": { + "jquery": ">= 1.7.1" + } +} diff --git a/app/bower_components/select2/component.json b/app/bower_components/select2/component.json new file mode 100644 index 0000000..ad7abf9 --- /dev/null +++ b/app/bower_components/select2/component.json @@ -0,0 +1,66 @@ +{ + "name": "select2", + "repo": "ivaynberg/select2", + "description": "Select2 is a jQuery based replacement for select boxes. It supports searching, remote data sets, and infinite scrolling of results.", + "version": "3.4.8", + "demo": "http://ivaynberg.github.io/select2/", + "keywords": [ + "jquery" + ], + "main": "select2.js", + "styles": [ + "select2.css", + "select2-bootstrap.css" + ], + "scripts": [ + "select2.js", + "select2_locale_ar.js", + "select2_locale_bg.js", + "select2_locale_ca.js", + "select2_locale_cs.js", + "select2_locale_da.js", + "select2_locale_de.js", + "select2_locale_el.js", + "select2_locale_es.js", + "select2_locale_et.js", + "select2_locale_eu.js", + "select2_locale_fa.js", + "select2_locale_fi.js", + "select2_locale_fr.js", + "select2_locale_gl.js", + "select2_locale_he.js", + "select2_locale_hr.js", + "select2_locale_hu.js", + "select2_locale_id.js", + "select2_locale_is.js", + "select2_locale_it.js", + "select2_locale_ja.js", + "select2_locale_ka.js", + "select2_locale_ko.js", + "select2_locale_lt.js", + "select2_locale_lv.js", + "select2_locale_mk.js", + "select2_locale_ms.js", + "select2_locale_nl.js", + "select2_locale_no.js", + "select2_locale_pl.js", + "select2_locale_pt-BR.js", + "select2_locale_pt-PT.js", + "select2_locale_ro.js", + "select2_locale_ru.js", + "select2_locale_sk.js", + "select2_locale_sv.js", + "select2_locale_th.js", + "select2_locale_tr.js", + "select2_locale_uk.js", + "select2_locale_vi.js", + "select2_locale_zh-CN.js", + "select2_locale_zh-TW.js" + ], + "images": [ + "select2-spinner.gif", + "select2.png", + "select2x2.png" + ], + "license": "MIT" +} diff --git a/app/bower_components/select2/composer.json b/app/bower_components/select2/composer.json new file mode 100644 index 0000000..c50fadb --- /dev/null +++ b/app/bower_components/select2/composer.json @@ -0,0 +1,29 @@ +{ + "name": + "ivaynberg/select2", + "description": "Select2 is a jQuery based replacement for select boxes.", + "version": "3.4.8", + "type": "component", + "homepage": "http://ivaynberg.github.io/select2/", + "license": "Apache-2.0", + "require": { + "robloach/component-installer": "*", + "components/jquery": ">=1.7.1" + }, + "extra": { + "component": { + "scripts": [ + "select2.js" + ], + "files": [ + "select2.js", + "select2_locale_*.js", + "select2.css", + "select2-bootstrap.css", + "select2-spinner.gif", + "select2.png", + "select2x2.png" + ] + } + } +} diff --git a/app/bower_components/select2/package.json b/app/bower_components/select2/package.json new file mode 100644 index 0000000..75ad84a --- /dev/null +++ b/app/bower_components/select2/package.json @@ -0,0 +1,20 @@ +{ + "name" : "Select2", + "description": "Select2 is a jQuery based replacement for select boxes. It supports searching, remote data sets, and infinite scrolling of results.", + "homepage": "http://ivaynberg.github.io/select2", + "author": "Igor Vaynberg", + "repository": {"type": "git", "url": "git://github.com/ivaynberg/select2.git"}, + "main": "select2.js", + "version": "3.4.8", + "jspm": { + "main": "select2", + "files": ["select2.js", "select2.png", "select2.css", "select2-spinner.gif"], + "shim": { + "select2": { + "imports": ["jquery", "./select2.css!"], + "exports": "$" + } + }, + "buildConfig": { "uglify": true } + } +} diff --git a/app/bower_components/select2/release.sh b/app/bower_components/select2/release.sh new file mode 100755 index 0000000..0d2e279 --- /dev/null +++ b/app/bower_components/select2/release.sh @@ -0,0 +1,79 @@ +#!/bin/bash +set -e + +echo -n "Enter the version for this release: " + +read ver + +if [ ! $ver ]; then + echo "Invalid version." + exit +fi + +name="select2" +js="$name.js" +mini="$name.min.js" +css="$name.css" +release="$name-$ver" +tag="$ver" +branch="build-$ver" +curbranch=`git branch | grep "*" | sed "s/* //"` +timestamp=$(date) +tokens="s/@@ver@@/$ver/g;s/\@@timestamp@@/$timestamp/g" +remote="github" + +echo "Pulling from origin" + +git pull + +echo "Updating Version Identifiers" + +sed -E -e "s/\"version\": \"([0-9\.]+)\",/\"version\": \"$ver\",/g" -i -- bower.json select2.jquery.json component.json composer.json package.json + +git add bower.json +git add select2.jquery.json +git add component.json +git add composer.json +git add package.json + +git commit -m "modified version identifiers in descriptors for release $ver" +git push + +git branch "$branch" +git checkout "$branch" + +echo "Tokenizing..." + +find . -name "$js" | xargs -I{} sed -e "$tokens" -i -- {} +find . -name "$css" | xargs -I{} sed -e "$tokens" -i -- {} + +sed -e "s/latest/$ver/g" -i -- bower.json + +git add "$js" +git add "$css" + +echo "Minifying..." + +echo "/*" > "$mini" +cat LICENSE | sed "$tokens" >> "$mini" +echo "*/" >> "$mini" + +curl -s \ + --data-urlencode "js_code@$js" \ + http://marijnhaverbeke.nl/uglifyjs \ + >> "$mini" + +git add "$mini" + +git commit -m "release $ver" + +echo "Tagging..." +git tag -a "$tag" -m "tagged version $ver" +git push "$remote" --tags + +echo "Cleaning Up..." + +git checkout "$curbranch" +git branch -D "$branch" + +echo "Done" diff --git a/app/bower_components/select2/select2-bootstrap.css b/app/bower_components/select2/select2-bootstrap.css new file mode 100644 index 0000000..3b83f0a --- /dev/null +++ b/app/bower_components/select2/select2-bootstrap.css @@ -0,0 +1,87 @@ +.form-control .select2-choice { + border: 0; + border-radius: 2px; +} + +.form-control .select2-choice .select2-arrow { + border-radius: 0 2px 2px 0; +} + +.form-control.select2-container { + height: auto !important; + padding: 0; +} + +.form-control.select2-container.select2-dropdown-open { + border-color: #5897FB; + border-radius: 3px 3px 0 0; +} + +.form-control .select2-container.select2-dropdown-open .select2-choices { + border-radius: 3px 3px 0 0; +} + +.form-control.select2-container .select2-choices { + border: 0 !important; + border-radius: 3px; +} + +.control-group.warning .select2-container .select2-choice, +.control-group.warning .select2-container .select2-choices, +.control-group.warning .select2-container-active .select2-choice, +.control-group.warning .select2-container-active .select2-choices, +.control-group.warning .select2-dropdown-open.select2-drop-above .select2-choice, +.control-group.warning .select2-dropdown-open.select2-drop-above .select2-choices, +.control-group.warning .select2-container-multi.select2-container-active .select2-choices { + border: 1px solid #C09853 !important; +} + +.control-group.warning .select2-container .select2-choice div { + border-left: 1px solid #C09853 !important; + background: #FCF8E3 !important; +} + +.control-group.error .select2-container .select2-choice, +.control-group.error .select2-container .select2-choices, +.control-group.error .select2-container-active .select2-choice, +.control-group.error .select2-container-active .select2-choices, +.control-group.error .select2-dropdown-open.select2-drop-above .select2-choice, +.control-group.error .select2-dropdown-open.select2-drop-above .select2-choices, +.control-group.error .select2-container-multi.select2-container-active .select2-choices { + border: 1px solid #B94A48 !important; +} + +.control-group.error .select2-container .select2-choice div { + border-left: 1px solid #B94A48 !important; + background: #F2DEDE !important; +} + +.control-group.info .select2-container .select2-choice, +.control-group.info .select2-container .select2-choices, +.control-group.info .select2-container-active .select2-choice, +.control-group.info .select2-container-active .select2-choices, +.control-group.info .select2-dropdown-open.select2-drop-above .select2-choice, +.control-group.info .select2-dropdown-open.select2-drop-above .select2-choices, +.control-group.info .select2-container-multi.select2-container-active .select2-choices { + border: 1px solid #3A87AD !important; +} + +.control-group.info .select2-container .select2-choice div { + border-left: 1px solid #3A87AD !important; + background: #D9EDF7 !important; +} + +.control-group.success .select2-container .select2-choice, +.control-group.success .select2-container .select2-choices, +.control-group.success .select2-container-active .select2-choice, +.control-group.success .select2-container-active .select2-choices, +.control-group.success .select2-dropdown-open.select2-drop-above .select2-choice, +.control-group.success .select2-dropdown-open.select2-drop-above .select2-choices, +.control-group.success .select2-container-multi.select2-container-active .select2-choices { + border: 1px solid #468847 !important; +} + +.control-group.success .select2-container .select2-choice div { + border-left: 1px solid #468847 !important; + background: #DFF0D8 !important; +} diff --git a/app/bower_components/select2/select2-spinner.gif b/app/bower_components/select2/select2-spinner.gif new file mode 100644 index 0000000000000000000000000000000000000000..5b33f7e54f4e55b6b8774d86d96895db9af044b4 GIT binary patch literal 1849 zcma*odr(tX9tZI2z31lM+(&YVk%mZ}5P~KlG2s=WSbGzm0!x7^P##Mnh7t-jP!X0Q zk_SQ}Po-L1tlDK;6l?(>v)e5ZBQx4|Y-Q?nr@Px3?9h(3ZWr3^tj=`TP57gKr87N$ zp2wWee1GRRCwo_xahnw)5cxNPJbCg2L6DV|6`#+yw6v6!mDS$f9-JvFD^n;GQ&UrZ zzh5jCkByB101O60U0q#p_1BM>Cv-vP?&s4@g_((4_1L=L$(a91)0=J91Gas#R{McE znYG^9*0A5YZ>#;~+Wkn(W5B0^yELIYLP!K}mB~<)AM@1&nqekynuaEGqPrzoH|KodRXJy)%+w_fu3nE5>@Bd_b zqC$EQ;{c`T&?EsNO|igL9gC7Ygxv?aQUEXMq?~>wg{EyW;VcJ37CUF#HjrT=KQO_* zS>M9yydXk18D(+QDJ1>r);Lav_uYKp$T?4vr{Q$lTo&pKv^?(>L-)G2*lwH!Ah7k? z7oH<8h-(KTKt5V6$8gF)C7Io&P5=SjTh)=zV=E2EUhQZP##L8S{d%UK>>+y82>+FV+#^BzW7u3F)Bb>=lYQ%%j`F>ASe zo*cw@V#u6T`A2He;70mR(V&iV&-7{qP~=SRf&jm9-T{*ZeZ}$rd0#6c&fLG^xJcf5 z+p<`wJYgW+_s*V{uI$nMB;%8`S_3>PfGOj3Rq}@Cx^+j?rk92fANSFDBYnOqQ>Vdj z)(|$AhP4t&Lb=Gvo2#3Gl%9<=Gv`Mz?Po@P4iLF!x}GUWJICDlFk-hS^Whyh7x~VH z@0vD1>HYD4&e+~yzS*-sFR{9`{QEEZO1zg7>R&7cHts-6j!xHVdA8eI+ZlVzd%`es zJT@$#GX(gvCJ1oJN%yLBK}{V=V;seo;!w|Yte!W1%5qLNFWqvZW>h&IiH+oPT=b@E zPhGzv5=(Un*X>v`>%8h_nj^NdYcE6NHS_ifkCV$*D)Tqrbu`s;<=t<4 zAHNqNV?6(g<1PY-w@#I-WYFViz?9TrkMr)u0g`O`u|>T;k|2sV*YF^punvT;$SuTy{j3Gv)yqD!R_CF>yR)MzmmYS5v+~R zXAdD%ng9?df;wd8GxR#%3O+gz};Vo;)sK%Bj-q>Oq%R7JU-KD?vYu>#2UjaDo z&8$>5xW~?KPD_#XFToU1hIb*VOMidUr6iYiO0N|i-7s`T8!cFT`rN!^1Pt78J93i6 z5HI1wIM$94m{3SLDvISDe6$ZG1;eq_D9RTaaC>=cO{@Bs>$IlPCPJJ$h$)-3vzNUQ6OsN#_zWxey!_9%hxwH2_dEJi=yY|1c7nDm2_Lm!Cof8-R_+9UkS zcBE(o47yE)oMR(Q=dp1a2wTX5KvvGyLqlWTa7V&!A*|w|)ax~1_~aJ0=_Lilg*0iQk7#ZD EAHN$8j{pDw literal 0 HcmV?d00001 diff --git a/app/bower_components/select2/select2.css b/app/bower_components/select2/select2.css new file mode 100644 index 0000000..1eb4d22 --- /dev/null +++ b/app/bower_components/select2/select2.css @@ -0,0 +1,646 @@ +/* +Version: 3.4.8 Timestamp: Thu May 1 09:50:32 EDT 2014 +*/ +.select2-container { + margin: 0; + position: relative; + display: inline-block; + /* inline-block for ie7 */ + zoom: 1; + *display: inline; + vertical-align: middle; +} + +.select2-container, +.select2-drop, +.select2-search, +.select2-search input { + /* + Force border-box so that % widths fit the parent + container without overlap because of margin/padding. + More Info : http://www.quirksmode.org/css/box.html + */ + -webkit-box-sizing: border-box; /* webkit */ + -moz-box-sizing: border-box; /* firefox */ + box-sizing: border-box; /* css3 */ +} + +.select2-container .select2-choice { + display: block; + height: 26px; + padding: 0 0 0 8px; + overflow: hidden; + position: relative; + + border: 1px solid #aaa; + white-space: nowrap; + line-height: 26px; + color: #444; + text-decoration: none; + + border-radius: 4px; + + background-clip: padding-box; + + -webkit-touch-callout: none; + -webkit-user-select: none; + -moz-user-select: none; + -ms-user-select: none; + user-select: none; + + background-color: #fff; + background-image: -webkit-gradient(linear, left bottom, left top, color-stop(0, #eee), color-stop(0.5, #fff)); + background-image: -webkit-linear-gradient(center bottom, #eee 0%, #fff 50%); + background-image: -moz-linear-gradient(center bottom, #eee 0%, #fff 50%); + filter: progid:DXImageTransform.Microsoft.gradient(startColorstr = '#ffffff', endColorstr = '#eeeeee', GradientType = 0); + background-image: linear-gradient(to top, #eee 0%, #fff 50%); +} + +.select2-container.select2-drop-above .select2-choice { + border-bottom-color: #aaa; + + border-radius: 0 0 4px 4px; + + background-image: -webkit-gradient(linear, left bottom, left top, color-stop(0, #eee), color-stop(0.9, #fff)); + background-image: -webkit-linear-gradient(center bottom, #eee 0%, #fff 90%); + background-image: -moz-linear-gradient(center bottom, #eee 0%, #fff 90%); + filter: progid:DXImageTransform.Microsoft.gradient(startColorstr='#ffffff', endColorstr='#eeeeee', GradientType=0); + background-image: linear-gradient(to bottom, #eee 0%, #fff 90%); +} + +.select2-container.select2-allowclear .select2-choice .select2-chosen { + margin-right: 42px; +} + +.select2-container .select2-choice > .select2-chosen { + margin-right: 26px; + display: block; + overflow: hidden; + + white-space: nowrap; + + text-overflow: ellipsis; + float: none; + width: auto; +} + +.select2-container .select2-choice abbr { + display: none; + width: 12px; + height: 12px; + position: absolute; + right: 24px; + top: 8px; + + font-size: 1px; + text-decoration: none; + + border: 0; + background: url('select2.png') right top no-repeat; + cursor: pointer; + outline: 0; +} + +.select2-container.select2-allowclear .select2-choice abbr { + display: inline-block; +} + +.select2-container .select2-choice abbr:hover { + background-position: right -11px; + cursor: pointer; +} + +.select2-drop-mask { + border: 0; + margin: 0; + padding: 0; + position: fixed; + left: 0; + top: 0; + min-height: 100%; + min-width: 100%; + height: auto; + width: auto; + opacity: 0; + z-index: 9998; + /* styles required for IE to work */ + background-color: #fff; + filter: alpha(opacity=0); +} + +.select2-drop { + width: 100%; + margin-top: -1px; + position: absolute; + z-index: 9999; + top: 100%; + + background: #fff; + color: #000; + border: 1px solid #aaa; + border-top: 0; + + border-radius: 0 0 4px 4px; + + -webkit-box-shadow: 0 4px 5px rgba(0, 0, 0, .15); + box-shadow: 0 4px 5px rgba(0, 0, 0, .15); +} + +.select2-drop.select2-drop-above { + margin-top: 1px; + border-top: 1px solid #aaa; + border-bottom: 0; + + border-radius: 4px 4px 0 0; + + -webkit-box-shadow: 0 -4px 5px rgba(0, 0, 0, .15); + box-shadow: 0 -4px 5px rgba(0, 0, 0, .15); +} + +.select2-drop-active { + border: 1px solid #5897fb; + border-top: none; +} + +.select2-drop.select2-drop-above.select2-drop-active { + border-top: 1px solid #5897fb; +} + +.select2-drop-auto-width { + border-top: 1px solid #aaa; + width: auto; +} + +.select2-drop-auto-width .select2-search { + padding-top: 4px; +} + +.select2-container .select2-choice .select2-arrow { + display: inline-block; + width: 18px; + height: 100%; + position: absolute; + right: 0; + top: 0; + + border-left: 1px solid #aaa; + border-radius: 0 4px 4px 0; + + background-clip: padding-box; + + background: #ccc; + background-image: -webkit-gradient(linear, left bottom, left top, color-stop(0, #ccc), color-stop(0.6, #eee)); + background-image: -webkit-linear-gradient(center bottom, #ccc 0%, #eee 60%); + background-image: -moz-linear-gradient(center bottom, #ccc 0%, #eee 60%); + filter: progid:DXImageTransform.Microsoft.gradient(startColorstr = '#eeeeee', endColorstr = '#cccccc', GradientType = 0); + background-image: linear-gradient(to top, #ccc 0%, #eee 60%); +} + +.select2-container .select2-choice .select2-arrow b { + display: block; + width: 100%; + height: 100%; + background: url('select2.png') no-repeat 0 1px; +} + +.select2-search { + display: inline-block; + width: 100%; + min-height: 26px; + margin: 0; + padding-left: 4px; + padding-right: 4px; + + position: relative; + z-index: 10000; + + white-space: nowrap; +} + +.select2-search input { + width: 100%; + height: auto !important; + min-height: 26px; + padding: 4px 20px 4px 5px; + margin: 0; + + outline: 0; + font-family: sans-serif; + font-size: 1em; + + border: 1px solid #aaa; + border-radius: 0; + + -webkit-box-shadow: none; + box-shadow: none; + + background: #fff url('select2.png') no-repeat 100% -22px; + background: url('select2.png') no-repeat 100% -22px, -webkit-gradient(linear, left bottom, left top, color-stop(0.85, #fff), color-stop(0.99, #eee)); + background: url('select2.png') no-repeat 100% -22px, -webkit-linear-gradient(center bottom, #fff 85%, #eee 99%); + background: url('select2.png') no-repeat 100% -22px, -moz-linear-gradient(center bottom, #fff 85%, #eee 99%); + background: url('select2.png') no-repeat 100% -22px, linear-gradient(to bottom, #fff 85%, #eee 99%) 0 0; +} + +.select2-drop.select2-drop-above .select2-search input { + margin-top: 4px; +} + +.select2-search input.select2-active { + background: #fff url('select2-spinner.gif') no-repeat 100%; + background: url('select2-spinner.gif') no-repeat 100%, -webkit-gradient(linear, left bottom, left top, color-stop(0.85, #fff), color-stop(0.99, #eee)); + background: url('select2-spinner.gif') no-repeat 100%, -webkit-linear-gradient(center bottom, #fff 85%, #eee 99%); + background: url('select2-spinner.gif') no-repeat 100%, -moz-linear-gradient(center bottom, #fff 85%, #eee 99%); + background: url('select2-spinner.gif') no-repeat 100%, linear-gradient(to bottom, #fff 85%, #eee 99%) 0 0; +} + +.select2-container-active .select2-choice, +.select2-container-active .select2-choices { + border: 1px solid #5897fb; + outline: none; + + -webkit-box-shadow: 0 0 5px rgba(0, 0, 0, .3); + box-shadow: 0 0 5px rgba(0, 0, 0, .3); +} + +.select2-dropdown-open .select2-choice { + border-bottom-color: transparent; + -webkit-box-shadow: 0 1px 0 #fff inset; + box-shadow: 0 1px 0 #fff inset; + + border-bottom-left-radius: 0; + border-bottom-right-radius: 0; + + background-color: #eee; + background-image: -webkit-gradient(linear, left bottom, left top, color-stop(0, #fff), color-stop(0.5, #eee)); + background-image: -webkit-linear-gradient(center bottom, #fff 0%, #eee 50%); + background-image: -moz-linear-gradient(center bottom, #fff 0%, #eee 50%); + filter: progid:DXImageTransform.Microsoft.gradient(startColorstr='#eeeeee', endColorstr='#ffffff', GradientType=0); + background-image: linear-gradient(to top, #fff 0%, #eee 50%); +} + +.select2-dropdown-open.select2-drop-above .select2-choice, +.select2-dropdown-open.select2-drop-above .select2-choices { + border: 1px solid #5897fb; + border-top-color: transparent; + + background-image: -webkit-gradient(linear, left top, left bottom, color-stop(0, #fff), color-stop(0.5, #eee)); + background-image: -webkit-linear-gradient(center top, #fff 0%, #eee 50%); + background-image: -moz-linear-gradient(center top, #fff 0%, #eee 50%); + filter: progid:DXImageTransform.Microsoft.gradient(startColorstr='#eeeeee', endColorstr='#ffffff', GradientType=0); + background-image: linear-gradient(to bottom, #fff 0%, #eee 50%); +} + +.select2-dropdown-open .select2-choice .select2-arrow { + background: transparent; + border-left: none; + filter: none; +} +.select2-dropdown-open .select2-choice .select2-arrow b { + background-position: -18px 1px; +} + +.select2-hidden-accessible { + border: 0; + clip: rect(0 0 0 0); + height: 1px; + margin: -1px; + overflow: hidden; + padding: 0; + position: absolute; + width: 1px; +} + +/* results */ +.select2-results { + max-height: 200px; + padding: 0 0 0 4px; + margin: 4px 4px 4px 0; + position: relative; + overflow-x: hidden; + overflow-y: auto; + -webkit-tap-highlight-color: rgba(0, 0, 0, 0); +} + +.select2-results ul.select2-result-sub { + margin: 0; + padding-left: 0; +} + +.select2-results li { + list-style: none; + display: list-item; + background-image: none; +} + +.select2-results li.select2-result-with-children > .select2-result-label { + font-weight: bold; +} + +.select2-results .select2-result-label { + padding: 3px 7px 4px; + margin: 0; + cursor: pointer; + + min-height: 1em; + + -webkit-touch-callout: none; + -webkit-user-select: none; + -moz-user-select: none; + -ms-user-select: none; + user-select: none; +} + +.select2-results-dept-1 .select2-result-label { padding-left: 20px } +.select2-results-dept-2 .select2-result-label { padding-left: 40px } +.select2-results-dept-3 .select2-result-label { padding-left: 60px } +.select2-results-dept-4 .select2-result-label { padding-left: 80px } +.select2-results-dept-5 .select2-result-label { padding-left: 100px } +.select2-results-dept-6 .select2-result-label { padding-left: 110px } +.select2-results-dept-7 .select2-result-label { padding-left: 120px } + +.select2-results .select2-highlighted { + background: #3875d7; + color: #fff; +} + +.select2-results li em { + background: #feffde; + font-style: normal; +} + +.select2-results .select2-highlighted em { + background: transparent; +} + +.select2-results .select2-highlighted ul { + background: #fff; + color: #000; +} + + +.select2-results .select2-no-results, +.select2-results .select2-searching, +.select2-results .select2-selection-limit { + background: #f4f4f4; + display: list-item; + padding-left: 5px; +} + +/* +disabled look for disabled choices in the results dropdown +*/ +.select2-results .select2-disabled.select2-highlighted { + color: #666; + background: #f4f4f4; + display: list-item; + cursor: default; +} +.select2-results .select2-disabled { + background: #f4f4f4; + display: list-item; + cursor: default; +} + +.select2-results .select2-selected { + display: none; +} + +.select2-more-results.select2-active { + background: #f4f4f4 url('select2-spinner.gif') no-repeat 100%; +} + +.select2-more-results { + background: #f4f4f4; + display: list-item; +} + +/* disabled styles */ + +.select2-container.select2-container-disabled .select2-choice { + background-color: #f4f4f4; + background-image: none; + border: 1px solid #ddd; + cursor: default; +} + +.select2-container.select2-container-disabled .select2-choice .select2-arrow { + background-color: #f4f4f4; + background-image: none; + border-left: 0; +} + +.select2-container.select2-container-disabled .select2-choice abbr { + display: none; +} + + +/* multiselect */ + +.select2-container-multi .select2-choices { + height: auto !important; + height: 1%; + margin: 0; + padding: 0; + position: relative; + + border: 1px solid #aaa; + cursor: text; + overflow: hidden; + + background-color: #fff; + background-image: -webkit-gradient(linear, 0% 0%, 0% 100%, color-stop(1%, #eee), color-stop(15%, #fff)); + background-image: -webkit-linear-gradient(top, #eee 1%, #fff 15%); + background-image: -moz-linear-gradient(top, #eee 1%, #fff 15%); + background-image: linear-gradient(to bottom, #eee 1%, #fff 15%); +} + +.select2-locked { + padding: 3px 5px 3px 5px !important; +} + +.select2-container-multi .select2-choices { + min-height: 26px; +} + +.select2-container-multi.select2-container-active .select2-choices { + border: 1px solid #5897fb; + outline: none; + + -webkit-box-shadow: 0 0 5px rgba(0, 0, 0, .3); + box-shadow: 0 0 5px rgba(0, 0, 0, .3); +} +.select2-container-multi .select2-choices li { + float: left; + list-style: none; +} +html[dir="rtl"] .select2-container-multi .select2-choices li +{ + float: right; +} +.select2-container-multi .select2-choices .select2-search-field { + margin: 0; + padding: 0; + white-space: nowrap; +} + +.select2-container-multi .select2-choices .select2-search-field input { + padding: 5px; + margin: 1px 0; + + font-family: sans-serif; + font-size: 100%; + color: #666; + outline: 0; + border: 0; + -webkit-box-shadow: none; + box-shadow: none; + background: transparent !important; +} + +.select2-container-multi .select2-choices .select2-search-field input.select2-active { + background: #fff url('select2-spinner.gif') no-repeat 100% !important; +} + +.select2-default { + color: #999 !important; +} + +.select2-container-multi .select2-choices .select2-search-choice { + padding: 3px 5px 3px 18px; + margin: 3px 0 3px 5px; + position: relative; + + line-height: 13px; + color: #333; + cursor: default; + border: 1px solid #aaaaaa; + + border-radius: 3px; + + -webkit-box-shadow: 0 0 2px #fff inset, 0 1px 0 rgba(0, 0, 0, 0.05); + box-shadow: 0 0 2px #fff inset, 0 1px 0 rgba(0, 0, 0, 0.05); + + background-clip: padding-box; + + -webkit-touch-callout: none; + -webkit-user-select: none; + -moz-user-select: none; + -ms-user-select: none; + user-select: none; + + background-color: #e4e4e4; + filter: progid:DXImageTransform.Microsoft.gradient(startColorstr='#eeeeee', endColorstr='#f4f4f4', GradientType=0); + background-image: -webkit-gradient(linear, 0% 0%, 0% 100%, color-stop(20%, #f4f4f4), color-stop(50%, #f0f0f0), color-stop(52%, #e8e8e8), color-stop(100%, #eee)); + background-image: -webkit-linear-gradient(top, #f4f4f4 20%, #f0f0f0 50%, #e8e8e8 52%, #eee 100%); + background-image: -moz-linear-gradient(top, #f4f4f4 20%, #f0f0f0 50%, #e8e8e8 52%, #eee 100%); + background-image: linear-gradient(to top, #f4f4f4 20%, #f0f0f0 50%, #e8e8e8 52%, #eee 100%); +} +html[dir="rtl"] .select2-container-multi .select2-choices .select2-search-choice +{ + margin-left: 0; + margin-right: 5px; +} +.select2-container-multi .select2-choices .select2-search-choice .select2-chosen { + cursor: default; +} +.select2-container-multi .select2-choices .select2-search-choice-focus { + background: #d4d4d4; +} + +.select2-search-choice-close { + display: block; + width: 12px; + height: 13px; + position: absolute; + right: 3px; + top: 4px; + + font-size: 1px; + outline: none; + background: url('select2.png') right top no-repeat; +} +html[dir="rtl"] .select2-search-choice-close { + right: auto; + left: 3px; +} + +.select2-container-multi .select2-search-choice-close { + left: 3px; +} + +.select2-container-multi .select2-choices .select2-search-choice .select2-search-choice-close:hover { + background-position: right -11px; +} +.select2-container-multi .select2-choices .select2-search-choice-focus .select2-search-choice-close { + background-position: right -11px; +} + +/* disabled styles */ +.select2-container-multi.select2-container-disabled .select2-choices { + background-color: #f4f4f4; + background-image: none; + border: 1px solid #ddd; + cursor: default; +} + +.select2-container-multi.select2-container-disabled .select2-choices .select2-search-choice { + padding: 3px 5px 3px 5px; + border: 1px solid #ddd; + background-image: none; + background-color: #f4f4f4; +} + +.select2-container-multi.select2-container-disabled .select2-choices .select2-search-choice .select2-search-choice-close { display: none; + background: none; +} +/* end multiselect */ + + +.select2-result-selectable .select2-match, +.select2-result-unselectable .select2-match { + text-decoration: underline; +} + +.select2-offscreen, .select2-offscreen:focus { + clip: rect(0 0 0 0) !important; + width: 1px !important; + height: 1px !important; + border: 0 !important; + margin: 0 !important; + padding: 0 !important; + overflow: hidden !important; + position: absolute !important; + outline: 0 !important; + left: 0px !important; + top: 0px !important; +} + +.select2-display-none { + display: none; +} + +.select2-measure-scrollbar { + position: absolute; + top: -10000px; + left: -10000px; + width: 100px; + height: 100px; + overflow: scroll; +} + +/* Retina-ize icons */ + +@media only screen and (-webkit-min-device-pixel-ratio: 1.5), only screen and (min-resolution: 2dppx) { + .select2-search input, + .select2-search-choice-close, + .select2-container .select2-choice abbr, + .select2-container .select2-choice .select2-arrow b { + background-image: url('select2x2.png') !important; + background-repeat: no-repeat !important; + background-size: 60px 40px !important; + } + + .select2-search input { + background-position: 100% -21px !important; + } +} diff --git a/app/bower_components/select2/select2.jquery.json b/app/bower_components/select2/select2.jquery.json new file mode 100644 index 0000000..e911927 --- /dev/null +++ b/app/bower_components/select2/select2.jquery.json @@ -0,0 +1,36 @@ +{ + "name": "select2", + "title": "Select2", + "description": "Select2 is a jQuery based replacement for select boxes. It supports searching, remote data sets, and infinite scrolling of results.", + "keywords": [ + "select", + "autocomplete", + "typeahead", + "dropdown", + "multiselect", + "tag", + "tagging" + ], + "version": "3.4.8", + "author": { + "name": "Igor Vaynberg", + "url": "https://github.com/ivaynberg" + }, + "licenses": [ + { + "type": "Apache", + "url": "http://www.apache.org/licenses/LICENSE-2.0" + }, + { + "type": "GPL v2", + "url": "http://www.gnu.org/licenses/gpl-2.0.html" + } + ], + "bugs": "https://github.com/ivaynberg/select2/issues", + "homepage": "http://ivaynberg.github.com/select2", + "docs": "http://ivaynberg.github.com/select2/", + "download": "https://github.com/ivaynberg/select2/tags", + "dependencies": { + "jquery": ">=1.7.1" + } +} diff --git a/app/bower_components/select2/select2.js b/app/bower_components/select2/select2.js new file mode 100644 index 0000000..2969da5 --- /dev/null +++ b/app/bower_components/select2/select2.js @@ -0,0 +1,3448 @@ +/* +Copyright 2012 Igor Vaynberg + +Version: 3.4.8 Timestamp: Thu May 1 09:50:32 EDT 2014 + +This software is licensed under the Apache License, Version 2.0 (the "Apache License") or the GNU +General Public License version 2 (the "GPL License"). You may choose either license to govern your +use of this software only upon the condition that you accept all of the terms of either the Apache +License or the GPL License. + +You may obtain a copy of the Apache License and the GPL License at: + + http://www.apache.org/licenses/LICENSE-2.0 + http://www.gnu.org/licenses/gpl-2.0.html + +Unless required by applicable law or agreed to in writing, software distributed under the +Apache License or the GPL License is distributed on an "AS IS" BASIS, WITHOUT WARRANTIES OR +CONDITIONS OF ANY KIND, either express or implied. See the Apache License and the GPL License for +the specific language governing permissions and limitations under the Apache License and the GPL License. +*/ +(function ($) { + if(typeof $.fn.each2 == "undefined") { + $.extend($.fn, { + /* + * 4-10 times faster .each replacement + * use it carefully, as it overrides jQuery context of element on each iteration + */ + each2 : function (c) { + var j = $([0]), i = -1, l = this.length; + while ( + ++i < l + && (j.context = j[0] = this[i]) + && c.call(j[0], i, j) !== false //"this"=DOM, i=index, j=jQuery object + ); + return this; + } + }); + } +})(jQuery); + +(function ($, undefined) { + "use strict"; + /*global document, window, jQuery, console */ + + if (window.Select2 !== undefined) { + return; + } + + var KEY, AbstractSelect2, SingleSelect2, MultiSelect2, nextUid, sizer, + lastMousePosition={x:0,y:0}, $document, scrollBarDimensions, + + KEY = { + TAB: 9, + ENTER: 13, + ESC: 27, + SPACE: 32, + LEFT: 37, + UP: 38, + RIGHT: 39, + DOWN: 40, + SHIFT: 16, + CTRL: 17, + ALT: 18, + PAGE_UP: 33, + PAGE_DOWN: 34, + HOME: 36, + END: 35, + BACKSPACE: 8, + DELETE: 46, + isArrow: function (k) { + k = k.which ? k.which : k; + switch (k) { + case KEY.LEFT: + case KEY.RIGHT: + case KEY.UP: + case KEY.DOWN: + return true; + } + return false; + }, + isControl: function (e) { + var k = e.which; + switch (k) { + case KEY.SHIFT: + case KEY.CTRL: + case KEY.ALT: + return true; + } + + if (e.metaKey) return true; + + return false; + }, + isFunctionKey: function (k) { + k = k.which ? k.which : k; + return k >= 112 && k <= 123; + } + }, + MEASURE_SCROLLBAR_TEMPLATE = "
", + + DIACRITICS = {"\u24B6":"A","\uFF21":"A","\u00C0":"A","\u00C1":"A","\u00C2":"A","\u1EA6":"A","\u1EA4":"A","\u1EAA":"A","\u1EA8":"A","\u00C3":"A","\u0100":"A","\u0102":"A","\u1EB0":"A","\u1EAE":"A","\u1EB4":"A","\u1EB2":"A","\u0226":"A","\u01E0":"A","\u00C4":"A","\u01DE":"A","\u1EA2":"A","\u00C5":"A","\u01FA":"A","\u01CD":"A","\u0200":"A","\u0202":"A","\u1EA0":"A","\u1EAC":"A","\u1EB6":"A","\u1E00":"A","\u0104":"A","\u023A":"A","\u2C6F":"A","\uA732":"AA","\u00C6":"AE","\u01FC":"AE","\u01E2":"AE","\uA734":"AO","\uA736":"AU","\uA738":"AV","\uA73A":"AV","\uA73C":"AY","\u24B7":"B","\uFF22":"B","\u1E02":"B","\u1E04":"B","\u1E06":"B","\u0243":"B","\u0182":"B","\u0181":"B","\u24B8":"C","\uFF23":"C","\u0106":"C","\u0108":"C","\u010A":"C","\u010C":"C","\u00C7":"C","\u1E08":"C","\u0187":"C","\u023B":"C","\uA73E":"C","\u24B9":"D","\uFF24":"D","\u1E0A":"D","\u010E":"D","\u1E0C":"D","\u1E10":"D","\u1E12":"D","\u1E0E":"D","\u0110":"D","\u018B":"D","\u018A":"D","\u0189":"D","\uA779":"D","\u01F1":"DZ","\u01C4":"DZ","\u01F2":"Dz","\u01C5":"Dz","\u24BA":"E","\uFF25":"E","\u00C8":"E","\u00C9":"E","\u00CA":"E","\u1EC0":"E","\u1EBE":"E","\u1EC4":"E","\u1EC2":"E","\u1EBC":"E","\u0112":"E","\u1E14":"E","\u1E16":"E","\u0114":"E","\u0116":"E","\u00CB":"E","\u1EBA":"E","\u011A":"E","\u0204":"E","\u0206":"E","\u1EB8":"E","\u1EC6":"E","\u0228":"E","\u1E1C":"E","\u0118":"E","\u1E18":"E","\u1E1A":"E","\u0190":"E","\u018E":"E","\u24BB":"F","\uFF26":"F","\u1E1E":"F","\u0191":"F","\uA77B":"F","\u24BC":"G","\uFF27":"G","\u01F4":"G","\u011C":"G","\u1E20":"G","\u011E":"G","\u0120":"G","\u01E6":"G","\u0122":"G","\u01E4":"G","\u0193":"G","\uA7A0":"G","\uA77D":"G","\uA77E":"G","\u24BD":"H","\uFF28":"H","\u0124":"H","\u1E22":"H","\u1E26":"H","\u021E":"H","\u1E24":"H","\u1E28":"H","\u1E2A":"H","\u0126":"H","\u2C67":"H","\u2C75":"H","\uA78D":"H","\u24BE":"I","\uFF29":"I","\u00CC":"I","\u00CD":"I","\u00CE":"I","\u0128":"I","\u012A":"I","\u012C":"I","\u0130":"I","\u00CF":"I","\u1E2E":"I","\u1EC8":"I","\u01CF":"I","\u0208":"I","\u020A":"I","\u1ECA":"I","\u012E":"I","\u1E2C":"I","\u0197":"I","\u24BF":"J","\uFF2A":"J","\u0134":"J","\u0248":"J","\u24C0":"K","\uFF2B":"K","\u1E30":"K","\u01E8":"K","\u1E32":"K","\u0136":"K","\u1E34":"K","\u0198":"K","\u2C69":"K","\uA740":"K","\uA742":"K","\uA744":"K","\uA7A2":"K","\u24C1":"L","\uFF2C":"L","\u013F":"L","\u0139":"L","\u013D":"L","\u1E36":"L","\u1E38":"L","\u013B":"L","\u1E3C":"L","\u1E3A":"L","\u0141":"L","\u023D":"L","\u2C62":"L","\u2C60":"L","\uA748":"L","\uA746":"L","\uA780":"L","\u01C7":"LJ","\u01C8":"Lj","\u24C2":"M","\uFF2D":"M","\u1E3E":"M","\u1E40":"M","\u1E42":"M","\u2C6E":"M","\u019C":"M","\u24C3":"N","\uFF2E":"N","\u01F8":"N","\u0143":"N","\u00D1":"N","\u1E44":"N","\u0147":"N","\u1E46":"N","\u0145":"N","\u1E4A":"N","\u1E48":"N","\u0220":"N","\u019D":"N","\uA790":"N","\uA7A4":"N","\u01CA":"NJ","\u01CB":"Nj","\u24C4":"O","\uFF2F":"O","\u00D2":"O","\u00D3":"O","\u00D4":"O","\u1ED2":"O","\u1ED0":"O","\u1ED6":"O","\u1ED4":"O","\u00D5":"O","\u1E4C":"O","\u022C":"O","\u1E4E":"O","\u014C":"O","\u1E50":"O","\u1E52":"O","\u014E":"O","\u022E":"O","\u0230":"O","\u00D6":"O","\u022A":"O","\u1ECE":"O","\u0150":"O","\u01D1":"O","\u020C":"O","\u020E":"O","\u01A0":"O","\u1EDC":"O","\u1EDA":"O","\u1EE0":"O","\u1EDE":"O","\u1EE2":"O","\u1ECC":"O","\u1ED8":"O","\u01EA":"O","\u01EC":"O","\u00D8":"O","\u01FE":"O","\u0186":"O","\u019F":"O","\uA74A":"O","\uA74C":"O","\u01A2":"OI","\uA74E":"OO","\u0222":"OU","\u24C5":"P","\uFF30":"P","\u1E54":"P","\u1E56":"P","\u01A4":"P","\u2C63":"P","\uA750":"P","\uA752":"P","\uA754":"P","\u24C6":"Q","\uFF31":"Q","\uA756":"Q","\uA758":"Q","\u024A":"Q","\u24C7":"R","\uFF32":"R","\u0154":"R","\u1E58":"R","\u0158":"R","\u0210":"R","\u0212":"R","\u1E5A":"R","\u1E5C":"R","\u0156":"R","\u1E5E":"R","\u024C":"R","\u2C64":"R","\uA75A":"R","\uA7A6":"R","\uA782":"R","\u24C8":"S","\uFF33":"S","\u1E9E":"S","\u015A":"S","\u1E64":"S","\u015C":"S","\u1E60":"S","\u0160":"S","\u1E66":"S","\u1E62":"S","\u1E68":"S","\u0218":"S","\u015E":"S","\u2C7E":"S","\uA7A8":"S","\uA784":"S","\u24C9":"T","\uFF34":"T","\u1E6A":"T","\u0164":"T","\u1E6C":"T","\u021A":"T","\u0162":"T","\u1E70":"T","\u1E6E":"T","\u0166":"T","\u01AC":"T","\u01AE":"T","\u023E":"T","\uA786":"T","\uA728":"TZ","\u24CA":"U","\uFF35":"U","\u00D9":"U","\u00DA":"U","\u00DB":"U","\u0168":"U","\u1E78":"U","\u016A":"U","\u1E7A":"U","\u016C":"U","\u00DC":"U","\u01DB":"U","\u01D7":"U","\u01D5":"U","\u01D9":"U","\u1EE6":"U","\u016E":"U","\u0170":"U","\u01D3":"U","\u0214":"U","\u0216":"U","\u01AF":"U","\u1EEA":"U","\u1EE8":"U","\u1EEE":"U","\u1EEC":"U","\u1EF0":"U","\u1EE4":"U","\u1E72":"U","\u0172":"U","\u1E76":"U","\u1E74":"U","\u0244":"U","\u24CB":"V","\uFF36":"V","\u1E7C":"V","\u1E7E":"V","\u01B2":"V","\uA75E":"V","\u0245":"V","\uA760":"VY","\u24CC":"W","\uFF37":"W","\u1E80":"W","\u1E82":"W","\u0174":"W","\u1E86":"W","\u1E84":"W","\u1E88":"W","\u2C72":"W","\u24CD":"X","\uFF38":"X","\u1E8A":"X","\u1E8C":"X","\u24CE":"Y","\uFF39":"Y","\u1EF2":"Y","\u00DD":"Y","\u0176":"Y","\u1EF8":"Y","\u0232":"Y","\u1E8E":"Y","\u0178":"Y","\u1EF6":"Y","\u1EF4":"Y","\u01B3":"Y","\u024E":"Y","\u1EFE":"Y","\u24CF":"Z","\uFF3A":"Z","\u0179":"Z","\u1E90":"Z","\u017B":"Z","\u017D":"Z","\u1E92":"Z","\u1E94":"Z","\u01B5":"Z","\u0224":"Z","\u2C7F":"Z","\u2C6B":"Z","\uA762":"Z","\u24D0":"a","\uFF41":"a","\u1E9A":"a","\u00E0":"a","\u00E1":"a","\u00E2":"a","\u1EA7":"a","\u1EA5":"a","\u1EAB":"a","\u1EA9":"a","\u00E3":"a","\u0101":"a","\u0103":"a","\u1EB1":"a","\u1EAF":"a","\u1EB5":"a","\u1EB3":"a","\u0227":"a","\u01E1":"a","\u00E4":"a","\u01DF":"a","\u1EA3":"a","\u00E5":"a","\u01FB":"a","\u01CE":"a","\u0201":"a","\u0203":"a","\u1EA1":"a","\u1EAD":"a","\u1EB7":"a","\u1E01":"a","\u0105":"a","\u2C65":"a","\u0250":"a","\uA733":"aa","\u00E6":"ae","\u01FD":"ae","\u01E3":"ae","\uA735":"ao","\uA737":"au","\uA739":"av","\uA73B":"av","\uA73D":"ay","\u24D1":"b","\uFF42":"b","\u1E03":"b","\u1E05":"b","\u1E07":"b","\u0180":"b","\u0183":"b","\u0253":"b","\u24D2":"c","\uFF43":"c","\u0107":"c","\u0109":"c","\u010B":"c","\u010D":"c","\u00E7":"c","\u1E09":"c","\u0188":"c","\u023C":"c","\uA73F":"c","\u2184":"c","\u24D3":"d","\uFF44":"d","\u1E0B":"d","\u010F":"d","\u1E0D":"d","\u1E11":"d","\u1E13":"d","\u1E0F":"d","\u0111":"d","\u018C":"d","\u0256":"d","\u0257":"d","\uA77A":"d","\u01F3":"dz","\u01C6":"dz","\u24D4":"e","\uFF45":"e","\u00E8":"e","\u00E9":"e","\u00EA":"e","\u1EC1":"e","\u1EBF":"e","\u1EC5":"e","\u1EC3":"e","\u1EBD":"e","\u0113":"e","\u1E15":"e","\u1E17":"e","\u0115":"e","\u0117":"e","\u00EB":"e","\u1EBB":"e","\u011B":"e","\u0205":"e","\u0207":"e","\u1EB9":"e","\u1EC7":"e","\u0229":"e","\u1E1D":"e","\u0119":"e","\u1E19":"e","\u1E1B":"e","\u0247":"e","\u025B":"e","\u01DD":"e","\u24D5":"f","\uFF46":"f","\u1E1F":"f","\u0192":"f","\uA77C":"f","\u24D6":"g","\uFF47":"g","\u01F5":"g","\u011D":"g","\u1E21":"g","\u011F":"g","\u0121":"g","\u01E7":"g","\u0123":"g","\u01E5":"g","\u0260":"g","\uA7A1":"g","\u1D79":"g","\uA77F":"g","\u24D7":"h","\uFF48":"h","\u0125":"h","\u1E23":"h","\u1E27":"h","\u021F":"h","\u1E25":"h","\u1E29":"h","\u1E2B":"h","\u1E96":"h","\u0127":"h","\u2C68":"h","\u2C76":"h","\u0265":"h","\u0195":"hv","\u24D8":"i","\uFF49":"i","\u00EC":"i","\u00ED":"i","\u00EE":"i","\u0129":"i","\u012B":"i","\u012D":"i","\u00EF":"i","\u1E2F":"i","\u1EC9":"i","\u01D0":"i","\u0209":"i","\u020B":"i","\u1ECB":"i","\u012F":"i","\u1E2D":"i","\u0268":"i","\u0131":"i","\u24D9":"j","\uFF4A":"j","\u0135":"j","\u01F0":"j","\u0249":"j","\u24DA":"k","\uFF4B":"k","\u1E31":"k","\u01E9":"k","\u1E33":"k","\u0137":"k","\u1E35":"k","\u0199":"k","\u2C6A":"k","\uA741":"k","\uA743":"k","\uA745":"k","\uA7A3":"k","\u24DB":"l","\uFF4C":"l","\u0140":"l","\u013A":"l","\u013E":"l","\u1E37":"l","\u1E39":"l","\u013C":"l","\u1E3D":"l","\u1E3B":"l","\u017F":"l","\u0142":"l","\u019A":"l","\u026B":"l","\u2C61":"l","\uA749":"l","\uA781":"l","\uA747":"l","\u01C9":"lj","\u24DC":"m","\uFF4D":"m","\u1E3F":"m","\u1E41":"m","\u1E43":"m","\u0271":"m","\u026F":"m","\u24DD":"n","\uFF4E":"n","\u01F9":"n","\u0144":"n","\u00F1":"n","\u1E45":"n","\u0148":"n","\u1E47":"n","\u0146":"n","\u1E4B":"n","\u1E49":"n","\u019E":"n","\u0272":"n","\u0149":"n","\uA791":"n","\uA7A5":"n","\u01CC":"nj","\u24DE":"o","\uFF4F":"o","\u00F2":"o","\u00F3":"o","\u00F4":"o","\u1ED3":"o","\u1ED1":"o","\u1ED7":"o","\u1ED5":"o","\u00F5":"o","\u1E4D":"o","\u022D":"o","\u1E4F":"o","\u014D":"o","\u1E51":"o","\u1E53":"o","\u014F":"o","\u022F":"o","\u0231":"o","\u00F6":"o","\u022B":"o","\u1ECF":"o","\u0151":"o","\u01D2":"o","\u020D":"o","\u020F":"o","\u01A1":"o","\u1EDD":"o","\u1EDB":"o","\u1EE1":"o","\u1EDF":"o","\u1EE3":"o","\u1ECD":"o","\u1ED9":"o","\u01EB":"o","\u01ED":"o","\u00F8":"o","\u01FF":"o","\u0254":"o","\uA74B":"o","\uA74D":"o","\u0275":"o","\u01A3":"oi","\u0223":"ou","\uA74F":"oo","\u24DF":"p","\uFF50":"p","\u1E55":"p","\u1E57":"p","\u01A5":"p","\u1D7D":"p","\uA751":"p","\uA753":"p","\uA755":"p","\u24E0":"q","\uFF51":"q","\u024B":"q","\uA757":"q","\uA759":"q","\u24E1":"r","\uFF52":"r","\u0155":"r","\u1E59":"r","\u0159":"r","\u0211":"r","\u0213":"r","\u1E5B":"r","\u1E5D":"r","\u0157":"r","\u1E5F":"r","\u024D":"r","\u027D":"r","\uA75B":"r","\uA7A7":"r","\uA783":"r","\u24E2":"s","\uFF53":"s","\u00DF":"s","\u015B":"s","\u1E65":"s","\u015D":"s","\u1E61":"s","\u0161":"s","\u1E67":"s","\u1E63":"s","\u1E69":"s","\u0219":"s","\u015F":"s","\u023F":"s","\uA7A9":"s","\uA785":"s","\u1E9B":"s","\u24E3":"t","\uFF54":"t","\u1E6B":"t","\u1E97":"t","\u0165":"t","\u1E6D":"t","\u021B":"t","\u0163":"t","\u1E71":"t","\u1E6F":"t","\u0167":"t","\u01AD":"t","\u0288":"t","\u2C66":"t","\uA787":"t","\uA729":"tz","\u24E4":"u","\uFF55":"u","\u00F9":"u","\u00FA":"u","\u00FB":"u","\u0169":"u","\u1E79":"u","\u016B":"u","\u1E7B":"u","\u016D":"u","\u00FC":"u","\u01DC":"u","\u01D8":"u","\u01D6":"u","\u01DA":"u","\u1EE7":"u","\u016F":"u","\u0171":"u","\u01D4":"u","\u0215":"u","\u0217":"u","\u01B0":"u","\u1EEB":"u","\u1EE9":"u","\u1EEF":"u","\u1EED":"u","\u1EF1":"u","\u1EE5":"u","\u1E73":"u","\u0173":"u","\u1E77":"u","\u1E75":"u","\u0289":"u","\u24E5":"v","\uFF56":"v","\u1E7D":"v","\u1E7F":"v","\u028B":"v","\uA75F":"v","\u028C":"v","\uA761":"vy","\u24E6":"w","\uFF57":"w","\u1E81":"w","\u1E83":"w","\u0175":"w","\u1E87":"w","\u1E85":"w","\u1E98":"w","\u1E89":"w","\u2C73":"w","\u24E7":"x","\uFF58":"x","\u1E8B":"x","\u1E8D":"x","\u24E8":"y","\uFF59":"y","\u1EF3":"y","\u00FD":"y","\u0177":"y","\u1EF9":"y","\u0233":"y","\u1E8F":"y","\u00FF":"y","\u1EF7":"y","\u1E99":"y","\u1EF5":"y","\u01B4":"y","\u024F":"y","\u1EFF":"y","\u24E9":"z","\uFF5A":"z","\u017A":"z","\u1E91":"z","\u017C":"z","\u017E":"z","\u1E93":"z","\u1E95":"z","\u01B6":"z","\u0225":"z","\u0240":"z","\u2C6C":"z","\uA763":"z"}; + + $document = $(document); + + nextUid=(function() { var counter=1; return function() { return counter++; }; }()); + + + function reinsertElement(element) { + var placeholder = $(document.createTextNode('')); + + element.before(placeholder); + placeholder.before(element); + placeholder.remove(); + } + + function stripDiacritics(str) { + // Used 'uni range + named function' from http://jsperf.com/diacritics/18 + function match(a) { + return DIACRITICS[a] || a; + } + + return str.replace(/[^\u0000-\u007E]/g, match); + } + + function indexOf(value, array) { + var i = 0, l = array.length; + for (; i < l; i = i + 1) { + if (equal(value, array[i])) return i; + } + return -1; + } + + function measureScrollbar () { + var $template = $( MEASURE_SCROLLBAR_TEMPLATE ); + $template.appendTo('body'); + + var dim = { + width: $template.width() - $template[0].clientWidth, + height: $template.height() - $template[0].clientHeight + }; + $template.remove(); + + return dim; + } + + /** + * Compares equality of a and b + * @param a + * @param b + */ + function equal(a, b) { + if (a === b) return true; + if (a === undefined || b === undefined) return false; + if (a === null || b === null) return false; + // Check whether 'a' or 'b' is a string (primitive or object). + // The concatenation of an empty string (+'') converts its argument to a string's primitive. + if (a.constructor === String) return a+'' === b+''; // a+'' - in case 'a' is a String object + if (b.constructor === String) return b+'' === a+''; // b+'' - in case 'b' is a String object + return false; + } + + /** + * Splits the string into an array of values, trimming each value. An empty array is returned for nulls or empty + * strings + * @param string + * @param separator + */ + function splitVal(string, separator) { + var val, i, l; + if (string === null || string.length < 1) return []; + val = string.split(separator); + for (i = 0, l = val.length; i < l; i = i + 1) val[i] = $.trim(val[i]); + return val; + } + + function getSideBorderPadding(element) { + return element.outerWidth(false) - element.width(); + } + + function installKeyUpChangeEvent(element) { + var key="keyup-change-value"; + element.on("keydown", function () { + if ($.data(element, key) === undefined) { + $.data(element, key, element.val()); + } + }); + element.on("keyup", function () { + var val= $.data(element, key); + if (val !== undefined && element.val() !== val) { + $.removeData(element, key); + element.trigger("keyup-change"); + } + }); + } + + $document.on("mousemove", function (e) { + lastMousePosition.x = e.pageX; + lastMousePosition.y = e.pageY; + }); + + /** + * filters mouse events so an event is fired only if the mouse moved. + * + * filters out mouse events that occur when mouse is stationary but + * the elements under the pointer are scrolled. + */ + function installFilteredMouseMove(element) { + element.on("mousemove", function (e) { + var lastpos = lastMousePosition; + if (lastpos === undefined || lastpos.x !== e.pageX || lastpos.y !== e.pageY) { + $(e.target).trigger("mousemove-filtered", e); + } + }); + } + + /** + * Debounces a function. Returns a function that calls the original fn function only if no invocations have been made + * within the last quietMillis milliseconds. + * + * @param quietMillis number of milliseconds to wait before invoking fn + * @param fn function to be debounced + * @param ctx object to be used as this reference within fn + * @return debounced version of fn + */ + function debounce(quietMillis, fn, ctx) { + ctx = ctx || undefined; + var timeout; + return function () { + var args = arguments; + window.clearTimeout(timeout); + timeout = window.setTimeout(function() { + fn.apply(ctx, args); + }, quietMillis); + }; + } + + function installDebouncedScroll(threshold, element) { + var notify = debounce(threshold, function (e) { element.trigger("scroll-debounced", e);}); + element.on("scroll", function (e) { + if (indexOf(e.target, element.get()) >= 0) notify(e); + }); + } + + function focus($el) { + if ($el[0] === document.activeElement) return; + + /* set the focus in a 0 timeout - that way the focus is set after the processing + of the current event has finished - which seems like the only reliable way + to set focus */ + window.setTimeout(function() { + var el=$el[0], pos=$el.val().length, range; + + $el.focus(); + + /* make sure el received focus so we do not error out when trying to manipulate the caret. + sometimes modals or others listeners may steal it after its set */ + var isVisible = (el.offsetWidth > 0 || el.offsetHeight > 0); + if (isVisible && el === document.activeElement) { + + /* after the focus is set move the caret to the end, necessary when we val() + just before setting focus */ + if(el.setSelectionRange) + { + el.setSelectionRange(pos, pos); + } + else if (el.createTextRange) { + range = el.createTextRange(); + range.collapse(false); + range.select(); + } + } + }, 0); + } + + function getCursorInfo(el) { + el = $(el)[0]; + var offset = 0; + var length = 0; + if ('selectionStart' in el) { + offset = el.selectionStart; + length = el.selectionEnd - offset; + } else if ('selection' in document) { + el.focus(); + var sel = document.selection.createRange(); + length = document.selection.createRange().text.length; + sel.moveStart('character', -el.value.length); + offset = sel.text.length - length; + } + return { offset: offset, length: length }; + } + + function killEvent(event) { + event.preventDefault(); + event.stopPropagation(); + } + function killEventImmediately(event) { + event.preventDefault(); + event.stopImmediatePropagation(); + } + + function measureTextWidth(e) { + if (!sizer){ + var style = e[0].currentStyle || window.getComputedStyle(e[0], null); + sizer = $(document.createElement("div")).css({ + position: "absolute", + left: "-10000px", + top: "-10000px", + display: "none", + fontSize: style.fontSize, + fontFamily: style.fontFamily, + fontStyle: style.fontStyle, + fontWeight: style.fontWeight, + letterSpacing: style.letterSpacing, + textTransform: style.textTransform, + whiteSpace: "nowrap" + }); + sizer.attr("class","select2-sizer"); + $("body").append(sizer); + } + sizer.text(e.val()); + return sizer.width(); + } + + function syncCssClasses(dest, src, adapter) { + var classes, replacements = [], adapted; + + classes = dest.attr("class"); + if (classes) { + classes = '' + classes; // for IE which returns object + $(classes.split(" ")).each2(function() { + if (this.indexOf("select2-") === 0) { + replacements.push(this); + } + }); + } + classes = src.attr("class"); + if (classes) { + classes = '' + classes; // for IE which returns object + $(classes.split(" ")).each2(function() { + if (this.indexOf("select2-") !== 0) { + adapted = adapter(this); + if (adapted) { + replacements.push(adapted); + } + } + }); + } + dest.attr("class", replacements.join(" ")); + } + + + function markMatch(text, term, markup, escapeMarkup) { + var match=stripDiacritics(text.toUpperCase()).indexOf(stripDiacritics(term.toUpperCase())), + tl=term.length; + + if (match<0) { + markup.push(escapeMarkup(text)); + return; + } + + markup.push(escapeMarkup(text.substring(0, match))); + markup.push(""); + markup.push(escapeMarkup(text.substring(match, match + tl))); + markup.push(""); + markup.push(escapeMarkup(text.substring(match + tl, text.length))); + } + + function defaultEscapeMarkup(markup) { + var replace_map = { + '\\': '\', + '&': '&', + '<': '<', + '>': '>', + '"': '"', + "'": ''', + "/": '/' + }; + + return String(markup).replace(/[&<>"'\/\\]/g, function (match) { + return replace_map[match]; + }); + } + + /** + * Produces an ajax-based query function + * + * @param options object containing configuration parameters + * @param options.params parameter map for the transport ajax call, can contain such options as cache, jsonpCallback, etc. see $.ajax + * @param options.transport function that will be used to execute the ajax request. must be compatible with parameters supported by $.ajax + * @param options.url url for the data + * @param options.data a function(searchTerm, pageNumber, context) that should return an object containing query string parameters for the above url. + * @param options.dataType request data type: ajax, jsonp, other datatypes supported by jQuery's $.ajax function or the transport function if specified + * @param options.quietMillis (optional) milliseconds to wait before making the ajaxRequest, helps debounce the ajax function if invoked too often + * @param options.results a function(remoteData, pageNumber) that converts data returned form the remote request to the format expected by Select2. + * The expected format is an object containing the following keys: + * results array of objects that will be used as choices + * more (optional) boolean indicating whether there are more results available + * Example: {results:[{id:1, text:'Red'},{id:2, text:'Blue'}], more:true} + */ + function ajax(options) { + var timeout, // current scheduled but not yet executed request + handler = null, + quietMillis = options.quietMillis || 100, + ajaxUrl = options.url, + self = this; + + return function (query) { + window.clearTimeout(timeout); + timeout = window.setTimeout(function () { + var data = options.data, // ajax data function + url = ajaxUrl, // ajax url string or function + transport = options.transport || $.fn.select2.ajaxDefaults.transport, + // deprecated - to be removed in 4.0 - use params instead + deprecated = { + type: options.type || 'GET', // set type of request (GET or POST) + cache: options.cache || false, + jsonpCallback: options.jsonpCallback||undefined, + dataType: options.dataType||"json" + }, + params = $.extend({}, $.fn.select2.ajaxDefaults.params, deprecated); + + data = data ? data.call(self, query.term, query.page, query.context) : null; + url = (typeof url === 'function') ? url.call(self, query.term, query.page, query.context) : url; + + if (handler && typeof handler.abort === "function") { handler.abort(); } + + if (options.params) { + if ($.isFunction(options.params)) { + $.extend(params, options.params.call(self)); + } else { + $.extend(params, options.params); + } + } + + $.extend(params, { + url: url, + dataType: options.dataType, + data: data, + success: function (data) { + // TODO - replace query.page with query so users have access to term, page, etc. + var results = options.results(data, query.page); + query.callback(results); + } + }); + handler = transport.call(self, params); + }, quietMillis); + }; + } + + /** + * Produces a query function that works with a local array + * + * @param options object containing configuration parameters. The options parameter can either be an array or an + * object. + * + * If the array form is used it is assumed that it contains objects with 'id' and 'text' keys. + * + * If the object form is used it is assumed that it contains 'data' and 'text' keys. The 'data' key should contain + * an array of objects that will be used as choices. These objects must contain at least an 'id' key. The 'text' + * key can either be a String in which case it is expected that each element in the 'data' array has a key with the + * value of 'text' which will be used to match choices. Alternatively, text can be a function(item) that can extract + * the text. + */ + function local(options) { + var data = options, // data elements + dataText, + tmp, + text = function (item) { return ""+item.text; }; // function used to retrieve the text portion of a data item that is matched against the search + + if ($.isArray(data)) { + tmp = data; + data = { results: tmp }; + } + + if ($.isFunction(data) === false) { + tmp = data; + data = function() { return tmp; }; + } + + var dataItem = data(); + if (dataItem.text) { + text = dataItem.text; + // if text is not a function we assume it to be a key name + if (!$.isFunction(text)) { + dataText = dataItem.text; // we need to store this in a separate variable because in the next step data gets reset and data.text is no longer available + text = function (item) { return item[dataText]; }; + } + } + + return function (query) { + var t = query.term, filtered = { results: [] }, process; + if (t === "") { + query.callback(data()); + return; + } + + process = function(datum, collection) { + var group, attr; + datum = datum[0]; + if (datum.children) { + group = {}; + for (attr in datum) { + if (datum.hasOwnProperty(attr)) group[attr]=datum[attr]; + } + group.children=[]; + $(datum.children).each2(function(i, childDatum) { process(childDatum, group.children); }); + if (group.children.length || query.matcher(t, text(group), datum)) { + collection.push(group); + } + } else { + if (query.matcher(t, text(datum), datum)) { + collection.push(datum); + } + } + }; + + $(data().results).each2(function(i, datum) { process(datum, filtered.results); }); + query.callback(filtered); + }; + } + + // TODO javadoc + function tags(data) { + var isFunc = $.isFunction(data); + return function (query) { + var t = query.term, filtered = {results: []}; + var result = isFunc ? data(query) : data; + if ($.isArray(result)) { + $(result).each(function () { + var isObject = this.text !== undefined, + text = isObject ? this.text : this; + if (t === "" || query.matcher(t, text)) { + filtered.results.push(isObject ? this : {id: this, text: this}); + } + }); + query.callback(filtered); + } + }; + } + + /** + * Checks if the formatter function should be used. + * + * Throws an error if it is not a function. Returns true if it should be used, + * false if no formatting should be performed. + * + * @param formatter + */ + function checkFormatter(formatter, formatterName) { + if ($.isFunction(formatter)) return true; + if (!formatter) return false; + if (typeof(formatter) === 'string') return true; + throw new Error(formatterName +" must be a string, function, or falsy value"); + } + + function evaluate(val) { + if ($.isFunction(val)) { + var args = Array.prototype.slice.call(arguments, 1); + return val.apply(null, args); + } + return val; + } + + function countResults(results) { + var count = 0; + $.each(results, function(i, item) { + if (item.children) { + count += countResults(item.children); + } else { + count++; + } + }); + return count; + } + + /** + * Default tokenizer. This function uses breaks the input on substring match of any string from the + * opts.tokenSeparators array and uses opts.createSearchChoice to create the choice object. Both of those + * two options have to be defined in order for the tokenizer to work. + * + * @param input text user has typed so far or pasted into the search field + * @param selection currently selected choices + * @param selectCallback function(choice) callback tho add the choice to selection + * @param opts select2's opts + * @return undefined/null to leave the current input unchanged, or a string to change the input to the returned value + */ + function defaultTokenizer(input, selection, selectCallback, opts) { + var original = input, // store the original so we can compare and know if we need to tell the search to update its text + dupe = false, // check for whether a token we extracted represents a duplicate selected choice + token, // token + index, // position at which the separator was found + i, l, // looping variables + separator; // the matched separator + + if (!opts.createSearchChoice || !opts.tokenSeparators || opts.tokenSeparators.length < 1) return undefined; + + while (true) { + index = -1; + + for (i = 0, l = opts.tokenSeparators.length; i < l; i++) { + separator = opts.tokenSeparators[i]; + index = input.indexOf(separator); + if (index >= 0) break; + } + + if (index < 0) break; // did not find any token separator in the input string, bail + + token = input.substring(0, index); + input = input.substring(index + separator.length); + + if (token.length > 0) { + token = opts.createSearchChoice.call(this, token, selection); + if (token !== undefined && token !== null && opts.id(token) !== undefined && opts.id(token) !== null) { + dupe = false; + for (i = 0, l = selection.length; i < l; i++) { + if (equal(opts.id(token), opts.id(selection[i]))) { + dupe = true; break; + } + } + + if (!dupe) selectCallback(token); + } + } + } + + if (original!==input) return input; + } + + function cleanupJQueryElements() { + var self = this; + + Array.prototype.forEach.call(arguments, function (element) { + self[element].remove(); + self[element] = null; + }); + } + + /** + * Creates a new class + * + * @param superClass + * @param methods + */ + function clazz(SuperClass, methods) { + var constructor = function () {}; + constructor.prototype = new SuperClass; + constructor.prototype.constructor = constructor; + constructor.prototype.parent = SuperClass.prototype; + constructor.prototype = $.extend(constructor.prototype, methods); + return constructor; + } + + AbstractSelect2 = clazz(Object, { + + // abstract + bind: function (func) { + var self = this; + return function () { + func.apply(self, arguments); + }; + }, + + // abstract + init: function (opts) { + var results, search, resultsSelector = ".select2-results"; + + // prepare options + this.opts = opts = this.prepareOpts(opts); + + this.id=opts.id; + + // destroy if called on an existing component + if (opts.element.data("select2") !== undefined && + opts.element.data("select2") !== null) { + opts.element.data("select2").destroy(); + } + + this.container = this.createContainer(); + + this.liveRegion = $("", { + role: "status", + "aria-live": "polite" + }) + .addClass("select2-hidden-accessible") + .appendTo(document.body); + + this.containerId="s2id_"+(opts.element.attr("id") || "autogen"+nextUid()); + this.containerEventName= this.containerId + .replace(/([.])/g, '_') + .replace(/([;&,\-\.\+\*\~':"\!\^#$%@\[\]\(\)=>\|])/g, '\\$1'); + this.container.attr("id", this.containerId); + + this.container.attr("title", opts.element.attr("title")); + + this.body = $("body"); + + syncCssClasses(this.container, this.opts.element, this.opts.adaptContainerCssClass); + + this.container.attr("style", opts.element.attr("style")); + this.container.css(evaluate(opts.containerCss)); + this.container.addClass(evaluate(opts.containerCssClass)); + + this.elementTabIndex = this.opts.element.attr("tabindex"); + + // swap container for the element + this.opts.element + .data("select2", this) + .attr("tabindex", "-1") + .before(this.container) + .on("click.select2", killEvent); // do not leak click events + + this.container.data("select2", this); + + this.dropdown = this.container.find(".select2-drop"); + + syncCssClasses(this.dropdown, this.opts.element, this.opts.adaptDropdownCssClass); + + this.dropdown.addClass(evaluate(opts.dropdownCssClass)); + this.dropdown.data("select2", this); + this.dropdown.on("click", killEvent); + + this.results = results = this.container.find(resultsSelector); + this.search = search = this.container.find("input.select2-input"); + + this.queryCount = 0; + this.resultsPage = 0; + this.context = null; + + // initialize the container + this.initContainer(); + + this.container.on("click", killEvent); + + installFilteredMouseMove(this.results); + + this.dropdown.on("mousemove-filtered", resultsSelector, this.bind(this.highlightUnderEvent)); + this.dropdown.on("touchstart touchmove touchend", resultsSelector, this.bind(function (event) { + this._touchEvent = true; + this.highlightUnderEvent(event); + })); + this.dropdown.on("touchmove", resultsSelector, this.bind(this.touchMoved)); + this.dropdown.on("touchstart touchend", resultsSelector, this.bind(this.clearTouchMoved)); + + // Waiting for a click event on touch devices to select option and hide dropdown + // otherwise click will be triggered on an underlying element + this.dropdown.on('click', this.bind(function (event) { + if (this._touchEvent) { + this._touchEvent = false; + this.selectHighlighted(); + } + })); + + installDebouncedScroll(80, this.results); + this.dropdown.on("scroll-debounced", resultsSelector, this.bind(this.loadMoreIfNeeded)); + + // do not propagate change event from the search field out of the component + $(this.container).on("change", ".select2-input", function(e) {e.stopPropagation();}); + $(this.dropdown).on("change", ".select2-input", function(e) {e.stopPropagation();}); + + // if jquery.mousewheel plugin is installed we can prevent out-of-bounds scrolling of results via mousewheel + if ($.fn.mousewheel) { + results.mousewheel(function (e, delta, deltaX, deltaY) { + var top = results.scrollTop(); + if (deltaY > 0 && top - deltaY <= 0) { + results.scrollTop(0); + killEvent(e); + } else if (deltaY < 0 && results.get(0).scrollHeight - results.scrollTop() + deltaY <= results.height()) { + results.scrollTop(results.get(0).scrollHeight - results.height()); + killEvent(e); + } + }); + } + + installKeyUpChangeEvent(search); + search.on("keyup-change input paste", this.bind(this.updateResults)); + search.on("focus", function () { search.addClass("select2-focused"); }); + search.on("blur", function () { search.removeClass("select2-focused");}); + + this.dropdown.on("mouseup", resultsSelector, this.bind(function (e) { + if ($(e.target).closest(".select2-result-selectable").length > 0) { + this.highlightUnderEvent(e); + this.selectHighlighted(e); + } + })); + + // trap all mouse events from leaving the dropdown. sometimes there may be a modal that is listening + // for mouse events outside of itself so it can close itself. since the dropdown is now outside the select2's + // dom it will trigger the popup close, which is not what we want + // focusin can cause focus wars between modals and select2 since the dropdown is outside the modal. + this.dropdown.on("click mouseup mousedown touchstart touchend focusin", function (e) { e.stopPropagation(); }); + + this.nextSearchTerm = undefined; + + if ($.isFunction(this.opts.initSelection)) { + // initialize selection based on the current value of the source element + this.initSelection(); + + // if the user has provided a function that can set selection based on the value of the source element + // we monitor the change event on the element and trigger it, allowing for two way synchronization + this.monitorSource(); + } + + if (opts.maximumInputLength !== null) { + this.search.attr("maxlength", opts.maximumInputLength); + } + + var disabled = opts.element.prop("disabled"); + if (disabled === undefined) disabled = false; + this.enable(!disabled); + + var readonly = opts.element.prop("readonly"); + if (readonly === undefined) readonly = false; + this.readonly(readonly); + + // Calculate size of scrollbar + scrollBarDimensions = scrollBarDimensions || measureScrollbar(); + + this.autofocus = opts.element.prop("autofocus"); + opts.element.prop("autofocus", false); + if (this.autofocus) this.focus(); + + this.search.attr("placeholder", opts.searchInputPlaceholder); + }, + + // abstract + destroy: function () { + var element=this.opts.element, select2 = element.data("select2"); + + this.close(); + + if (this.propertyObserver) { + this.propertyObserver.disconnect(); + this.propertyObserver = null; + } + + if (select2 !== undefined) { + select2.container.remove(); + select2.liveRegion.remove(); + select2.dropdown.remove(); + element + .removeClass("select2-offscreen") + .removeData("select2") + .off(".select2") + .prop("autofocus", this.autofocus || false); + if (this.elementTabIndex) { + element.attr({tabindex: this.elementTabIndex}); + } else { + element.removeAttr("tabindex"); + } + element.show(); + } + + cleanupJQueryElements.call(this, + "container", + "liveRegion", + "dropdown", + "results", + "search" + ); + }, + + // abstract + optionToData: function(element) { + if (element.is("option")) { + return { + id:element.prop("value"), + text:element.text(), + element: element.get(), + css: element.attr("class"), + disabled: element.prop("disabled"), + locked: equal(element.attr("locked"), "locked") || equal(element.data("locked"), true) + }; + } else if (element.is("optgroup")) { + return { + text:element.attr("label"), + children:[], + element: element.get(), + css: element.attr("class") + }; + } + }, + + // abstract + prepareOpts: function (opts) { + var element, select, idKey, ajaxUrl, self = this; + + element = opts.element; + + if (element.get(0).tagName.toLowerCase() === "select") { + this.select = select = opts.element; + } + + if (select) { + // these options are not allowed when attached to a select because they are picked up off the element itself + $.each(["id", "multiple", "ajax", "query", "createSearchChoice", "initSelection", "data", "tags"], function () { + if (this in opts) { + throw new Error("Option '" + this + "' is not allowed for Select2 when attached to a ", + "
", + " ", + "
    ", + "
", + "
"].join("")); + return container; + }, + + // single + enableInterface: function() { + if (this.parent.enableInterface.apply(this, arguments)) { + this.focusser.prop("disabled", !this.isInterfaceEnabled()); + } + }, + + // single + opening: function () { + var el, range, len; + + if (this.opts.minimumResultsForSearch >= 0) { + this.showSearch(true); + } + + this.parent.opening.apply(this, arguments); + + if (this.showSearchInput !== false) { + // IE appends focusser.val() at the end of field :/ so we manually insert it at the beginning using a range + // all other browsers handle this just fine + + this.search.val(this.focusser.val()); + } + if (this.opts.shouldFocusInput(this)) { + this.search.focus(); + // move the cursor to the end after focussing, otherwise it will be at the beginning and + // new text will appear *before* focusser.val() + el = this.search.get(0); + if (el.createTextRange) { + range = el.createTextRange(); + range.collapse(false); + range.select(); + } else if (el.setSelectionRange) { + len = this.search.val().length; + el.setSelectionRange(len, len); + } + } + + // initializes search's value with nextSearchTerm (if defined by user) + // ignore nextSearchTerm if the dropdown is opened by the user pressing a letter + if(this.search.val() === "") { + if(this.nextSearchTerm != undefined){ + this.search.val(this.nextSearchTerm); + this.search.select(); + } + } + + this.focusser.prop("disabled", true).val(""); + this.updateResults(true); + this.opts.element.trigger($.Event("select2-open")); + }, + + // single + close: function () { + if (!this.opened()) return; + this.parent.close.apply(this, arguments); + + this.focusser.prop("disabled", false); + + if (this.opts.shouldFocusInput(this)) { + this.focusser.focus(); + } + }, + + // single + focus: function () { + if (this.opened()) { + this.close(); + } else { + this.focusser.prop("disabled", false); + if (this.opts.shouldFocusInput(this)) { + this.focusser.focus(); + } + } + }, + + // single + isFocused: function () { + return this.container.hasClass("select2-container-active"); + }, + + // single + cancel: function () { + this.parent.cancel.apply(this, arguments); + this.focusser.prop("disabled", false); + + if (this.opts.shouldFocusInput(this)) { + this.focusser.focus(); + } + }, + + // single + destroy: function() { + $("label[for='" + this.focusser.attr('id') + "']") + .attr('for', this.opts.element.attr("id")); + this.parent.destroy.apply(this, arguments); + + cleanupJQueryElements.call(this, + "selection", + "focusser" + ); + }, + + // single + initContainer: function () { + + var selection, + container = this.container, + dropdown = this.dropdown, + idSuffix = nextUid(), + elementLabel; + + if (this.opts.minimumResultsForSearch < 0) { + this.showSearch(false); + } else { + this.showSearch(true); + } + + this.selection = selection = container.find(".select2-choice"); + + this.focusser = container.find(".select2-focusser"); + + // add aria associations + selection.find(".select2-chosen").attr("id", "select2-chosen-"+idSuffix); + this.focusser.attr("aria-labelledby", "select2-chosen-"+idSuffix); + this.results.attr("id", "select2-results-"+idSuffix); + this.search.attr("aria-owns", "select2-results-"+idSuffix); + + // rewrite labels from original element to focusser + this.focusser.attr("id", "s2id_autogen"+idSuffix); + + elementLabel = $("label[for='" + this.opts.element.attr("id") + "']"); + + this.focusser.prev() + .text(elementLabel.text()) + .attr('for', this.focusser.attr('id')); + + // Ensure the original element retains an accessible name + var originalTitle = this.opts.element.attr("title"); + this.opts.element.attr("title", (originalTitle || elementLabel.text())); + + this.focusser.attr("tabindex", this.elementTabIndex); + + // write label for search field using the label from the focusser element + this.search.attr("id", this.focusser.attr('id') + '_search'); + + this.search.prev() + .text($("label[for='" + this.focusser.attr('id') + "']").text()) + .attr('for', this.search.attr('id')); + + this.search.on("keydown", this.bind(function (e) { + if (!this.isInterfaceEnabled()) return; + + if (e.which === KEY.PAGE_UP || e.which === KEY.PAGE_DOWN) { + // prevent the page from scrolling + killEvent(e); + return; + } + + switch (e.which) { + case KEY.UP: + case KEY.DOWN: + this.moveHighlight((e.which === KEY.UP) ? -1 : 1); + killEvent(e); + return; + case KEY.ENTER: + this.selectHighlighted(); + killEvent(e); + return; + case KEY.TAB: + this.selectHighlighted({noFocus: true}); + return; + case KEY.ESC: + this.cancel(e); + killEvent(e); + return; + } + })); + + this.search.on("blur", this.bind(function(e) { + // a workaround for chrome to keep the search field focussed when the scroll bar is used to scroll the dropdown. + // without this the search field loses focus which is annoying + if (document.activeElement === this.body.get(0)) { + window.setTimeout(this.bind(function() { + if (this.opened()) { + this.search.focus(); + } + }), 0); + } + })); + + this.focusser.on("keydown", this.bind(function (e) { + if (!this.isInterfaceEnabled()) return; + + if (e.which === KEY.TAB || KEY.isControl(e) || KEY.isFunctionKey(e) || e.which === KEY.ESC) { + return; + } + + if (this.opts.openOnEnter === false && e.which === KEY.ENTER) { + killEvent(e); + return; + } + + if (e.which == KEY.DOWN || e.which == KEY.UP + || (e.which == KEY.ENTER && this.opts.openOnEnter)) { + + if (e.altKey || e.ctrlKey || e.shiftKey || e.metaKey) return; + + this.open(); + killEvent(e); + return; + } + + if (e.which == KEY.DELETE || e.which == KEY.BACKSPACE) { + if (this.opts.allowClear) { + this.clear(); + } + killEvent(e); + return; + } + })); + + + installKeyUpChangeEvent(this.focusser); + this.focusser.on("keyup-change input", this.bind(function(e) { + if (this.opts.minimumResultsForSearch >= 0) { + e.stopPropagation(); + if (this.opened()) return; + this.open(); + } + })); + + selection.on("mousedown touchstart", "abbr", this.bind(function (e) { + if (!this.isInterfaceEnabled()) return; + this.clear(); + killEventImmediately(e); + this.close(); + this.selection.focus(); + })); + + selection.on("mousedown touchstart", this.bind(function (e) { + // Prevent IE from generating a click event on the body + reinsertElement(selection); + + if (!this.container.hasClass("select2-container-active")) { + this.opts.element.trigger($.Event("select2-focus")); + } + + if (this.opened()) { + this.close(); + } else if (this.isInterfaceEnabled()) { + this.open(); + } + + killEvent(e); + })); + + dropdown.on("mousedown touchstart", this.bind(function() { + if (this.opts.shouldFocusInput(this)) { + this.search.focus(); + } + })); + + selection.on("focus", this.bind(function(e) { + killEvent(e); + })); + + this.focusser.on("focus", this.bind(function(){ + if (!this.container.hasClass("select2-container-active")) { + this.opts.element.trigger($.Event("select2-focus")); + } + this.container.addClass("select2-container-active"); + })).on("blur", this.bind(function() { + if (!this.opened()) { + this.container.removeClass("select2-container-active"); + this.opts.element.trigger($.Event("select2-blur")); + } + })); + this.search.on("focus", this.bind(function(){ + if (!this.container.hasClass("select2-container-active")) { + this.opts.element.trigger($.Event("select2-focus")); + } + this.container.addClass("select2-container-active"); + })); + + this.initContainerWidth(); + this.opts.element.addClass("select2-offscreen"); + this.setPlaceholder(); + + }, + + // single + clear: function(triggerChange) { + var data=this.selection.data("select2-data"); + if (data) { // guard against queued quick consecutive clicks + var evt = $.Event("select2-clearing"); + this.opts.element.trigger(evt); + if (evt.isDefaultPrevented()) { + return; + } + var placeholderOption = this.getPlaceholderOption(); + this.opts.element.val(placeholderOption ? placeholderOption.val() : ""); + this.selection.find(".select2-chosen").empty(); + this.selection.removeData("select2-data"); + this.setPlaceholder(); + + if (triggerChange !== false){ + this.opts.element.trigger({ type: "select2-removed", val: this.id(data), choice: data }); + this.triggerChange({removed:data}); + } + } + }, + + /** + * Sets selection based on source element's value + */ + // single + initSelection: function () { + var selected; + if (this.isPlaceholderOptionSelected()) { + this.updateSelection(null); + this.close(); + this.setPlaceholder(); + } else { + var self = this; + this.opts.initSelection.call(null, this.opts.element, function(selected){ + if (selected !== undefined && selected !== null) { + self.updateSelection(selected); + self.close(); + self.setPlaceholder(); + self.nextSearchTerm = self.opts.nextSearchTerm(selected, self.search.val()); + } + }); + } + }, + + isPlaceholderOptionSelected: function() { + var placeholderOption; + if (this.getPlaceholder() === undefined) return false; // no placeholder specified so no option should be considered + return ((placeholderOption = this.getPlaceholderOption()) !== undefined && placeholderOption.prop("selected")) + || (this.opts.element.val() === "") + || (this.opts.element.val() === undefined) + || (this.opts.element.val() === null); + }, + + // single + prepareOpts: function () { + var opts = this.parent.prepareOpts.apply(this, arguments), + self=this; + + if (opts.element.get(0).tagName.toLowerCase() === "select") { + // install the selection initializer + opts.initSelection = function (element, callback) { + var selected = element.find("option").filter(function() { return this.selected && !this.disabled }); + // a single select box always has a value, no need to null check 'selected' + callback(self.optionToData(selected)); + }; + } else if ("data" in opts) { + // install default initSelection when applied to hidden input and data is local + opts.initSelection = opts.initSelection || function (element, callback) { + var id = element.val(); + //search in data by id, storing the actual matching item + var match = null; + opts.query({ + matcher: function(term, text, el){ + var is_match = equal(id, opts.id(el)); + if (is_match) { + match = el; + } + return is_match; + }, + callback: !$.isFunction(callback) ? $.noop : function() { + callback(match); + } + }); + }; + } + + return opts; + }, + + // single + getPlaceholder: function() { + // if a placeholder is specified on a single select without a valid placeholder option ignore it + if (this.select) { + if (this.getPlaceholderOption() === undefined) { + return undefined; + } + } + + return this.parent.getPlaceholder.apply(this, arguments); + }, + + // single + setPlaceholder: function () { + var placeholder = this.getPlaceholder(); + + if (this.isPlaceholderOptionSelected() && placeholder !== undefined) { + + // check for a placeholder option if attached to a select + if (this.select && this.getPlaceholderOption() === undefined) return; + + this.selection.find(".select2-chosen").html(this.opts.escapeMarkup(placeholder)); + + this.selection.addClass("select2-default"); + + this.container.removeClass("select2-allowclear"); + } + }, + + // single + postprocessResults: function (data, initial, noHighlightUpdate) { + var selected = 0, self = this, showSearchInput = true; + + // find the selected element in the result list + + this.findHighlightableChoices().each2(function (i, elm) { + if (equal(self.id(elm.data("select2-data")), self.opts.element.val())) { + selected = i; + return false; + } + }); + + // and highlight it + if (noHighlightUpdate !== false) { + if (initial === true && selected >= 0) { + this.highlight(selected); + } else { + this.highlight(0); + } + } + + // hide the search box if this is the first we got the results and there are enough of them for search + + if (initial === true) { + var min = this.opts.minimumResultsForSearch; + if (min >= 0) { + this.showSearch(countResults(data.results) >= min); + } + } + }, + + // single + showSearch: function(showSearchInput) { + if (this.showSearchInput === showSearchInput) return; + + this.showSearchInput = showSearchInput; + + this.dropdown.find(".select2-search").toggleClass("select2-search-hidden", !showSearchInput); + this.dropdown.find(".select2-search").toggleClass("select2-offscreen", !showSearchInput); + //add "select2-with-searchbox" to the container if search box is shown + $(this.dropdown, this.container).toggleClass("select2-with-searchbox", showSearchInput); + }, + + // single + onSelect: function (data, options) { + + if (!this.triggerSelect(data)) { return; } + + var old = this.opts.element.val(), + oldData = this.data(); + + this.opts.element.val(this.id(data)); + this.updateSelection(data); + + this.opts.element.trigger({ type: "select2-selected", val: this.id(data), choice: data }); + + this.nextSearchTerm = this.opts.nextSearchTerm(data, this.search.val()); + this.close(); + + if ((!options || !options.noFocus) && this.opts.shouldFocusInput(this)) { + this.focusser.focus(); + } + + if (!equal(old, this.id(data))) { + this.triggerChange({ added: data, removed: oldData }); + } + }, + + // single + updateSelection: function (data) { + + var container=this.selection.find(".select2-chosen"), formatted, cssClass; + + this.selection.data("select2-data", data); + + container.empty(); + if (data !== null) { + formatted=this.opts.formatSelection(data, container, this.opts.escapeMarkup); + } + if (formatted !== undefined) { + container.append(formatted); + } + cssClass=this.opts.formatSelectionCssClass(data, container); + if (cssClass !== undefined) { + container.addClass(cssClass); + } + + this.selection.removeClass("select2-default"); + + if (this.opts.allowClear && this.getPlaceholder() !== undefined) { + this.container.addClass("select2-allowclear"); + } + }, + + // single + val: function () { + var val, + triggerChange = false, + data = null, + self = this, + oldData = this.data(); + + if (arguments.length === 0) { + return this.opts.element.val(); + } + + val = arguments[0]; + + if (arguments.length > 1) { + triggerChange = arguments[1]; + } + + if (this.select) { + this.select + .val(val) + .find("option").filter(function() { return this.selected }).each2(function (i, elm) { + data = self.optionToData(elm); + return false; + }); + this.updateSelection(data); + this.setPlaceholder(); + if (triggerChange) { + this.triggerChange({added: data, removed:oldData}); + } + } else { + // val is an id. !val is true for [undefined,null,'',0] - 0 is legal + if (!val && val !== 0) { + this.clear(triggerChange); + return; + } + if (this.opts.initSelection === undefined) { + throw new Error("cannot call val() if initSelection() is not defined"); + } + this.opts.element.val(val); + this.opts.initSelection(this.opts.element, function(data){ + self.opts.element.val(!data ? "" : self.id(data)); + self.updateSelection(data); + self.setPlaceholder(); + if (triggerChange) { + self.triggerChange({added: data, removed:oldData}); + } + }); + } + }, + + // single + clearSearch: function () { + this.search.val(""); + this.focusser.val(""); + }, + + // single + data: function(value) { + var data, + triggerChange = false; + + if (arguments.length === 0) { + data = this.selection.data("select2-data"); + if (data == undefined) data = null; + return data; + } else { + if (arguments.length > 1) { + triggerChange = arguments[1]; + } + if (!value) { + this.clear(triggerChange); + } else { + data = this.data(); + this.opts.element.val(!value ? "" : this.id(value)); + this.updateSelection(value); + if (triggerChange) { + this.triggerChange({added: value, removed:data}); + } + } + } + } + }); + + MultiSelect2 = clazz(AbstractSelect2, { + + // multi + createContainer: function () { + var container = $(document.createElement("div")).attr({ + "class": "select2-container select2-container-multi" + }).html([ + "
    ", + "
  • ", + " ", + " ", + "
  • ", + "
", + "
", + "
    ", + "
", + "
"].join("")); + return container; + }, + + // multi + prepareOpts: function () { + var opts = this.parent.prepareOpts.apply(this, arguments), + self=this; + + // TODO validate placeholder is a string if specified + + if (opts.element.get(0).tagName.toLowerCase() === "select") { + // install the selection initializer + opts.initSelection = function (element, callback) { + + var data = []; + + element.find("option").filter(function() { return this.selected && !this.disabled }).each2(function (i, elm) { + data.push(self.optionToData(elm)); + }); + callback(data); + }; + } else if ("data" in opts) { + // install default initSelection when applied to hidden input and data is local + opts.initSelection = opts.initSelection || function (element, callback) { + var ids = splitVal(element.val(), opts.separator); + //search in data by array of ids, storing matching items in a list + var matches = []; + opts.query({ + matcher: function(term, text, el){ + var is_match = $.grep(ids, function(id) { + return equal(id, opts.id(el)); + }).length; + if (is_match) { + matches.push(el); + } + return is_match; + }, + callback: !$.isFunction(callback) ? $.noop : function() { + // reorder matches based on the order they appear in the ids array because right now + // they are in the order in which they appear in data array + var ordered = []; + for (var i = 0; i < ids.length; i++) { + var id = ids[i]; + for (var j = 0; j < matches.length; j++) { + var match = matches[j]; + if (equal(id, opts.id(match))) { + ordered.push(match); + matches.splice(j, 1); + break; + } + } + } + callback(ordered); + } + }); + }; + } + + return opts; + }, + + // multi + selectChoice: function (choice) { + + var selected = this.container.find(".select2-search-choice-focus"); + if (selected.length && choice && choice[0] == selected[0]) { + + } else { + if (selected.length) { + this.opts.element.trigger("choice-deselected", selected); + } + selected.removeClass("select2-search-choice-focus"); + if (choice && choice.length) { + this.close(); + choice.addClass("select2-search-choice-focus"); + this.opts.element.trigger("choice-selected", choice); + } + } + }, + + // multi + destroy: function() { + $("label[for='" + this.search.attr('id') + "']") + .attr('for', this.opts.element.attr("id")); + this.parent.destroy.apply(this, arguments); + + cleanupJQueryElements.call(this, + "searchContainer", + "selection" + ); + }, + + // multi + initContainer: function () { + + var selector = ".select2-choices", selection; + + this.searchContainer = this.container.find(".select2-search-field"); + this.selection = selection = this.container.find(selector); + + var _this = this; + this.selection.on("click", ".select2-search-choice:not(.select2-locked)", function (e) { + //killEvent(e); + _this.search[0].focus(); + _this.selectChoice($(this)); + }); + + // rewrite labels from original element to focusser + this.search.attr("id", "s2id_autogen"+nextUid()); + + this.search.prev() + .text($("label[for='" + this.opts.element.attr("id") + "']").text()) + .attr('for', this.search.attr('id')); + + this.search.on("input paste", this.bind(function() { + if (!this.isInterfaceEnabled()) return; + if (!this.opened()) { + this.open(); + } + })); + + this.search.attr("tabindex", this.elementTabIndex); + + this.keydowns = 0; + this.search.on("keydown", this.bind(function (e) { + if (!this.isInterfaceEnabled()) return; + + ++this.keydowns; + var selected = selection.find(".select2-search-choice-focus"); + var prev = selected.prev(".select2-search-choice:not(.select2-locked)"); + var next = selected.next(".select2-search-choice:not(.select2-locked)"); + var pos = getCursorInfo(this.search); + + if (selected.length && + (e.which == KEY.LEFT || e.which == KEY.RIGHT || e.which == KEY.BACKSPACE || e.which == KEY.DELETE || e.which == KEY.ENTER)) { + var selectedChoice = selected; + if (e.which == KEY.LEFT && prev.length) { + selectedChoice = prev; + } + else if (e.which == KEY.RIGHT) { + selectedChoice = next.length ? next : null; + } + else if (e.which === KEY.BACKSPACE) { + if (this.unselect(selected.first())) { + this.search.width(10); + selectedChoice = prev.length ? prev : next; + } + } else if (e.which == KEY.DELETE) { + if (this.unselect(selected.first())) { + this.search.width(10); + selectedChoice = next.length ? next : null; + } + } else if (e.which == KEY.ENTER) { + selectedChoice = null; + } + + this.selectChoice(selectedChoice); + killEvent(e); + if (!selectedChoice || !selectedChoice.length) { + this.open(); + } + return; + } else if (((e.which === KEY.BACKSPACE && this.keydowns == 1) + || e.which == KEY.LEFT) && (pos.offset == 0 && !pos.length)) { + + this.selectChoice(selection.find(".select2-search-choice:not(.select2-locked)").last()); + killEvent(e); + return; + } else { + this.selectChoice(null); + } + + if (this.opened()) { + switch (e.which) { + case KEY.UP: + case KEY.DOWN: + this.moveHighlight((e.which === KEY.UP) ? -1 : 1); + killEvent(e); + return; + case KEY.ENTER: + this.selectHighlighted(); + killEvent(e); + return; + case KEY.TAB: + this.selectHighlighted({noFocus:true}); + this.close(); + return; + case KEY.ESC: + this.cancel(e); + killEvent(e); + return; + } + } + + if (e.which === KEY.TAB || KEY.isControl(e) || KEY.isFunctionKey(e) + || e.which === KEY.BACKSPACE || e.which === KEY.ESC) { + return; + } + + if (e.which === KEY.ENTER) { + if (this.opts.openOnEnter === false) { + return; + } else if (e.altKey || e.ctrlKey || e.shiftKey || e.metaKey) { + return; + } + } + + this.open(); + + if (e.which === KEY.PAGE_UP || e.which === KEY.PAGE_DOWN) { + // prevent the page from scrolling + killEvent(e); + } + + if (e.which === KEY.ENTER) { + // prevent form from being submitted + killEvent(e); + } + + })); + + this.search.on("keyup", this.bind(function (e) { + this.keydowns = 0; + this.resizeSearch(); + }) + ); + + this.search.on("blur", this.bind(function(e) { + this.container.removeClass("select2-container-active"); + this.search.removeClass("select2-focused"); + this.selectChoice(null); + if (!this.opened()) this.clearSearch(); + e.stopImmediatePropagation(); + this.opts.element.trigger($.Event("select2-blur")); + })); + + this.container.on("click", selector, this.bind(function (e) { + if (!this.isInterfaceEnabled()) return; + if ($(e.target).closest(".select2-search-choice").length > 0) { + // clicked inside a select2 search choice, do not open + return; + } + this.selectChoice(null); + this.clearPlaceholder(); + if (!this.container.hasClass("select2-container-active")) { + this.opts.element.trigger($.Event("select2-focus")); + } + this.open(); + this.focusSearch(); + e.preventDefault(); + })); + + this.container.on("focus", selector, this.bind(function () { + if (!this.isInterfaceEnabled()) return; + if (!this.container.hasClass("select2-container-active")) { + this.opts.element.trigger($.Event("select2-focus")); + } + this.container.addClass("select2-container-active"); + this.dropdown.addClass("select2-drop-active"); + this.clearPlaceholder(); + })); + + this.initContainerWidth(); + this.opts.element.addClass("select2-offscreen"); + + // set the placeholder if necessary + this.clearSearch(); + }, + + // multi + enableInterface: function() { + if (this.parent.enableInterface.apply(this, arguments)) { + this.search.prop("disabled", !this.isInterfaceEnabled()); + } + }, + + // multi + initSelection: function () { + var data; + if (this.opts.element.val() === "" && this.opts.element.text() === "") { + this.updateSelection([]); + this.close(); + // set the placeholder if necessary + this.clearSearch(); + } + if (this.select || this.opts.element.val() !== "") { + var self = this; + this.opts.initSelection.call(null, this.opts.element, function(data){ + if (data !== undefined && data !== null) { + self.updateSelection(data); + self.close(); + // set the placeholder if necessary + self.clearSearch(); + } + }); + } + }, + + // multi + clearSearch: function () { + var placeholder = this.getPlaceholder(), + maxWidth = this.getMaxSearchWidth(); + + if (placeholder !== undefined && this.getVal().length === 0 && this.search.hasClass("select2-focused") === false) { + this.search.val(placeholder).addClass("select2-default"); + // stretch the search box to full width of the container so as much of the placeholder is visible as possible + // we could call this.resizeSearch(), but we do not because that requires a sizer and we do not want to create one so early because of a firefox bug, see #944 + this.search.width(maxWidth > 0 ? maxWidth : this.container.css("width")); + } else { + this.search.val("").width(10); + } + }, + + // multi + clearPlaceholder: function () { + if (this.search.hasClass("select2-default")) { + this.search.val("").removeClass("select2-default"); + } + }, + + // multi + opening: function () { + this.clearPlaceholder(); // should be done before super so placeholder is not used to search + this.resizeSearch(); + + this.parent.opening.apply(this, arguments); + + this.focusSearch(); + + // initializes search's value with nextSearchTerm (if defined by user) + // ignore nextSearchTerm if the dropdown is opened by the user pressing a letter + if(this.search.val() === "") { + if(this.nextSearchTerm != undefined){ + this.search.val(this.nextSearchTerm); + this.search.select(); + } + } + + this.updateResults(true); + if (this.opts.shouldFocusInput(this)) { + this.search.focus(); + } + this.opts.element.trigger($.Event("select2-open")); + }, + + // multi + close: function () { + if (!this.opened()) return; + this.parent.close.apply(this, arguments); + }, + + // multi + focus: function () { + this.close(); + this.search.focus(); + }, + + // multi + isFocused: function () { + return this.search.hasClass("select2-focused"); + }, + + // multi + updateSelection: function (data) { + var ids = [], filtered = [], self = this; + + // filter out duplicates + $(data).each(function () { + if (indexOf(self.id(this), ids) < 0) { + ids.push(self.id(this)); + filtered.push(this); + } + }); + data = filtered; + + this.selection.find(".select2-search-choice").remove(); + $(data).each(function () { + self.addSelectedChoice(this); + }); + self.postprocessResults(); + }, + + // multi + tokenize: function() { + var input = this.search.val(); + input = this.opts.tokenizer.call(this, input, this.data(), this.bind(this.onSelect), this.opts); + if (input != null && input != undefined) { + this.search.val(input); + if (input.length > 0) { + this.open(); + } + } + + }, + + // multi + onSelect: function (data, options) { + + if (!this.triggerSelect(data)) { return; } + + this.addSelectedChoice(data); + + this.opts.element.trigger({ type: "selected", val: this.id(data), choice: data }); + + // keep track of the search's value before it gets cleared + this.nextSearchTerm = this.opts.nextSearchTerm(data, this.search.val()); + + this.clearSearch(); + this.updateResults(); + + if (this.select || !this.opts.closeOnSelect) this.postprocessResults(data, false, this.opts.closeOnSelect===true); + + if (this.opts.closeOnSelect) { + this.close(); + this.search.width(10); + } else { + if (this.countSelectableResults()>0) { + this.search.width(10); + this.resizeSearch(); + if (this.getMaximumSelectionSize() > 0 && this.val().length >= this.getMaximumSelectionSize()) { + // if we reached max selection size repaint the results so choices + // are replaced with the max selection reached message + this.updateResults(true); + } else { + // initializes search's value with nextSearchTerm and update search result + if(this.nextSearchTerm != undefined){ + this.search.val(this.nextSearchTerm); + this.updateResults(); + this.search.select(); + } + } + this.positionDropdown(); + } else { + // if nothing left to select close + this.close(); + this.search.width(10); + } + } + + // since its not possible to select an element that has already been + // added we do not need to check if this is a new element before firing change + this.triggerChange({ added: data }); + + if (!options || !options.noFocus) + this.focusSearch(); + }, + + // multi + cancel: function () { + this.close(); + this.focusSearch(); + }, + + addSelectedChoice: function (data) { + var enableChoice = !data.locked, + enabledItem = $( + "
  • " + + "
    " + + " " + + "
  • "), + disabledItem = $( + "
  • " + + "
    " + + "
  • "); + var choice = enableChoice ? enabledItem : disabledItem, + id = this.id(data), + val = this.getVal(), + formatted, + cssClass; + + formatted=this.opts.formatSelection(data, choice.find("div"), this.opts.escapeMarkup); + if (formatted != undefined) { + choice.find("div").replaceWith("
    "+formatted+"
    "); + } + cssClass=this.opts.formatSelectionCssClass(data, choice.find("div")); + if (cssClass != undefined) { + choice.addClass(cssClass); + } + + if(enableChoice){ + choice.find(".select2-search-choice-close") + .on("mousedown", killEvent) + .on("click dblclick", this.bind(function (e) { + if (!this.isInterfaceEnabled()) return; + + this.unselect($(e.target)); + this.selection.find(".select2-search-choice-focus").removeClass("select2-search-choice-focus"); + killEvent(e); + this.close(); + this.focusSearch(); + })).on("focus", this.bind(function () { + if (!this.isInterfaceEnabled()) return; + this.container.addClass("select2-container-active"); + this.dropdown.addClass("select2-drop-active"); + })); + } + + choice.data("select2-data", data); + choice.insertBefore(this.searchContainer); + + val.push(id); + this.setVal(val); + }, + + // multi + unselect: function (selected) { + var val = this.getVal(), + data, + index; + selected = selected.closest(".select2-search-choice"); + + if (selected.length === 0) { + throw "Invalid argument: " + selected + ". Must be .select2-search-choice"; + } + + data = selected.data("select2-data"); + + if (!data) { + // prevent a race condition when the 'x' is clicked really fast repeatedly the event can be queued + // and invoked on an element already removed + return; + } + + var evt = $.Event("select2-removing"); + evt.val = this.id(data); + evt.choice = data; + this.opts.element.trigger(evt); + + if (evt.isDefaultPrevented()) { + return false; + } + + while((index = indexOf(this.id(data), val)) >= 0) { + val.splice(index, 1); + this.setVal(val); + if (this.select) this.postprocessResults(); + } + + selected.remove(); + + this.opts.element.trigger({ type: "select2-removed", val: this.id(data), choice: data }); + this.triggerChange({ removed: data }); + + return true; + }, + + // multi + postprocessResults: function (data, initial, noHighlightUpdate) { + var val = this.getVal(), + choices = this.results.find(".select2-result"), + compound = this.results.find(".select2-result-with-children"), + self = this; + + choices.each2(function (i, choice) { + var id = self.id(choice.data("select2-data")); + if (indexOf(id, val) >= 0) { + choice.addClass("select2-selected"); + // mark all children of the selected parent as selected + choice.find(".select2-result-selectable").addClass("select2-selected"); + } + }); + + compound.each2(function(i, choice) { + // hide an optgroup if it doesn't have any selectable children + if (!choice.is('.select2-result-selectable') + && choice.find(".select2-result-selectable:not(.select2-selected)").length === 0) { + choice.addClass("select2-selected"); + } + }); + + if (this.highlight() == -1 && noHighlightUpdate !== false){ + self.highlight(0); + } + + //If all results are chosen render formatNoMatches + if(!this.opts.createSearchChoice && !choices.filter('.select2-result:not(.select2-selected)').length > 0){ + if(!data || data && !data.more && this.results.find(".select2-no-results").length === 0) { + if (checkFormatter(self.opts.formatNoMatches, "formatNoMatches")) { + this.results.append("
  • " + evaluate(self.opts.formatNoMatches, self.search.val()) + "
  • "); + } + } + } + + }, + + // multi + getMaxSearchWidth: function() { + return this.selection.width() - getSideBorderPadding(this.search); + }, + + // multi + resizeSearch: function () { + var minimumWidth, left, maxWidth, containerLeft, searchWidth, + sideBorderPadding = getSideBorderPadding(this.search); + + minimumWidth = measureTextWidth(this.search) + 10; + + left = this.search.offset().left; + + maxWidth = this.selection.width(); + containerLeft = this.selection.offset().left; + + searchWidth = maxWidth - (left - containerLeft) - sideBorderPadding; + + if (searchWidth < minimumWidth) { + searchWidth = maxWidth - sideBorderPadding; + } + + if (searchWidth < 40) { + searchWidth = maxWidth - sideBorderPadding; + } + + if (searchWidth <= 0) { + searchWidth = minimumWidth; + } + + this.search.width(Math.floor(searchWidth)); + }, + + // multi + getVal: function () { + var val; + if (this.select) { + val = this.select.val(); + return val === null ? [] : val; + } else { + val = this.opts.element.val(); + return splitVal(val, this.opts.separator); + } + }, + + // multi + setVal: function (val) { + var unique; + if (this.select) { + this.select.val(val); + } else { + unique = []; + // filter out duplicates + $(val).each(function () { + if (indexOf(this, unique) < 0) unique.push(this); + }); + this.opts.element.val(unique.length === 0 ? "" : unique.join(this.opts.separator)); + } + }, + + // multi + buildChangeDetails: function (old, current) { + var current = current.slice(0), + old = old.slice(0); + + // remove intersection from each array + for (var i = 0; i < current.length; i++) { + for (var j = 0; j < old.length; j++) { + if (equal(this.opts.id(current[i]), this.opts.id(old[j]))) { + current.splice(i, 1); + if(i>0){ + i--; + } + old.splice(j, 1); + j--; + } + } + } + + return {added: current, removed: old}; + }, + + + // multi + val: function (val, triggerChange) { + var oldData, self=this; + + if (arguments.length === 0) { + return this.getVal(); + } + + oldData=this.data(); + if (!oldData.length) oldData=[]; + + // val is an id. !val is true for [undefined,null,'',0] - 0 is legal + if (!val && val !== 0) { + this.opts.element.val(""); + this.updateSelection([]); + this.clearSearch(); + if (triggerChange) { + this.triggerChange({added: this.data(), removed: oldData}); + } + return; + } + + // val is a list of ids + this.setVal(val); + + if (this.select) { + this.opts.initSelection(this.select, this.bind(this.updateSelection)); + if (triggerChange) { + this.triggerChange(this.buildChangeDetails(oldData, this.data())); + } + } else { + if (this.opts.initSelection === undefined) { + throw new Error("val() cannot be called if initSelection() is not defined"); + } + + this.opts.initSelection(this.opts.element, function(data){ + var ids=$.map(data, self.id); + self.setVal(ids); + self.updateSelection(data); + self.clearSearch(); + if (triggerChange) { + self.triggerChange(self.buildChangeDetails(oldData, self.data())); + } + }); + } + this.clearSearch(); + }, + + // multi + onSortStart: function() { + if (this.select) { + throw new Error("Sorting of elements is not supported when attached to instead."); + } + + // collapse search field into 0 width so its container can be collapsed as well + this.search.width(0); + // hide the container + this.searchContainer.hide(); + }, + + // multi + onSortEnd:function() { + + var val=[], self=this; + + // show search and move it to the end of the list + this.searchContainer.show(); + // make sure the search container is the last item in the list + this.searchContainer.appendTo(this.searchContainer.parent()); + // since we collapsed the width in dragStarted, we resize it here + this.resizeSearch(); + + // update selection + this.selection.find(".select2-search-choice").each(function() { + val.push(self.opts.id($(this).data("select2-data"))); + }); + this.setVal(val); + this.triggerChange(); + }, + + // multi + data: function(values, triggerChange) { + var self=this, ids, old; + if (arguments.length === 0) { + return this.selection + .children(".select2-search-choice") + .map(function() { return $(this).data("select2-data"); }) + .get(); + } else { + old = this.data(); + if (!values) { values = []; } + ids = $.map(values, function(e) { return self.opts.id(e); }); + this.setVal(ids); + this.updateSelection(values); + this.clearSearch(); + if (triggerChange) { + this.triggerChange(this.buildChangeDetails(old, this.data())); + } + } + } + }); + + $.fn.select2 = function () { + + var args = Array.prototype.slice.call(arguments, 0), + opts, + select2, + method, value, multiple, + allowedMethods = ["val", "destroy", "opened", "open", "close", "focus", "isFocused", "container", "dropdown", "onSortStart", "onSortEnd", "enable", "disable", "readonly", "positionDropdown", "data", "search"], + valueMethods = ["opened", "isFocused", "container", "dropdown"], + propertyMethods = ["val", "data"], + methodsMap = { search: "externalSearch" }; + + this.each(function () { + if (args.length === 0 || typeof(args[0]) === "object") { + opts = args.length === 0 ? {} : $.extend({}, args[0]); + opts.element = $(this); + + if (opts.element.get(0).tagName.toLowerCase() === "select") { + multiple = opts.element.prop("multiple"); + } else { + multiple = opts.multiple || false; + if ("tags" in opts) {opts.multiple = multiple = true;} + } + + select2 = multiple ? new window.Select2["class"].multi() : new window.Select2["class"].single(); + select2.init(opts); + } else if (typeof(args[0]) === "string") { + + if (indexOf(args[0], allowedMethods) < 0) { + throw "Unknown method: " + args[0]; + } + + value = undefined; + select2 = $(this).data("select2"); + if (select2 === undefined) return; + + method=args[0]; + + if (method === "container") { + value = select2.container; + } else if (method === "dropdown") { + value = select2.dropdown; + } else { + if (methodsMap[method]) method = methodsMap[method]; + + value = select2[method].apply(select2, args.slice(1)); + } + if (indexOf(args[0], valueMethods) >= 0 + || (indexOf(args[0], propertyMethods) >= 0 && args.length == 1)) { + return false; // abort the iteration, ready to return first matched value + } + } else { + throw "Invalid arguments to select2 plugin: " + args; + } + }); + return (value === undefined) ? this : value; + }; + + // plugin defaults, accessible to users + $.fn.select2.defaults = { + width: "copy", + loadMorePadding: 0, + closeOnSelect: true, + openOnEnter: true, + containerCss: {}, + dropdownCss: {}, + containerCssClass: "", + dropdownCssClass: "", + formatResult: function(result, container, query, escapeMarkup) { + var markup=[]; + markMatch(result.text, query.term, markup, escapeMarkup); + return markup.join(""); + }, + formatSelection: function (data, container, escapeMarkup) { + return data ? escapeMarkup(data.text) : undefined; + }, + sortResults: function (results, container, query) { + return results; + }, + formatResultCssClass: function(data) {return data.css;}, + formatSelectionCssClass: function(data, container) {return undefined;}, + formatMatches: function (matches) { return matches + " results are available, use up and down arrow keys to navigate."; }, + formatNoMatches: function () { return "No matches found"; }, + formatInputTooShort: function (input, min) { var n = min - input.length; return "Please enter " + n + " or more character" + (n == 1? "" : "s"); }, + formatInputTooLong: function (input, max) { var n = input.length - max; return "Please delete " + n + " character" + (n == 1? "" : "s"); }, + formatSelectionTooBig: function (limit) { return "You can only select " + limit + " item" + (limit == 1 ? "" : "s"); }, + formatLoadMore: function (pageNumber) { return "Loading more results…"; }, + formatSearching: function () { return "Searching…"; }, + minimumResultsForSearch: 0, + minimumInputLength: 0, + maximumInputLength: null, + maximumSelectionSize: 0, + id: function (e) { return e == undefined ? null : e.id; }, + matcher: function(term, text) { + return stripDiacritics(''+text).toUpperCase().indexOf(stripDiacritics(''+term).toUpperCase()) >= 0; + }, + separator: ",", + tokenSeparators: [], + tokenizer: defaultTokenizer, + escapeMarkup: defaultEscapeMarkup, + blurOnChange: false, + selectOnBlur: false, + adaptContainerCssClass: function(c) { return c; }, + adaptDropdownCssClass: function(c) { return null; }, + nextSearchTerm: function(selectedObject, currentSearchTerm) { return undefined; }, + searchInputPlaceholder: '', + createSearchChoicePosition: 'top', + shouldFocusInput: function (instance) { + // Attempt to detect touch devices + var supportsTouchEvents = (('ontouchstart' in window) || + (navigator.msMaxTouchPoints > 0)); + + // Only devices which support touch events should be special cased + if (!supportsTouchEvents) { + return true; + } + + // Never focus the input if search is disabled + if (instance.opts.minimumResultsForSearch < 0) { + return false; + } + + return true; + } + }; + + $.fn.select2.ajaxDefaults = { + transport: $.ajax, + params: { + type: "GET", + cache: false, + dataType: "json" + } + }; + + // exports + window.Select2 = { + query: { + ajax: ajax, + local: local, + tags: tags + }, util: { + debounce: debounce, + markMatch: markMatch, + escapeMarkup: defaultEscapeMarkup, + stripDiacritics: stripDiacritics + }, "class": { + "abstract": AbstractSelect2, + "single": SingleSelect2, + "multi": MultiSelect2 + } + }; + +}(jQuery)); diff --git a/app/bower_components/select2/select2.min.js b/app/bower_components/select2/select2.min.js new file mode 100644 index 0000000..f396992 --- /dev/null +++ b/app/bower_components/select2/select2.min.js @@ -0,0 +1,22 @@ +/* +Copyright 2014 Igor Vaynberg + +Version: 3.4.8 Timestamp: Thu May 1 09:50:32 EDT 2014 + +This software is licensed under the Apache License, Version 2.0 (the "Apache License") or the GNU +General Public License version 2 (the "GPL License"). You may choose either license to govern your +use of this software only upon the condition that you accept all of the terms of either the Apache +License or the GPL License. + +You may obtain a copy of the Apache License and the GPL License at: + +http://www.apache.org/licenses/LICENSE-2.0 +http://www.gnu.org/licenses/gpl-2.0.html + +Unless required by applicable law or agreed to in writing, software distributed under the Apache License +or the GPL Licesnse is distributed on an "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, +either express or implied. See the Apache License and the GPL License for the specific language governing +permissions and limitations under the Apache License and the GPL License. +*/ +!function(a){"undefined"==typeof a.fn.each2&&a.extend(a.fn,{each2:function(b){for(var c=a([0]),d=-1,e=this.length;++dc;c+=1)if(r(a,b[c]))return c;return-1}function q(){var b=a(l);b.appendTo("body");var c={width:b.width()-b[0].clientWidth,height:b.height()-b[0].clientHeight};return b.remove(),c}function r(a,c){return a===c?!0:a===b||c===b?!1:null===a||null===c?!1:a.constructor===String?a+""==c+"":c.constructor===String?c+""==a+"":!1}function s(b,c){var d,e,f;if(null===b||b.length<1)return[];for(d=b.split(c),e=0,f=d.length;f>e;e+=1)d[e]=a.trim(d[e]);return d}function t(a){return a.outerWidth(!1)-a.width()}function u(c){var d="keyup-change-value";c.on("keydown",function(){a.data(c,d)===b&&a.data(c,d,c.val())}),c.on("keyup",function(){var e=a.data(c,d);e!==b&&c.val()!==e&&(a.removeData(c,d),c.trigger("keyup-change"))})}function v(c){c.on("mousemove",function(c){var d=i;(d===b||d.x!==c.pageX||d.y!==c.pageY)&&a(c.target).trigger("mousemove-filtered",c)})}function w(a,c,d){d=d||b;var e;return function(){var b=arguments;window.clearTimeout(e),e=window.setTimeout(function(){c.apply(d,b)},a)}}function x(a,b){var c=w(a,function(a){b.trigger("scroll-debounced",a)});b.on("scroll",function(a){p(a.target,b.get())>=0&&c(a)})}function y(a){a[0]!==document.activeElement&&window.setTimeout(function(){var d,b=a[0],c=a.val().length;a.focus();var e=b.offsetWidth>0||b.offsetHeight>0;e&&b===document.activeElement&&(b.setSelectionRange?b.setSelectionRange(c,c):b.createTextRange&&(d=b.createTextRange(),d.collapse(!1),d.select()))},0)}function z(b){b=a(b)[0];var c=0,d=0;if("selectionStart"in b)c=b.selectionStart,d=b.selectionEnd-c;else if("selection"in document){b.focus();var e=document.selection.createRange();d=document.selection.createRange().text.length,e.moveStart("character",-b.value.length),c=e.text.length-d}return{offset:c,length:d}}function A(a){a.preventDefault(),a.stopPropagation()}function B(a){a.preventDefault(),a.stopImmediatePropagation()}function C(b){if(!h){var c=b[0].currentStyle||window.getComputedStyle(b[0],null);h=a(document.createElement("div")).css({position:"absolute",left:"-10000px",top:"-10000px",display:"none",fontSize:c.fontSize,fontFamily:c.fontFamily,fontStyle:c.fontStyle,fontWeight:c.fontWeight,letterSpacing:c.letterSpacing,textTransform:c.textTransform,whiteSpace:"nowrap"}),h.attr("class","select2-sizer"),a("body").append(h)}return h.text(b.val()),h.width()}function D(b,c,d){var e,g,f=[];e=b.attr("class"),e&&(e=""+e,a(e.split(" ")).each2(function(){0===this.indexOf("select2-")&&f.push(this)})),e=c.attr("class"),e&&(e=""+e,a(e.split(" ")).each2(function(){0!==this.indexOf("select2-")&&(g=d(this),g&&f.push(g))})),b.attr("class",f.join(" "))}function E(a,b,c,d){var e=o(a.toUpperCase()).indexOf(o(b.toUpperCase())),f=b.length;return 0>e?(c.push(d(a)),void 0):(c.push(d(a.substring(0,e))),c.push(""),c.push(d(a.substring(e,e+f))),c.push(""),c.push(d(a.substring(e+f,a.length))),void 0)}function F(a){var b={"\\":"\","&":"&","<":"<",">":">",'"':""","'":"'","/":"/"};return String(a).replace(/[&<>"'\/\\]/g,function(a){return b[a]})}function G(c){var d,e=null,f=c.quietMillis||100,g=c.url,h=this;return function(i){window.clearTimeout(d),d=window.setTimeout(function(){var d=c.data,f=g,j=c.transport||a.fn.select2.ajaxDefaults.transport,k={type:c.type||"GET",cache:c.cache||!1,jsonpCallback:c.jsonpCallback||b,dataType:c.dataType||"json"},l=a.extend({},a.fn.select2.ajaxDefaults.params,k);d=d?d.call(h,i.term,i.page,i.context):null,f="function"==typeof f?f.call(h,i.term,i.page,i.context):f,e&&"function"==typeof e.abort&&e.abort(),c.params&&(a.isFunction(c.params)?a.extend(l,c.params.call(h)):a.extend(l,c.params)),a.extend(l,{url:f,dataType:c.dataType,data:d,success:function(a){var b=c.results(a,i.page);i.callback(b)}}),e=j.call(h,l)},f)}}function H(b){var d,e,c=b,f=function(a){return""+a.text};a.isArray(c)&&(e=c,c={results:e}),a.isFunction(c)===!1&&(e=c,c=function(){return e});var g=c();return g.text&&(f=g.text,a.isFunction(f)||(d=g.text,f=function(a){return a[d]})),function(b){var g,d=b.term,e={results:[]};return""===d?(b.callback(c()),void 0):(g=function(c,e){var h,i;if(c=c[0],c.children){h={};for(i in c)c.hasOwnProperty(i)&&(h[i]=c[i]);h.children=[],a(c.children).each2(function(a,b){g(b,h.children)}),(h.children.length||b.matcher(d,f(h),c))&&e.push(h)}else b.matcher(d,f(c),c)&&e.push(c)},a(c().results).each2(function(a,b){g(b,e.results)}),b.callback(e),void 0)}}function I(c){var d=a.isFunction(c);return function(e){var f=e.term,g={results:[]},h=d?c(e):c;a.isArray(h)&&(a(h).each(function(){var a=this.text!==b,c=a?this.text:this;(""===f||e.matcher(f,c))&&g.results.push(a?this:{id:this,text:this})}),e.callback(g))}}function J(b,c){if(a.isFunction(b))return!0;if(!b)return!1;if("string"==typeof b)return!0;throw new Error(c+" must be a string, function, or falsy value")}function K(b){if(a.isFunction(b)){var c=Array.prototype.slice.call(arguments,1);return b.apply(null,c)}return b}function L(b){var c=0;return a.each(b,function(a,b){b.children?c+=L(b.children):c++}),c}function M(a,c,d,e){var h,i,j,k,l,f=a,g=!1;if(!e.createSearchChoice||!e.tokenSeparators||e.tokenSeparators.length<1)return b;for(;;){for(i=-1,j=0,k=e.tokenSeparators.length;k>j&&(l=e.tokenSeparators[j],i=a.indexOf(l),!(i>=0));j++);if(0>i)break;if(h=a.substring(0,i),a=a.substring(i+l.length),h.length>0&&(h=e.createSearchChoice.call(this,h,c),h!==b&&null!==h&&e.id(h)!==b&&null!==e.id(h))){for(g=!1,j=0,k=c.length;k>j;j++)if(r(e.id(h),e.id(c[j]))){g=!0;break}g||d(h)}}return f!==a?a:void 0}function N(){var a=this;Array.prototype.forEach.call(arguments,function(b){a[b].remove(),a[b]=null})}function O(b,c){var d=function(){};return d.prototype=new b,d.prototype.constructor=d,d.prototype.parent=b.prototype,d.prototype=a.extend(d.prototype,c),d}if(window.Select2===b){var c,d,e,f,g,h,j,k,i={x:0,y:0},c={TAB:9,ENTER:13,ESC:27,SPACE:32,LEFT:37,UP:38,RIGHT:39,DOWN:40,SHIFT:16,CTRL:17,ALT:18,PAGE_UP:33,PAGE_DOWN:34,HOME:36,END:35,BACKSPACE:8,DELETE:46,isArrow:function(a){switch(a=a.which?a.which:a){case c.LEFT:case c.RIGHT:case c.UP:case c.DOWN:return!0}return!1},isControl:function(a){var b=a.which;switch(b){case c.SHIFT:case c.CTRL:case c.ALT:return!0}return a.metaKey?!0:!1},isFunctionKey:function(a){return a=a.which?a.which:a,a>=112&&123>=a}},l="
    ",m={"\u24b6":"A","\uff21":"A","\xc0":"A","\xc1":"A","\xc2":"A","\u1ea6":"A","\u1ea4":"A","\u1eaa":"A","\u1ea8":"A","\xc3":"A","\u0100":"A","\u0102":"A","\u1eb0":"A","\u1eae":"A","\u1eb4":"A","\u1eb2":"A","\u0226":"A","\u01e0":"A","\xc4":"A","\u01de":"A","\u1ea2":"A","\xc5":"A","\u01fa":"A","\u01cd":"A","\u0200":"A","\u0202":"A","\u1ea0":"A","\u1eac":"A","\u1eb6":"A","\u1e00":"A","\u0104":"A","\u023a":"A","\u2c6f":"A","\ua732":"AA","\xc6":"AE","\u01fc":"AE","\u01e2":"AE","\ua734":"AO","\ua736":"AU","\ua738":"AV","\ua73a":"AV","\ua73c":"AY","\u24b7":"B","\uff22":"B","\u1e02":"B","\u1e04":"B","\u1e06":"B","\u0243":"B","\u0182":"B","\u0181":"B","\u24b8":"C","\uff23":"C","\u0106":"C","\u0108":"C","\u010a":"C","\u010c":"C","\xc7":"C","\u1e08":"C","\u0187":"C","\u023b":"C","\ua73e":"C","\u24b9":"D","\uff24":"D","\u1e0a":"D","\u010e":"D","\u1e0c":"D","\u1e10":"D","\u1e12":"D","\u1e0e":"D","\u0110":"D","\u018b":"D","\u018a":"D","\u0189":"D","\ua779":"D","\u01f1":"DZ","\u01c4":"DZ","\u01f2":"Dz","\u01c5":"Dz","\u24ba":"E","\uff25":"E","\xc8":"E","\xc9":"E","\xca":"E","\u1ec0":"E","\u1ebe":"E","\u1ec4":"E","\u1ec2":"E","\u1ebc":"E","\u0112":"E","\u1e14":"E","\u1e16":"E","\u0114":"E","\u0116":"E","\xcb":"E","\u1eba":"E","\u011a":"E","\u0204":"E","\u0206":"E","\u1eb8":"E","\u1ec6":"E","\u0228":"E","\u1e1c":"E","\u0118":"E","\u1e18":"E","\u1e1a":"E","\u0190":"E","\u018e":"E","\u24bb":"F","\uff26":"F","\u1e1e":"F","\u0191":"F","\ua77b":"F","\u24bc":"G","\uff27":"G","\u01f4":"G","\u011c":"G","\u1e20":"G","\u011e":"G","\u0120":"G","\u01e6":"G","\u0122":"G","\u01e4":"G","\u0193":"G","\ua7a0":"G","\ua77d":"G","\ua77e":"G","\u24bd":"H","\uff28":"H","\u0124":"H","\u1e22":"H","\u1e26":"H","\u021e":"H","\u1e24":"H","\u1e28":"H","\u1e2a":"H","\u0126":"H","\u2c67":"H","\u2c75":"H","\ua78d":"H","\u24be":"I","\uff29":"I","\xcc":"I","\xcd":"I","\xce":"I","\u0128":"I","\u012a":"I","\u012c":"I","\u0130":"I","\xcf":"I","\u1e2e":"I","\u1ec8":"I","\u01cf":"I","\u0208":"I","\u020a":"I","\u1eca":"I","\u012e":"I","\u1e2c":"I","\u0197":"I","\u24bf":"J","\uff2a":"J","\u0134":"J","\u0248":"J","\u24c0":"K","\uff2b":"K","\u1e30":"K","\u01e8":"K","\u1e32":"K","\u0136":"K","\u1e34":"K","\u0198":"K","\u2c69":"K","\ua740":"K","\ua742":"K","\ua744":"K","\ua7a2":"K","\u24c1":"L","\uff2c":"L","\u013f":"L","\u0139":"L","\u013d":"L","\u1e36":"L","\u1e38":"L","\u013b":"L","\u1e3c":"L","\u1e3a":"L","\u0141":"L","\u023d":"L","\u2c62":"L","\u2c60":"L","\ua748":"L","\ua746":"L","\ua780":"L","\u01c7":"LJ","\u01c8":"Lj","\u24c2":"M","\uff2d":"M","\u1e3e":"M","\u1e40":"M","\u1e42":"M","\u2c6e":"M","\u019c":"M","\u24c3":"N","\uff2e":"N","\u01f8":"N","\u0143":"N","\xd1":"N","\u1e44":"N","\u0147":"N","\u1e46":"N","\u0145":"N","\u1e4a":"N","\u1e48":"N","\u0220":"N","\u019d":"N","\ua790":"N","\ua7a4":"N","\u01ca":"NJ","\u01cb":"Nj","\u24c4":"O","\uff2f":"O","\xd2":"O","\xd3":"O","\xd4":"O","\u1ed2":"O","\u1ed0":"O","\u1ed6":"O","\u1ed4":"O","\xd5":"O","\u1e4c":"O","\u022c":"O","\u1e4e":"O","\u014c":"O","\u1e50":"O","\u1e52":"O","\u014e":"O","\u022e":"O","\u0230":"O","\xd6":"O","\u022a":"O","\u1ece":"O","\u0150":"O","\u01d1":"O","\u020c":"O","\u020e":"O","\u01a0":"O","\u1edc":"O","\u1eda":"O","\u1ee0":"O","\u1ede":"O","\u1ee2":"O","\u1ecc":"O","\u1ed8":"O","\u01ea":"O","\u01ec":"O","\xd8":"O","\u01fe":"O","\u0186":"O","\u019f":"O","\ua74a":"O","\ua74c":"O","\u01a2":"OI","\ua74e":"OO","\u0222":"OU","\u24c5":"P","\uff30":"P","\u1e54":"P","\u1e56":"P","\u01a4":"P","\u2c63":"P","\ua750":"P","\ua752":"P","\ua754":"P","\u24c6":"Q","\uff31":"Q","\ua756":"Q","\ua758":"Q","\u024a":"Q","\u24c7":"R","\uff32":"R","\u0154":"R","\u1e58":"R","\u0158":"R","\u0210":"R","\u0212":"R","\u1e5a":"R","\u1e5c":"R","\u0156":"R","\u1e5e":"R","\u024c":"R","\u2c64":"R","\ua75a":"R","\ua7a6":"R","\ua782":"R","\u24c8":"S","\uff33":"S","\u1e9e":"S","\u015a":"S","\u1e64":"S","\u015c":"S","\u1e60":"S","\u0160":"S","\u1e66":"S","\u1e62":"S","\u1e68":"S","\u0218":"S","\u015e":"S","\u2c7e":"S","\ua7a8":"S","\ua784":"S","\u24c9":"T","\uff34":"T","\u1e6a":"T","\u0164":"T","\u1e6c":"T","\u021a":"T","\u0162":"T","\u1e70":"T","\u1e6e":"T","\u0166":"T","\u01ac":"T","\u01ae":"T","\u023e":"T","\ua786":"T","\ua728":"TZ","\u24ca":"U","\uff35":"U","\xd9":"U","\xda":"U","\xdb":"U","\u0168":"U","\u1e78":"U","\u016a":"U","\u1e7a":"U","\u016c":"U","\xdc":"U","\u01db":"U","\u01d7":"U","\u01d5":"U","\u01d9":"U","\u1ee6":"U","\u016e":"U","\u0170":"U","\u01d3":"U","\u0214":"U","\u0216":"U","\u01af":"U","\u1eea":"U","\u1ee8":"U","\u1eee":"U","\u1eec":"U","\u1ef0":"U","\u1ee4":"U","\u1e72":"U","\u0172":"U","\u1e76":"U","\u1e74":"U","\u0244":"U","\u24cb":"V","\uff36":"V","\u1e7c":"V","\u1e7e":"V","\u01b2":"V","\ua75e":"V","\u0245":"V","\ua760":"VY","\u24cc":"W","\uff37":"W","\u1e80":"W","\u1e82":"W","\u0174":"W","\u1e86":"W","\u1e84":"W","\u1e88":"W","\u2c72":"W","\u24cd":"X","\uff38":"X","\u1e8a":"X","\u1e8c":"X","\u24ce":"Y","\uff39":"Y","\u1ef2":"Y","\xdd":"Y","\u0176":"Y","\u1ef8":"Y","\u0232":"Y","\u1e8e":"Y","\u0178":"Y","\u1ef6":"Y","\u1ef4":"Y","\u01b3":"Y","\u024e":"Y","\u1efe":"Y","\u24cf":"Z","\uff3a":"Z","\u0179":"Z","\u1e90":"Z","\u017b":"Z","\u017d":"Z","\u1e92":"Z","\u1e94":"Z","\u01b5":"Z","\u0224":"Z","\u2c7f":"Z","\u2c6b":"Z","\ua762":"Z","\u24d0":"a","\uff41":"a","\u1e9a":"a","\xe0":"a","\xe1":"a","\xe2":"a","\u1ea7":"a","\u1ea5":"a","\u1eab":"a","\u1ea9":"a","\xe3":"a","\u0101":"a","\u0103":"a","\u1eb1":"a","\u1eaf":"a","\u1eb5":"a","\u1eb3":"a","\u0227":"a","\u01e1":"a","\xe4":"a","\u01df":"a","\u1ea3":"a","\xe5":"a","\u01fb":"a","\u01ce":"a","\u0201":"a","\u0203":"a","\u1ea1":"a","\u1ead":"a","\u1eb7":"a","\u1e01":"a","\u0105":"a","\u2c65":"a","\u0250":"a","\ua733":"aa","\xe6":"ae","\u01fd":"ae","\u01e3":"ae","\ua735":"ao","\ua737":"au","\ua739":"av","\ua73b":"av","\ua73d":"ay","\u24d1":"b","\uff42":"b","\u1e03":"b","\u1e05":"b","\u1e07":"b","\u0180":"b","\u0183":"b","\u0253":"b","\u24d2":"c","\uff43":"c","\u0107":"c","\u0109":"c","\u010b":"c","\u010d":"c","\xe7":"c","\u1e09":"c","\u0188":"c","\u023c":"c","\ua73f":"c","\u2184":"c","\u24d3":"d","\uff44":"d","\u1e0b":"d","\u010f":"d","\u1e0d":"d","\u1e11":"d","\u1e13":"d","\u1e0f":"d","\u0111":"d","\u018c":"d","\u0256":"d","\u0257":"d","\ua77a":"d","\u01f3":"dz","\u01c6":"dz","\u24d4":"e","\uff45":"e","\xe8":"e","\xe9":"e","\xea":"e","\u1ec1":"e","\u1ebf":"e","\u1ec5":"e","\u1ec3":"e","\u1ebd":"e","\u0113":"e","\u1e15":"e","\u1e17":"e","\u0115":"e","\u0117":"e","\xeb":"e","\u1ebb":"e","\u011b":"e","\u0205":"e","\u0207":"e","\u1eb9":"e","\u1ec7":"e","\u0229":"e","\u1e1d":"e","\u0119":"e","\u1e19":"e","\u1e1b":"e","\u0247":"e","\u025b":"e","\u01dd":"e","\u24d5":"f","\uff46":"f","\u1e1f":"f","\u0192":"f","\ua77c":"f","\u24d6":"g","\uff47":"g","\u01f5":"g","\u011d":"g","\u1e21":"g","\u011f":"g","\u0121":"g","\u01e7":"g","\u0123":"g","\u01e5":"g","\u0260":"g","\ua7a1":"g","\u1d79":"g","\ua77f":"g","\u24d7":"h","\uff48":"h","\u0125":"h","\u1e23":"h","\u1e27":"h","\u021f":"h","\u1e25":"h","\u1e29":"h","\u1e2b":"h","\u1e96":"h","\u0127":"h","\u2c68":"h","\u2c76":"h","\u0265":"h","\u0195":"hv","\u24d8":"i","\uff49":"i","\xec":"i","\xed":"i","\xee":"i","\u0129":"i","\u012b":"i","\u012d":"i","\xef":"i","\u1e2f":"i","\u1ec9":"i","\u01d0":"i","\u0209":"i","\u020b":"i","\u1ecb":"i","\u012f":"i","\u1e2d":"i","\u0268":"i","\u0131":"i","\u24d9":"j","\uff4a":"j","\u0135":"j","\u01f0":"j","\u0249":"j","\u24da":"k","\uff4b":"k","\u1e31":"k","\u01e9":"k","\u1e33":"k","\u0137":"k","\u1e35":"k","\u0199":"k","\u2c6a":"k","\ua741":"k","\ua743":"k","\ua745":"k","\ua7a3":"k","\u24db":"l","\uff4c":"l","\u0140":"l","\u013a":"l","\u013e":"l","\u1e37":"l","\u1e39":"l","\u013c":"l","\u1e3d":"l","\u1e3b":"l","\u017f":"l","\u0142":"l","\u019a":"l","\u026b":"l","\u2c61":"l","\ua749":"l","\ua781":"l","\ua747":"l","\u01c9":"lj","\u24dc":"m","\uff4d":"m","\u1e3f":"m","\u1e41":"m","\u1e43":"m","\u0271":"m","\u026f":"m","\u24dd":"n","\uff4e":"n","\u01f9":"n","\u0144":"n","\xf1":"n","\u1e45":"n","\u0148":"n","\u1e47":"n","\u0146":"n","\u1e4b":"n","\u1e49":"n","\u019e":"n","\u0272":"n","\u0149":"n","\ua791":"n","\ua7a5":"n","\u01cc":"nj","\u24de":"o","\uff4f":"o","\xf2":"o","\xf3":"o","\xf4":"o","\u1ed3":"o","\u1ed1":"o","\u1ed7":"o","\u1ed5":"o","\xf5":"o","\u1e4d":"o","\u022d":"o","\u1e4f":"o","\u014d":"o","\u1e51":"o","\u1e53":"o","\u014f":"o","\u022f":"o","\u0231":"o","\xf6":"o","\u022b":"o","\u1ecf":"o","\u0151":"o","\u01d2":"o","\u020d":"o","\u020f":"o","\u01a1":"o","\u1edd":"o","\u1edb":"o","\u1ee1":"o","\u1edf":"o","\u1ee3":"o","\u1ecd":"o","\u1ed9":"o","\u01eb":"o","\u01ed":"o","\xf8":"o","\u01ff":"o","\u0254":"o","\ua74b":"o","\ua74d":"o","\u0275":"o","\u01a3":"oi","\u0223":"ou","\ua74f":"oo","\u24df":"p","\uff50":"p","\u1e55":"p","\u1e57":"p","\u01a5":"p","\u1d7d":"p","\ua751":"p","\ua753":"p","\ua755":"p","\u24e0":"q","\uff51":"q","\u024b":"q","\ua757":"q","\ua759":"q","\u24e1":"r","\uff52":"r","\u0155":"r","\u1e59":"r","\u0159":"r","\u0211":"r","\u0213":"r","\u1e5b":"r","\u1e5d":"r","\u0157":"r","\u1e5f":"r","\u024d":"r","\u027d":"r","\ua75b":"r","\ua7a7":"r","\ua783":"r","\u24e2":"s","\uff53":"s","\xdf":"s","\u015b":"s","\u1e65":"s","\u015d":"s","\u1e61":"s","\u0161":"s","\u1e67":"s","\u1e63":"s","\u1e69":"s","\u0219":"s","\u015f":"s","\u023f":"s","\ua7a9":"s","\ua785":"s","\u1e9b":"s","\u24e3":"t","\uff54":"t","\u1e6b":"t","\u1e97":"t","\u0165":"t","\u1e6d":"t","\u021b":"t","\u0163":"t","\u1e71":"t","\u1e6f":"t","\u0167":"t","\u01ad":"t","\u0288":"t","\u2c66":"t","\ua787":"t","\ua729":"tz","\u24e4":"u","\uff55":"u","\xf9":"u","\xfa":"u","\xfb":"u","\u0169":"u","\u1e79":"u","\u016b":"u","\u1e7b":"u","\u016d":"u","\xfc":"u","\u01dc":"u","\u01d8":"u","\u01d6":"u","\u01da":"u","\u1ee7":"u","\u016f":"u","\u0171":"u","\u01d4":"u","\u0215":"u","\u0217":"u","\u01b0":"u","\u1eeb":"u","\u1ee9":"u","\u1eef":"u","\u1eed":"u","\u1ef1":"u","\u1ee5":"u","\u1e73":"u","\u0173":"u","\u1e77":"u","\u1e75":"u","\u0289":"u","\u24e5":"v","\uff56":"v","\u1e7d":"v","\u1e7f":"v","\u028b":"v","\ua75f":"v","\u028c":"v","\ua761":"vy","\u24e6":"w","\uff57":"w","\u1e81":"w","\u1e83":"w","\u0175":"w","\u1e87":"w","\u1e85":"w","\u1e98":"w","\u1e89":"w","\u2c73":"w","\u24e7":"x","\uff58":"x","\u1e8b":"x","\u1e8d":"x","\u24e8":"y","\uff59":"y","\u1ef3":"y","\xfd":"y","\u0177":"y","\u1ef9":"y","\u0233":"y","\u1e8f":"y","\xff":"y","\u1ef7":"y","\u1e99":"y","\u1ef5":"y","\u01b4":"y","\u024f":"y","\u1eff":"y","\u24e9":"z","\uff5a":"z","\u017a":"z","\u1e91":"z","\u017c":"z","\u017e":"z","\u1e93":"z","\u1e95":"z","\u01b6":"z","\u0225":"z","\u0240":"z","\u2c6c":"z","\ua763":"z"};j=a(document),g=function(){var a=1;return function(){return a++}}(),j.on("mousemove",function(a){i.x=a.pageX,i.y=a.pageY}),d=O(Object,{bind:function(a){var b=this;return function(){a.apply(b,arguments)}},init:function(c){var d,e,f=".select2-results";this.opts=c=this.prepareOpts(c),this.id=c.id,c.element.data("select2")!==b&&null!==c.element.data("select2")&&c.element.data("select2").destroy(),this.container=this.createContainer(),this.liveRegion=a("",{role:"status","aria-live":"polite"}).addClass("select2-hidden-accessible").appendTo(document.body),this.containerId="s2id_"+(c.element.attr("id")||"autogen"+g()),this.containerEventName=this.containerId.replace(/([.])/g,"_").replace(/([;&,\-\.\+\*\~':"\!\^#$%@\[\]\(\)=>\|])/g,"\\$1"),this.container.attr("id",this.containerId),this.container.attr("title",c.element.attr("title")),this.body=a("body"),D(this.container,this.opts.element,this.opts.adaptContainerCssClass),this.container.attr("style",c.element.attr("style")),this.container.css(K(c.containerCss)),this.container.addClass(K(c.containerCssClass)),this.elementTabIndex=this.opts.element.attr("tabindex"),this.opts.element.data("select2",this).attr("tabindex","-1").before(this.container).on("click.select2",A),this.container.data("select2",this),this.dropdown=this.container.find(".select2-drop"),D(this.dropdown,this.opts.element,this.opts.adaptDropdownCssClass),this.dropdown.addClass(K(c.dropdownCssClass)),this.dropdown.data("select2",this),this.dropdown.on("click",A),this.results=d=this.container.find(f),this.search=e=this.container.find("input.select2-input"),this.queryCount=0,this.resultsPage=0,this.context=null,this.initContainer(),this.container.on("click",A),v(this.results),this.dropdown.on("mousemove-filtered",f,this.bind(this.highlightUnderEvent)),this.dropdown.on("touchstart touchmove touchend",f,this.bind(function(a){this._touchEvent=!0,this.highlightUnderEvent(a)})),this.dropdown.on("touchmove",f,this.bind(this.touchMoved)),this.dropdown.on("touchstart touchend",f,this.bind(this.clearTouchMoved)),this.dropdown.on("click",this.bind(function(){this._touchEvent&&(this._touchEvent=!1,this.selectHighlighted())})),x(80,this.results),this.dropdown.on("scroll-debounced",f,this.bind(this.loadMoreIfNeeded)),a(this.container).on("change",".select2-input",function(a){a.stopPropagation()}),a(this.dropdown).on("change",".select2-input",function(a){a.stopPropagation()}),a.fn.mousewheel&&d.mousewheel(function(a,b,c,e){var f=d.scrollTop();e>0&&0>=f-e?(d.scrollTop(0),A(a)):0>e&&d.get(0).scrollHeight-d.scrollTop()+e<=d.height()&&(d.scrollTop(d.get(0).scrollHeight-d.height()),A(a))}),u(e),e.on("keyup-change input paste",this.bind(this.updateResults)),e.on("focus",function(){e.addClass("select2-focused")}),e.on("blur",function(){e.removeClass("select2-focused")}),this.dropdown.on("mouseup",f,this.bind(function(b){a(b.target).closest(".select2-result-selectable").length>0&&(this.highlightUnderEvent(b),this.selectHighlighted(b))})),this.dropdown.on("click mouseup mousedown touchstart touchend focusin",function(a){a.stopPropagation()}),this.nextSearchTerm=b,a.isFunction(this.opts.initSelection)&&(this.initSelection(),this.monitorSource()),null!==c.maximumInputLength&&this.search.attr("maxlength",c.maximumInputLength);var h=c.element.prop("disabled");h===b&&(h=!1),this.enable(!h);var i=c.element.prop("readonly");i===b&&(i=!1),this.readonly(i),k=k||q(),this.autofocus=c.element.prop("autofocus"),c.element.prop("autofocus",!1),this.autofocus&&this.focus(),this.search.attr("placeholder",c.searchInputPlaceholder)},destroy:function(){var a=this.opts.element,c=a.data("select2");this.close(),this.propertyObserver&&(this.propertyObserver.disconnect(),this.propertyObserver=null),c!==b&&(c.container.remove(),c.liveRegion.remove(),c.dropdown.remove(),a.removeClass("select2-offscreen").removeData("select2").off(".select2").prop("autofocus",this.autofocus||!1),this.elementTabIndex?a.attr({tabindex:this.elementTabIndex}):a.removeAttr("tabindex"),a.show()),N.call(this,"container","liveRegion","dropdown","results","search")},optionToData:function(a){return a.is("option")?{id:a.prop("value"),text:a.text(),element:a.get(),css:a.attr("class"),disabled:a.prop("disabled"),locked:r(a.attr("locked"),"locked")||r(a.data("locked"),!0)}:a.is("optgroup")?{text:a.attr("label"),children:[],element:a.get(),css:a.attr("class")}:void 0},prepareOpts:function(c){var d,e,f,h,i=this;if(d=c.element,"select"===d.get(0).tagName.toLowerCase()&&(this.select=e=c.element),e&&a.each(["id","multiple","ajax","query","createSearchChoice","initSelection","data","tags"],function(){if(this in c)throw new Error("Option '"+this+"' is not allowed for Select2 when attached to a ","
    "," ","
      ","
    ","
    "].join(""));return b},enableInterface:function(){this.parent.enableInterface.apply(this,arguments)&&this.focusser.prop("disabled",!this.isInterfaceEnabled())},opening:function(){var c,d,e;this.opts.minimumResultsForSearch>=0&&this.showSearch(!0),this.parent.opening.apply(this,arguments),this.showSearchInput!==!1&&this.search.val(this.focusser.val()),this.opts.shouldFocusInput(this)&&(this.search.focus(),c=this.search.get(0),c.createTextRange?(d=c.createTextRange(),d.collapse(!1),d.select()):c.setSelectionRange&&(e=this.search.val().length,c.setSelectionRange(e,e))),""===this.search.val()&&this.nextSearchTerm!=b&&(this.search.val(this.nextSearchTerm),this.search.select()),this.focusser.prop("disabled",!0).val(""),this.updateResults(!0),this.opts.element.trigger(a.Event("select2-open"))},close:function(){this.opened()&&(this.parent.close.apply(this,arguments),this.focusser.prop("disabled",!1),this.opts.shouldFocusInput(this)&&this.focusser.focus())},focus:function(){this.opened()?this.close():(this.focusser.prop("disabled",!1),this.opts.shouldFocusInput(this)&&this.focusser.focus())},isFocused:function(){return this.container.hasClass("select2-container-active")},cancel:function(){this.parent.cancel.apply(this,arguments),this.focusser.prop("disabled",!1),this.opts.shouldFocusInput(this)&&this.focusser.focus()},destroy:function(){a("label[for='"+this.focusser.attr("id")+"']").attr("for",this.opts.element.attr("id")),this.parent.destroy.apply(this,arguments),N.call(this,"selection","focusser")},initContainer:function(){var b,h,d=this.container,e=this.dropdown,f=g();this.opts.minimumResultsForSearch<0?this.showSearch(!1):this.showSearch(!0),this.selection=b=d.find(".select2-choice"),this.focusser=d.find(".select2-focusser"),b.find(".select2-chosen").attr("id","select2-chosen-"+f),this.focusser.attr("aria-labelledby","select2-chosen-"+f),this.results.attr("id","select2-results-"+f),this.search.attr("aria-owns","select2-results-"+f),this.focusser.attr("id","s2id_autogen"+f),h=a("label[for='"+this.opts.element.attr("id")+"']"),this.focusser.prev().text(h.text()).attr("for",this.focusser.attr("id"));var i=this.opts.element.attr("title");this.opts.element.attr("title",i||h.text()),this.focusser.attr("tabindex",this.elementTabIndex),this.search.attr("id",this.focusser.attr("id")+"_search"),this.search.prev().text(a("label[for='"+this.focusser.attr("id")+"']").text()).attr("for",this.search.attr("id")),this.search.on("keydown",this.bind(function(a){if(this.isInterfaceEnabled()){if(a.which===c.PAGE_UP||a.which===c.PAGE_DOWN)return A(a),void 0;switch(a.which){case c.UP:case c.DOWN:return this.moveHighlight(a.which===c.UP?-1:1),A(a),void 0;case c.ENTER:return this.selectHighlighted(),A(a),void 0;case c.TAB:return this.selectHighlighted({noFocus:!0}),void 0;case c.ESC:return this.cancel(a),A(a),void 0}}})),this.search.on("blur",this.bind(function(){document.activeElement===this.body.get(0)&&window.setTimeout(this.bind(function(){this.opened()&&this.search.focus()}),0)})),this.focusser.on("keydown",this.bind(function(a){if(this.isInterfaceEnabled()&&a.which!==c.TAB&&!c.isControl(a)&&!c.isFunctionKey(a)&&a.which!==c.ESC){if(this.opts.openOnEnter===!1&&a.which===c.ENTER)return A(a),void 0;if(a.which==c.DOWN||a.which==c.UP||a.which==c.ENTER&&this.opts.openOnEnter){if(a.altKey||a.ctrlKey||a.shiftKey||a.metaKey)return;return this.open(),A(a),void 0}return a.which==c.DELETE||a.which==c.BACKSPACE?(this.opts.allowClear&&this.clear(),A(a),void 0):void 0}})),u(this.focusser),this.focusser.on("keyup-change input",this.bind(function(a){if(this.opts.minimumResultsForSearch>=0){if(a.stopPropagation(),this.opened())return;this.open()}})),b.on("mousedown touchstart","abbr",this.bind(function(a){this.isInterfaceEnabled()&&(this.clear(),B(a),this.close(),this.selection.focus())})),b.on("mousedown touchstart",this.bind(function(c){n(b),this.container.hasClass("select2-container-active")||this.opts.element.trigger(a.Event("select2-focus")),this.opened()?this.close():this.isInterfaceEnabled()&&this.open(),A(c)})),e.on("mousedown touchstart",this.bind(function(){this.opts.shouldFocusInput(this)&&this.search.focus()})),b.on("focus",this.bind(function(a){A(a)})),this.focusser.on("focus",this.bind(function(){this.container.hasClass("select2-container-active")||this.opts.element.trigger(a.Event("select2-focus")),this.container.addClass("select2-container-active")})).on("blur",this.bind(function(){this.opened()||(this.container.removeClass("select2-container-active"),this.opts.element.trigger(a.Event("select2-blur")))})),this.search.on("focus",this.bind(function(){this.container.hasClass("select2-container-active")||this.opts.element.trigger(a.Event("select2-focus")),this.container.addClass("select2-container-active")})),this.initContainerWidth(),this.opts.element.addClass("select2-offscreen"),this.setPlaceholder()},clear:function(b){var c=this.selection.data("select2-data");if(c){var d=a.Event("select2-clearing");if(this.opts.element.trigger(d),d.isDefaultPrevented())return;var e=this.getPlaceholderOption();this.opts.element.val(e?e.val():""),this.selection.find(".select2-chosen").empty(),this.selection.removeData("select2-data"),this.setPlaceholder(),b!==!1&&(this.opts.element.trigger({type:"select2-removed",val:this.id(c),choice:c}),this.triggerChange({removed:c}))}},initSelection:function(){if(this.isPlaceholderOptionSelected())this.updateSelection(null),this.close(),this.setPlaceholder();else{var c=this;this.opts.initSelection.call(null,this.opts.element,function(a){a!==b&&null!==a&&(c.updateSelection(a),c.close(),c.setPlaceholder(),c.nextSearchTerm=c.opts.nextSearchTerm(a,c.search.val()))})}},isPlaceholderOptionSelected:function(){var a;return this.getPlaceholder()===b?!1:(a=this.getPlaceholderOption())!==b&&a.prop("selected")||""===this.opts.element.val()||this.opts.element.val()===b||null===this.opts.element.val()},prepareOpts:function(){var b=this.parent.prepareOpts.apply(this,arguments),c=this;return"select"===b.element.get(0).tagName.toLowerCase()?b.initSelection=function(a,b){var d=a.find("option").filter(function(){return this.selected&&!this.disabled});b(c.optionToData(d))}:"data"in b&&(b.initSelection=b.initSelection||function(c,d){var e=c.val(),f=null;b.query({matcher:function(a,c,d){var g=r(e,b.id(d));return g&&(f=d),g},callback:a.isFunction(d)?function(){d(f)}:a.noop})}),b},getPlaceholder:function(){return this.select&&this.getPlaceholderOption()===b?b:this.parent.getPlaceholder.apply(this,arguments)},setPlaceholder:function(){var a=this.getPlaceholder();if(this.isPlaceholderOptionSelected()&&a!==b){if(this.select&&this.getPlaceholderOption()===b)return;this.selection.find(".select2-chosen").html(this.opts.escapeMarkup(a)),this.selection.addClass("select2-default"),this.container.removeClass("select2-allowclear")}},postprocessResults:function(a,b,c){var d=0,e=this;if(this.findHighlightableChoices().each2(function(a,b){return r(e.id(b.data("select2-data")),e.opts.element.val())?(d=a,!1):void 0}),c!==!1&&(b===!0&&d>=0?this.highlight(d):this.highlight(0)),b===!0){var g=this.opts.minimumResultsForSearch;g>=0&&this.showSearch(L(a.results)>=g)}},showSearch:function(b){this.showSearchInput!==b&&(this.showSearchInput=b,this.dropdown.find(".select2-search").toggleClass("select2-search-hidden",!b),this.dropdown.find(".select2-search").toggleClass("select2-offscreen",!b),a(this.dropdown,this.container).toggleClass("select2-with-searchbox",b))},onSelect:function(a,b){if(this.triggerSelect(a)){var c=this.opts.element.val(),d=this.data();this.opts.element.val(this.id(a)),this.updateSelection(a),this.opts.element.trigger({type:"select2-selected",val:this.id(a),choice:a}),this.nextSearchTerm=this.opts.nextSearchTerm(a,this.search.val()),this.close(),b&&b.noFocus||!this.opts.shouldFocusInput(this)||this.focusser.focus(),r(c,this.id(a))||this.triggerChange({added:a,removed:d})}},updateSelection:function(a){var d,e,c=this.selection.find(".select2-chosen");this.selection.data("select2-data",a),c.empty(),null!==a&&(d=this.opts.formatSelection(a,c,this.opts.escapeMarkup)),d!==b&&c.append(d),e=this.opts.formatSelectionCssClass(a,c),e!==b&&c.addClass(e),this.selection.removeClass("select2-default"),this.opts.allowClear&&this.getPlaceholder()!==b&&this.container.addClass("select2-allowclear")},val:function(){var a,c=!1,d=null,e=this,f=this.data();if(0===arguments.length)return this.opts.element.val();if(a=arguments[0],arguments.length>1&&(c=arguments[1]),this.select)this.select.val(a).find("option").filter(function(){return this.selected}).each2(function(a,b){return d=e.optionToData(b),!1}),this.updateSelection(d),this.setPlaceholder(),c&&this.triggerChange({added:d,removed:f});else{if(!a&&0!==a)return this.clear(c),void 0;if(this.opts.initSelection===b)throw new Error("cannot call val() if initSelection() is not defined");this.opts.element.val(a),this.opts.initSelection(this.opts.element,function(a){e.opts.element.val(a?e.id(a):""),e.updateSelection(a),e.setPlaceholder(),c&&e.triggerChange({added:a,removed:f})})}},clearSearch:function(){this.search.val(""),this.focusser.val("")},data:function(a){var c,d=!1;return 0===arguments.length?(c=this.selection.data("select2-data"),c==b&&(c=null),c):(arguments.length>1&&(d=arguments[1]),a?(c=this.data(),this.opts.element.val(a?this.id(a):""),this.updateSelection(a),d&&this.triggerChange({added:a,removed:c})):this.clear(d),void 0)}}),f=O(d,{createContainer:function(){var b=a(document.createElement("div")).attr({"class":"select2-container select2-container-multi"}).html(["
      ","
    • "," "," ","
    • ","
    ","
    ","
      ","
    ","
    "].join(""));return b},prepareOpts:function(){var b=this.parent.prepareOpts.apply(this,arguments),c=this;return"select"===b.element.get(0).tagName.toLowerCase()?b.initSelection=function(a,b){var d=[];a.find("option").filter(function(){return this.selected&&!this.disabled}).each2(function(a,b){d.push(c.optionToData(b))}),b(d)}:"data"in b&&(b.initSelection=b.initSelection||function(c,d){var e=s(c.val(),b.separator),f=[];b.query({matcher:function(c,d,g){var h=a.grep(e,function(a){return r(a,b.id(g))}).length;return h&&f.push(g),h},callback:a.isFunction(d)?function(){for(var a=[],c=0;c0||(this.selectChoice(null),this.clearPlaceholder(),this.container.hasClass("select2-container-active")||this.opts.element.trigger(a.Event("select2-focus")),this.open(),this.focusSearch(),b.preventDefault()))})),this.container.on("focus",b,this.bind(function(){this.isInterfaceEnabled()&&(this.container.hasClass("select2-container-active")||this.opts.element.trigger(a.Event("select2-focus")),this.container.addClass("select2-container-active"),this.dropdown.addClass("select2-drop-active"),this.clearPlaceholder())})),this.initContainerWidth(),this.opts.element.addClass("select2-offscreen"),this.clearSearch()},enableInterface:function(){this.parent.enableInterface.apply(this,arguments)&&this.search.prop("disabled",!this.isInterfaceEnabled())},initSelection:function(){if(""===this.opts.element.val()&&""===this.opts.element.text()&&(this.updateSelection([]),this.close(),this.clearSearch()),this.select||""!==this.opts.element.val()){var c=this;this.opts.initSelection.call(null,this.opts.element,function(a){a!==b&&null!==a&&(c.updateSelection(a),c.close(),c.clearSearch())})}},clearSearch:function(){var a=this.getPlaceholder(),c=this.getMaxSearchWidth();a!==b&&0===this.getVal().length&&this.search.hasClass("select2-focused")===!1?(this.search.val(a).addClass("select2-default"),this.search.width(c>0?c:this.container.css("width"))):this.search.val("").width(10)},clearPlaceholder:function(){this.search.hasClass("select2-default")&&this.search.val("").removeClass("select2-default")},opening:function(){this.clearPlaceholder(),this.resizeSearch(),this.parent.opening.apply(this,arguments),this.focusSearch(),""===this.search.val()&&this.nextSearchTerm!=b&&(this.search.val(this.nextSearchTerm),this.search.select()),this.updateResults(!0),this.opts.shouldFocusInput(this)&&this.search.focus(),this.opts.element.trigger(a.Event("select2-open"))},close:function(){this.opened()&&this.parent.close.apply(this,arguments)},focus:function(){this.close(),this.search.focus()},isFocused:function(){return this.search.hasClass("select2-focused")},updateSelection:function(b){var c=[],d=[],e=this;a(b).each(function(){p(e.id(this),c)<0&&(c.push(e.id(this)),d.push(this))}),b=d,this.selection.find(".select2-search-choice").remove(),a(b).each(function(){e.addSelectedChoice(this)}),e.postprocessResults()},tokenize:function(){var a=this.search.val();a=this.opts.tokenizer.call(this,a,this.data(),this.bind(this.onSelect),this.opts),null!=a&&a!=b&&(this.search.val(a),a.length>0&&this.open())},onSelect:function(a,c){this.triggerSelect(a)&&(this.addSelectedChoice(a),this.opts.element.trigger({type:"selected",val:this.id(a),choice:a}),this.nextSearchTerm=this.opts.nextSearchTerm(a,this.search.val()),this.clearSearch(),this.updateResults(),(this.select||!this.opts.closeOnSelect)&&this.postprocessResults(a,!1,this.opts.closeOnSelect===!0),this.opts.closeOnSelect?(this.close(),this.search.width(10)):this.countSelectableResults()>0?(this.search.width(10),this.resizeSearch(),this.getMaximumSelectionSize()>0&&this.val().length>=this.getMaximumSelectionSize()?this.updateResults(!0):this.nextSearchTerm!=b&&(this.search.val(this.nextSearchTerm),this.updateResults(),this.search.select()),this.positionDropdown()):(this.close(),this.search.width(10)),this.triggerChange({added:a}),c&&c.noFocus||this.focusSearch())},cancel:function(){this.close(),this.focusSearch()},addSelectedChoice:function(c){var j,k,d=!c.locked,e=a("
  • "),f=a("
  • "),g=d?e:f,h=this.id(c),i=this.getVal();j=this.opts.formatSelection(c,g.find("div"),this.opts.escapeMarkup),j!=b&&g.find("div").replaceWith("
    "+j+"
    "),k=this.opts.formatSelectionCssClass(c,g.find("div")),k!=b&&g.addClass(k),d&&g.find(".select2-search-choice-close").on("mousedown",A).on("click dblclick",this.bind(function(b){this.isInterfaceEnabled()&&(this.unselect(a(b.target)),this.selection.find(".select2-search-choice-focus").removeClass("select2-search-choice-focus"),A(b),this.close(),this.focusSearch())})).on("focus",this.bind(function(){this.isInterfaceEnabled()&&(this.container.addClass("select2-container-active"),this.dropdown.addClass("select2-drop-active"))})),g.data("select2-data",c),g.insertBefore(this.searchContainer),i.push(h),this.setVal(i)},unselect:function(b){var d,e,c=this.getVal();if(b=b.closest(".select2-search-choice"),0===b.length)throw"Invalid argument: "+b+". Must be .select2-search-choice";if(d=b.data("select2-data")){var f=a.Event("select2-removing");if(f.val=this.id(d),f.choice=d,this.opts.element.trigger(f),f.isDefaultPrevented())return!1;for(;(e=p(this.id(d),c))>=0;)c.splice(e,1),this.setVal(c),this.select&&this.postprocessResults();return b.remove(),this.opts.element.trigger({type:"select2-removed",val:this.id(d),choice:d}),this.triggerChange({removed:d}),!0}},postprocessResults:function(a,b,c){var d=this.getVal(),e=this.results.find(".select2-result"),f=this.results.find(".select2-result-with-children"),g=this;e.each2(function(a,b){var c=g.id(b.data("select2-data"));p(c,d)>=0&&(b.addClass("select2-selected"),b.find(".select2-result-selectable").addClass("select2-selected"))}),f.each2(function(a,b){b.is(".select2-result-selectable")||0!==b.find(".select2-result-selectable:not(.select2-selected)").length||b.addClass("select2-selected")}),-1==this.highlight()&&c!==!1&&g.highlight(0),!this.opts.createSearchChoice&&!e.filter(".select2-result:not(.select2-selected)").length>0&&(!a||a&&!a.more&&0===this.results.find(".select2-no-results").length)&&J(g.opts.formatNoMatches,"formatNoMatches")&&this.results.append("
  • "+K(g.opts.formatNoMatches,g.search.val())+"
  • ")},getMaxSearchWidth:function(){return this.selection.width()-t(this.search)},resizeSearch:function(){var a,b,c,d,e,f=t(this.search);a=C(this.search)+10,b=this.search.offset().left,c=this.selection.width(),d=this.selection.offset().left,e=c-(b-d)-f,a>e&&(e=c-f),40>e&&(e=c-f),0>=e&&(e=a),this.search.width(Math.floor(e))},getVal:function(){var a;return this.select?(a=this.select.val(),null===a?[]:a):(a=this.opts.element.val(),s(a,this.opts.separator))},setVal:function(b){var c;this.select?this.select.val(b):(c=[],a(b).each(function(){p(this,c)<0&&c.push(this)}),this.opts.element.val(0===c.length?"":c.join(this.opts.separator)))},buildChangeDetails:function(a,b){for(var b=b.slice(0),a=a.slice(0),c=0;c0&&c--,a.splice(d,1),d--);return{added:b,removed:a}},val:function(c,d){var e,f=this;if(0===arguments.length)return this.getVal();if(e=this.data(),e.length||(e=[]),!c&&0!==c)return this.opts.element.val(""),this.updateSelection([]),this.clearSearch(),d&&this.triggerChange({added:this.data(),removed:e}),void 0;if(this.setVal(c),this.select)this.opts.initSelection(this.select,this.bind(this.updateSelection)),d&&this.triggerChange(this.buildChangeDetails(e,this.data()));else{if(this.opts.initSelection===b)throw new Error("val() cannot be called if initSelection() is not defined");this.opts.initSelection(this.opts.element,function(b){var c=a.map(b,f.id);f.setVal(c),f.updateSelection(b),f.clearSearch(),d&&f.triggerChange(f.buildChangeDetails(e,f.data()))})}this.clearSearch()},onSortStart:function(){if(this.select)throw new Error("Sorting of elements is not supported when attached to instead.");this.search.width(0),this.searchContainer.hide()},onSortEnd:function(){var b=[],c=this;this.searchContainer.show(),this.searchContainer.appendTo(this.searchContainer.parent()),this.resizeSearch(),this.selection.find(".select2-search-choice").each(function(){b.push(c.opts.id(a(this).data("select2-data")))}),this.setVal(b),this.triggerChange()},data:function(b,c){var e,f,d=this;return 0===arguments.length?this.selection.children(".select2-search-choice").map(function(){return a(this).data("select2-data")}).get():(f=this.data(),b||(b=[]),e=a.map(b,function(a){return d.opts.id(a)}),this.setVal(e),this.updateSelection(b),this.clearSearch(),c&&this.triggerChange(this.buildChangeDetails(f,this.data())),void 0)}}),a.fn.select2=function(){var d,e,f,g,h,c=Array.prototype.slice.call(arguments,0),i=["val","destroy","opened","open","close","focus","isFocused","container","dropdown","onSortStart","onSortEnd","enable","disable","readonly","positionDropdown","data","search"],j=["opened","isFocused","container","dropdown"],k=["val","data"],l={search:"externalSearch"};return this.each(function(){if(0===c.length||"object"==typeof c[0])d=0===c.length?{}:a.extend({},c[0]),d.element=a(this),"select"===d.element.get(0).tagName.toLowerCase()?h=d.element.prop("multiple"):(h=d.multiple||!1,"tags"in d&&(d.multiple=h=!0)),e=h?new window.Select2["class"].multi:new window.Select2["class"].single,e.init(d);else{if("string"!=typeof c[0])throw"Invalid arguments to select2 plugin: "+c;if(p(c[0],i)<0)throw"Unknown method: "+c[0];if(g=b,e=a(this).data("select2"),e===b)return;if(f=c[0],"container"===f?g=e.container:"dropdown"===f?g=e.dropdown:(l[f]&&(f=l[f]),g=e[f].apply(e,c.slice(1))),p(c[0],j)>=0||p(c[0],k)>=0&&1==c.length)return!1}}),g===b?this:g},a.fn.select2.defaults={width:"copy",loadMorePadding:0,closeOnSelect:!0,openOnEnter:!0,containerCss:{},dropdownCss:{},containerCssClass:"",dropdownCssClass:"",formatResult:function(a,b,c,d){var e=[];return E(a.text,c.term,e,d),e.join("")},formatSelection:function(a,c,d){return a?d(a.text):b},sortResults:function(a){return a},formatResultCssClass:function(a){return a.css},formatSelectionCssClass:function(){return b},formatMatches:function(a){return a+" results are available, use up and down arrow keys to navigate."},formatNoMatches:function(){return"No matches found"},formatInputTooShort:function(a,b){var c=b-a.length;return"Please enter "+c+" or more character"+(1==c?"":"s")},formatInputTooLong:function(a,b){var c=a.length-b;return"Please delete "+c+" character"+(1==c?"":"s")},formatSelectionTooBig:function(a){return"You can only select "+a+" item"+(1==a?"":"s")},formatLoadMore:function(){return"Loading more results\u2026"},formatSearching:function(){return"Searching\u2026"},minimumResultsForSearch:0,minimumInputLength:0,maximumInputLength:null,maximumSelectionSize:0,id:function(a){return a==b?null:a.id},matcher:function(a,b){return o(""+b).toUpperCase().indexOf(o(""+a).toUpperCase())>=0},separator:",",tokenSeparators:[],tokenizer:M,escapeMarkup:F,blurOnChange:!1,selectOnBlur:!1,adaptContainerCssClass:function(a){return a},adaptDropdownCssClass:function(){return null},nextSearchTerm:function(){return b},searchInputPlaceholder:"",createSearchChoicePosition:"top",shouldFocusInput:function(a){var b="ontouchstart"in window||navigator.msMaxTouchPoints>0;return b?a.opts.minimumResultsForSearch<0?!1:!0:!0}},a.fn.select2.ajaxDefaults={transport:a.ajax,params:{type:"GET",cache:!1,dataType:"json"}},window.Select2={query:{ajax:G,local:H,tags:I},util:{debounce:w,markMatch:E,escapeMarkup:F,stripDiacritics:o},"class":{"abstract":d,single:e,multi:f}}}}(jQuery); \ No newline at end of file diff --git a/app/bower_components/select2/select2.png b/app/bower_components/select2/select2.png new file mode 100644 index 0000000000000000000000000000000000000000..1d804ffb99699b9e030f1010314de0970b5a000d GIT binary patch literal 613 zcmV-r0-F7aP)#WY!I$JQV$)A5aAS1BM||2XVJl=+L1^1S1H% zM-&lx?NZpUrHhn>fk<>POqf2sh40}xxGZfc+t+#Eb(qHy9_3*1(U%t9t)QDnI#YAL(|ACV(>)>6WD-t!8tutHkdb^#3`HzoJG3A2@T`% zA|K@o*b!`R#(7)PWrMFn2))Ca3MR4(zaT`Zr61*kZK5NPnZwQszxh$fyv3?&4c>$q z2m=+yc0dRXRAsPDxF6sD;@rK4JGdR_``1S~o6Xi@2&aR6hcSrEp9HVRzEqVDqBn<1%hR=D4e1f^ra^A|34Cjc=Gny{F(o#MrvPYgZuTJOz(n)-F<| zj()qR;C={)N<0RRvDZ^@6ND+W*}gh-Lip(MDt!(zMSO)!j2j+*hxgzC-e3$@(O2p* zu;+gddm(cZwXTCLx*Ky4THOa*^b^F`woveIeCK^0aR|TJ00000NkvXXu0mjfA#WC6 literal 0 HcmV?d00001 diff --git a/app/bower_components/select2/select2_locale_ar.js b/app/bower_components/select2/select2_locale_ar.js new file mode 100644 index 0000000..acb33a2 --- /dev/null +++ b/app/bower_components/select2/select2_locale_ar.js @@ -0,0 +1,17 @@ +/** + * Select2 Arabic translation. + * + * Author: Adel KEDJOUR + */ +(function ($) { + "use strict"; + + $.extend($.fn.select2.defaults, { + formatNoMatches: function () { return "لم يتم العثور على مطابقات"; }, + formatInputTooShort: function (input, min) { var n = min - input.length; if (n == 1){ return "الرجاء إدخال حرف واحد على الأكثر"; } return n == 2 ? "الرجاء إدخال حرفين على الأكثر" : "الرجاء إدخال " + n + " على الأكثر"; }, + formatInputTooLong: function (input, max) { var n = input.length - max; if (n == 1){ return "الرجاء إدخال حرف واحد على الأقل"; } return n == 2 ? "الرجاء إدخال حرفين على الأقل" : "الرجاء إدخال " + n + " على الأقل "; }, + formatSelectionTooBig: function (limit) { if (n == 1){ return "يمكنك أن تختار إختيار واحد فقط"; } return n == 2 ? "يمكنك أن تختار إختيارين فقط" : "يمكنك أن تختار " + n + " إختيارات فقط"; }, + formatLoadMore: function (pageNumber) { return "تحميل المزيد من النتائج…"; }, + formatSearching: function () { return "البحث…"; } + }); +})(jQuery); diff --git a/app/bower_components/select2/select2_locale_bg.js b/app/bower_components/select2/select2_locale_bg.js new file mode 100644 index 0000000..585d28a --- /dev/null +++ b/app/bower_components/select2/select2_locale_bg.js @@ -0,0 +1,18 @@ +/** + * Select2 Bulgarian translation. + * + * @author Lubomir Vikev + * @author Uriy Efremochkin + */ +(function ($) { + "use strict"; + + $.extend($.fn.select2.defaults, { + formatNoMatches: function () { return "Няма намерени съвпадения"; }, + formatInputTooShort: function (input, min) { var n = min - input.length; return "Моля въведете още " + n + " символ" + (n > 1 ? "а" : ""); }, + formatInputTooLong: function (input, max) { var n = input.length - max; return "Моля въведете с " + n + " по-малко символ" + (n > 1 ? "а" : ""); }, + formatSelectionTooBig: function (limit) { return "Можете да направите до " + limit + (limit > 1 ? " избора" : " избор"); }, + formatLoadMore: function (pageNumber) { return "Зареждат се още…"; }, + formatSearching: function () { return "Търсене…"; } + }); +})(jQuery); diff --git a/app/bower_components/select2/select2_locale_ca.js b/app/bower_components/select2/select2_locale_ca.js new file mode 100644 index 0000000..7e19d3c --- /dev/null +++ b/app/bower_components/select2/select2_locale_ca.js @@ -0,0 +1,17 @@ +/** + * Select2 Catalan translation. + * + * Author: David Planella + */ +(function ($) { + "use strict"; + + $.extend($.fn.select2.defaults, { + formatNoMatches: function () { return "No s'ha trobat cap coincidència"; }, + formatInputTooShort: function (input, min) { var n = min - input.length; return "Introduïu " + n + " caràcter" + (n == 1 ? "" : "s") + " més"; }, + formatInputTooLong: function (input, max) { var n = input.length - max; return "Introduïu " + n + " caràcter" + (n == 1? "" : "s") + "menys"; }, + formatSelectionTooBig: function (limit) { return "Només podeu seleccionar " + limit + " element" + (limit == 1 ? "" : "s"); }, + formatLoadMore: function (pageNumber) { return "S'estan carregant més resultats…"; }, + formatSearching: function () { return "S'està cercant…"; } + }); +})(jQuery); diff --git a/app/bower_components/select2/select2_locale_cs.js b/app/bower_components/select2/select2_locale_cs.js new file mode 100644 index 0000000..376b54a --- /dev/null +++ b/app/bower_components/select2/select2_locale_cs.js @@ -0,0 +1,49 @@ +/** + * Select2 Czech translation. + * + * Author: Michal Marek + * Author - sklonovani: David Vallner + */ +(function ($) { + "use strict"; + // use text for the numbers 2 through 4 + var smallNumbers = { + 2: function(masc) { return (masc ? "dva" : "dvě"); }, + 3: function() { return "tři"; }, + 4: function() { return "čtyři"; } + } + $.extend($.fn.select2.defaults, { + formatNoMatches: function () { return "Nenalezeny žádné položky"; }, + formatInputTooShort: function (input, min) { + var n = min - input.length; + if (n == 1) { + return "Prosím zadejte ještě jeden znak"; + } else if (n <= 4) { + return "Prosím zadejte ještě další "+smallNumbers[n](true)+" znaky"; + } else { + return "Prosím zadejte ještě dalších "+n+" znaků"; + } + }, + formatInputTooLong: function (input, max) { + var n = input.length - max; + if (n == 1) { + return "Prosím zadejte o jeden znak méně"; + } else if (n <= 4) { + return "Prosím zadejte o "+smallNumbers[n](true)+" znaky méně"; + } else { + return "Prosím zadejte o "+n+" znaků méně"; + } + }, + formatSelectionTooBig: function (limit) { + if (limit == 1) { + return "Můžete zvolit jen jednu položku"; + } else if (limit <= 4) { + return "Můžete zvolit maximálně "+smallNumbers[limit](false)+" položky"; + } else { + return "Můžete zvolit maximálně "+limit+" položek"; + } + }, + formatLoadMore: function (pageNumber) { return "Načítají se další výsledky…"; }, + formatSearching: function () { return "Vyhledávání…"; } + }); +})(jQuery); diff --git a/app/bower_components/select2/select2_locale_da.js b/app/bower_components/select2/select2_locale_da.js new file mode 100644 index 0000000..dbce3e1 --- /dev/null +++ b/app/bower_components/select2/select2_locale_da.js @@ -0,0 +1,17 @@ +/** + * Select2 Danish translation. + * + * Author: Anders Jenbo + */ +(function ($) { + "use strict"; + + $.extend($.fn.select2.defaults, { + formatNoMatches: function () { return "Ingen resultater fundet"; }, + formatInputTooShort: function (input, min) { var n = min - input.length; return "Angiv venligst " + n + " tegn mere"; }, + formatInputTooLong: function (input, max) { var n = input.length - max; return "Angiv venligst " + n + " tegn mindre"; }, + formatSelectionTooBig: function (limit) { return "Du kan kun vælge " + limit + " emne" + (limit === 1 ? "" : "r"); }, + formatLoadMore: function (pageNumber) { return "Indlæser flere resultater…"; }, + formatSearching: function () { return "Søger…"; } + }); +})(jQuery); diff --git a/app/bower_components/select2/select2_locale_de.js b/app/bower_components/select2/select2_locale_de.js new file mode 100644 index 0000000..93b18e8 --- /dev/null +++ b/app/bower_components/select2/select2_locale_de.js @@ -0,0 +1,15 @@ +/** + * Select2 German translation + */ +(function ($) { + "use strict"; + + $.extend($.fn.select2.defaults, { + formatNoMatches: function () { return "Keine Übereinstimmungen gefunden"; }, + formatInputTooShort: function (input, min) { var n = min - input.length; return "Bitte " + n + " Zeichen mehr eingeben"; }, + formatInputTooLong: function (input, max) { var n = input.length - max; return "Bitte " + n + " Zeichen weniger eingeben"; }, + formatSelectionTooBig: function (limit) { return "Sie können nur " + limit + " Eintr" + (limit === 1 ? "ag" : "äge") + " auswählen"; }, + formatLoadMore: function (pageNumber) { return "Lade mehr Ergebnisse…"; }, + formatSearching: function () { return "Suche…"; } + }); +})(jQuery); \ No newline at end of file diff --git a/app/bower_components/select2/select2_locale_el.js b/app/bower_components/select2/select2_locale_el.js new file mode 100644 index 0000000..e94b02c --- /dev/null +++ b/app/bower_components/select2/select2_locale_el.js @@ -0,0 +1,17 @@ +/** + * Select2 Greek translation. + * + * @author Uriy Efremochkin + */ +(function ($) { + "use strict"; + + $.extend($.fn.select2.defaults, { + formatNoMatches: function () { return "Δεν βρέθηκαν αποτελέσματα"; }, + formatInputTooShort: function (input, min) { var n = min - input.length; return "Παρακαλούμε εισάγετε " + n + " περισσότερο" + (n > 1 ? "υς" : "") + " χαρακτήρ" + (n > 1 ? "ες" : "α"); }, + formatInputTooLong: function (input, max) { var n = input.length - max; return "Παρακαλούμε διαγράψτε " + n + " χαρακτήρ" + (n > 1 ? "ες" : "α"); }, + formatSelectionTooBig: function (limit) { return "Μπορείτε να επιλέξετε μόνο " + limit + " αντικείμεν" + (limit > 1 ? "α" : "ο"); }, + formatLoadMore: function (pageNumber) { return "Φόρτωση περισσότερων…"; }, + formatSearching: function () { return "Αναζήτηση…"; } + }); +})(jQuery); \ No newline at end of file diff --git a/app/bower_components/select2/select2_locale_en.js.template b/app/bower_components/select2/select2_locale_en.js.template new file mode 100644 index 0000000..f66bcc8 --- /dev/null +++ b/app/bower_components/select2/select2_locale_en.js.template @@ -0,0 +1,18 @@ +/** + * Select2 translation. + * + * Author: Your Name + */ +(function ($) { + "use strict"; + + $.extend($.fn.select2.defaults, { + formatMatches: function (matches) { return matches + " results are available, use up and down arrow keys to navigate."; }, + formatNoMatches: function () { return "No matches found"; }, + formatInputTooShort: function (input, min) { var n = min - input.length; return "Please enter " + n + " more character" + (n == 1 ? "" : "s"); }, + formatInputTooLong: function (input, max) { var n = input.length - max; return "Please delete " + n + " character" + (n == 1 ? "" : "s"); }, + formatSelectionTooBig: function (limit) { return "You can only select " + limit + " item" + (limit == 1 ? "" : "s"); }, + formatLoadMore: function (pageNumber) { return "Loading more results…"; }, + formatSearching: function () { return "Searching…"; } + }); +})(jQuery); diff --git a/app/bower_components/select2/select2_locale_es.js b/app/bower_components/select2/select2_locale_es.js new file mode 100644 index 0000000..f2b5817 --- /dev/null +++ b/app/bower_components/select2/select2_locale_es.js @@ -0,0 +1,15 @@ +/** + * Select2 Spanish translation + */ +(function ($) { + "use strict"; + + $.extend($.fn.select2.defaults, { + formatNoMatches: function () { return "No se encontraron resultados"; }, + formatInputTooShort: function (input, min) { var n = min - input.length; return "Por favor, introduzca " + n + " car" + (n == 1? "ácter" : "acteres"); }, + formatInputTooLong: function (input, max) { var n = input.length - max; return "Por favor, elimine " + n + " car" + (n == 1? "ácter" : "acteres"); }, + formatSelectionTooBig: function (limit) { return "Sólo puede seleccionar " + limit + " elemento" + (limit == 1 ? "" : "s"); }, + formatLoadMore: function (pageNumber) { return "Cargando más resultados…"; }, + formatSearching: function () { return "Buscando…"; } + }); +})(jQuery); diff --git a/app/bower_components/select2/select2_locale_et.js b/app/bower_components/select2/select2_locale_et.js new file mode 100644 index 0000000..a4045d2 --- /dev/null +++ b/app/bower_components/select2/select2_locale_et.js @@ -0,0 +1,17 @@ +/** + * Select2 Estonian translation. + * + * Author: Kuldar Kalvik + */ +(function ($) { + "use strict"; + + $.extend($.fn.select2.defaults, { + formatNoMatches: function () { return "Tulemused puuduvad"; }, + formatInputTooShort: function (input, min) { var n = min - input.length; return "Sisesta " + n + " täht" + (n == 1 ? "" : "e") + " rohkem"; }, + formatInputTooLong: function (input, max) { var n = input.length - max; return "Sisesta " + n + " täht" + (n == 1? "" : "e") + " vähem"; }, + formatSelectionTooBig: function (limit) { return "Saad vaid " + limit + " tulemus" + (limit == 1 ? "e" : "t") + " valida"; }, + formatLoadMore: function (pageNumber) { return "Laen tulemusi.."; }, + formatSearching: function () { return "Otsin.."; } + }); +})(jQuery); diff --git a/app/bower_components/select2/select2_locale_eu.js b/app/bower_components/select2/select2_locale_eu.js new file mode 100644 index 0000000..1da1a70 --- /dev/null +++ b/app/bower_components/select2/select2_locale_eu.js @@ -0,0 +1,43 @@ +/** + * Select2 Basque translation. + * + * Author: Julen Ruiz Aizpuru + */ +(function ($) { + "use strict"; + + $.extend($.fn.select2.defaults, { + formatNoMatches: function () { + return "Ez da bat datorrenik aurkitu"; + }, + formatInputTooShort: function (input, min) { + var n = min - input.length; + if (n === 1) { + return "Idatzi karaktere bat gehiago"; + } else { + return "Idatzi " + n + " karaktere gehiago"; + } + }, + formatInputTooLong: function (input, max) { + var n = input.length - max; + if (n === 1) { + return "Idatzi karaktere bat gutxiago"; + } else { + return "Idatzi " + n + " karaktere gutxiago"; + } + }, + formatSelectionTooBig: function (limit) { + if (limit === 1 ) { + return "Elementu bakarra hauta dezakezu"; + } else { + return limit + " elementu hauta ditzakezu soilik"; + } + }, + formatLoadMore: function (pageNumber) { + return "Emaitza gehiago kargatzen…"; + }, + formatSearching: function () { + return "Bilatzen…"; + } + }); +})(jQuery); diff --git a/app/bower_components/select2/select2_locale_fa.js b/app/bower_components/select2/select2_locale_fa.js new file mode 100644 index 0000000..a9e95af --- /dev/null +++ b/app/bower_components/select2/select2_locale_fa.js @@ -0,0 +1,19 @@ +/** + * Select2 Persian translation. + * + * Author: Ali Choopan + * Author: Ebrahim Byagowi + */ +(function ($) { + "use strict"; + + $.extend($.fn.select2.defaults, { + formatMatches: function (matches) { return matches + " نتیجه موجود است، کلیدهای جهت بالا و پایین را برای گشتن استفاده کنید."; }, + formatNoMatches: function () { return "نتیجه‌ای یافت نشد."; }, + formatInputTooShort: function (input, min) { var n = min - input.length; return "لطفاً " + n + " نویسه بیشتر وارد نمایید"; }, + formatInputTooLong: function (input, max) { var n = input.length - max; return "لطفاً " + n + " نویسه را حذف کنید."; }, + formatSelectionTooBig: function (limit) { return "شما فقط می‌توانید " + limit + " مورد را انتخاب کنید"; }, + formatLoadMore: function (pageNumber) { return "در حال بارگیری موارد بیشتر…"; }, + formatSearching: function () { return "در حال جستجو…"; } + }); +})(jQuery); diff --git a/app/bower_components/select2/select2_locale_fi.js b/app/bower_components/select2/select2_locale_fi.js new file mode 100644 index 0000000..9bed310 --- /dev/null +++ b/app/bower_components/select2/select2_locale_fi.js @@ -0,0 +1,28 @@ +/** + * Select2 Finnish translation + */ +(function ($) { + "use strict"; + $.extend($.fn.select2.defaults, { + formatNoMatches: function () { + return "Ei tuloksia"; + }, + formatInputTooShort: function (input, min) { + var n = min - input.length; + return "Ole hyvä ja anna " + n + " merkkiä lisää"; + }, + formatInputTooLong: function (input, max) { + var n = input.length - max; + return "Ole hyvä ja anna " + n + " merkkiä vähemmän"; + }, + formatSelectionTooBig: function (limit) { + return "Voit valita ainoastaan " + limit + " kpl"; + }, + formatLoadMore: function (pageNumber) { + return "Ladataan lisää tuloksia…"; + }, + formatSearching: function () { + return "Etsitään…"; + } + }); +})(jQuery); diff --git a/app/bower_components/select2/select2_locale_fr.js b/app/bower_components/select2/select2_locale_fr.js new file mode 100644 index 0000000..9afda2a --- /dev/null +++ b/app/bower_components/select2/select2_locale_fr.js @@ -0,0 +1,16 @@ +/** + * Select2 French translation + */ +(function ($) { + "use strict"; + + $.extend($.fn.select2.defaults, { + formatMatches: function (matches) { return matches + " résultats sont disponibles, utilisez les flèches haut et bas pour naviguer."; }, + formatNoMatches: function () { return "Aucun résultat trouvé"; }, + formatInputTooShort: function (input, min) { var n = min - input.length; return "Merci de saisir " + n + " caractère" + (n == 1 ? "" : "s") + " de plus"; }, + formatInputTooLong: function (input, max) { var n = input.length - max; return "Merci de supprimer " + n + " caractère" + (n == 1 ? "" : "s"); }, + formatSelectionTooBig: function (limit) { return "Vous pouvez seulement sélectionner " + limit + " élément" + (limit == 1 ? "" : "s"); }, + formatLoadMore: function (pageNumber) { return "Chargement de résultats supplémentaires…"; }, + formatSearching: function () { return "Recherche en cours…"; } + }); +})(jQuery); diff --git a/app/bower_components/select2/select2_locale_gl.js b/app/bower_components/select2/select2_locale_gl.js new file mode 100644 index 0000000..8032632 --- /dev/null +++ b/app/bower_components/select2/select2_locale_gl.js @@ -0,0 +1,43 @@ +/** + * Select2 Galician translation + * + * Author: Leandro Regueiro + */ +(function ($) { + "use strict"; + + $.extend($.fn.select2.defaults, { + formatNoMatches: function () { + return "Non se atoparon resultados"; + }, + formatInputTooShort: function (input, min) { + var n = min - input.length; + if (n === 1) { + return "Engada un carácter"; + } else { + return "Engada " + n + " caracteres"; + } + }, + formatInputTooLong: function (input, max) { + var n = input.length - max; + if (n === 1) { + return "Elimine un carácter"; + } else { + return "Elimine " + n + " caracteres"; + } + }, + formatSelectionTooBig: function (limit) { + if (limit === 1 ) { + return "Só pode seleccionar un elemento"; + } else { + return "Só pode seleccionar " + limit + " elementos"; + } + }, + formatLoadMore: function (pageNumber) { + return "Cargando máis resultados…"; + }, + formatSearching: function () { + return "Buscando…"; + } + }); +})(jQuery); diff --git a/app/bower_components/select2/select2_locale_he.js b/app/bower_components/select2/select2_locale_he.js new file mode 100644 index 0000000..0038541 --- /dev/null +++ b/app/bower_components/select2/select2_locale_he.js @@ -0,0 +1,17 @@ +/** +* Select2 Hebrew translation. +* +* Author: Yakir Sitbon +*/ +(function ($) { + "use strict"; + + $.extend($.fn.select2.defaults, { + formatNoMatches: function () { return "לא נמצאו התאמות"; }, + formatInputTooShort: function (input, min) { var n = min - input.length; return "נא להזין עוד " + n + " תווים נוספים"; }, + formatInputTooLong: function (input, max) { var n = input.length - max; return "נא להזין פחות " + n + " תווים"; }, + formatSelectionTooBig: function (limit) { return "ניתן לבחור " + limit + " פריטים"; }, + formatLoadMore: function (pageNumber) { return "טוען תוצאות נוספות…"; }, + formatSearching: function () { return "מחפש…"; } + }); +})(jQuery); diff --git a/app/bower_components/select2/select2_locale_hr.js b/app/bower_components/select2/select2_locale_hr.js new file mode 100644 index 0000000..c293725 --- /dev/null +++ b/app/bower_components/select2/select2_locale_hr.js @@ -0,0 +1,22 @@ +/** + * Select2 Croatian translation. + * + * @author Edi Modrić + * @author Uriy Efremochkin + */ +(function ($) { + "use strict"; + + $.extend($.fn.select2.defaults, { + formatNoMatches: function () { return "Nema rezultata"; }, + formatInputTooShort: function (input, min) { return "Unesite još" + character(min - input.length); }, + formatInputTooLong: function (input, max) { return "Unesite" + character(input.length - max) + " manje"; }, + formatSelectionTooBig: function (limit) { return "Maksimalan broj odabranih stavki je " + limit; }, + formatLoadMore: function (pageNumber) { return "Učitavanje rezultata…"; }, + formatSearching: function () { return "Pretraga…"; } + }); + + function character (n) { + return " " + n + " znak" + (n%10 < 5 && n%10 > 0 && (n%100 < 5 || n%100 > 19) ? n%10 > 1 ? "a" : "" : "ova"); + } +})(jQuery); diff --git a/app/bower_components/select2/select2_locale_hu.js b/app/bower_components/select2/select2_locale_hu.js new file mode 100644 index 0000000..a8c3088 --- /dev/null +++ b/app/bower_components/select2/select2_locale_hu.js @@ -0,0 +1,15 @@ +/** + * Select2 Hungarian translation + */ +(function ($) { + "use strict"; + + $.extend($.fn.select2.defaults, { + formatNoMatches: function () { return "Nincs találat."; }, + formatInputTooShort: function (input, min) { var n = min - input.length; return "Túl rövid. Még " + n + " karakter hiányzik."; }, + formatInputTooLong: function (input, max) { var n = input.length - max; return "Túl hosszú. " + n + " karakterrel több, mint kellene."; }, + formatSelectionTooBig: function (limit) { return "Csak " + limit + " elemet lehet kiválasztani."; }, + formatLoadMore: function (pageNumber) { return "Töltés…"; }, + formatSearching: function () { return "Keresés…"; } + }); +})(jQuery); diff --git a/app/bower_components/select2/select2_locale_id.js b/app/bower_components/select2/select2_locale_id.js new file mode 100644 index 0000000..5474540 --- /dev/null +++ b/app/bower_components/select2/select2_locale_id.js @@ -0,0 +1,17 @@ +/** + * Select2 Indonesian translation. + * + * Author: Ibrahim Yusuf + */ +(function ($) { + "use strict"; + + $.extend($.fn.select2.defaults, { + formatNoMatches: function () { return "Tidak ada data yang sesuai"; }, + formatInputTooShort: function (input, min) { var n = min - input.length; return "Masukkan " + n + " huruf lagi" + (n == 1 ? "" : "s"); }, + formatInputTooLong: function (input, max) { var n = input.length - max; return "Hapus " + n + " huruf" + (n == 1 ? "" : "s"); }, + formatSelectionTooBig: function (limit) { return "Anda hanya dapat memilih " + limit + " pilihan" + (limit == 1 ? "" : "s"); }, + formatLoadMore: function (pageNumber) { return "Mengambil data…"; }, + formatSearching: function () { return "Mencari…"; } + }); +})(jQuery); diff --git a/app/bower_components/select2/select2_locale_is.js b/app/bower_components/select2/select2_locale_is.js new file mode 100644 index 0000000..aecc6cd --- /dev/null +++ b/app/bower_components/select2/select2_locale_is.js @@ -0,0 +1,15 @@ +/** + * Select2 Icelandic translation. + */ +(function ($) { + "use strict"; + + $.extend($.fn.select2.defaults, { + formatNoMatches: function () { return "Ekkert fannst"; }, + formatInputTooShort: function (input, min) { var n = min - input.length; return "Vinsamlegast skrifið " + n + " staf" + (n > 1 ? "i" : "") + " í viðbót"; }, + formatInputTooLong: function (input, max) { var n = input.length - max; return "Vinsamlegast styttið texta um " + n + " staf" + (n > 1 ? "i" : ""); }, + formatSelectionTooBig: function (limit) { return "Þú getur aðeins valið " + limit + " atriði"; }, + formatLoadMore: function (pageNumber) { return "Sæki fleiri niðurstöður…"; }, + formatSearching: function () { return "Leita…"; } + }); +})(jQuery); diff --git a/app/bower_components/select2/select2_locale_it.js b/app/bower_components/select2/select2_locale_it.js new file mode 100644 index 0000000..d4e24de --- /dev/null +++ b/app/bower_components/select2/select2_locale_it.js @@ -0,0 +1,15 @@ +/** + * Select2 Italian translation + */ +(function ($) { + "use strict"; + + $.extend($.fn.select2.defaults, { + formatNoMatches: function () { return "Nessuna corrispondenza trovata"; }, + formatInputTooShort: function (input, min) { var n = min - input.length; return "Inserisci ancora " + n + " caratter" + (n == 1? "e" : "i"); }, + formatInputTooLong: function (input, max) { var n = input.length - max; return "Inserisci " + n + " caratter" + (n == 1? "e" : "i") + " in meno"; }, + formatSelectionTooBig: function (limit) { return "Puoi selezionare solo " + limit + " element" + (limit == 1 ? "o" : "i"); }, + formatLoadMore: function (pageNumber) { return "Caricamento in corso…"; }, + formatSearching: function () { return "Ricerca…"; } + }); +})(jQuery); \ No newline at end of file diff --git a/app/bower_components/select2/select2_locale_ja.js b/app/bower_components/select2/select2_locale_ja.js new file mode 100644 index 0000000..81106e7 --- /dev/null +++ b/app/bower_components/select2/select2_locale_ja.js @@ -0,0 +1,15 @@ +/** + * Select2 Japanese translation. + */ +(function ($) { + "use strict"; + + $.extend($.fn.select2.defaults, { + formatNoMatches: function () { return "該当なし"; }, + formatInputTooShort: function (input, min) { var n = min - input.length; return "後" + n + "文字入れてください"; }, + formatInputTooLong: function (input, max) { var n = input.length - max; return "検索文字列が" + n + "文字長すぎます"; }, + formatSelectionTooBig: function (limit) { return "最多で" + limit + "項目までしか選択できません"; }, + formatLoadMore: function (pageNumber) { return "読込中・・・"; }, + formatSearching: function () { return "検索中・・・"; } + }); +})(jQuery); diff --git a/app/bower_components/select2/select2_locale_ka.js b/app/bower_components/select2/select2_locale_ka.js new file mode 100644 index 0000000..366cc2d --- /dev/null +++ b/app/bower_components/select2/select2_locale_ka.js @@ -0,0 +1,17 @@ +/** + * Select2 Georgian (Kartuli) translation. + * + * Author: Dimitri Kurashvili dimakura@gmail.com + */ +(function ($) { + "use strict"; + + $.extend($.fn.select2.defaults, { + formatNoMatches: function () { return "ვერ მოიძებნა"; }, + formatInputTooShort: function (input, min) { var n = min - input.length; return "გთხოვთ შეიყვანოთ კიდევ " + n + " სიმბოლო"; }, + formatInputTooLong: function (input, max) { var n = input.length - max; return "გთხოვთ წაშალოთ " + n + " სიმბოლო"; }, + formatSelectionTooBig: function (limit) { return "თქვენ შეგიძლიათ მხოლოდ " + limit + " ჩანაწერის მონიშვნა"; }, + formatLoadMore: function (pageNumber) { return "შედეგის ჩატვირთვა…"; }, + formatSearching: function () { return "ძებნა…"; } + }); +})(jQuery); diff --git a/app/bower_components/select2/select2_locale_ko.js b/app/bower_components/select2/select2_locale_ko.js new file mode 100644 index 0000000..1a84d21 --- /dev/null +++ b/app/bower_components/select2/select2_locale_ko.js @@ -0,0 +1,17 @@ +/** + * Select2 Korean translation. + * + * @author Swen Mun + */ +(function ($) { + "use strict"; + + $.extend($.fn.select2.defaults, { + formatNoMatches: function () { return "결과 없음"; }, + formatInputTooShort: function (input, min) { var n = min - input.length; return "너무 짧습니다. "+n+"글자 더 입력해주세요."; }, + formatInputTooLong: function (input, max) { var n = input.length - max; return "너무 깁니다. "+n+"글자 지워주세요."; }, + formatSelectionTooBig: function (limit) { return "최대 "+limit+"개까지만 선택하실 수 있습니다."; }, + formatLoadMore: function (pageNumber) { return "불러오는 중…"; }, + formatSearching: function () { return "검색 중…"; } + }); +})(jQuery); diff --git a/app/bower_components/select2/select2_locale_lt.js b/app/bower_components/select2/select2_locale_lt.js new file mode 100644 index 0000000..2e2f950 --- /dev/null +++ b/app/bower_components/select2/select2_locale_lt.js @@ -0,0 +1,24 @@ +/** + * Select2 Lithuanian translation. + * + * @author CRONUS Karmalakas + * @author Uriy Efremochkin + */ +(function ($) { + "use strict"; + + $.extend($.fn.select2.defaults, { + formatNoMatches: function () { return "Atitikmenų nerasta"; }, + formatInputTooShort: function (input, min) { return "Įrašykite dar" + character(min - input.length); }, + formatInputTooLong: function (input, max) { return "Pašalinkite" + character(input.length - max); }, + formatSelectionTooBig: function (limit) { + return "Jūs galite pasirinkti tik " + limit + " element" + ((limit%100 > 9 && limit%100 < 21) || limit%10 == 0 ? "ų" : limit%10 > 1 ? "us" : "ą"); + }, + formatLoadMore: function (pageNumber) { return "Kraunama daugiau rezultatų…"; }, + formatSearching: function () { return "Ieškoma…"; } + }); + + function character (n) { + return " " + n + " simbol" + ((n%100 > 9 && n%100 < 21) || n%10 == 0 ? "ių" : n%10 > 1 ? "ius" : "į"); + } +})(jQuery); diff --git a/app/bower_components/select2/select2_locale_lv.js b/app/bower_components/select2/select2_locale_lv.js new file mode 100644 index 0000000..b300ec7 --- /dev/null +++ b/app/bower_components/select2/select2_locale_lv.js @@ -0,0 +1,17 @@ +/** + * Select2 Latvian translation. + * + * @author Uriy Efremochkin + */ +(function ($) { + "use strict"; + + $.extend($.fn.select2.defaults, { + formatNoMatches: function () { return "Sakritību nav"; }, + formatInputTooShort: function (input, min) { var n = min - input.length; return "Lūdzu ievadiet vēl " + n + " simbol" + (n == 11 ? "us" : n%10 == 1 ? "u" : "us"); }, + formatInputTooLong: function (input, max) { var n = input.length - max; return "Lūdzu ievadiet par " + n + " simbol" + (n == 11 ? "iem" : n%10 == 1 ? "u" : "iem") + " mazāk"; }, + formatSelectionTooBig: function (limit) { return "Jūs varat izvēlēties ne vairāk kā " + limit + " element" + (limit == 11 ? "us" : limit%10 == 1 ? "u" : "us"); }, + formatLoadMore: function (pageNumber) { return "Datu ielāde…"; }, + formatSearching: function () { return "Meklēšana…"; } + }); +})(jQuery); diff --git a/app/bower_components/select2/select2_locale_mk.js b/app/bower_components/select2/select2_locale_mk.js new file mode 100644 index 0000000..513562c --- /dev/null +++ b/app/bower_components/select2/select2_locale_mk.js @@ -0,0 +1,17 @@ +/** + * Select2 Macedonian translation. + * + * Author: Marko Aleksic + */ +(function ($) { + "use strict"; + + $.extend($.fn.select2.defaults, { + formatNoMatches: function () { return "Нема пронајдено совпаѓања"; }, + formatInputTooShort: function (input, min) { var n = min - input.length; return "Ве молиме внесете уште " + n + " карактер" + (n == 1 ? "" : "и"); }, + formatInputTooLong: function (input, max) { var n = input.length - max; return "Ве молиме внесете " + n + " помалку карактер" + (n == 1? "" : "и"); }, + formatSelectionTooBig: function (limit) { return "Можете да изберете само " + limit + " ставк" + (limit == 1 ? "а" : "и"); }, + formatLoadMore: function (pageNumber) { return "Вчитување резултати…"; }, + formatSearching: function () { return "Пребарување…"; } + }); +})(jQuery); \ No newline at end of file diff --git a/app/bower_components/select2/select2_locale_ms.js b/app/bower_components/select2/select2_locale_ms.js new file mode 100644 index 0000000..262042a --- /dev/null +++ b/app/bower_components/select2/select2_locale_ms.js @@ -0,0 +1,17 @@ +/** + * Select2 Malay translation. + * + * Author: Kepoweran + */ +(function ($) { + "use strict"; + + $.extend($.fn.select2.defaults, { + formatNoMatches: function () { return "Tiada padanan yang ditemui"; }, + formatInputTooShort: function (input, min) { var n = min - input.length; return "Sila masukkan " + n + " aksara lagi"; }, + formatInputTooLong: function (input, max) { var n = input.length - max; return "Sila hapuskan " + n + " aksara"; }, + formatSelectionTooBig: function (limit) { return "Anda hanya boleh memilih " + limit + " pilihan"; }, + formatLoadMore: function (pageNumber) { return "Sedang memuatkan keputusan…"; }, + formatSearching: function () { return "Mencari…"; } + }); +})(jQuery); diff --git a/app/bower_components/select2/select2_locale_nl.js b/app/bower_components/select2/select2_locale_nl.js new file mode 100644 index 0000000..5b5c415 --- /dev/null +++ b/app/bower_components/select2/select2_locale_nl.js @@ -0,0 +1,15 @@ +/** + * Select2 Dutch translation + */ +(function ($) { + "use strict"; + + $.extend($.fn.select2.defaults, { + formatNoMatches: function () { return "Geen resultaten gevonden"; }, + formatInputTooShort: function (input, min) { var n = min - input.length; return "Vul " + n + " karakter" + (n == 1? "" : "s") + " meer in"; }, + formatInputTooLong: function (input, max) { var n = input.length - max; return "Vul " + n + " karakter" + (n == 1? "" : "s") + " minder in"; }, + formatSelectionTooBig: function (limit) { return "Maximaal " + limit + " item" + (limit == 1 ? "" : "s") + " toegestaan"; }, + formatLoadMore: function (pageNumber) { return "Meer resultaten laden…"; }, + formatSearching: function () { return "Zoeken…"; } + }); +})(jQuery); \ No newline at end of file diff --git a/app/bower_components/select2/select2_locale_no.js b/app/bower_components/select2/select2_locale_no.js new file mode 100644 index 0000000..ab61c08 --- /dev/null +++ b/app/bower_components/select2/select2_locale_no.js @@ -0,0 +1,18 @@ +/** + * Select2 Norwegian translation. + * + * Author: Torgeir Veimo + */ +(function ($) { + "use strict"; + + $.extend($.fn.select2.defaults, { + formatNoMatches: function () { return "Ingen treff"; }, + formatInputTooShort: function (input, min) { var n = min - input.length; return "Vennligst skriv inn " + n + (n>1 ? " flere tegn" : " tegn til"); }, + formatInputTooLong: function (input, max) { var n = input.length - max; return "Vennligst fjern " + n + " tegn"; }, + formatSelectionTooBig: function (limit) { return "Du kan velge maks " + limit + " elementer"; }, + formatLoadMore: function (pageNumber) { return "Laster flere resultater…"; }, + formatSearching: function () { return "Søker…"; } + }); +})(jQuery); + diff --git a/app/bower_components/select2/select2_locale_pl.js b/app/bower_components/select2/select2_locale_pl.js new file mode 100644 index 0000000..75054e7 --- /dev/null +++ b/app/bower_components/select2/select2_locale_pl.js @@ -0,0 +1,22 @@ +/** + * Select2 Polish translation. + * + * @author Jan Kondratowicz + * @author Uriy Efremochkin + */ +(function ($) { + "use strict"; + + $.extend($.fn.select2.defaults, { + formatNoMatches: function () { return "Brak wyników"; }, + formatInputTooShort: function (input, min) { return "Wpisz jeszcze" + character(min - input.length, "znak", "i"); }, + formatInputTooLong: function (input, max) { return "Wpisana fraza jest za długa o" + character(input.length - max, "znak", "i"); }, + formatSelectionTooBig: function (limit) { return "Możesz zaznaczyć najwyżej" + character(limit, "element", "y"); }, + formatLoadMore: function (pageNumber) { return "Ładowanie wyników…"; }, + formatSearching: function () { return "Szukanie…"; } + }); + + function character (n, word, pluralSuffix) { + return " " + n + " " + word + (n == 1 ? "" : n%10 < 5 && n%10 > 1 && (n%100 < 5 || n%100 > 20) ? pluralSuffix : "ów"); + } +})(jQuery); diff --git a/app/bower_components/select2/select2_locale_pt-BR.js b/app/bower_components/select2/select2_locale_pt-BR.js new file mode 100644 index 0000000..ac4969a --- /dev/null +++ b/app/bower_components/select2/select2_locale_pt-BR.js @@ -0,0 +1,15 @@ +/** + * Select2 Brazilian Portuguese translation + */ +(function ($) { + "use strict"; + + $.extend($.fn.select2.defaults, { + formatNoMatches: function () { return "Nenhum resultado encontrado"; }, + formatInputTooShort: function (input, min) { var n = min - input.length; return "Digite mais " + n + " caracter" + (n == 1? "" : "es"); }, + formatInputTooLong: function (input, max) { var n = input.length - max; return "Apague " + n + " caracter" + (n == 1? "" : "es"); }, + formatSelectionTooBig: function (limit) { return "Só é possível selecionar " + limit + " elemento" + (limit == 1 ? "" : "s"); }, + formatLoadMore: function (pageNumber) { return "Carregando mais resultados…"; }, + formatSearching: function () { return "Buscando…"; } + }); +})(jQuery); diff --git a/app/bower_components/select2/select2_locale_pt-PT.js b/app/bower_components/select2/select2_locale_pt-PT.js new file mode 100644 index 0000000..cced7cf --- /dev/null +++ b/app/bower_components/select2/select2_locale_pt-PT.js @@ -0,0 +1,15 @@ +/** + * Select2 Portuguese (Portugal) translation + */ +(function ($) { + "use strict"; + + $.extend($.fn.select2.defaults, { + formatNoMatches: function () { return "Nenhum resultado encontrado"; }, + formatInputTooShort: function (input, min) { var n = min - input.length; return "Introduza " + n + " car" + (n == 1 ? "ácter" : "acteres"); }, + formatInputTooLong: function (input, max) { var n = input.length - max; return "Apague " + n + " car" + (n == 1 ? "ácter" : "acteres"); }, + formatSelectionTooBig: function (limit) { return "Só é possível selecionar " + limit + " elemento" + (limit == 1 ? "" : "s"); }, + formatLoadMore: function (pageNumber) { return "A carregar mais resultados…"; }, + formatSearching: function () { return "A pesquisar…"; } + }); +})(jQuery); diff --git a/app/bower_components/select2/select2_locale_ro.js b/app/bower_components/select2/select2_locale_ro.js new file mode 100644 index 0000000..87eca4c --- /dev/null +++ b/app/bower_components/select2/select2_locale_ro.js @@ -0,0 +1,15 @@ +/** + * Select2 Romanian translation. + */ +(function ($) { + "use strict"; + + $.extend($.fn.select2.defaults, { + formatNoMatches: function () { return "Nu a fost găsit nimic"; }, + formatInputTooShort: function (input, min) { var n = min - input.length; return "Vă rugăm să introduceți incă " + n + " caracter" + (n == 1 ? "" : "e"); }, + formatInputTooLong: function (input, max) { var n = input.length - max; return "Vă rugăm să introduceți mai puțin de " + n + " caracter" + (n == 1? "" : "e"); }, + formatSelectionTooBig: function (limit) { return "Aveți voie să selectați cel mult " + limit + " element" + (limit == 1 ? "" : "e"); }, + formatLoadMore: function (pageNumber) { return "Se încarcă…"; }, + formatSearching: function () { return "Căutare…"; } + }); +})(jQuery); diff --git a/app/bower_components/select2/select2_locale_rs.js b/app/bower_components/select2/select2_locale_rs.js new file mode 100644 index 0000000..300c01b --- /dev/null +++ b/app/bower_components/select2/select2_locale_rs.js @@ -0,0 +1,17 @@ +/** + * Select2 Serbian translation. + * + * @author Limon Monte + */ +(function ($) { + "use strict"; + + $.extend($.fn.select2.defaults, { + formatNoMatches: function () { return "Ništa nije pronađeno"; }, + formatInputTooShort: function (input, min) { var n = min - input.length; return "Ukucajte bar još " + n + " simbol" + (n % 10 == 1 && n % 100 != 11 ? "" : "a"); }, + formatInputTooLong: function (input, max) { var n = input.length - max; return "Obrišite " + n + " simbol" + (n % 10 == 1 && n % 100 != 11 ? "" : "a"); }, + formatSelectionTooBig: function (limit) { return "Možete izabrati samo " + limit + " stavk" + (limit % 10 == 1 && limit % 100 != 11 ? "u" : (limit % 10 >= 2 && limit % 10 <= 4 && (limit % 100 < 12 || limit % 100 > 14)? "e" : "i")); }, + formatLoadMore: function (pageNumber) { return "Preuzimanje još rezultata…"; }, + formatSearching: function () { return "Pretraga…"; } + }); +})(jQuery); diff --git a/app/bower_components/select2/select2_locale_ru.js b/app/bower_components/select2/select2_locale_ru.js new file mode 100644 index 0000000..0f45ce0 --- /dev/null +++ b/app/bower_components/select2/select2_locale_ru.js @@ -0,0 +1,21 @@ +/** + * Select2 Russian translation. + * + * @author Uriy Efremochkin + */ +(function ($) { + "use strict"; + + $.extend($.fn.select2.defaults, { + formatNoMatches: function () { return "Совпадений не найдено"; }, + formatInputTooShort: function (input, min) { return "Пожалуйста, введите еще" + character(min - input.length); }, + formatInputTooLong: function (input, max) { return "Пожалуйста, введите на" + character(input.length - max) + " меньше"; }, + formatSelectionTooBig: function (limit) { return "Вы можете выбрать не более " + limit + " элемент" + (limit%10 == 1 && limit%100 != 11 ? "а" : "ов"); }, + formatLoadMore: function (pageNumber) { return "Загрузка данных…"; }, + formatSearching: function () { return "Поиск…"; } + }); + + function character (n) { + return " " + n + " символ" + (n%10 < 5 && n%10 > 0 && (n%100 < 5 || n%100 > 20) ? n%10 > 1 ? "a" : "" : "ов"); + } +})(jQuery); diff --git a/app/bower_components/select2/select2_locale_sk.js b/app/bower_components/select2/select2_locale_sk.js new file mode 100644 index 0000000..772f304 --- /dev/null +++ b/app/bower_components/select2/select2_locale_sk.js @@ -0,0 +1,48 @@ +/** + * Select2 Slovak translation. + * + * Author: David Vallner + */ +(function ($) { + "use strict"; + // use text for the numbers 2 through 4 + var smallNumbers = { + 2: function(masc) { return (masc ? "dva" : "dve"); }, + 3: function() { return "tri"; }, + 4: function() { return "štyri"; } + } + $.extend($.fn.select2.defaults, { + formatNoMatches: function () { return "Nenašli sa žiadne položky"; }, + formatInputTooShort: function (input, min) { + var n = min - input.length; + if (n == 1) { + return "Prosím zadajte ešte jeden znak"; + } else if (n <= 4) { + return "Prosím zadajte ešte ďalšie "+smallNumbers[n](true)+" znaky"; + } else { + return "Prosím zadajte ešte ďalších "+n+" znakov"; + } + }, + formatInputTooLong: function (input, max) { + var n = input.length - max; + if (n == 1) { + return "Prosím zadajte o jeden znak menej"; + } else if (n <= 4) { + return "Prosím zadajte o "+smallNumbers[n](true)+" znaky menej"; + } else { + return "Prosím zadajte o "+n+" znakov menej"; + } + }, + formatSelectionTooBig: function (limit) { + if (limit == 1) { + return "Môžete zvoliť len jednu položku"; + } else if (limit <= 4) { + return "Môžete zvoliť najviac "+smallNumbers[limit](false)+" položky"; + } else { + return "Môžete zvoliť najviac "+limit+" položiek"; + } + }, + formatLoadMore: function (pageNumber) { return "Načítavajú sa ďalšie výsledky…"; }, + formatSearching: function () { return "Vyhľadávanie…"; } + }); +})(jQuery); diff --git a/app/bower_components/select2/select2_locale_sv.js b/app/bower_components/select2/select2_locale_sv.js new file mode 100644 index 0000000..d611189 --- /dev/null +++ b/app/bower_components/select2/select2_locale_sv.js @@ -0,0 +1,17 @@ +/** + * Select2 Swedish translation. + * + * Author: Jens Rantil + */ +(function ($) { + "use strict"; + + $.extend($.fn.select2.defaults, { + formatNoMatches: function () { return "Inga träffar"; }, + formatInputTooShort: function (input, min) { var n = min - input.length; return "Var god skriv in " + n + (n>1 ? " till tecken" : " tecken till"); }, + formatInputTooLong: function (input, max) { var n = input.length - max; return "Var god sudda ut " + n + " tecken"; }, + formatSelectionTooBig: function (limit) { return "Du kan max välja " + limit + " element"; }, + formatLoadMore: function (pageNumber) { return "Laddar fler resultat…"; }, + formatSearching: function () { return "Söker…"; } + }); +})(jQuery); diff --git a/app/bower_components/select2/select2_locale_th.js b/app/bower_components/select2/select2_locale_th.js new file mode 100644 index 0000000..df59bda --- /dev/null +++ b/app/bower_components/select2/select2_locale_th.js @@ -0,0 +1,17 @@ +/** + * Select2 Thai translation. + * + * Author: Atsawin Chaowanakritsanakul + */ +(function ($) { + "use strict"; + + $.extend($.fn.select2.defaults, { + formatNoMatches: function () { return "ไม่พบข้อมูล"; }, + formatInputTooShort: function (input, min) { var n = min - input.length; return "โปรดพิมพ์เพิ่มอีก " + n + " ตัวอักษร"; }, + formatInputTooLong: function (input, max) { var n = input.length - max; return "โปรดลบออก " + n + " ตัวอักษร"; }, + formatSelectionTooBig: function (limit) { return "คุณสามารถเลือกได้ไม่เกิน " + limit + " รายการ"; }, + formatLoadMore: function (pageNumber) { return "กำลังค้นข้อมูลเพิ่ม…"; }, + formatSearching: function () { return "กำลังค้นข้อมูล…"; } + }); +})(jQuery); diff --git a/app/bower_components/select2/select2_locale_tr.js b/app/bower_components/select2/select2_locale_tr.js new file mode 100644 index 0000000..f834dad --- /dev/null +++ b/app/bower_components/select2/select2_locale_tr.js @@ -0,0 +1,17 @@ +/** + * Select2 Turkish translation. + * + * Author: Salim KAYABAŞI + */ +(function ($) { + "use strict"; + + $.extend($.fn.select2.defaults, { + formatNoMatches: function () { return "Sonuç bulunamadı"; }, + formatInputTooShort: function (input, min) { var n = min - input.length; return "En az " + n + " karakter daha girmelisiniz"; }, + formatInputTooLong: function (input, max) { var n = input.length - max; return n + " karakter azaltmalısınız"; }, + formatSelectionTooBig: function (limit) { return "Sadece " + limit + " seçim yapabilirsiniz"; }, + formatLoadMore: function (pageNumber) { return "Daha fazla…"; }, + formatSearching: function () { return "Aranıyor…"; } + }); +})(jQuery); diff --git a/app/bower_components/select2/select2_locale_uk.js b/app/bower_components/select2/select2_locale_uk.js new file mode 100644 index 0000000..8d31a05 --- /dev/null +++ b/app/bower_components/select2/select2_locale_uk.js @@ -0,0 +1,23 @@ +/** + * Select2 Ukrainian translation. + * + * @author bigmihail + * @author Uriy Efremochkin + */ +(function ($) { + "use strict"; + + $.extend($.fn.select2.defaults, { + formatMatches: function (matches) { return character(matches, "результат") + " знайдено, використовуйте клавіші зі стрілками вверх та вниз для навігації."; }, + formatNoMatches: function () { return "Нічого не знайдено"; }, + formatInputTooShort: function (input, min) { return "Введіть буль ласка ще " + character(min - input.length, "символ"); }, + formatInputTooLong: function (input, max) { return "Введіть буль ласка на " + character(input.length - max, "символ") + " менше"; }, + formatSelectionTooBig: function (limit) { return "Ви можете вибрати лише " + character(limit, "елемент"); }, + formatLoadMore: function (pageNumber) { return "Завантаження даних…"; }, + formatSearching: function () { return "Пошук…"; } + }); + + function character (n, word) { + return n + " " + word + (n%10 < 5 && n%10 > 0 && (n%100 < 5 || n%100 > 19) ? n%10 > 1 ? "и" : "" : "ів"); + } +})(jQuery); diff --git a/app/bower_components/select2/select2_locale_vi.js b/app/bower_components/select2/select2_locale_vi.js new file mode 100644 index 0000000..5dbc275 --- /dev/null +++ b/app/bower_components/select2/select2_locale_vi.js @@ -0,0 +1,18 @@ +/** + * Select2 Vietnamese translation. + * + * Author: Long Nguyen + */ +(function ($) { + "use strict"; + + $.extend($.fn.select2.defaults, { + formatNoMatches: function () { return "Không tìm thấy kết quả"; }, + formatInputTooShort: function (input, min) { var n = min - input.length; return "Vui lòng nhập nhiều hơn " + n + " ký tự" + (n == 1 ? "" : "s"); }, + formatInputTooLong: function (input, max) { var n = input.length - max; return "Vui lòng nhập ít hơn " + n + " ký tự" + (n == 1? "" : "s"); }, + formatSelectionTooBig: function (limit) { return "Chỉ có thể chọn được " + limit + " tùy chọn" + (limit == 1 ? "" : "s"); }, + formatLoadMore: function (pageNumber) { return "Đang lấy thêm kết quả…"; }, + formatSearching: function () { return "Đang tìm…"; } + }); +})(jQuery); + diff --git a/app/bower_components/select2/select2_locale_zh-CN.js b/app/bower_components/select2/select2_locale_zh-CN.js new file mode 100644 index 0000000..6add3c5 --- /dev/null +++ b/app/bower_components/select2/select2_locale_zh-CN.js @@ -0,0 +1,14 @@ +/** + * Select2 Chinese translation + */ +(function ($) { + "use strict"; + $.extend($.fn.select2.defaults, { + formatNoMatches: function () { return "没有找到匹配项"; }, + formatInputTooShort: function (input, min) { var n = min - input.length; return "请再输入" + n + "个字符";}, + formatInputTooLong: function (input, max) { var n = input.length - max; return "请删掉" + n + "个字符";}, + formatSelectionTooBig: function (limit) { return "你只能选择最多" + limit + "项"; }, + formatLoadMore: function (pageNumber) { return "加载结果中…"; }, + formatSearching: function () { return "搜索中…"; } + }); +})(jQuery); diff --git a/app/bower_components/select2/select2_locale_zh-TW.js b/app/bower_components/select2/select2_locale_zh-TW.js new file mode 100755 index 0000000..f072381 --- /dev/null +++ b/app/bower_components/select2/select2_locale_zh-TW.js @@ -0,0 +1,14 @@ +/** + * Select2 Traditional Chinese translation + */ +(function ($) { + "use strict"; + $.extend($.fn.select2.defaults, { + formatNoMatches: function () { return "沒有找到相符的項目"; }, + formatInputTooShort: function (input, min) { var n = min - input.length; return "請再輸入" + n + "個字元";}, + formatInputTooLong: function (input, max) { var n = input.length - max; return "請刪掉" + n + "個字元";}, + formatSelectionTooBig: function (limit) { return "你只能選擇最多" + limit + "項"; }, + formatLoadMore: function (pageNumber) { return "載入中…"; }, + formatSearching: function () { return "搜尋中…"; } + }); +})(jQuery); diff --git a/app/bower_components/select2/select2x2.png b/app/bower_components/select2/select2x2.png new file mode 100644 index 0000000000000000000000000000000000000000..4bdd5c961d452c49dfa0789c2c7ffb82c238fc24 GIT binary patch literal 845 zcmV-T1G4;yP)upQ6WKflyv?C|ADVW!U!t`EpA+x zB)5#EjWk-_X77YJZtQo`E0SF)^1bZr%)B7Cd`*OK*r z5WG-7e-R9G9^69ksDt29&oyHqxPSt|-S>xi3%PTd+GjY+BGF|nWC(7D-sd(kxqd9~ zS@2YF5vB+>dP8+$l^{oO3-lEWiGA*QIU)Wds#9M6RZ9N zcQ4y4)xqQOxD=vwu%7cz1nY#$lT&y8HCmkWgpwQP#3dhnYj9|2aS_R}IUF_^6s#$= zTm%~>A#oM?KIg$kh=<`gJkeoHa2LrulVy$Yx+N_0R3$4I!R*0677f(FKqm`2_o4~W z0h}fQZ`lC^1A+m;fM7uI(R1`S0KtG@KrkQ}5DW+&@cTnDVIow56KciMk7a899t0bC zC1KI{TsMe5NAR%GD_5`B-@ad4k~K3SO%H z_M31|`HV?E6)u$E3c&*<*n20+V@mRCop>R5;DWuZCmjSo7p@R&OYl^@GCe)V?bnhaO%#TM?ls!4s@hFEulXK7W#`rlKUgF-Qa1d zn}0)}bl9wCi&eATbyC0Ky=|(hZjURX)9dtEV{UraKk(kYUuDusD$HOY7zhS}fnea< z4B*Tb89x|?4hDjOVBm`Z*&h;`V0J8qx^+Nl2>_I9vQ0;uLk9!FK%aqo>rUkSf59&^SmgIZq8AJV z1OJQx9#xBKj*s%Q_3HEFtW9WdXd>cQ#DKu=T>{XNedI|eZ9a(&zwB5HWfd9Ma9~^n Ml#o!tz%MXx215-po&W#< literal 0 HcmV?d00001 diff --git a/app/images/illustrations/.DS_Store b/app/images/illustrations/.DS_Store new file mode 100644 index 0000000000000000000000000000000000000000..5008ddfcf53c02e82d7eee2e57c38e5672ef89f6 GIT binary patch literal 6148 zcmeH~Jr2S!425mzP>H1@V-^m;4Wg<&0T*E43hX&L&p$$qDprKhvt+--jT7}7np#A3 zem<@ulZcFPQ@L2!n>{z**++&mCkOWA81W14cNZlEfg7;MkzE(HCqgga^y>{tEnwC%0;vJ&^%eQ zLs35+`xjp>T0z|_Hx#rPi@77she4{itu zArTKpV^bRdkjw;NVP!8&ao*NNL1twpOrgcCz^33R4zRS6@p1;Jc`2%!dfAxrn^A~- zArtZt_yDj20FB8!>}>5_1U!T({)H>>asN*YqHb}}9w7IrRf9v*fkG7dI&4pz30orjs7OMsh4fPRE_Y0hTm0;&>H|0C<; zNtnVC2y_%+Wp#IVXL09bad5U^W#{MT{|AGEgZYDk*~QZyXzamk??U-+1POqPsk4>os969-qIFvW+a|JwvR$N#|EyZlc#eRLSBhp{6oI}6)CCjFaGLE-;TYG?N! zY8Rj?;Q#3R{{(hX_jClXssdabT%Aon9A{4Xk0?h0ac6)r(7{>V!NK<5y{K&I0CaG% zbZ{gSSK}e0Q!qBQvj3-n{$Csl3IekBE>J= zZU8eWX9qj7e;F-c_1|@o_^){X!)x|mb>Wfxue_`u%CP?9+W*Vd|8Dw-pMP%u6SyA_ z{|SA7{YShze+2fF-LG5-2;LW22{Cn#Pgr zbiOMyMd0+KsltphxUGSeC2E6Nf@Ej|ZYank6`;ry3}k2lXa1co2Q)JQNAxa}*F-dC z9PZ{5p6BlCHOK{YU;R_k(vVJja>o;G70p~QvixkzUHvHzi%YX^ZRZcik$7Ad^~U$L z$jQlFl?PzM?K^rGeS*g6ZQ-=NV+RJLW)~Jly$exv5KN623&&S6?rXy*<8t`|`CSgS z)3O{i1FCqrMlc&?m1pRmraq6RZS}@~`Km7tefM{zgeiuiZiTCK2mf~QdKH;f!eOxy zQKu^H{mT~?#l%IV+7+hKU~6mZCPn|FB7>|Z+pX1Q50O+2)lwNKm^L4nDwN*nyf%FI zs{Gg@)v|0sWMmXVdij(e(qbBO*pC9?&HsvcT$m)aBCaCUe(>Om3VWV0){HItZ+62{ zgCT1*7*Gh7Q@{5mXl zs1L*0aS#y@ln)~)>U60~rQ0v(bw{gU!Bn-9>gwv7Ifz);3T z#KX}Cb-#&>UD`T0I5ZzDA=T=7VB_HQ%X{8T-3WW%yET5Ey;5cuaDLu+Kb!B?r2k{B zqDXvmwfd`z4|7(aj``X))ReJzFYoTfWT}4dT^C%QE-r>TEKt8O?%DKJQU`AK_q^Ro zn$X*BvU^g&;h`{@XVsMDYNiDvW*h9l9kJlPFuz@3wY@kokXZq#umWmFLZO!o9u7U zb|+pHoZ63UUriWZ$AGyax%2qhu-$lk8GQZ=X_jb;0Y}QvDO9(**<{cSwG`g>ah%tX zhli(Jck}Psm5gR-MDpP1_5Q6+t>u&y+_7W214|)AVq&7btTeWfpp(z@n){`a$o(o> zG2KA(DjG6UZR%Ew)5FD9p8vY<{rt$thynAj0kb|@Y&H%KPTvy6tfu<% z@)2|8nbG58n4co(2>|8sMsk1uMEVdOy&=?{2As&hn~APhpuyd6(zmm|NG#q(lM0%B zWqoExp@BhOlf|Lr!)4gT<_&m}cWmTXsSq8z@mm-eczAKhCJtK?NlD4y(CEUAyWKs( z?#q~q61pmy40+$~;o8|=vEk5RDWI}Wc)KnkFOE;uAD$uwj&1o{aEusxi^T#J96GKi z1`U~Xd4_S7ZI-@Gq$0N*%?q_($>Esv{@69|a`~@!;u1Zlx#X9!W4fngayzeM$w{8m4e=?fp`O!dg=E9Z(19)f+j*fTiD|<#r zK?~Y)(ue9_++JFA|3-h6JcYSM7kT6JpC4rvVSygfk*q6Cn2PT@Fx{d}<*R|W7DFGq zx-e=efWz|!U^*+>Z0-RbpA)@bfldK}EDo9lsMW6Mi>5>C&k3CQhvErp%VbS$+ z6-264P2><=Ad|_nGyZ{a&kd2*vdEsmX-& zq9<{4zsgmby(WnL9W_Vny);$Z{*?-@74igE$1;r+~41cIsFPS(30yF-jBqZRuc4+p>>(+q- zzoKl<>)+;$<+*j>=`7;Oe3f_#c1{Jv%Jk)ol1Qw#-$2YgBLhRy>987=)?=ZP`DS1n zXukhRng%TF=f`s~{`pc*btcaP!)ts1+?_|_#T%j6N?WpTx`KOxEwjB;Qs1!B-?{2` zQuT25e9m8s6KPkpXZjup?I3hHtEM!|c}c&l^O_R5w`~H+yQ&(IUi{78`IS+H`$Q=X zinKjDDnYpy4};;S*LDjl!BPc`Fq)W%v_vf- zj1iR16>x(TWD|Xjk5x{M zmtrzF3*G;&qk40U44a6p_bjZBe63MeLzcn8T8kILj^!+wLqPj9K8*xrFB=KZz!;bi zU~ZH=dp;fe%A!8%KoX17CWEw_vAWt+LRDN$!O4hBLP8SN*97$k6gqC|GP0^=s8OZe zhI^MLo7Y_|U2MLY#y*~;W8jD+mVF0R>l;m~h0EHPI!EwHGSu2E7mC7Lj>R2+u?$gE zX9LN09j}kmrV<}}K)__NmZw4FNVi$%l^`_>dO3U?eldQ~+Qx>|^X~CLW25Ffq<48P zCUYs>XEq}v<{ZDUsZV$WaYtxg?^s5cB}w%jbz+!V)vk`YW|&+}F(`Q7L&Ch;Jeq#j zt$g|+YZPa6?Z)F^%z1OV)Zk(N1SI<6+-EQA`_|sgsb}DMjS|$J`FF0qz9o=8+Qm>V z)IR{Q`h!SdWd@r4$Z!uX?UUE(*kQy#FHg?v^LbbEu`dA+kS+oZ7aNDZn+Mutr2JUV z&~T%zprAm@)AMn&-sJ%9GcNAa-rgQLs|YD9EbOBDCIrj;#L_gmpz*p7D^{>Ke$a=F z4KbD?uM(JAxV}D;(POSTC@r*{!H(6PMC&BuLRmySk+K1-`r#clMv^2{m$s@gq+S<2 zn#~r{aU}hkgr(AL@ORA{zV70Fes9E~l9IxB0fGmgu|1|~(rUG}RUo4Vu*@!{;tPg& zmp?fj6;VT-BVv#ON=0ehAWU`$ z963gz*R2^TQC2+N>v*6~Z*G8HNz>Ec;ie_vR%ch++db}nbaxX@f}A`&B_$>F_4VHp^Obrz3<`(qa(O4%FJzObK6uiHsK^rp5O36f6rkaMzV~m1qC<@_V zmd$9Kc1GpC6-Gx#n@*&r4=&`0kV+(JvcXl^C!0aE2~f&t;LE8#J+nR{^`8lgNISJ*Ww5O(~vd?jI`w=xZMtkMWr8g<0 zqF`S343=PgwzjURHu`CNT*w}yh=72EYv&y7U58v{m>w{gBY=u7oHKqA z*SL<2p%J`+_T<=Uhg!>6QNezB)~1^#z+!kt!0?-j_SHV`42D_4Y0&i)Y!EKrptLdYghc@Wz%|q`QpTqmyNW!pnKIE( z11E>$C^$?JkHDr9R zxSO#-?GpywGFIhmyUJ<%*cb|6#56KeSn$iI)hc_ia8^fmk_^9e+`6#$RTljhmI-c5 z!6Fw6)aL>$OH5QJtv@l&fmq$i@gT>^{BZcq2 zYz)cxtxqv`9!qei*QazXf75h-cG}B#{WBoeYf@q$E}e^wja{$?FPAK)$0~RGup@_d z_XxaqB+JBcGzKJK6-Rv93@4S}#LON^;J2oypRQ>igXW$KbHXsgkBl%&q7y~VdinO3 zOJ6>15gVQ_bes>i^D~J$T7F>U5W2{4H+L`UOxtX0zt0)J5|O~BRVvniYNWnqu{jpP zr43rd_J?avA40DAZnDsuy>+Du6VlR0KLyLnkorUVG;jqnM#p`*p_{I$lyIH}#wE-9a^N7ExU0X9 zPMDnMsDH1DW@pd+7~ZPQSNLyqE;jg!2+dZ9r_!*numGomV4FMN1_+G_dF+B3p3$2C z%7%UbSQ6jG_Ii&^bffh#?1#r5@{#ROCQA4_2-6xiaLmo|C|wll`M2EM-zWnH-c{lv z=L4~Xy1=f8>e!fw2s}Rb2_l7X5S4+g1pdGv7$zXR1oz@cyqBAg+VsizabKi&8@`FW%`%41);ptR{KXsk?9tb0}qi{y0L4&hL1|; z7%?c3lBC5jvQl_{RsQPaUsF*{&bpI>)e|m8(Lzc6N%?epD~C^;!AFiZ80Wzk8iZ$y zyHeF)@uH$_I70cln}h-^?5CB%=LP^6Xnt1iF3t8Yh#i@%wYv2`p%QMIx?V)>1PaSE z#R1RfQR79P==Qs=(IjYjmQzO8re>{SNd{z-r2MeK<49O`G_qn2tcYXQV6)G~jf`GZ zG4@aXz8z$q&|p<^SCz?<0mdKYAP=NWGk_(O|BM1T&l=GcXhfl|PG>AbYpiCf6yCNz zXe<-`rF9NoMMZ~C7uTZ}OgFTUmynG?yqy`SkV{XMGUkU$$8r@Cx}*k&WTvPXr=R-3b z_}{hDGB9wd0%*L1+r)OIq<}6L!_`V(7?AY54horo=SGJdw8|E20lx399AASZTebt# z>asFz4`Clg2V3@KM3SJtpp4}ke+=et8twc~54XK9{^V=QO8Uh3^S_3Ec065V-`zhD zl*mXSgo6#YblP~;KI9Cb*E6;aV?)D+sdn^ymJ<_q)}T7H(7k;n9{ICkpc`?qC9M-BfeRmkiDeeI3(cALh1i*DbGpNfxr79d z$<%amOQrPnCB0IWy`(JEoB$SHYnkyo%mcw$-pJT^{6%LbQj#1kd#OEXTx*ZEL_Q~mvgon7Z7)Caj8RJaQaeR zvRV`cx0VLfK~lU+^~NHv6kJpiulpx8U4oaL&l3wA<0EMXj3Cf!D^82uX{bmaX@)wF z*2onL3kA1&S9M(+Dukw32O{GD-H$hDF0wk!To= z1TlCbEC|LV>4K>H^od0Ns;otL^+Jk#;`FE})L#@D+7ViCc{DLWIoijqy+%7ZeBvz{}@=r5(`wQ~3OaJlGPR{CN(k9+xC0oW%iZn9kn z#~^DbR!O9CPhBi`R+)KfN<2Ub7qIyjS@t69Ksp#K-HC5zf#%6hK6Iv_k$j?uJ$DMc z_@j~=Km&+D+G?aK1>8&@&<}CG1HXsdBKAIYvoJIF{~;Hr>uJ?jNkm3_jk?4RvqasX zA%lU9`u?Us6sDgO=xxsnj{EcO&=LiC)`jn3smj3nDQVY@D&j`}Y#hGjS1#+DzD_S4 zGkcAALSIu6QpJ~+73j&Py>(pMCEX;7-Ttggc_g0m#4)x4e8&xEVz&2Sl(R=lhdhq4 zjl6@AA~hxd(8G6-_{DLB+n+?kA}PrUE;cZl5$pGMylg>t`%EoESDczftG{H3^7wRW zXD8iuJ^S4XP806yFk{}F!7E)=cC$xl!Immc#s~ysbdtM_`D4UY#0j989}tQ!tyNH~ z^LQFP(N@MmsTRc9&a)_ows8da8(8r#9K&12@(6T6XK!skfVs&%J9*i7@pClcDes5l z*QBx3P1prwa*!r&Xi$6#^%0HS0V`NO%!`<9T_~E3kx$QWuw(b(u*+!R3@ydL(gWN{FjAhgOZM*rG}XgIb1= z_MO7${gOy6)N#yLd`>im@&zw+Upa)@2g+^~;5 z(-?q94k>xiJQ-Oc9$iQ~_Dq^o&5E8Nw#`+}V$7@%@n(_(y@GUQ39?77sHmt~$IER^ z>V8)1K|kXsphQTx;SH2lOp3L=%0`+L;d8Va+tl;5+9#Zhz(JA(Cd#KeB5d@nUboX^ zr4dI~@yE>6e7CvZHYehWjYCh-fj*680JBYH`j~*vA?{*Gj7rpI-iErmqcgu_y4NU@ zhExo7^9V(2*+2a-ka8M#F$Zmrk`_(3vFYF=8C{xezCCmm;rV$|Pl{u&e)pKkBwjrq zRq%Tn6;<)eZj({*b8ZQ!fP>U4rvLa6an|p~&1YbMN5;&8hb5Wvxk^;8Tr#oVDYi*I z5$=Y6n52D_`8(UK5O{`U&suCpDufZ(?%ZpdPUYsvhVe;bq2NmZO#-K^ftKO9b5@Hs z1IOc5cvYvevol9-(||ozRUSxxJ1&{F$Y@wA18;qUZ8Cvm807~ZWc%|J{i>fD(!HYU zMN%88oON}%y3?qPgprFZ!jiSBT9vsC{oK6$Q53cZ;I%y0ImmW^1^Gp<{4^}{U2D`X>;vzwd{@tcI`OS+q#n_1N%?VQUDyqWIn zpQnUBY<6@n5=MDuTe}xhshTIzX}ECL$0Xczo*QpA$roZQA5OkNsT;GDxu&S^9`sn_JXArIbDNYpKqNQ+u+LM@6DO75Eo(t zV6r)>esOm0LDtLRLwfP+!wN^2qU7uiUeF{zr_P3}{sIeVAdgM0(4yoJTHU|Uw&2#P zXPz5CX&D}Por!Yv;oBu5Y1`n6%Th~v4yekSFz#I@GuY`R=Hm^FvwrO0U_{JTQ_9z( zmF?5$NpLw)OVL@QLd?a32AW+jC-#k=DC;H1LVE{tR|Je_B{_0@>%}6V>!_wqalwpw zgoQQx+B8hVBHwaAQnD71)okx7!%e>(YzF&qnJ)j4w5-gfy;l+P!fe?(#x7%PEAh5W zhB+%|fHdCHi6Kr89hHVITtvahOwJ=@7Mj@`k%f5@YU*B@4$Sqt>8&PC92(WQv}wd1 zdUOYP5h^X4%So!5P(0n9NHgDrFxIqVexxFIBH1EO?`PYRfI_aM@Z2$6oaTURA^sWi z!RjyuPDDO$&F*pDg&$@a*DT*r@6RrDK0d4ANy=yzu3#iV_Yjl4C}rEV?bzSb za+Zq(4|RfHh6?$;u1qMTDs-h=@qIeFVTW!P7Is>7M-t|nu?-BsbaWTuD)~{!1j|_I znV(!~#J6{-i;CJ+GsqA)larGz%+1XwuI{gQLUZUWlHJP+kIN@s_>Sc99Ybbmyu{?t z01KC1?QShLFeZd!VUgb7*^|>(+cd}oEF>=q{ajw^ z9!R?ZPN`5w4qtu3E8Sc6b^dAG)V8{4iKSNj=48rnUcVO?mqmkEnW}nHTEVK4211L) zbLy8xAw~oKB~K+ryGjdK$=g{^#}qLTNSKLrilEP~@H3KIAEA1A3=bPDZp7}s6`N4- zWk@Ak<@RfzfgNrl79^qo@8#_Au4RUYl4?2iPkGQIuDB=DJU0lc_m9%x?0C~9DhV3gTmzAd^YiSx*tWt5HYP&`> zf)$ZUuB~kOcc@>Hqqs#TRwVA3Ly;tkG(Fs8jlj_CK(jmdh=Dy(b&l~?@-T{s@w~V1 z0i(Eh&2f|;?oibX0L#uYk-`h^>(!O_+7LDl`gTZ)zfL^25$0hQz6)1r;En|8H||=n zx0OE=X5Yz9;O+i=NhAu;``MHb9A=4pMDq%#zI|+i#P;GWrQ0eq{Y#N{xF7ikW``?h z3Cu&F>_zi_$%PrhByO#;Q-zF9?w4wh8toFrZ08@dG`!9eR@~Os-`L$6%Ups$C>ibT zK@68OQOX7jO3GJQEOM8Y3ckSo(*PcIbF}?0g{pF|Qk*Iky{*gSgffg|>URCQ zJR~N{=gi{e=m$fD8kGV^J7lryB>4!5t%!Ov0DD4BvZ&u?GaOgxF$N|D&N1%+i`6WB zp+26%YU6MgBH4*<_~JM5uR+0EBY&G1uO>q{%ZtnlM!O;I_A$<8Tmx5;hf4p?qmZkudZ{b+Y4@~6EP2$?HNb>01mi9PLjJlZ2Ubu)&xrid}I zoUU%Hg7xPu_4UlHF7m_{!QRdKs#&)6Vy7NHZeC@w(E`894i_o{^}C*&m<{o9bAoKi zD{Nra0kJv|anD^uJSXh7Foieeh>KH8~KQi2!lNi>lz>wuIeoA z&-k2gO110eFw>;kirfIy7gr}4hbzPFHXTWJe+EhWoCM2FP=7t-RT2~sfQ;bT$l1)k zQx6#A#@h@)(6di(C|4ix3$IBU%8ima-m4<eY6Gv&jhlgOvs6$n=3 zSANz)AE~eFuO6?6NkeQg0m7bjDIsZd8(1dIBX>dHon5(UXSFsBWYFu!czvIqG~S|k zLND!(7)AB~8r6^_$;N{m9z(11r3J6>w+}jyeeTN4nv3zgq>+$?SS(D#6|^G-d;F@H+LLH`BEkPYs@c|vp~!c3@1Xd4hf60w>vI8R}2b}W1q=it;2HKvvpgB z^o56*5=$EW`IEu51(@}fA0o=*Zp5|Q|4Yp8yQ;T~n}l-D;qxOpQ8llv!>PhDh@ zrj|MdhyZiVG>z_J5o+;wtjT?{zEO2!D%r2vq%{-r+tO8Sp7?ul9XP2_zbPeR2=pUP z9GC_p7y}kXhmBRCM>7Y@|ExZ>r9@thuLO{4c^IASd;Aox*w&w;yBok4%4B0dYdxuT zc=v0oS;tiGV0oQ>jk@BRcOxIRklad3-E&! zDZEeoSd3Yp{<>R_A=xew#TH8YcxuBru$BcR78W&}(o>1X<9#7IIyyq*9ck4uiGD%W z-oh>jE1v91iCm}Ox0|1>-rjI2q)4dBi@ z<=!bSsUP=Rk~@Anq0Pu#9ly$lRSJAw06D*{jaOBMD?;w_N6SO5W-7|%k>34{6g|`C zF2PUn5!GfTC!d&xgqg^vUvgVrtb4dRsmVU$nK`_70NxEv4A=b#yO1iBZRV^(jm=slY9nb} zHlYkP?qun2XsE8@7J(ejSQeonXG)zs9~`c3eEI{KF^07h>5Pc%JVP+^ehAg?_J_}z z-jo(5;w)gVd$l>haGr|%npOXjP=tPC3P-%jSh@`XSn*aNRoQ_*%2?LSr$iMBbSdY# zNE&Fb#RT%jyOSDbx471kZAP8t5-FbZ*ba8mh1jHR92m+O>|cHx-jqR%F+4XacC^zv zqF+sf1zg$39zlC_rYH6G3PR0R$rOi3%GWw1r?FBoc;tizIw?ff(=#)=sng$kJxsr< zQkqXx+m2LmvRE`lSzYP!!V7TEH-qD^W5R$(nn8}Fy&k{Z+YO#}+kSj0GUUMW&Y^JTC(-bYlbrYuJ5rq{jAg&>wYd!i({x|t4dEoVe#0?6kJ z$TF&*oR5t}d9%$*q(pokwR3+%7)vAi*EF5I@Y(4n^lEW|>H6~wbc3+eZiBPxC7nHC3Rz4^^E%lIcT-lOt9Lr6GYPY& z6q~pF#4XZe+1KzxT{uJqlGf6N>zu8wf=)ssTNzsla$A4$XX(o3Si2gin=GxOg`5Xa zNIlUg;WOoIQsctfxz@s+q`7^3)&v6su0EOWoM7OXBG~E_QVeV;=3Z@q)rnv&>m}V2 zD=n%tzh=ptGOOBz;A#*^X7{}vJQUDaRlO7S2fx&ke804-T)}qhS|oEYR#oMPnpK_6 z5wiSSuf*>7xjcVrv00}6S@4%Qyjix;(mt9DYJaDIjdG3MH%o+m!5h-=!R-E=H+jRV zr9s3U=acbUzFIoTzhw-osJ|!`rqvrU$cI4CCs`;4f6l!@uZ22L;h;jmo;Llo6(303{)=O~Ro^*Vz% z^=p+}0@5e~%N5cei^yo+_vd!bX^Z;XFv^B(%I*A>s;d^y(X?;V82tS1FCF+T_8|Jw zBa5qYW_>({z;Csr-8YE@$3>XXFec6y%BvE}wYbK{s0gUS@dqNgL>FT_mkZL?UwW73hQQ|*ZXed?zzHTtH z$wY(D!lDY9U?z59zUPX8qC3R}Ie4s^e6?Pl%h+FaLK`ak zX+*WH-!YRwM70JKK0Xo;Pgb8W{tST}h?85n5ztxTVOhiK@IOJ)gf5whNDs0(dK`|R zoWU;sS2d=ZC!DIdAb|@T^KK6`iv{G{&x)jr7d4fRKg6pIf4r>>xm%J6#nvt zxdO!foM(0`vw)A;>h?G4<>jRb^^|Ve2|m8T(=%P2fPR9KLoRw{@Z0n<9<*8Wn+N^H z3M47;L}e1BE}UHI8pEJY#`Gdoh>B9Fve`l0`#VxDz{wG*KP4*B`?wP3smT$)h3d%K zC==WE`I2hwM_FVy@5Zk2G8bwZv+Q=6dfY@86;kSKK9rb2(q~OWj9r|%jFX;M$a%Tb z{9yPjU+bOyaU>io6L?%%8_0#&QLzKO>ridFH{%QCrdmNxKFczktaLf3iYKUmx#Mvi zyv*Nv`F}3$TTmQHJ65_C!%^Dr(^9JUWgL@(vX<*oHd?r)2t8@Sfe@*4#b4I^z>K-+ zG;=-t@e+0{)Ky1TS26njE^CrSM$K{KlKo(TC}s465`RQ5wW9lmpG6e!8xIW#mS-Cr z?gE!vC_Wc%<>FR|+6Jlu8E-lEcRy|E=Lb0d5EwHDY=`>kfRBUxcVg5!s$^}W-4Z+~ zrVG2Qj*qGLW^@;NL+QkTGS^3Bhx%%r`Uhh$ zNXRZ1x1TSC@PDt11*NWciPu|&vw9iU8}nLMb*QN02|4CT`mcc1Xt7gM8c~hjTTR19 zQ>Bs?XRWjf-KuZq(%Y?xJ?1RqD9J=|bD`@qK%LkqZ-QH=kQ&4b0Oq=(VTSFrk;$ocy-~-sR^5TV0v@}^<+WNaB3|!O=1v*~- zch7)tm`)Fl#BbM5JWoLG#?zt3zIfS3r7z5VeTWPohZ_e5c=L*FJVJL8mBiv6rN%J+ z5=swY8ym|AQZ<8lyH(4%g9}R3wb;@KODhh@z)%oLs)CGeW;lXAm_i$Ic7qK}GRX~R z%e^vwEJwpUN`E5doP&+SzPYc`4gqp+`Z^5#ibITi4KFaPp+--1~12eKFm@wK_F&s2BmhKLn}u zu6)^lZ8X$LAqB_d+#=w&Qd7%|2_|85suX)?KKu@r z@F&uS2>U{*Ei4zM(c8I=X^1R50>7JzFV zVGvrabu5a3%JykzHM-pP2BoN3o~rS5pM*~r1!3K%u#DRq86FqIJJ0v$4b@eRy}+t0 zs1|Uas&=>j5lT;XTSn`&6_ye}Hskg4)t}7d`Q0B&V4L(cn>_2#eoXE*_j9+Q(8dBg z%m|^dSwm&FXsxu0OuacMXr^27d)qx<0?)lEvdFYmPIkD_v^@&0KSC|9i|(&C4N$9I z$)Dri&W0J&bn1a-k@+5JyXtEFiPhPUC1yKKz-*Z8<|&oJ@>YViHg^Z%ZZzu8IoX8? z5mlBBFCQ6Cy)~ZTs-qJ%?b@}jr|s&tf;vkT5(@DT7dKJ~;Ca07%(QsgA{FW;f%lSL zS`|f0SPniB+7M8F6&N)1x2lY0F+*0Q#{9|N3Oo)m9gG7X`jryZm!O?)ET+N3^A>&< zYA=6d@uYxA9Tu zA9$5;XUb4)FZ_ZvJHD>RTa@_7scm0eXL2j*M?c_}cAU}esi-eI>*KAqH9eb5gAkY= z+Y>(f&7zYf1lR44RrU6~qVi?rZ)Mzn%+UOv+xU3-Ad59}5k@ocMP(zSJ`dI*EXpsP zY;<*v&hLyc*6hX~u`mUcA1zm9jk6lOJRYDO)vx4O4To`y{kT*mU-ukmYYORu)DAEW z3h?jpMS5@NPyOsj3s~~_S%dSZ%7WPo$QyH5C}ur8)vFqVK);3S-{O{Y=n&tB3;tWG z{Yx)M0pmv1RiZA^d`YhPYj5MjOM^NJVMbtAJh$s+!npUW=w_%kzQnGWYD`Ht4KEOT8%S`HnV9OILkJ3Wi&z?ZMjs_vL+;)Z?40|GwRCfnTz zovk;N%+bffscNCO-|%zGgH-mp6`;=Vz5(61JGr1czw7JU&A8L(`r20`%@j**R@5ME z<#X(gI7f81d&cs4fzY~0uXf#>)^ii5l6OC~_pA5cdojYi69@<@gFHT2VhWS%bBmz&t zQ4*cc<_yzM=9}-;Jd@4vY_Lx2Ss5N4stoAU6bziUAbLkx3LN!@WETrepUOOPeY-^m zi@5D=lbesMfQF1M;xrG`vq^W+(I|En8;uj??_N)HXPmyLo?d(v+$l@H?q>)*=qlYP!7jJuMDjM#B4N*0Muiw`_KUS7fk%sV|JDx++B49N)zPP&j3Q>r%MdgHVDSMSva5pb_-iWhK8xk58 zB`H7sy+SCNDev&N&p>mo4-?XcPZqjTY<~1lGC6i?Rw4M)HI06%rnGeRY97=5l@9%= zfJSwvSyvku0h*SYGE`+1MVJVX2xv&#as*Sb+ig^yhMC+I9ZU=& z7Kes5{JiL{fD|gA5PyZ(Vy24-YanwuG!fgjy$COuHZNXKiP@Vc3gs5e2b6Sy47` z_rdBn@}u2ryjja7vR`RwA<7WLs8g+!y9Rb>1I6K?Tl)J|YY(k;n#-K7V|kacl>yAP zYa{+&yk_Zk37o!Ew;yv$tk!xqDEMThd@aCWRs1HFK9Pa9IHR6X+16c@(fmcuW%S`-PSR*-u9yA{`U z&571;kCp)6XK_0Q1|_rxap}00!I6{HK;;16z{HFUt6Q7jy}gehG09mlPf!*dWJ}}s zSPe$%Nj5N6T@yTdHqo8e1$JZ=3bcIx;6T(Y_jt}MKf2OXwO{P69TAshg06kQ@49S+ zv%EYq1m^G5!)xuaAC)fTEpyi3#nN=aBY^@|GCDSllldC0(g=>9q3kOh4yUkgB7zKM z4BhtOh1Jz)Bm~cC#orDl;NF|LzmFLBFm`K(sX^`^oG@x?YPNXU&H7loJWnpGg1Pz!@(H8SH!R8&-65>Izn%5$jcJ|IRxO^l5)txjlf zcUcs5spP0yFv!%j)W*HV3W~|g65@2`OKag!r)dexicEYGX!-f}$9C!gcIG$dE1$t& zFpFo+mUx)a^F+2H`}?nk4?%7=3ClXnlMn7xdubi9A~pIIGPba$-M;thCs+3%Ra0bK z<{-*(|J9WtMG^p=m@+d1*!%YMC`Qv+E*eqNq?uGQ2?Q=Fq4je$btr_g?GT$Y*TqCx zTY6So;`1K&Z+9>)QA8^ED8PyWHPJ2qq%He{A!(8ogSa!;95u;qxhcwIP~T@RshU2P z7oY>_c9Oi@lxClhMLjh%G@`1h`q2W-3s{NJG+#+*Bq{J9z=>O1?y<9r18rNWQ#JMA z{iz|1dwKJ&codo~kYFMD<-YMHnhtRaqg=u7v=0$>_@jENYqp82F%|U8t)*X7`2*^7 zU#v<(=cL8!#K^Tn-7x}9KF4~qSSi~yKYGUdGUBW^4i3(i*|&o1Yn(6)zcB+ e#m+k{9>fh=&*{539q^y(SXoI$iR!OLLH`TL9Q6zU literal 0 HcmV?d00001 diff --git a/app/images/illustrations/item1.svg b/app/images/illustrations/item1.svg new file mode 100644 index 0000000..962e40d --- /dev/null +++ b/app/images/illustrations/item1.svg @@ -0,0 +1,35 @@ + + + + +Created by potrace 1.13, written by Peter Selinger 2001-2015 + + + + + + diff --git a/app/images/illustrations/item2.png b/app/images/illustrations/item2.png new file mode 100644 index 0000000000000000000000000000000000000000..3086b35421ab654d307315b956a0b39feb0b126b GIT binary patch literal 15230 zcmaKTbyOYCvM%lfcXxN#xI4k!**F__cPF@o;0f;T?(XjH?gY)t@7#OteSf_3X3b2? zs_(1n?pi(5Gu2Vbiqgmk_y}NNV92sE5~_dGw7*vb9L(Q4f$aF+-vrN9QrlI{!NS$U z*x4LR)Xc%eoK)7%*wS3p+}O;^Y1CW*3=EPIq^|9%tsu{5>R`ug{ErN?r=83BNrAT z74YQyOJHa2YE0^BXKU}m=P5}3FJ8XC`G2Ze$VvYt;%XyE{$ECED=3qSJ2;z@axrr- znXd42!;^E=J?7_k8;B3jl#>>n54+lFt(_aZD7cYBPV^1b~7m9x~NSM2rI)fZt zK@Rq$|1cVxIJmhAlK-{zznWm@_&>DvF8|$4e>;rD)7X)PjhXeICjDDbLE--|YG?O9 z(k`y5=KpK&|C887-OJIOMb+HJ!Ohw9@4#75{G-Z|Pu$tu*ww*V-NC{3-@T}8<>2bz zV&&jSDy{|~rByIC1=;^oLH93&f&!ncy^E`{y{WmZgdq7}4rUO@jE`GXN|Y7A&A}@L z;9+Bv1n}~*vGcIAa&bv;aC7srvi%z?;b7`!XKwHMZ>-t>VmbdK_8(`kbNs7W!rU3; zZf+*!>|jUwuSWBM{&%v1b3-7WV&$W%+9i%RfW=e+~7&tN!}WKiU6r+`onY zaeZ_9zy9w0*RdyyP@TcRxNl@7MAbdlF8p4S36~SM#-GdDECcZZn>|lRwNf+}Bn`gP z>b2WcHX`V3)dbvh?+1(+ORo^ry7OEhS3f71fh38FN!7jv*z^5J_R8mu44%3V*`U=0MO|0x1HVu8Oku&z-5_GX~7y0*Oo{3}q zxCgoqU*Yn7Q|W(Y`f(TWMFAeB_x>4ZtZ)m!(~o*2@vQeQgK^}iSSLD`Ze7BsS z9XWxhB4>e-zD*~^+m7*Hj*ze8eEVY_cXT(^<8I8h_GOm==5QZIDjce}e-#My4FAmS zih2)IL=W7{jamIO?V|7N1N}Lhow#`l+aZ}qhYPbBiQIKs!TlK0i%vW+ITY5*I?y6z zBvvO`myb%WfED0h=F%^SP{81;1l!(?xknyJ) z2;`K(tqm zvP?dnJ7B|wt9|rD?Gm#9X+qt^;%ZL0B?h4tqWKH`u@9>6Wr*)$F2lc#{IECfPe0+)6Yzln$vK%APX^`%%*-C`^f;dsrvI4(r^G$z{ zV5udbuE=xNI6%9jj8h^iziBW&-5eJY%4qgaQZyxsRphLP9nugCw*PXcVyMjsIE0A4 zUlD{$4PtV0so{N$j>^=4P4t69xPY~uw-9Sk?-gv(qqN0m7*M)5A8tFoi zt->+?`cJc9*2l`&W2Hi$rlR-~zR2_?%*!)vnaTtCMpsWC9-&|H7 zA1t&B4j-2z<+pL#^@sJ%f`F3=ZzdfY#)zS8-}TZ%%SXhaL&V&~vW&A3_#DEnLfB@IRF+YP?ymOhb@&KCns)CF zox3ytdi~|R*aPON$~=@sm*dYh)tX1>iGAEq4SPgT29XpsL>*8AZeaIZ2eEi{+=Y#Y z0R2rxW}*{YFmA;Q4}-} z@EM{0ITxWpi!P-y*QBjzlmeN`-2~EBUb7FCU{#*c^<()gD42_OCO#aKO8=m?f<%_7 zR9_?qo`5UNQxH{r5((*KdYx`5IS7jdbLgXC1#g9EK+A^=>FQ$|0?&6^rS}cQ0gjnD z3l*3x4KJU!&OA(p66{|snZ_gM+RG$fDSr}<>5UToa%%_Mm&4i=378=&TFbMDKJF9BP$lKhHRn2=0Q-pE zreeIA34iUK3+cFNCdjKQ7a;lqyEHV~g5ErNx9N$EB)|`8K^>xC`&QNEsmo5kreWij zLq_uVDZreZ0p%3=m4j3xB&NCzK=+*G8hZfSG9AY5e3w@+aFu}L0AL|AZg zH7$KjzN&KcEs7BBfSF!74rR5Qf<#zRzrQ049`UguteP-x&UJ^SZ;ycXP4MGBzro50 z6Nb_r;0}|EuaD4H(;bgGMoRZ6?0^nUl+2vDSk}D>8E^^QA>r_G; zyv{A6<yk6y4bEN@&xh!p~{$sf&ws4B|Kd>o(QciP|M<*rJZ(=lNg;{|PH3uM~c?E`Dj7 zZLk7isk`E{AS@ClBkaA=tQA{vp$C*Pvl0Ta@bMwq zEkOv{g?E%beVm?MC$6a7^F-l;wd@?5d=c{_e00;Rm~GsT%vAX(II4+f1bB9Q;72mLyt~3 z3~@Yh)Z&ojD#t>UWQ#CJH+uQo-iMGE43^vntWA|Td?KI38hx}9=BS3eAtyI0Lasv? zqsNuPZ6+%99|zW&LxYJR=$)?T=f97t65vXpB9NVH(DBeTcsTF=aynySd*|_WOx@gTm$N5twns9X~%AzTzQziTJIEXq$gOboCHzlfEPL52a>FHsZ08dzRhH5ZHXtk zgV;XiD=Ey!TWnCeza8$XBP*CR z5jhT7)N~9jiOz==pHvY!r>aT<47~5t27<+=UfHlP#ZPys9|wKeM&XnyBu?4`w?P*B zuEZH+teHqQ)OG?0{`CIel9&*J_tHB<*>8teiZ-z}C)Q%{}y&ny% zgY~=AUh}tMrtumKi#y!wSo`H47e{thR2k^-=;T;59QNmqdR8^D&4LvXGNBJ?X*M!U zp9*$p!@9qH;OanK9s5$(je=6lfGtHquKF>F7K3jzc(m&A1X-Is) zT9@|9T2IuilZVUppG8)|+W7m6D=BB86b(9gBvLMYXM<|XSX-*`9NokVcf%9MWpsLC zV9-`Q?B6J8tIa8UT!x&-#Wv8hz#>MnJQm`!1aJX{h13bgxw}rU@MBt7Me35Nyy>QA z6$}r;0|!))fRxB3nXOg7i_~Q^-fKr3F5KWFDiJz@f3KiV)e+{q^wBTa=PSaf(SXSw zlGj_}*JKFbQlenzwEqtH?pd?G7P881^%O7yXO!#@Aw;9;st#}Z_kCM5zalWxL_&~J z)dJfvJhxR#UAnj<#WSN~KQD2;L^}A(RxoiJL7h$RBp%(8_R=p@I0CW!CKok@XclIJ zXTC(I6uzD)xTTiUI;Jgja@KqI*q}}2v5F+-ye+-bC0Adgaa?+BQ%D~UTeg@ExDe@~K|2rJA0`we4YU*}z=i>f!t*^K9`u6`zMPAqZ&CeY~jfZXN>(aUMl`eA@c?=IQIpzIT5IYt#yF6_gye;0llUXy|ZDLWa z1Fg8Yj(%Gu58kaL;%5Wg-eQ}jP~`_QHADsW*JLE4oL$w zf4;5ira;^_PVxrg>G7uKN(qC)s>%iY}+&f`!CqU%-1^Ln}RY>{+#5+f@G zE$>cEUWE~qBKEN7JwI54cz0Kzyo$4@3z6hNm+;~=)xh7|^S~1}@#K8p3z!lXoSTf! z7XPr*R7Ce7)#mmg%#cJK*8^u+h{rp!`H|;H0Ux>*l%*-1qrmV7;0fJl{5}KpJ&Y!^ z6*}K)_cps>E^uJUMReS4`|>eUhev?zR)W&WmCZQMdWAa())$BPxp0z*Q^ysxcV7Eo z*I`Z-)1>#i_Ec%&jcjQfrJ>)_;!FLP+-`f)d~OumD#1RmU)Cwxeg35=0nI5$bzRa| zL*ZtZ{eC}$7(EEgC78MWQJ-2!NixSIsrIwByH8NJz&YL&@z}M2XVClE)3{&R4uE%1 zNjhq~tqVo)UGV+pJja>Q6Z;Z>7dEhN%rceL;s%+q$chvJ462@n+tnBeQSyE0qPCTQ}GQPqh)H{_? z<>51SM;s01*?7hfEaXFMz_)(`C&QS=VvsK=6aC29koGiHYnio3uOAV2;k|RMcCuZD zP1O@6c`j8CA8dp}|MeWip4czqf71E-BTsQ)5WrpXgX&4RbrD^9yk0bmIF_$Wy5aXl zwr>QJeU)xYbk#2bqlcfGN8wRHrFnZEl5mL&xGz_@xKVE{i{}c5HMVlwu#MVYbkxC) z*^KJjG?OfoVMQBehhZdyhZI~D#FX|mT1W`5g2&1Gb%MkqKG^1K1$#Uwu}+gxv5?%h z^D8i@3=|U%O)Qkw^b;O8?C9k)fC`F9PlRkg;i9BiJGF%wFCyrZbC=p6BH14%C`~wG z2R3A8e%%uK8+?%Y#C_zRgL^MPZHKR6dAl`^BGHE?*kAaRCpqgUPyF*JVXynKO-15O zvvhWkYP_lMR&?%d>=WGNn^YI@LjosXJThbm#lH*8!G;BaQ;OeH00Uj__Sr_UApl5&kBy@(WinCYeHz|5s3N>ndtT6lWZfzDgCY=t$-uZ^-o$td3S%5dipvi@7HSAnGqfWVSs(eDz zRY^*Y7JuXXi9+n_{_C`bB17|i7yJ~QF6K4BSAVXKp~I_~hK)NJ{;cTN!2rQOz=X(o{G!^oo zk%kf!?+#X{3;rR2@xy#-2zZIiZfdC~GXTy{)F=rbDC5EoqU{T$;b*1@zw)xv(Sf>& zXyLWL+}J0mV++`=l}UJ)634i1OKYwzedk+GUSr73{^jHJdMu$UDc+4CKo+}iR#=R6 zK}+m;fC>6N^$aFMJAT7dU_2;+pw@CZJd|N@H5}?69MtgpQl2)DAWy^fi%MXPWBPGM zCeFc^aFC|o8bx^VyPL?3hSs4Zp zKVu%O#A!3-B8^vCI_J%IVTQ!;X9wov-@q8~79-XQy%6g4MTm#l$o6Wg3S-930cF57 zyg6y&P$#&8XM`dzs@Kp(yTPXQ_<|o9Mau~PaD5|E?e9U0_FnwNZ~Y#4djl_MQRur` zOc-$a#*U5$>%Isj0~WzDi7Y$3W|Dz{K7;U7PiMbh(7uk!eEjlM(fx*1ijat=w$D^U zm{~i;XqF`Gk#ZZ`m3BwdYud?dt&Pnu71PMsrh@a$&li`qcv9D#B4{0&SrT7``3_It+#qaKy3V8Kn9(sS4I{ z=qUuG+{$*@i7@ZC0gO+7uwh57$F-8&X}}Xqn7!0v9YP<3S&!&E66?e6OJ2Ha zl)~8#Ms`p_CguP;oZ%FLXS(JWdg7qxXQ0jT+?%{&TUo~jm`7+8#wbBT&{40tBrNaU zZ&;3O8GI@DH--+h$2=Obx~1uJa-vx%MiO01%UrfnC?&ts>W`QM8W$TcdLmkai$f#u+1`!z&KT0;ZV|%F}F<>?&At{ial5g^)(Rz}l7P8-&)G$r`$-Ur#yXSqVT+&PHCi zR}YVglTo8#Da8~X8We>8Y&)s!xn@%2E+-)Wa+iV1lFYFN%v5r5_cqB3#-JI{;heYr zb}OYvHwfg?XY}^YzoU{WaoRwZmb#Tnx^fBI27Q+;IMGlkoEwejgd6uqJV}HfC8vUT zGD}5f@K5rp5qtY!=GpaNfsL2Ec#GF>FAyJm%7+K4YoRQ~FDTUdb#}p)zASn;FtXEg z%@mgTI;1*}SUk7kbL@a2sfIi=XUcg}Yvt*Jat_*udynjM*KCLL&Uj7*n6A@uEoue3 zOBhbLBp8#GEQBWD)nd2+EBPv*oFAMlf)-rkUtshGy>ptXRhH@(dV2ua>4|UP?;q^B zd8>jTb{*&9lMQ`3!Rn1!O#gUyagOuPCY@YK0_1b4i-|GzUA!VZf{IT^rp~RWtuhuT zH3!}J#UH=4R#B4>tgwI?h~}xkGugu}^%M&h_+726q;h9nn_s4E8wsG@(7FL73S@6eJwIaj@WU{J9S zKQ2zU8k14~YQr#%iKUIvJAF$P?lhNFCG_b?8*Fg*bOi&x;=LdR6tz#xQ!4{bW69;8 z_4$PKvGHut?)Eq90SQJ(jjJRD#&$C&`9ZVygoDf`L}X?@8Kj;Jncg*3__D}xUJVtI zU*y&u^Fnlrohu#an7bJhxIPKTAQkuE#Wj}lQVG5fyW?(fD6DH6nehnXAlRW0{~-tq zUKijh)p%+r;3UOzE>|1q^1ttW^HTVdWunnj}B zJWViVMqKx*>WUGF!?T-&z-66~YD?~L)_dg|{-omw8DO?Q^-)Qa-?g~eu1s8IOqQ?; ze0S6)vdH(EJ<%bWJg{SL3$Ypid2mED=-lzyLC#m&(a=Me)e0VuJ^KcMGJL!iyh=BD zXLf7r?rTb8`pL4WoovKJ7Qc-;wk(h9eHc{NlPB%k;xA$`K)HTd`(YDbMa}_C-ooTe zKB6A*q479qXf1=h6^6|n)TT3?*GmhBL*M9q{3gxJ1}_WaicLv)NNA`(27DFNW-qbT z`ZbEou0gR<@-^E=ev?}fS$tf`kqI$GQ3mMhet%pxK%g4jLmr5LteDjeAs9}pJ!kPP z0u63~b82YHb3TW0WLQ48Uty=l;`A!}BA9^#l$Up^SS^~3M6~T&+E%Dmw0YsgAX$4K zrv;flgYNcOVG=2rJ{gLu94>&bwZ(H5W(A!dKxU+hdOWnqK1*Iie*05FVSrm6A4Tr> z8Dqg|K&GM|6NK0qqvbSgje>|y_bJ(x@2 z_Wl8AMjX;JzqxOfi4?vc*_efYKE;XD=-mHxw{W0I2(F*t?KO~ znhvA;*f4uxfKE6vNN`;c-%)kDU&l0$uy*B)Kg)i6$OYlj;~A*sZLMjS(oGw&zO~tV}HN_25l@g@O&=p$46jU;kw z&1+2Jj44y>6^Y^PR_;i802Sbwk15AQT7mNRoYDKeC;%}`OR0XY2vt>oMqbqA;IXbj?5k#znR%4lRL;xfb0&SNe*nMB!Q(5G38fVBw2P~HM4`Qm2rZhqmdqOXkOgnJerXQ#usZdPHd8>0qs3P3o1OYYGpk*H*`e?9?Qccvv-&>Eh=$XA?zH!8ih3%Oe-|3OQz9kLL#``MRdB_9g*l>uAQ}G@Qxy z00UNawxbxHD&l>)du7>aR}77(%prrznSPRop6EB`FcN%)W<9$*yZAxp3|)8w6i7T{ z#`#F&C~8Koth%vBc-cSs0!B9gbeNzh#vF2GwFH9|xJ+1be|n=)J&o)5UdNQ5JE5>~MF!vST@58* z%MXJ{%*DMI%WuLe0pM!$3qvd87pu1Pb;b@Ff;#Dg%M6YVJZhhvk{)<1p`l;&ei0$c zHz@dC@jz)6igpBhDIq0_Kj#$C|2+SR*T3o!}DnaZh3AaF5aqa&b@cmOotm$g@Jf%cwY+}L2=>S&slb(6zf&C zX{?9>71Mo8uh3z)!5)#(65d_4sD+|@==BWyHlSr+Sf_0!$oD~r(IBv5H-D9fB%4rd zz2+|Z&=i*wL|@mWFRGwpVE5hV#^P}hf%L7Tytogx4WY;}j)2>f(ZcW`c8(}H)@u$C zj&Da2-zgO_GkRl4SS}$^kravZko8r1nEy zNT+l&YZh5RGTB_@_;y|X_^6aWk6b$d9&gpE4#dW^Lmc5{=4r|K@fdultN|x)Rkjd{ z6zJ~C@~0sDY}{?U=67~zrqg2>mZRF$M_xn1;msxLD9jP5tanE+h^V8lUkZB;lRR7M zAU(S@_lDfE3ie23!NL>%ocjFkTo!gHsJ&I;C3e3fd3a5l!yXTn4LnX*XN#K~Gg^sb zEG_6eJ;(HuFEfjrbf4jbk-@pswb1@0Kr~VHb}?NW6X%o_t%(z8_Y#Yxu7qrf%Gzvk zdk6$Jyqx>*lt%D0mzHvJ*O1!)B&}fLIr*C99C5kQls}e)gY(5bS^+wCvh>_i!ZRPp zHHN=xYSQD#z3z?21}=b%#CE6bAn`<^rQbc1tayBiNoyy|jRpvSPI=giLp#%71jBgd zL#`ZLj70C_yX5*8ul-w$T^gbvyYM8G@1J+$SjsvPN0#X;rv_%|Ya1cF$w{$46s*M~ zXB`z+sj5@xfSzybQM`WXZYTauKe8?B(I$RL@lTaa$AY~c&0}Mvpw)=h1aJu8(I;GY zL2*mZ_|jWmi1DQ?!_UdU+sJv?*67J`Idc*U9jR7V_BVQ6x59w& z!SP0kwv9KoB`=-7+;p|FiHhV84t}QZCJ@^HpuJ1$a_kD6Pu)h1pop8SUoVBnWyO)T z-qJ2__yADs32Z3;*!uCB^BPyDDzSZ?1vVLDrd?^)WQ%KF6gUB}N5cP}78O>3Fj;gV z8QA_xo{=nUU~j2?OA(RK;#~xTe)aO!ak6!EHdu#>*IYL=O#@YuHgO|?{mX@8eDOxp zsHQ^-6;Xd!Z;`II1MlgqWsz$EuaYzW$yWv%3;<-#q0vC`06Xp$l#1y6PAb%1PHSWR zqQQV+X?3J=u@UF_4Y>f*&wn0_U9+RH1pl?6HJYPuM+Muc-1wytOT_EdS|A5y>am=G z6cme#`)%x5e(7Y!HIPP`Xjok?nPH?(f$RN_TQ%NR3jGGcYxnYo(}fI%^7v=JCx%9C zFHD_gfNsG2G1ziHk=3oYZGxSd^9R`Yxe^gtqa9jwOB86Z;^~Z;Sreu>hGur>-2J{`yWHb>onpctIJI&eQbBrX+^N z1(sF7&BfF&Jd`IX*qEwpnPhyqXLRjDJcHv7-p_j=T(hSJ@kEchQHk-Rs|*6MTz#9T z+zw+H0Pvt~e>*13wSwdp+VWJG5M;1a){CwbZ*yK7M83)xPZbC8+QJu^rg7OEpt&Is zozwcnS9eBKh1krw(h3yHxseVr$MK^WOyv;-fKYyMF*S9iX9L|1?Ln^Sai8{J{fiXf zEq~6jb~>*O;miHmLx+7Be(tspBJR4RngAEBw`_G8=2=aSx=cLM=y@{2w{NcZxR=xi zqSMt%6o;?gRy0c<6&10ETy1X;_e;vBm_tlVzww&0g^L=znkCOv54!ETUKAqnBBTGR zZlr=8Y8ZlN^K2F;R1A9gQ{@JWfG=Yny`C|=!|AF^i_)CjZ zRr%ZA#E0%z-PxWFmCrHCRjE`#=ksi;tu<9_zwPHlCMNYJ^! z*~8IIqh}F2&9>o(Arb?PUYb!g@OF52jCsNH8!q*Jtl8X!A6E@bCV0WLsQ4K(=p@+b zh)_Pi z*}Phh1?y-K?n>X4(`~CD;Lm8q^?fOJeg>%YE8rX}d8r$f@nDYM@bB)u6LVrfzX%K% zg6EDX(z#|X6lr1XJo62hZH|a6Pc1|U8AQP0g_B1mA16*=0dDc4tlScG_W|L9a{7Ci zf={H|Tuw(4`zFV2LzUMSvx3tpf`>jS%QBJ)Dci%1Oo`TTWSLgrcZ81-TW>_m5_5Z^ z(D&VpiEl`jWpz}HZUrt}dl3~2)N;0I8zLTGw@8HpvnNgIMR-yOkgLzWStTSoL2BG+ z=91IN0g*Vl>(v(r8P{C+E`XrowP0fw`y>fy6|cJunCiR^!mm85u?p+MQpn>YH3onR zi;Dcnm$Tu&|7y6)*ZXQRMu@h?N4pW7E@QBBJEtmmpx~34F$grB6B>LE@3QBGHaI}cXnd@>stzQ>^=l%j+exo8p7B2bo)t&!6-zu)V6N()Q zVZ9bO9pdpUKes0V^{aUJjqY z^wVh9(?hFiG^WiTzxDa2(0WFl4h4i?SB3Iu(Nh;c9 z6C=V00_>nY$m|_LOS9557rdLv(cH=v{*9`LKR_AQF078T4=$hU$Xc1#{b>>Mf)|Hv zTXu{O^`$~JWAVUyq?kP99xtSM3bFAYBb97|`4o%CtNP3=ll`59Y1}sR2_rQnR>Hk5 zUXW^kXWy@2y83Wdt@+x`wCvOw`?7}NPJ?Vu>RX4cRtOx8e(Aq9uiDPy%xCT~|Ewaa z2AnL@Yx^;QJwr@f`X>Z2b>rRaP`KH2v3ao=4$M3#4ngo#;XK4l0imlM7}KhRlkg>2~61lOtj_l9y@z_Tno9+M~Zw_hRb_OY083zU!B#YHb#16_K&uH*6A#rI9FQ)GqlG=u@Q*(jA2w`pu?hbSs9_sb&9fu9cPGL zpIM197h?*c`AwdX_yK35E>kyjY>>Y^?oEsHLk_#MCnL#6|E3{-b81+m@MQdxkanwVDFF^4 zNb|#TWS(xTh6Kz@T^%VZ^mqwz0s}xLxmO~Mrcjt7PEbe8`6%e!JAKg4>Fd)#NzZ&@ zKM~m(iaGV&-;;#&TVL{(NkEa`aH3U>KP&E1w^7iapRM)rUokYcp$}o<`#=2P2}Re`>gMBGF(eL#3+V zgvsAAtBTWSPbV*=2|Yljh5BPP(YN}^hBu$JOqxo1&La<6I#b`cmo9Z!6>lCMQeKKb zU#)5RoU+Dx%IkcIRXk)=S?H@Ns^|)f9kOG5p{_Bc2no2|xj;<eJT66yzv>0Exe^_o-nCI->crVN8|o;zv! z@gEE&l%S1DhQpSuCKa@PcAV1E<~Pqd_pZ=>Ekn5)JeG0eqEphQ_E!3A2|nbeqi8s) z5(t*o_Ai787~&Wzm?5$8=Y+?%Os^fVcPP(iN5s-U6I18gzEYSZzh|>_VmmiCU*(>9 z7$0KHN?hvhQeAt+x>aS1@J8I9YwWbJAh^}l9~j+hO21=99p_nv2>kR;5}--UJGS)^ z04PB>5QgJy8>+UawVuaAsy1oP8DMrGHdhbMyZ#KdhF1V@ZM362e=14@cO?devC(m!Bo!v+j?&*MC-9J4g-N4O-ygi!%-##d zk0{>1+ z{7r@p%z{(5F{5^fd&2_ce4>risri>}))U2wKjgkuojwa>p__2a6auF1LtMUG$&(i=7o&;oOsLyXgH0%AeYG1t zt+I!FuEunIpz$gUp5_Sq`F&9$`TeyOL%@gU2wZnp@GC_NM-f>9i5O+Ja4^l zWum$&{=UGn2BCKn9U7@ZSVl`jokMUf z&Q4@4Ov3dDXeo=dn@)(W4B67bJnYs$P{$<}nPd%biTdx?Xh)Je#^u|1C>Hl2#HS2X z$P=B@wVfIOoD$!=eBJ)rOXWyV5c3;(x`Ng)*Iuh*=TG>x-TEeSocc!4m@(d{l$jnq zp#BmA$27$$t%?vnsO*OzlE)V0mbw!3&F7+{=G3LF<(TM4qC~?I%Azf8XzzRH*g{&A z{$Z`E>GQ<(SK=u7I-h15DF#!V(^f z*o2egvVL@i&DeQZGnq+(qRiuH20kv>5r6*bSWh3cp+B8xjgNT+`ep%T2wF7+C^Rq? z6s2EN^>dUs{aClG9yg>JtnE~+`B9fKio)M7 zE&Gy@lM?Yk4W#}&@_|)8RpKc7u~_GNa=b{);Vo#fFR*KyAx@F@c4yKI>Cuf!gqp~Y z`~H?>%@84i7)TeyD%pF+H^6wWqDWoI?^UQZs1*AOqZVi8;_0Xx zQD(GfqhLsfd^-LDd&u0iwAlzH;NpvAjWMBl(_zC*1u-P%)gxrsd09|Q?o`2HV;RPAlWsUQ2b_iVmUVi@s-|^*^lnZP0>E0;SgRZ65}Zu}r1v&M*yamU!H= z;4-~Qq0b(;5pBFiPjD6LtyIaQd9Y7uN^VxVMoe7q>ka)`OJo(G)PLaLQj~iyBA7II z-&-V;?mY`1je;>`PFBE9I`YMK3${i>+n4mm{a0+AM;YsWo3dG5^Xnk=C>QoW$?V~r zG+@c(^gozEzS4*o^I`gxOwQaSQAC6<=bvNcXGz>uP28ofNW6{#OL>Tbi z*S-(90Un3U|4xZWu=?ev_Y0XfxKMU;iO+5(ZEYU+5?8M5 zn?799xaQRsdb4)6eg8>7Grk(>T`|MZN&>6;Flz1hkAc-38>K&80lszHq>x9#xW1;p z_T2$TZR{xZul=aw-Ax;KOWByjkl}Yq3q5w$K4qt418^WVEz50BxWvW${q#RSof3m8 zgz)q&m_CBUk?|{_^YE^WbVMIZ7dO|1J-P3J@e974I-GFn2i8_Qb?%{d8GO9f@Q=wk z{Qh2-*HM7HJ4VG-QJDhT#DWHj2m)yL;q22+Ih*gf2+Bu{W8^BF``YO=${|i^LqwxP zI%u4_wcbC&@30~q*$B2LLk6ttUstL?dsSf1DB-Nn@F<7(&`aPRt=t+mmT!VMD}l3H z@MMp(uMb0m-#bx?URz-AZ*MxjW*ZAtw}knmA#Vvvf2cTI4D$Jg4P4ARZf?Wai`vAt zNGyQ(cQcozxP|SyMIkLRm*=kH_<4NZU6Jp*p$m2caFLK?tNcTUsxX(62MNE;%xLzz z4XWWSU$upm85Uz(TOu;r@o!x@}FwsQTS5lV!+`41H!KcMF0Q* literal 0 HcmV?d00001 diff --git a/app/images/illustrations/item2.svg b/app/images/illustrations/item2.svg new file mode 100644 index 0000000..28c5711 --- /dev/null +++ b/app/images/illustrations/item2.svg @@ -0,0 +1,100 @@ + + + + +Created by potrace 1.10, written by Peter Selinger 2001-2011 + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + diff --git a/app/images/illustrations/item3.png b/app/images/illustrations/item3.png new file mode 100644 index 0000000000000000000000000000000000000000..6c91e1704dfde8fa8e17d738b8f5bbeb7544787a GIT binary patch literal 13578 zcmbVzbyQp3wr_w0f(Mr(!HT*0{}vzUQWiQw&re76LU*z2Vu&S_HIh3wV5!b7PlgsqLYNVm9?yoi@BQ5dv#ME zTT^~BN>LH0ke9%#0DE&cW2l$Cor9}@moVkO{ zC8htZ>$N0IY31hTB*4n*>FLSh$;smAV#&(R&(Hsl3=R(FR|;lVZwEJHFJ=cSgT2%Fe>ZYH$Bf zyZ%M(>ZWS`zs>j`sa@5*oy=KP&0QVcT})s5!-DER%&)%tzbpEO@YNatB^T@0PBFHV zbToChH+OK8lN6?W{e{KM+Dt&2msgsdotKM^mxGOmkDZ;5gF}o@jGdp2SDH^+l3(mU zGX5uCPDwr2j!sYsH6AFPqOqy9!#@@D|8&rQwO7*I z#oEK%OxnfK9{Mj23t0aT7W}_k{$IRi|36-1eKm&lpYZrU!sS0zuQB+~?SBXVYvI3# zkGaF^m~nX>9L!`?UjP7hJ~>G-b+45}eWYx4so7dyZ`Vn<&yA?qG+;0o2_*`gE6)av zijsvuE-x?Nm2PB}jY)&3}K znUUkqIj8?p5vZZ1g*q@WKnX}cyT`2^IvqtrMlRUPl$4j3SHI04REQ;bsu~)bat3Yx zz^d(vuVgeZ_PX0Cfn(9@fWij@QVljGW_Unx@7N|TXq4u%)0!`wDMD=#BDuMpHLTlb z*HeFn1Nj1>T-iH2y(Pk^!A6|qh%85>z`u8FPSz(-zMjZn1z#jF|J(GjrBb|JX#713mr;mX!KE0QQNgN zH9Z=Z?No06@`*v#F;8y-g@q_7cb-A047cj8ZIX?X)Ru zjli3qr=Mt*zTgrNcybWOu}gtKSQ;(V$p*JhWm2J=ktf}YC$fs9u1*_WqD86XwVIWt zvN=b$-cmy}2VMKqSKnGB_3nLrs{FSkU*Z>QmX?-s^gn%SxjJ0F*sNCjva}k~=eW{H zzqK2UBY{cA$HvCU`893X?l@eYOwCu%Cc*rO9fyT5QRjMhyS{&sv`MF0G$K6w=>3E*iguun+YL)*9WC4q7KU(1l0?6P12vD z8p9PcdGXeBMoMm^rl`y@fX0Ef>z%wG3He=)cC#D=*05>aR;NV&s;a4-y!%cQN`;$IbVzCRHuo`_lzeA~y+vcC{txN?~DPLO&#- zUL@qXCjE=*Q0=o(#)}32i;1z@BC^m@O>S?OTnZ+p!-Mj<(%RdL3Er$Xf1jS8=hgI^ z?Uoy`H!hT_{U5W9runRXw<6|?@OU@+8-&?jy-QSE3SDw1dH)ZP=5rvFK*y-_gg?O%+CwIb}J4g zL_6|iCK9k27hF7LJ21wy(j#3i8hQQ($h}Vome9CSDbE(I9|w2YCcj4&VQ*Y|xLIB7a~sO&A-+05a34$32Pum9`~zu5 zaY&Y9oB8u&IO?L0OCACeMwx+Oy~*A3SIa!{odUfxK!P!Wi`qyq+uaxC+z5u@51!A`C+nG*xzGJS4T;kLf z0}4ux^9@2vW+Hx<;_9T}X>#&hYh1{hu9I11+K5@~HY~ za84ykbeHGo5xD*k$%0t~jBlpaI5H}k(2=lcg2S|nBT#Dp=jf{M;@^GubQGOt)iGo$ z6pRDi*|XU-U?7p&fhjxXnXn3>+;`0Hf2SfK3PoQISHn&s$pfOi?hIdaOe<=-YADv{ z4%ijPO;^qyte`rkL1q#VY8(Fytb_cUP(r^+!)mFW0*{X~G&>&85lw@5Czg#LAcPuD z-_=owxTX1mcf1{+{4Z zJ`1YI?Qv44{@xf_>J2Vt%p;@T92t@c0`7k<=Ohw@&flf6=r@l(O%T{FVhr6L;5=$N zlbKJ_?L=s$hB8R!yLb0N&=CCk^D&7N;`t&1ZnKLIli6F1gd}-~CcXJzr&|V6;ltWN z_}ezh1R{JYV%$Iy(dw)ntuaQsH#~l~lEpH=;(+k?r@Y>HK%BuiUkv6YDosz?#J8BV zg?(@7e>$l@j`Sk4L1>kvViG=~c=#fu8uWh0h7MD1?LdMXoT84GbE#b@S1yp-^{-pBl4Ow6gFQqdt>R0DOV&s_(rj^w&m*QRZ`%1xL8;cH(EhV`lv3Iz&ZHL&FZ;zq-HZe)yGUxcRy~06i6?t8VX6ilH;a zxo@Zb#8dPV+FDAg&o3#7JXDR3L6x}) zfjc#w9=UB_exqlp0{FZFi5OIAvm3*c=-C+97O>D;@<%F>&@3wyHsc;Yow}Nnq2^vO zH0iAVAfjO54Cr$|oeUasm=Ws{Zf zM%W2YyNK_jzl2cO=;zR^vIyDO6a#^^gWwpkpeTxqADDM`6&GzIIJE29DhAJZg8-Wn zK-u6(;o8$~zN9uJ15HfFP%@lIC$6k`!t3u0RY#_0b_ps1y@Lv05-?2Aay)3pbg(CR zAhw{aPTBbmOhhbyaLonm-7X_z1DMj%%Nf}U??lEJT2x1*xg_-7H=xlkxJ)J5#l^*u zzVynFXJp|5!2kr2wV1_EUj8w#+rO9PYQDerem&VV=^&)&)VV}H1h9QW(s|*dU$R%k z(ayRk+|Cmtc)2+Yb%JzCuzlbTKmKXN1~W0C%;tBMCIXO@znAx3$4>^{NO>S2bdj4k z>Xg*ERRIiBvcnh8mGX@n1^1IopnmJjG{2g8*Zt-gM~hw`$I1QD;}=ysu+RQ{^*fkN z40(KXmxqJ#zfe{Z-QR`vRm4kR0nTQD&GG;~{v4uj`=Ogx-+S3mm|f_fS8ICmr>QgF zz2$SgZ#2PF4qwQ{FU*ZTLX9=`ssC}Ni3;EW^Zf30K>iE=^1cJ5kjtmJE1%j`YR9}@ z`%AWf^Y(^;>oEr)U-9qQsSl)?TB? zyNLe3q=;V!+Bqx;@eqvH(^ZP_xfs9@z_3c=#PjrGo2|L0}PPtyqR)LmSW z0r=^7D@3_5-PnG^znXS87pb7KZ8tI|57|f|WdN{z*!i>MR|BcUt8-LG!NDC$8g_{g z5x_bu0Tx?y4Cu9J>I#7o{-lG#0LquV*tLI8`(}_7t*xzlZ5cJEulq_<-xcEkT&I6A z#~gSY*MDI~d2sLmiaWNlKoR9}TRqy&ijuJm(FhGco?wp1Qms-0CK+Qvl#KzWs*kY! zvJ2C4LmC*Ywz7HkDDPd{-S70lQy?$|m>92Sem*&x+Rnhhph=bRgW(MDi-!@R=W(A= zC*Xck7Y4g~;}d2OVWb(lTmK%a(Xb@t#q^EVCuq1CJxFJs0|gFdz$(2n){&1b5pqwc zqNmq!zuf(zf64>izoSDUgt`yKe-czvd!WSp)MO+H8b(+n%2Y=M9PNUE#nS3o7t}t$ zhHZ=Xhg>B$vl)wU_mCMT#Ij%ys@u+;tKd^VJ<-qLG8H2}Ir603gw^w(p01tf@D0~) z&()(=Tz!8uD$ku=wsFUyW6654DMs`NLDf%y{Li*0hd78g5$@&-&sctX?_+sgsoI{&uZ!%8QlDK3UDq= z9(puhC((}EPV}XSrhArG-Q}CgjGv+GSd8JS+vsH^ z@H=HH&ogY`TFp+3P3!}(oejk3Yr6%ql@Pw9M`V`>Mb$e=mF8iKEVhG)H{Zv{$3@lw za90jDFNbqVfkO%WG8oa9z71ZO`Jlgl2v$63rpKn9z&?kt2Y8%+~Np2uxEiwPgx}JGQ7~E3ZOOm{7JEE4nG~y8?cG^FH?L zxc{a~TU=Ta{`Ad0Yv656jc23^G*Vuv@(XXl13V*Ak9SDICr>q5_+m}GQOzh-MUBAb zJDSFc@9>xI1H`Cp;*fg}gw_fI*bpICy~sEYIJ^Wf^bEMYf=0E003ssu=O=}?49mPE z7GWMCyeLXyQTZxBHDuvF0!!Pvs`!544O%`I+$8YyQR-8!8 z`%H0voQ==hvZwITr3d2Y?)k3w7Ea`>Nvx?ps^`--qXX2l#K5N@;~BT0NK5#ShY8Rq zP!t$03Ikz3+W9cW7A`jfsqfYpz|EcJ3*rKE_6bN3_ydSh%-8b=%{c6SHkh}{xJ7yJ zZAq~1s#690>=KUR@opE-{e<`vD-(DoB6h@?wKYq$)T?A_v`VbV@-|UD_xhK|K(qs6 zZ=F>$2cSoy>@n2$TYxjP;Uoh`EZsL&UDC2yk8ZT&X@<~r68WSLEjk%W6r6wWF!yEk zH6ef?bOt0$>dkpsZLR+#Uwuq{6Twxle--SctBt+WqxXj=dI#RLXWPnAl_00sz9a?z zNRF}pnkQKq>JJ-;DAxWJ7@8}t?IIYYNi|cZ(`aR9M6$|QZH9$TpCrJ`+j0~9^ziTv z1b+$N$ir4tShzj48gMU{zbi=oM9vH2nY-sWf8^&3_zj8M&gsfF@rPl7N;b|%#&#M#VmU-^l%QQkD zHy28xG=lO$xW4f63Tvs~Ol1gN7)0C0DM4pnaU~!hQDaOQ{q^(`NweFAOnv)9qHq@m z!);>s3&X^f@{BZv7A7FG9{beZ!OuU1UwqLD!{rubmy307I#xun@9!dHmw5=*gFwR` zzSCWuzO-qdKaVcp{g6g(Dp7#3Du2XhFqlMDMrzfSz!n?h@l0>48T*ddNPgE>D4P{u$M1n!h6$@k@k9SZBt7 zs-WT`T*HDH2fDD|{xn{1Z?8861%*XgZqH0$iLQr7^Y5j4(*}hfDI-yf_YE;}WN7UL zBvyAgZg6ZYd{}QI+`=f}W>iCKn|UILi`}~-B7RClMr;ix5e&)lz3+db{P1PC*p8jY zYop6w?UY>(nUpdC(q*|=quQw5#e!fW<3DBv3?jd3+^P@CGOCk{jdpALvE3JOE#*2I zbPT1=mvKfMnU9n$inK*AEw;--qY-z6lJL7(WiH!w^(WnXBEuWP_a6UjS2%4hs40WE z$K;wo5^Pula1EvU8?ZiSzk2{k5yMsg7 z?lrj5Sf(Ddo{#;)kKHMjW6!J}4{8u2M3u~6oo<567vzW~{Al8(0HNXh=_qp7LM`*>y~D=X{l56urn zshN~jvXrCKIs=qQ9S8-z_X(5<)nn27^ZVQcZnhvtro**6K=$BZ4XL!Rh-|Qc%wqpOTS5PZ&37P-7AzcnV_Q=lFPj7DT!e47IioA{cdcrb&7G`-@kh$g=0 zrK#p7=KA9u!34_a=Y!rg{pr%NI`Dg zljSZ!@O=@nl`bB=`M5>{VIB}2>qb(xtuFh9x=8GcNL|e~{N4!f@`n$Le1Jr40x*=5 zYKJfcx`tP{AGe<$PFNir8WhXHp2#~4bFAy$xgf1iyS!oH#A?GzVa-k&F_5}vuVPm_f$jeFLmNhhRsIas`xj=OykMR;4txnEE zZ%9PY*TsUpW?Tz&I#ul(b;m8v;jz*NfEpSa@CIiMq%^066Xej-aR`BDXYl(KQn?@9=x8m*)4%V-Ah%SrhnN*J0m7zQF*g(nW>aj-mz(y#qL6EUcg3z%_G2VKqb7 zvlaEy8OF`Taf8dZUdwI63<9i`gJv!nL@v2eH5Z#swk&$ZJ@^^J>pSi@gy)1H$~ie2 zNRO9RalZ-}EiJgmrarL}taZ-rMcp&tDqjr8j*74=${{?|W9}wvLhE)MPOA6D85q1` zQto?`JIeG#nLdS`CXJ_R#Nf+!AL+RbhlH|(T)2 z5Nd+J-BZpr^{iPXh%SEy&_{9mYQR!kNF`5T%j8R6zOawMagIUv^&tPSlTs@eqhBwdg*KNgnvW!z{z%jQkp;)Y`Ax-eJ zuCICL*c;JGKR>@77<0Y3L!tBltC*6}UP@GKskqx0TcIGall6^XxWTgZVb?Az?|s+H z5n@PybY##_L&xvqLcwTYI(XKG1zF}(uLB@KLK(!snJl~6hea3Vi$=wmtUxdft5-ay zIt^py#iXz(r(;Cw9W)3p&~Re4%E>xvzw!8G;$Yn8x(=)y6p_J@t)F4O@?oLP)e?+> zTuu(WRNz;FWmnER1p8GktH_Op$0Dg}9|n*(Z+n&>7GnI(wXOC*hUYjeZXcni50Ni% z*+Mok1y!_pfPg*})i}E!D)~vbw=<@FaIdIbXvG>I%H~sASRk8mqf8ceT3y%J&%7jq#tAeV+YRLKz z_vKJ#W@c){AQ8}Mn_q3joga9-;kz_@25=~ZX~Lh4s9-wre;0Gb>K=FWAz0wU;xPdS zi~d`#em#&5k3d=pj*2V2_bsItLSz3+e(si7t*k0|+Gf;;|)ofT?cG(>a3! ztHqUMt?{bv+rvQEI18Xx%dllaN}u^_MpACplDA_GAsRDWSa|r42jVzRpLiwNptZHN z*wvpu;6m)&M8o&d``ADf;DJgJ|N#Rg>BsRh& zAMs9xh;On6`F#$~ZByYe$eTB)6lrD=R=wkQYj;18(Bd=fJ>Az?NO|;azQP3HDfITH zbZec?2*Gw+3Po`2r4T6RR4@kKswW@-MKeW(08=ZiA*Hid3JKSQ*V);bgKL9={Saz&cS#qg*$}NkP8yz-7H8&QK$gflp05nxl(o?tL@LufP`3Hg0AJu-a7<_@RevgD49evdm5#&S$Y^;CV zrpr4#GHJ12K1HQW{T_=yr^hQb5EluKU@>IDF#qD?NhTQLHv)Iz=5-US25<~SrnJwT zVLWt*is>%>mj0u@?N5}f00|KhvY43I=srX)Ay*i*jL{v^GfBT>&a~|eN8pV)%}Zpo z)i?&XnbP$WfWN^42eaNWXh&CNL|q=qbGhu)I#~}{n;eO4Y_+U47!M!*fpvft{ZJWm z_EkHmmcXf8SLG<#MCpx|%+(&vEHhS^s6NQ3LS+|(!mQy$k`dJl!gC>Z{fM-?tZ@`L z9r7WqM&JB~M2*b_B{Z4SYsMH^uT}4@1u9q{8z8{IltVVF7K677Z$967Gzd@kJzbq@ z2Q-{dTUy+T1phnd{z|Z$z3o{PyC=%ePFG5#R8sHH4N#?E)R3GE4gN^rlOQ6R>2x0B z`BG-;Scno3HdIWV#w~Fbl5f}@5c0z&^_PxhbO8HrSNZP)+>n$Qx=}4C^zU#*d6>ix znoTN+a4^vS{#xU5AuTvxZEq4y*u`CP{&GL8oCL!(Ws)8%Z7ht=T{HN6HuF%NUZPmD z?IRLTs-;Bq#OqYWNTnFz*AoO6A_L9$GCED9K$EMXPipLTRrAK!Fzor|Qs9cbKi*(! zncDfB=I`FDUS6_nG|0CZ8KY+r^s5Z=169TEFBVv~hD=1S?wdBFQvjXeBb%t!Z?W>W zm?1|ulcyl<4{>QtSNmStpi&a?q)nup`P&>M@u&fZA5|g*hLeuha1&o^`KWz z?}mar4Jt#p2P_NLEX>UxUDV68Y7JuWhjBymJ@Z7EeiRo2qA?x})Z9J~0rfg)t(2z< z2=beP0UR|f9TEH5c5g(DLsr$l(}2qm2GDue>4vL`rXw$898cf)g!m8og;C!i>UC_f z1GV)p1=Uw(P>0PJMwDd=kn$VIYeRa7plVcVZEoc#FI0}F23zDEuG|Ey-yu4D${Cnh zBdEiK8kR7j6Wlg4A$Syu zU1>p36NAYDpRQPRnRy6-^L3tUVaVs}fB^#0OA0iLE*8bo{`}i87w0+TvVw6{kYfQw zY9*G74_qP4bSUm(X`6xNHX{m-gY<}c4}D)^Zn>dyCKWH8(L0=;fR|ep{RB5V;+<>i zSdM8^CjdU^YR=vb0z^W>f#7;0beeKLkA|pq)Wyf@a#bf)3YSyu^`4|#1YF8ClsJc-f-+6e4DK?pz+xP+K+3#XP z+{%iMiwL~$_f@y_Jzk0z0ykqR&ZeRFP_I?>7FlrY$G0|{)sLU-5ISq+#pH3t#H-Z@ zO{-QmTRd(sr4xt{NCn)CK=Lm1YN9elHN0nIXD%o#HCEFOW@zex_+g@`C=D^Y^k3d( zy}iA^=Me@EqmJit%3Pbhp=Cx9cevqq5sJn?xD9*72guATJFxe@{30_Q7ehbiib7+v zFQg4U#G~CEA$LESL6D9kra3_ebIFEU)$c54_bY$@Dy7F#f@(#VHzkZ_Ie}NjL~eFe z;dYKjWKtqHL<|B_dyc15DD#IOBK5NV3N>VzQw6a$4tntYntpD`giYg5x48gkl`PCBDML1@1j`A^C9bMKibB>awil>Z{T+^sS zwz7`_1b~JrRQ9!Oc$aEbTZO9fs8_N(O+%YaN{b`unG0vqM9ju_tmm$o%8)=7R6H6)T+)CK0Swq4`Vnvp zUv2}(M0(qBM|jxbcbi{DeFxn41DI-p8$J~Sd*)=i>kI-WIGAG(jf)X1dz{IyCVMyy*N74XuR$FO2+1j41CLny6CY0eoM@)V?U1>iWN7mONXCqvJDZa4X*|ViU=~Lf8&{ zk#wx<6pBSCh(j>)G{+Fi@(m+xVQA5qMFz~4GuE`ie^Ja^FXMNw#dZ;(IekTs;0__p zx5kP929RhgV!Q^+;^2dRU$bT)1-+N~fjSD1KFXC_y~%HS=`P;zU;K&fTzw^_7M z7dJn~aU=e%Jo{DE0H9kdtw%L`RlYrZqA3}c9<##*4nay|B@idprdVNuLNhqr8PLA{ zVVI`Z7KKviq}Y~6{NmFd_{?Bnw}=n)7A0yLAZjn@vFYR2v{;K0gXDDiPLk{gtCz`% z*qHwG>MfKKxAW`h`SnNk!QSUxwDUA?^G^T3;Fe$hz>R0(7I>>-YBgi{4 z=o|XPcCw(!@7m94-QY&c)`{1JX*iL>>BRr0{@$^qGK_++Z1v+^oscP}`f8PswAB`X zPg7$Uplnnf3_t{!vjdoGW`o%hM4nq=aqF2hVb&GAg)APEPa~6X%J5-F;II-xBaJ1S zSCw=C56#^^%IqS_Y^p$BI7nI|AVKsj3^FfEgT;&jq*g0c3_asrgIeK{W z$qtD%XWj~k$6^J;8A*)rYli^X3R|w#tctS%QPHus9sn+Wu&l*YuA;95sJf3ESSrI8 z<>zX!f+1VGg=#ZV`vU)0=vi*d+KXWil0`+HD(#K73Fz6#^-~3-qS{{9&M~=X9>>zgke!a8sL!%S|cOg32*cuW!6?!2+TVcS-0gz9H z*sCP;w zF0ZQ>LKU9@l;b%>xxnY^%A-7@3&UK80IzOq40=U|a1aXkwd#@uf74QaL$F;`>5`!E z7wi|QQ)Cf@L5xZSpyNSRX{8uM25`7&T^=F_`X91WK%w~q{+$+6{IfL_Cn^Q z_rGW<;;CQJK)7M}entwh+mM^_oUs)< zTU?g1de%+Zg5wI7kmbFAaN*RuC=6k(ZA9yE{Er@}LMioc))|CAA|cYF0QzFlao84# zDmR@54l48Gcglj+*46?4vf8dkY?1p@i6lgIl_@prOXuw>yS>?vGTe0Rl@Eo|he6IP zqj%k8?+e7d86Kb{oT>E#@}9S%wyO!X-L}8qrE__^R1Rx5%0dz!PoHj12W@NFzZMdL z=`7U!;QK#LzptaK5G)%BS+3S=!#jV;8~wVuoGqbj!p+DM;tC%mZ!(O)q}QRHuco9s zq2*W(g)TR_(so>K#}@uDfvcSOLI~z*d^YFdM7xd+>K?p|0Qy5ktbfNCus+SOCCJgD zK9%mHSvh5+JIq`2^Y$ylt<9Q`g^Bn-G_yRmm_ZUrgk69J{&(g{BDA3Kx7 zB3^72NFULUgUEXO4ra_RWyW+UMbcaen>Baq4-=9dAWcIV95D9!`nt!h$naNy(!w54 zR{$(~ety15J|#?RVPO^o>I~V2p^m6?t5UpqX2UTJd!YQpo~Y^Uvs*0cCao zGD!hh`}IO?hgGG^+e{GTfz>=(V1*8amY0NHxRQTbi* z4Nn~z&oOZPy^rLUjwN{!t}iw=dPtIW^aOQU>Ta!-@!>?OTfE?`OKGy zH;#5s@9Ud_gLWS#vbJ(sHt_8UnO4`p>GW|rq4G+)JhZ@peivY9_u#Y${vydTIfIZN z%N|&eOX}dxC=Ibk{l0E97%A-e>7gaAz&Z{JZZ;W6)iLbZM3R+A9W!VgKr-QDZ&HuTpJ za(?7XFQ4y=kz@}MbcP=oz{UN%$~?VD8^&Cte?Sm!(94vQ zGhJb+smM)ps_0DIksOG|V6Un9a>DXtJb`t(Culi|`&Kb`jVHsz7AaUQVC@^;`iC}E zYUS3ixto_Lcwpe4bU#mRtyab=PAjYW;dS{=c*Ga;&o*BCCxlh3V`lR*v}L$+=0Hv0AO z^a3HCzTP|tfE=)7q;c7rdI0Uy!SYvH)F9ni7B&ockgC20=;V1%bX)Th&0&rz5?i?n zMs1`cE7Qtb_~v%{xal()BlHKmj_p5iin?YlboJZ2pU45WbL2i9zZP`2ngx%o2z0Mk zNWj?*?qm3f5r6*JBlxMnp zzE>B-81+bdo?bR`-J8Hc#2^75Nv$w}WoPH+USnw;TPd4w3rm=iO}zmPyN9`#)W}0p z3;g50Is1o&`n7!Hvm<|%XmnoR0lz&uRJJ`RaZhZI*;eH=huZLvp~nOG@WL6I~F=E+vx^n1n6uqnS# z*$}U#<3|6uiLI+=!U^5LNi;9_a0*P-CACby(lTE9xR}mvs{P#EM!e+$;VOD;@E5Ey zXp%1;RcDy6K-hXq$h40|XR!YT(+u}ODY$-?wL>w9B$(Cxr!RWy%i<{fbP@a;VBG4c zl6Ws`4w8`T0+aD=6jo13PDoHOz=QY*GyRZUpFM1WouFQga6gYXwQ`UPcj!6#n& zWU5pD+EX+?&E&yrY2`)B)G(bE0L(Y=;G4~Asu5TCNMw6 zi+kMfRnQ$+ESaF^G4zQ;w6rpIDj$n^##dE=g=%(rd%T!L@HJi`h7VL#8{SC?sec&+XXM?^8CfeJxc z)>8^?FFj(Ro7aLTy9;@tJ+8|wo~#O`zkmPsImUzOSQU9u=$Qs(h2oH&h4dz=riN?? z?LIP|$M?7VS|-!-6KL!1T_iZpW|wGnIMf!2CIO-oR0!(aOz@umT4}0!llxVsf;Kle zb6M5cpl|{6OC(J%7Z5@CMZ;R4ia`kdH6x?ztL$y`l*9cZQPV|y4EsxtM>;{95Zcr3 z^83>ImXLn7AQUNSWU2SJoIsOi2P}wio3@0`lknn05o0IP!baO4g*_>pn{J;aHjxh` zz&J+Hr&}u2Yz29FV#y@Q<}M?5vj8r#Y8|z93Hb?w1hJFLgE^3BV4#Q?2~d%$q@;w& z>G`?+MEfAP6nA7~2ZV{=`8s<^d+J=;OmT~n04JDAlPFd84qs1xIDcKz#qPpgoelJ) zRS5r+Fq!`Ajp~CDf)7=XyhQeiczpD$E6}R*l}*x9C07q%_)F-2)a3Lxg)%=i+3&2 + + + +Created by potrace 1.10, written by Peter Selinger 2001-2011 + + + + + + + + + diff --git a/app/images/illustrations/item4.png b/app/images/illustrations/item4.png new file mode 100644 index 0000000000000000000000000000000000000000..87e75314ce04709d59735fc52b70c2e1366e8508 GIT binary patch literal 20952 zcmaI7b9iP!vo9Lkwr$(CjhWbZV_Os3m^XN%i6*u)v27<4+mqzx+vn_a?jLvG_4Hbe zr|Q>L-Sw>QRjWE$O+^+NfdByv3=CObPD_UllELUwd|{JVEbLs|JUr}7WE^bl9IR|#iHDh;OMsh4fPk{O`WL zYQhvY?(P5qR#q=BFBUIO7H3y$R(5`V{{LWba4>&SFuVCUxtn@3JGoK*H-eOVSlLLcMZ$`EARg&u$z_-z>-zN(#_e!)%ruf2Ov9+}j;FRLy;S-nP z;r~kP?9x2^{OlZj9Bka&Qk=ZJ{A}$1%`4?>?%`dYwz;vVIA}`k$%&e@*p&H+|X9e~SOd zaK9@5$Mh|ozUp35 zsBXOL4~xdH&<&eGPnYl8ZlBg}@$vC!q{gHPI4GWh8NI|S<^JXESWYu^s{fR*ZZyD< zvcWQ|TH6nm?b}5~Ow|dDh+2&aUku#=e+@4-iv4z-eiGxnK!ODhT8cTm`3b=SwI!?n zAQcBbwj5a%OUJ2xBWev0MR8p2%lNdD)xz$Bgd0N)2!yXIBZMb-mVIPeuGQH*NKiGy zf+77GnwnVqjn{7b_19y~DFxroLtliG^Rk%Yz)6JtUC+|t#cQdMNV3b$BYI+!%k`3E z#_D!w&Bht#j!Ggb*Jc1}30mhj=){2c3=$#~S$~cF-gu78&B}R^JHtE32*VxwOk7vU zE?~I?nAI|oih%v`iQFyrBAe4v}$}oiW~=Gc0-5O`frg!6Br_PUU!ESHuZ1O}D`Kccl&4bePHInUW+Es?yy1KZsc}6M6Z})ZSLzPXW zqUqOCo9Jvl?dZz`GY{Q!rIG~xlKX*hKeh-rvrrg1(6fcvDl8=6p%m`F( z={s{3Y`eY9&<-UND%WDzABokB&_ub|&2NYO`C`16L43uC^AbQS=Ep#` zU14R`ADJ)0b%zgnCBp2v=EU0MPA9C0urcJsUxagEVWG;S&B$e8i28C=*0{~}a>*-h z`rHuJ9M7rUB-hdir^QwM%&>0QlhGUU0eFX2k4LV^cZ4NEPf(=<7h17^}_pe|;>EZ(n?9ZTVc7ASE2ate{07cNchx44UF* zw$?cpJIx(^+I@Gb3BT!P$!c8-YaZ2wF(g^(9bYK?FK30(Hc_!xYeY4T4z zd3UgWa?#l`=56=2DC>qUe}`q*B7&*@?q1Z0ELQLWZ*v`hsLb4fzJQ~DX?XuuSXGtw z7ow!J^v~=vY41ZTm{B!?O{IG178Y2w2-?yX|7A(%%!UeG&b1f1j0xPg=)UdI;WMxw zL^k(r7tE35a6p1KNKSTNOOYvLgb zCXo;Nc-eJul>{Q0jzz1q02rI9Cdk8=p%6mqojrA=2W&ex=|Vdj$#gqB2qwbsQ#*X@ zZJ?0hh4IMk&;^phB^xU5tV&v#F6-bj>ST%ZT%d!q2 zD0g4|SYYNB>%3ue3d}dOM**nqB9rA90L}5h*-IQu;1jVyibZW|Gey>F z+k&m8;D+lavw>tD@zGSD>jtx3tJvYMj;i)T9p{%3Q=Xiqem-<_d4BM}hFZ(KQZmx> z!&~APt|Jb4#rz4@UgMi*=7aXr$lo1mCMKq!CnNmC6q_8APz8AZ-oZi} z!Q0N;*v4-m%F!Cj5Mgk|KbR+vhPlBF3`2Uf8<;cXLf3~hrsy%&axD3zQa?dl z$+8sl6(*B6-C8)B)ZYOA_^`MOV_S0P{!o5W@|WT*iKi`S)lZP!X<_SL!+f6G#$Q0F zTcr7i>2t{g<>W#XDcqY^9tsly;hWB@jG$h9Y*+$4)K?Yqx7?e`176PkCJzBrlOX>M zA}i%)6|+aNQEHUXwC16QjYNFixP!|PI*cMVK!$2rx-F5g6y2Y0w2g!;b1T|tdh2z! zbZyN5fi5vB`T?rdc7T2c%Jbnd{x6wW@9;B@)vNZE!wg`2atd`w#YSg2wUOA0o$5?lP#GM06yt?1u@N2?D~-*ZS(=l+`9 zYVcpHAVy>5IGUt`)EXN9YU+Po-?HI3nLZ=ACcSaIX72Xo=r>bWJojf|4t)!k5xiAl zvv_8oY7O_)&S{2;MW>;^cjY|8Gw41c3dbRuEE*&^$8l^ytrIMB*y4_YQQMvj z|NO*Zs=Se-)ff=UN@J);L*pAo*v0J<-?>F&kc8Zbe8~`6)(b9j=>Y?gH)!-wA(Qmn6WJkf;fk`N8WKLHg)i6=1wB^cSb4fM&xN>FJu)F zuxPFOy7OH6Nucf%#8Xs;&35^kLW+b9eE(BLlXCyS8Q~&7W+lYWvBLRW+zQ!7mK6{z_?-k z27BJLNrbe8LhmX<(={dcK`@b{gl2}-X{08-q1J=t&<)v#HjEa6)>~D8q`!tpF6l>- zr6oU6zjswkNdA3%(k26L2;cn=9{hNZm9Q=52rM4s4O5=Pqx@seE(*)bRO z+P%+rLwE=56%QLFWz&P2Ifdl|*gCxSKCG4oSu?qfqv@%L^EO@jA9Nf;(dy!->4EEX zm;}xZGYvE9^eH}lKYhh$Uiglra0KEM^RrUPTaMk>EFnNNkL!^{`yNS_*=oxK@P^>1 zh5HznH=%KOgQ|n|UNKh)b<8d{xf`h{K$hcmpaa3u0EkhJOK58v&TqL-efWD7sRf^S zL}A_>y`UgXN)D+ahAXoXVpBz-`OD=OCRkek4(E~XaBjdj1$hjP&SvPLWtK6@b0WH8 z)wzTt*k;hYN+B`Y?s)MjO=tcoZU*5Cu0JR+LF&5PP4c$*h*#?@Lb*pp zVF#x2=vN;ATeR72qjDGLclbzJw2D&AkV?$;AgjA2aB{M0CeJtnS2o27?UFpP7|g~C z|1^-~NkkuP9bsKi<;L8Yl=WbZ9o?hl3HD#V;* zRHxs@)l0vH$Fa4{WfH7N=}{MGZF-2i+?g@Mm_;dxjSG7(~$|RY=5@OblT?bLOkaNW`%A$eq8D! zcdT5N><^~edkVjnrk@;pLygS))hws*UNCr#Mumg?C|c^%IYTz+!RpE2u575@P6mi2 z5E|RfIf8xCs!^W>S!thCEJ|wya{7y})k(ndU@cbZ3Ec|8{mj$>vO!SU3=xn6qKFkg z3DUW}!=82uCcUA^(B}>Pm1Tm|OQTaMtq#SNYWh6OV-E=dHzL4^wQNBp2-I(9RHTl| z5ci+1%7H(;lb|}uh2mdB6#s>X6i=tW`LU1G zS!gW){=EP^%SQTFE!bF+1X^%Y3{i<{*Z@rnUf@=n>{I17K2KLO%WNe+UN5z<<8@N_ z0pvPXgLGNtlLoF$A0~j~e#C1Vd3ZWykb+S%|JZ(HrUrt!HcXF|hxGOpWJfDr>clp}4h!p74!PnMv1ECSdr{M0Pe?hlvo8ok4`%JIb> zTg~jH9#aF(EWcL*erc0u4k~CVM>0HF@1PK&E?uUy*3ha&)GkUkn+^rjOG(V>PTD8G zv4nDMMld;c;Zw8m>tn@<n_EKg2Ju}P?HU|Zu)afhf8JV6NOCMJXUIu6LNtER4P0lHBIVD* z3M))GTqwwCsmib|k#qB5czU_zL#*_IecOK_;=MhFOQMp~N-$gWGK>DK$AH*6peGq9 zEu&E;-c7`=@Dtd9n7-2nR=?`+W;6nZs<#yAe+gjz1NK9|(NP@A_&&*8d8V0U7E_dj zhG>B^Ks8foNi=x;>MbgWp8jhVU7S|DL?7(3ud#;CElKay4d1k-3_PmuEg1usjsweb z60Zff|24kJ=1Jo)fA#V&P_0r^Bi}$lqM6{y->8RXM=Pw`otbWc#se zVwjw+Sfl~ez6>~DA^H(kC*$OBn**{f>+38jGcmo5N-D}9#^U>wpUc(iOdev^4C$^t z&5*1v3r?52xDuZ(M7BU)`!wEXH3R8=*X_9MWDhLWS)h3n1Em~?*_zHbrJAPQz+`ZG zhJMoP`3_zlZ3nMko#?<0>k)O61#32GnyAkSvdzB=Da@ho+$^&vtY<^WDr;?&|GoJA zP6G8q1UW|nAtgL(Mgh|!sSoy4PSor_m=)>2Y5=& zg~yhyasQJ~!~tBTMABpccwTZn$sek%{!_6Z`K6vefO``YgGXqUehW>;m*VWbF@NY! z{8|J8`I5etz|BEv@4*v@i95-cIaEfO9ULgUBTX^FeARAOSTgO0}F~vAjH;Ps>B>W#kvZW#ld7Fz*p|{fdxqV2OR#1GC!YYVVo-C70;`e(r;9KTk zkfF(s-6)g7`vUN9b3d6Nq1F(VaaPn?kPsZ6V2elAU`u1m%a{7t2Bu9*U(`qIiOr`~ zjQ{eN*)Fx5o#G&4?KJa{=#G4g&#KoSH@>QqW0Y=fvn`gUo2o9{ zfZ-bs@Q{x2kt=g7w{~PWi1YCME_P+^D8KTytd9 zxeeGHF!2DPJszLbT+I|OEYHnhl}fMb6@zAy{~@#D=m)m6SO5-6z;)?+m@u0Q#3^?o zxOp+!e@M#oX4PCY<3CTX5>FVLfbQ_T5GdYO`Cao-G~S17UkOv3S3r~^hum#ua|>)d zL`L_^i9(OGUzvJ*gT*lc?JbFvK&tkm4{OE^SGErRc*VF#*b0t^-c;fd1v6J(t`ob| zL*=10Ejq3T@@?P24r2`ahV`L!^g24K#d&c-j^LY%`?qa%M8DiF8l`a27hy7;jwV%R z<2Jk)a6bOjn+zY&0 zbf9OnI4sm9B?pY4E;F(~2u+~MiUn^;70VDC+4$pMCO&gJ_CLx?VKr4&5lAb9NZL?$lPOWO@_iiA7wxqkQz6wjqjmU}Tl3(4rw&6lP>_MKgVMF71fzid^o5;NY03uN>CNuTgRt$2yU^Za zR$8s8ZC-{&jqVj#dP#w2-JWmhKU0BGeeZ9;62sB(=CFgA+gCDTddC90S*%eZ<3WLS zrSuJ*kC83;_$7cHe&bfcsWUGI|CiaNLDXCYlaWJM8djyRxz6E`g_=i+&p6|&sq>vM zVDN)WkXl7MI{y@6{z`9gK6!WxM!$W?l+}Ri1To|uc<~dkauZap#_v)*5rLmkCN`XV z0M1&Y{!jpK^br!)qMXHNrOl)PUAz-g=t^RF|E)<5lLB_Jqp7@%-C4aVlB+%t7cNv8 z8JFT`S0XmQ`b|DBSs@);-EL&Xs%qXU1)$CbcgJ3TaR z{!3rPo*ro)L!njoCUDMkqq0`0o_sX7-iLP6xM6zI9?*~%oKyLegWY^b$iKUj981U7 zlA$#dWH91H$)-2ACD_(3VI7F7T<|3z5zIVOVjVEYXkf^p{!IeB7_;xl-h#!l(vZA~ zUv1~zN(^)sU~`=@g6kZr(PD8%_c2r0-}8qEa5lDxc@eKM)nydBeXuzcIwHxU>iRTC zMQeLB^2k5S7ie2pjza+5)A&g*90rTcdb-Fn`cGFcr5^oHR$xC+c}(|vcAH!gNxdi( z%jXSG6DeG$)?L-$4bccSq1nuy>i4&V!ZjcT7rM;vJte4{x2&5Cb{wMS~W-O7P-E%K-YYpPJ1lYa`rZO4P5+xvIVv?Cll? zqvOnGq6Z9~U#0hqteImUkO%8m2&H{@;;)BR>|~r1pTXp>+)C_%?A8ov?at#gbabVI zuWb@19V2kWzckZ9zq4^w)!x0@pN!sZA= z2|6^(ExQPE0{ryz#Jao?8_95~aeqasid≀H3k65)oPEw~2<4X(MxCVFp;y@qCAN z0+BswQMU>+XtP0)zFiTQS$iV46RKhY^e-xur_@?Qq6=izYItkFtp{ zJfMqBwzvGVM9fc{o;C2lJv|@-?8mj{4-l%zf$43Z1O5+E$o;X?C*;}<2PMG>@>;Kc z9J0w)SJ$NGWT2tSr@#RrK*=iR&s6U`k$?E^QkOQb)S7yK@PaljDDxfpoQbvkx*g16 zC>bR}UHLQ_-Vj?X@NI6F#7xg5fqP7}2~H(&CuD*IFDnm8<^!6Qh zPbC{q8tyYCKyO`eGqk*#fcz`i@=x!5kH zqT7+l5nJ(0i?VYDR4vYqo2euF-V!5NoQEA2#c%CD?Vj3E-u-MjOKdYAa;d{x|G6xC zYK?ufoXQ;ubd^LFjnKMiz2=ykt$Sqh3<`JrfUG*QmWXg1vKVrua>exCi zWZEujJzx5B9FOC~_VIU1M13mfEG^ZLP&^|T7s4XmnpnleP0uH()6!~W&Uhm3t$HK~ zwW%8__bdqE`_g0>Gcqovmme7D+zW{c%SU>c=odd?jOMjEyUmB~8^fV@GUMZVDWl%+ zZe9T-l<2PX2T-lh57!nbw{MPdM%~lv&)APIHXF?a1yVE^az4 zwvB5yoO?HkQv%?^141Z2nf*J=t56xNY9%EY>xR`KLbL4;9-+icn$uopVPJk?_!i+@ z8xX>SD6v8=hpb4ZSi3~L?TlIP`_tF@--G7K{Yd~C@q2!2s-i+Co^&s9DdP_Qq2!Ah zR2l@oL*7mJBG{;&(K81xz)Vfl-a8j?c_=)^W{kd;P1i!7elfEa(Nk^sgq zjM8GsDO_{U_E}%fSSG^8WP1PmhUP0uj%cm@4~S;28tGd!K4$M?%fcYZZi}!@E_yk#(3wxr`+7oFR2^M>yaZ9BmAPoV|ZJy&yEKMz|mzGhbf^s14ux z6;q_+sKnE{xAUB!HGycu36pXQ0%O=Sw3L(b(=5^23W30!i$zLm{)&~k` zeIr6Et>9K|2NCmZ(Po1>O@t!k-h$iq!zg9U{Z$%Oa0w~K0jI%UBLN1H1P+U+8u1VB zOpz1=9t;TGO0U2i8A6^zQDHY4dy!5ER;IIUTK5)vBcgyOTV_oz`{Q5<+2hP%5ZR9$ ziL;6i6cKjbgrkjvG{<7)X{!N{-%Dv^aS=((z1b=+AmIA$u1!pF`Ku>z4Z(OxU(~kK zsN!I=9<1fH+zwwl+{gd+yjkX|c?U)G{YEuKN`s8gimRo(tiInnY#}x~Q(^emDuox! z5>F|<&XJqY0Xba@_rEN9_lx3ox!VkZZ&o@{t4G6l!4P}!tlKWrvJ(qSR<|z6qdCB{ zkldE8J1R6IC0L01AvdU;fDVutNnw&l)jhO9sJgpQ$CKJsQM(2L4V$X&0O>sMT9x5a!NRazQ`Lzn`hPZ1=u7$qMF%!04-w9-B^WvYNc9nZs)B{;a>xHy%dp9yaOtu31JgOP%We}l-VQNr) zMrMWCG?S96%Iq@-)ZgZjfL!uLf2~tu?ZPYCq%u-e^q{4$3yBXC`P{eO<b^{_riPtj-g1>+%XGDo{BL%#m{+T@f_|xXv z?>}8i0^ZUt<=DjAi`Letv}d%s*3fGih=p*0S{z=-&Zf6uO{RBTWMK>yJ(j$Sa3CSJ zCHKo@fFIAfJ;ssfl(9;Os)_yg?6SoqpUoR$YdFHeAJpRe)s51Al^@%swo|7XM$q&E z={3%3;6~6SLeSVi^I>7f4NYoYPfvnw`Zd~e86au*bY zALLarD&-maVb+A9K9FYwQrnmjYPY^Z53YSxB#8ol06IU^YDdhnNf7?AV)atVz~vOE z!CHboL8NG4IW}mN1BMGSqR@arDDBQ|C~V}0HYrvlc2}VCp_WFMteLNmNNhcqK2>Ne zmgk<@(`oBG?N_GXv1AVo$TXo?NGf1+d(kFpR>c~82)ud_q1E{512=3^pOj0Z<+Q(H zsOY+F{}C%5M!Q?ewz_0h=NA}O?lTVEr%*;>Nml07$S_DgSx8G~r)g{CG<7ylwtL#g z^XWJY{^XJQHx#OvuZsHf;G%tyd95&yp+#Mo>cJg>5>Lw z-|kYBzJR~swd;h?^1&tv61tX@oFQ)kMk*OP_0$PYI8HAuL@~idHNNA;jFS~Vd|lBC z#hdZ%2sOhnIcz??Jl`Q)8eo;FKn&l-D2fS9IA78i)wKn8{U?HfaU=SALMoPcDQfwe zH*&T<#}14v5b7N6)HiKzcxT%oEV)1oY-+|B?BtZXb*c2)z-uyQusp2jmh9=^R}fbg zEz6>Cl2-;IOyYe3LF*$8No9x$-NkZB0LR$Rh_*@duMKJ?kl zUa8&GIfgRucwz6Aw!%7WGLzK5r+E<{z68ryhK3&bXXJ(tLY8(adKKl30-T$IL97@+ z{jfxhN{*w^EqQ($HR|GXn7}@@5jCG_B7F3@C5Aqx&{OyP`@e7Kp{i_B+*&RvDJG+D z6`B?l#Qcad__f1d9vj!+a>V7JwfC2^m)r zt>aP$!O*0qgQq6$L>H~_lC+^kP|70e^Os|^kAFw-41!lgpr)R?sI?4E z4?YrX@(({P#!r(pHN747j^3+nAT=2l5@g2kz;{p^-NDxw>f&cS5S9s zr^b=q8?q!i;BZzvAwhmWAQVoQC!P!^vv|(-Pl9k{`fma;FB!jhLg>KvI9~;Jw;yVH z^y%TCpy)(RA_a?3u#jAyGD$uJ(A2U?%*#;$p95cK6s-^h(YMbctNj^zRO41VIbcc)K+gS9gpsDi*x`7SNTIW3xzP^qb1_Og-aasWaaQ%b?gsx_n4pm0TXy?umDC*B1%wdJuk3qJ zaRMDg+qZdlYjObVnP)E_c&Ni1rji$@roo$QF~bzpn`4W3QyJM20Y+pVY9aC^^0z_l z=pcJ;%Kz*?+_jbv*HT)fpdrC5kZH!DG)^mP7~xA4Pp+e> zxVX4s<&0KwXrw|3eBkpp6oIAarv%=22v_7DFkS{NDdLfDl_#YkJz)n3YN9P2g;RGP z;n7O36&Sp74bG(J4(%vM)S{z-ylh}x`)a<6PU`_`CU5rPno;J21(4hmzq=8_JbdbB z$kv!VKa=0=?Ts7Od^r{kg1_7H2BQpid^1*^^yw`;|^%dRd^T@5Lat2V2<6Vwoin%F& z`yI}L)M)h>43SOp34l0TL-Li7VSNDEi6;lGdIXNi83rvybsfl7VTJ+Gspqso*zEb@ zY6{GlOft(0o${xQh_GREghnzD=f&^MM4%(9E%C$v&+se3SJcFqBx)$I`i3NQ{~GQq zf^lSOYHJf8kpCNMO=7rbH+Jph+H%uj#k3<|_=hW4SSD4gbUq3u=9PIy>|=ocD2{^X z>}K=XK=Y9vKDqVKw{>$s-Jw$k1U9?@1F9I%@?MNa{+D_(W*N3Z>-tC$;y@(wo7KPP zn`JMUjZ!^u$6^2$_o87~X$2UOQvenZcNH|MD_y$TPU!NuLkDiZ-aPRRB9})JyM=6x zOF;DWTWyw)3IxLD_*RB2dCy@Y6I~gzO_LIODrO@C^<+AnEI2!u2b;|du<~#`^Sgli zUp3b4Z}!D(3t3ro4E?)XKY$+W#lnkcMR7X}Pj5_nV-X!{!eV`d2#?too$%b3r0!#0 z^o0C9htqtpQE$YZg@0Dx9D<@CC%x+ZQbQA|q~l=YtAN;HKx8tq#2-Ddv@NLjzFkk} z4b$BgQ+fQ@LZQXT01p{aC~vxb;3u+~``v+{GwHvgUCqML4on`Ns&E|VhhP}i_=;#$ z_S*cCXxUKd$rPcd=8b+j$mK*}I@WJklOV()cEf%kC=Ri*ZBCH?F zp<&xF3Lp#|)^Gn}Ij4o(Vr7cqe}e6rD&K`rV|OAz6P-A-NMnp%ip~{ww7RF!{MLFx zMm`n`Yw_+4&CDKIu*%40ggPfKNbP5|-#7yf-l+7*8S6AK+X(a7bmZy_OPCfMXj7@~ zaE*(SM=2P<-v*T8fE=@*QLh;gvpFJx?{Cn!M%Q_(4o;HBD%T3wu$Y-EHYuL>i~#*n zU)H&h{l0UPzfhez00hgrwq1-mWRp=vTj_y&+@mC_X(9DaWi%pxLhIHu6DXXn zKxy|Po&%|5bT$DbC@YsSbtH1YhgU-N-~TA%c)m^X6c~lE>F#dE89ks@CGV!uYmVvE z82RYi*;Tf1TK=A7%Z_7v=)dZ=f!7LFXH1u)-514eER^|XlqLm6Z&f4aQMVSemo~1l z)ASZ&BDv{G=jq?uD>zeSnG(A^P*2wCnW`YRL|^~fXoeEfyzs*PpFj;3d4@^P;GyFL z)lNbh>aCf5g8^DdN01j{+HH$C8Cr0mWR$?Pz*$v#7z}cyV0L=(Ko&o13!g{d_=f3K zPh9*~*t9Rbf&$VXYZz8?F!fZ3Mt7}n$;t)SR{%cz(ntmB+geG0?k!qTu2_%()YE2xX= zou@a`ktA}8xv)h{T9u6e4L4hB)*K}ozNdejeY?J!-2rd0y6`LmX9^;_SIa{aRHMmONuf5FjM6ta`%_T#|{c@ZwjzASh>z3(ov!#ey!1gX8@)?c36s^fQ zkzxd@)$z>*{c^gjXr@Ure(6a3Kp0F+=QPJ}CxF@A=x-;6sGtpFq{gq)Cx8=B<`%p4 zRNfPIOzO{OT4p#7|7Sq!dHp!p3p5rMmjCL^3|rrY=l7V6eHx)D8cdg^7Au)}7P;TQ zHVv6|VziP&H_k&$UjF^$bksdBJRl$I_c9AgcjE+zLr>D2TT6?rO^EkG>s+|AG0eYm z8N`{{P);)yIaIV;CS^V+N!eSZoJ&b6hG!N=2Ejo66idlqds^FQbGs78wo!%OK=YoT zpD%1~#;L5V3}0GW(oGKPi~$Od?}x5?bqUya@BB!BawQ+W91T%bfbuDz&uY~ZZElZlim}-Vq&POSDV0}a502D9)1Sp8PRu=#{W9?KN#%~#Zu^sU3B zzL@@sn0!y0e+-^EdvKtg!Dbh+uhgLH2~c1cC4k8ENT;V?_&(`X_mo}W z&6-<{=DiM?E;dU=WX}GZSsab~?Xj-kwGd5euC(G$@5X#pEGavNxH8l@~S zTw{0j&4mh0R;d|JdY#g;3r6my;l;$H$CG%CNK%melanr^9+Zyy*|z@7qx&7{zz%hX zd8``5Ln|J0E8YV1$PuGSc55M%&Ju6v*h9++*-0eE+Z~(6r~M3LTzzn6iC?O-ZWIU@ zb1Yy9Lsgh|rKyQWYIk+ocdQ%1+pe{@IBO5e#5yLJHZ2c^6_Zj?1R6J3#RqM)y4YV2 z9~uY#BnkY8mwhUiWiS(>OG)6{>y&=%X}I$6C*Y#Ybhsh5z;8~TRD~-yrjNy95MYjV zh0vHqtKhAxCm!|+ljl!Z)cre7V%J!r^664)Ufz$~U-2_H#Zv6)NasiMS0p`F^s;2I zSMN+-VaX5hP#h3~|7tbzOxQGO#PWqDwEqN8tkbklbS-w12o94iRr=p^r}vtq6p2G= zWQ8WCyi_c#mL6;)3GFD2QmxC8asv8vj?+KZ^ptdJs_F7SS4NH)Hl~s3F;>S%#piMZ zotR=n7@?D$BNoIf>db}^Qd*%_oNx~>SOB)3-}&pL%YHE@e0!m)h$$yLX!zr*r15xJ z08xburp=dT--FRhw54Iyz2BNpwutfWK>vK^qh&L(Ydf49|ftc%E&{I##@ZBrKZ@atJV_qcCh|$tpMtsk;4`s(9 z?zm0lglwDJHnx-1xB~*FVt9OMJ`QY|0*eD$ZBl<7TzVj8G`cK#WnnNpPh7j^0x)=k zbfzl~M85H_3=!PAmmQf=vF=&MZpfi~RWWn^OT0=W;*97ID{sX)3pr!g)H9sP=sTF+ zanm9Cd}%)L@Li}lL&*B$uXmZA4F_tUYtAe?2BtCEfHq{iFU&RD2B6v1ENauTCCy>lg^_vQp1yy^QZc0Vx%IfAE8b zJ|5kpe-65=hh=bhwtaK=Et>YAcmwp2%c)F-l$4Y>KHs_t>)f_K`PTi(V#m^I%1>)5D5$Rz!QWym&n2TY=gFEpG6dr4?ACzsQhyR|zWo#iaYTqQ{t8EC zfuR@Fz9d$&2qIuGa<0d?oeLeCmMysyHR3I)CIww^Z|bC}{K|s%H+jPSO)=(pH64Yp za}6-?x6#yGEv6VY1e8CJ*ZDmC#*0tza1`7UU9}i(cO^P*T5Un3$-N3AZ?}v~X(~g} zkXQ3t2MbKjaip#DyQBwzdMnJ6lCr?`_4Q?wY5W%%8`e(JepeP(wut&G2~v=aeW}k@ zzeUcsTYe|3gB4$CnmTJZnY$|$fA%*iqQ=b-R*%bv&gFQF!4ZUGKE=A~Nb);_irK=-s^;qAUp_|b*Kwrb?>)4p1v@D@ zRW2O8)Kahpo!o#y`MC#2D@{-*b%nf~!;r`9Z{axr@mV%m*?PJ@)<0Q&Y`KaHO~WB3 zY0kuu@`(p(tY#62hl1+9kD;a1JPHwp90KVQrLIzq={EB|?aco8rK+?&Q`;Ux{!n#9st1*qb+n*^C z1gEh^XWwAYx)e?0ZoHCm0nGMLTL+FZAL}zLof=XRtRUSCija0i34S~zeGBCk9PFLT z?UJxWl4Ta`P7TfIg3ye=V9-DKTsnx|I#Febr=d>7f-nB*K|4_4l9cuk;Nll)K%`w! z;e>StXc_!88b5Cp9i^wTq~H<{wWAAtNKC5kK!^CBs+%Y?FpAa#ME6L4gnu>}94DY#&@^WZ6`qOui>vCK*csAyR|p3XI$rX`Ag z@VoAt_kArLG*9Fg4cnaL-Bl4CQ{w*3Vk}q;Kk%>|{H^duOrvF5FsDZ$qrYJTQM}S7 z>a}+dI(;AAA7a&XQ^ltm*;97W6X=y?0i23~0gPqG7WR<_IR#T{hA}3ADrH9I(E9G< zN)BjVmvTCKAt}tqG4>#&uX9$tzn=7fA84_U1k5qlcO*UJTNYi%Y!3FFDa6(U(ga9x zLgCFoP-MselCF&MT78aQ3=)lp^dG@CO#^s1E&7}nxD`V(NzP1u+xAK(ggy-wO$_Hq ztx1UzlokrFt|s3FH%(JP36eSRzyMdO1vlgDlbJYLUP-2;>Ow zM!&55OP#+y3wZNF_CjZ2!`UvqAsIsw(Sdl`0Afv@qI4gzQt1XeD5^?Ys17Ap;&Oz= zS!y;*pex_}D+ZIoD;Vg)$jb3=O+8)_3jUftKxRw;FX~^WcU2-k;h^Tfd|0G0BDU*Q zVNX1c+H7yM@~kMMUhO4qI@7E6>&9g8hx#oA3`sUVss$4#GGqv(2M)r@4!TO=6{<7v zUcUYOy44Ph&OWp0!rS-gN|&ldjpjgPs){Ii@}!Tg+=IVY>2x(^SwW~_O~(V>8G?GV z=zDef59Yg^*^08nn)FUo&nYUVBb|s{$5HTAz;=;s+PdjNB zIw)ZM{g;`8lpz%T`|M@^KB7Uq41Q2B*;Lqta!;ti6O2{~W;So)k$CM$i2G!=@KnDE zEwnJ=cL)Jvod|}N>ZXl;mkc5GfXk6s0J#-u3)=jx&l zk7UUH=ZXu-#V(?bFsdU)ZO@gj*vxQJ*l5*Qi1a9F@AIHw_Glc0TilpBUHnh8$K3)N z)VCFT&U2ME46F*>_|n47jKVe#Lb zT6y>=O(Jo!&o3kFQ8GhrOM%_5ZqK1AvGUQpeSiVhufvrR#+Gyp<^Ht=`PLpgl_AS~ zbSk@Q}*dAe=T9>0|yn9ikx$$1RY}1Qx2x3TT!kjOF?GNHBE<)t2?} zIIr7rcc;B&jwLkcZ#V1avw2u+eeTHfKM}1_UI{?g?-N*(_u}Czr$}@j@W&=WXBRt< zv5@U93O$qLQ`xYmWaQ)_3Vzxn2pjkJT3P#AK`;8?T4xRZm|Wk3!G{l%<;wXQq4sxyIji zQd+)$6*bDc+TQ$gunR3Q*{+I|YdkGcs!38VbcJ45^+Uom&(e*&sQgz`#~i|#TXx{m z7%^f5tXjJg5~scNV1fVE4+-3R7s@WKk$2 z%YtkauFVJWJWQTEnTT}DhaZ0U%Wd24dbhGA1=2iM!C=h-)=M?ogFG}!&;?zPcII)5 z74TAMW`*kwD0Iw+vBn=q-LusdDNEp}^nVP;`DZ}nn^=um1@ajx11p)H8o(|dhI+@# zkmz0x8Qhg%)+RFxk3Y)yFGYnN0)s(E={j%AWeV#6+%}ST)vEV~4I4Ie-@bh-iwYmU zyP+Z5kgOd7E^oBqK~mSkLg~D$2wm(H1(B4sL^#-bFQjXhv%0nYRfbBfloA_@{C@$v zYCZUTKG19RRDzzmFS4TM~9 zB$YIRsZ*!YvCNdA6LTtp!{LC6iVE1ZYZvU;@gC$Cy#Pk{LKvjD2u#Xs79WAwmwh98 z#2QGkSZvA3$=~(~a3%i4F#zLLh`V^!i`+AJm2aK%`!v-Or6TB8=OQcwEK^jJ=ccF{ z3xTfZUDHL}?M_yxjR5QM*CXF*l0Xa+h)L;+tl1?6b9dnbab76RyDx<;MXFI|2~~rs z^sk2sc$~EfRp5Vf=FB;A!37umIyX00#N+rXkjfg-u6G32QHfG7YxL;RBXJ$)Oq@6| zedETBuz&wIaJcGS(0Io{5_di%@k_ygqMW3#Pliw!s>0*pj*-OOXfPOrJ_By#NKa4q zt^C2#+h6m(_E!F`_n$Tj^QP(e9B^>?2n8o3!3s#=hlJxsxgNt!QqU+nK6F(A(WvcsACC)o^+pYl6)?D$D@bMu|}QYMjZYVo7b6{s-!!Nqc~a`bB;Q@ilAHMn{#O_WlQxywh!`vPc$FQFmu3Gx&>n`a7C z$;!%FzhJ?FU*J`Uicimva*rpiyuAE^Lx&DsfdHO;khvl7MFgA+lcT>JW?KHi0O=nis2{l_R^{FM^biO4oO=so{K9 zKcFkXC3=u;xEv+zlaf7nfW;!}GyunapFySaK1K(OMk6zAAy5I8s;x*3uC`b#2m11! z=ss#{YRvih`IqAf`{VpQRntr@S1}JKf%jym8S!$5&H?l5FDKF-eCuFwXuB-n)Gu%T{|)Lrs41)fR4qCyt)tp5cS z#}7ErvV{&Dhl0Qlfm8YcwSGAB%rhZ3H`kGpl5!hL*T(_+*NsSa;BDKs-L-!G`a7LR z7eTh-CroMUOc77OO?brp7BuRf_#5)un^v!0Ei0vA7`gf8o1KGBPrr8aZ;L zD?QUR>u8}@rST5x5=Ww=Mg$F%xn5(1+)fT$jww&6nq@FQ=?xb6>>q$p-*mzp3ETrd zMH!Q_mtTH4%$PA_AL0S;f-SHWkP5&#=bS@j=HJ2}&Bg0bEZr+f zO*{?0T(f4)%%v9(I%NvbyRC0L=_BFK!tk|v|1JO zdd-?O>t2+ymjG4ejL|`S_5AbC|L~F@&6@5TcK?b4{!7>I_gp9L4_tyL$MsZ&v)XF4 z-aUW*eCEK4%DnaA^WHaZ7Qi>fUDvXyC`LzW$FW|sB#q}MzXN79&Dz?_`==ym&E%Dt`RQC!c(L^ytwc0f%F)lGCn6VBfW5$r9VV zdGjDz){njf?sKE_#K*pR0lHkPfNH*W1g)Jqm%$9{bC9ea*6$Hoy;3kx+ExlrgG$Yl z<$$g~4ygM_P$CzH!Gi}wQBl#cy1Kf15YYFKeVGD%BI6|nGH@SH&En4+G!&LLl>vB9 z6Cz3e@m zvk-9UBHMmsUEOGoz6^Gy0FY}ZE^c&pC2)o$vW_<(NMC`$x|K*9Mnk6l5?Gl0Aq+;) zdIz$kRY)GF zO;}o4($%Cx0Y>M}pw4FVB z_MgU$8@DMA#TW-J4tL(!wwpZ)Pqz~IqGh6`pcVos`PQ9c6&&UM2*t{uKz`s#DDpfF zjY0vlYv_W>qxAbd#WB4{x$kwbDc@&&aQgJ=_b*+#^e#DbvA!=OS}xzye(rxBZ}_%k z{fHT^emo#aL2C8cz{YKWM)3=Q1-2q;=W5Cl--&6v$e%n^V`IJC61Kw)7al$Di1b@iuEW_ukxE)ERb zD6lG)LJ}+mqsGKsp1zZWZxTHq(As@=D1kfJYokVudgU#&O6pymdLGr^>i~s_varEfXdm-}Ljop1uq7n#P%AB2u()fa!nwk~(+H{Y{BPCV@(ErgXtMI2C`w(Dw8y+}K%M%ZOz9#Q>#9|&%BM}6 zwj6(auvcahx0?d4p`@gQu9S+3ih1?*_0u?xn~H#)f;8m0v17;HK`G>M3&Q^haA|z} zqWg_~@1|ek^hOV~)xPaes<@Gvp(v~1(n~KrFlo}HbMVLIa(t&MIX0tI*5_JnF z2^-B+n>cX$Y1G#^#y|P%%)O!)c%L9YXq$x!I3!*P0dT>XF=OCIKl;&T1n+tH;ly0-^|O)J0E}Sj4yp0xU!7FgEMxIm|^=&*~>d3 z>jBmFE%ki>MerLCpowwJ<;$19xM0D8RZ68Y9?TL4uDoN$S;Ai_?YXCvA!Mg5_q`2O z%7-Bk5LoI6Dq>HrSh3{2!`4N~SPQ0J)kWfprtpdB@86ge0EGhnsM)fSMY#d zb0UD7oKFO1dW~8`lnJlH0dX}n! + + + +Created by potrace 1.13, written by Peter Selinger 2001-2015 + + + + + diff --git a/app/index.html b/app/index.html index 8c70dc6..81a76c4 100644 --- a/app/index.html +++ b/app/index.html @@ -13,6 +13,7 @@ + @@ -38,6 +39,7 @@ ga('send', 'pageview'); + -